From 09757a4164d44f224b44291f1e01b1e813a52220 Mon Sep 17 00:00:00 2001 From: Kazunobu Ndong <33208377+ndkazu@users.noreply.github.com> Date: Wed, 20 Nov 2024 04:08:46 +0900 Subject: [PATCH 01/64] Migrate pallet-democracy benchmarks to benchmark v2 syntax (#6509) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit # Description Migrates pallet-democracy benchmarks to benchmark v2 syntax This is Part of https://github.com/paritytech/polkadot-sdk/issues/6202 --------- Co-authored-by: Bastian Köcher Co-authored-by: command-bot <> Co-authored-by: Dmitry Markin Co-authored-by: Alexandru Vasile <60601340+lexnv@users.noreply.github.com> --- prdoc/pr_6509.prdoc | 13 + substrate/frame/democracy/src/benchmarking.rs | 548 +++++++++++------- substrate/frame/democracy/src/weights.rs | 302 +++++----- 3 files changed, 498 insertions(+), 365 deletions(-) create mode 100644 prdoc/pr_6509.prdoc diff --git a/prdoc/pr_6509.prdoc b/prdoc/pr_6509.prdoc new file mode 100644 index 000000000000..74215fe0084c --- /dev/null +++ b/prdoc/pr_6509.prdoc @@ -0,0 +1,13 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: Migrate pallet-democracy benchmark to v2 + +doc: + - audience: Runtime Dev + description: | + "Part of issue #6202." + +crates: +- name: pallet-democracy + bump: patch diff --git a/substrate/frame/democracy/src/benchmarking.rs b/substrate/frame/democracy/src/benchmarking.rs index ee36e9212f52..f9c810e56192 100644 --- a/substrate/frame/democracy/src/benchmarking.rs +++ b/substrate/frame/democracy/src/benchmarking.rs @@ -17,9 +17,11 @@ //! Democracy pallet benchmarking. +#![cfg(feature = "runtime-benchmarks")] + use super::*; -use frame_benchmarking::v1::{account, benchmarks, whitelist_account, BenchmarkError}; +use frame_benchmarking::v2::*; use frame_support::{ assert_noop, assert_ok, traits::{Currency, EnsureOrigin, Get, OnInitialize, UnfilteredDispatchable}, @@ -94,11 +96,15 @@ fn note_preimage() -> T::Hash { hash } -benchmarks! { - propose { +#[benchmarks] +mod benchmarks { + use super::*; + + #[benchmark] + fn propose() -> Result<(), BenchmarkError> { let p = T::MaxProposals::get(); - for i in 0 .. (p - 1) { + for i in 0..(p - 1) { add_proposal::(i)?; } @@ -106,18 +112,22 @@ benchmarks! { let proposal = make_proposal::(0); let value = T::MinimumDeposit::get(); whitelist_account!(caller); - }: _(RawOrigin::Signed(caller), proposal, value) - verify { + + #[extrinsic_call] + _(RawOrigin::Signed(caller), proposal, value); + assert_eq!(PublicProps::::get().len(), p as usize, "Proposals not created."); + Ok(()) } - second { + #[benchmark] + fn second() -> Result<(), BenchmarkError> { let caller = funded_account::("caller", 0); add_proposal::(0)?; // Create s existing "seconds" // we must reserve one deposit for the `proposal` and one for our benchmarked `second` call. - for i in 0 .. T::MaxDeposits::get() - 2 { + for i in 0..T::MaxDeposits::get() - 2 { let seconder = funded_account::("seconder", i); Democracy::::second(RawOrigin::Signed(seconder).into(), 0)?; } @@ -125,20 +135,32 @@ benchmarks! { let deposits = DepositOf::::get(0).ok_or("Proposal not created")?; assert_eq!(deposits.0.len(), (T::MaxDeposits::get() - 1) as usize, "Seconds not recorded"); whitelist_account!(caller); - }: _(RawOrigin::Signed(caller), 0) - verify { + + #[extrinsic_call] + _(RawOrigin::Signed(caller), 0); + let deposits = DepositOf::::get(0).ok_or("Proposal not created")?; - assert_eq!(deposits.0.len(), (T::MaxDeposits::get()) as usize, "`second` benchmark did not work"); + assert_eq!( + deposits.0.len(), + (T::MaxDeposits::get()) as usize, + "`second` benchmark did not work" + ); + Ok(()) } - vote_new { + #[benchmark] + fn vote_new() -> Result<(), BenchmarkError> { let caller = funded_account::("caller", 0); let account_vote = account_vote::(100u32.into()); // We need to create existing direct votes - for i in 0 .. T::MaxVotes::get() - 1 { + for i in 0..T::MaxVotes::get() - 1 { let ref_index = add_referendum::(i).0; - Democracy::::vote(RawOrigin::Signed(caller.clone()).into(), ref_index, account_vote)?; + Democracy::::vote( + RawOrigin::Signed(caller.clone()).into(), + ref_index, + account_vote, + )?; } let votes = match VotingOf::::get(&caller) { Voting::Direct { votes, .. } => votes, @@ -148,23 +170,32 @@ benchmarks! { let ref_index = add_referendum::(T::MaxVotes::get() - 1).0; whitelist_account!(caller); - }: vote(RawOrigin::Signed(caller.clone()), ref_index, account_vote) - verify { + + #[extrinsic_call] + vote(RawOrigin::Signed(caller.clone()), ref_index, account_vote); + let votes = match VotingOf::::get(&caller) { Voting::Direct { votes, .. } => votes, _ => return Err("Votes are not direct".into()), }; + assert_eq!(votes.len(), T::MaxVotes::get() as usize, "Vote was not recorded."); + Ok(()) } - vote_existing { + #[benchmark] + fn vote_existing() -> Result<(), BenchmarkError> { let caller = funded_account::("caller", 0); let account_vote = account_vote::(100u32.into()); // We need to create existing direct votes for i in 0..T::MaxVotes::get() { let ref_index = add_referendum::(i).0; - Democracy::::vote(RawOrigin::Signed(caller.clone()).into(), ref_index, account_vote)?; + Democracy::::vote( + RawOrigin::Signed(caller.clone()).into(), + ref_index, + account_vote, + )?; } let votes = match VotingOf::::get(&caller) { Voting::Direct { votes, .. } => votes, @@ -179,43 +210,50 @@ benchmarks! { // This tests when a user changes a vote whitelist_account!(caller); - }: vote(RawOrigin::Signed(caller.clone()), ref_index, new_vote) - verify { + + #[extrinsic_call] + vote(RawOrigin::Signed(caller.clone()), ref_index, new_vote); + let votes = match VotingOf::::get(&caller) { Voting::Direct { votes, .. } => votes, _ => return Err("Votes are not direct".into()), }; assert_eq!(votes.len(), T::MaxVotes::get() as usize, "Vote was incorrectly added"); - let referendum_info = ReferendumInfoOf::::get(ref_index) - .ok_or("referendum doesn't exist")?; - let tally = match referendum_info { + let referendum_info = + ReferendumInfoOf::::get(ref_index).ok_or("referendum doesn't exist")?; + let tally = match referendum_info { ReferendumInfo::Ongoing(r) => r.tally, _ => return Err("referendum not ongoing".into()), }; assert_eq!(tally.nays, 1000u32.into(), "changed vote was not recorded"); + Ok(()) } - emergency_cancel { - let origin = - T::CancellationOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?; + #[benchmark] + fn emergency_cancel() -> Result<(), BenchmarkError> { + let origin = T::CancellationOrigin::try_successful_origin() + .map_err(|_| BenchmarkError::Weightless)?; let (ref_index, _, preimage_hash) = add_referendum::(0); assert_ok!(Democracy::::referendum_status(ref_index)); - }: _(origin, ref_index) - verify { + + #[extrinsic_call] + _(origin as T::RuntimeOrigin, ref_index); // Referendum has been canceled - assert_noop!( - Democracy::::referendum_status(ref_index), - Error::::ReferendumInvalid, + assert_noop!(Democracy::::referendum_status(ref_index), Error::::ReferendumInvalid,); + assert_last_event::( + crate::Event::MetadataCleared { + owner: MetadataOwner::Referendum(ref_index), + hash: preimage_hash, + } + .into(), ); - assert_last_event::(crate::Event::MetadataCleared { - owner: MetadataOwner::Referendum(ref_index), - hash: preimage_hash, - }.into()); + Ok(()) } - blacklist { + #[benchmark] + fn blacklist() -> Result<(), BenchmarkError> { // Place our proposal at the end to make sure it's worst case. - for i in 0 .. T::MaxProposals::get() - 1 { + for i in 0..T::MaxProposals::get() - 1 { add_proposal::(i)?; } // We should really add a lot of seconds here, but we're not doing it elsewhere. @@ -231,21 +269,24 @@ benchmarks! { )); let origin = T::BlacklistOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?; - }: _(origin, hash, Some(ref_index)) - verify { + #[extrinsic_call] + _(origin as T::RuntimeOrigin, hash, Some(ref_index)); + // Referendum has been canceled - assert_noop!( - Democracy::::referendum_status(ref_index), - Error::::ReferendumInvalid + assert_noop!(Democracy::::referendum_status(ref_index), Error::::ReferendumInvalid); + assert_has_event::( + crate::Event::MetadataCleared { + owner: MetadataOwner::Referendum(ref_index), + hash: preimage_hash, + } + .into(), ); - assert_has_event::(crate::Event::MetadataCleared { - owner: MetadataOwner::Referendum(ref_index), - hash: preimage_hash, - }.into()); + Ok(()) } // Worst case scenario, we external propose a previously blacklisted proposal - external_propose { + #[benchmark] + fn external_propose() -> Result<(), BenchmarkError> { let origin = T::ExternalOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?; let proposal = make_proposal::(0); @@ -258,33 +299,42 @@ benchmarks! { .try_into() .unwrap(); Blacklist::::insert(proposal.hash(), (BlockNumberFor::::zero(), addresses)); - }: _(origin, proposal) - verify { + #[extrinsic_call] + _(origin as T::RuntimeOrigin, proposal); + // External proposal created ensure!(NextExternal::::exists(), "External proposal didn't work"); + Ok(()) } - external_propose_majority { + #[benchmark] + fn external_propose_majority() -> Result<(), BenchmarkError> { let origin = T::ExternalMajorityOrigin::try_successful_origin() .map_err(|_| BenchmarkError::Weightless)?; let proposal = make_proposal::(0); - }: _(origin, proposal) - verify { + #[extrinsic_call] + _(origin as T::RuntimeOrigin, proposal); + // External proposal created ensure!(NextExternal::::exists(), "External proposal didn't work"); + Ok(()) } - external_propose_default { + #[benchmark] + fn external_propose_default() -> Result<(), BenchmarkError> { let origin = T::ExternalDefaultOrigin::try_successful_origin() .map_err(|_| BenchmarkError::Weightless)?; let proposal = make_proposal::(0); - }: _(origin, proposal) - verify { + #[extrinsic_call] + _(origin as T::RuntimeOrigin, proposal); + // External proposal created ensure!(NextExternal::::exists(), "External proposal didn't work"); + Ok(()) } - fast_track { + #[benchmark] + fn fast_track() -> Result<(), BenchmarkError> { let origin_propose = T::ExternalDefaultOrigin::try_successful_origin() .expect("ExternalDefaultOrigin has no successful origin required for the benchmark"); let proposal = make_proposal::(0); @@ -295,23 +345,30 @@ benchmarks! { assert_ok!(Democracy::::set_metadata( origin_propose, MetadataOwner::External, - Some(preimage_hash))); + Some(preimage_hash) + )); // NOTE: Instant origin may invoke a little bit more logic, but may not always succeed. let origin_fast_track = T::FastTrackOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?; let voting_period = T::FastTrackVotingPeriod::get(); let delay = 0u32; - }: _(origin_fast_track, proposal_hash, voting_period, delay.into()) - verify { + #[extrinsic_call] + _(origin_fast_track as T::RuntimeOrigin, proposal_hash, voting_period, delay.into()); + assert_eq!(ReferendumCount::::get(), 1, "referendum not created"); - assert_last_event::(crate::Event::MetadataTransferred { - prev_owner: MetadataOwner::External, - owner: MetadataOwner::Referendum(0), - hash: preimage_hash, - }.into()); + assert_last_event::( + crate::Event::MetadataTransferred { + prev_owner: MetadataOwner::External, + owner: MetadataOwner::Referendum(0), + hash: preimage_hash, + } + .into(), + ); + Ok(()) } - veto_external { + #[benchmark] + fn veto_external() -> Result<(), BenchmarkError> { let proposal = make_proposal::(0); let proposal_hash = proposal.hash(); @@ -323,28 +380,32 @@ benchmarks! { assert_ok!(Democracy::::set_metadata( origin_propose, MetadataOwner::External, - Some(preimage_hash)) - ); + Some(preimage_hash) + )); let mut vetoers: BoundedVec = Default::default(); - for i in 0 .. (T::MaxBlacklisted::get() - 1) { + for i in 0..(T::MaxBlacklisted::get() - 1) { vetoers.try_push(account::("vetoer", i, SEED)).unwrap(); } vetoers.sort(); Blacklist::::insert(proposal_hash, (BlockNumberFor::::zero(), vetoers)); - let origin = T::VetoOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?; + let origin = + T::VetoOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?; ensure!(NextExternal::::get().is_some(), "no external proposal"); - }: _(origin, proposal_hash) - verify { + #[extrinsic_call] + _(origin as T::RuntimeOrigin, proposal_hash); + assert!(NextExternal::::get().is_none()); let (_, new_vetoers) = Blacklist::::get(&proposal_hash).ok_or("no blacklist")?; assert_eq!(new_vetoers.len(), T::MaxBlacklisted::get() as usize, "vetoers not added"); + Ok(()) } - cancel_proposal { + #[benchmark] + fn cancel_proposal() -> Result<(), BenchmarkError> { // Place our proposal at the end to make sure it's worst case. - for i in 0 .. T::MaxProposals::get() { + for i in 0..T::MaxProposals::get() { add_proposal::(i)?; } // Add metadata to the first proposal. @@ -353,31 +414,41 @@ benchmarks! { assert_ok!(Democracy::::set_metadata( RawOrigin::Signed(proposer).into(), MetadataOwner::Proposal(0), - Some(preimage_hash))); + Some(preimage_hash) + )); let cancel_origin = T::CancelProposalOrigin::try_successful_origin() .map_err(|_| BenchmarkError::Weightless)?; - }: _(cancel_origin, 0) - verify { - assert_last_event::(crate::Event::MetadataCleared { - owner: MetadataOwner::Proposal(0), - hash: preimage_hash, - }.into()); + #[extrinsic_call] + _(cancel_origin as T::RuntimeOrigin, 0); + + assert_last_event::( + crate::Event::MetadataCleared { + owner: MetadataOwner::Proposal(0), + hash: preimage_hash, + } + .into(), + ); + Ok(()) } - cancel_referendum { + #[benchmark] + fn cancel_referendum() -> Result<(), BenchmarkError> { let (ref_index, _, preimage_hash) = add_referendum::(0); - }: _(RawOrigin::Root, ref_index) - verify { - assert_last_event::(crate::Event::MetadataCleared { - owner: MetadataOwner::Referendum(0), - hash: preimage_hash, - }.into()); - } + #[extrinsic_call] + _(RawOrigin::Root, ref_index); - #[extra] - on_initialize_external { - let r in 0 .. REFERENDUM_COUNT_HINT; + assert_last_event::( + crate::Event::MetadataCleared { + owner: MetadataOwner::Referendum(0), + hash: preimage_hash, + } + .into(), + ); + Ok(()) + } + #[benchmark(extra)] + fn on_initialize_external(r: Linear<0, REFERENDUM_COUNT_HINT>) -> Result<(), BenchmarkError> { for i in 0..r { add_referendum::(i); } @@ -397,14 +468,17 @@ benchmarks! { let block_number = T::LaunchPeriod::get(); - }: { Democracy::::on_initialize(block_number) } - verify { + #[block] + { + Democracy::::on_initialize(block_number); + } + // One extra because of next external assert_eq!(ReferendumCount::::get(), r + 1, "referenda not created"); ensure!(!NextExternal::::exists(), "External wasn't taken"); // All but the new next external should be finished - for i in 0 .. r { + for i in 0..r { if let Some(value) = ReferendumInfoOf::::get(i) { match value { ReferendumInfo::Finished { .. } => (), @@ -412,12 +486,13 @@ benchmarks! { } } } + Ok(()) } - #[extra] - on_initialize_public { - let r in 0 .. (T::MaxVotes::get() - 1); - + #[benchmark(extra)] + fn on_initialize_public( + r: Linear<0, { T::MaxVotes::get() - 1 }>, + ) -> Result<(), BenchmarkError> { for i in 0..r { add_referendum::(i); } @@ -430,13 +505,16 @@ benchmarks! { let block_number = T::LaunchPeriod::get(); - }: { Democracy::::on_initialize(block_number) } - verify { + #[block] + { + Democracy::::on_initialize(block_number); + } + // One extra because of next public assert_eq!(ReferendumCount::::get(), r + 1, "proposal not accepted"); // All should be finished - for i in 0 .. r { + for i in 0..r { if let Some(value) = ReferendumInfoOf::::get(i) { match value { ReferendumInfo::Finished { .. } => (), @@ -444,12 +522,12 @@ benchmarks! { } } } + Ok(()) } // No launch no maturing referenda. - on_initialize_base { - let r in 0 .. (T::MaxVotes::get() - 1); - + #[benchmark] + fn on_initialize_base(r: Linear<0, { T::MaxVotes::get() - 1 }>) -> Result<(), BenchmarkError> { for i in 0..r { add_referendum::(i); } @@ -464,22 +542,28 @@ benchmarks! { assert_eq!(ReferendumCount::::get(), r, "referenda not created"); assert_eq!(LowestUnbaked::::get(), 0, "invalid referenda init"); - }: { Democracy::::on_initialize(1u32.into()) } - verify { + #[block] + { + Democracy::::on_initialize(1u32.into()); + } + // All should be on going - for i in 0 .. r { + for i in 0..r { if let Some(value) = ReferendumInfoOf::::get(i) { match value { - ReferendumInfo::Finished { .. } => return Err("Referendum has been finished".into()), + ReferendumInfo::Finished { .. } => + return Err("Referendum has been finished".into()), ReferendumInfo::Ongoing(_) => (), } } } + Ok(()) } - on_initialize_base_with_launch_period { - let r in 0 .. (T::MaxVotes::get() - 1); - + #[benchmark] + fn on_initialize_base_with_launch_period( + r: Linear<0, { T::MaxVotes::get() - 1 }>, + ) -> Result<(), BenchmarkError> { for i in 0..r { add_referendum::(i); } @@ -496,22 +580,26 @@ benchmarks! { let block_number = T::LaunchPeriod::get(); - }: { Democracy::::on_initialize(block_number) } - verify { + #[block] + { + Democracy::::on_initialize(block_number); + } + // All should be on going - for i in 0 .. r { + for i in 0..r { if let Some(value) = ReferendumInfoOf::::get(i) { match value { - ReferendumInfo::Finished { .. } => return Err("Referendum has been finished".into()), + ReferendumInfo::Finished { .. } => + return Err("Referendum has been finished".into()), ReferendumInfo::Ongoing(_) => (), } } } + Ok(()) } - delegate { - let r in 0 .. (T::MaxVotes::get() - 1); - + #[benchmark] + fn delegate(r: Linear<0, { T::MaxVotes::get() - 1 }>) -> Result<(), BenchmarkError> { let initial_balance: BalanceOf = 100u32.into(); let delegated_balance: BalanceOf = 1000u32.into(); @@ -538,7 +626,11 @@ benchmarks! { // We need to create existing direct votes for the `new_delegate` for i in 0..r { let ref_index = add_referendum::(i).0; - Democracy::::vote(RawOrigin::Signed(new_delegate.clone()).into(), ref_index, account_vote)?; + Democracy::::vote( + RawOrigin::Signed(new_delegate.clone()).into(), + ref_index, + account_vote, + )?; } let votes = match VotingOf::::get(&new_delegate) { Voting::Direct { votes, .. } => votes, @@ -546,8 +638,15 @@ benchmarks! { }; assert_eq!(votes.len(), r as usize, "Votes were not recorded."); whitelist_account!(caller); - }: _(RawOrigin::Signed(caller.clone()), new_delegate_lookup, Conviction::Locked1x, delegated_balance) - verify { + + #[extrinsic_call] + _( + RawOrigin::Signed(caller.clone()), + new_delegate_lookup, + Conviction::Locked1x, + delegated_balance, + ); + let (target, balance) = match VotingOf::::get(&caller) { Voting::Delegating { target, balance, .. } => (target, balance), _ => return Err("Votes are not direct".into()), @@ -559,11 +658,11 @@ benchmarks! { _ => return Err("Votes are not direct".into()), }; assert_eq!(delegations.capital, delegated_balance, "delegation was not recorded."); + Ok(()) } - undelegate { - let r in 0 .. (T::MaxVotes::get() - 1); - + #[benchmark] + fn undelegate(r: Linear<0, { T::MaxVotes::get() - 1 }>) -> Result<(), BenchmarkError> { let initial_balance: BalanceOf = 100u32.into(); let delegated_balance: BalanceOf = 1000u32.into(); @@ -590,7 +689,7 @@ benchmarks! { Democracy::::vote( RawOrigin::Signed(the_delegate.clone()).into(), ref_index, - account_vote + account_vote, )?; } let votes = match VotingOf::::get(&the_delegate) { @@ -599,31 +698,38 @@ benchmarks! { }; assert_eq!(votes.len(), r as usize, "Votes were not recorded."); whitelist_account!(caller); - }: _(RawOrigin::Signed(caller.clone())) - verify { + + #[extrinsic_call] + _(RawOrigin::Signed(caller.clone())); + // Voting should now be direct match VotingOf::::get(&caller) { Voting::Direct { .. } => (), _ => return Err("undelegation failed".into()), } + Ok(()) } - clear_public_proposals { + #[benchmark] + fn clear_public_proposals() -> Result<(), BenchmarkError> { add_proposal::(0)?; - }: _(RawOrigin::Root) + #[extrinsic_call] + _(RawOrigin::Root); - // Test when unlock will remove locks - unlock_remove { - let r in 0 .. (T::MaxVotes::get() - 1); + Ok(()) + } + // Test when unlock will remove locks + #[benchmark] + fn unlock_remove(r: Linear<0, { T::MaxVotes::get() - 1 }>) -> Result<(), BenchmarkError> { let locker = funded_account::("locker", 0); let locker_lookup = T::Lookup::unlookup(locker.clone()); // Populate votes so things are locked let base_balance: BalanceOf = 100u32.into(); let small_vote = account_vote::(base_balance); // Vote and immediately unvote - for i in 0 .. r { + for i in 0..r { let ref_index = add_referendum::(i).0; Democracy::::vote(RawOrigin::Signed(locker.clone()).into(), ref_index, small_vote)?; Democracy::::remove_vote(RawOrigin::Signed(locker.clone()).into(), ref_index)?; @@ -631,23 +737,25 @@ benchmarks! { let caller = funded_account::("caller", 0); whitelist_account!(caller); - }: unlock(RawOrigin::Signed(caller), locker_lookup) - verify { + + #[extrinsic_call] + unlock(RawOrigin::Signed(caller), locker_lookup); + // Note that we may want to add a `get_lock` api to actually verify let voting = VotingOf::::get(&locker); assert_eq!(voting.locked_balance(), BalanceOf::::zero()); + Ok(()) } // Test when unlock will set a new value - unlock_set { - let r in 0 .. (T::MaxVotes::get() - 1); - + #[benchmark] + fn unlock_set(r: Linear<0, { T::MaxVotes::get() - 1 }>) -> Result<(), BenchmarkError> { let locker = funded_account::("locker", 0); let locker_lookup = T::Lookup::unlookup(locker.clone()); // Populate votes so things are locked let base_balance: BalanceOf = 100u32.into(); let small_vote = account_vote::(base_balance); - for i in 0 .. r { + for i in 0..r { let ref_index = add_referendum::(i).0; Democracy::::vote(RawOrigin::Signed(locker.clone()).into(), ref_index, small_vote)?; } @@ -670,8 +778,10 @@ benchmarks! { let caller = funded_account::("caller", 0); whitelist_account!(caller); - }: unlock(RawOrigin::Signed(caller), locker_lookup) - verify { + + #[extrinsic_call] + unlock(RawOrigin::Signed(caller), locker_lookup); + let votes = match VotingOf::::get(&locker) { Voting::Direct { votes, .. } => votes, _ => return Err("Votes are not direct".into()), @@ -681,17 +791,21 @@ benchmarks! { let voting = VotingOf::::get(&locker); // Note that we may want to add a `get_lock` api to actually verify assert_eq!(voting.locked_balance(), if r > 0 { base_balance } else { 0u32.into() }); + Ok(()) } - remove_vote { - let r in 1 .. T::MaxVotes::get(); - + #[benchmark] + fn remove_vote(r: Linear<1, { T::MaxVotes::get() }>) -> Result<(), BenchmarkError> { let caller = funded_account::("caller", 0); let account_vote = account_vote::(100u32.into()); - for i in 0 .. r { + for i in 0..r { let ref_index = add_referendum::(i).0; - Democracy::::vote(RawOrigin::Signed(caller.clone()).into(), ref_index, account_vote)?; + Democracy::::vote( + RawOrigin::Signed(caller.clone()).into(), + ref_index, + account_vote, + )?; } let votes = match VotingOf::::get(&caller) { @@ -702,26 +816,32 @@ benchmarks! { let ref_index = r - 1; whitelist_account!(caller); - }: _(RawOrigin::Signed(caller.clone()), ref_index) - verify { + + #[extrinsic_call] + _(RawOrigin::Signed(caller.clone()), ref_index); + let votes = match VotingOf::::get(&caller) { Voting::Direct { votes, .. } => votes, _ => return Err("Votes are not direct".into()), }; assert_eq!(votes.len(), (r - 1) as usize, "Vote was not removed"); + Ok(()) } // Worst case is when target == caller and referendum is ongoing - remove_other_vote { - let r in 1 .. T::MaxVotes::get(); - + #[benchmark] + fn remove_other_vote(r: Linear<1, { T::MaxVotes::get() }>) -> Result<(), BenchmarkError> { let caller = funded_account::("caller", r); let caller_lookup = T::Lookup::unlookup(caller.clone()); let account_vote = account_vote::(100u32.into()); - for i in 0 .. r { + for i in 0..r { let ref_index = add_referendum::(i).0; - Democracy::::vote(RawOrigin::Signed(caller.clone()).into(), ref_index, account_vote)?; + Democracy::::vote( + RawOrigin::Signed(caller.clone()).into(), + ref_index, + account_vote, + )?; } let votes = match VotingOf::::get(&caller) { @@ -732,68 +852,71 @@ benchmarks! { let ref_index = r - 1; whitelist_account!(caller); - }: _(RawOrigin::Signed(caller.clone()), caller_lookup, ref_index) - verify { + + #[extrinsic_call] + _(RawOrigin::Signed(caller.clone()), caller_lookup, ref_index); + let votes = match VotingOf::::get(&caller) { Voting::Direct { votes, .. } => votes, _ => return Err("Votes are not direct".into()), }; assert_eq!(votes.len(), (r - 1) as usize, "Vote was not removed"); + Ok(()) } - set_external_metadata { + #[benchmark] + fn set_external_metadata() -> Result<(), BenchmarkError> { let origin = T::ExternalOrigin::try_successful_origin() .expect("ExternalOrigin has no successful origin required for the benchmark"); - assert_ok!( - Democracy::::external_propose(origin.clone(), make_proposal::(0)) - ); + assert_ok!(Democracy::::external_propose(origin.clone(), make_proposal::(0))); let owner = MetadataOwner::External; let hash = note_preimage::(); - }: set_metadata(origin, owner.clone(), Some(hash)) - verify { - assert_last_event::(crate::Event::MetadataSet { - owner, - hash, - }.into()); + + #[extrinsic_call] + set_metadata(origin as T::RuntimeOrigin, owner.clone(), Some(hash)); + + assert_last_event::(crate::Event::MetadataSet { owner, hash }.into()); + Ok(()) } - clear_external_metadata { + #[benchmark] + fn clear_external_metadata() -> Result<(), BenchmarkError> { let origin = T::ExternalOrigin::try_successful_origin() .expect("ExternalOrigin has no successful origin required for the benchmark"); - assert_ok!( - Democracy::::external_propose(origin.clone(), make_proposal::(0)) - ); + assert_ok!(Democracy::::external_propose(origin.clone(), make_proposal::(0))); let owner = MetadataOwner::External; - let proposer = funded_account::("proposer", 0); + let _proposer = funded_account::("proposer", 0); let hash = note_preimage::(); assert_ok!(Democracy::::set_metadata(origin.clone(), owner.clone(), Some(hash))); - }: set_metadata(origin, owner.clone(), None) - verify { - assert_last_event::(crate::Event::MetadataCleared { - owner, - hash, - }.into()); + + #[extrinsic_call] + set_metadata(origin as T::RuntimeOrigin, owner.clone(), None); + + assert_last_event::(crate::Event::MetadataCleared { owner, hash }.into()); + Ok(()) } - set_proposal_metadata { + #[benchmark] + fn set_proposal_metadata() -> Result<(), BenchmarkError> { // Place our proposal at the end to make sure it's worst case. - for i in 0 .. T::MaxProposals::get() { + for i in 0..T::MaxProposals::get() { add_proposal::(i)?; } let owner = MetadataOwner::Proposal(0); let proposer = funded_account::("proposer", 0); let hash = note_preimage::(); - }: set_metadata(RawOrigin::Signed(proposer).into(), owner.clone(), Some(hash)) - verify { - assert_last_event::(crate::Event::MetadataSet { - owner, - hash, - }.into()); + + #[extrinsic_call] + set_metadata(RawOrigin::Signed(proposer), owner.clone(), Some(hash)); + + assert_last_event::(crate::Event::MetadataSet { owner, hash }.into()); + Ok(()) } - clear_proposal_metadata { + #[benchmark] + fn clear_proposal_metadata() -> Result<(), BenchmarkError> { // Place our proposal at the end to make sure it's worst case. - for i in 0 .. T::MaxProposals::get() { + for i in 0..T::MaxProposals::get() { add_proposal::(i)?; } let proposer = funded_account::("proposer", 0); @@ -802,33 +925,36 @@ benchmarks! { assert_ok!(Democracy::::set_metadata( RawOrigin::Signed(proposer.clone()).into(), owner.clone(), - Some(hash))); - }: set_metadata(RawOrigin::Signed(proposer).into(), owner.clone(), None) - verify { - assert_last_event::(crate::Event::MetadataCleared { - owner, - hash, - }.into()); + Some(hash) + )); + + #[extrinsic_call] + set_metadata::(RawOrigin::Signed(proposer), owner.clone(), None); + + assert_last_event::(crate::Event::MetadataCleared { owner, hash }.into()); + Ok(()) } - set_referendum_metadata { + #[benchmark] + fn set_referendum_metadata() -> Result<(), BenchmarkError> { // create not ongoing referendum. ReferendumInfoOf::::insert( 0, ReferendumInfo::Finished { end: BlockNumberFor::::zero(), approved: true }, ); let owner = MetadataOwner::Referendum(0); - let caller = funded_account::("caller", 0); + let _caller = funded_account::("caller", 0); let hash = note_preimage::(); - }: set_metadata(RawOrigin::Root.into(), owner.clone(), Some(hash)) - verify { - assert_last_event::(crate::Event::MetadataSet { - owner, - hash, - }.into()); + + #[extrinsic_call] + set_metadata::(RawOrigin::Root, owner.clone(), Some(hash)); + + assert_last_event::(crate::Event::MetadataSet { owner, hash }.into()); + Ok(()) } - clear_referendum_metadata { + #[benchmark] + fn clear_referendum_metadata() -> Result<(), BenchmarkError> { // create not ongoing referendum. ReferendumInfoOf::::insert( 0, @@ -838,17 +964,13 @@ benchmarks! { let hash = note_preimage::(); MetadataOf::::insert(owner.clone(), hash); let caller = funded_account::("caller", 0); - }: set_metadata(RawOrigin::Signed(caller).into(), owner.clone(), None) - verify { - assert_last_event::(crate::Event::MetadataCleared { - owner, - hash, - }.into()); + + #[extrinsic_call] + set_metadata::(RawOrigin::Signed(caller), owner.clone(), None); + + assert_last_event::(crate::Event::MetadataCleared { owner, hash }.into()); + Ok(()) } - impl_benchmark_test_suite!( - Democracy, - crate::tests::new_test_ext(), - crate::tests::Test - ); + impl_benchmark_test_suite!(Democracy, crate::tests::new_test_ext(), crate::tests::Test); } diff --git a/substrate/frame/democracy/src/weights.rs b/substrate/frame/democracy/src/weights.rs index 0a2200a78b5d..765ee57f0eb3 100644 --- a/substrate/frame/democracy/src/weights.rs +++ b/substrate/frame/democracy/src/weights.rs @@ -18,27 +18,25 @@ //! Autogenerated weights for `pallet_democracy` //! //! THIS FILE WAS AUTO-GENERATED USING THE SUBSTRATE BENCHMARK CLI VERSION 32.0.0 -//! DATE: 2024-11-08, STEPS: `50`, REPEAT: `20`, LOW RANGE: `[]`, HIGH RANGE: `[]` +//! DATE: 2024-11-19, STEPS: `50`, REPEAT: `20`, LOW RANGE: `[]`, HIGH RANGE: `[]` //! WORST CASE MAP SIZE: `1000000` //! HOSTNAME: `runner-wiukf8gn-project-674-concurrent-0`, CPU: `Intel(R) Xeon(R) CPU @ 2.60GHz` //! WASM-EXECUTION: `Compiled`, CHAIN: `Some("dev")`, DB CACHE: `1024` // Executed Command: -// ./target/production/substrate-node +// target/production/substrate-node // benchmark // pallet -// --chain=dev // --steps=50 // --repeat=20 -// --pallet=pallet_democracy -// --no-storage-info -// --no-median-slopes -// --no-min-squares // --extrinsic=* // --wasm-execution=compiled // --heap-pages=4096 -// --output=./substrate/frame/democracy/src/weights.rs +// --json-file=/builds/parity/mirrors/polkadot-sdk/.git/.artifacts/bench.json +// --pallet=pallet_democracy +// --chain=dev // --header=./substrate/HEADER-APACHE2 +// --output=./substrate/frame/democracy/src/weights.rs // --template=./substrate/.maintain/frame-weight-template.hbs #![cfg_attr(rustfmt, rustfmt_skip)] @@ -96,8 +94,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `4834` // Estimated: `18187` - // Minimum execution time: 48_991_000 picoseconds. - Weight::from_parts(50_476_000, 18187) + // Minimum execution time: 49_681_000 picoseconds. + Weight::from_parts(51_578_000, 18187) .saturating_add(T::DbWeight::get().reads(3_u64)) .saturating_add(T::DbWeight::get().writes(3_u64)) } @@ -107,8 +105,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `3589` // Estimated: `6695` - // Minimum execution time: 43_129_000 picoseconds. - Weight::from_parts(45_076_000, 6695) + // Minimum execution time: 45_001_000 picoseconds. + Weight::from_parts(45_990_000, 6695) .saturating_add(T::DbWeight::get().reads(1_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -124,8 +122,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `3503` // Estimated: `7260` - // Minimum execution time: 63_761_000 picoseconds. - Weight::from_parts(65_424_000, 7260) + // Minimum execution time: 65_095_000 picoseconds. + Weight::from_parts(67_484_000, 7260) .saturating_add(T::DbWeight::get().reads(4_u64)) .saturating_add(T::DbWeight::get().writes(3_u64)) } @@ -141,8 +139,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `3525` // Estimated: `7260` - // Minimum execution time: 66_543_000 picoseconds. - Weight::from_parts(69_537_000, 7260) + // Minimum execution time: 66_877_000 picoseconds. + Weight::from_parts(68_910_000, 7260) .saturating_add(T::DbWeight::get().reads(4_u64)) .saturating_add(T::DbWeight::get().writes(3_u64)) } @@ -156,8 +154,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `399` // Estimated: `3666` - // Minimum execution time: 28_934_000 picoseconds. - Weight::from_parts(29_982_000, 3666) + // Minimum execution time: 29_312_000 picoseconds. + Weight::from_parts(30_040_000, 3666) .saturating_add(T::DbWeight::get().reads(3_u64)) .saturating_add(T::DbWeight::get().writes(3_u64)) } @@ -179,8 +177,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `5943` // Estimated: `18187` - // Minimum execution time: 108_004_000 picoseconds. - Weight::from_parts(110_779_000, 18187) + // Minimum execution time: 107_932_000 picoseconds. + Weight::from_parts(108_940_000, 18187) .saturating_add(T::DbWeight::get().reads(8_u64)) .saturating_add(T::DbWeight::get().writes(7_u64)) } @@ -192,8 +190,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `3449` // Estimated: `6703` - // Minimum execution time: 17_630_000 picoseconds. - Weight::from_parts(18_419_000, 6703) + // Minimum execution time: 17_703_000 picoseconds. + Weight::from_parts(18_188_000, 6703) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -203,8 +201,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `0` // Estimated: `0` - // Minimum execution time: 2_572_000 picoseconds. - Weight::from_parts(2_810_000, 0) + // Minimum execution time: 2_672_000 picoseconds. + Weight::from_parts(2_814_000, 0) .saturating_add(T::DbWeight::get().writes(1_u64)) } /// Storage: `Democracy::NextExternal` (r:0 w:1) @@ -213,8 +211,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `0` // Estimated: `0` - // Minimum execution time: 2_628_000 picoseconds. - Weight::from_parts(2_724_000, 0) + // Minimum execution time: 2_584_000 picoseconds. + Weight::from_parts(2_846_000, 0) .saturating_add(T::DbWeight::get().writes(1_u64)) } /// Storage: `Democracy::NextExternal` (r:1 w:1) @@ -229,8 +227,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `319` // Estimated: `3518` - // Minimum execution time: 24_624_000 picoseconds. - Weight::from_parts(25_518_000, 3518) + // Minimum execution time: 24_603_000 picoseconds. + Weight::from_parts(25_407_000, 3518) .saturating_add(T::DbWeight::get().reads(3_u64)) .saturating_add(T::DbWeight::get().writes(5_u64)) } @@ -244,8 +242,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `3552` // Estimated: `6703` - // Minimum execution time: 31_786_000 picoseconds. - Weight::from_parts(32_786_000, 6703) + // Minimum execution time: 31_721_000 picoseconds. + Weight::from_parts(32_785_000, 6703) .saturating_add(T::DbWeight::get().reads(3_u64)) .saturating_add(T::DbWeight::get().writes(3_u64)) } @@ -261,8 +259,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `5854` // Estimated: `18187` - // Minimum execution time: 87_352_000 picoseconds. - Weight::from_parts(89_670_000, 18187) + // Minimum execution time: 86_981_000 picoseconds. + Weight::from_parts(89_140_000, 18187) .saturating_add(T::DbWeight::get().reads(4_u64)) .saturating_add(T::DbWeight::get().writes(4_u64)) } @@ -274,8 +272,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `304` // Estimated: `3518` - // Minimum execution time: 17_561_000 picoseconds. - Weight::from_parts(18_345_000, 3518) + // Minimum execution time: 17_465_000 picoseconds. + Weight::from_parts(18_018_000, 3518) .saturating_add(T::DbWeight::get().reads(1_u64)) .saturating_add(T::DbWeight::get().writes(2_u64)) } @@ -290,10 +288,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `277 + r * (86 ±0)` // Estimated: `1489 + r * (2676 ±0)` - // Minimum execution time: 6_801_000 picoseconds. - Weight::from_parts(8_524_132, 1489) - // Standard Error: 10_028 - .saturating_add(Weight::from_parts(4_073_619, 0).saturating_mul(r.into())) + // Minimum execution time: 6_746_000 picoseconds. + Weight::from_parts(7_381_932, 1489) + // Standard Error: 10_311 + .saturating_add(Weight::from_parts(4_107_935, 0).saturating_mul(r.into())) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().reads((1_u64).saturating_mul(r.into()))) .saturating_add(T::DbWeight::get().writes(1_u64)) @@ -316,10 +314,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `277 + r * (86 ±0)` // Estimated: `18187 + r * (2676 ±0)` - // Minimum execution time: 10_160_000 picoseconds. - Weight::from_parts(11_472_067, 18187) - // Standard Error: 10_730 - .saturating_add(Weight::from_parts(4_104_654, 0).saturating_mul(r.into())) + // Minimum execution time: 9_766_000 picoseconds. + Weight::from_parts(9_788_895, 18187) + // Standard Error: 11_913 + .saturating_add(Weight::from_parts(4_130_441, 0).saturating_mul(r.into())) .saturating_add(T::DbWeight::get().reads(5_u64)) .saturating_add(T::DbWeight::get().reads((1_u64).saturating_mul(r.into()))) .saturating_add(T::DbWeight::get().writes(1_u64)) @@ -338,10 +336,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `863 + r * (108 ±0)` // Estimated: `19800 + r * (2676 ±0)` - // Minimum execution time: 49_741_000 picoseconds. - Weight::from_parts(53_544_421, 19800) - // Standard Error: 11_984 - .saturating_add(Weight::from_parts(5_123_946, 0).saturating_mul(r.into())) + // Minimum execution time: 48_992_000 picoseconds. + Weight::from_parts(55_524_560, 19800) + // Standard Error: 11_278 + .saturating_add(Weight::from_parts(4_987_109, 0).saturating_mul(r.into())) .saturating_add(T::DbWeight::get().reads(5_u64)) .saturating_add(T::DbWeight::get().reads((1_u64).saturating_mul(r.into()))) .saturating_add(T::DbWeight::get().writes(4_u64)) @@ -357,10 +355,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `526 + r * (108 ±0)` // Estimated: `13530 + r * (2676 ±0)` - // Minimum execution time: 24_977_000 picoseconds. - Weight::from_parts(22_449_729, 13530) - // Standard Error: 10_846 - .saturating_add(Weight::from_parts(5_058_209, 0).saturating_mul(r.into())) + // Minimum execution time: 23_828_000 picoseconds. + Weight::from_parts(23_638_577, 13530) + // Standard Error: 10_946 + .saturating_add(Weight::from_parts(4_971_245, 0).saturating_mul(r.into())) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().reads((1_u64).saturating_mul(r.into()))) .saturating_add(T::DbWeight::get().writes(2_u64)) @@ -373,8 +371,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `0` // Estimated: `0` - // Minimum execution time: 2_700_000 picoseconds. - Weight::from_parts(3_028_000, 0) + // Minimum execution time: 2_759_000 picoseconds. + Weight::from_parts(2_850_000, 0) .saturating_add(T::DbWeight::get().writes(1_u64)) } /// Storage: `Democracy::VotingOf` (r:1 w:1) @@ -390,10 +388,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `596` // Estimated: `7260` - // Minimum execution time: 31_183_000 picoseconds. - Weight::from_parts(43_105_470, 7260) - // Standard Error: 3_096 - .saturating_add(Weight::from_parts(98_571, 0).saturating_mul(r.into())) + // Minimum execution time: 30_804_000 picoseconds. + Weight::from_parts(42_750_018, 7260) + // Standard Error: 3_300 + .saturating_add(Weight::from_parts(99_997, 0).saturating_mul(r.into())) .saturating_add(T::DbWeight::get().reads(4_u64)) .saturating_add(T::DbWeight::get().writes(3_u64)) } @@ -410,10 +408,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `597 + r * (22 ±0)` // Estimated: `7260` - // Minimum execution time: 39_672_000 picoseconds. - Weight::from_parts(44_120_387, 7260) - // Standard Error: 1_890 - .saturating_add(Weight::from_parts(130_089, 0).saturating_mul(r.into())) + // Minimum execution time: 39_946_000 picoseconds. + Weight::from_parts(44_500_306, 7260) + // Standard Error: 1_914 + .saturating_add(Weight::from_parts(116_987, 0).saturating_mul(r.into())) .saturating_add(T::DbWeight::get().reads(4_u64)) .saturating_add(T::DbWeight::get().writes(3_u64)) } @@ -426,10 +424,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `761 + r * (26 ±0)` // Estimated: `7260` - // Minimum execution time: 21_396_000 picoseconds. - Weight::from_parts(26_151_983, 7260) - // Standard Error: 2_052 - .saturating_add(Weight::from_parts(131_709, 0).saturating_mul(r.into())) + // Minimum execution time: 21_677_000 picoseconds. + Weight::from_parts(25_329_290, 7260) + // Standard Error: 1_998 + .saturating_add(Weight::from_parts(157_800, 0).saturating_mul(r.into())) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(2_u64)) } @@ -442,10 +440,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `761 + r * (26 ±0)` // Estimated: `7260` - // Minimum execution time: 21_425_000 picoseconds. - Weight::from_parts(26_335_367, 7260) - // Standard Error: 2_170 - .saturating_add(Weight::from_parts(130_502, 0).saturating_mul(r.into())) + // Minimum execution time: 21_777_000 picoseconds. + Weight::from_parts(26_635_600, 7260) + // Standard Error: 2_697 + .saturating_add(Weight::from_parts(135_641, 0).saturating_mul(r.into())) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(2_u64)) } @@ -461,8 +459,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `351` // Estimated: `3556` - // Minimum execution time: 19_765_000 picoseconds. - Weight::from_parts(20_266_000, 3556) + // Minimum execution time: 19_914_000 picoseconds. + Weight::from_parts(20_450_000, 3556) .saturating_add(T::DbWeight::get().reads(3_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -474,8 +472,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `319` // Estimated: `3518` - // Minimum execution time: 16_560_000 picoseconds. - Weight::from_parts(17_277_000, 3518) + // Minimum execution time: 16_212_000 picoseconds. + Weight::from_parts(16_745_000, 3518) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -491,8 +489,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `4883` // Estimated: `18187` - // Minimum execution time: 47_711_000 picoseconds. - Weight::from_parts(48_669_000, 18187) + // Minimum execution time: 47_225_000 picoseconds. + Weight::from_parts(47_976_000, 18187) .saturating_add(T::DbWeight::get().reads(3_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -504,8 +502,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `4855` // Estimated: `18187` - // Minimum execution time: 43_809_000 picoseconds. - Weight::from_parts(45_698_000, 18187) + // Minimum execution time: 43_140_000 picoseconds. + Weight::from_parts(43_924_000, 18187) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -519,8 +517,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `106` // Estimated: `3556` - // Minimum execution time: 14_736_000 picoseconds. - Weight::from_parts(15_191_000, 3556) + // Minimum execution time: 14_614_000 picoseconds. + Weight::from_parts(15_376_000, 3556) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -532,8 +530,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `335` // Estimated: `3666` - // Minimum execution time: 22_803_000 picoseconds. - Weight::from_parts(23_732_000, 3666) + // Minimum execution time: 22_588_000 picoseconds. + Weight::from_parts(23_267_000, 3666) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -553,8 +551,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `4834` // Estimated: `18187` - // Minimum execution time: 48_991_000 picoseconds. - Weight::from_parts(50_476_000, 18187) + // Minimum execution time: 49_681_000 picoseconds. + Weight::from_parts(51_578_000, 18187) .saturating_add(RocksDbWeight::get().reads(3_u64)) .saturating_add(RocksDbWeight::get().writes(3_u64)) } @@ -564,8 +562,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `3589` // Estimated: `6695` - // Minimum execution time: 43_129_000 picoseconds. - Weight::from_parts(45_076_000, 6695) + // Minimum execution time: 45_001_000 picoseconds. + Weight::from_parts(45_990_000, 6695) .saturating_add(RocksDbWeight::get().reads(1_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -581,8 +579,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `3503` // Estimated: `7260` - // Minimum execution time: 63_761_000 picoseconds. - Weight::from_parts(65_424_000, 7260) + // Minimum execution time: 65_095_000 picoseconds. + Weight::from_parts(67_484_000, 7260) .saturating_add(RocksDbWeight::get().reads(4_u64)) .saturating_add(RocksDbWeight::get().writes(3_u64)) } @@ -598,8 +596,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `3525` // Estimated: `7260` - // Minimum execution time: 66_543_000 picoseconds. - Weight::from_parts(69_537_000, 7260) + // Minimum execution time: 66_877_000 picoseconds. + Weight::from_parts(68_910_000, 7260) .saturating_add(RocksDbWeight::get().reads(4_u64)) .saturating_add(RocksDbWeight::get().writes(3_u64)) } @@ -613,8 +611,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `399` // Estimated: `3666` - // Minimum execution time: 28_934_000 picoseconds. - Weight::from_parts(29_982_000, 3666) + // Minimum execution time: 29_312_000 picoseconds. + Weight::from_parts(30_040_000, 3666) .saturating_add(RocksDbWeight::get().reads(3_u64)) .saturating_add(RocksDbWeight::get().writes(3_u64)) } @@ -636,8 +634,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `5943` // Estimated: `18187` - // Minimum execution time: 108_004_000 picoseconds. - Weight::from_parts(110_779_000, 18187) + // Minimum execution time: 107_932_000 picoseconds. + Weight::from_parts(108_940_000, 18187) .saturating_add(RocksDbWeight::get().reads(8_u64)) .saturating_add(RocksDbWeight::get().writes(7_u64)) } @@ -649,8 +647,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `3449` // Estimated: `6703` - // Minimum execution time: 17_630_000 picoseconds. - Weight::from_parts(18_419_000, 6703) + // Minimum execution time: 17_703_000 picoseconds. + Weight::from_parts(18_188_000, 6703) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -660,8 +658,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `0` // Estimated: `0` - // Minimum execution time: 2_572_000 picoseconds. - Weight::from_parts(2_810_000, 0) + // Minimum execution time: 2_672_000 picoseconds. + Weight::from_parts(2_814_000, 0) .saturating_add(RocksDbWeight::get().writes(1_u64)) } /// Storage: `Democracy::NextExternal` (r:0 w:1) @@ -670,8 +668,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `0` // Estimated: `0` - // Minimum execution time: 2_628_000 picoseconds. - Weight::from_parts(2_724_000, 0) + // Minimum execution time: 2_584_000 picoseconds. + Weight::from_parts(2_846_000, 0) .saturating_add(RocksDbWeight::get().writes(1_u64)) } /// Storage: `Democracy::NextExternal` (r:1 w:1) @@ -686,8 +684,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `319` // Estimated: `3518` - // Minimum execution time: 24_624_000 picoseconds. - Weight::from_parts(25_518_000, 3518) + // Minimum execution time: 24_603_000 picoseconds. + Weight::from_parts(25_407_000, 3518) .saturating_add(RocksDbWeight::get().reads(3_u64)) .saturating_add(RocksDbWeight::get().writes(5_u64)) } @@ -701,8 +699,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `3552` // Estimated: `6703` - // Minimum execution time: 31_786_000 picoseconds. - Weight::from_parts(32_786_000, 6703) + // Minimum execution time: 31_721_000 picoseconds. + Weight::from_parts(32_785_000, 6703) .saturating_add(RocksDbWeight::get().reads(3_u64)) .saturating_add(RocksDbWeight::get().writes(3_u64)) } @@ -718,8 +716,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `5854` // Estimated: `18187` - // Minimum execution time: 87_352_000 picoseconds. - Weight::from_parts(89_670_000, 18187) + // Minimum execution time: 86_981_000 picoseconds. + Weight::from_parts(89_140_000, 18187) .saturating_add(RocksDbWeight::get().reads(4_u64)) .saturating_add(RocksDbWeight::get().writes(4_u64)) } @@ -731,8 +729,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `304` // Estimated: `3518` - // Minimum execution time: 17_561_000 picoseconds. - Weight::from_parts(18_345_000, 3518) + // Minimum execution time: 17_465_000 picoseconds. + Weight::from_parts(18_018_000, 3518) .saturating_add(RocksDbWeight::get().reads(1_u64)) .saturating_add(RocksDbWeight::get().writes(2_u64)) } @@ -747,10 +745,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `277 + r * (86 ±0)` // Estimated: `1489 + r * (2676 ±0)` - // Minimum execution time: 6_801_000 picoseconds. - Weight::from_parts(8_524_132, 1489) - // Standard Error: 10_028 - .saturating_add(Weight::from_parts(4_073_619, 0).saturating_mul(r.into())) + // Minimum execution time: 6_746_000 picoseconds. + Weight::from_parts(7_381_932, 1489) + // Standard Error: 10_311 + .saturating_add(Weight::from_parts(4_107_935, 0).saturating_mul(r.into())) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().reads((1_u64).saturating_mul(r.into()))) .saturating_add(RocksDbWeight::get().writes(1_u64)) @@ -773,10 +771,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `277 + r * (86 ±0)` // Estimated: `18187 + r * (2676 ±0)` - // Minimum execution time: 10_160_000 picoseconds. - Weight::from_parts(11_472_067, 18187) - // Standard Error: 10_730 - .saturating_add(Weight::from_parts(4_104_654, 0).saturating_mul(r.into())) + // Minimum execution time: 9_766_000 picoseconds. + Weight::from_parts(9_788_895, 18187) + // Standard Error: 11_913 + .saturating_add(Weight::from_parts(4_130_441, 0).saturating_mul(r.into())) .saturating_add(RocksDbWeight::get().reads(5_u64)) .saturating_add(RocksDbWeight::get().reads((1_u64).saturating_mul(r.into()))) .saturating_add(RocksDbWeight::get().writes(1_u64)) @@ -795,10 +793,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `863 + r * (108 ±0)` // Estimated: `19800 + r * (2676 ±0)` - // Minimum execution time: 49_741_000 picoseconds. - Weight::from_parts(53_544_421, 19800) - // Standard Error: 11_984 - .saturating_add(Weight::from_parts(5_123_946, 0).saturating_mul(r.into())) + // Minimum execution time: 48_992_000 picoseconds. + Weight::from_parts(55_524_560, 19800) + // Standard Error: 11_278 + .saturating_add(Weight::from_parts(4_987_109, 0).saturating_mul(r.into())) .saturating_add(RocksDbWeight::get().reads(5_u64)) .saturating_add(RocksDbWeight::get().reads((1_u64).saturating_mul(r.into()))) .saturating_add(RocksDbWeight::get().writes(4_u64)) @@ -814,10 +812,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `526 + r * (108 ±0)` // Estimated: `13530 + r * (2676 ±0)` - // Minimum execution time: 24_977_000 picoseconds. - Weight::from_parts(22_449_729, 13530) - // Standard Error: 10_846 - .saturating_add(Weight::from_parts(5_058_209, 0).saturating_mul(r.into())) + // Minimum execution time: 23_828_000 picoseconds. + Weight::from_parts(23_638_577, 13530) + // Standard Error: 10_946 + .saturating_add(Weight::from_parts(4_971_245, 0).saturating_mul(r.into())) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().reads((1_u64).saturating_mul(r.into()))) .saturating_add(RocksDbWeight::get().writes(2_u64)) @@ -830,8 +828,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `0` // Estimated: `0` - // Minimum execution time: 2_700_000 picoseconds. - Weight::from_parts(3_028_000, 0) + // Minimum execution time: 2_759_000 picoseconds. + Weight::from_parts(2_850_000, 0) .saturating_add(RocksDbWeight::get().writes(1_u64)) } /// Storage: `Democracy::VotingOf` (r:1 w:1) @@ -847,10 +845,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `596` // Estimated: `7260` - // Minimum execution time: 31_183_000 picoseconds. - Weight::from_parts(43_105_470, 7260) - // Standard Error: 3_096 - .saturating_add(Weight::from_parts(98_571, 0).saturating_mul(r.into())) + // Minimum execution time: 30_804_000 picoseconds. + Weight::from_parts(42_750_018, 7260) + // Standard Error: 3_300 + .saturating_add(Weight::from_parts(99_997, 0).saturating_mul(r.into())) .saturating_add(RocksDbWeight::get().reads(4_u64)) .saturating_add(RocksDbWeight::get().writes(3_u64)) } @@ -867,10 +865,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `597 + r * (22 ±0)` // Estimated: `7260` - // Minimum execution time: 39_672_000 picoseconds. - Weight::from_parts(44_120_387, 7260) - // Standard Error: 1_890 - .saturating_add(Weight::from_parts(130_089, 0).saturating_mul(r.into())) + // Minimum execution time: 39_946_000 picoseconds. + Weight::from_parts(44_500_306, 7260) + // Standard Error: 1_914 + .saturating_add(Weight::from_parts(116_987, 0).saturating_mul(r.into())) .saturating_add(RocksDbWeight::get().reads(4_u64)) .saturating_add(RocksDbWeight::get().writes(3_u64)) } @@ -883,10 +881,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `761 + r * (26 ±0)` // Estimated: `7260` - // Minimum execution time: 21_396_000 picoseconds. - Weight::from_parts(26_151_983, 7260) - // Standard Error: 2_052 - .saturating_add(Weight::from_parts(131_709, 0).saturating_mul(r.into())) + // Minimum execution time: 21_677_000 picoseconds. + Weight::from_parts(25_329_290, 7260) + // Standard Error: 1_998 + .saturating_add(Weight::from_parts(157_800, 0).saturating_mul(r.into())) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(2_u64)) } @@ -899,10 +897,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `761 + r * (26 ±0)` // Estimated: `7260` - // Minimum execution time: 21_425_000 picoseconds. - Weight::from_parts(26_335_367, 7260) - // Standard Error: 2_170 - .saturating_add(Weight::from_parts(130_502, 0).saturating_mul(r.into())) + // Minimum execution time: 21_777_000 picoseconds. + Weight::from_parts(26_635_600, 7260) + // Standard Error: 2_697 + .saturating_add(Weight::from_parts(135_641, 0).saturating_mul(r.into())) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(2_u64)) } @@ -918,8 +916,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `351` // Estimated: `3556` - // Minimum execution time: 19_765_000 picoseconds. - Weight::from_parts(20_266_000, 3556) + // Minimum execution time: 19_914_000 picoseconds. + Weight::from_parts(20_450_000, 3556) .saturating_add(RocksDbWeight::get().reads(3_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -931,8 +929,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `319` // Estimated: `3518` - // Minimum execution time: 16_560_000 picoseconds. - Weight::from_parts(17_277_000, 3518) + // Minimum execution time: 16_212_000 picoseconds. + Weight::from_parts(16_745_000, 3518) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -948,8 +946,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `4883` // Estimated: `18187` - // Minimum execution time: 47_711_000 picoseconds. - Weight::from_parts(48_669_000, 18187) + // Minimum execution time: 47_225_000 picoseconds. + Weight::from_parts(47_976_000, 18187) .saturating_add(RocksDbWeight::get().reads(3_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -961,8 +959,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `4855` // Estimated: `18187` - // Minimum execution time: 43_809_000 picoseconds. - Weight::from_parts(45_698_000, 18187) + // Minimum execution time: 43_140_000 picoseconds. + Weight::from_parts(43_924_000, 18187) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -976,8 +974,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `106` // Estimated: `3556` - // Minimum execution time: 14_736_000 picoseconds. - Weight::from_parts(15_191_000, 3556) + // Minimum execution time: 14_614_000 picoseconds. + Weight::from_parts(15_376_000, 3556) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -989,8 +987,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `335` // Estimated: `3666` - // Minimum execution time: 22_803_000 picoseconds. - Weight::from_parts(23_732_000, 3666) + // Minimum execution time: 22_588_000 picoseconds. + Weight::from_parts(23_267_000, 3666) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } From cccf3417e5f0dace12a0da2ee157f1f284651700 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Bastian=20K=C3=B6cher?= Date: Tue, 19 Nov 2024 22:02:12 +0000 Subject: [PATCH 02/64] Forward logging directives to Polkadot workers (#6534) This pull request forward all the logging directives given to the node via `RUST_LOG` or `-l` to the workers, instead of only forwarding `RUST_LOG`. --------- Co-authored-by: GitHub Action --- Cargo.lock | 1 + polkadot/node/core/pvf/Cargo.toml | 1 + polkadot/node/core/pvf/src/worker_interface.rs | 6 ++---- prdoc/pr_6534.prdoc | 10 ++++++++++ substrate/client/tracing/src/logging/directives.rs | 7 ++++++- 5 files changed, 20 insertions(+), 5 deletions(-) create mode 100644 prdoc/pr_6534.prdoc diff --git a/Cargo.lock b/Cargo.lock index 02d7da8f7657..330c2563d976 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -17553,6 +17553,7 @@ dependencies = [ "rococo-runtime", "rusty-fork", "sc-sysinfo", + "sc-tracing", "slotmap", "sp-core 28.0.0", "sp-maybe-compressed-blob 11.0.0", diff --git a/polkadot/node/core/pvf/Cargo.toml b/polkadot/node/core/pvf/Cargo.toml index a9f97c308f26..37d5878ea597 100644 --- a/polkadot/node/core/pvf/Cargo.toml +++ b/polkadot/node/core/pvf/Cargo.toml @@ -38,6 +38,7 @@ polkadot-node-primitives = { workspace = true, default-features = true } polkadot-node-subsystem = { workspace = true, default-features = true } polkadot-primitives = { workspace = true, default-features = true } +sc-tracing = { workspace = true } sp-core = { workspace = true, default-features = true } sp-maybe-compressed-blob = { optional = true, workspace = true, default-features = true } polkadot-node-core-pvf-prepare-worker = { optional = true, workspace = true, default-features = true } diff --git a/polkadot/node/core/pvf/src/worker_interface.rs b/polkadot/node/core/pvf/src/worker_interface.rs index e63778d4692f..f279fbb53544 100644 --- a/polkadot/node/core/pvf/src/worker_interface.rs +++ b/polkadot/node/core/pvf/src/worker_interface.rs @@ -237,10 +237,8 @@ impl WorkerHandle { // Clear all env vars from the spawned process. let mut command = process::Command::new(program.as_ref()); command.env_clear(); - // Add back any env vars we want to keep. - if let Ok(value) = std::env::var("RUST_LOG") { - command.env("RUST_LOG", value); - } + + command.env("RUST_LOG", sc_tracing::logging::get_directives().join(",")); let mut child = command .args(extra_args) diff --git a/prdoc/pr_6534.prdoc b/prdoc/pr_6534.prdoc new file mode 100644 index 000000000000..7a92fe3c857b --- /dev/null +++ b/prdoc/pr_6534.prdoc @@ -0,0 +1,10 @@ +title: Forward logging directives to Polkadot workers +doc: +- audience: Node Dev + description: |- + This pull request forward all the logging directives given to the node via `RUST_LOG` or `-l` to the workers, instead of only forwarding `RUST_LOG`. +crates: +- name: polkadot-node-core-pvf + bump: patch +- name: sc-tracing + bump: patch diff --git a/substrate/client/tracing/src/logging/directives.rs b/substrate/client/tracing/src/logging/directives.rs index a99e9c4c8909..811511bb20f5 100644 --- a/substrate/client/tracing/src/logging/directives.rs +++ b/substrate/client/tracing/src/logging/directives.rs @@ -40,7 +40,7 @@ pub(crate) fn add_default_directives(directives: &str) { add_directives(directives); } -/// Add directives to current directives +/// Add directives to current directives. pub fn add_directives(directives: &str) { CURRENT_DIRECTIVES .get_or_init(|| Mutex::new(Vec::new())) @@ -48,6 +48,11 @@ pub fn add_directives(directives: &str) { .push(directives.to_owned()); } +/// Returns the current directives. +pub fn get_directives() -> Vec { + CURRENT_DIRECTIVES.get_or_init(|| Mutex::new(Vec::new())).lock().clone() +} + /// Parse `Directive` and add to default directives if successful. /// /// Ensures the supplied directive will be restored when resetting the log filter. From ce20d0a5a1bdaf2e2776cf159656b31073da07e4 Mon Sep 17 00:00:00 2001 From: Liu-Cheng Xu Date: Wed, 20 Nov 2024 07:34:43 +0800 Subject: [PATCH 03/64] Support block gap created by fast sync (#5703) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit This is part 2 of https://github.com/paritytech/polkadot-sdk/issues/5406#issuecomment-2325064863, properly handling the block gap generated during fast sync. Although #5406 remains unresolved due to the known issues in #5663, I decided to open up this PR earlier than later to speed up the overall progress. I've tested the fast sync locally with this PR, and it appears to be functioning well. (I was doing a fast sync from a discontinued archive node locally, thus the issue highlighted in https://github.com/paritytech/polkadot-sdk/pull/5663#discussion_r1752124039 was bypassed exactly.) Once the edge cases in #5663 are addressed, we can move forward by removing the body attribute from the LightState block request and complete the work on #5406. The changes in this PR are incremental, so reviewing commit by commit should provide the best clarity. cc @dmitry-markin --------- Co-authored-by: Bastian Köcher --- prdoc/pr_5703.prdoc | 13 +++++ substrate/client/db/src/lib.rs | 100 +++++++++++++++++++++++---------- 2 files changed, 83 insertions(+), 30 deletions(-) create mode 100644 prdoc/pr_5703.prdoc diff --git a/prdoc/pr_5703.prdoc b/prdoc/pr_5703.prdoc new file mode 100644 index 000000000000..3cef4468a87d --- /dev/null +++ b/prdoc/pr_5703.prdoc @@ -0,0 +1,13 @@ +title: Properly handle block gap created by fast sync + +doc: + - audience: Node Dev + description: | + Implements support for handling block gaps generated during fast sync. This includes managing the creation, + updating, and removal of block gaps. + Note that this feature is not fully activated until the `body` attribute is removed from the `LightState` + block request in chain sync, which will occur after the issue #5406 is resolved. + +crates: + - name: sc-client-db + bump: patch diff --git a/substrate/client/db/src/lib.rs b/substrate/client/db/src/lib.rs index cec981c05602..092101945107 100644 --- a/substrate/client/db/src/lib.rs +++ b/substrate/client/db/src/lib.rs @@ -1486,6 +1486,7 @@ impl Backend { .map(|(n, _)| n) .unwrap_or(Zero::zero()); let existing_header = number <= highest_leaf && self.blockchain.header(hash)?.is_some(); + let existing_body = pending_block.body.is_some(); // blocks are keyed by number + hash. let lookup_key = utils::number_and_hash_to_lookup_key(number, hash)?; @@ -1677,6 +1678,23 @@ impl Backend { children, ); } + } + + let should_check_block_gap = !existing_header || !existing_body; + + if should_check_block_gap { + let insert_new_gap = + |transaction: &mut Transaction, + new_gap: BlockGap>, + block_gap: &mut Option>>| { + transaction.set(columns::META, meta_keys::BLOCK_GAP, &new_gap.encode()); + transaction.set( + columns::META, + meta_keys::BLOCK_GAP_VERSION, + &BLOCK_GAP_CURRENT_VERSION.encode(), + ); + block_gap.replace(new_gap); + }; if let Some(mut gap) = block_gap { match gap.gap_type { @@ -1695,43 +1713,65 @@ impl Backend { block_gap = None; debug!(target: "db", "Removed block gap."); } else { - block_gap = Some(gap); + insert_new_gap(&mut transaction, gap, &mut block_gap); debug!(target: "db", "Update block gap. {block_gap:?}"); - transaction.set( - columns::META, - meta_keys::BLOCK_GAP, - &gap.encode(), - ); - transaction.set( - columns::META, - meta_keys::BLOCK_GAP_VERSION, - &BLOCK_GAP_CURRENT_VERSION.encode(), - ); } block_gap_updated = true; }, BlockGapType::MissingBody => { - unreachable!("Unsupported block gap. TODO: https://github.com/paritytech/polkadot-sdk/issues/5406") + // Gap increased when syncing the header chain during fast sync. + if number == gap.end + One::one() && !existing_body { + gap.end += One::one(); + utils::insert_number_to_key_mapping( + &mut transaction, + columns::KEY_LOOKUP, + number, + hash, + )?; + insert_new_gap(&mut transaction, gap, &mut block_gap); + debug!(target: "db", "Update block gap. {block_gap:?}"); + block_gap_updated = true; + // Gap decreased when downloading the full blocks. + } else if number == gap.start && existing_body { + gap.start += One::one(); + if gap.start > gap.end { + transaction.remove(columns::META, meta_keys::BLOCK_GAP); + transaction.remove(columns::META, meta_keys::BLOCK_GAP_VERSION); + block_gap = None; + debug!(target: "db", "Removed block gap."); + } else { + insert_new_gap(&mut transaction, gap, &mut block_gap); + debug!(target: "db", "Update block gap. {block_gap:?}"); + } + block_gap_updated = true; + } }, } - } else if operation.create_gap && - number > best_num + One::one() && - self.blockchain.header(parent_hash)?.is_none() - { - let gap = BlockGap { - start: best_num + One::one(), - end: number - One::one(), - gap_type: BlockGapType::MissingHeaderAndBody, - }; - transaction.set(columns::META, meta_keys::BLOCK_GAP, &gap.encode()); - transaction.set( - columns::META, - meta_keys::BLOCK_GAP_VERSION, - &BLOCK_GAP_CURRENT_VERSION.encode(), - ); - block_gap = Some(gap); - block_gap_updated = true; - debug!(target: "db", "Detected block gap {block_gap:?}"); + } else if operation.create_gap { + if number > best_num + One::one() && + self.blockchain.header(parent_hash)?.is_none() + { + let gap = BlockGap { + start: best_num + One::one(), + end: number - One::one(), + gap_type: BlockGapType::MissingHeaderAndBody, + }; + insert_new_gap(&mut transaction, gap, &mut block_gap); + block_gap_updated = true; + debug!(target: "db", "Detected block gap (warp sync) {block_gap:?}"); + } else if number == best_num + One::one() && + self.blockchain.header(parent_hash)?.is_some() && + !existing_body + { + let gap = BlockGap { + start: number, + end: number, + gap_type: BlockGapType::MissingBody, + }; + insert_new_gap(&mut transaction, gap, &mut block_gap); + block_gap_updated = true; + debug!(target: "db", "Detected block gap (fast sync) {block_gap:?}"); + } } } From 07a593338fd2fd221c7165c0da308dc8fbf3f985 Mon Sep 17 00:00:00 2001 From: Liu-Cheng Xu Date: Wed, 20 Nov 2024 07:57:11 +0800 Subject: [PATCH 04/64] Pure state sync refactoring (part-2) (#6521) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit This PR is the second part of the pure state sync refactoring, encapsulating `StateSyncMetadata` as a separate entity. Now it's pretty straightforward what changes are needed for the persistent state sync as observed in the struct `StateSync`: - `state`: redirect directly to the DB layer instead of being accumulated in the memory. - `metadata`: handle the state sync metadata on disk whenever the state is forwarded to the DB, resume an ongoing state sync on a restart, etc. --------- Co-authored-by: Bastian Köcher Co-authored-by: Alexandru Vasile <60601340+lexnv@users.noreply.github.com> --- prdoc/pr_6521.prdoc | 10 ++ .../network/sync/src/strategy/state_sync.rs | 136 ++++++++++-------- 2 files changed, 90 insertions(+), 56 deletions(-) create mode 100644 prdoc/pr_6521.prdoc diff --git a/prdoc/pr_6521.prdoc b/prdoc/pr_6521.prdoc new file mode 100644 index 000000000000..6f4acf8d028b --- /dev/null +++ b/prdoc/pr_6521.prdoc @@ -0,0 +1,10 @@ +title: Pure state sync refactoring (part-2) + +doc: +- audience: Node Dev + description: | + This is the last part of the pure refactoring of state sync, focusing on encapsulating `StateSyncMetadata` as a separate entity. + +crates: +- name: sc-network-sync + bump: none diff --git a/substrate/client/network/sync/src/strategy/state_sync.rs b/substrate/client/network/sync/src/strategy/state_sync.rs index 7a0cc1191609..47d859a1b7c6 100644 --- a/substrate/client/network/sync/src/strategy/state_sync.rs +++ b/substrate/client/network/sync/src/strategy/state_sync.rs @@ -89,22 +89,62 @@ pub enum ImportResult { BadResponse, } -/// State sync state machine. Accumulates partial state data until it -/// is ready to be imported. -pub struct StateSync { - target_block: B::Hash, +struct StateSyncMetadata { + last_key: SmallVec<[Vec; 2]>, target_header: B::Header, - target_root: B::Hash, target_body: Option>, target_justifications: Option, - last_key: SmallVec<[Vec; 2]>, - state: HashMap, (Vec<(Vec, Vec)>, Vec>)>, complete: bool, - client: Arc, imported_bytes: u64, skip_proof: bool, } +impl StateSyncMetadata { + fn target_hash(&self) -> B::Hash { + self.target_header.hash() + } + + /// Returns target block number. + fn target_number(&self) -> NumberFor { + *self.target_header.number() + } + + fn target_root(&self) -> B::Hash { + *self.target_header.state_root() + } + + fn next_request(&self) -> StateRequest { + StateRequest { + block: self.target_hash().encode(), + start: self.last_key.clone().into_vec(), + no_proof: self.skip_proof, + } + } + + fn progress(&self) -> StateSyncProgress { + let cursor = *self.last_key.get(0).and_then(|last| last.get(0)).unwrap_or(&0u8); + let percent_done = cursor as u32 * 100 / 256; + StateSyncProgress { + percentage: percent_done, + size: self.imported_bytes, + phase: if self.complete { + StateSyncPhase::ImportingState + } else { + StateSyncPhase::DownloadingState + }, + } + } +} + +/// State sync state machine. +/// +/// Accumulates partial state data until it is ready to be imported. +pub struct StateSync { + metadata: StateSyncMetadata, + state: HashMap, (Vec<(Vec, Vec)>, Vec>)>, + client: Arc, +} + impl StateSync where B: BlockT, @@ -120,16 +160,16 @@ where ) -> Self { Self { client, - target_block: target_header.hash(), - target_root: *target_header.state_root(), - target_header, - target_body, - target_justifications, - last_key: SmallVec::default(), + metadata: StateSyncMetadata { + last_key: SmallVec::default(), + target_header, + target_body, + target_justifications, + complete: false, + imported_bytes: 0, + skip_proof, + }, state: HashMap::default(), - complete: false, - imported_bytes: 0, - skip_proof, } } @@ -155,7 +195,7 @@ where if is_top && well_known_keys::is_child_storage_key(key.as_slice()) { child_storage_roots.push((value, key)); } else { - self.imported_bytes += key.len() as u64; + self.metadata.imported_bytes += key.len() as u64; entry.0.push((key, value)); } } @@ -177,11 +217,11 @@ where // the parent cursor stays valid. // Empty parent trie content only happens when all the response content // is part of a single child trie. - if self.last_key.len() == 2 && response.entries[0].entries.is_empty() { + if self.metadata.last_key.len() == 2 && response.entries[0].entries.is_empty() { // Do not remove the parent trie position. - self.last_key.pop(); + self.metadata.last_key.pop(); } else { - self.last_key.clear(); + self.metadata.last_key.clear(); } for state in response.entries { debug!( @@ -193,7 +233,7 @@ where if !state.complete { if let Some(e) = state.entries.last() { - self.last_key.push(e.key.clone()); + self.metadata.last_key.push(e.key.clone()); } complete = false; } @@ -219,11 +259,11 @@ where debug!(target: LOG_TARGET, "Bad state response"); return ImportResult::BadResponse } - if !self.skip_proof && response.proof.is_empty() { + if !self.metadata.skip_proof && response.proof.is_empty() { debug!(target: LOG_TARGET, "Missing proof"); return ImportResult::BadResponse } - let complete = if !self.skip_proof { + let complete = if !self.metadata.skip_proof { debug!(target: LOG_TARGET, "Importing state from {} trie nodes", response.proof.len()); let proof_size = response.proof.len() as u64; let proof = match CompactProof::decode(&mut response.proof.as_ref()) { @@ -234,9 +274,9 @@ where }, }; let (values, completed) = match self.client.verify_range_proof( - self.target_root, + self.metadata.target_root(), proof, - self.last_key.as_slice(), + self.metadata.last_key.as_slice(), ) { Err(e) => { debug!( @@ -251,27 +291,25 @@ where debug!(target: LOG_TARGET, "Imported with {} keys", values.len()); let complete = completed == 0; - if !complete && !values.update_last_key(completed, &mut self.last_key) { + if !complete && !values.update_last_key(completed, &mut self.metadata.last_key) { debug!(target: LOG_TARGET, "Error updating key cursor, depth: {}", completed); }; self.process_state_verified(values); - self.imported_bytes += proof_size; + self.metadata.imported_bytes += proof_size; complete } else { self.process_state_unverified(response) }; if complete { - self.complete = true; + self.metadata.complete = true; + let target_hash = self.metadata.target_hash(); ImportResult::Import( - self.target_block, - self.target_header.clone(), - ImportedState { - block: self.target_block, - state: std::mem::take(&mut self.state).into(), - }, - self.target_body.clone(), - self.target_justifications.clone(), + target_hash, + self.metadata.target_header.clone(), + ImportedState { block: target_hash, state: std::mem::take(&mut self.state).into() }, + self.metadata.target_body.clone(), + self.metadata.target_justifications.clone(), ) } else { ImportResult::Continue @@ -280,40 +318,26 @@ where /// Produce next state request. fn next_request(&self) -> StateRequest { - StateRequest { - block: self.target_block.encode(), - start: self.last_key.clone().into_vec(), - no_proof: self.skip_proof, - } + self.metadata.next_request() } /// Check if the state is complete. fn is_complete(&self) -> bool { - self.complete + self.metadata.complete } /// Returns target block number. fn target_number(&self) -> NumberFor { - *self.target_header.number() + self.metadata.target_number() } /// Returns target block hash. fn target_hash(&self) -> B::Hash { - self.target_block + self.metadata.target_hash() } /// Returns state sync estimated progress. fn progress(&self) -> StateSyncProgress { - let cursor = *self.last_key.get(0).and_then(|last| last.get(0)).unwrap_or(&0u8); - let percent_done = cursor as u32 * 100 / 256; - StateSyncProgress { - percentage: percent_done, - size: self.imported_bytes, - phase: if self.complete { - StateSyncPhase::ImportingState - } else { - StateSyncPhase::DownloadingState - }, - } + self.metadata.progress() } } From ca8beaed148a1fc65d181aedeb91b23c262886e1 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Alexandre=20R=2E=20Bald=C3=A9?= Date: Wed, 20 Nov 2024 01:10:30 +0000 Subject: [PATCH 05/64] Add and test events in `pallet-conviction-voting` (#6544) # Description https://github.com/paritytech/polkadot-sdk/pull/4613 introduced events for `pallet_conviction_voting::{vote, remove_vote, remove_other_vote}`. However: 1. it did not include `unlock` 2. the pallet's unit tests were missing an update ## Integration N/A ## Review Notes This is as https://github.com/paritytech/polkadot-sdk/pull/6261 was, so it is a trivial change. --- prdoc/pr_6544.prdoc | 14 +++ substrate/frame/conviction-voting/src/lib.rs | 7 +- .../frame/conviction-voting/src/tests.rs | 85 ++++++++++++++++--- .../frame/conviction-voting/src/types.rs | 9 +- 4 files changed, 96 insertions(+), 19 deletions(-) create mode 100644 prdoc/pr_6544.prdoc diff --git a/prdoc/pr_6544.prdoc b/prdoc/pr_6544.prdoc new file mode 100644 index 000000000000..f2bc9627697d --- /dev/null +++ b/prdoc/pr_6544.prdoc @@ -0,0 +1,14 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: Add and test events to conviction voting pallet + +doc: + - audience: Runtime Dev + description: | + Add event for the unlocking of an expired conviction vote's funds, and test recently added + voting events. + +crates: + - name: pallet-conviction-voting + bump: major diff --git a/substrate/frame/conviction-voting/src/lib.rs b/substrate/frame/conviction-voting/src/lib.rs index 85da1aed3c27..31bd6b85ec86 100644 --- a/substrate/frame/conviction-voting/src/lib.rs +++ b/substrate/frame/conviction-voting/src/lib.rs @@ -171,10 +171,12 @@ pub mod pallet { Delegated(T::AccountId, T::AccountId), /// An \[account\] has cancelled a previous delegation operation. Undelegated(T::AccountId), - /// An account that has voted + /// An account has voted Voted { who: T::AccountId, vote: AccountVote> }, - /// A vote that been removed + /// A vote has been removed VoteRemoved { who: T::AccountId, vote: AccountVote> }, + /// The lockup period of a conviction vote expired, and the funds have been unlocked. + VoteUnlocked { who: T::AccountId, class: ClassOf }, } #[pallet::error] @@ -315,6 +317,7 @@ pub mod pallet { ensure_signed(origin)?; let target = T::Lookup::lookup(target)?; Self::update_lock(&class, &target); + Self::deposit_event(Event::VoteUnlocked { who: target, class }); Ok(()) } diff --git a/substrate/frame/conviction-voting/src/tests.rs b/substrate/frame/conviction-voting/src/tests.rs index 37cdd7a5b338..dd9ee33ee183 100644 --- a/substrate/frame/conviction-voting/src/tests.rs +++ b/substrate/frame/conviction-voting/src/tests.rs @@ -238,27 +238,52 @@ fn basic_stuff() { fn basic_voting_works() { new_test_ext().execute_with(|| { assert_ok!(Voting::vote(RuntimeOrigin::signed(1), 3, aye(2, 5))); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::Voted { + who: 1, + vote: aye(2, 5), + })); assert_eq!(tally(3), Tally::from_parts(10, 0, 2)); assert_ok!(Voting::vote(RuntimeOrigin::signed(1), 3, nay(2, 5))); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::Voted { + who: 1, + vote: nay(2, 5), + })); assert_eq!(tally(3), Tally::from_parts(0, 10, 0)); assert_eq!(Balances::usable_balance(1), 8); assert_ok!(Voting::vote(RuntimeOrigin::signed(1), 3, aye(5, 1))); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::Voted { + who: 1, + vote: aye(5, 1), + })); assert_eq!(tally(3), Tally::from_parts(5, 0, 5)); assert_ok!(Voting::vote(RuntimeOrigin::signed(1), 3, nay(5, 1))); assert_eq!(tally(3), Tally::from_parts(0, 5, 0)); assert_eq!(Balances::usable_balance(1), 5); assert_ok!(Voting::vote(RuntimeOrigin::signed(1), 3, aye(10, 0))); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::Voted { + who: 1, + vote: aye(10, 0), + })); assert_eq!(tally(3), Tally::from_parts(1, 0, 10)); + assert_ok!(Voting::vote(RuntimeOrigin::signed(1), 3, nay(10, 0))); assert_eq!(tally(3), Tally::from_parts(0, 1, 0)); assert_eq!(Balances::usable_balance(1), 0); assert_ok!(Voting::remove_vote(RuntimeOrigin::signed(1), None, 3)); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::VoteRemoved { + who: 1, + vote: nay(10, 0), + })); assert_eq!(tally(3), Tally::from_parts(0, 0, 0)); assert_ok!(Voting::unlock(RuntimeOrigin::signed(1), class(3), 1)); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::VoteUnlocked { + who: 1, + class: class(3), + })); assert_eq!(Balances::usable_balance(1), 10); }); } @@ -267,15 +292,32 @@ fn basic_voting_works() { fn split_voting_works() { new_test_ext().execute_with(|| { assert_ok!(Voting::vote(RuntimeOrigin::signed(1), 3, split(10, 0))); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::Voted { + who: 1, + vote: split(10, 0), + })); assert_eq!(tally(3), Tally::from_parts(1, 0, 10)); + assert_ok!(Voting::vote(RuntimeOrigin::signed(1), 3, split(5, 5))); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::Voted { + who: 1, + vote: split(5, 5), + })); assert_eq!(tally(3), Tally::from_parts(0, 0, 5)); assert_eq!(Balances::usable_balance(1), 0); assert_ok!(Voting::remove_vote(RuntimeOrigin::signed(1), None, 3)); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::VoteRemoved { + who: 1, + vote: split(5, 5), + })); assert_eq!(tally(3), Tally::from_parts(0, 0, 0)); assert_ok!(Voting::unlock(RuntimeOrigin::signed(1), class(3), 1)); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::VoteUnlocked { + who: 1, + class: class(3), + })); assert_eq!(Balances::usable_balance(1), 10); }); } @@ -284,25 +326,48 @@ fn split_voting_works() { fn abstain_voting_works() { new_test_ext().execute_with(|| { assert_ok!(Voting::vote(RuntimeOrigin::signed(1), 3, split_abstain(0, 0, 10))); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::Voted { + who: 1, + vote: split_abstain(0, 0, 10), + })); assert_eq!(tally(3), Tally::from_parts(0, 0, 10)); - assert_ok!(Voting::vote(RuntimeOrigin::signed(2), 3, split_abstain(0, 0, 20))); - assert_eq!(tally(3), Tally::from_parts(0, 0, 30)); - assert_ok!(Voting::vote(RuntimeOrigin::signed(2), 3, split_abstain(10, 0, 10))); - assert_eq!(tally(3), Tally::from_parts(1, 0, 30)); + + assert_ok!(Voting::vote(RuntimeOrigin::signed(6), 3, split_abstain(10, 0, 20))); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::Voted { + who: 6, + vote: split_abstain(10, 0, 20), + })); + assert_eq!(tally(3), Tally::from_parts(1, 0, 40)); + + assert_ok!(Voting::vote(RuntimeOrigin::signed(6), 3, split_abstain(0, 0, 40))); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::Voted { + who: 6, + vote: split_abstain(0, 0, 40), + })); + + assert_eq!(tally(3), Tally::from_parts(0, 0, 50)); assert_eq!(Balances::usable_balance(1), 0); - assert_eq!(Balances::usable_balance(2), 0); + assert_eq!(Balances::usable_balance(6), 20); assert_ok!(Voting::remove_vote(RuntimeOrigin::signed(1), None, 3)); - assert_eq!(tally(3), Tally::from_parts(1, 0, 20)); - - assert_ok!(Voting::remove_vote(RuntimeOrigin::signed(2), None, 3)); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::VoteRemoved { + who: 1, + vote: split_abstain(0, 0, 10), + })); + assert_eq!(tally(3), Tally::from_parts(0, 0, 40)); + + assert_ok!(Voting::remove_vote(RuntimeOrigin::signed(6), Some(class(3)), 3)); + System::assert_last_event(tests::RuntimeEvent::Voting(Event::VoteRemoved { + who: 6, + vote: split_abstain(0, 0, 40), + })); assert_eq!(tally(3), Tally::from_parts(0, 0, 0)); assert_ok!(Voting::unlock(RuntimeOrigin::signed(1), class(3), 1)); assert_eq!(Balances::usable_balance(1), 10); - assert_ok!(Voting::unlock(RuntimeOrigin::signed(2), class(3), 2)); - assert_eq!(Balances::usable_balance(2), 20); + assert_ok!(Voting::unlock(RuntimeOrigin::signed(6), class(3), 6)); + assert_eq!(Balances::usable_balance(6), 60); }); } diff --git a/substrate/frame/conviction-voting/src/types.rs b/substrate/frame/conviction-voting/src/types.rs index d6bbb678a14b..aa7dd578fbad 100644 --- a/substrate/frame/conviction-voting/src/types.rs +++ b/substrate/frame/conviction-voting/src/types.rs @@ -117,14 +117,9 @@ impl< pub fn from_parts( ayes_with_conviction: Votes, nays_with_conviction: Votes, - ayes: Votes, + support: Votes, ) -> Self { - Self { - ayes: ayes_with_conviction, - nays: nays_with_conviction, - support: ayes, - dummy: PhantomData, - } + Self { ayes: ayes_with_conviction, nays: nays_with_conviction, support, dummy: PhantomData } } /// Add an account's vote into the tally. From 65a92ba5d444c7278d038c8181086bd9f006f68d Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Bastian=20K=C3=B6cher?= Date: Wed, 20 Nov 2024 11:19:28 +0000 Subject: [PATCH 06/64] Increase default trie cache size to 1GiB (#6546) The default trie cache size before was set to `64MiB`, which is quite low to achieve real speed ups. `1GiB` should be a reasonable number as the requirements for validators/collators/full nodes are much higher when it comes to minimum memory requirements. Also the cache will not use `1GiB` from the start and fills over time. The setting can be changed by setting `--trie-cache-size BYTE_SIZE`. --------- Co-authored-by: GitHub Action --- prdoc/pr_6546.prdoc | 13 +++++++++++++ substrate/client/cli/src/params/import_params.rs | 10 +--------- 2 files changed, 14 insertions(+), 9 deletions(-) create mode 100644 prdoc/pr_6546.prdoc diff --git a/prdoc/pr_6546.prdoc b/prdoc/pr_6546.prdoc new file mode 100644 index 000000000000..353578a7f58f --- /dev/null +++ b/prdoc/pr_6546.prdoc @@ -0,0 +1,13 @@ +title: Increase default trie cache size to 1GiB +doc: +- audience: Node Operator + description: "The default trie cache size before was set to `64MiB`, which is quite\ + \ low to achieve real speed ups. `1GiB` should be a reasonable number as the requirements\ + \ for validators/collators/full nodes are much higher when it comes to minimum\ + \ memory requirements. Also the cache will not use `1GiB` from the start and fills\ + \ over time. The setting can be changed by setting `--trie-cache-size BYTE_SIZE`.\ + The CLI option `--state-cache-size` is also removed, which was not having any effect anymore.\r\ + \n" +crates: +- name: sc-cli + bump: patch diff --git a/substrate/client/cli/src/params/import_params.rs b/substrate/client/cli/src/params/import_params.rs index add7cb4f8505..e4b8b9644feb 100644 --- a/substrate/client/cli/src/params/import_params.rs +++ b/substrate/client/cli/src/params/import_params.rs @@ -78,21 +78,13 @@ pub struct ImportParams { /// Specify the state cache size. /// /// Providing `0` will disable the cache. - #[arg(long, value_name = "Bytes", default_value_t = 67108864)] + #[arg(long, value_name = "Bytes", default_value_t = 1024 * 1024 * 1024)] pub trie_cache_size: usize, - - /// DEPRECATED: switch to `--trie-cache-size`. - #[arg(long)] - state_cache_size: Option, } impl ImportParams { /// Specify the trie cache maximum size. pub fn trie_cache_maximum_size(&self) -> Option { - if self.state_cache_size.is_some() { - eprintln!("`--state-cache-size` was deprecated. Please switch to `--trie-cache-size`."); - } - if self.trie_cache_size == 0 { None } else { From bd0d0cde53272833deaaa0bcaddf95fba290ea77 Mon Sep 17 00:00:00 2001 From: Branislav Kontur Date: Wed, 20 Nov 2024 13:23:37 +0100 Subject: [PATCH 07/64] Bridges testing improvements (#6536) This PR includes: - Refactored integrity tests to support standalone deployment of `pallet-bridge-messages`. - Refactored the `open_and_close_bridge_works` test case to support multiple scenarios, such as: 1. A local chain opening a bridge. 2. Sibling parachains opening a bridge. 3. The relay chain opening a bridge. - Previously, we added instance support for `pallet-bridge-relayer` but overlooked updating the `DeliveryConfirmationPaymentsAdapter`. --------- Co-authored-by: GitHub Action --- bridges/bin/runtime-common/src/integrity.rs | 95 +++++++++++---- bridges/bin/runtime-common/src/mock.rs | 1 + bridges/modules/relayers/src/lib.rs | 5 +- bridges/modules/relayers/src/mock.rs | 15 +-- .../modules/relayers/src/payment_adapter.rs | 24 ++-- .../src/bridge_to_bulletin_config.rs | 1 - .../src/bridge_to_westend_config.rs | 3 +- .../bridge-hub-rococo/tests/tests.rs | 30 +++-- .../src/bridge_to_rococo_config.rs | 3 +- .../bridge-hub-westend/tests/tests.rs | 15 ++- .../test-utils/src/test_cases/helpers.rs | 112 +++++++++++------- .../test-utils/src/test_cases/mod.rs | 28 +++-- .../parachains/runtimes/test-utils/src/lib.rs | 22 ++-- prdoc/pr_6536.prdoc | 24 ++++ 14 files changed, 251 insertions(+), 127 deletions(-) create mode 100644 prdoc/pr_6536.prdoc diff --git a/bridges/bin/runtime-common/src/integrity.rs b/bridges/bin/runtime-common/src/integrity.rs index 2ff6c4c9165a..535f1a26e5e8 100644 --- a/bridges/bin/runtime-common/src/integrity.rs +++ b/bridges/bin/runtime-common/src/integrity.rs @@ -89,13 +89,11 @@ macro_rules! assert_bridge_messages_pallet_types( /// Macro that combines four other macro calls - `assert_chain_types`, `assert_bridge_types`, /// and `assert_bridge_messages_pallet_types`. It may be used -/// at the chain that is implementing complete standard messages bridge (i.e. with bridge GRANDPA -/// and messages pallets deployed). +/// at the chain that is implementing standard messages bridge with messages pallets deployed. #[macro_export] macro_rules! assert_complete_bridge_types( ( runtime: $r:path, - with_bridged_chain_grandpa_instance: $gi:path, with_bridged_chain_messages_instance: $mi:path, this_chain: $this:path, bridged_chain: $bridged:path, @@ -186,34 +184,55 @@ where ); } -/// Parameters for asserting bridge pallet names. +/// Parameters for asserting bridge GRANDPA pallet names. #[derive(Debug)] -pub struct AssertBridgePalletNames<'a> { +struct AssertBridgeGrandpaPalletNames<'a> { /// Name of the GRANDPA pallet, deployed at this chain and used to bridge with the bridged /// chain. pub with_bridged_chain_grandpa_pallet_name: &'a str, - /// Name of the messages pallet, deployed at this chain and used to bridge with the bridged - /// chain. - pub with_bridged_chain_messages_pallet_name: &'a str, } /// Tests that bridge pallet names used in `construct_runtime!()` macro call are matching constants /// from chain primitives crates. -fn assert_bridge_pallet_names(params: AssertBridgePalletNames) +fn assert_bridge_grandpa_pallet_names(params: AssertBridgeGrandpaPalletNames) where - R: pallet_bridge_grandpa::Config + pallet_bridge_messages::Config, + R: pallet_bridge_grandpa::Config, GI: 'static, - MI: 'static, { // check that the bridge GRANDPA pallet has required name assert_eq!( - pallet_bridge_grandpa::PalletOwner::::storage_value_final_key().to_vec(), + pallet_bridge_grandpa::PalletOwner::::storage_value_final_key().to_vec(), + bp_runtime::storage_value_key( + params.with_bridged_chain_grandpa_pallet_name, + "PalletOwner", + ) + .0, + ); + assert_eq!( + pallet_bridge_grandpa::PalletOperatingMode::::storage_value_final_key().to_vec(), bp_runtime::storage_value_key( params.with_bridged_chain_grandpa_pallet_name, - "PalletOwner", - ).0, + "PalletOperatingMode", + ) + .0, ); +} +/// Parameters for asserting bridge messages pallet names. +#[derive(Debug)] +struct AssertBridgeMessagesPalletNames<'a> { + /// Name of the messages pallet, deployed at this chain and used to bridge with the bridged + /// chain. + pub with_bridged_chain_messages_pallet_name: &'a str, +} + +/// Tests that bridge pallet names used in `construct_runtime!()` macro call are matching constants +/// from chain primitives crates. +fn assert_bridge_messages_pallet_names(params: AssertBridgeMessagesPalletNames) +where + R: pallet_bridge_messages::Config, + MI: 'static, +{ // check that the bridge messages pallet has required name assert_eq!( pallet_bridge_messages::PalletOwner::::storage_value_final_key().to_vec(), @@ -223,6 +242,14 @@ where ) .0, ); + assert_eq!( + pallet_bridge_messages::PalletOperatingMode::::storage_value_final_key().to_vec(), + bp_runtime::storage_value_key( + params.with_bridged_chain_messages_pallet_name, + "PalletOperatingMode", + ) + .0, + ); } /// Parameters for asserting complete standard messages bridge. @@ -246,9 +273,11 @@ pub fn assert_complete_with_relay_chain_bridge_constants( assert_chain_constants::(params.this_chain_constants); assert_bridge_grandpa_pallet_constants::(); assert_bridge_messages_pallet_constants::(); - assert_bridge_pallet_names::(AssertBridgePalletNames { + assert_bridge_grandpa_pallet_names::(AssertBridgeGrandpaPalletNames { with_bridged_chain_grandpa_pallet_name: >::BridgedChain::WITH_CHAIN_GRANDPA_PALLET_NAME, + }); + assert_bridge_messages_pallet_names::(AssertBridgeMessagesPalletNames { with_bridged_chain_messages_pallet_name: >::BridgedChain::WITH_CHAIN_MESSAGES_PALLET_NAME, }); @@ -256,21 +285,43 @@ pub fn assert_complete_with_relay_chain_bridge_constants( /// All bridge-related constants tests for the complete standard parachain messages bridge /// (i.e. with bridge GRANDPA, parachains and messages pallets deployed). -pub fn assert_complete_with_parachain_bridge_constants( +pub fn assert_complete_with_parachain_bridge_constants( params: AssertCompleteBridgeConstants, ) where R: frame_system::Config - + pallet_bridge_grandpa::Config + + pallet_bridge_parachains::Config + pallet_bridge_messages::Config, - GI: 'static, + >::BridgedRelayChain: ChainWithGrandpa, + PI: 'static, + MI: 'static, +{ + assert_chain_constants::(params.this_chain_constants); + assert_bridge_grandpa_pallet_constants::(); + assert_bridge_messages_pallet_constants::(); + assert_bridge_grandpa_pallet_names::( + AssertBridgeGrandpaPalletNames { + with_bridged_chain_grandpa_pallet_name: + <>::BridgedRelayChain>::WITH_CHAIN_GRANDPA_PALLET_NAME, + }, + ); + assert_bridge_messages_pallet_names::(AssertBridgeMessagesPalletNames { + with_bridged_chain_messages_pallet_name: + >::BridgedChain::WITH_CHAIN_MESSAGES_PALLET_NAME, + }); +} + +/// All bridge-related constants tests for the standalone messages bridge deployment (only with +/// messages pallets deployed). +pub fn assert_standalone_messages_bridge_constants(params: AssertCompleteBridgeConstants) +where + R: frame_system::Config + pallet_bridge_messages::Config, MI: 'static, - RelayChain: ChainWithGrandpa, { assert_chain_constants::(params.this_chain_constants); - assert_bridge_grandpa_pallet_constants::(); assert_bridge_messages_pallet_constants::(); - assert_bridge_pallet_names::(AssertBridgePalletNames { - with_bridged_chain_grandpa_pallet_name: RelayChain::WITH_CHAIN_GRANDPA_PALLET_NAME, + assert_bridge_messages_pallet_names::(AssertBridgeMessagesPalletNames { with_bridged_chain_messages_pallet_name: >::BridgedChain::WITH_CHAIN_MESSAGES_PALLET_NAME, }); diff --git a/bridges/bin/runtime-common/src/mock.rs b/bridges/bin/runtime-common/src/mock.rs index 6cf04b452da7..88037d9deff5 100644 --- a/bridges/bin/runtime-common/src/mock.rs +++ b/bridges/bin/runtime-common/src/mock.rs @@ -196,6 +196,7 @@ impl pallet_bridge_messages::Config for TestRuntime { type DeliveryConfirmationPayments = pallet_bridge_relayers::DeliveryConfirmationPaymentsAdapter< TestRuntime, (), + (), ConstU64<100_000>, >; type OnMessagesDelivered = (); diff --git a/bridges/modules/relayers/src/lib.rs b/bridges/modules/relayers/src/lib.rs index f06c2e16ac24..d1c71b6d3051 100644 --- a/bridges/modules/relayers/src/lib.rs +++ b/bridges/modules/relayers/src/lib.rs @@ -22,8 +22,9 @@ use bp_relayers::{ ExplicitOrAccountParams, PaymentProcedure, Registration, RelayerRewardsKeyProvider, - RewardsAccountParams, StakeAndSlash, + StakeAndSlash, }; +pub use bp_relayers::{RewardsAccountOwner, RewardsAccountParams}; use bp_runtime::StorageDoubleMapKeyProvider; use frame_support::fail; use sp_arithmetic::traits::{AtLeast32BitUnsigned, Zero}; @@ -31,7 +32,7 @@ use sp_runtime::{traits::CheckedSub, Saturating}; use sp_std::marker::PhantomData; pub use pallet::*; -pub use payment_adapter::DeliveryConfirmationPaymentsAdapter; +pub use payment_adapter::{DeliveryConfirmationPaymentsAdapter, PayRewardFromAccount}; pub use stake_adapter::StakeAndSlashNamed; pub use weights::WeightInfo; pub use weights_ext::WeightInfoExt; diff --git a/bridges/modules/relayers/src/mock.rs b/bridges/modules/relayers/src/mock.rs index d186e968e648..7dc213249379 100644 --- a/bridges/modules/relayers/src/mock.rs +++ b/bridges/modules/relayers/src/mock.rs @@ -171,14 +171,14 @@ pub type TestStakeAndSlash = pallet_bridge_relayers::StakeAndSlashNamed< frame_support::construct_runtime! { pub enum TestRuntime { - System: frame_system::{Pallet, Call, Config, Storage, Event}, + System: frame_system, Utility: pallet_utility, - Balances: pallet_balances::{Pallet, Call, Storage, Config, Event}, - TransactionPayment: pallet_transaction_payment::{Pallet, Storage, Event}, - BridgeRelayers: pallet_bridge_relayers::{Pallet, Call, Storage, Event}, - BridgeGrandpa: pallet_bridge_grandpa::{Pallet, Call, Storage, Event}, - BridgeParachains: pallet_bridge_parachains::{Pallet, Call, Storage, Event}, - BridgeMessages: pallet_bridge_messages::{Pallet, Call, Storage, Event, Config}, + Balances: pallet_balances, + TransactionPayment: pallet_transaction_payment, + BridgeRelayers: pallet_bridge_relayers, + BridgeGrandpa: pallet_bridge_grandpa, + BridgeParachains: pallet_bridge_parachains, + BridgeMessages: pallet_bridge_messages, } } @@ -267,6 +267,7 @@ impl pallet_bridge_messages::Config for TestRuntime { type DeliveryConfirmationPayments = pallet_bridge_relayers::DeliveryConfirmationPaymentsAdapter< TestRuntime, (), + (), ConstU64<100_000>, >; type OnMessagesDelivered = (); diff --git a/bridges/modules/relayers/src/payment_adapter.rs b/bridges/modules/relayers/src/payment_adapter.rs index 5383cba5ecbd..5af0d8f9dfbf 100644 --- a/bridges/modules/relayers/src/payment_adapter.rs +++ b/bridges/modules/relayers/src/payment_adapter.rs @@ -22,6 +22,7 @@ use bp_messages::{ source_chain::{DeliveryConfirmationPayments, RelayersRewards}, MessageNonce, }; +pub use bp_relayers::PayRewardFromAccount; use bp_relayers::{RewardsAccountOwner, RewardsAccountParams}; use bp_runtime::Chain; use frame_support::{sp_runtime::SaturatedConversion, traits::Get}; @@ -31,15 +32,16 @@ use sp_std::{collections::vec_deque::VecDeque, marker::PhantomData, ops::RangeIn /// Adapter that allows relayers pallet to be used as a delivery+dispatch payment mechanism /// for the messages pallet. -pub struct DeliveryConfirmationPaymentsAdapter( - PhantomData<(T, MI, DeliveryReward)>, +pub struct DeliveryConfirmationPaymentsAdapter( + PhantomData<(T, MI, RI, DeliveryReward)>, ); -impl DeliveryConfirmationPayments> - for DeliveryConfirmationPaymentsAdapter +impl DeliveryConfirmationPayments> + for DeliveryConfirmationPaymentsAdapter where - T: Config + pallet_bridge_messages::Config::LaneId>, + T: Config + pallet_bridge_messages::Config>::LaneId>, MI: 'static, + RI: 'static, DeliveryReward: Get, { type Error = &'static str; @@ -54,7 +56,7 @@ where bp_messages::calc_relayers_rewards::(messages_relayers, received_range); let rewarded_relayers = relayers_rewards.len(); - register_relayers_rewards::( + register_relayers_rewards::( confirmation_relayer, relayers_rewards, RewardsAccountParams::new( @@ -70,7 +72,7 @@ where } // Update rewards to given relayers, optionally rewarding confirmation relayer. -fn register_relayers_rewards( +fn register_relayers_rewards, I: 'static>( confirmation_relayer: &T::AccountId, relayers_rewards: RelayersRewards, lane_id: RewardsAccountParams, @@ -84,7 +86,7 @@ fn register_relayers_rewards( let relayer_reward = T::Reward::saturated_from(messages).saturating_mul(delivery_fee); if relayer != *confirmation_relayer { - Pallet::::register_relayer_reward(lane_id, &relayer, relayer_reward); + Pallet::::register_relayer_reward(lane_id, &relayer, relayer_reward); } else { confirmation_relayer_reward = confirmation_relayer_reward.saturating_add(relayer_reward); @@ -92,7 +94,7 @@ fn register_relayers_rewards( } // finally - pay reward to confirmation relayer - Pallet::::register_relayer_reward( + Pallet::::register_relayer_reward( lane_id, confirmation_relayer, confirmation_relayer_reward, @@ -115,7 +117,7 @@ mod tests { #[test] fn confirmation_relayer_is_rewarded_if_it_has_also_delivered_messages() { run_test(|| { - register_relayers_rewards::( + register_relayers_rewards::( &RELAYER_2, relayers_rewards(), test_reward_account_param(), @@ -136,7 +138,7 @@ mod tests { #[test] fn confirmation_relayer_is_not_rewarded_if_it_has_not_delivered_any_messages() { run_test(|| { - register_relayers_rewards::( + register_relayers_rewards::( &RELAYER_3, relayers_rewards(), test_reward_account_param(), diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_bulletin_config.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_bulletin_config.rs index 7e0385692375..b284fa9e7af7 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_bulletin_config.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_bulletin_config.rs @@ -201,7 +201,6 @@ mod tests { fn ensure_bridge_integrity() { assert_complete_bridge_types!( runtime: Runtime, - with_bridged_chain_grandpa_instance: BridgeGrandpaRococoBulletinInstance, with_bridged_chain_messages_instance: WithRococoBulletinMessagesInstance, this_chain: bp_bridge_hub_rococo::BridgeHubRococo, bridged_chain: bp_polkadot_bulletin::PolkadotBulletin, diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_westend_config.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_westend_config.rs index 0eab3c74a7e2..2710d033d64b 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_westend_config.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_westend_config.rs @@ -121,6 +121,7 @@ impl pallet_bridge_messages::Config for Ru type DeliveryConfirmationPayments = pallet_bridge_relayers::DeliveryConfirmationPaymentsAdapter< Runtime, WithBridgeHubWestendMessagesInstance, + RelayersForLegacyLaneIdsMessagesInstance, DeliveryRewardInBalance, >; @@ -256,7 +257,6 @@ mod tests { fn ensure_bridge_integrity() { assert_complete_bridge_types!( runtime: Runtime, - with_bridged_chain_grandpa_instance: BridgeGrandpaWestendInstance, with_bridged_chain_messages_instance: WithBridgeHubWestendMessagesInstance, this_chain: bp_bridge_hub_rococo::BridgeHubRococo, bridged_chain: bp_bridge_hub_westend::BridgeHubWestend, @@ -266,7 +266,6 @@ mod tests { Runtime, BridgeGrandpaWestendInstance, WithBridgeHubWestendMessagesInstance, - bp_westend::Westend, >(AssertCompleteBridgeConstants { this_chain_constants: AssertChainConstants { block_length: bp_bridge_hub_rococo::BlockLength::get(), diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs index 2e7dd98e9dce..6ca858e961d3 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs @@ -324,11 +324,12 @@ mod bridge_hub_westend_tests { >( SiblingParachainLocation::get(), BridgedUniversalLocation::get(), - |locations, fee| { + false, + |locations, _fee| { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverBridgeHubWestendInstance - >(locations, fee, LegacyLaneId([0, 0, 0, 1])) + >(locations, LegacyLaneId([0, 0, 0, 1])) } ).1 }, @@ -388,11 +389,12 @@ mod bridge_hub_westend_tests { >( SiblingParachainLocation::get(), BridgedUniversalLocation::get(), - |locations, fee| { + false, + |locations, _fee| { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverBridgeHubWestendInstance, - >(locations, fee, LegacyLaneId([0, 0, 0, 1])) + >(locations, LegacyLaneId([0, 0, 0, 1])) }, ) .1 @@ -422,11 +424,12 @@ mod bridge_hub_westend_tests { >( SiblingParachainLocation::get(), BridgedUniversalLocation::get(), - |locations, fee| { + false, + |locations, _fee| { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverBridgeHubWestendInstance, - >(locations, fee, LegacyLaneId([0, 0, 0, 1])) + >(locations, LegacyLaneId([0, 0, 0, 1])) }, ) .1 @@ -591,11 +594,12 @@ mod bridge_hub_bulletin_tests { >( SiblingPeopleParachainLocation::get(), BridgedBulletinLocation::get(), - |locations, fee| { + false, + |locations, _fee| { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverPolkadotBulletinInstance - >(locations, fee, HashedLaneId::try_new(1, 2).unwrap()) + >(locations, HashedLaneId::try_new(1, 2).unwrap()) } ).1 }, @@ -654,11 +658,12 @@ mod bridge_hub_bulletin_tests { >( SiblingPeopleParachainLocation::get(), BridgedBulletinLocation::get(), - |locations, fee| { + false, + |locations, _fee| { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverPolkadotBulletinInstance, - >(locations, fee, HashedLaneId::try_new(1, 2).unwrap()) + >(locations, HashedLaneId::try_new(1, 2).unwrap()) }, ) .1 @@ -687,11 +692,12 @@ mod bridge_hub_bulletin_tests { >( SiblingPeopleParachainLocation::get(), BridgedBulletinLocation::get(), - |locations, fee| { + false, + |locations, _fee| { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverPolkadotBulletinInstance, - >(locations, fee, HashedLaneId::try_new(1, 2).unwrap()) + >(locations, HashedLaneId::try_new(1, 2).unwrap()) }, ) .1 diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/bridge_to_rococo_config.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/bridge_to_rococo_config.rs index 62c93da7c831..cd3465513144 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/bridge_to_rococo_config.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/bridge_to_rococo_config.rs @@ -152,6 +152,7 @@ impl pallet_bridge_messages::Config for Run type DeliveryConfirmationPayments = pallet_bridge_relayers::DeliveryConfirmationPaymentsAdapter< Runtime, WithBridgeHubRococoMessagesInstance, + RelayersForLegacyLaneIdsMessagesInstance, DeliveryRewardInBalance, >; @@ -284,7 +285,6 @@ mod tests { fn ensure_bridge_integrity() { assert_complete_bridge_types!( runtime: Runtime, - with_bridged_chain_grandpa_instance: BridgeGrandpaRococoInstance, with_bridged_chain_messages_instance: WithBridgeHubRococoMessagesInstance, this_chain: bp_bridge_hub_westend::BridgeHubWestend, bridged_chain: bp_bridge_hub_rococo::BridgeHubRococo, @@ -294,7 +294,6 @@ mod tests { Runtime, BridgeGrandpaRococoInstance, WithBridgeHubRococoMessagesInstance, - bp_rococo::Rococo, >(AssertCompleteBridgeConstants { this_chain_constants: AssertChainConstants { block_length: bp_bridge_hub_westend::BlockLength::get(), diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/tests/tests.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/tests/tests.rs index 69301b34fe6b..84025c4cefeb 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/tests/tests.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/tests/tests.rs @@ -246,10 +246,11 @@ fn handle_export_message_from_system_parachain_add_to_outbound_queue_works() { >( SiblingParachainLocation::get(), BridgedUniversalLocation::get(), - |locations, fee| { + false, + |locations, _fee| { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverBridgeHubRococoInstance - >(locations, fee, LegacyLaneId([0, 0, 0, 1])) + >(locations, LegacyLaneId([0, 0, 0, 1])) } ).1 }, @@ -307,11 +308,12 @@ fn relayed_incoming_message_works() { >( SiblingParachainLocation::get(), BridgedUniversalLocation::get(), - |locations, fee| { + false, + |locations, _fee| { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverBridgeHubRococoInstance, - >(locations, fee, LegacyLaneId([0, 0, 0, 1])) + >(locations, LegacyLaneId([0, 0, 0, 1])) }, ) .1 @@ -341,11 +343,12 @@ fn free_relay_extrinsic_works() { >( SiblingParachainLocation::get(), BridgedUniversalLocation::get(), - |locations, fee| { + false, + |locations, _fee| { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverBridgeHubRococoInstance, - >(locations, fee, LegacyLaneId([0, 0, 0, 1])) + >(locations, LegacyLaneId([0, 0, 0, 1])) }, ) .1 diff --git a/cumulus/parachains/runtimes/bridge-hubs/test-utils/src/test_cases/helpers.rs b/cumulus/parachains/runtimes/bridge-hubs/test-utils/src/test_cases/helpers.rs index aac60bba0b53..03ddc4313b45 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/test-utils/src/test_cases/helpers.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/test-utils/src/test_cases/helpers.rs @@ -29,7 +29,7 @@ use core::marker::PhantomData; use frame_support::{ assert_ok, dispatch::GetDispatchInfo, - traits::{fungible::Mutate, OnFinalize, OnInitialize, PalletInfoAccess}, + traits::{fungible::Mutate, Contains, OnFinalize, OnInitialize, PalletInfoAccess}, }; use frame_system::pallet_prelude::BlockNumberFor; use pallet_bridge_grandpa::{BridgedBlockHash, BridgedHeader}; @@ -395,7 +395,7 @@ pub fn ensure_opened_bridge< XcmOverBridgePalletInstance, LocationToAccountId, TokenLocation> -(source: Location, destination: InteriorLocation, bridge_opener: impl Fn(BridgeLocations, Asset)) -> (BridgeLocations, pallet_xcm_bridge_hub::LaneIdOf) +(source: Location, destination: InteriorLocation, is_paid_xcm_execution: bool, bridge_opener: impl Fn(BridgeLocations, Option)) -> (BridgeLocations, pallet_xcm_bridge_hub::LaneIdOf) where Runtime: BasicParachainRuntime + BridgeXcmOverBridgeConfig, XcmOverBridgePalletInstance: 'static, @@ -416,24 +416,37 @@ TokenLocation: Get{ ) .is_none()); - // required balance: ED + fee + BridgeDeposit - let bridge_deposit = - >::BridgeDeposit::get( - ); - // random high enough value for `BuyExecution` fees - let buy_execution_fee_amount = 5_000_000_000_000_u128; - let buy_execution_fee = (TokenLocation::get(), buy_execution_fee_amount).into(); - let balance_needed = ::ExistentialDeposit::get() + - buy_execution_fee_amount.into() + - bridge_deposit.into(); - // SA of source location needs to have some required balance - let source_account_id = LocationToAccountId::convert_location(&source).expect("valid location"); - let _ = >::mint_into(&source_account_id, balance_needed) - .expect("mint_into passes"); + if !>::AllowWithoutBridgeDeposit::contains(&source) { + // required balance: ED + fee + BridgeDeposit + let bridge_deposit = + >::BridgeDeposit::get( + ); + let balance_needed = ::ExistentialDeposit::get() + bridge_deposit.into(); + + let source_account_id = LocationToAccountId::convert_location(&source).expect("valid location"); + let _ = >::mint_into(&source_account_id, balance_needed) + .expect("mint_into passes"); + }; + + let maybe_paid_execution = if is_paid_xcm_execution { + // random high enough value for `BuyExecution` fees + let buy_execution_fee_amount = 5_000_000_000_000_u128; + let buy_execution_fee = (TokenLocation::get(), buy_execution_fee_amount).into(); + + let balance_needed = ::ExistentialDeposit::get() + + buy_execution_fee_amount.into(); + let source_account_id = + LocationToAccountId::convert_location(&source).expect("valid location"); + let _ = >::mint_into(&source_account_id, balance_needed) + .expect("mint_into passes"); + Some(buy_execution_fee) + } else { + None + }; // call the bridge opener - bridge_opener(*locations.clone(), buy_execution_fee); + bridge_opener(*locations.clone(), maybe_paid_execution); // check opened bridge let bridge = pallet_xcm_bridge_hub::Bridges::::get( @@ -452,8 +465,9 @@ TokenLocation: Get{ /// Utility for opening bridge with dedicated `pallet_xcm_bridge_hub`'s extrinsic. pub fn open_bridge_with_extrinsic( - locations: BridgeLocations, - buy_execution_fee: Asset, + (origin, origin_kind): (Location, OriginKind), + bridge_destination_universal_location: InteriorLocation, + maybe_paid_execution: Option, ) where Runtime: frame_system::Config + pallet_xcm_bridge_hub::Config @@ -469,15 +483,15 @@ pub fn open_bridge_with_extrinsic( XcmOverBridgePalletInstance, >::open_bridge { bridge_destination_universal_location: Box::new( - locations.bridge_destination_universal_location().clone().into(), + bridge_destination_universal_location.clone().into(), ), }); // execute XCM as source origin would do with `Transact -> Origin::Xcm` - assert_ok!(RuntimeHelper::::execute_as_origin_xcm( - locations.bridge_origin_relative_location().clone(), + assert_ok!(RuntimeHelper::::execute_as_origin( + (origin, origin_kind), open_bridge_call, - buy_execution_fee + maybe_paid_execution ) .ensure_complete()); } @@ -486,7 +500,6 @@ pub fn open_bridge_with_extrinsic( /// purposes). pub fn open_bridge_with_storage( locations: BridgeLocations, - _buy_execution_fee: Asset, lane_id: pallet_xcm_bridge_hub::LaneIdOf, ) where Runtime: pallet_xcm_bridge_hub::Config, @@ -503,8 +516,12 @@ pub fn open_bridge_with_storage( } /// Helper function to close the bridge/lane for `source` and `destination`. -pub fn close_bridge(source: Location, destination: InteriorLocation) -where +pub fn close_bridge( + expected_source: Location, + bridge_destination_universal_location: InteriorLocation, + (origin, origin_kind): (Location, OriginKind), + is_paid_xcm_execution: bool +) where Runtime: BasicParachainRuntime + BridgeXcmOverBridgeConfig, XcmOverBridgePalletInstance: 'static, ::RuntimeCall: GetDispatchInfo + From>, @@ -515,8 +532,8 @@ TokenLocation: Get{ // construct expected bridge configuration let locations = pallet_xcm_bridge_hub::Pallet::::bridge_locations( - source.clone().into(), - destination.clone().into(), + expected_source.clone().into(), + bridge_destination_universal_location.clone().into(), ) .expect("valid bridge locations"); assert!(pallet_xcm_bridge_hub::Bridges::::get( @@ -525,35 +542,38 @@ TokenLocation: Get{ .is_some()); // required balance: ED + fee + BridgeDeposit - let bridge_deposit = - >::BridgeDeposit::get( - ); - // random high enough value for `BuyExecution` fees - let buy_execution_fee_amount = 2_500_000_000_000_u128; - let buy_execution_fee = (TokenLocation::get(), buy_execution_fee_amount).into(); - let balance_needed = ::ExistentialDeposit::get() + - buy_execution_fee_amount.into() + - bridge_deposit.into(); - - // SA of source location needs to have some required balance - let source_account_id = LocationToAccountId::convert_location(&source).expect("valid location"); - let _ = >::mint_into(&source_account_id, balance_needed) - .expect("mint_into passes"); + let maybe_paid_execution = if is_paid_xcm_execution { + // random high enough value for `BuyExecution` fees + let buy_execution_fee_amount = 2_500_000_000_000_u128; + let buy_execution_fee = (TokenLocation::get(), buy_execution_fee_amount).into(); + + let balance_needed = ::ExistentialDeposit::get() + + buy_execution_fee_amount.into(); + let source_account_id = + LocationToAccountId::convert_location(&expected_source).expect("valid location"); + let _ = >::mint_into(&source_account_id, balance_needed) + .expect("mint_into passes"); + Some(buy_execution_fee) + } else { + None + }; // close bridge with `Transact` call let close_bridge_call = RuntimeCallOf::::from(BridgeXcmOverBridgeCall::< Runtime, XcmOverBridgePalletInstance, >::close_bridge { - bridge_destination_universal_location: Box::new(destination.into()), + bridge_destination_universal_location: Box::new( + bridge_destination_universal_location.into(), + ), may_prune_messages: 16, }); // execute XCM as source origin would do with `Transact -> Origin::Xcm` - assert_ok!(RuntimeHelper::::execute_as_origin_xcm( - source.clone(), + assert_ok!(RuntimeHelper::::execute_as_origin( + (origin, origin_kind), close_bridge_call, - buy_execution_fee + maybe_paid_execution ) .ensure_complete()); diff --git a/cumulus/parachains/runtimes/bridge-hubs/test-utils/src/test_cases/mod.rs b/cumulus/parachains/runtimes/bridge-hubs/test-utils/src/test_cases/mod.rs index ad6db0b83e80..f96d0bf405b9 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/test-utils/src/test_cases/mod.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/test-utils/src/test_cases/mod.rs @@ -654,8 +654,10 @@ where pub fn open_and_close_bridge_works( collator_session_key: CollatorSessionKeys, runtime_para_id: u32, - source: Location, + expected_source: Location, destination: InteriorLocation, + origin_with_origin_kind: (Location, OriginKind), + is_paid_xcm_execution: bool, ) where Runtime: BasicParachainRuntime + BridgeXcmOverBridgeConfig, XcmOverBridgePalletInstance: 'static, @@ -669,7 +671,7 @@ pub fn open_and_close_bridge_works(collator_session_key, runtime_para_id, vec![], || { // construct expected bridge configuration let locations = pallet_xcm_bridge_hub::Pallet::::bridge_locations( - source.clone().into(), + expected_source.clone().into(), destination.clone().into(), ).expect("valid bridge locations"); let expected_lane_id = @@ -704,7 +706,7 @@ pub fn open_and_close_bridge_works( - source.clone(), + expected_source.clone(), destination.clone(), - open_bridge_with_extrinsic:: + is_paid_xcm_execution, + |locations, maybe_paid_execution| open_bridge_with_extrinsic::< + Runtime, + XcmOverBridgePalletInstance, + >( + origin_with_origin_kind.clone(), + locations.bridge_destination_universal_location().clone(), + maybe_paid_execution + ) ) .0 .bridge_id(), @@ -727,7 +737,7 @@ pub fn open_and_close_bridge_works(source.clone(), destination); + >(expected_source, destination, origin_with_origin_kind, is_paid_xcm_execution); // check bridge/lane DOES not exist assert_eq!( diff --git a/cumulus/parachains/runtimes/test-utils/src/lib.rs b/cumulus/parachains/runtimes/test-utils/src/lib.rs index 05ecf6ca8e81..3f2e721d13f6 100644 --- a/cumulus/parachains/runtimes/test-utils/src/lib.rs +++ b/cumulus/parachains/runtimes/test-utils/src/lib.rs @@ -460,18 +460,26 @@ impl< ) } - pub fn execute_as_origin_xcm( - origin: Location, + pub fn execute_as_origin( + (origin, origin_kind): (Location, OriginKind), call: Call, - buy_execution_fee: Asset, + maybe_buy_execution_fee: Option, ) -> Outcome { + let mut instructions = if let Some(buy_execution_fee) = maybe_buy_execution_fee { + vec![ + WithdrawAsset(buy_execution_fee.clone().into()), + BuyExecution { fees: buy_execution_fee.clone(), weight_limit: Unlimited }, + ] + } else { + vec![UnpaidExecution { check_origin: None, weight_limit: Unlimited }] + }; + // prepare `Transact` xcm - let xcm = Xcm(vec![ - WithdrawAsset(buy_execution_fee.clone().into()), - BuyExecution { fees: buy_execution_fee.clone(), weight_limit: Unlimited }, - Transact { origin_kind: OriginKind::Xcm, call: call.encode().into() }, + instructions.extend(vec![ + Transact { origin_kind, call: call.encode().into() }, ExpectTransactStatus(MaybeErrorCode::Success), ]); + let xcm = Xcm(instructions); // execute xcm as parent origin let mut hash = xcm.using_encoded(sp_io::hashing::blake2_256); diff --git a/prdoc/pr_6536.prdoc b/prdoc/pr_6536.prdoc new file mode 100644 index 000000000000..676b5c131f17 --- /dev/null +++ b/prdoc/pr_6536.prdoc @@ -0,0 +1,24 @@ +title: Bridges testing improvements +doc: +- audience: Runtime Dev + description: |- + This PR includes: + - Refactored integrity tests to support standalone deployment of `pallet-bridge-messages`. + - Refactored the `open_and_close_bridge_works` test case to support multiple scenarios, such as: + 1. A local chain opening a bridge. + 2. Sibling parachains opening a bridge. + 3. The relay chain opening a bridge. + - Previously, we added instance support for `pallet-bridge-relayer` but overlooked updating the `DeliveryConfirmationPaymentsAdapter`. +crates: +- name: bridge-runtime-common + bump: patch +- name: pallet-bridge-relayers + bump: patch +- name: bridge-hub-rococo-runtime + bump: patch +- name: bridge-hub-westend-runtime + bump: patch +- name: bridge-hub-test-utils + bump: major +- name: parachains-runtimes-test-utils + bump: major From 70b6c7b08a0bc27c6155bca66461af97b829d208 Mon Sep 17 00:00:00 2001 From: Xavier Lau Date: Thu, 21 Nov 2024 00:04:46 +0800 Subject: [PATCH 08/64] Migrate pallet-scheduler benchmark to v2 (#6292) Part of: - #6202. --------- Signed-off-by: Xavier Lau Co-authored-by: Giuseppe Re Co-authored-by: Guillaume Thiolliere --- substrate/frame/scheduler/src/benchmarking.rs | 306 ++++++++++++------ 1 file changed, 202 insertions(+), 104 deletions(-) diff --git a/substrate/frame/scheduler/src/benchmarking.rs b/substrate/frame/scheduler/src/benchmarking.rs index d0a14fc73d64..ff40e8ef8abf 100644 --- a/substrate/frame/scheduler/src/benchmarking.rs +++ b/substrate/frame/scheduler/src/benchmarking.rs @@ -17,25 +17,23 @@ //! Scheduler pallet benchmarking. -use super::*; use alloc::vec; -use frame_benchmarking::v1::{account, benchmarks, BenchmarkError}; +use frame_benchmarking::v2::*; use frame_support::{ ensure, traits::{schedule::Priority, BoundedInline}, weights::WeightMeter, }; -use frame_system::{pallet_prelude::BlockNumberFor, RawOrigin}; +use frame_system::{EventRecord, RawOrigin}; -use crate::Pallet as Scheduler; -use frame_system::{Call as SystemCall, EventRecord}; +use crate::*; -const SEED: u32 = 0; +type SystemCall = frame_system::Call; +type SystemOrigin = ::RuntimeOrigin; +const SEED: u32 = 0; const BLOCK_NUMBER: u32 = 2; -type SystemOrigin = ::RuntimeOrigin; - fn assert_last_event(generic_event: ::RuntimeEvent) { let events = frame_system::Pallet::::events(); let system_event: ::RuntimeEvent = generic_event.into(); @@ -61,7 +59,7 @@ fn fill_schedule( let call = make_call::(None); let period = Some(((i + 100).into(), 100)); let name = u32_to_name(i); - Scheduler::::do_schedule_named(name, t, period, 0, origin.clone(), call)?; + Pallet::::do_schedule_named(name, t, period, 0, origin.clone(), call)?; } ensure!(Agenda::::get(when).len() == n as usize, "didn't fill schedule"); Ok(()) @@ -134,107 +132,160 @@ fn make_origin(signed: bool) -> ::PalletsOrigin { } } -benchmarks! { +#[benchmarks] +mod benchmarks { + use super::*; + // `service_agendas` when no work is done. - service_agendas_base { - let now = BlockNumberFor::::from(BLOCK_NUMBER); + #[benchmark] + fn service_agendas_base() { + let now = BLOCK_NUMBER.into(); IncompleteSince::::put(now - One::one()); - }: { - Scheduler::::service_agendas(&mut WeightMeter::new(), now, 0); - } verify { + + #[block] + { + Pallet::::service_agendas(&mut WeightMeter::new(), now, 0); + } + assert_eq!(IncompleteSince::::get(), Some(now - One::one())); } // `service_agenda` when no work is done. - service_agenda_base { + #[benchmark] + fn service_agenda_base( + s: Linear<0, { T::MaxScheduledPerBlock::get() }>, + ) -> Result<(), BenchmarkError> { let now = BLOCK_NUMBER.into(); - let s in 0 .. T::MaxScheduledPerBlock::get(); fill_schedule::(now, s)?; let mut executed = 0; - }: { - Scheduler::::service_agenda(&mut WeightMeter::new(), &mut executed, now, now, 0); - } verify { + + #[block] + { + Pallet::::service_agenda(&mut WeightMeter::new(), &mut executed, now, now, 0); + } + assert_eq!(executed, 0); + + Ok(()) } // `service_task` when the task is a non-periodic, non-named, non-fetched call which is not // dispatched (e.g. due to being overweight). - service_task_base { + #[benchmark] + fn service_task_base() { let now = BLOCK_NUMBER.into(); let task = make_task::(false, false, false, None, 0); // prevent any tasks from actually being executed as we only want the surrounding weight. let mut counter = WeightMeter::with_limit(Weight::zero()); - }: { - let result = Scheduler::::service_task(&mut counter, now, now, 0, true, task); - } verify { - //assert_eq!(result, Ok(())); + let _result; + + #[block] + { + _result = Pallet::::service_task(&mut counter, now, now, 0, true, task); + } + + // assert!(_result.is_ok()); } // `service_task` when the task is a non-periodic, non-named, fetched call (with a known // preimage length) and which is not dispatched (e.g. due to being overweight). - #[pov_mode = MaxEncodedLen { + #[benchmark(pov_mode = MaxEncodedLen { // Use measured PoV size for the Preimages since we pass in a length witness. Preimage::PreimageFor: Measured - }] - service_task_fetched { - let s in (BoundedInline::bound() as u32) .. (T::Preimages::MAX_LENGTH as u32); + })] + fn service_task_fetched( + s: Linear<{ BoundedInline::bound() as u32 }, { T::Preimages::MAX_LENGTH as u32 }>, + ) { let now = BLOCK_NUMBER.into(); let task = make_task::(false, false, false, Some(s), 0); // prevent any tasks from actually being executed as we only want the surrounding weight. let mut counter = WeightMeter::with_limit(Weight::zero()); - }: { - let result = Scheduler::::service_task(&mut counter, now, now, 0, true, task); - } verify { + let _result; + + #[block] + { + _result = Pallet::::service_task(&mut counter, now, now, 0, true, task); + } + + // assert!(result.is_ok()); } // `service_task` when the task is a non-periodic, named, non-fetched call which is not // dispatched (e.g. due to being overweight). - service_task_named { + #[benchmark] + fn service_task_named() { let now = BLOCK_NUMBER.into(); let task = make_task::(false, true, false, None, 0); // prevent any tasks from actually being executed as we only want the surrounding weight. let mut counter = WeightMeter::with_limit(Weight::zero()); - }: { - let result = Scheduler::::service_task(&mut counter, now, now, 0, true, task); - } verify { + let _result; + + #[block] + { + _result = Pallet::::service_task(&mut counter, now, now, 0, true, task); + } + + // assert!(result.is_ok()); } // `service_task` when the task is a periodic, non-named, non-fetched call which is not // dispatched (e.g. due to being overweight). - service_task_periodic { + #[benchmark] + fn service_task_periodic() { let now = BLOCK_NUMBER.into(); let task = make_task::(true, false, false, None, 0); // prevent any tasks from actually being executed as we only want the surrounding weight. let mut counter = WeightMeter::with_limit(Weight::zero()); - }: { - let result = Scheduler::::service_task(&mut counter, now, now, 0, true, task); - } verify { + let _result; + + #[block] + { + _result = Pallet::::service_task(&mut counter, now, now, 0, true, task); + } + + // assert!(result.is_ok()); } // `execute_dispatch` when the origin is `Signed`, not counting the dispatchable's weight. - execute_dispatch_signed { + #[benchmark] + fn execute_dispatch_signed() -> Result<(), BenchmarkError> { let mut counter = WeightMeter::new(); let origin = make_origin::(true); - let call = T::Preimages::realize(&make_call::(None)).unwrap().0; - }: { - assert!(Scheduler::::execute_dispatch(&mut counter, origin, call).is_ok()); - } - verify { + let call = T::Preimages::realize(&make_call::(None))?.0; + let result; + + #[block] + { + result = Pallet::::execute_dispatch(&mut counter, origin, call); + } + + assert!(result.is_ok()); + + Ok(()) } // `execute_dispatch` when the origin is not `Signed`, not counting the dispatchable's weight. - execute_dispatch_unsigned { + #[benchmark] + fn execute_dispatch_unsigned() -> Result<(), BenchmarkError> { let mut counter = WeightMeter::new(); let origin = make_origin::(false); - let call = T::Preimages::realize(&make_call::(None)).unwrap().0; - }: { - assert!(Scheduler::::execute_dispatch(&mut counter, origin, call).is_ok()); - } - verify { + let call = T::Preimages::realize(&make_call::(None))?.0; + let result; + + #[block] + { + result = Pallet::::execute_dispatch(&mut counter, origin, call); + } + + assert!(result.is_ok()); + + Ok(()) } - schedule { - let s in 0 .. (T::MaxScheduledPerBlock::get() - 1); + #[benchmark] + fn schedule( + s: Linear<0, { T::MaxScheduledPerBlock::get() - 1 }>, + ) -> Result<(), BenchmarkError> { let when = BLOCK_NUMBER.into(); let periodic = Some((BlockNumberFor::::one(), 100)); let priority = 0; @@ -242,24 +293,27 @@ benchmarks! { let call = Box::new(SystemCall::set_storage { items: vec![] }.into()); fill_schedule::(when, s)?; - }: _(RawOrigin::Root, when, periodic, priority, call) - verify { - ensure!( - Agenda::::get(when).len() == (s + 1) as usize, - "didn't add to schedule" - ); + + #[extrinsic_call] + _(RawOrigin::Root, when, periodic, priority, call); + + ensure!(Agenda::::get(when).len() == s as usize + 1, "didn't add to schedule"); + + Ok(()) } - cancel { - let s in 1 .. T::MaxScheduledPerBlock::get(); + #[benchmark] + fn cancel(s: Linear<1, { T::MaxScheduledPerBlock::get() }>) -> Result<(), BenchmarkError> { let when = BLOCK_NUMBER.into(); fill_schedule::(when, s)?; assert_eq!(Agenda::::get(when).len(), s as usize); let schedule_origin = T::ScheduleOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?; - }: _>(schedule_origin, when, 0) - verify { + + #[extrinsic_call] + _(schedule_origin as SystemOrigin, when, 0); + ensure!( s == 1 || Lookup::::get(u32_to_name(0)).is_none(), "didn't remove from lookup if more than 1 task scheduled for `when`" @@ -273,10 +327,14 @@ benchmarks! { s > 1 || Agenda::::get(when).len() == 0, "remove from schedule if only 1 task scheduled for `when`" ); + + Ok(()) } - schedule_named { - let s in 0 .. (T::MaxScheduledPerBlock::get() - 1); + #[benchmark] + fn schedule_named( + s: Linear<0, { T::MaxScheduledPerBlock::get() - 1 }>, + ) -> Result<(), BenchmarkError> { let id = u32_to_name(s); let when = BLOCK_NUMBER.into(); let periodic = Some((BlockNumberFor::::one(), 100)); @@ -285,21 +343,26 @@ benchmarks! { let call = Box::new(SystemCall::set_storage { items: vec![] }.into()); fill_schedule::(when, s)?; - }: _(RawOrigin::Root, id, when, periodic, priority, call) - verify { - ensure!( - Agenda::::get(when).len() == (s + 1) as usize, - "didn't add to schedule" - ); + + #[extrinsic_call] + _(RawOrigin::Root, id, when, periodic, priority, call); + + ensure!(Agenda::::get(when).len() == s as usize + 1, "didn't add to schedule"); + + Ok(()) } - cancel_named { - let s in 1 .. T::MaxScheduledPerBlock::get(); + #[benchmark] + fn cancel_named( + s: Linear<1, { T::MaxScheduledPerBlock::get() }>, + ) -> Result<(), BenchmarkError> { let when = BLOCK_NUMBER.into(); fill_schedule::(when, s)?; - }: _(RawOrigin::Root, u32_to_name(0)) - verify { + + #[extrinsic_call] + _(RawOrigin::Root, u32_to_name(0)); + ensure!( s == 1 || Lookup::::get(u32_to_name(0)).is_none(), "didn't remove from lookup if more than 1 task scheduled for `when`" @@ -313,33 +376,49 @@ benchmarks! { s > 1 || Agenda::::get(when).len() == 0, "remove from schedule if only 1 task scheduled for `when`" ); + + Ok(()) } - schedule_retry { - let s in 1 .. T::MaxScheduledPerBlock::get(); + #[benchmark] + fn schedule_retry( + s: Linear<1, { T::MaxScheduledPerBlock::get() }>, + ) -> Result<(), BenchmarkError> { let when = BLOCK_NUMBER.into(); fill_schedule::(when, s)?; let name = u32_to_name(s - 1); let address = Lookup::::get(name).unwrap(); - let period: BlockNumberFor = 1u32.into(); - let root: ::PalletsOrigin = frame_system::RawOrigin::Root.into(); + let period: BlockNumberFor = 1_u32.into(); let retry_config = RetryConfig { total_retries: 10, remaining: 10, period }; Retries::::insert(address, retry_config); let (mut when, index) = address; let task = Agenda::::get(when)[index as usize].clone().unwrap(); let mut weight_counter = WeightMeter::with_limit(T::MaximumWeight::get()); - }: { - Scheduler::::schedule_retry(&mut weight_counter, when, when, index, &task, retry_config); - } verify { + + #[block] + { + Pallet::::schedule_retry( + &mut weight_counter, + when, + when, + index, + &task, + retry_config, + ); + } + when = when + BlockNumberFor::::one(); assert_eq!( Retries::::get((when, 0)), Some(RetryConfig { total_retries: 10, remaining: 9, period }) ); + + Ok(()) } - set_retry { + #[benchmark] + fn set_retry() -> Result<(), BenchmarkError> { let s = T::MaxScheduledPerBlock::get(); let when = BLOCK_NUMBER.into(); @@ -348,8 +427,10 @@ benchmarks! { let address = Lookup::::get(name).unwrap(); let (when, index) = address; let period = BlockNumberFor::::one(); - }: _(RawOrigin::Root, (when, index), 10, period) - verify { + + #[extrinsic_call] + _(RawOrigin::Root, (when, index), 10, period); + assert_eq!( Retries::::get((when, index)), Some(RetryConfig { total_retries: 10, remaining: 10, period }) @@ -357,9 +438,12 @@ benchmarks! { assert_last_event::( Event::RetrySet { task: address, id: None, period, retries: 10 }.into(), ); + + Ok(()) } - set_retry_named { + #[benchmark] + fn set_retry_named() -> Result<(), BenchmarkError> { let s = T::MaxScheduledPerBlock::get(); let when = BLOCK_NUMBER.into(); @@ -368,8 +452,10 @@ benchmarks! { let address = Lookup::::get(name).unwrap(); let (when, index) = address; let period = BlockNumberFor::::one(); - }: _(RawOrigin::Root, name, 10, period) - verify { + + #[extrinsic_call] + _(RawOrigin::Root, name, 10, period); + assert_eq!( Retries::::get((when, index)), Some(RetryConfig { total_retries: 10, remaining: 10, period }) @@ -377,9 +463,12 @@ benchmarks! { assert_last_event::( Event::RetrySet { task: address, id: Some(name), period, retries: 10 }.into(), ); + + Ok(()) } - cancel_retry { + #[benchmark] + fn cancel_retry() -> Result<(), BenchmarkError> { let s = T::MaxScheduledPerBlock::get(); let when = BLOCK_NUMBER.into(); @@ -388,16 +477,19 @@ benchmarks! { let address = Lookup::::get(name).unwrap(); let (when, index) = address; let period = BlockNumberFor::::one(); - assert!(Scheduler::::set_retry(RawOrigin::Root.into(), (when, index), 10, period).is_ok()); - }: _(RawOrigin::Root, (when, index)) - verify { + assert!(Pallet::::set_retry(RawOrigin::Root.into(), (when, index), 10, period).is_ok()); + + #[extrinsic_call] + _(RawOrigin::Root, (when, index)); + assert!(!Retries::::contains_key((when, index))); - assert_last_event::( - Event::RetryCancelled { task: address, id: None }.into(), - ); + assert_last_event::(Event::RetryCancelled { task: address, id: None }.into()); + + Ok(()) } - cancel_retry_named { + #[benchmark] + fn cancel_retry_named() -> Result<(), BenchmarkError> { let s = T::MaxScheduledPerBlock::get(); let when = BLOCK_NUMBER.into(); @@ -406,14 +498,20 @@ benchmarks! { let address = Lookup::::get(name).unwrap(); let (when, index) = address; let period = BlockNumberFor::::one(); - assert!(Scheduler::::set_retry_named(RawOrigin::Root.into(), name, 10, period).is_ok()); - }: _(RawOrigin::Root, name) - verify { + assert!(Pallet::::set_retry_named(RawOrigin::Root.into(), name, 10, period).is_ok()); + + #[extrinsic_call] + _(RawOrigin::Root, name); + assert!(!Retries::::contains_key((when, index))); - assert_last_event::( - Event::RetryCancelled { task: address, id: Some(name) }.into(), - ); + assert_last_event::(Event::RetryCancelled { task: address, id: Some(name) }.into()); + + Ok(()) } - impl_benchmark_test_suite!(Scheduler, crate::mock::new_test_ext(), crate::mock::Test); + impl_benchmark_test_suite! { + Pallet, + mock::new_test_ext(), + mock::Test + } } From a8722784fb36e13c811605bd5631d78643273e24 Mon Sep 17 00:00:00 2001 From: gupnik Date: Thu, 21 Nov 2024 09:53:55 +0530 Subject: [PATCH 09/64] Removes constraint in `BlockNumberProvider` from treasury (#6522) https://github.com/paritytech/polkadot-sdk/pull/3970 updated the treasury pallet to support relay chain block number provider. However, it added a constraint to the BlockNumberProvider to have the same block number type as frame_system: ```rust type BlockNumberProvider: BlockNumberProvider>; ``` This PR removes that constraint as suggested by @gui1117 --- prdoc/pr_6522.prdoc | 18 +++++++++ substrate/frame/bounties/src/benchmarking.rs | 6 +-- substrate/frame/bounties/src/lib.rs | 19 +++++---- .../frame/child-bounties/src/benchmarking.rs | 2 +- substrate/frame/child-bounties/src/lib.rs | 8 +++- substrate/frame/treasury/src/benchmarking.rs | 2 +- substrate/frame/treasury/src/lib.rs | 40 ++++++++++--------- .../primitives/runtime/src/traits/mod.rs | 3 +- 8 files changed, 64 insertions(+), 34 deletions(-) create mode 100644 prdoc/pr_6522.prdoc diff --git a/prdoc/pr_6522.prdoc b/prdoc/pr_6522.prdoc new file mode 100644 index 000000000000..bd59e9cb08dc --- /dev/null +++ b/prdoc/pr_6522.prdoc @@ -0,0 +1,18 @@ +title: Removes constraint in BlockNumberProvider from treasury + +doc: +- audience: Runtime Dev + description: |- + https://github.com/paritytech/polkadot-sdk/pull/3970 updated the treasury pallet to support + relay chain block number provider. However, it added a constraint to the `BlockNumberProvider` + trait to have the same block number type as `frame_system`: + + ```rust + type BlockNumberProvider: BlockNumberProvider>; + ``` + + This PR removes that constraint and allows the treasury pallet to use any block number type. + +crates: +- name: pallet-treasury + bump: major \ No newline at end of file diff --git a/substrate/frame/bounties/src/benchmarking.rs b/substrate/frame/bounties/src/benchmarking.rs index 8ad85d5420ed..1e931958898d 100644 --- a/substrate/frame/bounties/src/benchmarking.rs +++ b/substrate/frame/bounties/src/benchmarking.rs @@ -25,7 +25,7 @@ use alloc::{vec, vec::Vec}; use frame_benchmarking::v1::{ account, benchmarks_instance_pallet, whitelisted_caller, BenchmarkError, }; -use frame_system::{pallet_prelude::BlockNumberFor, RawOrigin}; +use frame_system::{pallet_prelude::BlockNumberFor as SystemBlockNumberFor, RawOrigin}; use sp_runtime::traits::{BlockNumberProvider, Bounded}; use crate::Pallet as Bounties; @@ -33,7 +33,7 @@ use pallet_treasury::Pallet as Treasury; const SEED: u32 = 0; -fn set_block_number, I: 'static>(n: BlockNumberFor) { +fn set_block_number, I: 'static>(n: BlockNumberFor) { >::BlockNumberProvider::set_block_number(n); } @@ -132,7 +132,7 @@ benchmarks_instance_pallet! { Bounties::::propose_bounty(RawOrigin::Signed(caller).into(), value, reason)?; let bounty_id = BountyCount::::get() - 1; let approve_origin = T::SpendOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?; - Treasury::::on_initialize(BlockNumberFor::::zero()); + Treasury::::on_initialize(SystemBlockNumberFor::::zero()); }: _(approve_origin, bounty_id, curator_lookup, fee) verify { assert_last_event::( diff --git a/substrate/frame/bounties/src/lib.rs b/substrate/frame/bounties/src/lib.rs index 3ed408a19120..729c76b5cc75 100644 --- a/substrate/frame/bounties/src/lib.rs +++ b/substrate/frame/bounties/src/lib.rs @@ -105,7 +105,9 @@ use sp_runtime::{ use frame_support::{dispatch::DispatchResultWithPostInfo, traits::EnsureOrigin}; use frame_support::pallet_prelude::*; -use frame_system::pallet_prelude::*; +use frame_system::pallet_prelude::{ + ensure_signed, BlockNumberFor as SystemBlockNumberFor, OriginFor, +}; use scale_info::TypeInfo; pub use weights::WeightInfo; @@ -120,6 +122,9 @@ pub type BountyIndex = u32; type AccountIdLookupOf = <::Lookup as StaticLookup>::Source; +type BlockNumberFor = + <>::BlockNumberProvider as BlockNumberProvider>::BlockNumber; + /// A bounty proposal. #[derive(Encode, Decode, Clone, PartialEq, Eq, RuntimeDebug, TypeInfo, MaxEncodedLen)] pub struct Bounty { @@ -213,11 +218,11 @@ pub mod pallet { /// The delay period for which a bounty beneficiary need to wait before claim the payout. #[pallet::constant] - type BountyDepositPayoutDelay: Get>; + type BountyDepositPayoutDelay: Get>; /// Bounty duration in blocks. #[pallet::constant] - type BountyUpdatePeriod: Get>; + type BountyUpdatePeriod: Get>; /// The curator deposit is calculated as a percentage of the curator fee. /// @@ -326,7 +331,7 @@ pub mod pallet { _, Twox64Concat, BountyIndex, - Bounty, BlockNumberFor>, + Bounty, BlockNumberFor>, >; /// The description of each bounty. @@ -876,9 +881,9 @@ pub mod pallet { } #[pallet::hooks] - impl, I: 'static> Hooks> for Pallet { + impl, I: 'static> Hooks> for Pallet { #[cfg(feature = "try-runtime")] - fn try_state(_n: BlockNumberFor) -> Result<(), sp_runtime::TryRuntimeError> { + fn try_state(_n: SystemBlockNumberFor) -> Result<(), sp_runtime::TryRuntimeError> { Self::do_try_state() } } @@ -928,7 +933,7 @@ impl, I: 'static> Pallet { /// Get the block number used in the treasury pallet. /// /// It may be configured to use the relay chain block number on a parachain. - pub fn treasury_block_number() -> BlockNumberFor { + pub fn treasury_block_number() -> BlockNumberFor { >::BlockNumberProvider::current_block_number() } diff --git a/substrate/frame/child-bounties/src/benchmarking.rs b/substrate/frame/child-bounties/src/benchmarking.rs index 4b2d62cd920e..2864f3ab5048 100644 --- a/substrate/frame/child-bounties/src/benchmarking.rs +++ b/substrate/frame/child-bounties/src/benchmarking.rs @@ -22,7 +22,7 @@ use alloc::vec; use frame_benchmarking::{v2::*, BenchmarkError}; use frame_support::ensure; -use frame_system::{pallet_prelude::BlockNumberFor, RawOrigin}; +use frame_system::RawOrigin; use pallet_bounties::Pallet as Bounties; use pallet_treasury::Pallet as Treasury; use sp_runtime::traits::BlockNumberProvider; diff --git a/substrate/frame/child-bounties/src/lib.rs b/substrate/frame/child-bounties/src/lib.rs index ea1d9547d465..9fca26510989 100644 --- a/substrate/frame/child-bounties/src/lib.rs +++ b/substrate/frame/child-bounties/src/lib.rs @@ -79,7 +79,9 @@ use sp_runtime::{ }; use frame_support::pallet_prelude::*; -use frame_system::pallet_prelude::*; +use frame_system::pallet_prelude::{ + ensure_signed, BlockNumberFor as SystemBlockNumberFor, OriginFor, +}; use pallet_bounties::BountyStatus; use scale_info::TypeInfo; pub use weights::WeightInfo; @@ -90,6 +92,8 @@ type BalanceOf = pallet_treasury::BalanceOf; type BountiesError = pallet_bounties::Error; type BountyIndex = pallet_bounties::BountyIndex; type AccountIdLookupOf = <::Lookup as StaticLookup>::Source; +type BlockNumberFor = + <::BlockNumberProvider as BlockNumberProvider>::BlockNumber; /// A child bounty proposal. #[derive(Encode, Decode, Clone, PartialEq, Eq, RuntimeDebug, TypeInfo, MaxEncodedLen)] @@ -810,7 +814,7 @@ pub mod pallet { } #[pallet::hooks] - impl Hooks> for Pallet { + impl Hooks> for Pallet { fn integrity_test() { let parent_bounty_id: BountyIndex = 1; let child_bounty_id: BountyIndex = 2; diff --git a/substrate/frame/treasury/src/benchmarking.rs b/substrate/frame/treasury/src/benchmarking.rs index a03ee149db9b..a11723a27b2c 100644 --- a/substrate/frame/treasury/src/benchmarking.rs +++ b/substrate/frame/treasury/src/benchmarking.rs @@ -198,7 +198,7 @@ mod benchmarks { None, ); - let valid_from = frame_system::Pallet::::block_number(); + let valid_from = T::BlockNumberProvider::current_block_number(); let expire_at = valid_from.saturating_add(T::PayoutPeriod::get()); assert_last_event::( Event::AssetSpendApproved { diff --git a/substrate/frame/treasury/src/lib.rs b/substrate/frame/treasury/src/lib.rs index faacda1c0783..281012ffb4c9 100644 --- a/substrate/frame/treasury/src/lib.rs +++ b/substrate/frame/treasury/src/lib.rs @@ -106,7 +106,7 @@ use frame_support::{ weights::Weight, BoundedVec, PalletId, }; -use frame_system::pallet_prelude::BlockNumberFor; +use frame_system::pallet_prelude::BlockNumberFor as SystemBlockNumberFor; pub use pallet::*; pub use weights::WeightInfo; @@ -122,6 +122,8 @@ pub type NegativeImbalanceOf = <>::Currency as Currenc >>::NegativeImbalance; type AccountIdLookupOf = <::Lookup as StaticLookup>::Source; type BeneficiaryLookupOf = <>::BeneficiaryLookup as StaticLookup>::Source; +pub type BlockNumberFor = + <>::BlockNumberProvider as BlockNumberProvider>::BlockNumber; /// A trait to allow the Treasury Pallet to spend it's funds for other purposes. /// There is an expectation that the implementer of this trait will correctly manage @@ -202,7 +204,7 @@ pub mod pallet { pallet_prelude::*, traits::tokens::{ConversionFromAssetBalance, PaymentStatus}, }; - use frame_system::pallet_prelude::*; + use frame_system::pallet_prelude::{ensure_signed, OriginFor}; #[pallet::pallet] pub struct Pallet(PhantomData<(T, I)>); @@ -221,7 +223,7 @@ pub mod pallet { /// Period between successive spends. #[pallet::constant] - type SpendPeriod: Get>; + type SpendPeriod: Get>; /// Percentage of spare funds (if any) that are burnt per spend period. #[pallet::constant] @@ -277,14 +279,14 @@ pub mod pallet { /// The period during which an approved treasury spend has to be claimed. #[pallet::constant] - type PayoutPeriod: Get>; + type PayoutPeriod: Get>; /// Helper type for benchmarks. #[cfg(feature = "runtime-benchmarks")] type BenchmarkHelper: ArgumentsFactory; /// Provider for the block number. Normally this is the `frame_system` pallet. - type BlockNumberProvider: BlockNumberProvider>; + type BlockNumberProvider: BlockNumberProvider; } /// DEPRECATED: associated with `spend_local` call and will be removed in May 2025. @@ -335,7 +337,7 @@ pub mod pallet { T::AssetKind, AssetBalanceOf, T::Beneficiary, - BlockNumberFor, + BlockNumberFor, ::Id, >, OptionQuery, @@ -343,7 +345,7 @@ pub mod pallet { /// The blocknumber for the last triggered spend period. #[pallet::storage] - pub(crate) type LastSpendPeriod = StorageValue<_, BlockNumberFor, OptionQuery>; + pub(crate) type LastSpendPeriod = StorageValue<_, BlockNumberFor, OptionQuery>; #[pallet::genesis_config] #[derive(frame_support::DefaultNoBound)] @@ -391,8 +393,8 @@ pub mod pallet { asset_kind: T::AssetKind, amount: AssetBalanceOf, beneficiary: T::Beneficiary, - valid_from: BlockNumberFor, - expire_at: BlockNumberFor, + valid_from: BlockNumberFor, + expire_at: BlockNumberFor, }, /// An approved spend was voided. AssetSpendVoided { index: SpendIndex }, @@ -434,10 +436,10 @@ pub mod pallet { } #[pallet::hooks] - impl, I: 'static> Hooks> for Pallet { + impl, I: 'static> Hooks> for Pallet { /// ## Complexity /// - `O(A)` where `A` is the number of approvals - fn on_initialize(_do_not_use_local_block_number: BlockNumberFor) -> Weight { + fn on_initialize(_do_not_use_local_block_number: SystemBlockNumberFor) -> Weight { let block_number = T::BlockNumberProvider::current_block_number(); let pot = Self::pot(); let deactivated = Deactivated::::get(); @@ -458,7 +460,7 @@ pub mod pallet { // empty. .unwrap_or_else(|| Self::update_last_spend_period()); let blocks_since_last_spend_period = block_number.saturating_sub(last_spend_period); - let safe_spend_period = T::SpendPeriod::get().max(BlockNumberFor::::one()); + let safe_spend_period = T::SpendPeriod::get().max(BlockNumberFor::::one()); // Safe because of `max(1)` above. let (spend_periods_passed, extra_blocks) = ( @@ -466,7 +468,7 @@ pub mod pallet { blocks_since_last_spend_period % safe_spend_period, ); let new_last_spend_period = block_number.saturating_sub(extra_blocks); - if spend_periods_passed > BlockNumberFor::::zero() { + if spend_periods_passed > BlockNumberFor::::zero() { Self::spend_funds(spend_periods_passed, new_last_spend_period) } else { Weight::zero() @@ -474,7 +476,7 @@ pub mod pallet { } #[cfg(feature = "try-runtime")] - fn try_state(_: BlockNumberFor) -> Result<(), sp_runtime::TryRuntimeError> { + fn try_state(_: SystemBlockNumberFor) -> Result<(), sp_runtime::TryRuntimeError> { Self::do_try_state()?; Ok(()) } @@ -638,7 +640,7 @@ pub mod pallet { asset_kind: Box, #[pallet::compact] amount: AssetBalanceOf, beneficiary: Box>, - valid_from: Option>, + valid_from: Option>, ) -> DispatchResult { let max_amount = T::SpendOrigin::ensure_origin(origin)?; let beneficiary = T::BeneficiaryLookup::lookup(*beneficiary)?; @@ -844,9 +846,9 @@ impl, I: 'static> Pallet { // Backfill the `LastSpendPeriod` storage, assuming that no configuration has changed // since introducing this code. Used specifically for a migration-less switch to populate // `LastSpendPeriod`. - fn update_last_spend_period() -> BlockNumberFor { + fn update_last_spend_period() -> BlockNumberFor { let block_number = T::BlockNumberProvider::current_block_number(); - let spend_period = T::SpendPeriod::get().max(BlockNumberFor::::one()); + let spend_period = T::SpendPeriod::get().max(BlockNumberFor::::one()); let time_since_last_spend = block_number % spend_period; // If it happens that this logic runs directly on a spend period block, we need to backdate // to the last spend period so a spend still occurs this block. @@ -889,8 +891,8 @@ impl, I: 'static> Pallet { /// Spend some money! returns number of approvals before spend. pub fn spend_funds( - spend_periods_passed: BlockNumberFor, - new_last_spend_period: BlockNumberFor, + spend_periods_passed: BlockNumberFor, + new_last_spend_period: BlockNumberFor, ) -> Weight { LastSpendPeriod::::put(new_last_spend_period); let mut total_weight = Weight::zero(); diff --git a/substrate/primitives/runtime/src/traits/mod.rs b/substrate/primitives/runtime/src/traits/mod.rs index 01bdcca86b6f..02bc7adc8ba5 100644 --- a/substrate/primitives/runtime/src/traits/mod.rs +++ b/substrate/primitives/runtime/src/traits/mod.rs @@ -2349,7 +2349,8 @@ pub trait BlockNumberProvider { + TypeInfo + Debug + MaxEncodedLen - + Copy; + + Copy + + EncodeLike; /// Returns the current block number. /// From b290f27c9bdbc76ca0f21272e4567c346da23f08 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Alexander=20Thei=C3=9Fen?= Date: Thu, 21 Nov 2024 10:13:23 +0100 Subject: [PATCH 10/64] revive: Bump connect timeout to fix flaky tests (#6567) The eth RPC tests fail sometimes because they run into a connect timeout because the node takes a long time to start. This bumps the connect timeout from 30 to 120 seconds. Locally they take around 40s for me. As a drive by I also remove a apparently duplicated nextest config. --------- Co-authored-by: ordian --- .config/nextest.toml | 1 - substrate/.config/nextest.toml | 124 ------------------------ substrate/frame/revive/rpc/src/tests.rs | 4 +- 3 files changed, 2 insertions(+), 127 deletions(-) delete mode 100644 substrate/.config/nextest.toml diff --git a/.config/nextest.toml b/.config/nextest.toml index 912bf2514a77..b4bdec4aea92 100644 --- a/.config/nextest.toml +++ b/.config/nextest.toml @@ -21,7 +21,6 @@ retries = 5 # The number of threads to run tests with. Supported values are either an integer or # the string "num-cpus". Can be overridden through the `--test-threads` option. # test-threads = "num-cpus" - test-threads = 20 # The number of threads required for each test. This is generally used in overrides to diff --git a/substrate/.config/nextest.toml b/substrate/.config/nextest.toml deleted file mode 100644 index eb0ed09cad92..000000000000 --- a/substrate/.config/nextest.toml +++ /dev/null @@ -1,124 +0,0 @@ -# This is the default config used by nextest. It is embedded in the binary at -# build time. It may be used as a template for .config/nextest.toml. - -[store] -# The directory under the workspace root at which nextest-related files are -# written. Profile-specific storage is currently written to dir/. -dir = "target/nextest" - -# This section defines the default nextest profile. Custom profiles are layered -# on top of the default profile. -[profile.default] -# "retries" defines the number of times a test should be retried. If set to a -# non-zero value, tests that succeed on a subsequent attempt will be marked as -# non-flaky. Can be overridden through the `--retries` option. -# Examples -# * retries = 3 -# * retries = { backoff = "fixed", count = 2, delay = "1s" } -# * retries = { backoff = "exponential", count = 10, delay = "1s", jitter = true, max-delay = "10s" } -retries = 5 - -# The number of threads to run tests with. Supported values are either an integer or -# the string "num-cpus". Can be overridden through the `--test-threads` option. -test-threads = "num-cpus" - -# The number of threads required for each test. This is generally used in overrides to -# mark certain tests as heavier than others. However, it can also be set as a global parameter. -threads-required = 1 - -# Show these test statuses in the output. -# -# The possible values this can take are: -# * none: no output -# * fail: show failed (including exec-failed) tests -# * retry: show flaky and retried tests -# * slow: show slow tests -# * pass: show passed tests -# * skip: show skipped tests (most useful for CI) -# * all: all of the above -# -# Each value includes all the values above it; for example, "slow" includes -# failed and retried tests. -# -# Can be overridden through the `--status-level` flag. -status-level = "pass" - -# Similar to status-level, show these test statuses at the end of the run. -final-status-level = "flaky" - -# "failure-output" defines when standard output and standard error for failing tests are produced. -# Accepted values are -# * "immediate": output failures as soon as they happen -# * "final": output failures at the end of the test run -# * "immediate-final": output failures as soon as they happen and at the end of -# the test run; combination of "immediate" and "final" -# * "never": don't output failures at all -# -# For large test suites and CI it is generally useful to use "immediate-final". -# -# Can be overridden through the `--failure-output` option. -failure-output = "immediate" - -# "success-output" controls production of standard output and standard error on success. This should -# generally be set to "never". -success-output = "never" - -# Cancel the test run on the first failure. For CI runs, consider setting this -# to false. -fail-fast = true - -# Treat a test that takes longer than the configured 'period' as slow, and print a message. -# See for more information. -# -# Optional: specify the parameter 'terminate-after' with a non-zero integer, -# which will cause slow tests to be terminated after the specified number of -# periods have passed. -# Example: slow-timeout = { period = "60s", terminate-after = 2 } -slow-timeout = { period = "60s" } - -# Treat a test as leaky if after the process is shut down, standard output and standard error -# aren't closed within this duration. -# -# This usually happens in case of a test that creates a child process and lets it inherit those -# handles, but doesn't clean the child process up (especially when it fails). -# -# See for more information. -leak-timeout = "100ms" - -[profile.default.junit] -# Output a JUnit report into the given file inside 'store.dir/'. -# If unspecified, JUnit is not written out. - -path = "junit.xml" - -# The name of the top-level "report" element in JUnit report. If aggregating -# reports across different test runs, it may be useful to provide separate names -# for each report. -report-name = "substrate" - -# Whether standard output and standard error for passing tests should be stored in the JUnit report. -# Output is stored in the and elements of the element. -store-success-output = false - -# Whether standard output and standard error for failing tests should be stored in the JUnit report. -# Output is stored in the and elements of the element. -# -# Note that if a description can be extracted from the output, it is always stored in the -# element. -store-failure-output = true - -# This profile is activated if MIRI_SYSROOT is set. -[profile.default-miri] -# Miri tests take up a lot of memory, so only run 1 test at a time by default. -test-threads = 1 - -# Mutual exclusion of tests with `cargo build` invocation as a lock to avoid multiple -# simultaneous invocations clobbering each other. -[test-groups] -serial-integration = { max-threads = 1 } - -# Running UI tests sequentially -# More info can be found here: https://github.com/paritytech/ci_cd/issues/754 -[[profile.default.overrides]] -filter = 'test(/(^ui$|_ui|ui_)/)' -test-group = 'serial-integration' diff --git a/substrate/frame/revive/rpc/src/tests.rs b/substrate/frame/revive/rpc/src/tests.rs index eb23bd7583a0..7734c8c57209 100644 --- a/substrate/frame/revive/rpc/src/tests.rs +++ b/substrate/frame/revive/rpc/src/tests.rs @@ -32,9 +32,9 @@ use static_init::dynamic; use std::thread; use substrate_cli_test_utils::*; -/// Create a websocket client with a 30s timeout. +/// Create a websocket client with a 120s timeout. async fn ws_client_with_retry(url: &str) -> WsClient { - let timeout = tokio::time::Duration::from_secs(30); + let timeout = tokio::time::Duration::from_secs(120); tokio::time::timeout(timeout, async { loop { if let Ok(client) = WsClientBuilder::default().build(url).await { From 7c9e34b576ad91aba2575ddaaddca0ad1aecae83 Mon Sep 17 00:00:00 2001 From: Alexandru Vasile <60601340+lexnv@users.noreply.github.com> Date: Thu, 21 Nov 2024 11:58:44 +0200 Subject: [PATCH 11/64] network-gossip: Ensure sync event is processed on unknown peer roles (#6553) The `GossipEngine::poll_next` implementation polls both the `notification_service` and the `sync_event_stream`. If both polls produce valid data to be processed (`Poll::Ready(Some(..))`), then the sync event is ignored when we receive `NotificationEvent::NotificationStreamOpened` and the role cannot be deduced. This PR ensures both events are processed gracefully. While at it, I have added a warning to the sync engine related to `notification_service` producing `Poll::Ready(None)`. This effectively ensures that `SyncEvents` propagate to the network potentially fixing any state mismatch. For more context: https://github.com/paritytech/polkadot-sdk/issues/6507 cc @paritytech/sdk-node --------- Signed-off-by: Alexandru Vasile --- prdoc/pr_6553.prdoc | 13 ++++++++++++ substrate/client/network-gossip/src/bridge.rs | 20 +++++++++---------- substrate/client/network/sync/src/engine.rs | 9 ++++++++- 3 files changed, 30 insertions(+), 12 deletions(-) create mode 100644 prdoc/pr_6553.prdoc diff --git a/prdoc/pr_6553.prdoc b/prdoc/pr_6553.prdoc new file mode 100644 index 000000000000..8692eba3a9f5 --- /dev/null +++ b/prdoc/pr_6553.prdoc @@ -0,0 +1,13 @@ +title: Ensure sync event is processed on unknown peer roles + +doc: + - audience: Node Dev + description: | + The GossipEngine::poll_next implementation polls both the notification_service and the sync_event_stream. + This PR ensures both events are processed gracefully. + +crates: + - name: sc-network-gossip + bump: patch + - name: sc-network-sync + bump: patch diff --git a/substrate/client/network-gossip/src/bridge.rs b/substrate/client/network-gossip/src/bridge.rs index a4bd922a76d5..2daf1e49ee4b 100644 --- a/substrate/client/network-gossip/src/bridge.rs +++ b/substrate/client/network-gossip/src/bridge.rs @@ -220,18 +220,16 @@ impl Future for GossipEngine { }, NotificationEvent::NotificationStreamOpened { peer, handshake, .. - } => { - let Some(role) = this.network.peer_role(peer, handshake) else { + } => + if let Some(role) = this.network.peer_role(peer, handshake) { + this.state_machine.new_peer( + &mut this.notification_service, + peer, + role, + ); + } else { log::debug!(target: "gossip", "role for {peer} couldn't be determined"); - continue - }; - - this.state_machine.new_peer( - &mut this.notification_service, - peer, - role, - ); - }, + }, NotificationEvent::NotificationStreamClosed { peer } => { this.state_machine .peer_disconnected(&mut this.notification_service, peer); diff --git a/substrate/client/network/sync/src/engine.rs b/substrate/client/network/sync/src/engine.rs index cc2089d1974c..349c41ee1f4a 100644 --- a/substrate/client/network/sync/src/engine.rs +++ b/substrate/client/network/sync/src/engine.rs @@ -545,7 +545,14 @@ where self.process_service_command(command), notification_event = self.notification_service.next_event() => match notification_event { Some(event) => self.process_notification_event(event), - None => return, + None => { + error!( + target: LOG_TARGET, + "Terminating `SyncingEngine` because `NotificationService` has terminated.", + ); + + return; + } }, response_event = self.pending_responses.select_next_some() => self.process_response_event(response_event), From 56d97c3ad8c86e602bc7ac368751210517c4309f Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Bastian=20K=C3=B6cher?= Date: Thu, 21 Nov 2024 10:14:36 +0000 Subject: [PATCH 12/64] slot-based-collator: Move spawning of the futures (#6561) Move spawning of the slot-based collator into the `run` function. Also the tasks are being spawned as blocking task and not just as normal tasks. --------- Co-authored-by: GitHub Action --- .../aura/src/collators/slot_based/mod.rs | 82 ++++++++++++------- .../polkadot-omni-node/lib/src/nodes/aura.rs | 23 ++---- cumulus/test/service/src/lib.rs | 14 +--- prdoc/pr_6561.prdoc | 11 +++ 4 files changed, 73 insertions(+), 57 deletions(-) create mode 100644 prdoc/pr_6561.prdoc diff --git a/cumulus/client/consensus/aura/src/collators/slot_based/mod.rs b/cumulus/client/consensus/aura/src/collators/slot_based/mod.rs index 7453d3c89d08..18e63681d578 100644 --- a/cumulus/client/consensus/aura/src/collators/slot_based/mod.rs +++ b/cumulus/client/consensus/aura/src/collators/slot_based/mod.rs @@ -28,6 +28,7 @@ //! during the relay chain block. After the block is built, the block builder task sends it to //! the collation task which compresses it and submits it to the collation-generation subsystem. +use self::{block_builder_task::run_block_builder, collation_task::run_collation_task}; use codec::Codec; use consensus_common::ParachainCandidate; use cumulus_client_collator::service::ServiceInterface as CollatorServiceInterface; @@ -36,32 +37,28 @@ use cumulus_client_consensus_proposer::ProposerInterface; use cumulus_primitives_aura::AuraUnincludedSegmentApi; use cumulus_primitives_core::GetCoreSelectorApi; use cumulus_relay_chain_interface::RelayChainInterface; +use futures::FutureExt; use polkadot_primitives::{ CollatorPair, CoreIndex, Hash as RelayHash, Id as ParaId, ValidationCodeHash, }; - use sc_client_api::{backend::AuxStore, BlockBackend, BlockOf, UsageProvider}; use sc_consensus::BlockImport; use sc_utils::mpsc::tracing_unbounded; - use sp_api::ProvideRuntimeApi; use sp_application_crypto::AppPublic; use sp_blockchain::HeaderBackend; use sp_consensus_aura::AuraApi; -use sp_core::crypto::Pair; +use sp_core::{crypto::Pair, traits::SpawnNamed}; use sp_inherents::CreateInherentDataProviders; use sp_keystore::KeystorePtr; use sp_runtime::traits::{Block as BlockT, Member}; - use std::{sync::Arc, time::Duration}; -use self::{block_builder_task::run_block_builder, collation_task::run_collation_task}; - mod block_builder_task; mod collation_task; /// Parameters for [`run`]. -pub struct Params { +pub struct Params { /// Inherent data providers. Only non-consensus inherent data should be provided, i.e. /// the timestamp, slot, and paras inherents should be omitted, as they are set by this /// collator. @@ -93,13 +90,30 @@ pub struct Params { /// Drift slots by a fixed duration. This can be used to create more preferrable authoring /// timings. pub slot_drift: Duration, + /// Spawner for spawning futures. + pub spawner: Spawner, } /// Run aura-based block building and collation task. -pub fn run( - params: Params, -) -> (impl futures::Future, impl futures::Future) -where +pub fn run( + Params { + create_inherent_data_providers, + block_import, + para_client, + para_backend, + relay_client, + code_hash_provider, + keystore, + collator_key, + para_id, + proposer, + collator_service, + authoring_duration, + reinitialize, + slot_drift, + spawner, + }: Params, +) where Block: BlockT, Client: ProvideRuntimeApi + BlockOf @@ -123,39 +137,49 @@ where P: Pair + 'static, P::Public: AppPublic + Member + Codec, P::Signature: TryFrom> + Member + Codec, + Spawner: SpawnNamed, { let (tx, rx) = tracing_unbounded("mpsc_builder_to_collator", 100); let collator_task_params = collation_task::Params { - relay_client: params.relay_client.clone(), - collator_key: params.collator_key, - para_id: params.para_id, - reinitialize: params.reinitialize, - collator_service: params.collator_service.clone(), + relay_client: relay_client.clone(), + collator_key, + para_id, + reinitialize, + collator_service: collator_service.clone(), collator_receiver: rx, }; let collation_task_fut = run_collation_task::(collator_task_params); let block_builder_params = block_builder_task::BuilderTaskParams { - create_inherent_data_providers: params.create_inherent_data_providers, - block_import: params.block_import, - para_client: params.para_client, - para_backend: params.para_backend, - relay_client: params.relay_client, - code_hash_provider: params.code_hash_provider, - keystore: params.keystore, - para_id: params.para_id, - proposer: params.proposer, - collator_service: params.collator_service, - authoring_duration: params.authoring_duration, + create_inherent_data_providers, + block_import, + para_client, + para_backend, + relay_client, + code_hash_provider, + keystore, + para_id, + proposer, + collator_service, + authoring_duration, collator_sender: tx, - slot_drift: params.slot_drift, + slot_drift, }; let block_builder_fut = run_block_builder::(block_builder_params); - (collation_task_fut, block_builder_fut) + spawner.spawn_blocking( + "slot-based-block-builder", + Some("slot-based-collator"), + block_builder_fut.boxed(), + ); + spawner.spawn_blocking( + "slot-based-collation", + Some("slot-based-collator"), + collation_task_fut.boxed(), + ); } /// Message to be sent from the block builder to the collation task. diff --git a/cumulus/polkadot-omni-node/lib/src/nodes/aura.rs b/cumulus/polkadot-omni-node/lib/src/nodes/aura.rs index ec5d0a439ec4..0b2c230f695d 100644 --- a/cumulus/polkadot-omni-node/lib/src/nodes/aura.rs +++ b/cumulus/polkadot-omni-node/lib/src/nodes/aura.rs @@ -54,6 +54,7 @@ use sc_service::{Configuration, Error, TaskManager}; use sc_telemetry::TelemetryHandle; use sc_transaction_pool::TransactionPoolHandle; use sp_api::ProvideRuntimeApi; +use sp_core::traits::SpawnNamed; use sp_inherents::CreateInherentDataProviders; use sp_keystore::KeystorePtr; use sp_runtime::{ @@ -242,7 +243,7 @@ where AuraId: AuraIdT + Sync, { #[docify::export_content] - fn launch_slot_based_collator( + fn launch_slot_based_collator( params: SlotBasedParams< ParachainBlockImport, CIDP, @@ -252,28 +253,17 @@ where CHP, Proposer, CS, + Spawner, >, - task_manager: &TaskManager, ) where CIDP: CreateInherentDataProviders + 'static, CIDP::InherentDataProviders: Send, CHP: cumulus_client_consensus_common::ValidationCodeHashProvider + Send + 'static, Proposer: ProposerInterface + Send + Sync + 'static, CS: CollatorServiceInterface + Send + Sync + Clone + 'static, + Spawner: SpawnNamed, { - let (collation_future, block_builder_future) = - slot_based::run::::Pair, _, _, _, _, _, _, _, _>(params); - - task_manager.spawn_essential_handle().spawn( - "collation-task", - Some("parachain-block-authoring"), - collation_future, - ); - task_manager.spawn_essential_handle().spawn( - "block-builder-task", - Some("parachain-block-authoring"), - block_builder_future, - ); + slot_based::run::::Pair, _, _, _, _, _, _, _, _, _>(params); } } @@ -335,11 +325,12 @@ where authoring_duration: Duration::from_millis(2000), reinitialize: false, slot_drift: Duration::from_secs(1), + spawner: task_manager.spawn_handle(), }; // We have a separate function only to be able to use `docify::export` on this piece of // code. - Self::launch_slot_based_collator(params, task_manager); + Self::launch_slot_based_collator(params); Ok(()) } diff --git a/cumulus/test/service/src/lib.rs b/cumulus/test/service/src/lib.rs index 9234442d399c..f01da9becef1 100644 --- a/cumulus/test/service/src/lib.rs +++ b/cumulus/test/service/src/lib.rs @@ -497,20 +497,10 @@ where authoring_duration: Duration::from_millis(2000), reinitialize: false, slot_drift: Duration::from_secs(1), + spawner: task_manager.spawn_handle(), }; - let (collation_future, block_builder_future) = - slot_based::run::(params); - task_manager.spawn_essential_handle().spawn( - "collation-task", - None, - collation_future, - ); - task_manager.spawn_essential_handle().spawn( - "block-builder-task", - None, - block_builder_future, - ); + slot_based::run::(params); } else { tracing::info!(target: LOG_TARGET, "Starting block authoring with lookahead collator."); let params = AuraParams { diff --git a/prdoc/pr_6561.prdoc b/prdoc/pr_6561.prdoc new file mode 100644 index 000000000000..714521925a6b --- /dev/null +++ b/prdoc/pr_6561.prdoc @@ -0,0 +1,11 @@ +title: 'slot-based-collator: Move spawning of the futures' +doc: +- audience: Node Dev + description: "Move spawning of the slot-based collator into the `run` function.\ + \ Also the tasks are being spawned as blocking task and not just as normal tasks.\r\ + \n" +crates: +- name: cumulus-client-consensus-aura + bump: major +- name: polkadot-omni-node-lib + bump: major From 1f7765b63530e362d6b1b4a225b47daddda03637 Mon Sep 17 00:00:00 2001 From: Iulian Barbu <14218860+iulianbarbu@users.noreply.github.com> Date: Thu, 21 Nov 2024 15:39:08 +0200 Subject: [PATCH 13/64] github/workflows: add ARM macos build binaries job (#6427) # Description This PR adds the required changes to release `polkadot`, `polkadot-parachain` and `polkadot-omni-node` binaries built on Apple Sillicon macos. ## Integration This addresses requests from the community for such binaries: #802, and they should be part of the Github release page. ## Review Notes Test on paritytech-stg solely focused on macos binaries: https://github.com/paritytech-stg/polkadot-sdk/actions/runs/11824692766/job/32946793308, except the steps related to `pgpkms` (which need AWS credentials, missing from paritytech-stg). The binary names don't have a `darwin-arm` identifier, and conflict with the existing x86_64-linux binaries. I haven't tested building everything on `paritytech-stg` because the x86_64-linux builds run on `unbutu-latest-m` which isn't enabled on `pairtytech-stg` (and I haven't asked CI team to enable one), so testing how to go around naming conflicts should be covered next. ### TODO - [x] Test the workflow start to end (especially the last bits related to uploading the binaries on S3 and ensuring the previous binaries and the new ones coexist harmoniously on S3/action artifacts storage without naming conflicts) @EgorPopelyaev - [x] Publish the arm binaries on the Github release page - to clarify what's needed @iulianbarbu . Current practice is to manually publish the binaries built via `release-build-rc.yml` workflow, taken from S3. Would be great to have the binaries there in the first place before working on automating this, but I would also do it in a follow up PR. ### Follow ups - [ ] unify the binaries building under `release-30_publish_release_draft.yml` maybe? - [ ] automate binary artifacts upload to S3 in `release-30_publish_release_draft.yml` --------- Signed-off-by: Iulian Barbu Co-authored-by: EgorPopelyaev --- .../scripts/release/build-linux-release.sh | 4 +- .../scripts/release/build-macos-release.sh | 37 +++ .github/scripts/release/release_lib.sh | 38 ++-- .../release-30_publish_release_draft.yml | 4 +- .github/workflows/release-build-rc.yml | 91 ++++++++ .../workflows/release-reusable-rc-buid.yml | 212 +++++++++++++++++- .../workflows/release-reusable-s3-upload.yml | 17 +- 7 files changed, 376 insertions(+), 27 deletions(-) create mode 100755 .github/scripts/release/build-macos-release.sh diff --git a/.github/scripts/release/build-linux-release.sh b/.github/scripts/release/build-linux-release.sh index a6bd658d292a..874c9b44788b 100755 --- a/.github/scripts/release/build-linux-release.sh +++ b/.github/scripts/release/build-linux-release.sh @@ -3,6 +3,8 @@ # This is used to build our binaries: # - polkadot # - polkadot-parachain +# - polkadot-omni-node +# # set -e BIN=$1 @@ -21,7 +23,7 @@ time cargo build --profile $PROFILE --locked --verbose --bin $BIN --package $PAC echo "Artifact target: $ARTIFACTS" cp ./target/$PROFILE/$BIN "$ARTIFACTS" -pushd "$ARTIFACTS" > /dev/nul +pushd "$ARTIFACTS" > /dev/null sha256sum "$BIN" | tee "$BIN.sha256" EXTRATAG="$($ARTIFACTS/$BIN --version | diff --git a/.github/scripts/release/build-macos-release.sh b/.github/scripts/release/build-macos-release.sh new file mode 100755 index 000000000000..ba6dcc65d650 --- /dev/null +++ b/.github/scripts/release/build-macos-release.sh @@ -0,0 +1,37 @@ +#!/usr/bin/env bash + +# This is used to build our binaries: +# - polkadot +# - polkadot-parachain +# - polkadot-omni-node +# set -e + +BIN=$1 +PACKAGE=${2:-$BIN} + +PROFILE=${PROFILE:-production} +# parity-macos runner needs a path where it can +# write, so make it relative to github workspace. +ARTIFACTS=$GITHUB_WORKSPACE/artifacts/$BIN +VERSION=$(git tag -l --contains HEAD | grep -E "^v.*") + +echo "Artifacts will be copied into $ARTIFACTS" +mkdir -p "$ARTIFACTS" + +git log --pretty=oneline -n 1 +time cargo build --profile $PROFILE --locked --verbose --bin $BIN --package $PACKAGE + +echo "Artifact target: $ARTIFACTS" + +cp ./target/$PROFILE/$BIN "$ARTIFACTS" +pushd "$ARTIFACTS" > /dev/null +sha256sum "$BIN" | tee "$BIN.sha256" + +EXTRATAG="$($ARTIFACTS/$BIN --version | + sed -n -r 's/^'$BIN' ([0-9.]+.*-[0-9a-f]{7,13})-.*$/\1/p')" + +EXTRATAG="${VERSION}-${EXTRATAG}-$(cut -c 1-8 $ARTIFACTS/$BIN.sha256)" + +echo "$BIN version = ${VERSION} (EXTRATAG = ${EXTRATAG})" +echo -n ${VERSION} > "$ARTIFACTS/VERSION" +echo -n ${EXTRATAG} > "$ARTIFACTS/EXTRATAG" diff --git a/.github/scripts/release/release_lib.sh b/.github/scripts/release/release_lib.sh index f5032073b617..8b9254ec3f29 100644 --- a/.github/scripts/release/release_lib.sh +++ b/.github/scripts/release/release_lib.sh @@ -1,6 +1,6 @@ #!/usr/bin/env bash -# Set the new version by replacing the value of the constant given as patetrn +# Set the new version by replacing the value of the constant given as pattern # in the file. # # input: pattern, version, file @@ -119,21 +119,23 @@ set_polkadot_parachain_binary_version() { upload_s3_release() { - alias aws='podman run --rm -it docker.io/paritytech/awscli -e AWS_ACCESS_KEY_ID -e AWS_SECRET_ACCESS_KEY -e AWS_BUCKET aws' - - product=$1 - version=$2 - - echo "Working on product: $product " - echo "Working on version: $version " - - echo "Current content, should be empty on new uploads:" - aws s3 ls "s3://releases.parity.io/polkadot/${version}/" --recursive --human-readable --summarize || true - echo "Content to be uploaded:" - artifacts="artifacts/$product/" - ls "$artifacts" - aws s3 sync --acl public-read "$artifacts" "s3://releases.parity.io/polkadot/${version}/" - echo "Uploaded files:" - aws s3 ls "s3://releases.parity.io/polkadot/${version}/" --recursive --human-readable --summarize - echo "✅ The release should be at https://releases.parity.io/polkadot/${version}" + alias aws='podman run --rm -it docker.io/paritytech/awscli -e AWS_ACCESS_KEY_ID -e AWS_SECRET_ACCESS_KEY -e AWS_BUCKET aws' + + product=$1 + version=$2 + target=$3 + + echo "Working on product: $product " + echo "Working on version: $version " + echo "Working on platform: $target " + + echo "Current content, should be empty on new uploads:" + aws s3 ls "s3://releases.parity.io/${product}/${version}/${target}" --recursive --human-readable --summarize || true + echo "Content to be uploaded:" + artifacts="artifacts/$product/" + ls "$artifacts" + aws s3 sync --acl public-read "$artifacts" "s3://releases.parity.io/${product}/${version}/${target}" + echo "Uploaded files:" + aws s3 ls "s3://releases.parity.io/${product}/${version}/${target}" --recursive --human-readable --summarize + echo "✅ The release should be at https://releases.parity.io/${product}/${version}/${target}" } diff --git a/.github/workflows/release-30_publish_release_draft.yml b/.github/workflows/release-30_publish_release_draft.yml index 376f5fbce909..4364b4f80457 100644 --- a/.github/workflows/release-30_publish_release_draft.yml +++ b/.github/workflows/release-30_publish_release_draft.yml @@ -34,7 +34,7 @@ jobs: strategy: matrix: # Tuples of [package, binary-name] - binary: [ [frame-omni-bencher, frame-omni-bencher], [staging-chain-spec-builder, chain-spec-builder], [polkadot-omni-node, polkadot-omni-node] ] + binary: [ [frame-omni-bencher, frame-omni-bencher], [staging-chain-spec-builder, chain-spec-builder] ] steps: - name: Checkout sources uses: actions/checkout@6d193bf28034eafb982f37bd894289fe649468fc # v4.0.0 @@ -161,7 +161,7 @@ jobs: runs-on: ubuntu-latest strategy: matrix: - binary: [frame-omni-bencher, chain-spec-builder, polkadot-omni-node] + binary: [frame-omni-bencher, chain-spec-builder] steps: - name: Download artifacts diff --git a/.github/workflows/release-build-rc.yml b/.github/workflows/release-build-rc.yml index 94bacf320898..a43c2b282a8d 100644 --- a/.github/workflows/release-build-rc.yml +++ b/.github/workflows/release-build-rc.yml @@ -10,6 +10,7 @@ on: options: - polkadot - polkadot-parachain + - polkadot-omni-node - all release_tag: @@ -47,6 +48,7 @@ jobs: binary: '["polkadot", "polkadot-prepare-worker", "polkadot-execute-worker"]' package: polkadot release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: x86_64-unknown-linux-gnu secrets: PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} @@ -68,6 +70,95 @@ jobs: binary: '["polkadot-parachain"]' package: "polkadot-parachain-bin" release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: x86_64-unknown-linux-gnu + secrets: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + permissions: + id-token: write + attestations: write + contents: read + + build-polkadot-omni-node-binary: + needs: [validate-inputs] + if: ${{ inputs.binary == 'polkadot-omni-node' || inputs.binary == 'all' }} + uses: "./.github/workflows/release-reusable-rc-buid.yml" + with: + binary: '["polkadot-omni-node"]' + package: "polkadot-omni-node" + release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: x86_64-unknown-linux-gnu + secrets: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + permissions: + id-token: write + attestations: write + contents: read + + build-polkadot-macos-binary: + needs: [validate-inputs] + if: ${{ inputs.binary == 'polkadot' || inputs.binary == 'all' }} + uses: "./.github/workflows/release-reusable-rc-buid.yml" + with: + binary: '["polkadot", "polkadot-prepare-worker", "polkadot-execute-worker"]' + package: polkadot + release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: aarch64-apple-darwin + secrets: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + permissions: + id-token: write + attestations: write + contents: read + + build-polkadot-parachain-macos-binary: + needs: [validate-inputs] + if: ${{ inputs.binary == 'polkadot-parachain' || inputs.binary == 'all' }} + uses: "./.github/workflows/release-reusable-rc-buid.yml" + with: + binary: '["polkadot-parachain"]' + package: "polkadot-parachain-bin" + release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: aarch64-apple-darwin + secrets: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + permissions: + id-token: write + attestations: write + contents: read + + build-polkadot-omni-node-macos-binary: + needs: [validate-inputs] + if: ${{ inputs.binary == 'polkadot-omni-node' || inputs.binary == 'all' }} + uses: "./.github/workflows/release-reusable-rc-buid.yml" + with: + binary: '["polkadot-omni-node"]' + package: "polkadot-omni-node" + release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: aarch64-apple-darwin secrets: PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} diff --git a/.github/workflows/release-reusable-rc-buid.yml b/.github/workflows/release-reusable-rc-buid.yml index d925839fb84a..7e31a4744b59 100644 --- a/.github/workflows/release-reusable-rc-buid.yml +++ b/.github/workflows/release-reusable-rc-buid.yml @@ -10,7 +10,7 @@ on: type: string package: - description: Package to be built, for now is either polkadot or polkadot-parachain-bin + description: Package to be built, for now can be polkadot, polkadot-parachain-bin, or polkadot-omni-node required: true type: string @@ -19,6 +19,11 @@ on: required: true type: string + target: + description: Target triple for which the artifacts are being built (e.g. x86_64-unknown-linux-gnu) + required: true + type: string + secrets: PGP_KMS_KEY: required: true @@ -57,6 +62,7 @@ jobs: run: cat .github/env >> $GITHUB_OUTPUT build-rc: + if: ${{ inputs.target == 'x86_64-unknown-linux-gnu' }} needs: [set-image] runs-on: ubuntu-latest-m environment: release @@ -130,8 +136,124 @@ jobs: name: ${{ matrix.binaries }} path: /artifacts/${{ matrix.binaries }} + build-macos-rc: + if: ${{ inputs.target == 'aarch64-apple-darwin' }} + runs-on: parity-macos + environment: release + strategy: + matrix: + binaries: ${{ fromJSON(inputs.binary) }} + env: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + SKIP_WASM_BUILD: 1 + steps: + - name: Checkout sources + uses: actions/checkout@d632683dd7b4114ad314bca15554477dd762a938 # v4.2.0 + with: + ref: ${{ inputs.release_tag }} + fetch-depth: 0 + + - name: Set rust version from env file + run: | + RUST_VERSION=$(cat .github/env | sed -E 's/.*ci-unified:([^-]+)-([^-]+).*/\2/') + echo $RUST_VERSION + echo "RUST_VERSION=${RUST_VERSION}" >> $GITHUB_ENV + - name: Set workspace environment variable + # relevant for artifacts upload, which can not interpolate Github Action variable syntax when + # used within valid paths. We can not use root-based paths either, since it is set as read-only + # on the `parity-macos` runner. + run: echo "ARTIFACTS_PATH=${GITHUB_WORKSPACE}/artifacts/${{ matrix.binaries }}" >> $GITHUB_ENV + + - name: Set up Homebrew + uses: Homebrew/actions/setup-homebrew@1ccc07ccd54b6048295516a3eb89b192c35057dc # master from 12.09.2024 + - name: Set homebrew binaries location on path + run: echo "/opt/homebrew/bin" >> $GITHUB_PATH + + - name: Install rust ${{ env.RUST_VERSION }} + uses: actions-rust-lang/setup-rust-toolchain@11df97af8e8102fd60b60a77dfbf58d40cd843b8 # v1.10.1 + with: + cache: false + toolchain: ${{ env.RUST_VERSION }} + target: wasm32-unknown-unknown + components: cargo, clippy, rust-docs, rust-src, rustfmt, rustc, rust-std + + - name: cargo info + run: | + echo "######## rustup show ########" + rustup show + echo "######## cargo --version ########" + cargo --version + + - name: Install protobuf + run: brew install protobuf + - name: Install gpg + run: | + brew install gnupg + # Setup for being able to resolve: keyserver.ubuntu.com. + # See: https://github.com/actions/runner-images/issues/9777 + mkdir -p ~/.gnupg/ + touch ~/.gnupg/dirmngr.conf + echo "standard-resolver" > ~/.gnupg/dirmngr.conf + - name: Install sha256sum + run: | + brew install coreutils + + - name: Install pgpkkms + run: | + # Install pgpkms that is used to sign built artifacts + python3 -m pip install "pgpkms @ git+https://github.com/paritytech-release/pgpkms.git@5a8f82fbb607ea102d8c178e761659de54c7af69" --break-system-packages + + - name: Import gpg keys + shell: bash + run: | + . ./.github/scripts/common/lib.sh + + import_gpg_keys + + - name: Build binary + run: | + git config --global --add safe.directory "${GITHUB_WORKSPACE}" #avoid "detected dubious ownership" error + ./.github/scripts/release/build-macos-release.sh ${{ matrix.binaries }} ${{ inputs.package }} + + - name: Generate artifact attestation + uses: actions/attest-build-provenance@1c608d11d69870c2092266b3f9a6f3abbf17002c # v1.4.3 + with: + subject-path: ${{ env.ARTIFACTS_PATH }}/${{ matrix.binaries }} + + - name: Sign artifacts + working-directory: ${{ env.ARTIFACTS_PATH }} + run: | + python3 -m pgpkms sign --input ${{matrix.binaries }} -o ${{ matrix.binaries }}.asc + + - name: Check sha256 ${{ matrix.binaries }} + working-directory: ${{ env.ARTIFACTS_PATH }} + shell: bash + run: | + . "${GITHUB_WORKSPACE}"/.github/scripts/common/lib.sh + + echo "Checking binary ${{ matrix.binaries }}" + check_sha256 ${{ matrix.binaries }} + + - name: Check GPG ${{ matrix.binaries }} + working-directory: ${{ env.ARTIFACTS_PATH }} + shell: bash + run: | + . "${GITHUB_WORKSPACE}"/.github/scripts/common/lib.sh + + check_gpg ${{ matrix.binaries }} + + - name: Upload ${{ matrix.binaries }} artifacts + uses: actions/upload-artifact@5d5d22a31266ced268874388b861e4b58bb5c2f3 # v4.3.1 + with: + name: ${{ matrix.binaries }}_${{ inputs.target }} + path: ${{ env.ARTIFACTS_PATH }} + build-polkadot-deb-package: - if: ${{ inputs.package == 'polkadot' }} + if: ${{ inputs.package == 'polkadot' && inputs.target == 'x86_64-unknown-linux-gnu' }} needs: [build-rc] runs-on: ubuntu-latest @@ -168,12 +290,13 @@ jobs: overwrite: true upload-polkadot-artifacts-to-s3: - if: ${{ inputs.package == 'polkadot' }} + if: ${{ inputs.package == 'polkadot' && inputs.target == 'x86_64-unknown-linux-gnu' }} needs: [build-polkadot-deb-package] uses: ./.github/workflows/release-reusable-s3-upload.yml with: package: ${{ inputs.package }} release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} secrets: AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} @@ -181,12 +304,93 @@ jobs: upload-polkadot-parachain-artifacts-to-s3: - if: ${{ inputs.package == 'polkadot-parachain-bin' }} + if: ${{ inputs.package == 'polkadot-parachain-bin' && inputs.target == 'x86_64-unknown-linux-gnu' }} needs: [build-rc] uses: ./.github/workflows/release-reusable-s3-upload.yml with: package: polkadot-parachain release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + + upload-polkadot-omni-node-artifacts-to-s3: + if: ${{ inputs.package == 'polkadot-omni-node' && inputs.target == 'x86_64-unknown-linux-gnu' }} + needs: [build-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: ${{ inputs.package }} + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + + upload-polkadot-macos-artifacts-to-s3: + if: ${{ inputs.package == 'polkadot' && inputs.target == 'aarch64-apple-darwin' }} + # TODO: add and use a `build-polkadot-homebrew-package` which packs all `polkadot` binaries: + # `polkadot`, `polkadot-prepare-worker` and `polkadot-execute-worker`. + needs: [build-macos-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: ${{ inputs.package }} + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + + upload-polkadot-prepare-worker-macos-artifacts-to-s3: + if: ${{ inputs.package == 'polkadot' && inputs.target == 'aarch64-apple-darwin' }} + needs: [build-macos-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: polkadot-prepare-worker + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + + upload-polkadot-execute-worker-macos-artifacts-to-s3: + if: ${{ inputs.package == 'polkadot' && inputs.target == 'aarch64-apple-darwin' }} + needs: [build-macos-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: polkadot-execute-worker + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + + upload-polkadot-omni-node-macos-artifacts-to-s3: + if: ${{ inputs.package == 'polkadot-omni-node' && inputs.target == 'aarch64-apple-darwin' }} + needs: [build-macos-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: ${{ inputs.package }} + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + + upload-polkadot-parachain-macos-artifacts-to-s3: + if: ${{ inputs.package == 'polkadot-parachain-bin' && inputs.target == 'aarch64-apple-darwin' }} + needs: [build-macos-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: polkadot-parachain + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} secrets: AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} diff --git a/.github/workflows/release-reusable-s3-upload.yml b/.github/workflows/release-reusable-s3-upload.yml index 6776b78da8e6..f85466bc8c07 100644 --- a/.github/workflows/release-reusable-s3-upload.yml +++ b/.github/workflows/release-reusable-s3-upload.yml @@ -13,6 +13,11 @@ on: required: true type: string + target: + description: Target triple for which the artifacts are being uploaded (e.g aarch64-apple-darwin) + required: true + type: string + secrets: AWS_DEFAULT_REGION: required: true @@ -34,12 +39,20 @@ jobs: - name: Checkout uses: actions/checkout@d632683dd7b4114ad314bca15554477dd762a938 # v4.2.0 - - name: Download artifacts + - name: Download amd64 artifacts + if: ${{ inputs.target == 'x86_64-unknown-linux-gnu' }} uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8 with: name: ${{ inputs.package }} path: artifacts/${{ inputs.package }} + - name: Download arm artifacts + if: ${{ inputs.target == 'aarch64-apple-darwin' }} + uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8 + with: + name: ${{ inputs.package }}_aarch64-apple-darwin + path: artifacts/${{ inputs.package }} + - name: Configure AWS Credentials uses: aws-actions/configure-aws-credentials@e3dd6a429d7300a6a4c196c26e071d42e0343502 # v4.0.2 with: @@ -50,4 +63,4 @@ jobs: - name: Upload ${{ inputs.package }} artifacts to s3 run: | . ./.github/scripts/release/release_lib.sh - upload_s3_release ${{ inputs.package }} ${{ inputs.release_tag }} + upload_s3_release ${{ inputs.package }} ${{ inputs.release_tag }} ${{ inputs.target }} From bf20a9ee18f7215210bbbabf79e955c8c35b3360 Mon Sep 17 00:00:00 2001 From: Ankan <10196091+Ank4n@users.noreply.github.com> Date: Thu, 21 Nov 2024 21:04:47 +0700 Subject: [PATCH 14/64] [Fix|NominationPools] Only allow apply slash to be executed if the slash amount is atleast ED (#6540) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit This change prevents `pools::apply_slash` from being executed when the pending slash amount of the member is lower than the ED. The issue came to light with the failing [benchmark test](https://github.com/polkadot-fellows/runtimes/actions/runs/11879471717/job/33101445269?pr=490#step:11:765) in Kusama. The problem arises from the inexact conversion between points and balance. Specifically, when points are converted to balance and then back to points, rounding can introduce a small discrepancy between the input and the resulting value. This issue surfaced in Kusama due to its ED being different from Westend and Polkadot (1 UNIT/300), making the rounding issue noticeable. This fix is also significant because applying a slash is feeless and permissionless. Allowing super small slash amounts to be applied without a fee is undesirable. With this change, such small slashes will still be applied but only when member funds are withdrawn. --------- Co-authored-by: Dónal Murray --- prdoc/pr_6540.prdoc | 16 ++++++++ .../nomination-pools/runtime-api/src/lib.rs | 3 ++ substrate/frame/nomination-pools/src/lib.rs | 23 +++++++++--- .../test-delegate-stake/Cargo.toml | 2 +- .../test-delegate-stake/src/lib.rs | 37 +++++++++++++++++-- 5 files changed, 71 insertions(+), 10 deletions(-) create mode 100644 prdoc/pr_6540.prdoc diff --git a/prdoc/pr_6540.prdoc b/prdoc/pr_6540.prdoc new file mode 100644 index 000000000000..5e0305205521 --- /dev/null +++ b/prdoc/pr_6540.prdoc @@ -0,0 +1,16 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: Only allow apply slash to be executed if the slash amount is atleast ED + +doc: + - audience: Runtime User + description: | + This change prevents `pools::apply_slash` from being executed when the pending slash amount of the member is lower + than the ED. With this change, such small slashes will still be applied but only when member funds are withdrawn. + +crates: +- name: pallet-nomination-pools-runtime-api + bump: patch +- name: pallet-nomination-pools + bump: major diff --git a/substrate/frame/nomination-pools/runtime-api/src/lib.rs b/substrate/frame/nomination-pools/runtime-api/src/lib.rs index 4138dd22d898..644ee07fd634 100644 --- a/substrate/frame/nomination-pools/runtime-api/src/lib.rs +++ b/substrate/frame/nomination-pools/runtime-api/src/lib.rs @@ -43,6 +43,9 @@ sp_api::decl_runtime_apis! { fn pool_pending_slash(pool_id: PoolId) -> Balance; /// Returns the pending slash for a given pool member. + /// + /// If pending slash of the member exceeds `ExistentialDeposit`, it can be reported on + /// chain. fn member_pending_slash(member: AccountId) -> Balance; /// Returns true if the pool with `pool_id` needs migration. diff --git a/substrate/frame/nomination-pools/src/lib.rs b/substrate/frame/nomination-pools/src/lib.rs index 201b0af1d608..dc82bf3a37c6 100644 --- a/substrate/frame/nomination-pools/src/lib.rs +++ b/substrate/frame/nomination-pools/src/lib.rs @@ -1944,6 +1944,8 @@ pub mod pallet { NothingToAdjust, /// No slash pending that can be applied to the member. NothingToSlash, + /// The slash amount is too low to be applied. + SlashTooLow, /// The pool or member delegation has already migrated to delegate stake. AlreadyMigrated, /// The pool or member delegation has not migrated yet to delegate stake. @@ -2300,7 +2302,7 @@ pub mod pallet { let slash_weight = // apply slash if any before withdraw. - match Self::do_apply_slash(&member_account, None) { + match Self::do_apply_slash(&member_account, None, false) { Ok(_) => T::WeightInfo::apply_slash(), Err(e) => { let no_pending_slash: DispatchResult = Err(Error::::NothingToSlash.into()); @@ -2974,8 +2976,10 @@ pub mod pallet { /// Fails unless [`crate::pallet::Config::StakeAdapter`] is of strategy type: /// [`adapter::StakeStrategyType::Delegate`]. /// - /// This call can be dispatched permissionlessly (i.e. by any account). If the member has - /// slash to be applied, caller may be rewarded with the part of the slash. + /// The pending slash amount of the member must be equal or more than `ExistentialDeposit`. + /// This call can be dispatched permissionlessly (i.e. by any account). If the execution + /// is successful, fee is refunded and caller may be rewarded with a part of the slash + /// based on the [`crate::pallet::Config::StakeAdapter`] configuration. #[pallet::call_index(23)] #[pallet::weight(T::WeightInfo::apply_slash())] pub fn apply_slash( @@ -2989,7 +2993,7 @@ pub mod pallet { let who = ensure_signed(origin)?; let member_account = T::Lookup::lookup(member_account)?; - Self::do_apply_slash(&member_account, Some(who))?; + Self::do_apply_slash(&member_account, Some(who), true)?; // If successful, refund the fees. Ok(Pays::No.into()) @@ -3574,15 +3578,21 @@ impl Pallet { fn do_apply_slash( member_account: &T::AccountId, reporter: Option, + enforce_min_slash: bool, ) -> DispatchResult { let member = PoolMembers::::get(member_account).ok_or(Error::::PoolMemberNotFound)?; let pending_slash = Self::member_pending_slash(Member::from(member_account.clone()), member.clone())?; - // if nothing to slash, return error. + // ensure there is something to slash. ensure!(!pending_slash.is_zero(), Error::::NothingToSlash); + if enforce_min_slash { + // ensure slashed amount is at least the minimum balance. + ensure!(pending_slash >= T::Currency::minimum_balance(), Error::::SlashTooLow); + } + T::StakeAdapter::member_slash( Member::from(member_account.clone()), Pool::from(Pallet::::generate_bonded_account(member.pool_id)), @@ -3946,6 +3956,9 @@ impl Pallet { /// Returns the unapplied slash of a member. /// /// Pending slash is only applicable with [`adapter::DelegateStake`] strategy. + /// + /// If pending slash of the member exceeds `ExistentialDeposit`, it can be reported on + /// chain via [`Call::apply_slash`]. pub fn api_member_pending_slash(who: T::AccountId) -> BalanceOf { PoolMembers::::get(who.clone()) .map(|pool_member| { diff --git a/substrate/frame/nomination-pools/test-delegate-stake/Cargo.toml b/substrate/frame/nomination-pools/test-delegate-stake/Cargo.toml index 7940caaff775..70e1591409b8 100644 --- a/substrate/frame/nomination-pools/test-delegate-stake/Cargo.toml +++ b/substrate/frame/nomination-pools/test-delegate-stake/Cargo.toml @@ -26,7 +26,7 @@ sp-staking = { workspace = true, default-features = true } sp-core = { workspace = true, default-features = true } frame-system = { workspace = true, default-features = true } -frame-support = { workspace = true, default-features = true } +frame-support = { features = ["experimental"], workspace = true, default-features = true } frame-election-provider-support = { workspace = true, default-features = true } pallet-timestamp = { workspace = true, default-features = true } diff --git a/substrate/frame/nomination-pools/test-delegate-stake/src/lib.rs b/substrate/frame/nomination-pools/test-delegate-stake/src/lib.rs index 40025cdbb3cd..cc6335959ab7 100644 --- a/substrate/frame/nomination-pools/test-delegate-stake/src/lib.rs +++ b/substrate/frame/nomination-pools/test-delegate-stake/src/lib.rs @@ -20,7 +20,7 @@ mod mock; use frame_support::{ - assert_noop, assert_ok, + assert_noop, assert_ok, hypothetically, traits::{fungible::InspectHold, Currency}, }; use mock::*; @@ -537,10 +537,10 @@ fn pool_slash_proportional() { // a typical example where 3 pool members unbond in era 99, 100, and 101, and a slash that // happened in era 100 should only affect the latter two. new_test_ext().execute_with(|| { - ExistentialDeposit::set(1); + ExistentialDeposit::set(2); BondingDuration::set(28); - assert_eq!(Balances::minimum_balance(), 1); - assert_eq!(CurrentEra::::get(), None); + assert_eq!(Balances::minimum_balance(), 2); + assert_eq!(Staking::current_era(), None); // create the pool, we know this has id 1. assert_ok!(Pools::create(RuntimeOrigin::signed(10), 40, 10, 10, 10)); @@ -670,6 +670,34 @@ fn pool_slash_proportional() { // no pending slash yet. assert_eq!(Pools::api_pool_pending_slash(1), 0); + // and therefore applying slash fails + assert_noop!( + Pools::apply_slash(RuntimeOrigin::signed(10), 21), + PoolsError::::NothingToSlash + ); + + hypothetically!({ + // a very small amount is slashed + pallet_staking::slashing::do_slash::( + &POOL1_BONDED, + 3, + &mut Default::default(), + &mut Default::default(), + 100, + ); + + // ensure correct amount is pending to be slashed + assert_eq!(Pools::api_pool_pending_slash(1), 3); + + // 21 has pending slash lower than ED (2) + assert_eq!(Pools::api_member_pending_slash(21), 1); + + // slash fails as minimum pending slash amount not met. + assert_noop!( + Pools::apply_slash(RuntimeOrigin::signed(10), 21), + PoolsError::::SlashTooLow + ); + }); pallet_staking::slashing::do_slash::( &POOL1_BONDED, @@ -909,6 +937,7 @@ fn pool_slash_non_proportional_bonded_pool_and_chunks() { ); }); } + #[test] fn pool_migration_e2e() { new_test_ext().execute_with(|| { From 6d59c3b1417cd07ae8d502236e8a98c3498f76b1 Mon Sep 17 00:00:00 2001 From: Iulian Barbu <14218860+iulianbarbu@users.noreply.github.com> Date: Thu, 21 Nov 2024 20:19:14 +0200 Subject: [PATCH 15/64] parachain-template-node: add properties for dev chain-spec (#6560) # Description Reused as before the `properties` variable when defining a development chain spec for parachain-template-node. ## Integration N/A ## Review Notes One line change, pretty self explanatory (it got lost within the history of changes over the parachain-template-node/chain_spec.rs file). To be honest, not really sure how useful it is, but I had the choice of removing the `properties` var or reuse it as before, and I went with the latter. Signed-off-by: Iulian Barbu --- templates/parachain/node/src/chain_spec.rs | 1 + 1 file changed, 1 insertion(+) diff --git a/templates/parachain/node/src/chain_spec.rs b/templates/parachain/node/src/chain_spec.rs index 55a099dd022b..7ae3c4900e42 100644 --- a/templates/parachain/node/src/chain_spec.rs +++ b/templates/parachain/node/src/chain_spec.rs @@ -45,6 +45,7 @@ pub fn development_chain_spec() -> ChainSpec { .with_id("dev") .with_chain_type(ChainType::Development) .with_genesis_config_preset_name(sp_genesis_builder::DEV_RUNTIME_PRESET) + .with_properties(properties) .build() } From d8ce550256f08c42d1ba6630990ed7e2e9ce0352 Mon Sep 17 00:00:00 2001 From: PG Herveou Date: Thu, 21 Nov 2024 21:44:42 +0100 Subject: [PATCH 16/64] [pallet-revive] Support all eth tx types (#6461) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Add support for all eth tx types Note that js libs will continue to use the Legacy type since we don't include base_fee_per_gas yet in the block. We can think about setting these values after we revisit how we encode the gas into weight & deposit_limit in a follow up PR --------- Co-authored-by: Alexander Theißen Co-authored-by: GitHub Action --- prdoc/pr_6461.prdoc | 12 + substrate/frame/revive/rpc/src/client.rs | 24 +- substrate/frame/revive/rpc/src/example.rs | 9 +- substrate/frame/revive/rpc/src/lib.rs | 57 +-- substrate/frame/revive/src/evm/api.rs | 2 - substrate/frame/revive/src/evm/api/account.rs | 28 +- .../frame/revive/src/evm/api/rlp_codec.rs | 471 ++++++++++++++++-- .../frame/revive/src/evm/api/rpc_types.rs | 140 +++++- .../frame/revive/src/evm/api/rpc_types_gen.rs | 18 +- .../frame/revive/src/evm/api/signature.rs | 190 +++++-- substrate/frame/revive/src/evm/api/type_id.rs | 22 +- substrate/frame/revive/src/evm/runtime.rs | 39 +- substrate/frame/revive/src/lib.rs | 2 +- 13 files changed, 824 insertions(+), 190 deletions(-) create mode 100644 prdoc/pr_6461.prdoc diff --git a/prdoc/pr_6461.prdoc b/prdoc/pr_6461.prdoc new file mode 100644 index 000000000000..1b3d1e8b0364 --- /dev/null +++ b/prdoc/pr_6461.prdoc @@ -0,0 +1,12 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json +title: '[pallet-revive] add support for all eth tx types' +doc: +- audience: Runtime Dev + description: Add support for 1559, 4844, and 2930 transaction types +crates: +- name: pallet-revive-eth-rpc + bump: minor +- name: pallet-revive + bump: minor + diff --git a/substrate/frame/revive/rpc/src/client.rs b/substrate/frame/revive/rpc/src/client.rs index 1ca1a6d37c53..d37f1d760065 100644 --- a/substrate/frame/revive/rpc/src/client.rs +++ b/substrate/frame/revive/rpc/src/client.rs @@ -17,13 +17,12 @@ //! The client connects to the source substrate chain //! and is used by the rpc server to query and send transactions to the substrate chain. use crate::{ - rlp, runtime::GAS_PRICE, subxt_client::{ revive::{calls::types::EthTransact, events::ContractEmitted}, runtime_types::pallet_revive::storage::ContractInfo, }, - TransactionLegacySigned, LOG_TARGET, + LOG_TARGET, }; use futures::{stream, StreamExt}; use jsonrpsee::types::{error::CALL_EXECUTION_FAILED_CODE, ErrorObjectOwned}; @@ -269,25 +268,26 @@ impl ClientInner { let extrinsics = extrinsics.iter().flat_map(|ext| { let call = ext.as_extrinsic::().ok()??; let transaction_hash = H256(keccak_256(&call.payload)); - let tx = rlp::decode::(&call.payload).ok()?; - let from = tx.recover_eth_address().ok()?; - let contract_address = if tx.transaction_legacy_unsigned.to.is_none() { - Some(create1(&from, tx.transaction_legacy_unsigned.nonce.try_into().ok()?)) + let signed_tx = TransactionSigned::decode(&call.payload).ok()?; + let from = signed_tx.recover_eth_address().ok()?; + let tx_info = GenericTransaction::from_signed(signed_tx.clone(), Some(from)); + let contract_address = if tx_info.to.is_none() { + Some(create1(&from, tx_info.nonce.unwrap_or_default().try_into().ok()?)) } else { None }; - Some((from, tx, transaction_hash, contract_address, ext)) + Some((from, signed_tx, tx_info, transaction_hash, contract_address, ext)) }); // Map each extrinsic to a receipt stream::iter(extrinsics) - .map(|(from, tx, transaction_hash, contract_address, ext)| async move { + .map(|(from, signed_tx, tx_info, transaction_hash, contract_address, ext)| async move { let events = ext.events().await?; let tx_fees = events.find_first::()?.ok_or(ClientError::TxFeeNotFound)?; - let gas_price = tx.transaction_legacy_unsigned.gas_price; + let gas_price = tx_info.gas_price.unwrap_or_default(); let gas_used = (tx_fees.tip.saturating_add(tx_fees.actual_fee)) .checked_div(gas_price.as_u128()) .unwrap_or_default(); @@ -324,16 +324,16 @@ impl ClientInner { contract_address, from, logs, - tx.transaction_legacy_unsigned.to, + tx_info.to, gas_price, gas_used.into(), success, transaction_hash, transaction_index.into(), - tx.transaction_legacy_unsigned.r#type.as_byte() + tx_info.r#type.unwrap_or_default() ); - Ok::<_, ClientError>((receipt.transaction_hash, (tx.into(), receipt))) + Ok::<_, ClientError>((receipt.transaction_hash, (signed_tx, receipt))) }) .buffer_unordered(10) .collect::>>() diff --git a/substrate/frame/revive/rpc/src/example.rs b/substrate/frame/revive/rpc/src/example.rs index 20f00465b146..3b9a33296ef4 100644 --- a/substrate/frame/revive/rpc/src/example.rs +++ b/substrate/frame/revive/rpc/src/example.rs @@ -20,8 +20,7 @@ use crate::{EthRpcClient, ReceiptInfo}; use anyhow::Context; use pallet_revive::evm::{ - rlp::*, Account, BlockTag, Bytes, GenericTransaction, TransactionLegacyUnsigned, H160, H256, - U256, + Account, BlockTag, Bytes, GenericTransaction, TransactionLegacyUnsigned, H160, H256, U256, }; /// Wait for a transaction receipt. @@ -169,11 +168,11 @@ impl TransactionBuilder { mutate(&mut unsigned_tx); - let tx = signer.sign_transaction(unsigned_tx.clone()); - let bytes = tx.rlp_bytes().to_vec(); + let tx = signer.sign_transaction(unsigned_tx.into()); + let bytes = tx.signed_payload(); let hash = client - .send_raw_transaction(bytes.clone().into()) + .send_raw_transaction(bytes.into()) .await .with_context(|| "transaction failed")?; diff --git a/substrate/frame/revive/rpc/src/lib.rs b/substrate/frame/revive/rpc/src/lib.rs index 8d9d6fab829e..6a324e63a857 100644 --- a/substrate/frame/revive/rpc/src/lib.rs +++ b/substrate/frame/revive/rpc/src/lib.rs @@ -137,7 +137,7 @@ impl EthRpcServer for EthRpcServerImpl { async fn send_raw_transaction(&self, transaction: Bytes) -> RpcResult { let hash = H256(keccak_256(&transaction.0)); - let tx = rlp::decode::(&transaction.0).map_err(|err| { + let tx = TransactionSigned::decode(&transaction.0).map_err(|err| { log::debug!(target: LOG_TARGET, "Failed to decode transaction: {err:?}"); EthRpcError::from(err) })?; @@ -147,21 +147,10 @@ impl EthRpcServer for EthRpcServerImpl { EthRpcError::InvalidSignature })?; + let tx = GenericTransaction::from_signed(tx, Some(eth_addr)); + // Dry run the transaction to get the weight limit and storage deposit limit - let TransactionLegacyUnsigned { to, input, value, .. } = tx.transaction_legacy_unsigned; - let dry_run = self - .client - .dry_run( - &GenericTransaction { - from: Some(eth_addr), - input: Some(input.clone()), - to, - value: Some(value), - ..Default::default() - }, - BlockTag::Latest.into(), - ) - .await?; + let dry_run = self.client.dry_run(&tx, BlockTag::Latest.into()).await?; let EthContractResult { gas_required, storage_deposit, .. } = dry_run; let call = subxt_client::tx().revive().eth_transact( @@ -174,11 +163,10 @@ impl EthRpcServer for EthRpcServerImpl { Ok(hash) } - async fn send_transaction(&self, transaction: GenericTransaction) -> RpcResult { + async fn send_transaction(&self, mut transaction: GenericTransaction) -> RpcResult { log::debug!(target: LOG_TARGET, "{transaction:#?}"); - let GenericTransaction { from, gas, gas_price, input, to, value, r#type, .. } = transaction; - let Some(from) = from else { + let Some(from) = transaction.from else { log::debug!(target: LOG_TARGET, "Transaction must have a sender"); return Err(EthRpcError::InvalidTransaction.into()); }; @@ -189,27 +177,26 @@ impl EthRpcServer for EthRpcServerImpl { .find(|account| account.address() == from) .ok_or(EthRpcError::AccountNotFound(from))?; - let gas_price = gas_price.unwrap_or_else(|| U256::from(GAS_PRICE)); - let chain_id = Some(self.client.chain_id().into()); - let input = input.unwrap_or_default(); - let value = value.unwrap_or_default(); - let r#type = r#type.unwrap_or_default(); + if transaction.gas.is_none() { + transaction.gas = Some(self.estimate_gas(transaction.clone(), None).await?); + } - let Some(gas) = gas else { - log::debug!(target: LOG_TARGET, "Transaction must have a gas limit"); - return Err(EthRpcError::InvalidTransaction.into()); - }; + if transaction.gas_price.is_none() { + transaction.gas_price = Some(self.gas_price().await?); + } - let r#type = Type0::try_from_byte(r#type.clone()) - .map_err(|_| EthRpcError::TransactionTypeNotSupported(r#type))?; + if transaction.nonce.is_none() { + transaction.nonce = + Some(self.get_transaction_count(from, BlockTag::Latest.into()).await?); + } - let nonce = self.get_transaction_count(from, BlockTag::Latest.into()).await?; + if transaction.chain_id.is_none() { + transaction.chain_id = Some(self.chain_id().await?); + } - let tx = - TransactionLegacyUnsigned { chain_id, gas, gas_price, input, nonce, to, value, r#type }; - let tx = account.sign_transaction(tx); - let rlp_bytes = rlp::encode(&tx).to_vec(); - self.send_raw_transaction(Bytes(rlp_bytes)).await + let tx = transaction.try_into_unsigned().map_err(|_| EthRpcError::InvalidTransaction)?; + let payload = account.sign_transaction(tx).signed_payload(); + self.send_raw_transaction(Bytes(payload)).await } async fn get_block_by_hash( diff --git a/substrate/frame/revive/src/evm/api.rs b/substrate/frame/revive/src/evm/api.rs index 8185a2c8f6f8..fe18c8735bed 100644 --- a/substrate/frame/revive/src/evm/api.rs +++ b/substrate/frame/revive/src/evm/api.rs @@ -25,9 +25,7 @@ pub use rlp; mod type_id; pub use type_id::*; -#[cfg(feature = "std")] mod rpc_types; - mod rpc_types_gen; pub use rpc_types_gen::*; diff --git a/substrate/frame/revive/src/evm/api/account.rs b/substrate/frame/revive/src/evm/api/account.rs index 8365ebf83cae..ba1c68ea0cf7 100644 --- a/substrate/frame/revive/src/evm/api/account.rs +++ b/substrate/frame/revive/src/evm/api/account.rs @@ -16,10 +16,9 @@ // limitations under the License. //! Utilities for working with Ethereum accounts. use crate::{ - evm::{TransactionLegacySigned, TransactionLegacyUnsigned}, + evm::{TransactionSigned, TransactionUnsigned}, H160, }; -use rlp::Encodable; use sp_runtime::AccountId32; /// A simple account that can sign transactions @@ -38,6 +37,11 @@ impl From for Account { } impl Account { + /// Create a new account from a secret + pub fn from_secret_key(secret_key: [u8; 32]) -> Self { + subxt_signer::eth::Keypair::from_secret_key(secret_key).unwrap().into() + } + /// Get the [`H160`] address of the account. pub fn address(&self) -> H160 { H160::from_slice(&self.0.public_key().to_account_id().as_ref()) @@ -52,9 +56,21 @@ impl Account { } /// Sign a transaction. - pub fn sign_transaction(&self, tx: TransactionLegacyUnsigned) -> TransactionLegacySigned { - let rlp_encoded = tx.rlp_bytes(); - let signature = self.0.sign(&rlp_encoded); - TransactionLegacySigned::from(tx, signature.as_ref()) + pub fn sign_transaction(&self, tx: TransactionUnsigned) -> TransactionSigned { + let payload = tx.unsigned_payload(); + let signature = self.0.sign(&payload).0; + tx.with_signature(signature) } } + +#[test] +fn from_secret_key_works() { + let account = Account::from_secret_key(hex_literal::hex!( + "a872f6cbd25a0e04a08b1e21098017a9e6194d101d75e13111f71410c59cd57f" + )); + + assert_eq!( + account.address(), + H160::from(hex_literal::hex!("75e480db528101a381ce68544611c169ad7eb342")) + ) +} diff --git a/substrate/frame/revive/src/evm/api/rlp_codec.rs b/substrate/frame/revive/src/evm/api/rlp_codec.rs index e5f24c28a482..3442ed73acca 100644 --- a/substrate/frame/revive/src/evm/api/rlp_codec.rs +++ b/substrate/frame/revive/src/evm/api/rlp_codec.rs @@ -21,6 +21,73 @@ use super::*; use alloc::vec::Vec; use rlp::{Decodable, Encodable}; +impl TransactionUnsigned { + /// Return the bytes to be signed by the private key. + pub fn unsigned_payload(&self) -> Vec { + use TransactionUnsigned::*; + let mut s = rlp::RlpStream::new(); + match self { + Transaction2930Unsigned(ref tx) => { + s.append(&tx.r#type.value()); + s.append(tx); + }, + Transaction1559Unsigned(ref tx) => { + s.append(&tx.r#type.value()); + s.append(tx); + }, + Transaction4844Unsigned(ref tx) => { + s.append(&tx.r#type.value()); + s.append(tx); + }, + TransactionLegacyUnsigned(ref tx) => { + s.append(tx); + }, + } + + s.out().to_vec() + } +} + +impl TransactionSigned { + /// Encode the Ethereum transaction into bytes. + pub fn signed_payload(&self) -> Vec { + use TransactionSigned::*; + let mut s = rlp::RlpStream::new(); + match self { + Transaction2930Signed(ref tx) => { + s.append(&tx.transaction_2930_unsigned.r#type.value()); + s.append(tx); + }, + Transaction1559Signed(ref tx) => { + s.append(&tx.transaction_1559_unsigned.r#type.value()); + s.append(tx); + }, + Transaction4844Signed(ref tx) => { + s.append(&tx.transaction_4844_unsigned.r#type.value()); + s.append(tx); + }, + TransactionLegacySigned(ref tx) => { + s.append(tx); + }, + } + + s.out().to_vec() + } + + /// Decode the Ethereum transaction from bytes. + pub fn decode(data: &[u8]) -> Result { + if data.len() < 1 { + return Err(rlp::DecoderError::RlpIsTooShort); + } + match data[0] { + TYPE_EIP2930 => rlp::decode::(&data[1..]).map(Into::into), + TYPE_EIP1559 => rlp::decode::(&data[1..]).map(Into::into), + TYPE_EIP4844 => rlp::decode::(&data[1..]).map(Into::into), + _ => rlp::decode::(data).map(Into::into), + } + } +} + impl TransactionLegacyUnsigned { /// Get the rlp encoded bytes of a signed transaction with a dummy 65 bytes signature. pub fn dummy_signed_payload(&self) -> Vec { @@ -47,8 +114,8 @@ impl Encodable for TransactionLegacyUnsigned { s.append(&self.value); s.append(&self.input.0); s.append(&chain_id); - s.append(&0_u8); - s.append(&0_u8); + s.append(&0u8); + s.append(&0u8); } else { s.begin_list(6); s.append(&self.nonce); @@ -64,7 +131,6 @@ impl Encodable for TransactionLegacyUnsigned { } } -/// See impl Decodable for TransactionLegacyUnsigned { fn decode(rlp: &rlp::Rlp) -> Result { Ok(TransactionLegacyUnsigned { @@ -95,16 +161,18 @@ impl Decodable for TransactionLegacyUnsigned { impl Encodable for TransactionLegacySigned { fn rlp_append(&self, s: &mut rlp::RlpStream) { + let tx = &self.transaction_legacy_unsigned; + s.begin_list(9); - s.append(&self.transaction_legacy_unsigned.nonce); - s.append(&self.transaction_legacy_unsigned.gas_price); - s.append(&self.transaction_legacy_unsigned.gas); - match self.transaction_legacy_unsigned.to { + s.append(&tx.nonce); + s.append(&tx.gas_price); + s.append(&tx.gas); + match tx.to { Some(ref to) => s.append(to), None => s.append_empty_data(), }; - s.append(&self.transaction_legacy_unsigned.value); - s.append(&self.transaction_legacy_unsigned.input.0); + s.append(&tx.value); + s.append(&tx.input.0); s.append(&self.v); s.append(&self.r); @@ -112,6 +180,232 @@ impl Encodable for TransactionLegacySigned { } } +impl Encodable for AccessListEntry { + fn rlp_append(&self, s: &mut rlp::RlpStream) { + s.begin_list(2); + s.append(&self.address); + s.append_list(&self.storage_keys); + } +} + +impl Decodable for AccessListEntry { + fn decode(rlp: &rlp::Rlp) -> Result { + Ok(AccessListEntry { address: rlp.val_at(0)?, storage_keys: rlp.list_at(1)? }) + } +} + +/// See +impl Encodable for Transaction1559Unsigned { + fn rlp_append(&self, s: &mut rlp::RlpStream) { + s.begin_list(9); + s.append(&self.chain_id); + s.append(&self.nonce); + s.append(&self.max_priority_fee_per_gas); + s.append(&self.max_fee_per_gas); + s.append(&self.gas); + match self.to { + Some(ref to) => s.append(to), + None => s.append_empty_data(), + }; + s.append(&self.value); + s.append(&self.input.0); + s.append_list(&self.access_list); + } +} + +/// See +impl Encodable for Transaction1559Signed { + fn rlp_append(&self, s: &mut rlp::RlpStream) { + let tx = &self.transaction_1559_unsigned; + s.begin_list(12); + s.append(&tx.chain_id); + s.append(&tx.nonce); + s.append(&tx.max_priority_fee_per_gas); + s.append(&tx.max_fee_per_gas); + s.append(&tx.gas); + match tx.to { + Some(ref to) => s.append(to), + None => s.append_empty_data(), + }; + s.append(&tx.value); + s.append(&tx.input.0); + s.append_list(&tx.access_list); + + s.append(&self.y_parity); + s.append(&self.r); + s.append(&self.s); + } +} + +impl Decodable for Transaction1559Signed { + fn decode(rlp: &rlp::Rlp) -> Result { + Ok(Transaction1559Signed { + transaction_1559_unsigned: { + Transaction1559Unsigned { + chain_id: rlp.val_at(0)?, + nonce: rlp.val_at(1)?, + max_priority_fee_per_gas: rlp.val_at(2)?, + max_fee_per_gas: rlp.val_at(3)?, + gas: rlp.val_at(4)?, + to: { + let to = rlp.at(5)?; + if to.is_empty() { + None + } else { + Some(to.as_val()?) + } + }, + value: rlp.val_at(6)?, + input: Bytes(rlp.val_at(7)?), + access_list: rlp.list_at(8)?, + ..Default::default() + } + }, + y_parity: rlp.val_at(9)?, + r: rlp.val_at(10)?, + s: rlp.val_at(11)?, + ..Default::default() + }) + } +} + +//See https://eips.ethereum.org/EIPS/eip-2930 +impl Encodable for Transaction2930Unsigned { + fn rlp_append(&self, s: &mut rlp::RlpStream) { + s.begin_list(8); + s.append(&self.chain_id); + s.append(&self.nonce); + s.append(&self.gas_price); + s.append(&self.gas); + match self.to { + Some(ref to) => s.append(to), + None => s.append_empty_data(), + }; + s.append(&self.value); + s.append(&self.input.0); + s.append_list(&self.access_list); + } +} + +//See https://eips.ethereum.org/EIPS/eip-2930 +impl Encodable for Transaction2930Signed { + fn rlp_append(&self, s: &mut rlp::RlpStream) { + let tx = &self.transaction_2930_unsigned; + s.begin_list(11); + s.append(&tx.chain_id); + s.append(&tx.nonce); + s.append(&tx.gas_price); + s.append(&tx.gas); + match tx.to { + Some(ref to) => s.append(to), + None => s.append_empty_data(), + }; + s.append(&tx.value); + s.append(&tx.input.0); + s.append_list(&tx.access_list); + s.append(&self.y_parity); + s.append(&self.r); + s.append(&self.s); + } +} + +impl Decodable for Transaction2930Signed { + fn decode(rlp: &rlp::Rlp) -> Result { + Ok(Transaction2930Signed { + transaction_2930_unsigned: { + Transaction2930Unsigned { + chain_id: rlp.val_at(0)?, + nonce: rlp.val_at(1)?, + gas_price: rlp.val_at(2)?, + gas: rlp.val_at(3)?, + to: { + let to = rlp.at(4)?; + if to.is_empty() { + None + } else { + Some(to.as_val()?) + } + }, + value: rlp.val_at(5)?, + input: Bytes(rlp.val_at(6)?), + access_list: rlp.list_at(7)?, + ..Default::default() + } + }, + y_parity: rlp.val_at(8)?, + r: rlp.val_at(9)?, + s: rlp.val_at(10)?, + ..Default::default() + }) + } +} + +//See https://eips.ethereum.org/EIPS/eip-4844 +impl Encodable for Transaction4844Unsigned { + fn rlp_append(&self, s: &mut rlp::RlpStream) { + s.begin_list(11); + s.append(&self.chain_id); + s.append(&self.nonce); + s.append(&self.max_priority_fee_per_gas); + s.append(&self.max_fee_per_gas); + s.append(&self.gas); + s.append(&self.to); + s.append(&self.value); + s.append(&self.input.0); + s.append_list(&self.access_list); + s.append(&self.max_fee_per_blob_gas); + s.append_list(&self.blob_versioned_hashes); + } +} + +//See https://eips.ethereum.org/EIPS/eip-4844 +impl Encodable for Transaction4844Signed { + fn rlp_append(&self, s: &mut rlp::RlpStream) { + let tx = &self.transaction_4844_unsigned; + s.begin_list(14); + s.append(&tx.chain_id); + s.append(&tx.nonce); + s.append(&tx.max_priority_fee_per_gas); + s.append(&tx.max_fee_per_gas); + s.append(&tx.gas); + s.append(&tx.to); + s.append(&tx.value); + s.append(&tx.input.0); + s.append_list(&tx.access_list); + s.append(&tx.max_fee_per_blob_gas); + s.append_list(&tx.blob_versioned_hashes); + s.append(&self.y_parity); + s.append(&self.r); + s.append(&self.s); + } +} + +impl Decodable for Transaction4844Signed { + fn decode(rlp: &rlp::Rlp) -> Result { + Ok(Transaction4844Signed { + transaction_4844_unsigned: { + Transaction4844Unsigned { + chain_id: rlp.val_at(0)?, + nonce: rlp.val_at(1)?, + max_priority_fee_per_gas: rlp.val_at(2)?, + max_fee_per_gas: rlp.val_at(3)?, + gas: rlp.val_at(4)?, + to: rlp.val_at(5)?, + value: rlp.val_at(6)?, + input: Bytes(rlp.val_at(7)?), + access_list: rlp.list_at(8)?, + max_fee_per_blob_gas: rlp.val_at(9)?, + blob_versioned_hashes: rlp.list_at(10)?, + ..Default::default() + } + }, + y_parity: rlp.val_at(11)?, + r: rlp.val_at(12)?, + s: rlp.val_at(13)?, + }) + } +} + /// See impl Decodable for TransactionLegacySigned { fn decode(rlp: &rlp::Rlp) -> Result { @@ -142,7 +436,7 @@ impl Decodable for TransactionLegacySigned { value: rlp.val_at(4)?, input: Bytes(rlp.val_at(5)?), chain_id: extract_chain_id(v).map(|v| v.into()), - r#type: Type0 {}, + r#type: TypeLegacy {}, } }, v, @@ -157,26 +451,118 @@ mod test { use super::*; #[test] - fn encode_decode_legacy_transaction_works() { - let tx = TransactionLegacyUnsigned { - chain_id: Some(596.into()), - gas: U256::from(21000), - nonce: U256::from(1), - gas_price: U256::from("0x640000006a"), - to: Some(Account::from(subxt_signer::eth::dev::baltathar()).address()), - value: U256::from(123123), - input: Bytes(vec![]), - r#type: Type0, - }; + fn encode_decode_tx_works() { + let txs = [ + // Legacy + ( + "f86080808301e24194095e7baea6a6c7c4c2dfeb977efac326af552d87808025a0fe38ca4e44a30002ac54af7cf922a6ac2ba11b7d22f548e8ecb3f51f41cb31b0a06de6a5cbae13c0c856e33acf021b51819636cfc009d39eafb9f606d546e305a8", + r#" + { + "chainId": "0x1", + "gas": "0x1e241", + "gasPrice": "0x0", + "input": "0x", + "nonce": "0x0", + "to": "0x095e7baea6a6c7c4c2dfeb977efac326af552d87", + "type": "0x0", + "value": "0x0", + "r": "0xfe38ca4e44a30002ac54af7cf922a6ac2ba11b7d22f548e8ecb3f51f41cb31b0", + "s": "0x6de6a5cbae13c0c856e33acf021b51819636cfc009d39eafb9f606d546e305a8", + "v": "0x25" + } + "# + ), + // type 1: EIP2930 + ( + "01f89b0180808301e24194095e7baea6a6c7c4c2dfeb977efac326af552d878080f838f7940000000000000000000000000000000000000001e1a0000000000000000000000000000000000000000000000000000000000000000080a0fe38ca4e44a30002ac54af7cf922a6ac2ba11b7d22f548e8ecb3f51f41cb31b0a06de6a5cbae13c0c856e33acf021b51819636cfc009d39eafb9f606d546e305a8", + r#" + { + "accessList": [ + { + "address": "0x0000000000000000000000000000000000000001", + "storageKeys": ["0x0000000000000000000000000000000000000000000000000000000000000000"] + } + ], + "chainId": "0x1", + "gas": "0x1e241", + "gasPrice": "0x0", + "input": "0x", + "nonce": "0x0", + "to": "0x095e7baea6a6c7c4c2dfeb977efac326af552d87", + "type": "0x1", + "value": "0x0", + "r": "0xfe38ca4e44a30002ac54af7cf922a6ac2ba11b7d22f548e8ecb3f51f41cb31b0", + "s": "0x6de6a5cbae13c0c856e33acf021b51819636cfc009d39eafb9f606d546e305a8", + "yParity": "0x0" + } + "# + ), + // type 2: EIP1559 + ( + "02f89c018080018301e24194095e7baea6a6c7c4c2dfeb977efac326af552d878080f838f7940000000000000000000000000000000000000001e1a0000000000000000000000000000000000000000000000000000000000000000080a0fe38ca4e44a30002ac54af7cf922a6ac2ba11b7d22f548e8ecb3f51f41cb31b0a06de6a5cbae13c0c856e33acf021b51819636cfc009d39eafb9f606d546e305a8", + r#" + { + "accessList": [ + { + "address": "0x0000000000000000000000000000000000000001", + "storageKeys": ["0x0000000000000000000000000000000000000000000000000000000000000000"] + } + ], + "chainId": "0x1", + "gas": "0x1e241", + "gasPrice": "0x0", + "input": "0x", + "maxFeePerGas": "0x1", + "maxPriorityFeePerGas": "0x0", + "nonce": "0x0", + "to": "0x095e7baea6a6c7c4c2dfeb977efac326af552d87", + "type": "0x2", + "value": "0x0", + "r": "0xfe38ca4e44a30002ac54af7cf922a6ac2ba11b7d22f548e8ecb3f51f41cb31b0", + "s": "0x6de6a5cbae13c0c856e33acf021b51819636cfc009d39eafb9f606d546e305a8", + "yParity": "0x0" - let rlp_bytes = rlp::encode(&tx); - let decoded = rlp::decode::(&rlp_bytes).unwrap(); - assert_eq!(&tx, &decoded); + } + "# + ), + // type 3: EIP4844 + ( - let tx = Account::default().sign_transaction(tx); - let rlp_bytes = rlp::encode(&tx); - let decoded = rlp::decode::(&rlp_bytes).unwrap(); - assert_eq!(&tx, &decoded); + "03f8bf018002018301e24194095e7baea6a6c7c4c2dfeb977efac326af552d878080f838f7940000000000000000000000000000000000000001e1a0000000000000000000000000000000000000000000000000000000000000000080e1a0000000000000000000000000000000000000000000000000000000000000000080a0fe38ca4e44a30002ac54af7cf922a6ac2ba11b7d22f548e8ecb3f51f41cb31b0a06de6a5cbae13c0c856e33acf021b51819636cfc009d39eafb9f606d546e305a8", + r#" + { + "accessList": [ + { + "address": "0x0000000000000000000000000000000000000001", + "storageKeys": ["0x0000000000000000000000000000000000000000000000000000000000000000"] + } + ], + "blobVersionedHashes": ["0x0000000000000000000000000000000000000000000000000000000000000000"], + "chainId": "0x1", + "gas": "0x1e241", + "input": "0x", + "maxFeePerBlobGas": "0x0", + "maxFeePerGas": "0x1", + "maxPriorityFeePerGas": "0x2", + "nonce": "0x0", + "to": "0x095e7baea6a6c7c4c2dfeb977efac326af552d87", + "type": "0x3", + "value": "0x0", + "r": "0xfe38ca4e44a30002ac54af7cf922a6ac2ba11b7d22f548e8ecb3f51f41cb31b0", + "s": "0x6de6a5cbae13c0c856e33acf021b51819636cfc009d39eafb9f606d546e305a8", + "yParity": "0x0" + } + "# + ) + ]; + + for (tx, json) in txs { + let raw_tx = hex::decode(tx).unwrap(); + let tx = TransactionSigned::decode(&raw_tx).unwrap(); + assert_eq!(tx.signed_payload(), raw_tx); + let expected_tx = serde_json::from_str(json).unwrap(); + assert_eq!(tx, expected_tx); + } } #[test] @@ -189,31 +575,12 @@ mod test { to: Some(Account::from(subxt_signer::eth::dev::baltathar()).address()), value: U256::from(123123), input: Bytes(vec![]), - r#type: Type0, + r#type: TypeLegacy, }; - let signed_tx = Account::default().sign_transaction(tx.clone()); - let rlp_bytes = rlp::encode(&signed_tx); - assert_eq!(tx.dummy_signed_payload().len(), rlp_bytes.len()); - } - - #[test] - fn recover_address_works() { - let account = Account::default(); - - let unsigned_tx = TransactionLegacyUnsigned { - value: 200_000_000_000_000_000_000u128.into(), - gas_price: 100_000_000_200u64.into(), - gas: 100_107u32.into(), - nonce: 3.into(), - to: Some(Account::from(subxt_signer::eth::dev::baltathar()).address()), - chain_id: Some(596.into()), - ..Default::default() - }; - - let tx = account.sign_transaction(unsigned_tx.clone()); - let recovered_address = tx.recover_eth_address().unwrap(); - - assert_eq!(account.address(), recovered_address); + let dummy_signed_payload = tx.dummy_signed_payload(); + let tx: TransactionUnsigned = tx.into(); + let payload = Account::default().sign_transaction(tx).signed_payload(); + assert_eq!(dummy_signed_payload.len(), payload.len()); } } diff --git a/substrate/frame/revive/src/evm/api/rpc_types.rs b/substrate/frame/revive/src/evm/api/rpc_types.rs index dd1a2642724d..1cf8d984b68b 100644 --- a/substrate/frame/revive/src/evm/api/rpc_types.rs +++ b/substrate/frame/revive/src/evm/api/rpc_types.rs @@ -16,7 +16,8 @@ // limitations under the License. //! Utility impl for the RPC types. use super::*; -use sp_core::U256; +use alloc::vec::Vec; +use sp_core::{H160, U256}; impl TransactionInfo { /// Create a new [`TransactionInfo`] from a receipt and a signed transaction. @@ -138,3 +139,140 @@ fn logs_bloom_works() { .unwrap(); assert_eq!(receipt.logs_bloom, ReceiptInfo::logs_bloom(&receipt.logs)); } + +impl GenericTransaction { + /// Create a new [`GenericTransaction`] from a signed transaction. + pub fn from_signed(tx: TransactionSigned, from: Option) -> Self { + use TransactionSigned::*; + match tx { + TransactionLegacySigned(tx) => { + let tx = tx.transaction_legacy_unsigned; + GenericTransaction { + from, + r#type: Some(tx.r#type.as_byte()), + chain_id: tx.chain_id, + input: Some(tx.input), + nonce: Some(tx.nonce), + value: Some(tx.value), + to: tx.to, + gas: Some(tx.gas), + gas_price: Some(tx.gas_price), + ..Default::default() + } + }, + Transaction4844Signed(tx) => { + let tx = tx.transaction_4844_unsigned; + GenericTransaction { + from, + r#type: Some(tx.r#type.as_byte()), + chain_id: Some(tx.chain_id), + input: Some(tx.input), + nonce: Some(tx.nonce), + value: Some(tx.value), + to: Some(tx.to), + gas: Some(tx.gas), + gas_price: Some(tx.max_fee_per_blob_gas), + access_list: Some(tx.access_list), + blob_versioned_hashes: Some(tx.blob_versioned_hashes), + max_fee_per_blob_gas: Some(tx.max_fee_per_blob_gas), + max_fee_per_gas: Some(tx.max_fee_per_gas), + max_priority_fee_per_gas: Some(tx.max_priority_fee_per_gas), + ..Default::default() + } + }, + Transaction1559Signed(tx) => { + let tx = tx.transaction_1559_unsigned; + GenericTransaction { + from, + r#type: Some(tx.r#type.as_byte()), + chain_id: Some(tx.chain_id), + input: Some(tx.input), + nonce: Some(tx.nonce), + value: Some(tx.value), + to: tx.to, + gas: Some(tx.gas), + gas_price: Some(tx.gas_price), + access_list: Some(tx.access_list), + max_fee_per_gas: Some(tx.max_fee_per_gas), + max_priority_fee_per_gas: Some(tx.max_priority_fee_per_gas), + ..Default::default() + } + }, + Transaction2930Signed(tx) => { + let tx = tx.transaction_2930_unsigned; + GenericTransaction { + from, + r#type: Some(tx.r#type.as_byte()), + chain_id: Some(tx.chain_id), + input: Some(tx.input), + nonce: Some(tx.nonce), + value: Some(tx.value), + to: tx.to, + gas: Some(tx.gas), + gas_price: Some(tx.gas_price), + access_list: Some(tx.access_list), + ..Default::default() + } + }, + } + } + + /// Convert to a [`TransactionUnsigned`]. + pub fn try_into_unsigned(self) -> Result { + match self.r#type.unwrap_or_default().0 { + TYPE_LEGACY => Ok(TransactionLegacyUnsigned { + r#type: TypeLegacy {}, + chain_id: self.chain_id, + input: self.input.unwrap_or_default(), + nonce: self.nonce.unwrap_or_default(), + value: self.value.unwrap_or_default(), + to: self.to, + gas: self.gas.unwrap_or_default(), + gas_price: self.gas_price.unwrap_or_default(), + } + .into()), + TYPE_EIP1559 => Ok(Transaction1559Unsigned { + r#type: TypeEip1559 {}, + chain_id: self.chain_id.unwrap_or_default(), + input: self.input.unwrap_or_default(), + nonce: self.nonce.unwrap_or_default(), + value: self.value.unwrap_or_default(), + to: self.to, + gas: self.gas.unwrap_or_default(), + gas_price: self.gas_price.unwrap_or_default(), + access_list: self.access_list.unwrap_or_default(), + max_fee_per_gas: self.max_fee_per_gas.unwrap_or_default(), + max_priority_fee_per_gas: self.max_priority_fee_per_gas.unwrap_or_default(), + } + .into()), + TYPE_EIP2930 => Ok(Transaction2930Unsigned { + r#type: TypeEip2930 {}, + chain_id: self.chain_id.unwrap_or_default(), + input: self.input.unwrap_or_default(), + nonce: self.nonce.unwrap_or_default(), + value: self.value.unwrap_or_default(), + to: self.to, + gas: self.gas.unwrap_or_default(), + gas_price: self.gas_price.unwrap_or_default(), + access_list: self.access_list.unwrap_or_default(), + } + .into()), + TYPE_EIP4844 => Ok(Transaction4844Unsigned { + r#type: TypeEip4844 {}, + chain_id: self.chain_id.unwrap_or_default(), + input: self.input.unwrap_or_default(), + nonce: self.nonce.unwrap_or_default(), + value: self.value.unwrap_or_default(), + to: self.to.unwrap_or_default(), + gas: self.gas.unwrap_or_default(), + max_fee_per_gas: self.max_fee_per_gas.unwrap_or_default(), + max_fee_per_blob_gas: self.max_fee_per_blob_gas.unwrap_or_default(), + max_priority_fee_per_gas: self.max_priority_fee_per_gas.unwrap_or_default(), + access_list: self.access_list.unwrap_or_default(), + blob_versioned_hashes: self.blob_versioned_hashes.unwrap_or_default(), + } + .into()), + _ => Err(()), + } + } +} diff --git a/substrate/frame/revive/src/evm/api/rpc_types_gen.rs b/substrate/frame/revive/src/evm/api/rpc_types_gen.rs index 48045a6acc86..5037ec05d881 100644 --- a/substrate/frame/revive/src/evm/api/rpc_types_gen.rs +++ b/substrate/frame/revive/src/evm/api/rpc_types_gen.rs @@ -17,7 +17,7 @@ //! Generated JSON-RPC types. #![allow(missing_docs)] -use super::{byte::*, Type0, Type1, Type2, Type3}; +use super::{byte::*, TypeEip1559, TypeEip2930, TypeEip4844, TypeLegacy}; use alloc::vec::Vec; use codec::{Decode, Encode}; use derive_more::{From, TryInto}; @@ -455,7 +455,7 @@ pub struct Transaction1559Unsigned { /// to address pub to: Option
, /// type - pub r#type: Type2, + pub r#type: TypeEip1559, /// value pub value: U256, } @@ -486,7 +486,7 @@ pub struct Transaction2930Unsigned { /// to address pub to: Option
, /// type - pub r#type: Type1, + pub r#type: TypeEip2930, /// value pub value: U256, } @@ -530,7 +530,7 @@ pub struct Transaction4844Unsigned { /// to address pub to: Address, /// type - pub r#type: Type3, + pub r#type: TypeEip4844, /// value pub value: U256, } @@ -557,7 +557,7 @@ pub struct TransactionLegacyUnsigned { /// to address pub to: Option
, /// type - pub r#type: Type0, + pub r#type: TypeLegacy, /// value pub value: U256, } @@ -622,8 +622,8 @@ pub struct Transaction1559Signed { pub v: Option, /// yParity /// The parity (0 for even, 1 for odd) of the y-value of the secp256k1 signature. - #[serde(rename = "yParity", skip_serializing_if = "Option::is_none")] - pub y_parity: Option, + #[serde(rename = "yParity")] + pub y_parity: U256, } /// Signed 2930 Transaction @@ -661,8 +661,8 @@ pub struct Transaction4844Signed { pub s: U256, /// yParity /// The parity (0 for even, 1 for odd) of the y-value of the secp256k1 signature. - #[serde(rename = "yParity", skip_serializing_if = "Option::is_none")] - pub y_parity: Option, + #[serde(rename = "yParity")] + pub y_parity: U256, } /// Signed Legacy Transaction diff --git a/substrate/frame/revive/src/evm/api/signature.rs b/substrate/frame/revive/src/evm/api/signature.rs index 957d50c8e324..9f39b92b461e 100644 --- a/substrate/frame/revive/src/evm/api/signature.rs +++ b/substrate/frame/revive/src/evm/api/signature.rs @@ -15,49 +15,11 @@ // See the License for the specific language governing permissions and // limitations under the License. //! Ethereum signature utilities -use super::{TransactionLegacySigned, TransactionLegacyUnsigned}; -use rlp::Encodable; +use super::*; use sp_core::{H160, U256}; use sp_io::{crypto::secp256k1_ecdsa_recover, hashing::keccak_256}; -impl TransactionLegacyUnsigned { - /// Recover the Ethereum address, from an RLP encoded transaction and a 65 bytes signature. - pub fn recover_eth_address(rlp_encoded: &[u8], signature: &[u8; 65]) -> Result { - let hash = keccak_256(rlp_encoded); - let mut addr = H160::default(); - let pk = secp256k1_ecdsa_recover(&signature, &hash).map_err(|_| ())?; - addr.assign_from_slice(&keccak_256(&pk[..])[12..]); - - Ok(addr) - } -} - impl TransactionLegacySigned { - /// Create a signed transaction from an [`TransactionLegacyUnsigned`] and a signature. - pub fn from( - transaction_legacy_unsigned: TransactionLegacyUnsigned, - signature: &[u8; 65], - ) -> TransactionLegacySigned { - let r = U256::from_big_endian(&signature[..32]); - let s = U256::from_big_endian(&signature[32..64]); - let recovery_id = signature[64] as u32; - let v = transaction_legacy_unsigned - .chain_id - .map(|chain_id| chain_id * 2 + 35 + recovery_id) - .unwrap_or_else(|| U256::from(27) + recovery_id); - - TransactionLegacySigned { transaction_legacy_unsigned, r, s, v } - } - - /// Get the raw 65 bytes signature from the signed transaction. - pub fn raw_signature(&self) -> Result<[u8; 65], ()> { - let mut s = [0u8; 65]; - self.r.write_as_big_endian(s[0..32].as_mut()); - self.s.write_as_big_endian(s[32..64].as_mut()); - s[64] = self.extract_recovery_id().ok_or(())?; - Ok(s) - } - /// Get the recovery ID from the signed transaction. /// See https://eips.ethereum.org/EIPS/eip-155 fn extract_recovery_id(&self) -> Option { @@ -71,10 +33,154 @@ impl TransactionLegacySigned { self.v.try_into().ok() } } +} + +impl TransactionUnsigned { + /// Extract the unsigned transaction from a signed transaction. + pub fn from_signed(tx: TransactionSigned) -> Self { + match tx { + TransactionSigned::TransactionLegacySigned(signed) => + Self::TransactionLegacyUnsigned(signed.transaction_legacy_unsigned), + TransactionSigned::Transaction4844Signed(signed) => + Self::Transaction4844Unsigned(signed.transaction_4844_unsigned), + TransactionSigned::Transaction1559Signed(signed) => + Self::Transaction1559Unsigned(signed.transaction_1559_unsigned), + TransactionSigned::Transaction2930Signed(signed) => + Self::Transaction2930Unsigned(signed.transaction_2930_unsigned), + } + } + + /// Create a signed transaction from an [`TransactionUnsigned`] and a signature. + pub fn with_signature(self, signature: [u8; 65]) -> TransactionSigned { + let r = U256::from_big_endian(&signature[..32]); + let s = U256::from_big_endian(&signature[32..64]); + let recovery_id = signature[64]; + + match self { + TransactionUnsigned::Transaction2930Unsigned(transaction_2930_unsigned) => + Transaction2930Signed { + transaction_2930_unsigned, + r, + s, + v: None, + y_parity: U256::from(recovery_id), + } + .into(), + TransactionUnsigned::Transaction1559Unsigned(transaction_1559_unsigned) => + Transaction1559Signed { + transaction_1559_unsigned, + r, + s, + v: None, + y_parity: U256::from(recovery_id), + } + .into(), + + TransactionUnsigned::Transaction4844Unsigned(transaction_4844_unsigned) => + Transaction4844Signed { + transaction_4844_unsigned, + r, + s, + y_parity: U256::from(recovery_id), + } + .into(), + + TransactionUnsigned::TransactionLegacyUnsigned(transaction_legacy_unsigned) => { + let v = transaction_legacy_unsigned + .chain_id + .map(|chain_id| { + chain_id + .saturating_mul(U256::from(2)) + .saturating_add(U256::from(35u32 + recovery_id as u32)) + }) + .unwrap_or_else(|| U256::from(27u32 + recovery_id as u32)); + + TransactionLegacySigned { transaction_legacy_unsigned, r, s, v }.into() + }, + } + } +} + +impl TransactionSigned { + /// Get the raw 65 bytes signature from the signed transaction. + pub fn raw_signature(&self) -> Result<[u8; 65], ()> { + use TransactionSigned::*; + let (r, s, v) = match self { + TransactionLegacySigned(tx) => (tx.r, tx.s, tx.extract_recovery_id().ok_or(())?), + Transaction4844Signed(tx) => (tx.r, tx.s, tx.y_parity.try_into().map_err(|_| ())?), + Transaction1559Signed(tx) => (tx.r, tx.s, tx.y_parity.try_into().map_err(|_| ())?), + Transaction2930Signed(tx) => (tx.r, tx.s, tx.y_parity.try_into().map_err(|_| ())?), + }; + let mut sig = [0u8; 65]; + r.write_as_big_endian(sig[0..32].as_mut()); + s.write_as_big_endian(sig[32..64].as_mut()); + sig[64] = v; + Ok(sig) + } - /// Recover the Ethereum address from the signed transaction. + /// Recover the Ethereum address, from a signed transaction. pub fn recover_eth_address(&self) -> Result { - let rlp_encoded = self.transaction_legacy_unsigned.rlp_bytes(); - TransactionLegacyUnsigned::recover_eth_address(&rlp_encoded, &self.raw_signature()?) + use TransactionSigned::*; + + let mut s = rlp::RlpStream::new(); + match self { + TransactionLegacySigned(tx) => { + let tx = &tx.transaction_legacy_unsigned; + s.append(tx); + }, + Transaction4844Signed(tx) => { + let tx = &tx.transaction_4844_unsigned; + s.append(&tx.r#type.value()); + s.append(tx); + }, + Transaction1559Signed(tx) => { + let tx = &tx.transaction_1559_unsigned; + s.append(&tx.r#type.value()); + s.append(tx); + }, + Transaction2930Signed(tx) => { + let tx = &tx.transaction_2930_unsigned; + s.append(&tx.r#type.value()); + s.append(tx); + }, + } + let bytes = s.out().to_vec(); + let signature = self.raw_signature()?; + + let hash = keccak_256(&bytes); + let mut addr = H160::default(); + let pk = secp256k1_ecdsa_recover(&signature, &hash).map_err(|_| ())?; + addr.assign_from_slice(&keccak_256(&pk[..])[12..]); + Ok(addr) + } +} + +#[test] +fn sign_and_recover_work() { + use crate::evm::TransactionUnsigned; + let txs = [ + // Legacy + "f86080808301e24194095e7baea6a6c7c4c2dfeb977efac326af552d87808026a07b2e762a17a71a46b422e60890a04512cf0d907ccf6b78b5bd6e6977efdc2bf5a01ea673d50bbe7c2236acb498ceb8346a8607c941f0b8cbcde7cf439aa9369f1f", + //// type 1: EIP2930 + "01f89b0180808301e24194095e7baea6a6c7c4c2dfeb977efac326af552d878080f838f7940000000000000000000000000000000000000001e1a0000000000000000000000000000000000000000000000000000000000000000080a0c45a61b3d1d00169c649e7326e02857b850efb96e587db4b9aad29afc80d0752a070ae1eb47ab4097dbed2f19172ae286492621b46ac737ee6c32fb18a00c94c9c", + // type 2: EIP1559 + "02f89c018080018301e24194095e7baea6a6c7c4c2dfeb977efac326af552d878080f838f7940000000000000000000000000000000000000001e1a0000000000000000000000000000000000000000000000000000000000000000080a055d72bbc3047d4b9d3e4b8099f187143202407746118204cc2e0cb0c85a68baea04f6ef08a1418c70450f53398d9f0f2d78d9e9d6b8a80cba886b67132c4a744f2", + // type 3: EIP4844 + "03f8bf018002018301e24194095e7baea6a6c7c4c2dfeb977efac326af552d878080f838f7940000000000000000000000000000000000000001e1a0000000000000000000000000000000000000000000000000000000000000000080e1a0000000000000000000000000000000000000000000000000000000000000000001a0672b8bac466e2cf1be3148c030988d40d582763ecebbc07700dfc93bb070d8a4a07c635887005b11cb58964c04669ac2857fa633aa66f662685dadfd8bcacb0f21", + ]; + let account = Account::from_secret_key(hex_literal::hex!( + "a872f6cbd25a0e04a08b1e21098017a9e6194d101d75e13111f71410c59cd57f" + )); + + for tx in txs { + let raw_tx = hex::decode(tx).unwrap(); + let tx = TransactionSigned::decode(&raw_tx).unwrap(); + + let address = tx.recover_eth_address(); + assert_eq!(address.unwrap(), account.address()); + + let unsigned = TransactionUnsigned::from_signed(tx.clone()); + let signed = account.sign_transaction(unsigned); + assert_eq!(tx, signed); } } diff --git a/substrate/frame/revive/src/evm/api/type_id.rs b/substrate/frame/revive/src/evm/api/type_id.rs index 7434ca6e9b7f..c6e018a379b3 100644 --- a/substrate/frame/revive/src/evm/api/type_id.rs +++ b/substrate/frame/revive/src/evm/api/type_id.rs @@ -17,6 +17,7 @@ //! Ethereum Typed Transaction types use super::Byte; use codec::{Decode, Encode}; +use paste::paste; use rlp::Decodable; use scale_info::TypeInfo; use serde::{Deserialize, Deserializer, Serialize, Serializer}; @@ -29,8 +30,14 @@ macro_rules! transaction_type { #[derive(Clone, Default, Debug, Eq, PartialEq)] pub struct $name; + // upper case const name + paste! { + #[doc = concat!("Transaction value for type identifier: ", $value)] + pub const [<$name:snake:upper>]: u8 = $value; + } + impl $name { - /// Get the value of the type + /// Convert to u8 pub fn value(&self) -> u8 { $value } @@ -107,7 +114,12 @@ macro_rules! transaction_type { }; } -transaction_type!(Type0, 0); -transaction_type!(Type1, 1); -transaction_type!(Type2, 2); -transaction_type!(Type3, 3); +transaction_type!(TypeLegacy, 0); +transaction_type!(TypeEip2930, 1); +transaction_type!(TypeEip1559, 2); +transaction_type!(TypeEip4844, 3); + +#[test] +fn transaction_type() { + assert_eq!(TYPE_EIP2930, 1u8); +} diff --git a/substrate/frame/revive/src/evm/runtime.rs b/substrate/frame/revive/src/evm/runtime.rs index 21294fdf6baa..40c210304ca2 100644 --- a/substrate/frame/revive/src/evm/runtime.rs +++ b/substrate/frame/revive/src/evm/runtime.rs @@ -16,7 +16,7 @@ // limitations under the License. //! Runtime types for integrating `pallet-revive` with the EVM. use crate::{ - evm::api::{TransactionLegacySigned, TransactionLegacyUnsigned}, + evm::api::{GenericTransaction, TransactionSigned}, AccountIdOf, AddressMapper, BalanceOf, MomentOf, Weight, LOG_TARGET, }; use codec::{Decode, Encode}; @@ -293,7 +293,7 @@ pub trait EthExtra { CallOf: From>, ::Hash: frame_support::traits::IsType, { - let tx = rlp::decode::(&payload).map_err(|err| { + let tx = TransactionSigned::decode(&payload).map_err(|err| { log::debug!(target: LOG_TARGET, "Failed to decode transaction: {err:?}"); InvalidTransaction::Call })?; @@ -305,33 +305,33 @@ pub trait EthExtra { let signer = ::AddressMapper::to_fallback_account_id(&signer); - let TransactionLegacyUnsigned { nonce, chain_id, to, value, input, gas, gas_price, .. } = - tx.transaction_legacy_unsigned; + let GenericTransaction { nonce, chain_id, to, value, input, gas, gas_price, .. } = + GenericTransaction::from_signed(tx, None); if chain_id.unwrap_or_default() != ::ChainId::get().into() { log::debug!(target: LOG_TARGET, "Invalid chain_id {chain_id:?}"); return Err(InvalidTransaction::Call); } - let value = crate::Pallet::::convert_evm_to_native(value).map_err(|err| { - log::debug!(target: LOG_TARGET, "Failed to convert value to native: {err:?}"); - InvalidTransaction::Call - })?; + let value = crate::Pallet::::convert_evm_to_native(value.unwrap_or_default()) + .map_err(|err| { + log::debug!(target: LOG_TARGET, "Failed to convert value to native: {err:?}"); + InvalidTransaction::Call + })?; + let data = input.unwrap_or_default().0; let call = if let Some(dest) = to { crate::Call::call:: { dest, value, gas_limit, storage_deposit_limit, - data: input.0, + data, } } else { - let blob = match polkavm::ProgramBlob::blob_length(&input.0) { - Some(blob_len) => blob_len - .try_into() - .ok() - .and_then(|blob_len| (input.0.split_at_checked(blob_len))), + let blob = match polkavm::ProgramBlob::blob_length(&data) { + Some(blob_len) => + blob_len.try_into().ok().and_then(|blob_len| (data.split_at_checked(blob_len))), _ => None, }; @@ -350,18 +350,18 @@ pub trait EthExtra { } }; - let nonce = nonce.try_into().map_err(|_| InvalidTransaction::Call)?; + let nonce = nonce.unwrap_or_default().try_into().map_err(|_| InvalidTransaction::Call)?; // Fees calculated with the fixed `GAS_PRICE` // When we dry-run the transaction, we set the gas to `Fee / GAS_PRICE` let eth_fee_no_tip = U256::from(GAS_PRICE) - .saturating_mul(gas) + .saturating_mul(gas.unwrap_or_default()) .try_into() .map_err(|_| InvalidTransaction::Call)?; // Fees with the actual gas_price from the transaction. - let eth_fee: BalanceOf = U256::from(gas_price) - .saturating_mul(gas) + let eth_fee: BalanceOf = U256::from(gas_price.unwrap_or_default()) + .saturating_mul(gas.unwrap_or_default()) .try_into() .map_err(|_| InvalidTransaction::Call)?; @@ -414,7 +414,6 @@ mod test { }; use frame_support::{error::LookupError, traits::fungible::Mutate}; use pallet_revive_fixtures::compile_module; - use rlp::Encodable; use sp_runtime::{ traits::{Checkable, DispatchTransaction}, MultiAddress, MultiSignature, @@ -523,7 +522,7 @@ mod test { 100_000_000_000_000, ); - let payload = account.sign_transaction(tx).rlp_bytes().to_vec(); + let payload = account.sign_transaction(tx.into()).signed_payload(); let call = RuntimeCall::Contracts(crate::Call::eth_transact { payload, gas_limit, diff --git a/substrate/frame/revive/src/lib.rs b/substrate/frame/revive/src/lib.rs index caecf07c4071..b55854e2eec5 100644 --- a/substrate/frame/revive/src/lib.rs +++ b/substrate/frame/revive/src/lib.rs @@ -768,7 +768,7 @@ pub mod pallet { /// /// # Parameters /// - /// * `payload`: The RLP-encoded [`crate::evm::TransactionLegacySigned`]. + /// * `payload`: The encoded [`crate::evm::TransactionSigned`]. /// * `gas_limit`: The gas limit enforced during contract execution. /// * `storage_deposit_limit`: The maximum balance that can be charged to the caller for /// storage usage. From 7c5224cb01710d0c14c87bf3463cc79e49b3e7b5 Mon Sep 17 00:00:00 2001 From: gupnik Date: Fri, 22 Nov 2024 10:16:45 +0530 Subject: [PATCH 17/64] Adds `BlockNumberProvider` in multisig, proxy and nft pallets (#5723) Step in https://github.com/paritytech/polkadot-sdk/issues/3268 This PR adds the ability for these pallets to specify their source of the block number. This is useful when these pallets are migrated from the relay chain to a parachain and vice versa. This change is backwards compatible: 1. If the `BlockNumberProvider` continues to use the system pallet's block number 2. When a pallet deployed on the relay chain is moved to a parachain, but still uses the relay chain's block number However, we would need migrations if the deployed pallets are upgraded on an existing parachain, and the `BlockNumberProvider` uses the relay chain block number. --------- Co-authored-by: Kian Paimani <5588131+kianenigma@users.noreply.github.com> --- .../assets/asset-hub-rococo/src/lib.rs | 3 ++ .../assets/asset-hub-westend/src/lib.rs | 3 ++ .../bridge-hubs/bridge-hub-rococo/src/lib.rs | 1 + .../bridge-hubs/bridge-hub-westend/src/lib.rs | 1 + .../collectives-westend/src/lib.rs | 2 ++ .../contracts/contracts-rococo/src/lib.rs | 1 + .../coretime/coretime-rococo/src/lib.rs | 2 ++ .../coretime/coretime-westend/src/lib.rs | 2 ++ .../runtimes/people/people-rococo/src/lib.rs | 2 ++ .../runtimes/people/people-westend/src/lib.rs | 2 ++ polkadot/runtime/rococo/src/lib.rs | 2 ++ polkadot/runtime/westend/src/lib.rs | 2 ++ prdoc/pr_5723.prdoc | 24 +++++++++++++++ substrate/bin/node/runtime/src/lib.rs | 3 ++ substrate/frame/contracts/src/tests.rs | 1 + substrate/frame/multisig/src/lib.rs | 10 +++++-- substrate/frame/multisig/src/tests.rs | 1 + .../frame/nft-fractionalization/src/mock.rs | 1 + substrate/frame/nfts/src/benchmarking.rs | 22 +++++++------- .../frame/nfts/src/features/approvals.rs | 6 ++-- .../frame/nfts/src/features/atomic_swap.rs | 8 ++--- .../frame/nfts/src/features/attributes.rs | 2 +- .../nfts/src/features/create_delete_item.rs | 2 +- substrate/frame/nfts/src/features/settings.rs | 6 +--- substrate/frame/nfts/src/lib.rs | 29 ++++++++++--------- substrate/frame/nfts/src/mock.rs | 1 + substrate/frame/nfts/src/types.rs | 12 ++++---- substrate/frame/proxy/src/benchmarking.rs | 6 ++-- substrate/frame/proxy/src/lib.rs | 12 ++++++-- substrate/frame/proxy/src/tests.rs | 1 + substrate/frame/revive/src/tests.rs | 1 + substrate/frame/safe-mode/src/mock.rs | 1 + substrate/frame/src/lib.rs | 4 +-- substrate/frame/tx-pause/src/mock.rs | 1 + 34 files changed, 125 insertions(+), 52 deletions(-) create mode 100644 prdoc/pr_5723.prdoc diff --git a/cumulus/parachains/runtimes/assets/asset-hub-rococo/src/lib.rs b/cumulus/parachains/runtimes/assets/asset-hub-rococo/src/lib.rs index 2f9d83bd9d0b..bc48c2d805fd 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/assets/asset-hub-rococo/src/lib.rs @@ -467,6 +467,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = MaxSignatories; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { @@ -652,6 +653,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } parameter_types! { @@ -918,6 +920,7 @@ impl pallet_nfts::Config for Runtime { type WeightInfo = weights::pallet_nfts::WeightInfo; #[cfg(feature = "runtime-benchmarks")] type Helper = (); + type BlockNumberProvider = frame_system::Pallet; } /// XCM router instance to BridgeHub with bridging capabilities for `Westend` global diff --git a/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs b/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs index 2206aea78ec2..cafea3b6ff8b 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs @@ -466,6 +466,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = MaxSignatories; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { @@ -651,6 +652,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } parameter_types! { @@ -912,6 +914,7 @@ impl pallet_nfts::Config for Runtime { type WeightInfo = weights::pallet_nfts::WeightInfo; #[cfg(feature = "runtime-benchmarks")] type Helper = (); + type BlockNumberProvider = frame_system::Pallet; } /// XCM router instance to BridgeHub with bridging capabilities for `Rococo` global diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs index ff7af475f5e2..3f3316d0be49 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs @@ -537,6 +537,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = ConstU32<100>; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/lib.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/lib.rs index 065400016791..65e7d291dc37 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/lib.rs @@ -513,6 +513,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = ConstU32<100>; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { diff --git a/cumulus/parachains/runtimes/collectives/collectives-westend/src/lib.rs b/cumulus/parachains/runtimes/collectives/collectives-westend/src/lib.rs index c3e105a84fb6..0ee3a4068718 100644 --- a/cumulus/parachains/runtimes/collectives/collectives-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/collectives/collectives-westend/src/lib.rs @@ -258,6 +258,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = ConstU32<100>; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { @@ -382,6 +383,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } parameter_types! { diff --git a/cumulus/parachains/runtimes/contracts/contracts-rococo/src/lib.rs b/cumulus/parachains/runtimes/contracts/contracts-rococo/src/lib.rs index f661a8bdccfe..2951662a979b 100644 --- a/cumulus/parachains/runtimes/contracts/contracts-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/contracts/contracts-rococo/src/lib.rs @@ -268,6 +268,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = ConstU32<100>; type WeightInfo = pallet_multisig::weights::SubstrateWeight; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { diff --git a/cumulus/parachains/runtimes/coretime/coretime-rococo/src/lib.rs b/cumulus/parachains/runtimes/coretime/coretime-rococo/src/lib.rs index 31700c2e25ff..3f3126b749d8 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/coretime/coretime-rococo/src/lib.rs @@ -445,6 +445,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = ConstU32<100>; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } /// The type used to represent the kinds of proxying allowed. @@ -577,6 +578,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { diff --git a/cumulus/parachains/runtimes/coretime/coretime-westend/src/lib.rs b/cumulus/parachains/runtimes/coretime/coretime-westend/src/lib.rs index 1f0f54884fa8..098a17cc9984 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/coretime/coretime-westend/src/lib.rs @@ -446,6 +446,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = ConstU32<100>; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } /// The type used to represent the kinds of proxying allowed. @@ -578,6 +579,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { diff --git a/cumulus/parachains/runtimes/people/people-rococo/src/lib.rs b/cumulus/parachains/runtimes/people/people-rococo/src/lib.rs index 25356a84806d..7921030f2bb8 100644 --- a/cumulus/parachains/runtimes/people/people-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/people/people-rococo/src/lib.rs @@ -407,6 +407,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = ConstU32<100>; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } /// The type used to represent the kinds of proxying allowed. @@ -520,6 +521,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { diff --git a/cumulus/parachains/runtimes/people/people-westend/src/lib.rs b/cumulus/parachains/runtimes/people/people-westend/src/lib.rs index 1c5183636c49..19a64ab8d6e8 100644 --- a/cumulus/parachains/runtimes/people/people-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/people/people-westend/src/lib.rs @@ -406,6 +406,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = ConstU32<100>; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } /// The type used to represent the kinds of proxying allowed. @@ -519,6 +520,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_utility::Config for Runtime { diff --git a/polkadot/runtime/rococo/src/lib.rs b/polkadot/runtime/rococo/src/lib.rs index 96a97faa4750..5da9da86f02e 100644 --- a/polkadot/runtime/rococo/src/lib.rs +++ b/polkadot/runtime/rococo/src/lib.rs @@ -767,6 +767,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = MaxSignatories; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } parameter_types! { @@ -971,6 +972,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } impl parachains_origin::Config for Runtime {} diff --git a/polkadot/runtime/westend/src/lib.rs b/polkadot/runtime/westend/src/lib.rs index 7a5562cc98c1..9f0b701f20be 100644 --- a/polkadot/runtime/westend/src/lib.rs +++ b/polkadot/runtime/westend/src/lib.rs @@ -1004,6 +1004,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = MaxSignatories; type WeightInfo = weights::pallet_multisig::WeightInfo; + type BlockNumberProvider = frame_system::Pallet; } parameter_types! { @@ -1204,6 +1205,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } impl parachains_origin::Config for Runtime {} diff --git a/prdoc/pr_5723.prdoc b/prdoc/pr_5723.prdoc new file mode 100644 index 000000000000..ded5f9cebd1d --- /dev/null +++ b/prdoc/pr_5723.prdoc @@ -0,0 +1,24 @@ +title: Adds `BlockNumberProvider` in multisig, proxy and nft pallets + +doc: + - audience: Runtime Dev + description: | + This PR adds the ability for these pallets to specify their source of the block number. + This is useful when these pallets are migrated from the relay chain to a parachain and + vice versa. + + This change is backwards compatible: + 1. If the `BlockNumberProvider` continues to use the system pallet's block number + 2. When a pallet deployed on the relay chain is moved to a parachain, but still uses the + relay chain's block number + + However, we would need migrations if the deployed pallets are upgraded on an existing parachain, + and the `BlockNumberProvider` uses the relay chain block number. + +crates: + - name: pallet-multisig + bump: major + - name: pallet-proxy + bump: major + - name: pallet-nfts + bump: major diff --git a/substrate/bin/node/runtime/src/lib.rs b/substrate/bin/node/runtime/src/lib.rs index e68e04840776..bff263548087 100644 --- a/substrate/bin/node/runtime/src/lib.rs +++ b/substrate/bin/node/runtime/src/lib.rs @@ -392,6 +392,7 @@ impl pallet_multisig::Config for Runtime { type DepositFactor = DepositFactor; type MaxSignatories = ConstU32<100>; type WeightInfo = pallet_multisig::weights::SubstrateWeight; + type BlockNumberProvider = frame_system::Pallet; } parameter_types! { @@ -479,6 +480,7 @@ impl pallet_proxy::Config for Runtime { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = AnnouncementDepositBase; type AnnouncementDepositFactor = AnnouncementDepositFactor; + type BlockNumberProvider = frame_system::Pallet; } parameter_types! { @@ -2048,6 +2050,7 @@ impl pallet_nfts::Config for Runtime { type Helper = (); type CreateOrigin = AsEnsureOriginWithArg>; type Locker = (); + type BlockNumberProvider = frame_system::Pallet; } impl pallet_transaction_storage::Config for Runtime { diff --git a/substrate/frame/contracts/src/tests.rs b/substrate/frame/contracts/src/tests.rs index c3b6e3273f34..b01d0aa4fa48 100644 --- a/substrate/frame/contracts/src/tests.rs +++ b/substrate/frame/contracts/src/tests.rs @@ -399,6 +399,7 @@ impl pallet_proxy::Config for Test { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = ConstU64<1>; type AnnouncementDepositFactor = ConstU64<1>; + type BlockNumberProvider = frame_system::Pallet; } impl pallet_dummy::Config for Test {} diff --git a/substrate/frame/multisig/src/lib.rs b/substrate/frame/multisig/src/lib.rs index 4a30b5c119b9..869b4adc2adc 100644 --- a/substrate/frame/multisig/src/lib.rs +++ b/substrate/frame/multisig/src/lib.rs @@ -77,6 +77,9 @@ macro_rules! log { type BalanceOf = <::Currency as Currency<::AccountId>>::Balance; +pub type BlockNumberFor = + <::BlockNumberProvider as BlockNumberProvider>::BlockNumber; + /// A global extrinsic index, formed as the extrinsic index within a block, together with that /// block's height. This allows a transaction in which a multisig operation of a particular /// composite was created to be uniquely identified. @@ -153,6 +156,9 @@ pub mod pallet { /// Weight information for extrinsics in this pallet. type WeightInfo: weights::WeightInfo; + + /// Provider for the block number. Normally this is the `frame_system` pallet. + type BlockNumberProvider: BlockNumberProvider; } /// The in-code storage version. @@ -235,7 +241,7 @@ pub mod pallet { } #[pallet::hooks] - impl Hooks> for Pallet {} + impl Hooks> for Pallet {} #[pallet::call] impl Pallet { @@ -626,7 +632,7 @@ impl Pallet { /// The current `Timepoint`. pub fn timepoint() -> Timepoint> { Timepoint { - height: >::block_number(), + height: T::BlockNumberProvider::current_block_number(), index: >::extrinsic_index().unwrap_or_default(), } } diff --git a/substrate/frame/multisig/src/tests.rs b/substrate/frame/multisig/src/tests.rs index c5a98845270c..4065ce73f905 100644 --- a/substrate/frame/multisig/src/tests.rs +++ b/substrate/frame/multisig/src/tests.rs @@ -66,6 +66,7 @@ impl Config for Test { type DepositFactor = ConstU64<1>; type MaxSignatories = ConstU32<3>; type WeightInfo = (); + type BlockNumberProvider = frame_system::Pallet; } use pallet_balances::Call as BalancesCall; diff --git a/substrate/frame/nft-fractionalization/src/mock.rs b/substrate/frame/nft-fractionalization/src/mock.rs index 50b41b5fc64e..762c1776e30f 100644 --- a/substrate/frame/nft-fractionalization/src/mock.rs +++ b/substrate/frame/nft-fractionalization/src/mock.rs @@ -115,6 +115,7 @@ impl pallet_nfts::Config for Test { type OffchainSignature = Signature; type OffchainPublic = AccountPublic; type WeightInfo = (); + type BlockNumberProvider = frame_system::Pallet; pallet_nfts::runtime_benchmarks_enabled! { type Helper = (); } diff --git a/substrate/frame/nfts/src/benchmarking.rs b/substrate/frame/nfts/src/benchmarking.rs index bc81096b459d..81828be5fa09 100644 --- a/substrate/frame/nfts/src/benchmarking.rs +++ b/substrate/frame/nfts/src/benchmarking.rs @@ -29,7 +29,7 @@ use frame_support::{ traits::{EnsureOrigin, Get, UnfilteredDispatchable}, BoundedVec, }; -use frame_system::{pallet_prelude::BlockNumberFor, RawOrigin as SystemOrigin}; +use frame_system::RawOrigin as SystemOrigin; use sp_runtime::traits::{Bounded, One}; use crate::Pallet as Nfts; @@ -577,7 +577,7 @@ benchmarks_instance_pallet! { let (item, ..) = mint_item::(0); let delegate: T::AccountId = account("delegate", 0, SEED); let delegate_lookup = T::Lookup::unlookup(delegate.clone()); - let deadline = BlockNumberFor::::max_value(); + let deadline = BlockNumberFor::::max_value(); }: _(SystemOrigin::Signed(caller.clone()), collection, item, delegate_lookup, Some(deadline)) verify { assert_last_event::(Event::TransferApproved { collection, item, owner: caller, delegate, deadline: Some(deadline) }.into()); @@ -589,7 +589,7 @@ benchmarks_instance_pallet! { let delegate: T::AccountId = account("delegate", 0, SEED); let delegate_lookup = T::Lookup::unlookup(delegate.clone()); let origin = SystemOrigin::Signed(caller.clone()).into(); - let deadline = BlockNumberFor::::max_value(); + let deadline = BlockNumberFor::::max_value(); Nfts::::approve_transfer(origin, collection, item, delegate_lookup.clone(), Some(deadline))?; }: _(SystemOrigin::Signed(caller.clone()), collection, item, delegate_lookup) verify { @@ -602,7 +602,7 @@ benchmarks_instance_pallet! { let delegate: T::AccountId = account("delegate", 0, SEED); let delegate_lookup = T::Lookup::unlookup(delegate.clone()); let origin = SystemOrigin::Signed(caller.clone()).into(); - let deadline = BlockNumberFor::::max_value(); + let deadline = BlockNumberFor::::max_value(); Nfts::::approve_transfer(origin, collection, item, delegate_lookup.clone(), Some(deadline))?; }: _(SystemOrigin::Signed(caller.clone()), collection, item) verify { @@ -712,10 +712,10 @@ benchmarks_instance_pallet! { let price_direction = PriceDirection::Receive; let price_with_direction = PriceWithDirection { amount: price, direction: price_direction }; let duration = T::MaxDeadlineDuration::get(); - frame_system::Pallet::::set_block_number(One::one()); + T::BlockNumberProvider::set_block_number(One::one()); }: _(SystemOrigin::Signed(caller.clone()), collection, item1, collection, Some(item2), Some(price_with_direction.clone()), duration) verify { - let current_block = frame_system::Pallet::::block_number(); + let current_block = T::BlockNumberProvider::current_block_number(); assert_last_event::(Event::SwapCreated { offered_collection: collection, offered_item: item1, @@ -735,7 +735,7 @@ benchmarks_instance_pallet! { let duration = T::MaxDeadlineDuration::get(); let price_direction = PriceDirection::Receive; let price_with_direction = PriceWithDirection { amount: price, direction: price_direction }; - frame_system::Pallet::::set_block_number(One::one()); + T::BlockNumberProvider::set_block_number(One::one()); Nfts::::create_swap(origin, collection, item1, collection, Some(item2), Some(price_with_direction.clone()), duration)?; }: _(SystemOrigin::Signed(caller.clone()), collection, item1) verify { @@ -761,7 +761,7 @@ benchmarks_instance_pallet! { let target_lookup = T::Lookup::unlookup(target.clone()); T::Currency::make_free_balance_be(&target, T::Currency::minimum_balance()); let origin = SystemOrigin::Signed(caller.clone()); - frame_system::Pallet::::set_block_number(One::one()); + T::BlockNumberProvider::set_block_number(One::one()); Nfts::::transfer(origin.clone().into(), collection, item2, target_lookup)?; Nfts::::create_swap( origin.clone().into(), @@ -774,7 +774,7 @@ benchmarks_instance_pallet! { )?; }: _(SystemOrigin::Signed(target.clone()), collection, item2, collection, item1, Some(price_with_direction.clone())) verify { - let current_block = frame_system::Pallet::::block_number(); + let current_block = T::BlockNumberProvider::current_block_number(); assert_last_event::(Event::SwapClaimed { sent_collection: collection, sent_item: item2, @@ -822,7 +822,7 @@ benchmarks_instance_pallet! { let target: T::AccountId = account("target", 0, SEED); T::Currency::make_free_balance_be(&target, DepositBalanceOf::::max_value()); - frame_system::Pallet::::set_block_number(One::one()); + T::BlockNumberProvider::set_block_number(One::one()); }: _(SystemOrigin::Signed(target.clone()), Box::new(mint_data), signature.into(), caller) verify { let metadata: BoundedVec<_, _> = metadata.try_into().unwrap(); @@ -865,7 +865,7 @@ benchmarks_instance_pallet! { let message = Encode::encode(&pre_signed_data); let signature = T::Helper::sign(&signer_public, &message); - frame_system::Pallet::::set_block_number(One::one()); + T::BlockNumberProvider::set_block_number(One::one()); }: _(SystemOrigin::Signed(item_owner.clone()), pre_signed_data, signature.into(), signer.clone()) verify { assert_last_event::( diff --git a/substrate/frame/nfts/src/features/approvals.rs b/substrate/frame/nfts/src/features/approvals.rs index 053fa67163b9..4738f69f83c4 100644 --- a/substrate/frame/nfts/src/features/approvals.rs +++ b/substrate/frame/nfts/src/features/approvals.rs @@ -46,7 +46,7 @@ impl, I: 'static> Pallet { collection: T::CollectionId, item: T::ItemId, delegate: T::AccountId, - maybe_deadline: Option>, + maybe_deadline: Option>, ) -> DispatchResult { ensure!( Self::is_pallet_feature_enabled(PalletFeature::Approvals), @@ -65,7 +65,7 @@ impl, I: 'static> Pallet { ensure!(check_origin == details.owner, Error::::NoPermission); } - let now = frame_system::Pallet::::block_number(); + let now = T::BlockNumberProvider::current_block_number(); let deadline = maybe_deadline.map(|d| d.saturating_add(now)); details @@ -111,7 +111,7 @@ impl, I: 'static> Pallet { let maybe_deadline = details.approvals.get(&delegate).ok_or(Error::::NotDelegate)?; let is_past_deadline = if let Some(deadline) = maybe_deadline { - let now = frame_system::Pallet::::block_number(); + let now = T::BlockNumberProvider::current_block_number(); now > *deadline } else { false diff --git a/substrate/frame/nfts/src/features/atomic_swap.rs b/substrate/frame/nfts/src/features/atomic_swap.rs index 830283b73c2a..03ebd35b81b2 100644 --- a/substrate/frame/nfts/src/features/atomic_swap.rs +++ b/substrate/frame/nfts/src/features/atomic_swap.rs @@ -53,7 +53,7 @@ impl, I: 'static> Pallet { desired_collection_id: T::CollectionId, maybe_desired_item_id: Option, maybe_price: Option>>, - duration: frame_system::pallet_prelude::BlockNumberFor, + duration: BlockNumberFor, ) -> DispatchResult { ensure!( Self::is_pallet_feature_enabled(PalletFeature::Swaps), @@ -76,7 +76,7 @@ impl, I: 'static> Pallet { ), }; - let now = frame_system::Pallet::::block_number(); + let now = T::BlockNumberProvider::current_block_number(); let deadline = duration.saturating_add(now); PendingSwapOf::::insert( @@ -119,7 +119,7 @@ impl, I: 'static> Pallet { let swap = PendingSwapOf::::get(&offered_collection_id, &offered_item_id) .ok_or(Error::::UnknownSwap)?; - let now = frame_system::Pallet::::block_number(); + let now = T::BlockNumberProvider::current_block_number(); if swap.deadline > now { let item = Item::::get(&offered_collection_id, &offered_item_id) .ok_or(Error::::UnknownItem)?; @@ -187,7 +187,7 @@ impl, I: 'static> Pallet { ensure!(desired_item == send_item_id, Error::::UnknownSwap); } - let now = frame_system::Pallet::::block_number(); + let now = T::BlockNumberProvider::current_block_number(); ensure!(now <= swap.deadline, Error::::DeadlineExpired); if let Some(ref price) = swap.price { diff --git a/substrate/frame/nfts/src/features/attributes.rs b/substrate/frame/nfts/src/features/attributes.rs index 28f7bd2c58ce..2cd09f7d2193 100644 --- a/substrate/frame/nfts/src/features/attributes.rs +++ b/substrate/frame/nfts/src/features/attributes.rs @@ -225,7 +225,7 @@ impl, I: 'static> Pallet { Error::::MaxAttributesLimitReached ); - let now = frame_system::Pallet::::block_number(); + let now = T::BlockNumberProvider::current_block_number(); ensure!(deadline >= now, Error::::DeadlineExpired); let item_details = diff --git a/substrate/frame/nfts/src/features/create_delete_item.rs b/substrate/frame/nfts/src/features/create_delete_item.rs index 37f64ae1b1b9..57366127f142 100644 --- a/substrate/frame/nfts/src/features/create_delete_item.rs +++ b/substrate/frame/nfts/src/features/create_delete_item.rs @@ -145,7 +145,7 @@ impl, I: 'static> Pallet { ensure!(account == mint_to, Error::::WrongOrigin); } - let now = frame_system::Pallet::::block_number(); + let now = T::BlockNumberProvider::current_block_number(); ensure!(deadline >= now, Error::::DeadlineExpired); ensure!( diff --git a/substrate/frame/nfts/src/features/settings.rs b/substrate/frame/nfts/src/features/settings.rs index d4f7533ffa4e..48719ae2c20e 100644 --- a/substrate/frame/nfts/src/features/settings.rs +++ b/substrate/frame/nfts/src/features/settings.rs @@ -96,11 +96,7 @@ impl, I: 'static> Pallet { pub(crate) fn do_update_mint_settings( maybe_check_origin: Option, collection: T::CollectionId, - mint_settings: MintSettings< - BalanceOf, - frame_system::pallet_prelude::BlockNumberFor, - T::CollectionId, - >, + mint_settings: MintSettings, BlockNumberFor, T::CollectionId>, ) -> DispatchResult { if let Some(check_origin) = &maybe_check_origin { ensure!( diff --git a/substrate/frame/nfts/src/lib.rs b/substrate/frame/nfts/src/lib.rs index 4e5493a3c755..346ad162c503 100644 --- a/substrate/frame/nfts/src/lib.rs +++ b/substrate/frame/nfts/src/lib.rs @@ -58,7 +58,7 @@ use frame_support::traits::{ }; use frame_system::Config as SystemConfig; use sp_runtime::{ - traits::{IdentifyAccount, Saturating, StaticLookup, Verify, Zero}, + traits::{BlockNumberProvider, IdentifyAccount, Saturating, StaticLookup, Verify, Zero}, RuntimeDebug, }; @@ -76,7 +76,7 @@ type AccountIdLookupOf = <::Lookup as StaticLookup>::Sourc pub mod pallet { use super::*; use frame_support::{pallet_prelude::*, traits::ExistenceRequirement}; - use frame_system::pallet_prelude::*; + use frame_system::{ensure_signed, pallet_prelude::OriginFor}; /// The in-code storage version. const STORAGE_VERSION: StorageVersion = StorageVersion::new(1); @@ -210,7 +210,7 @@ pub mod pallet { /// The max duration in blocks for deadlines. #[pallet::constant] - type MaxDeadlineDuration: Get>; + type MaxDeadlineDuration: Get>; /// The max number of attributes a user could set per call. #[pallet::constant] @@ -242,6 +242,9 @@ pub mod pallet { /// Weight information for extrinsics in this pallet. type WeightInfo: WeightInfo; + + /// Provider for the block number. Normally this is the `frame_system` pallet. + type BlockNumberProvider: BlockNumberProvider; } /// Details of a collection. @@ -388,7 +391,7 @@ pub mod pallet { T::CollectionId, T::ItemId, PriceWithDirection>, - BlockNumberFor, + BlockNumberFor, >, OptionQuery, >; @@ -459,7 +462,7 @@ pub mod pallet { item: T::ItemId, owner: T::AccountId, delegate: T::AccountId, - deadline: Option>, + deadline: Option>, }, /// An approval for a `delegate` account to transfer the `item` of an item /// `collection` was cancelled by its `owner`. @@ -554,7 +557,7 @@ pub mod pallet { desired_collection: T::CollectionId, desired_item: Option, price: Option>>, - deadline: BlockNumberFor, + deadline: BlockNumberFor, }, /// The swap was cancelled. SwapCancelled { @@ -563,7 +566,7 @@ pub mod pallet { desired_collection: T::CollectionId, desired_item: Option, price: Option>>, - deadline: BlockNumberFor, + deadline: BlockNumberFor, }, /// The swap has been claimed. SwapClaimed { @@ -574,7 +577,7 @@ pub mod pallet { received_item: T::ItemId, received_item_owner: T::AccountId, price: Option>>, - deadline: BlockNumberFor, + deadline: BlockNumberFor, }, /// New attributes have been set for an `item` of the `collection`. PreSignedAttributesSet { @@ -857,7 +860,7 @@ pub mod pallet { item_config, |collection_details, collection_config| { let mint_settings = collection_config.mint_settings; - let now = frame_system::Pallet::::block_number(); + let now = T::BlockNumberProvider::current_block_number(); if let Some(start_block) = mint_settings.start_block { ensure!(start_block <= now, Error::::MintNotStarted); @@ -1029,7 +1032,7 @@ pub mod pallet { let deadline = details.approvals.get(&origin).ok_or(Error::::NoPermission)?; if let Some(d) = deadline { - let block_number = frame_system::Pallet::::block_number(); + let block_number = T::BlockNumberProvider::current_block_number(); ensure!(block_number <= *d, Error::::ApprovalExpired); } } @@ -1290,7 +1293,7 @@ pub mod pallet { collection: T::CollectionId, item: T::ItemId, delegate: AccountIdLookupOf, - maybe_deadline: Option>, + maybe_deadline: Option>, ) -> DispatchResult { let maybe_check_origin = T::ForceOrigin::try_origin(origin) .map(|_| None) @@ -1713,7 +1716,7 @@ pub mod pallet { pub fn update_mint_settings( origin: OriginFor, collection: T::CollectionId, - mint_settings: MintSettings, BlockNumberFor, T::CollectionId>, + mint_settings: MintSettings, BlockNumberFor, T::CollectionId>, ) -> DispatchResult { let maybe_check_origin = T::ForceOrigin::try_origin(origin) .map(|_| None) @@ -1809,7 +1812,7 @@ pub mod pallet { desired_collection: T::CollectionId, maybe_desired_item: Option, maybe_price: Option>>, - duration: BlockNumberFor, + duration: BlockNumberFor, ) -> DispatchResult { let origin = ensure_signed(origin)?; Self::do_create_swap( diff --git a/substrate/frame/nfts/src/mock.rs b/substrate/frame/nfts/src/mock.rs index 5b589f591ca3..291c3c081334 100644 --- a/substrate/frame/nfts/src/mock.rs +++ b/substrate/frame/nfts/src/mock.rs @@ -92,6 +92,7 @@ impl Config for Test { type WeightInfo = (); #[cfg(feature = "runtime-benchmarks")] type Helper = (); + type BlockNumberProvider = frame_system::Pallet; } pub(crate) fn new_test_ext() -> sp_io::TestExternalities { diff --git a/substrate/frame/nfts/src/types.rs b/substrate/frame/nfts/src/types.rs index d67fb404ea79..3ab85993473a 100644 --- a/substrate/frame/nfts/src/types.rs +++ b/substrate/frame/nfts/src/types.rs @@ -27,9 +27,11 @@ use frame_support::{ traits::Get, BoundedBTreeMap, BoundedBTreeSet, }; -use frame_system::pallet_prelude::BlockNumberFor; use scale_info::{build::Fields, meta_type, Path, Type, TypeInfo, TypeParameter}; +pub type BlockNumberFor = + <>::BlockNumberProvider as BlockNumberProvider>::BlockNumber; + /// A type alias for handling balance deposits. pub type DepositBalanceOf = <>::Currency as Currency<::AccountId>>::Balance; @@ -39,7 +41,7 @@ pub type CollectionDetailsFor = /// A type alias for keeping track of approvals used by a single item. pub type ApprovalsOf = BoundedBTreeMap< ::AccountId, - Option>, + Option>, >::ApprovalsLimit, >; /// A type alias for keeping track of approvals for an item's attributes. @@ -70,13 +72,13 @@ pub type ItemTipOf = ItemTip< >; /// A type alias for the settings configuration of a collection. pub type CollectionConfigFor = - CollectionConfig, BlockNumberFor, >::CollectionId>; + CollectionConfig, BlockNumberFor, >::CollectionId>; /// A type alias for the pre-signed minting configuration for a specified collection. pub type PreSignedMintOf = PreSignedMint< >::CollectionId, >::ItemId, ::AccountId, - BlockNumberFor, + BlockNumberFor, BalanceOf, >; /// A type alias for the pre-signed minting configuration on the attribute level of an item. @@ -84,7 +86,7 @@ pub type PreSignedAttributesOf = PreSignedAttributes< >::CollectionId, >::ItemId, ::AccountId, - BlockNumberFor, + BlockNumberFor, >; /// Information about a collection. diff --git a/substrate/frame/proxy/src/benchmarking.rs b/substrate/frame/proxy/src/benchmarking.rs index eebb506bf374..b72f53af8e72 100644 --- a/substrate/frame/proxy/src/benchmarking.rs +++ b/substrate/frame/proxy/src/benchmarking.rs @@ -22,7 +22,9 @@ use super::*; use crate::Pallet as Proxy; use alloc::{boxed::Box, vec}; -use frame::benchmarking::prelude::*; +use frame::benchmarking::prelude::{ + account, benchmarks, impl_test_function, whitelisted_caller, BenchmarkError, RawOrigin, +}; const SEED: u32 = 0; @@ -317,7 +319,7 @@ mod benchmarks { BlockNumberFor::::zero(), 0, )?; - let height = frame_system::Pallet::::block_number(); + let height = T::BlockNumberProvider::current_block_number(); let ext_index = frame_system::Pallet::::extrinsic_index().unwrap_or(0); let pure_account = Pallet::::pure_account(&caller, &T::ProxyType::default(), 0, None); diff --git a/substrate/frame/proxy/src/lib.rs b/substrate/frame/proxy/src/lib.rs index cc8aeedcc5f9..cc21db7469b2 100644 --- a/substrate/frame/proxy/src/lib.rs +++ b/substrate/frame/proxy/src/lib.rs @@ -47,6 +47,9 @@ type CallHashOf = <::CallHasher as Hash>::Output; type BalanceOf = <::Currency as Currency<::AccountId>>::Balance; +pub type BlockNumberFor = + <::BlockNumberProvider as BlockNumberProvider>::BlockNumber; + type AccountIdLookupOf = <::Lookup as StaticLookup>::Source; /// The parameters under which a particular account has a proxy relationship with some other @@ -163,6 +166,9 @@ pub mod pallet { /// into a pre-existing storage value. #[pallet::constant] type AnnouncementDepositFactor: Get>; + + /// Provider for the block number. Normally this is the `frame_system` pallet. + type BlockNumberProvider: BlockNumberProvider; } #[pallet::call] @@ -379,7 +385,7 @@ pub mod pallet { let announcement = Announcement { real: real.clone(), call_hash, - height: frame_system::Pallet::::block_number(), + height: T::BlockNumberProvider::current_block_number(), }; Announcements::::try_mutate(&who, |(ref mut pending, ref mut deposit)| { @@ -490,7 +496,7 @@ pub mod pallet { let def = Self::find_proxy(&real, &delegate, force_proxy_type)?; let call_hash = T::CallHasher::hash_of(&call); - let now = frame_system::Pallet::::block_number(); + let now = T::BlockNumberProvider::current_block_number(); Self::edit_announcements(&delegate, |ann| { ann.real != real || ann.call_hash != call_hash || @@ -626,7 +632,7 @@ impl Pallet { ) -> T::AccountId { let (height, ext_index) = maybe_when.unwrap_or_else(|| { ( - frame_system::Pallet::::block_number(), + T::BlockNumberProvider::current_block_number(), frame_system::Pallet::::extrinsic_index().unwrap_or_default(), ) }); diff --git a/substrate/frame/proxy/src/tests.rs b/substrate/frame/proxy/src/tests.rs index 5baf9bb9e838..afc668188e6c 100644 --- a/substrate/frame/proxy/src/tests.rs +++ b/substrate/frame/proxy/src/tests.rs @@ -119,6 +119,7 @@ impl Config for Test { type MaxPending = ConstU32<2>; type AnnouncementDepositBase = ConstU64<1>; type AnnouncementDepositFactor = ConstU64<1>; + type BlockNumberProvider = frame_system::Pallet; } use super::{Call as ProxyCall, Event as ProxyEvent}; diff --git a/substrate/frame/revive/src/tests.rs b/substrate/frame/revive/src/tests.rs index 177b8dff706b..34afe8aabfe6 100644 --- a/substrate/frame/revive/src/tests.rs +++ b/substrate/frame/revive/src/tests.rs @@ -416,6 +416,7 @@ impl pallet_proxy::Config for Test { type CallHasher = BlakeTwo256; type AnnouncementDepositBase = ConstU64<1>; type AnnouncementDepositFactor = ConstU64<1>; + type BlockNumberProvider = frame_system::Pallet; } parameter_types! { diff --git a/substrate/frame/safe-mode/src/mock.rs b/substrate/frame/safe-mode/src/mock.rs index ec1ad8249514..aaf3456272fa 100644 --- a/substrate/frame/safe-mode/src/mock.rs +++ b/substrate/frame/safe-mode/src/mock.rs @@ -138,6 +138,7 @@ impl pallet_proxy::Config for Test { type MaxPending = ConstU32<2>; type AnnouncementDepositBase = ConstU64<1>; type AnnouncementDepositFactor = ConstU64<1>; + type BlockNumberProvider = frame_system::Pallet; } /// The calls that can always bypass safe-mode. diff --git a/substrate/frame/src/lib.rs b/substrate/frame/src/lib.rs index 0ca36ca8545a..03d815e349df 100644 --- a/substrate/frame/src/lib.rs +++ b/substrate/frame/src/lib.rs @@ -219,8 +219,8 @@ pub mod prelude { /// Runtime traits #[doc(no_inline)] pub use sp_runtime::traits::{ - Bounded, DispatchInfoOf, Dispatchable, SaturatedConversion, Saturating, StaticLookup, - TrailingZeroInput, + BlockNumberProvider, Bounded, DispatchInfoOf, Dispatchable, SaturatedConversion, + Saturating, StaticLookup, TrailingZeroInput, }; /// Other error/result types for runtime diff --git a/substrate/frame/tx-pause/src/mock.rs b/substrate/frame/tx-pause/src/mock.rs index 84ce45e83528..fd9b3b552ccd 100644 --- a/substrate/frame/tx-pause/src/mock.rs +++ b/substrate/frame/tx-pause/src/mock.rs @@ -105,6 +105,7 @@ impl pallet_proxy::Config for Test { type MaxPending = ConstU32<2>; type AnnouncementDepositBase = ConstU64<1>; type AnnouncementDepositFactor = ConstU64<1>; + type BlockNumberProvider = frame_system::Pallet; } parameter_types! { From 08ec8cdbfdbdd29c7921a8a141187e04354a449e Mon Sep 17 00:00:00 2001 From: eskimor Date: Fri, 22 Nov 2024 14:19:40 +0100 Subject: [PATCH 18/64] Only mess with coretime if we are registering an actual parachain. (#6554) Co-authored-by: Robert Co-authored-by: ordian --- polkadot/runtime/common/src/paras_sudo_wrapper.rs | 9 +++++++-- 1 file changed, 7 insertions(+), 2 deletions(-) diff --git a/polkadot/runtime/common/src/paras_sudo_wrapper.rs b/polkadot/runtime/common/src/paras_sudo_wrapper.rs index af93c70b4783..a93c209e9279 100644 --- a/polkadot/runtime/common/src/paras_sudo_wrapper.rs +++ b/polkadot/runtime/common/src/paras_sudo_wrapper.rs @@ -24,7 +24,7 @@ pub use pallet::*; use polkadot_primitives::Id as ParaId; use polkadot_runtime_parachains::{ configuration, dmp, hrmp, - paras::{self, AssignCoretime, ParaGenesisArgs}, + paras::{self, AssignCoretime, ParaGenesisArgs, ParaKind}, ParaLifecycle, }; @@ -80,10 +80,15 @@ pub mod pallet { genesis: ParaGenesisArgs, ) -> DispatchResult { ensure_root(origin)?; + + let assign_coretime = genesis.para_kind == ParaKind::Parachain; + polkadot_runtime_parachains::schedule_para_initialize::(id, genesis) .map_err(|_| Error::::ParaAlreadyExists)?; - T::AssignCoretime::assign_coretime(id)?; + if assign_coretime { + T::AssignCoretime::assign_coretime(id)?; + } Ok(()) } From 1e3b8e1639c1cf784eabf0a9afcab1f3987e0ca4 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Bastian=20K=C3=B6cher?= Date: Sun, 24 Nov 2024 08:36:16 +0000 Subject: [PATCH 19/64] Notify telemetry only every second about the tx pool status (#6605) Before this was done for every imported transaction. When a lot of transactions got imported, the import notification channel was filled. The underlying problem was that the `status` call is read locking the `validated_pool` which will be write locked by the internal submitting logic. Thus, the submitting and status reading was interferring which each other. --------- Co-authored-by: GitHub Action --- Cargo.lock | 1 + cumulus/client/service/Cargo.toml | 1 + prdoc/pr_6605.prdoc | 10 +++++ substrate/client/service/src/builder.rs | 58 +++++++++++++++++-------- 4 files changed, 53 insertions(+), 17 deletions(-) create mode 100644 prdoc/pr_6605.prdoc diff --git a/Cargo.lock b/Cargo.lock index 330c2563d976..c79adee6f38e 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -4680,6 +4680,7 @@ dependencies = [ "cumulus-relay-chain-interface", "cumulus-relay-chain-minimal-node", "futures", + "futures-timer", "polkadot-primitives 7.0.0", "sc-client-api", "sc-consensus", diff --git a/cumulus/client/service/Cargo.toml b/cumulus/client/service/Cargo.toml index 8e9e41ca89dc..0a77b465d96a 100644 --- a/cumulus/client/service/Cargo.toml +++ b/cumulus/client/service/Cargo.toml @@ -11,6 +11,7 @@ workspace = true [dependencies] futures = { workspace = true } +futures-timer = { workspace = true } # Substrate sc-client-api = { workspace = true, default-features = true } diff --git a/prdoc/pr_6605.prdoc b/prdoc/pr_6605.prdoc new file mode 100644 index 000000000000..2adb1d8aee35 --- /dev/null +++ b/prdoc/pr_6605.prdoc @@ -0,0 +1,10 @@ +title: Notify telemetry only every second about the tx pool status +doc: +- audience: Node Operator + description: |- + Before this was done for every imported transaction. When a lot of transactions got imported, the import notification channel was filled. The underlying problem was that the `status` call is read locking the `validated_pool` which will be write locked by the internal submitting logic. Thus, the submitting and status reading was interferring which each other. +crates: +- name: cumulus-client-service + bump: patch +- name: sc-service + bump: patch diff --git a/substrate/client/service/src/builder.rs b/substrate/client/service/src/builder.rs index 68ac94539df8..ac9371a8941b 100644 --- a/substrate/client/service/src/builder.rs +++ b/substrate/client/service/src/builder.rs @@ -25,7 +25,7 @@ use crate::{ start_rpc_servers, BuildGenesisBlock, GenesisBlockBuilder, RpcHandlers, SpawnTaskHandle, TaskManager, TransactionPoolAdapter, }; -use futures::{future::ready, FutureExt, StreamExt}; +use futures::{select, FutureExt, StreamExt}; use jsonrpsee::RpcModule; use log::info; use prometheus_endpoint::Registry; @@ -90,7 +90,11 @@ use sp_consensus::block_validation::{ use sp_core::traits::{CodeExecutor, SpawnNamed}; use sp_keystore::KeystorePtr; use sp_runtime::traits::{Block as BlockT, BlockIdTo, NumberFor, Zero}; -use std::{str::FromStr, sync::Arc, time::SystemTime}; +use std::{ + str::FromStr, + sync::Arc, + time::{Duration, SystemTime}, +}; /// Full client type. pub type TFullClient = @@ -577,22 +581,42 @@ pub async fn propagate_transaction_notifications( Block: BlockT, ExPool: MaintainedTransactionPool::Hash>, { + const TELEMETRY_INTERVAL: Duration = Duration::from_secs(1); + // transaction notifications - transaction_pool - .import_notification_stream() - .for_each(move |hash| { - tx_handler_controller.propagate_transaction(hash); - let status = transaction_pool.status(); - telemetry!( - telemetry; - SUBSTRATE_INFO; - "txpool.import"; - "ready" => status.ready, - "future" => status.future, - ); - ready(()) - }) - .await; + let mut notifications = transaction_pool.import_notification_stream().fuse(); + let mut timer = futures_timer::Delay::new(TELEMETRY_INTERVAL).fuse(); + let mut tx_imported = false; + + loop { + select! { + notification = notifications.next() => { + let Some(hash) = notification else { return }; + + tx_handler_controller.propagate_transaction(hash); + + tx_imported = true; + }, + _ = timer => { + timer = futures_timer::Delay::new(TELEMETRY_INTERVAL).fuse(); + + if !tx_imported { + continue; + } + + tx_imported = false; + let status = transaction_pool.status(); + + telemetry!( + telemetry; + SUBSTRATE_INFO; + "txpool.import"; + "ready" => status.ready, + "future" => status.future, + ); + } + } + } } /// Initialize telemetry with provided configuration and return telemetry handle From 6da7d36e060c6e5fd5a20395470db6910037a640 Mon Sep 17 00:00:00 2001 From: gupnik Date: Mon, 25 Nov 2024 10:56:21 +0530 Subject: [PATCH 20/64] Fixes cfg attributes in runtime macro (#6410) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Fixes https://github.com/paritytech/polkadot-sdk/issues/6209 This PR adds the support for cfg attributes in the runtime macro. --------- Co-authored-by: Bastian Köcher --- .../procedural/src/runtime/parse/pallet.rs | 15 ++++- substrate/frame/support/test/tests/pallet.rs | 59 +++++++++++++++---- 2 files changed, 59 insertions(+), 15 deletions(-) diff --git a/substrate/frame/support/procedural/src/runtime/parse/pallet.rs b/substrate/frame/support/procedural/src/runtime/parse/pallet.rs index 52f57cd2cd8b..1397b7266a18 100644 --- a/substrate/frame/support/procedural/src/runtime/parse/pallet.rs +++ b/substrate/frame/support/procedural/src/runtime/parse/pallet.rs @@ -21,7 +21,7 @@ use crate::{ }; use frame_support_procedural_tools::get_doc_literals; use quote::ToTokens; -use syn::{punctuated::Punctuated, token, Error}; +use syn::{punctuated::Punctuated, spanned::Spanned, token, Error}; impl Pallet { pub fn try_from( @@ -78,7 +78,18 @@ impl Pallet { }) .collect(); - let cfg_pattern = vec![]; + let cfg_pattern = item + .attrs + .iter() + .filter(|attr| attr.path().segments.first().map_or(false, |s| s.ident == "cfg")) + .map(|attr| { + attr.parse_args_with(|input: syn::parse::ParseStream| { + let input = input.parse::()?; + cfg_expr::Expression::parse(&input.to_string()) + .map_err(|e| syn::Error::new(attr.span(), e.to_string())) + }) + }) + .collect::>>()?; let docs = get_doc_literals(&item.attrs); diff --git a/substrate/frame/support/test/tests/pallet.rs b/substrate/frame/support/test/tests/pallet.rs index b0b83f772499..de7f7eb4bc97 100644 --- a/substrate/frame/support/test/tests/pallet.rs +++ b/substrate/frame/support/test/tests/pallet.rs @@ -799,20 +799,43 @@ where } } -frame_support::construct_runtime!( - pub struct Runtime { - // Exclude part `Storage` in order not to check its metadata in tests. - System: frame_system exclude_parts { Pallet, Storage }, - Example: pallet, - Example2: pallet2 exclude_parts { Call }, - #[cfg(feature = "frame-feature-testing")] - Example3: pallet3, - Example4: pallet4 use_parts { Call }, +#[frame_support::runtime] +mod runtime { + #[runtime::runtime] + #[runtime::derive( + RuntimeCall, + RuntimeEvent, + RuntimeError, + RuntimeOrigin, + RuntimeFreezeReason, + RuntimeHoldReason, + RuntimeSlashReason, + RuntimeLockId, + RuntimeTask + )] + pub struct Runtime; - #[cfg(feature = "frame-feature-testing-2")] - Example5: pallet5, - } -); + #[runtime::pallet_index(0)] + pub type System = frame_system + Call + Event; + + #[runtime::pallet_index(1)] + pub type Example = pallet; + + #[runtime::pallet_index(2)] + #[runtime::disable_call] + pub type Example2 = pallet2; + + #[cfg(feature = "frame-feature-testing")] + #[runtime::pallet_index(3)] + pub type Example3 = pallet3; + + #[runtime::pallet_index(4)] + pub type Example4 = pallet4; + + #[cfg(feature = "frame-feature-testing-2")] + #[runtime::pallet_index(5)] + pub type Example5 = pallet5; +} // Test that the part `RuntimeCall` is excluded from Example2 and included in Example4. fn _ensure_call_is_correctly_excluded_and_included(call: RuntimeCall) { @@ -1847,6 +1870,16 @@ fn metadata() { error: None, docs: vec![" Test that the supertrait check works when we pass some parameter to the `frame_system::Config`."], }, + PalletMetadata { + index: 4, + name: "Example4", + storage: None, + calls: Some(meta_type::>().into()), + event: None, + constants: vec![], + error: None, + docs: vec![], + }, #[cfg(feature = "frame-feature-testing-2")] PalletMetadata { index: 5, From 75e79fad682bd86451464bc95117f6e22b86dfd9 Mon Sep 17 00:00:00 2001 From: Alexander Samusev <41779041+alvicsam@users.noreply.github.com> Date: Mon, 25 Nov 2024 11:02:37 +0100 Subject: [PATCH 21/64] ci: fix node-bench-regression-guard for master (#6589) Closes https://github.com/paritytech/ci_cd/issues/1067 --- .github/workflows/tests-misc.yml | 8 ++++++++ 1 file changed, 8 insertions(+) diff --git a/.github/workflows/tests-misc.yml b/.github/workflows/tests-misc.yml index cca32650b106..decd88f2e84c 100644 --- a/.github/workflows/tests-misc.yml +++ b/.github/workflows/tests-misc.yml @@ -165,12 +165,14 @@ jobs: - name: Download artifact (master run) uses: actions/download-artifact@v4.1.8 + continue-on-error: true with: name: cargo-check-benches-master-${{ github.sha }} path: ./artifacts/master - name: Download artifact (current run) uses: actions/download-artifact@v4.1.8 + continue-on-error: true with: name: cargo-check-benches-current-${{ github.sha }} path: ./artifacts/current @@ -183,6 +185,12 @@ jobs: exit 0 fi + # fail if no artifacts + if [ ! -d ./artifacts/master ] || [ ! -d ./artifacts/current ]; then + echo "No artifacts found" + exit 1 + fi + docker run --rm \ -v $PWD/artifacts/master:/artifacts/master \ -v $PWD/artifacts/current:/artifacts/current \ From e709c9f3db017309d88d240cb32d62c2df6f0a52 Mon Sep 17 00:00:00 2001 From: Branislav Kontur Date: Mon, 25 Nov 2024 11:59:48 +0100 Subject: [PATCH 22/64] Error logging for send xcm to pallet-xcm (#6579) --- polkadot/xcm/pallet-xcm/src/lib.rs | 16 +++++++++++++--- .../xcm/xcm-builder/src/process_xcm_message.rs | 2 +- 2 files changed, 14 insertions(+), 4 deletions(-) diff --git a/polkadot/xcm/pallet-xcm/src/lib.rs b/polkadot/xcm/pallet-xcm/src/lib.rs index 5e0512c6a9fd..6360298b21c3 100644 --- a/polkadot/xcm/pallet-xcm/src/lib.rs +++ b/polkadot/xcm/pallet-xcm/src/lib.rs @@ -363,7 +363,10 @@ pub mod pallet { let message: Xcm<()> = (*message).try_into().map_err(|()| Error::::BadVersion)?; let message_id = Self::send_xcm(interior, dest.clone(), message.clone()) - .map_err(Error::::from)?; + .map_err(|error| { + tracing::error!(target: "xcm::pallet_xcm::send", ?error, ?dest, ?message, "XCM send failed with error"); + Error::::from(error) + })?; let e = Event::Sent { origin: origin_location, destination: dest, message, message_id }; Self::deposit_event(e); Ok(message_id) @@ -1800,7 +1803,10 @@ impl Pallet { if let Some(remote_xcm) = remote_xcm { let (ticket, price) = validate_send::(dest.clone(), remote_xcm.clone()) - .map_err(Error::::from)?; + .map_err(|error| { + tracing::error!(target: "xcm::pallet_xcm::execute_xcm_transfer", ?error, ?dest, ?remote_xcm, "XCM validate_send failed with error"); + Error::::from(error) + })?; if origin != Here.into_location() { Self::charge_fees(origin.clone(), price.clone()).map_err(|error| { tracing::error!( @@ -1810,7 +1816,11 @@ impl Pallet { Error::::FeesNotMet })?; } - let message_id = T::XcmRouter::deliver(ticket).map_err(Error::::from)?; + let message_id = T::XcmRouter::deliver(ticket) + .map_err(|error| { + tracing::error!(target: "xcm::pallet_xcm::execute_xcm_transfer", ?error, ?dest, ?remote_xcm, "XCM deliver failed with error"); + Error::::from(error) + })?; let e = Event::Sent { origin, destination: dest, message: remote_xcm, message_id }; Self::deposit_event(e); diff --git a/polkadot/xcm/xcm-builder/src/process_xcm_message.rs b/polkadot/xcm/xcm-builder/src/process_xcm_message.rs index 8dafbf66adf0..67c05c116e9d 100644 --- a/polkadot/xcm/xcm-builder/src/process_xcm_message.rs +++ b/polkadot/xcm/xcm-builder/src/process_xcm_message.rs @@ -58,7 +58,7 @@ impl< let message = Xcm::::try_from(versioned_message).map_err(|_| { log::trace!( target: LOG_TARGET, - "Failed to convert `VersionedXcm` into `XcmV3`.", + "Failed to convert `VersionedXcm` into `xcm::prelude::Xcm`!", ); ProcessMessageError::Unsupported From c422d8bbae8ba327597582203f05d30c26ef1392 Mon Sep 17 00:00:00 2001 From: Alexander Samusev <41779041+alvicsam@users.noreply.github.com> Date: Mon, 25 Nov 2024 13:12:22 +0100 Subject: [PATCH 23/64] ci: improve workflow-stopper ux (#6632) PR addresses https://github.com/paritytech/polkadot-sdk/pull/6265#issuecomment-2497506857 cc https://github.com/paritytech/ci_cd/issues/1084 --- .github/workflows/build-misc.yml | 4 ++-- .github/workflows/check-frame-omni-bencher.yml | 4 ++-- .github/workflows/checks-quick.yml | 2 +- .github/workflows/checks.yml | 6 +++--- .github/workflows/docs.yml | 4 ++-- .github/workflows/tests-linux-stable.yml | 8 ++++---- 6 files changed, 14 insertions(+), 14 deletions(-) diff --git a/.github/workflows/build-misc.yml b/.github/workflows/build-misc.yml index a9b433a94b64..c4a7281b9ebc 100644 --- a/.github/workflows/build-misc.yml +++ b/.github/workflows/build-misc.yml @@ -44,7 +44,7 @@ jobs: forklift cargo check -p rococo-runtime forklift cargo check -p polkadot-test-runtime - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} @@ -73,7 +73,7 @@ jobs: cd ./substrate/bin/utils/subkey forklift cargo build --locked --release - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} diff --git a/.github/workflows/check-frame-omni-bencher.yml b/.github/workflows/check-frame-omni-bencher.yml index b47c9d49feaf..bc0ff82b6774 100644 --- a/.github/workflows/check-frame-omni-bencher.yml +++ b/.github/workflows/check-frame-omni-bencher.yml @@ -41,7 +41,7 @@ jobs: forklift cargo build --locked --quiet --release -p asset-hub-westend-runtime --features runtime-benchmarks forklift cargo run --locked --release -p frame-omni-bencher --quiet -- v1 benchmark pallet --runtime target/release/wbuild/asset-hub-westend-runtime/asset_hub_westend_runtime.compact.compressed.wasm --all --steps 2 --repeat 1 --quiet - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} @@ -99,7 +99,7 @@ jobs: echo "Running command: $cmd" eval "$cmd" - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} diff --git a/.github/workflows/checks-quick.yml b/.github/workflows/checks-quick.yml index 4fcaf80c83fc..c733a2517cb8 100644 --- a/.github/workflows/checks-quick.yml +++ b/.github/workflows/checks-quick.yml @@ -30,7 +30,7 @@ jobs: id: required run: cargo +nightly fmt --all -- --check - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} diff --git a/.github/workflows/checks.yml b/.github/workflows/checks.yml index c240504fa1e7..02428711811f 100644 --- a/.github/workflows/checks.yml +++ b/.github/workflows/checks.yml @@ -36,7 +36,7 @@ jobs: cargo clippy --all-targets --locked --workspace --quiet cargo clippy --all-targets --all-features --locked --workspace --quiet - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} @@ -62,7 +62,7 @@ jobs: # experimental code may rely on try-runtime and vice-versa forklift cargo check --locked --all --features try-runtime,experimental --quiet - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} @@ -91,7 +91,7 @@ jobs: ./check-features-variants.sh cd - - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} diff --git a/.github/workflows/docs.yml b/.github/workflows/docs.yml index cc84e7f9ad3b..b7c70c9e6d66 100644 --- a/.github/workflows/docs.yml +++ b/.github/workflows/docs.yml @@ -29,7 +29,7 @@ jobs: env: RUSTFLAGS: "-Cdebug-assertions=y -Dwarnings" - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} @@ -69,7 +69,7 @@ jobs: retention-days: 1 if-no-files-found: error - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} diff --git a/.github/workflows/tests-linux-stable.yml b/.github/workflows/tests-linux-stable.yml index b9d0605b2495..3f8dc4fe1240 100644 --- a/.github/workflows/tests-linux-stable.yml +++ b/.github/workflows/tests-linux-stable.yml @@ -37,7 +37,7 @@ jobs: id: required run: WASM_BUILD_NO_COLOR=1 forklift cargo test -p staging-node-cli --release --locked -- --ignored - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} @@ -63,7 +63,7 @@ jobs: id: required run: forklift cargo nextest run --workspace --features runtime-benchmarks benchmark --locked --cargo-profile testnet --cargo-quiet - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} @@ -113,7 +113,7 @@ jobs: if: ${{ matrix.partition == '1/3' }} run: forklift cargo nextest run -p sp-api-test --features enable-staging-api --cargo-quiet - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} @@ -155,7 +155,7 @@ jobs: --filter-expr " !test(/all_security_features_work/) - test(/nonexistent_cache_dir/)" \ --partition count:${{ matrix.partition }} \ - name: Stop all workflows if failed - if: ${{ failure() && steps.required.conclusion == 'failure' }} + if: ${{ failure() && steps.required.conclusion == 'failure' && !github.event.pull_request.head.repo.fork }} uses: ./.github/actions/workflow-stopper with: app-id: ${{ secrets.WORKFLOW_STOPPER_RUNNER_APP_ID }} From 41b6915ecb4b5691cdeeb585e26d46c4897ae151 Mon Sep 17 00:00:00 2001 From: jpserrat <35823283+jpserrat@users.noreply.github.com> Date: Mon, 25 Nov 2024 12:54:04 -0300 Subject: [PATCH 24/64] remove ReportCollator message (#6628) Closes #6415 # Description Remove unused message `ReportCollator` and test related to this message on the collator protocol validator side. cc: @tdimitrov --------- Co-authored-by: Tsvetomir Dimitrov Co-authored-by: command-bot <> --- .../src/collator_side/mod.rs | 2 +- .../src/validator_side/mod.rs | 3 - .../src/validator_side/tests/mod.rs | 60 ------------------- polkadot/node/subsystem-types/src/messages.rs | 15 ++--- .../src/node/collators/collator-protocol.md | 6 -- .../src/node/subsystems-and-jobs.md | 7 +-- .../src/types/overseer-protocol.md | 3 - prdoc/pr_6628.prdoc | 12 ++++ 8 files changed, 20 insertions(+), 88 deletions(-) create mode 100644 prdoc/pr_6628.prdoc diff --git a/polkadot/node/network/collator-protocol/src/collator_side/mod.rs b/polkadot/node/network/collator-protocol/src/collator_side/mod.rs index 504b0d716043..d77480272cb4 100644 --- a/polkadot/node/network/collator-protocol/src/collator_side/mod.rs +++ b/polkadot/node/network/collator-protocol/src/collator_side/mod.rs @@ -899,7 +899,7 @@ async fn process_msg( ); } }, - msg @ (ReportCollator(..) | Invalid(..) | Seconded(..)) => { + msg @ (Invalid(..) | Seconded(..)) => { gum::warn!( target: LOG_TARGET, "{:?} message is not expected on the collator side of the protocol", diff --git a/polkadot/node/network/collator-protocol/src/validator_side/mod.rs b/polkadot/node/network/collator-protocol/src/validator_side/mod.rs index 86358f503d04..36ec959c3406 100644 --- a/polkadot/node/network/collator-protocol/src/validator_side/mod.rs +++ b/polkadot/node/network/collator-protocol/src/validator_side/mod.rs @@ -1462,9 +1462,6 @@ async fn process_msg( "DistributeCollation message is not expected on the validator side of the protocol", ); }, - ReportCollator(id) => { - report_collator(&mut state.reputation, ctx.sender(), &state.peer_data, id).await; - }, NetworkBridgeUpdate(event) => { if let Err(e) = handle_network_msg(ctx, state, keystore, event).await { gum::warn!( diff --git a/polkadot/node/network/collator-protocol/src/validator_side/tests/mod.rs b/polkadot/node/network/collator-protocol/src/validator_side/tests/mod.rs index 7bc61dd4ebec..f2f23c188a66 100644 --- a/polkadot/node/network/collator-protocol/src/validator_side/tests/mod.rs +++ b/polkadot/node/network/collator-protocol/src/validator_side/tests/mod.rs @@ -638,66 +638,6 @@ fn act_on_advertisement_v2() { }); } -// Test that other subsystems may modify collators' reputations. -#[test] -fn collator_reporting_works() { - let test_state = TestState::default(); - - test_harness(ReputationAggregator::new(|_| true), |test_harness| async move { - let TestHarness { mut virtual_overseer, .. } = test_harness; - - overseer_send( - &mut virtual_overseer, - CollatorProtocolMessage::NetworkBridgeUpdate(NetworkBridgeEvent::OurViewChange( - our_view![test_state.relay_parent], - )), - ) - .await; - - respond_to_runtime_api_queries(&mut virtual_overseer, &test_state, test_state.relay_parent) - .await; - - let peer_b = PeerId::random(); - let peer_c = PeerId::random(); - - connect_and_declare_collator( - &mut virtual_overseer, - peer_b, - test_state.collators[0].clone(), - test_state.chain_ids[0], - CollationVersion::V1, - ) - .await; - - connect_and_declare_collator( - &mut virtual_overseer, - peer_c, - test_state.collators[1].clone(), - test_state.chain_ids[0], - CollationVersion::V1, - ) - .await; - - overseer_send( - &mut virtual_overseer, - CollatorProtocolMessage::ReportCollator(test_state.collators[0].public()), - ) - .await; - - assert_matches!( - overseer_recv(&mut virtual_overseer).await, - AllMessages::NetworkBridgeTx( - NetworkBridgeTxMessage::ReportPeer(ReportPeerMessage::Single(peer, rep)), - ) => { - assert_eq!(peer, peer_b); - assert_eq!(rep.value, COST_REPORT_BAD.cost_or_benefit()); - } - ); - - virtual_overseer - }); -} - // Test that we verify the signatures on `Declare` and `AdvertiseCollation` messages. #[test] fn collator_authentication_verification_works() { diff --git a/polkadot/node/subsystem-types/src/messages.rs b/polkadot/node/subsystem-types/src/messages.rs index 28a3a1ab82ab..b541f9519219 100644 --- a/polkadot/node/subsystem-types/src/messages.rs +++ b/polkadot/node/subsystem-types/src/messages.rs @@ -48,12 +48,12 @@ use polkadot_primitives::{ CommittedCandidateReceiptV2 as CommittedCandidateReceipt, CoreState, }, ApprovalVotingParams, AuthorityDiscoveryId, BlockNumber, CandidateCommitments, CandidateHash, - CandidateIndex, CollatorId, CoreIndex, DisputeState, ExecutorParams, GroupIndex, - GroupRotationInfo, Hash, HeadData, Header as BlockHeader, Id as ParaId, InboundDownwardMessage, - InboundHrmpMessage, MultiDisputeStatementSet, NodeFeatures, OccupiedCoreAssumption, - PersistedValidationData, PvfCheckStatement, PvfExecKind as RuntimePvfExecKind, SessionIndex, - SessionInfo, SignedAvailabilityBitfield, SignedAvailabilityBitfields, ValidationCode, - ValidationCodeHash, ValidatorId, ValidatorIndex, ValidatorSignature, + CandidateIndex, CoreIndex, DisputeState, ExecutorParams, GroupIndex, GroupRotationInfo, Hash, + HeadData, Header as BlockHeader, Id as ParaId, InboundDownwardMessage, InboundHrmpMessage, + MultiDisputeStatementSet, NodeFeatures, OccupiedCoreAssumption, PersistedValidationData, + PvfCheckStatement, PvfExecKind as RuntimePvfExecKind, SessionIndex, SessionInfo, + SignedAvailabilityBitfield, SignedAvailabilityBitfields, ValidationCode, ValidationCodeHash, + ValidatorId, ValidatorIndex, ValidatorSignature, }; use polkadot_statement_table::v2::Misbehavior; use std::{ @@ -250,9 +250,6 @@ pub enum CollatorProtocolMessage { /// The core index where the candidate should be backed. core_index: CoreIndex, }, - /// Report a collator as having provided an invalid collation. This should lead to disconnect - /// and blacklist of the collator. - ReportCollator(CollatorId), /// Get a network bridge update. #[from] NetworkBridgeUpdate(NetworkBridgeEvent), diff --git a/polkadot/roadmap/implementers-guide/src/node/collators/collator-protocol.md b/polkadot/roadmap/implementers-guide/src/node/collators/collator-protocol.md index 432d9ab69bab..586a4169b5bc 100644 --- a/polkadot/roadmap/implementers-guide/src/node/collators/collator-protocol.md +++ b/polkadot/roadmap/implementers-guide/src/node/collators/collator-protocol.md @@ -151,12 +151,6 @@ time per relay parent. This reduces the bandwidth requirements and as we can sec the others are probably not required anyway. If the request times out, we need to note the collator as being unreliable and reduce its priority relative to other collators. -As a validator, once the collation has been fetched some other subsystem will inspect and do deeper validation of the -collation. The subsystem will report to this subsystem with a [`CollatorProtocolMessage`][CPM]`::ReportCollator`. In -that case, if we are connected directly to the collator, we apply a cost to the `PeerId` associated with the collator -and potentially disconnect or blacklist it. If the collation is seconded, we notify the collator and apply a benefit to -the `PeerId` associated with the collator. - ### Interaction with [Candidate Backing][CB] As collators advertise the availability, a validator will simply second the first valid parablock candidate per relay diff --git a/polkadot/roadmap/implementers-guide/src/node/subsystems-and-jobs.md b/polkadot/roadmap/implementers-guide/src/node/subsystems-and-jobs.md index a3ca7347eb63..a96f3fa3d4a0 100644 --- a/polkadot/roadmap/implementers-guide/src/node/subsystems-and-jobs.md +++ b/polkadot/roadmap/implementers-guide/src/node/subsystems-and-jobs.md @@ -129,7 +129,6 @@ digraph { cand_sel -> coll_prot [arrowhead = "diamond", label = "FetchCollation"] cand_sel -> cand_back [arrowhead = "onormal", label = "Second"] - cand_sel -> coll_prot [arrowhead = "onormal", label = "ReportCollator"] cand_val -> runt_api [arrowhead = "diamond", label = "Request::PersistedValidationData"] cand_val -> runt_api [arrowhead = "diamond", label = "Request::ValidationCode"] @@ -231,7 +230,7 @@ sequenceDiagram VS ->> CandidateSelection: Collation - Note over CandidateSelection: Lots of other machinery in play here,
but there are only three outcomes from the
perspective of the `CollatorProtocol`: + Note over CandidateSelection: Lots of other machinery in play here,
but there are only two outcomes from the
perspective of the `CollatorProtocol`: alt happy path CandidateSelection -->> VS: FetchCollation @@ -242,10 +241,6 @@ sequenceDiagram NB ->> VS: Collation Deactivate VS - else collation invalid or unexpected - CandidateSelection ->> VS: ReportCollator - VS ->> NB: ReportPeer - else CandidateSelection already selected a different candidate Note over CandidateSelection: silently drop end diff --git a/polkadot/roadmap/implementers-guide/src/types/overseer-protocol.md b/polkadot/roadmap/implementers-guide/src/types/overseer-protocol.md index 85415e42a11c..cb862440727b 100644 --- a/polkadot/roadmap/implementers-guide/src/types/overseer-protocol.md +++ b/polkadot/roadmap/implementers-guide/src/types/overseer-protocol.md @@ -436,9 +436,6 @@ enum CollatorProtocolMessage { DistributeCollation(CandidateReceipt, PoV, Option>), /// Fetch a collation under the given relay-parent for the given ParaId. FetchCollation(Hash, ParaId, ResponseChannel<(CandidateReceipt, PoV)>), - /// Report a collator as having provided an invalid collation. This should lead to disconnect - /// and blacklist of the collator. - ReportCollator(CollatorId), /// Note a collator as having provided a good collation. NoteGoodCollation(CollatorId, SignedFullStatement), /// Notify a collator that its collation was seconded. diff --git a/prdoc/pr_6628.prdoc b/prdoc/pr_6628.prdoc new file mode 100644 index 000000000000..7ea0c4968385 --- /dev/null +++ b/prdoc/pr_6628.prdoc @@ -0,0 +1,12 @@ +title: "Remove ReportCollator message" + +doc: + - audience: Node Dev + description: | + Remove unused message ReportCollator and test related to this message on the collator protocol validator side. + +crates: + - name: polkadot-node-subsystem-types + bump: patch + - name: polkadot-collator-protocol + bump: major \ No newline at end of file From 6d5f8141ad42d7a528a09715c492974550709b92 Mon Sep 17 00:00:00 2001 From: Tarek Mohamed Abdalla Date: Mon, 25 Nov 2024 19:33:32 +0200 Subject: [PATCH 25/64] rpc server: fix subscription id_provider being reset to default one. (#6588) # Description The PR ensures that the id_provider variable is cloned instead of taken, which can help prevent issues related id provider being reset to the default. In [a test in moonbeam](https://github.com/moonbeam-foundation/moonbeam/blob/c6d07d703dfcdd94cc311fa83b553071b7d433ff/test/suites/dev/moonbase/test-subscription/test-subscription.ts#L20-L31) we found that the id_provider is being reset somehow and changed to the default one. Changing .take() to .clone() would fix the issue. # Checklist * [x] My PR includes a detailed description as outlined in the "Description" and its two subsections above. * [ ] My PR follows the [labeling requirements]( https://github.com/paritytech/polkadot-sdk/blob/master/docs/contributor/CONTRIBUTING.md#Process ) of this project (at minimum one label for `T` required) * External contributors: ask maintainers to put the right label on your PR. * [ ] I have made corresponding changes to the documentation (if applicable) * [ ] I have added tests that prove my fix is effective or that my feature works (if applicable) --------- Co-authored-by: Niklas Adolfsson --- prdoc/pr_6588.prdoc | 14 ++++++++++++++ substrate/client/rpc-servers/src/lib.rs | 7 +++---- 2 files changed, 17 insertions(+), 4 deletions(-) create mode 100644 prdoc/pr_6588.prdoc diff --git a/prdoc/pr_6588.prdoc b/prdoc/pr_6588.prdoc new file mode 100644 index 000000000000..bf44b2ed3784 --- /dev/null +++ b/prdoc/pr_6588.prdoc @@ -0,0 +1,14 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: "rpc server: fix subscription id_provider being reset to default one" + +doc: + - audience: Node Dev + description: | + The modification ensures that the id_provider variable is cloned instead of taken, which can help prevent issues related id provider being reset to the default. + + +crates: + - name: sc-rpc-server + bump: patch \ No newline at end of file diff --git a/substrate/client/rpc-servers/src/lib.rs b/substrate/client/rpc-servers/src/lib.rs index 31e4042d81f2..ff21e2da768e 100644 --- a/substrate/client/rpc-servers/src/lib.rs +++ b/substrate/client/rpc-servers/src/lib.rs @@ -144,7 +144,7 @@ where local_addrs.push(local_addr); let cfg = cfg.clone(); - let mut id_provider2 = id_provider.clone(); + let id_provider2 = id_provider.clone(); tokio_handle.spawn(async move { loop { @@ -197,10 +197,9 @@ where .set_http_middleware(http_middleware) .set_message_buffer_capacity(max_buffer_capacity_per_connection) .set_batch_request_config(batch_config) - .custom_tokio_runtime(cfg.tokio_handle.clone()) - .set_id_provider(RandomStringIdProvider::new(16)); + .custom_tokio_runtime(cfg.tokio_handle.clone()); - if let Some(provider) = id_provider2.take() { + if let Some(provider) = id_provider2.clone() { builder = builder.set_id_provider(provider); } else { builder = builder.set_id_provider(RandomStringIdProvider::new(16)); From 7f64e66b3b01ff5e391e42a8159f601cbbeb46d8 Mon Sep 17 00:00:00 2001 From: Javier Viola <363911+pepoviola@users.noreply.github.com> Date: Tue, 26 Nov 2024 09:25:18 +0100 Subject: [PATCH 26/64] bump zombienet-sdk version `v0.2.16` (#6633) Fix #6575. cc: @iulianbarbu Co-authored-by: Iulian Barbu <14218860+iulianbarbu@users.noreply.github.com> --- Cargo.lock | 24 ++++++++++++------------ Cargo.toml | 2 +- 2 files changed, 13 insertions(+), 13 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index c79adee6f38e..338d5025b662 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -31910,9 +31910,9 @@ dependencies = [ [[package]] name = "zombienet-configuration" -version = "0.2.15" +version = "0.2.16" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7d7a8cc4f8e8bb3f40757b62d3b054da5c95f43321c775eb321edc89d431583e" +checksum = "8ad4fc5b0f1aa54de6bf2d6771c449b41cad47e1cf30559af0a71452686b47ab" dependencies = [ "anyhow", "lazy_static", @@ -31930,9 +31930,9 @@ dependencies = [ [[package]] name = "zombienet-orchestrator" -version = "0.2.15" +version = "0.2.16" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3d32fa87851f41443a78971bd7110274f9a66d139ac834de159adc08f90cf8e3" +checksum = "e4a7dd25842ded75c7f4dc4f38f05fef567bd0b37fd3057c223d4ee34d8fa817" dependencies = [ "anyhow", "async-trait", @@ -31963,9 +31963,9 @@ dependencies = [ [[package]] name = "zombienet-prom-metrics-parser" -version = "0.2.15" +version = "0.2.16" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9acb9c94bc7c2c83f8eb8e26ed403f757af1632f22b89394d8876412ede990ca" +checksum = "a63e0c6024dd19b0f8b28afa94f78c211e5c163350ecda4a48084532d74d7cfe" dependencies = [ "pest", "pest_derive", @@ -31974,9 +31974,9 @@ dependencies = [ [[package]] name = "zombienet-provider" -version = "0.2.15" +version = "0.2.16" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dc8f3f71d4d974fc4a2262fa9293c2eedc423540378bd7c1dc1b66cc95d1d1af" +checksum = "8d87c29390a342d0f4f62b6796861fb82e0e56c49929a272b689e8dbf24eaab9" dependencies = [ "anyhow", "async-trait", @@ -32005,9 +32005,9 @@ dependencies = [ [[package]] name = "zombienet-sdk" -version = "0.2.15" +version = "0.2.16" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5dbfddce7a6100cdc930b93301f1b6381e6577ecc013d6802258ea6902a2bebd" +checksum = "829e5111182caf00ba57cd63656cf0bde6ce6add7f6a9747d15821c202a3f27e" dependencies = [ "async-trait", "futures", @@ -32022,9 +32022,9 @@ dependencies = [ [[package]] name = "zombienet-support" -version = "0.2.15" +version = "0.2.16" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d20567c52b4fd46b600cda254dedb6a6dc30cabf512de91e4f6f78f0f7f4644b" +checksum = "99568384a1d9645458ab9de377b3517cb543a1ece5aba905aeb58d269139df4e" dependencies = [ "anyhow", "async-trait", diff --git a/Cargo.toml b/Cargo.toml index 533ea4c9e878..57e049885da5 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -1387,7 +1387,7 @@ xcm-procedural = { path = "polkadot/xcm/procedural", default-features = false } xcm-runtime-apis = { path = "polkadot/xcm/xcm-runtime-apis", default-features = false } xcm-simulator = { path = "polkadot/xcm/xcm-simulator", default-features = false } zeroize = { version = "1.7.0", default-features = false } -zombienet-sdk = { version = "0.2.15" } +zombienet-sdk = { version = "0.2.16" } zstd = { version = "0.12.4", default-features = false } [profile.release] From 86a917f59d04ea3b399b34edcb8effe76b6415e6 Mon Sep 17 00:00:00 2001 From: "dependabot[bot]" <49699333+dependabot[bot]@users.noreply.github.com> Date: Tue, 26 Nov 2024 08:49:46 +0000 Subject: [PATCH 27/64] Bump rustls from 0.23.14 to 0.23.18 (#6641) Bumps [rustls](https://github.com/rustls/rustls) from 0.23.14 to 0.23.18.
Commits
  • 33af2c3 Prepare 0.23.18
  • ffe646d Add reproducer for bug 2227
  • 69b6f74 Record and restore the processed cursor in first_handshake_message
  • 4ef3532 Upgrade to mio 1
  • 092a164 Manage dependencies via the workspace
  • a01bd6b rustls-bench: fix warnings with no features
  • 7d74de2 tests: linearize new test code helper
  • 499d797 fix: do not send session_ticket(35) extension for TLS 1.3
  • faca289 chore(deps): lock file maintenance
  • d12f423 fix(deps): update rust crate asn1 to 0.20
  • Additional commits viewable in compare view

[![Dependabot compatibility score](https://dependabot-badges.githubapp.com/badges/compatibility_score?dependency-name=rustls&package-manager=cargo&previous-version=0.23.14&new-version=0.23.18)](https://docs.github.com/en/github/managing-security-vulnerabilities/about-dependabot-security-updates#about-compatibility-scores) Dependabot will resolve any conflicts with this PR as long as you don't alter it yourself. You can also trigger a rebase manually by commenting `@dependabot rebase`. [//]: # (dependabot-automerge-start) [//]: # (dependabot-automerge-end) ---
Dependabot commands and options
You can trigger Dependabot actions by commenting on this PR: - `@dependabot rebase` will rebase this PR - `@dependabot recreate` will recreate this PR, overwriting any edits that have been made to it - `@dependabot merge` will merge this PR after your CI passes on it - `@dependabot squash and merge` will squash and merge this PR after your CI passes on it - `@dependabot cancel merge` will cancel a previously requested merge and block automerging - `@dependabot reopen` will reopen this PR if it is closed - `@dependabot close` will close this PR and stop Dependabot recreating it. You can achieve the same result by closing it manually - `@dependabot show ignore conditions` will show all of the ignore conditions of the specified dependency - `@dependabot ignore this major version` will close this PR and stop Dependabot creating any more for this major version (unless you reopen the PR or upgrade to it yourself) - `@dependabot ignore this minor version` will close this PR and stop Dependabot creating any more for this minor version (unless you reopen the PR or upgrade to it yourself) - `@dependabot ignore this dependency` will close this PR and stop Dependabot creating any more for this dependency (unless you reopen the PR or upgrade to it yourself) You can disable automated security fix PRs for this repo from the [Security Alerts page](https://github.com/paritytech/polkadot-sdk/network/alerts).
Signed-off-by: dependabot[bot] Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> --- Cargo.lock | 28 ++++++++++++++-------------- Cargo.toml | 2 +- 2 files changed, 15 insertions(+), 15 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 338d5025b662..c2d2eb3e9644 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -8530,7 +8530,7 @@ dependencies = [ "hyper 1.3.1", "hyper-util", "log", - "rustls 0.23.14", + "rustls 0.23.18", "rustls-native-certs 0.8.0", "rustls-pki-types", "tokio", @@ -9145,7 +9145,7 @@ dependencies = [ "http 1.1.0", "jsonrpsee-core", "pin-project", - "rustls 0.23.14", + "rustls 0.23.18", "rustls-pki-types", "rustls-platform-verifier", "soketto 0.8.0", @@ -9198,7 +9198,7 @@ dependencies = [ "hyper-util", "jsonrpsee-core", "jsonrpsee-types", - "rustls 0.23.14", + "rustls 0.23.18", "rustls-platform-verifier", "serde", "serde_json", @@ -20609,7 +20609,7 @@ dependencies = [ "quinn-proto 0.11.8", "quinn-udp 0.5.4", "rustc-hash 2.0.0", - "rustls 0.23.14", + "rustls 0.23.18", "socket2 0.5.7", "thiserror", "tokio", @@ -20643,7 +20643,7 @@ dependencies = [ "rand", "ring 0.17.7", "rustc-hash 2.0.0", - "rustls 0.23.14", + "rustls 0.23.18", "slab", "thiserror", "tinyvec", @@ -21130,7 +21130,7 @@ dependencies = [ "percent-encoding", "pin-project-lite", "quinn 0.11.5", - "rustls 0.23.14", + "rustls 0.23.18", "rustls-pemfile 2.0.0", "rustls-pki-types", "serde", @@ -21734,9 +21734,9 @@ dependencies = [ [[package]] name = "rustls" -version = "0.23.14" +version = "0.23.18" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "415d9944693cb90382053259f89fbb077ea730ad7273047ec63b19bc9b160ba8" +checksum = "9c9cc1d47e243d655ace55ed38201c19ae02c148ae56412ab8750e8f0166ab7f" dependencies = [ "log", "once_cell", @@ -21806,9 +21806,9 @@ dependencies = [ [[package]] name = "rustls-pki-types" -version = "1.9.0" +version = "1.10.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0e696e35370c65c9c541198af4543ccd580cf17fc25d8e05c5a242b202488c55" +checksum = "16f1201b3c9a7ee8039bcadc17b7e605e2945b27eee7631788c1bd2b0643674b" [[package]] name = "rustls-platform-verifier" @@ -21821,7 +21821,7 @@ dependencies = [ "jni", "log", "once_cell", - "rustls 0.23.14", + "rustls 0.23.18", "rustls-native-certs 0.7.0", "rustls-platform-verifier-android", "rustls-webpki 0.102.8", @@ -23128,7 +23128,7 @@ dependencies = [ "parity-scale-codec", "parking_lot 0.12.3", "rand", - "rustls 0.23.14", + "rustls 0.23.18", "sc-block-builder", "sc-client-api", "sc-client-db", @@ -29529,7 +29529,7 @@ version = "0.26.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0c7bc40d0e5a97695bb96e27995cd3a08538541b0a846f65bba7a359f36700d4" dependencies = [ - "rustls 0.23.14", + "rustls 0.23.18", "rustls-pki-types", "tokio", ] @@ -30240,7 +30240,7 @@ dependencies = [ "flate2", "log", "once_cell", - "rustls 0.23.14", + "rustls 0.23.18", "rustls-pki-types", "serde", "serde_json", diff --git a/Cargo.toml b/Cargo.toml index 57e049885da5..53f95406e79a 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -1136,7 +1136,7 @@ rstest = { version = "0.18.2" } rustc-hash = { version = "1.1.0" } rustc-hex = { version = "2.1.0", default-features = false } rustix = { version = "0.36.7", default-features = false } -rustls = { version = "0.23.14", default-features = false, features = ["logging", "ring", "std", "tls12"] } +rustls = { version = "0.23.18", default-features = false, features = ["logging", "ring", "std", "tls12"] } rustversion = { version = "1.0.17" } rusty-fork = { version = "0.3.0", default-features = false } safe-mix = { version = "1.0", default-features = false } From 8216235b480630c5a69636b172f5146711c88c9a Mon Sep 17 00:00:00 2001 From: Alexandru Vasile <60601340+lexnv@users.noreply.github.com> Date: Tue, 26 Nov 2024 10:58:48 +0200 Subject: [PATCH 28/64] ci/check-semver: Fix semver failed step (#6535) The semver-check is failing with the following [error](https://github.com/paritytech/polkadot-sdk/actions/runs/11908981132/job/33185572284): ```bash error[E0658]: use of unstable library feature 'error_in_core' --> /usr/local/cargo/registry/src/index.crates.io-6f17d22bba15001f/frame-decode-0.5.0/src/decoding/extrinsic_decoder.rs:56:6 | 56 | impl core::error::Error for ExtrinsicDecodeError {} | ^^^^^^^^^^^^^^^^^^ | = note: see issue #103765 for more information = help: add `#![feature(error_in_core)]` to the crate attributes to enable = note: this compiler was built on 2024-05-31; consider upgrading it if it is out of date ``` This is related to the toolchain nightly version 1.80. In rust, 1.81 the `core::error::Error` is stable. After updating the rust-toolchain, parity-publish crate must be updated as well. The `cargo-semver-checks` dependency of `parity-publish` crate is updated from 0.34 to 0.38. This update enables rustdoc v36 that fixes the following [issue](https://github.com/paritytech/polkadot-sdk/actions/runs/11912689841/job/33196936011): ```bash validating prdocs... checking file changes... checking semver changes... (1/18) building frame-support-HEAD... (2/18) building frame-support-28.0.0... Error: rustdoc format v36 for file /__w/polkadot-sdk/polkadot-sdk/target/doc/frame_support.new is not supported ``` This PR is pending on a release of parity-publish to version 0.9.0 (fixes already on origin/master) --------- Signed-off-by: Alexandru Vasile --- .github/workflows/check-semver.yml | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/.github/workflows/check-semver.yml b/.github/workflows/check-semver.yml index 78602410cdf6..8d77b6a31b75 100644 --- a/.github/workflows/check-semver.yml +++ b/.github/workflows/check-semver.yml @@ -11,7 +11,7 @@ concurrency: cancel-in-progress: true env: - TOOLCHAIN: nightly-2024-06-01 + TOOLCHAIN: nightly-2024-10-19 jobs: preflight: @@ -74,7 +74,7 @@ jobs: - name: install parity-publish # Set the target dir to cache the build. - run: CARGO_TARGET_DIR=./target/ cargo install parity-publish@0.8.0 --locked -q + run: CARGO_TARGET_DIR=./target/ cargo install parity-publish@0.10.1 --locked -q - name: check semver run: | From 3c003872178b6ce535e9f26ce52e324f36075ffd Mon Sep 17 00:00:00 2001 From: Egor_P Date: Tue, 26 Nov 2024 14:46:51 +0100 Subject: [PATCH 29/64] [Release|CI/CD] Github pipeline to publish polkadot deb package (#6640) This pipeline should replace a manual action done on the `cleamroom` server to publish the `polkadot` deb package to our apt repo with the pipeline triggered from the new paritytech-release org. Right now, this is done manually by running the [add-packages.sh](https://github.com/paritytech/cleanroom/blob/master/ansible/roles/parity-repos/files/add-packages.sh) script on the `cleanroom` machine. What is done under the hood: - Pipeline downloads `polakdot` deb package from S3, that was prebuilt in the [Build release rc pipeline](https://github.com/paritytech/polkadot-sdk/blob/master/.github/workflows/release-build-rc.yml) - Prepares and syncs local apt repository - Adds and signs deb package to it using `reprepro` - Uploads new deb package to the distributed repo Closes: https://github.com/paritytech/release-engineering/issues/239 --- .github/scripts/common/lib.sh | 33 +++- .github/scripts/release/distributions | 39 +++++ .../release-40_publish-deb-package.yml | 152 ++++++++++++++++++ 3 files changed, 222 insertions(+), 2 deletions(-) create mode 100644 .github/scripts/release/distributions create mode 100644 .github/workflows/release-40_publish-deb-package.yml diff --git a/.github/scripts/common/lib.sh b/.github/scripts/common/lib.sh index e3dd6224f29b..6b8f70a26d7e 100755 --- a/.github/scripts/common/lib.sh +++ b/.github/scripts/common/lib.sh @@ -237,15 +237,44 @@ fetch_release_artifacts() { popd > /dev/null } -# Fetch the release artifacts like binary and signatures from S3. Assumes the ENV are set: +# Fetch deb package from S3. Assumes the ENV are set: # - RELEASE_ID # - GITHUB_TOKEN # - REPO in the form paritytech/polkadot -fetch_release_artifacts_from_s3() { +fetch_debian_package_from_s3() { BINARY=$1 echo "Version : $VERSION" echo "Repo : $REPO" echo "Binary : $BINARY" + echo "Tag : $RELEASE_TAG" + OUTPUT_DIR=${OUTPUT_DIR:-"./release-artifacts/${BINARY}"} + echo "OUTPUT_DIR : $OUTPUT_DIR" + + URL_BASE=$(get_s3_url_base $BINARY) + echo "URL_BASE=$URL_BASE" + + URL=$URL_BASE/$RELEASE_TAG/x86_64-unknown-linux-gnu/${BINARY}_${VERSION}_amd64.deb + + mkdir -p "$OUTPUT_DIR" + pushd "$OUTPUT_DIR" > /dev/null + + echo "Fetching deb package..." + + echo "Fetching %s" "$URL" + curl --progress-bar -LO "$URL" || echo "Missing $URL" + + pwd + ls -al --color + popd > /dev/null + +} + +# Fetch the release artifacts like binary and signatures from S3. Assumes the ENV are set: +# - RELEASE_ID +# - GITHUB_TOKEN +# - REPO in the form paritytech/polkadot +fetch_release_artifacts_from_s3() { + BINARY=$1 OUTPUT_DIR=${OUTPUT_DIR:-"./release-artifacts/${BINARY}"} echo "OUTPUT_DIR : $OUTPUT_DIR" diff --git a/.github/scripts/release/distributions b/.github/scripts/release/distributions new file mode 100644 index 000000000000..a430ec76c6ba --- /dev/null +++ b/.github/scripts/release/distributions @@ -0,0 +1,39 @@ +Origin: Parity +Label: Parity +Codename: release +Architectures: amd64 +Components: main +Description: Apt repository for software made by Parity Technologies Ltd. +SignWith: 90BD75EBBB8E95CB3DA6078F94A4029AB4B35DAE + +Origin: Parity +Label: Parity Staging +Codename: staging +Architectures: amd64 +Components: main +Description: Staging distribution for Parity Technologies Ltd. packages +SignWith: 90BD75EBBB8E95CB3DA6078F94A4029AB4B35DAE + +Origin: Parity +Label: Parity stable2407 +Codename: stable2407 +Architectures: amd64 +Components: main +Description: Apt repository for software made by Parity Technologies Ltd. +SignWith: 90BD75EBBB8E95CB3DA6078F94A4029AB4B35DAE + +Origin: Parity +Label: Parity stable2409 +Codename: stable2409 +Architectures: amd64 +Components: main +Description: Apt repository for software made by Parity Technologies Ltd. +SignWith: 90BD75EBBB8E95CB3DA6078F94A4029AB4B35DAE + +Origin: Parity +Label: Parity stable2412 +Codename: stable2412 +Architectures: amd64 +Components: main +Description: Apt repository for software made by Parity Technologies Ltd. +SignWith: 90BD75EBBB8E95CB3DA6078F94A4029AB4B35DAE diff --git a/.github/workflows/release-40_publish-deb-package.yml b/.github/workflows/release-40_publish-deb-package.yml new file mode 100644 index 000000000000..3c5411ab16f0 --- /dev/null +++ b/.github/workflows/release-40_publish-deb-package.yml @@ -0,0 +1,152 @@ +name: Release - Publish polakdot deb package + +on: + workflow_dispatch: + inputs: + tag: + description: Current final release tag in the format polakdot-stableYYMM or polkadot-stable-YYMM-X + default: polkadot-stable2412 + required: true + type: string + + distribution: + description: Distribution where to publish deb package (release, staging, stable2407, etc) + default: staging + required: true + type: string + +jobs: + check-synchronization: + uses: paritytech-release/sync-workflows/.github/workflows/check-syncronization.yml@main + + validate-inputs: + needs: [check-synchronization] + if: ${{ needs.check-synchronization.outputs.checks_passed }} == 'true' + runs-on: ubuntu-latest + outputs: + release_tag: ${{ steps.validate_inputs.outputs.release_tag }} + + steps: + - name: Checkout sources + uses: actions/checkout@d632683dd7b4114ad314bca15554477dd762a938 # v4.2.0 + + - name: Validate inputs + id: validate_inputs + run: | + . ./.github/scripts/common/lib.sh + + RELEASE_TAG=$(validate_stable_tag ${{ inputs.tag }}) + echo "release_tag=${RELEASE_TAG}" >> $GITHUB_OUTPUT + + + fetch-artifacts-from-s3: + runs-on: ubuntu-latest + needs: [validate-inputs] + env: + REPO: ${{ github.repository }} + RELEASE_TAG: ${{ needs.validate-inputs.outputs.release_tag }} + outputs: + VERSION: ${{ steps.fetch_artifacts_from_s3.outputs.VERSION }} + + steps: + - name: Checkout sources + uses: actions/checkout@d632683dd7b4114ad314bca15554477dd762a938 # v4.2.0 + + - name: Fetch rc artifacts or release artifacts from s3 based on version + id: fetch_artifacts_from_s3 + run: | + . ./.github/scripts/common/lib.sh + + VERSION="$(get_polkadot_node_version_from_code)" + echo "VERSION=${VERSION}" >> $GITHUB_OUTPUT + + fetch_debian_package_from_s3 polkadot + + - name: Upload artifacts + uses: actions/upload-artifact@5d5d22a31266ced268874388b861e4b58bb5c2f3 # v4.3.1 + with: + name: release-artifacts + path: release-artifacts/polkadot/*.deb + + publish-deb-package: + runs-on: ubuntu-latest + needs: [fetch-artifacts-from-s3] + environment: release + env: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_DEB_PATH: "s3://releases-package-repos/deb" + LOCAL_DEB_REPO_PATH: ${{ github.workspace }}/deb + VERSION: ${{ needs.fetch-artifacts-from-s3.outputs.VERSION }} + + steps: + - name: Install pgpkkms + run: | + # Install pgpkms that is used to sign built artifacts + python3 -m pip install "pgpkms @ git+https://github.com/paritytech-release/pgpkms.git@1f8555426662ac93a3849480a35449f683b1c89f" + echo "PGPKMS_REPREPRO_PATH=$(which pgpkms-reprepro)" >> $GITHUB_ENV + + - name: Install awscli + run: | + python3 -m pip install awscli + which aws + + - name: Checkout sources + uses: actions/checkout@d632683dd7b4114ad314bca15554477dd762a938 # v4.2.0 + + - name: Import gpg keys + shell: bash + run: | + . ./.github/scripts/common/lib.sh + + import_gpg_keys + + - name: Download artifacts + uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8 + with: + name: release-artifacts + path: release-artifacts + + - name: Setup local deb repo + run: | + sudo apt-get install -y reprepro + which reprepro + + sed -i "s|^SignWith:.*|SignWith: ! ${PGPKMS_REPREPRO_PATH}|" ${{ github.workspace }}/.github/scripts/release/distributions + + mkdir -p ${{ github.workspace }}/deb/conf + cp ${{ github.workspace }}/.github/scripts/release/distributions ${{ github.workspace }}/deb/conf/distributions + cat ${{ github.workspace }}/deb/conf/distributions + + - name: Sync local deb repo + env: + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + run: | + # Download the current state of the deb repo + aws s3 sync "$AWS_DEB_PATH/db" "$LOCAL_DEB_REPO_PATH/db" + aws s3 sync "$AWS_DEB_PATH/pool" "$LOCAL_DEB_REPO_PATH/pool" + aws s3 sync "$AWS_DEB_PATH/dists" "$LOCAL_DEB_REPO_PATH/dists" + + - name: Add deb package to local repo + env: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + run: | + # Add the new deb to the repo + reprepro -b "$LOCAL_DEB_REPO_PATH" includedeb "${{ inputs.distribution }}" "release-artifacts/polkadot_${VERSION}_amd64.deb" + + - name: Upload updated deb repo + env: + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + run: | + # Upload the updated repo - dists and pool should be publicly readable + aws s3 sync "$LOCAL_DEB_REPO_PATH/pool" "$AWS_DEB_PATH/pool" --acl public-read + aws s3 sync "$LOCAL_DEB_REPO_PATH/dists" "$AWS_DEB_PATH/dists" --acl public-read + aws s3 sync "$LOCAL_DEB_REPO_PATH/db" "$AWS_DEB_PATH/db" + aws s3 sync "$LOCAL_DEB_REPO_PATH/conf" "$AWS_DEB_PATH/conf" + + # Invalidate caches to make sure latest files are served + aws cloudfront create-invalidation --distribution-id E36FKEYWDXAZYJ --paths '/deb/*' From 1c0b610078611dfebc082be52e77109ea4517e48 Mon Sep 17 00:00:00 2001 From: Branislav Kontur Date: Tue, 26 Nov 2024 15:52:23 +0100 Subject: [PATCH 30/64] xcm: fix local/remote exports when inner routers return `NotApplicable` (#6645) This PR addresses two small fixes: 1. Fixed a typo ("as as") found on the way. 2. Resolved a bug in the `local/remote exporters` used for bridging. Previously, they consumed `dest` and `msg` without returning them when inner routers/exporters failed with `NotApplicable`. This PR ensures compliance with the [`SendXcm`](https://github.com/paritytech/polkadot-sdk/blob/master/polkadot/xcm/src/v5/traits.rs#L449-L450) and [`ExportXcm`](https://github.com/paritytech/polkadot-sdk/blob/master/polkadot/xcm/xcm-executor/src/traits/export.rs#L44-L45) traits. --------- Co-authored-by: GitHub Action --- polkadot/grafana/README.md | 2 +- polkadot/grafana/parachains/status.json | 2 +- polkadot/xcm/src/v3/traits.rs | 4 +- polkadot/xcm/src/v4/traits.rs | 4 +- polkadot/xcm/src/v5/traits.rs | 4 +- .../xcm/xcm-builder/src/universal_exports.rs | 265 +++++++++++++++--- .../xcm/xcm-executor/src/traits/export.rs | 4 +- prdoc/pr_6645.prdoc | 14 + .../frame/examples/default-config/src/lib.rs | 4 +- 9 files changed, 248 insertions(+), 55 deletions(-) create mode 100644 prdoc/pr_6645.prdoc diff --git a/polkadot/grafana/README.md b/polkadot/grafana/README.md index e909fdd29a75..0ecb0b70515b 100644 --- a/polkadot/grafana/README.md +++ b/polkadot/grafana/README.md @@ -90,4 +90,4 @@ and issue statement or initiate dispute. - **Assignment delay tranches**. Approval voting is designed such that validators assigned to check a specific candidate are split up into equal delay tranches (0.5 seconds each). All validators checks are ordered by the delay tranche index. Early tranches of validators have the opportunity to check the candidate first before later tranches -that act as as backups in case of no shows. +that act as backups in case of no shows. diff --git a/polkadot/grafana/parachains/status.json b/polkadot/grafana/parachains/status.json index 5942cbdf4479..22250967848d 100644 --- a/polkadot/grafana/parachains/status.json +++ b/polkadot/grafana/parachains/status.json @@ -1405,7 +1405,7 @@ "type": "prometheus", "uid": "$data_source" }, - "description": "Approval voting requires that validators which are assigned to check a specific \ncandidate are split up into delay tranches (0.5s each). Then, all validators checks are ordered by the delay \ntranche index. Early tranches of validators will check the candidate first and later tranches act as as backups in case of no shows.", + "description": "Approval voting requires that validators which are assigned to check a specific \ncandidate are split up into delay tranches (0.5s each). Then, all validators checks are ordered by the delay \ntranche index. Early tranches of validators will check the candidate first and later tranches act as backups in case of no shows.", "gridPos": { "h": 9, "w": 18, diff --git a/polkadot/xcm/src/v3/traits.rs b/polkadot/xcm/src/v3/traits.rs index 1c8620708922..cbf85b454cc6 100644 --- a/polkadot/xcm/src/v3/traits.rs +++ b/polkadot/xcm/src/v3/traits.rs @@ -547,13 +547,13 @@ impl SendXcm for Tuple { } /// Convenience function for using a `SendXcm` implementation. Just interprets the `dest` and wraps -/// both in `Some` before passing them as as mutable references into `T::send_xcm`. +/// both in `Some` before passing them as mutable references into `T::send_xcm`. pub fn validate_send(dest: MultiLocation, msg: Xcm<()>) -> SendResult { T::validate(&mut Some(dest), &mut Some(msg)) } /// Convenience function for using a `SendXcm` implementation. Just interprets the `dest` and wraps -/// both in `Some` before passing them as as mutable references into `T::send_xcm`. +/// both in `Some` before passing them as mutable references into `T::send_xcm`. /// /// Returns either `Ok` with the price of the delivery, or `Err` with the reason why the message /// could not be sent. diff --git a/polkadot/xcm/src/v4/traits.rs b/polkadot/xcm/src/v4/traits.rs index f32b26fb163d..178093d27177 100644 --- a/polkadot/xcm/src/v4/traits.rs +++ b/polkadot/xcm/src/v4/traits.rs @@ -289,13 +289,13 @@ impl SendXcm for Tuple { } /// Convenience function for using a `SendXcm` implementation. Just interprets the `dest` and wraps -/// both in `Some` before passing them as as mutable references into `T::send_xcm`. +/// both in `Some` before passing them as mutable references into `T::send_xcm`. pub fn validate_send(dest: Location, msg: Xcm<()>) -> SendResult { T::validate(&mut Some(dest), &mut Some(msg)) } /// Convenience function for using a `SendXcm` implementation. Just interprets the `dest` and wraps -/// both in `Some` before passing them as as mutable references into `T::send_xcm`. +/// both in `Some` before passing them as mutable references into `T::send_xcm`. /// /// Returns either `Ok` with the price of the delivery, or `Err` with the reason why the message /// could not be sent. diff --git a/polkadot/xcm/src/v5/traits.rs b/polkadot/xcm/src/v5/traits.rs index 1f5041ca8d84..dd067b774fcd 100644 --- a/polkadot/xcm/src/v5/traits.rs +++ b/polkadot/xcm/src/v5/traits.rs @@ -502,13 +502,13 @@ impl SendXcm for Tuple { } /// Convenience function for using a `SendXcm` implementation. Just interprets the `dest` and wraps -/// both in `Some` before passing them as as mutable references into `T::send_xcm`. +/// both in `Some` before passing them as mutable references into `T::send_xcm`. pub fn validate_send(dest: Location, msg: Xcm<()>) -> SendResult { T::validate(&mut Some(dest), &mut Some(msg)) } /// Convenience function for using a `SendXcm` implementation. Just interprets the `dest` and wraps -/// both in `Some` before passing them as as mutable references into `T::send_xcm`. +/// both in `Some` before passing them as mutable references into `T::send_xcm`. /// /// Returns either `Ok` with the price of the delivery, or `Err` with the reason why the message /// could not be sent. diff --git a/polkadot/xcm/xcm-builder/src/universal_exports.rs b/polkadot/xcm/xcm-builder/src/universal_exports.rs index 5c754f01ec0a..aae8438c78d2 100644 --- a/polkadot/xcm/xcm-builder/src/universal_exports.rs +++ b/polkadot/xcm/xcm-builder/src/universal_exports.rs @@ -68,20 +68,28 @@ impl> SendXcm fn validate( dest: &mut Option, - xcm: &mut Option>, + msg: &mut Option>, ) -> SendResult { - let d = dest.take().ok_or(MissingArgument)?; + // This `clone` ensures that `dest` is not consumed in any case. + let d = dest.clone().take().ok_or(MissingArgument)?; let universal_source = UniversalLocation::get(); - let devolved = match ensure_is_remote(universal_source.clone(), d) { - Ok(x) => x, - Err(d) => { - *dest = Some(d); - return Err(NotApplicable) - }, - }; - let (network, destination) = devolved; - let xcm = xcm.take().ok_or(SendError::MissingArgument)?; - validate_export::(network, 0, universal_source, destination, xcm) + let devolved = ensure_is_remote(universal_source.clone(), d).map_err(|_| NotApplicable)?; + let (remote_network, remote_location) = devolved; + let xcm = msg.take().ok_or(MissingArgument)?; + + validate_export::( + remote_network, + 0, + universal_source, + remote_location, + xcm.clone(), + ) + .inspect_err(|err| { + if let NotApplicable = err { + // We need to make sure that msg is not consumed in case of `NotApplicable`. + *msg = Some(xcm); + } + }) } fn deliver(ticket: Exporter::Ticket) -> Result { @@ -95,7 +103,7 @@ pub trait ExporterFor { /// /// The payment is specified from the local context, not the bridge chain. This is the /// total amount to withdraw in to Holding and should cover both payment for the execution on - /// the bridge chain as well as payment for the use of the `ExportMessage` instruction. + /// the bridge chain and payment for the use of the `ExportMessage` instruction. fn exporter_for( network: &NetworkId, remote_location: &InteriorLocation, @@ -205,7 +213,8 @@ impl, msg: &mut Option>, ) -> SendResult { - let d = dest.clone().ok_or(MissingArgument)?; + // This `clone` ensures that `dest` is not consumed in any case. + let d = dest.clone().take().ok_or(MissingArgument)?; let devolved = ensure_is_remote(UniversalLocation::get(), d).map_err(|_| NotApplicable)?; let (remote_network, remote_location) = devolved; let xcm = msg.take().ok_or(MissingArgument)?; @@ -216,7 +225,7 @@ impl(bridge, message) + validate_send::(bridge, message).inspect_err(|err| { + if let NotApplicable = err { + // We need to make sure that msg is not consumed in case of `NotApplicable`. + *msg = Some(xcm); + } + }) } fn deliver(validation: Self::Ticket) -> Result { @@ -272,9 +290,9 @@ impl, msg: &mut Option>, ) -> SendResult { - let d = dest.as_ref().ok_or(MissingArgument)?; - let devolved = - ensure_is_remote(UniversalLocation::get(), d.clone()).map_err(|_| NotApplicable)?; + // This `clone` ensures that `dest` is not consumed in any case. + let d = dest.clone().take().ok_or(MissingArgument)?; + let devolved = ensure_is_remote(UniversalLocation::get(), d).map_err(|_| NotApplicable)?; let (remote_network, remote_location) = devolved; let xcm = msg.take().ok_or(MissingArgument)?; @@ -284,7 +302,7 @@ impl(bridge, message)?; + let (v, mut cost) = validate_send::(bridge, message).inspect_err(|err| { + if let NotApplicable = err { + // We need to make sure that msg is not consumed in case of `NotApplicable`. + *msg = Some(xcm); + } + })?; if let Some(bridge_payment) = maybe_payment { cost.push(bridge_payment); } @@ -476,10 +502,10 @@ impl< let Location { parents, interior: mut junctions } = BridgedNetwork::get(); match junctions.take_first() { Some(GlobalConsensus(network)) => (network, parents), - _ => return Err(SendError::NotApplicable), + _ => return Err(NotApplicable), } }; - ensure!(&network == &bridged_network, SendError::NotApplicable); + ensure!(&network == &bridged_network, NotApplicable); // We don't/can't use the `channel` for this adapter. let dest = destination.take().ok_or(SendError::MissingArgument)?; @@ -496,7 +522,7 @@ impl< }, Err((dest, _)) => { *destination = Some(dest); - return Err(SendError::NotApplicable) + return Err(NotApplicable) }, }; @@ -540,6 +566,10 @@ impl< #[cfg(test)] mod tests { use super::*; + use frame_support::{ + assert_err, assert_ok, + traits::{Contains, Equals}, + }; #[test] fn ensure_is_remote_works() { @@ -564,21 +594,48 @@ mod tests { assert_eq!(x, Err((Parent, Polkadot, Parachain(1000)).into())); } - pub struct OkSender; - impl SendXcm for OkSender { + pub struct OkFor(PhantomData); + impl> SendXcm for OkFor { type Ticket = (); fn validate( - _destination: &mut Option, + destination: &mut Option, _message: &mut Option>, ) -> SendResult { - Ok(((), Assets::new())) + if let Some(d) = destination.as_ref() { + if Filter::contains(&d) { + return Ok(((), Assets::new())) + } + } + Err(NotApplicable) } fn deliver(_ticket: Self::Ticket) -> Result { Ok([0; 32]) } } + impl> ExportXcm for OkFor { + type Ticket = (); + + fn validate( + network: NetworkId, + _: u32, + _: &mut Option, + destination: &mut Option, + _: &mut Option>, + ) -> SendResult { + if let Some(d) = destination.as_ref() { + if Filter::contains(&(network, d.clone())) { + return Ok(((), Assets::new())) + } + } + Err(NotApplicable) + } + + fn deliver(_ticket: Self::Ticket) -> Result { + Ok([1; 32]) + } + } /// Generic test case asserting that dest and msg is not consumed by `validate` implementation /// of `SendXcm` in case of expected result. @@ -598,46 +655,168 @@ mod tests { } #[test] - fn remote_exporters_does_not_consume_dest_or_msg_on_not_applicable() { + fn local_exporters_works() { frame_support::parameter_types! { pub Local: NetworkId = ByGenesis([0; 32]); pub UniversalLocation: InteriorLocation = [GlobalConsensus(Local::get()), Parachain(1234)].into(); pub DifferentRemote: NetworkId = ByGenesis([22; 32]); - // no routers - pub BridgeTable: Vec = vec![]; + pub RemoteDestination: Junction = Parachain(9657); + pub RoutableBridgeFilter: (NetworkId, InteriorLocation) = (DifferentRemote::get(), RemoteDestination::get().into()); } + type RoutableBridgeExporter = OkFor>; + type NotApplicableBridgeExporter = OkFor<()>; + assert_ok!(validate_export::( + DifferentRemote::get(), + 0, + UniversalLocation::get(), + RemoteDestination::get().into(), + Xcm::default() + )); + assert_err!( + validate_export::( + DifferentRemote::get(), + 0, + UniversalLocation::get(), + RemoteDestination::get().into(), + Xcm::default() + ), + NotApplicable + ); - // check with local destination (should be remote) + // 1. check with local destination (should be remote) let local_dest: Location = (Parent, Parachain(5678)).into(); assert!(ensure_is_remote(UniversalLocation::get(), local_dest.clone()).is_err()); + // UnpaidLocalExporter ensure_validate_does_not_consume_dest_or_msg::< - UnpaidRemoteExporter, OkSender, UniversalLocation>, + UnpaidLocalExporter, >(local_dest.clone(), |result| assert_eq!(Err(NotApplicable), result)); + // 2. check with not applicable from the inner router (using `NotApplicableBridgeSender`) + let remote_dest: Location = + (Parent, Parent, DifferentRemote::get(), RemoteDestination::get()).into(); + assert!(ensure_is_remote(UniversalLocation::get(), remote_dest.clone()).is_ok()); + + // UnpaidLocalExporter + ensure_validate_does_not_consume_dest_or_msg::< + UnpaidLocalExporter, + >(remote_dest.clone(), |result| assert_eq!(Err(NotApplicable), result)); + + // 3. Ok - deliver + // UnpaidRemoteExporter + assert_ok!(send_xcm::>( + remote_dest, + Xcm::default() + )); + } + + #[test] + fn remote_exporters_works() { + frame_support::parameter_types! { + pub Local: NetworkId = ByGenesis([0; 32]); + pub UniversalLocation: InteriorLocation = [GlobalConsensus(Local::get()), Parachain(1234)].into(); + pub DifferentRemote: NetworkId = ByGenesis([22; 32]); + pub RoutableBridge: Location = Location::new(1, Parachain(9657)); + // not routable + pub NotApplicableBridgeTable: Vec = vec![]; + // routable + pub RoutableBridgeTable: Vec = vec![ + NetworkExportTableItem::new( + DifferentRemote::get(), + None, + RoutableBridge::get(), + None + ) + ]; + } + type RoutableBridgeSender = OkFor>; + type NotApplicableBridgeSender = OkFor<()>; + assert_ok!(validate_send::(RoutableBridge::get(), Xcm::default())); + assert_err!( + validate_send::(RoutableBridge::get(), Xcm::default()), + NotApplicable + ); + + // 1. check with local destination (should be remote) + let local_dest: Location = (Parent, Parachain(5678)).into(); + assert!(ensure_is_remote(UniversalLocation::get(), local_dest.clone()).is_err()); + + // UnpaidRemoteExporter + ensure_validate_does_not_consume_dest_or_msg::< + UnpaidRemoteExporter< + NetworkExportTable, + RoutableBridgeSender, + UniversalLocation, + >, + >(local_dest.clone(), |result| assert_eq!(Err(NotApplicable), result)); + // SovereignPaidRemoteExporter ensure_validate_does_not_consume_dest_or_msg::< SovereignPaidRemoteExporter< - NetworkExportTable, - OkSender, + NetworkExportTable, + RoutableBridgeSender, UniversalLocation, >, >(local_dest, |result| assert_eq!(Err(NotApplicable), result)); - // check with not applicable destination + // 2. check with not applicable destination (`NotApplicableBridgeTable`) let remote_dest: Location = (Parent, Parent, DifferentRemote::get()).into(); assert!(ensure_is_remote(UniversalLocation::get(), remote_dest.clone()).is_ok()); + // UnpaidRemoteExporter ensure_validate_does_not_consume_dest_or_msg::< - UnpaidRemoteExporter, OkSender, UniversalLocation>, + UnpaidRemoteExporter< + NetworkExportTable, + RoutableBridgeSender, + UniversalLocation, + >, >(remote_dest.clone(), |result| assert_eq!(Err(NotApplicable), result)); - + // SovereignPaidRemoteExporter ensure_validate_does_not_consume_dest_or_msg::< SovereignPaidRemoteExporter< - NetworkExportTable, - OkSender, + NetworkExportTable, + RoutableBridgeSender, UniversalLocation, >, >(remote_dest, |result| assert_eq!(Err(NotApplicable), result)); + + // 3. check with not applicable from the inner router (using `NotApplicableBridgeSender`) + let remote_dest: Location = (Parent, Parent, DifferentRemote::get()).into(); + assert!(ensure_is_remote(UniversalLocation::get(), remote_dest.clone()).is_ok()); + + // UnpaidRemoteExporter + ensure_validate_does_not_consume_dest_or_msg::< + UnpaidRemoteExporter< + NetworkExportTable, + NotApplicableBridgeSender, + UniversalLocation, + >, + >(remote_dest.clone(), |result| assert_eq!(Err(NotApplicable), result)); + // SovereignPaidRemoteExporter + ensure_validate_does_not_consume_dest_or_msg::< + SovereignPaidRemoteExporter< + NetworkExportTable, + NotApplicableBridgeSender, + UniversalLocation, + >, + >(remote_dest.clone(), |result| assert_eq!(Err(NotApplicable), result)); + + // 4. Ok - deliver + // UnpaidRemoteExporter + assert_ok!(send_xcm::< + UnpaidRemoteExporter< + NetworkExportTable, + RoutableBridgeSender, + UniversalLocation, + >, + >(remote_dest.clone(), Xcm::default())); + // SovereignPaidRemoteExporter + assert_ok!(send_xcm::< + SovereignPaidRemoteExporter< + NetworkExportTable, + RoutableBridgeSender, + UniversalLocation, + >, + >(remote_dest, Xcm::default())); } #[test] diff --git a/polkadot/xcm/xcm-executor/src/traits/export.rs b/polkadot/xcm/xcm-executor/src/traits/export.rs index b356e0da7df7..3e9275edab37 100644 --- a/polkadot/xcm/xcm-executor/src/traits/export.rs +++ b/polkadot/xcm/xcm-executor/src/traits/export.rs @@ -108,7 +108,7 @@ impl ExportXcm for Tuple { } /// Convenience function for using a `SendXcm` implementation. Just interprets the `dest` and wraps -/// both in `Some` before passing them as as mutable references into `T::send_xcm`. +/// both in `Some` before passing them as mutable references into `T::send_xcm`. pub fn validate_export( network: NetworkId, channel: u32, @@ -120,7 +120,7 @@ pub fn validate_export( } /// Convenience function for using a `SendXcm` implementation. Just interprets the `dest` and wraps -/// both in `Some` before passing them as as mutable references into `T::send_xcm`. +/// both in `Some` before passing them as mutable references into `T::send_xcm`. /// /// Returns either `Ok` with the price of the delivery, or `Err` with the reason why the message /// could not be sent. diff --git a/prdoc/pr_6645.prdoc b/prdoc/pr_6645.prdoc new file mode 100644 index 000000000000..f033cadc0b6e --- /dev/null +++ b/prdoc/pr_6645.prdoc @@ -0,0 +1,14 @@ +title: 'xcm: fix local/remote exports when inner routers return `NotApplicable`' +doc: +- audience: Runtime Dev + description: |- + Resolved a bug in the `local/remote exporters` used for bridging. Previously, they consumed `dest` and `msg` without returning them when inner routers/exporters failed with `NotApplicable`. This PR ensures compliance with the [`SendXcm`](https://github.com/paritytech/polkadot-sdk/blob/master/polkadot/xcm/src/v5/traits.rs#L449-L450) and [`ExportXcm`](https://github.com/paritytech/polkadot-sdk/blob/master/polkadot/xcm/xcm-executor/src/traits/export.rs#L44-L45) traits. +crates: +- name: staging-xcm-builder + bump: patch +- name: polkadot + bump: none +- name: staging-xcm + bump: none +- name: staging-xcm-executor + bump: none diff --git a/substrate/frame/examples/default-config/src/lib.rs b/substrate/frame/examples/default-config/src/lib.rs index ccdcd4968598..f690bffe0998 100644 --- a/substrate/frame/examples/default-config/src/lib.rs +++ b/substrate/frame/examples/default-config/src/lib.rs @@ -62,10 +62,10 @@ pub mod pallet { type OverwrittenDefaultValue: Get; /// An input parameter that relies on `::AccountId`. This can - /// too have a default, as long as as it is present in `frame_system::DefaultConfig`. + /// too have a default, as long as it is present in `frame_system::DefaultConfig`. type CanDeriveDefaultFromSystem: Get; - /// We might chose to declare as one that doesn't have a default, for whatever semantical + /// We might choose to declare as one that doesn't have a default, for whatever semantical /// reason. #[pallet::no_default] type HasNoDefault: Get; From f520adb0aacd51247ed548c7db9bef874c2cca9e Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Dino=20Pa=C4=8Dandi?= <3002868+Dinonard@users.noreply.github.com> Date: Tue, 26 Nov 2024 15:56:02 +0100 Subject: [PATCH 31/64] Zero refund check for FungibleAdapter (#6506) `FungibleAdapter` will now check if the _refund amount_ is zero before calling deposit & emitting an event. Fixes https://github.com/paritytech/polkadot-sdk/issues/6469. --------- Co-authored-by: GitHub Action --- prdoc/pr_6506.prdoc | 10 +++++ .../frame/transaction-payment/src/payment.rs | 17 +++++---- .../frame/transaction-payment/src/tests.rs | 37 +++++++++++++++++++ 3 files changed, 56 insertions(+), 8 deletions(-) create mode 100644 prdoc/pr_6506.prdoc diff --git a/prdoc/pr_6506.prdoc b/prdoc/pr_6506.prdoc new file mode 100644 index 000000000000..7c6164a9959a --- /dev/null +++ b/prdoc/pr_6506.prdoc @@ -0,0 +1,10 @@ +title: Zero refund check for FungibleAdapter +doc: +- audience: Runtime User + description: |- + `FungibleAdapter` will now check if the _refund amount_ is zero before calling deposit & emitting an event. + + Fixes https://github.com/paritytech/polkadot-sdk/issues/6469. +crates: +- name: pallet-transaction-payment + bump: patch diff --git a/substrate/frame/transaction-payment/src/payment.rs b/substrate/frame/transaction-payment/src/payment.rs index 4b39cd3fe53b..b8a047fee3e6 100644 --- a/substrate/frame/transaction-payment/src/payment.rs +++ b/substrate/frame/transaction-payment/src/payment.rs @@ -155,14 +155,15 @@ where if let Some(paid) = already_withdrawn { // Calculate how much refund we should return let refund_amount = paid.peek().saturating_sub(corrected_fee); - // refund to the the account that paid the fees if it exists. otherwise, don't refind - // anything. - let refund_imbalance = if F::total_balance(who) > F::Balance::zero() { - F::deposit(who, refund_amount, Precision::BestEffort) - .unwrap_or_else(|_| Debt::::zero()) - } else { - Debt::::zero() - }; + // Refund to the the account that paid the fees if it exists & refund is non-zero. + // Otherwise, don't refund anything. + let refund_imbalance = + if refund_amount > Zero::zero() && F::total_balance(who) > F::Balance::zero() { + F::deposit(who, refund_amount, Precision::BestEffort) + .unwrap_or_else(|_| Debt::::zero()) + } else { + Debt::::zero() + }; // merge the imbalance caused by paying the fees and refunding parts of it again. let adjusted_paid: Credit = paid .offset(refund_imbalance) diff --git a/substrate/frame/transaction-payment/src/tests.rs b/substrate/frame/transaction-payment/src/tests.rs index 572c1d4961dd..bde1bf64728e 100644 --- a/substrate/frame/transaction-payment/src/tests.rs +++ b/substrate/frame/transaction-payment/src/tests.rs @@ -877,3 +877,40 @@ fn no_fee_and_no_weight_for_other_origins() { assert_eq!(post_info.actual_weight, Some(info.call_weight)); }) } + +#[test] +fn fungible_adapter_no_zero_refund_action() { + type FungibleAdapterT = payment::FungibleAdapter; + + ExtBuilder::default().balance_factor(10).build().execute_with(|| { + System::set_block_number(10); + + let dummy_acc = 1; + let (actual_fee, no_tip) = (10, 0); + let already_paid = >::withdraw_fee( + &dummy_acc, + CALL, + &CALL.get_dispatch_info(), + actual_fee, + no_tip, + ).expect("Account must have enough funds."); + + // Correction action with no expected side effect. + assert!(>::correct_and_deposit_fee( + &dummy_acc, + &CALL.get_dispatch_info(), + &default_post_info(), + actual_fee, + no_tip, + already_paid, + ).is_ok()); + + // Ensure no zero amount deposit event is emitted. + let events = System::events(); + assert!(!events + .iter() + .any(|record| matches!(record.event, RuntimeEvent::Balances(pallet_balances::Event::Deposit { amount, .. }) if amount.is_zero())), + "No zero amount deposit amount event should be emitted.", + ); + }); +} From fc315ac5979e9bf1cc56b58ab6f364b6b2689635 Mon Sep 17 00:00:00 2001 From: Giuseppe Re Date: Tue, 26 Nov 2024 17:26:19 +0100 Subject: [PATCH 32/64] Hide nonce implementation details in metadata (#6562) See https://github.com/polkadot-fellows/runtimes/issues/248 : using `TypeWithDefault` having derived `TypeInfo` for `Nonce` causes a breaking change in metadata for nonce type because it's no longer `u64`. Adding a default implementation of `TypeInfo` for `TypeWithDefault` to restore the original type info in metadata. --------- Co-authored-by: Kian Paimani <5588131+kianenigma@users.noreply.github.com> --- prdoc/pr_6562.prdoc | 14 +++++++++++ .../runtime/src/type_with_default.rs | 23 +++++++++++++++++-- 2 files changed, 35 insertions(+), 2 deletions(-) create mode 100644 prdoc/pr_6562.prdoc diff --git a/prdoc/pr_6562.prdoc b/prdoc/pr_6562.prdoc new file mode 100644 index 000000000000..250b656aefb5 --- /dev/null +++ b/prdoc/pr_6562.prdoc @@ -0,0 +1,14 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: Hide nonce implementation details in metadata + +doc: + - audience: Runtime Dev + description: | + Use custom implementation of TypeInfo for TypeWithDefault to show inner value's type info. + This should bring back nonce to u64 in metadata. + +crates: +- name: sp-runtime + bump: minor \ No newline at end of file diff --git a/substrate/primitives/runtime/src/type_with_default.rs b/substrate/primitives/runtime/src/type_with_default.rs index 5790e3ab6bf6..b0eca22e5c1a 100644 --- a/substrate/primitives/runtime/src/type_with_default.rs +++ b/substrate/primitives/runtime/src/type_with_default.rs @@ -31,7 +31,7 @@ use num_traits::{ CheckedAdd, CheckedDiv, CheckedMul, CheckedNeg, CheckedRem, CheckedShl, CheckedShr, CheckedSub, Num, NumCast, PrimInt, Saturating, ToPrimitive, }; -use scale_info::TypeInfo; +use scale_info::{StaticTypeInfo, TypeInfo}; use sp_core::Get; #[cfg(feature = "serde")] @@ -40,7 +40,8 @@ use serde::{Deserialize, Serialize}; /// A type that wraps another type and provides a default value. /// /// Passes through arithmetical and many other operations to the inner value. -#[derive(Encode, Decode, TypeInfo, Debug, MaxEncodedLen)] +/// Type information for metadata is the same as the inner value's type. +#[derive(Encode, Decode, Debug, MaxEncodedLen)] #[cfg_attr(feature = "serde", derive(Serialize, Deserialize))] pub struct TypeWithDefault>(T, PhantomData); @@ -50,6 +51,17 @@ impl> TypeWithDefault { } } +// Hides implementation details from the outside (for metadata type information). +// +// The type info showed in metadata is the one of the inner value's type. +impl + 'static> TypeInfo for TypeWithDefault { + type Identity = Self; + + fn type_info() -> scale_info::Type { + T::type_info() + } +} + impl> Clone for TypeWithDefault { fn clone(&self) -> Self { Self(self.0.clone(), PhantomData) @@ -511,6 +523,7 @@ impl> CompactAs for TypeWithDefault { #[cfg(test)] mod tests { use super::TypeWithDefault; + use scale_info::TypeInfo; use sp_arithmetic::traits::{AtLeast16Bit, AtLeast32Bit, AtLeast8Bit}; use sp_core::Get; @@ -565,5 +578,11 @@ mod tests { } type U128WithDefault = TypeWithDefault; impl WrapAtLeast32Bit for U128WithDefault {} + + assert_eq!(U8WithDefault::type_info(), ::type_info()); + assert_eq!(U16WithDefault::type_info(), ::type_info()); + assert_eq!(U32WithDefault::type_info(), ::type_info()); + assert_eq!(U64WithDefault::type_info(), ::type_info()); + assert_eq!(U128WithDefault::type_info(), ::type_info()); } } From 139691b17c66aa074d2b4ae935158d4296068f72 Mon Sep 17 00:00:00 2001 From: Francisco Aguirre Date: Tue, 26 Nov 2024 16:24:43 -0300 Subject: [PATCH 33/64] Fix `XcmPaymentApi::query_weight_to_asset_fee` version conversion (#6459) The `query_weight_to_asset_fee` function was trying to convert versions by using `try_as`, this function [doesn't convert from a versioned to a concrete type](https://github.com/paritytech/polkadot-sdk/blob/0156ca8f959d5cf3787c18113ce48acaaf1a8345/polkadot/xcm/src/lib.rs#L131). This would cause all calls with a lower version to fail. The correct function to use is the good old [try_into](https://github.com/paritytech/polkadot-sdk/blob/0156ca8f959d5cf3787c18113ce48acaaf1a8345/polkadot/xcm/src/lib.rs#L184). Now those calls work :) --------- Co-authored-by: command-bot <> Co-authored-by: Branislav Kontur Co-authored-by: GitHub Action --- Cargo.lock | 13 +++ .../assets/asset-hub-rococo/Cargo.toml | 1 + .../assets/asset-hub-rococo/src/lib.rs | 28 ++--- .../assets/asset-hub-rococo/tests/tests.rs | 24 +++- .../assets/asset-hub-westend/Cargo.toml | 1 + .../assets/asset-hub-westend/src/lib.rs | 29 ++--- .../assets/asset-hub-westend/tests/tests.rs | 18 ++- .../runtimes/assets/common/src/lib.rs | 79 +++++++++---- .../runtimes/assets/test-utils/Cargo.toml | 4 + .../assets/test-utils/src/test_cases.rs | 110 +++++++++++++++++- .../bridge-hubs/bridge-hub-rococo/Cargo.toml | 1 + .../bridge-hubs/bridge-hub-rococo/src/lib.rs | 3 +- .../bridge-hub-rococo/tests/tests.rs | 16 ++- .../bridge-hubs/bridge-hub-westend/Cargo.toml | 1 + .../bridge-hubs/bridge-hub-westend/src/lib.rs | 3 +- .../bridge-hub-westend/tests/tests.rs | 16 ++- .../collectives-westend/Cargo.toml | 1 + .../collectives-westend/src/lib.rs | 3 +- .../collectives-westend/tests/tests.rs | 14 ++- .../coretime/coretime-rococo/Cargo.toml | 4 + .../coretime/coretime-rococo/src/lib.rs | 3 +- .../coretime/coretime-rococo/tests/tests.rs | 14 ++- .../coretime/coretime-westend/Cargo.toml | 3 + .../coretime/coretime-westend/src/lib.rs | 3 +- .../coretime/coretime-westend/tests/tests.rs | 14 ++- .../runtimes/people/people-rococo/Cargo.toml | 3 + .../runtimes/people/people-rococo/src/lib.rs | 3 +- .../people/people-rococo/tests/tests.rs | 14 ++- .../runtimes/people/people-westend/Cargo.toml | 3 + .../runtimes/people/people-westend/src/lib.rs | 3 +- .../people/people-westend/tests/tests.rs | 14 ++- .../parachains/runtimes/test-utils/Cargo.toml | 4 + .../runtimes/test-utils/src/test_cases.rs | 67 ++++++++++- .../xcm-runtime-apis/tests/fee_estimation.rs | 23 ++++ polkadot/xcm/xcm-runtime-apis/tests/mock.rs | 3 +- prdoc/pr_6459.prdoc | 22 ++++ 36 files changed, 483 insertions(+), 82 deletions(-) create mode 100644 prdoc/pr_6459.prdoc diff --git a/Cargo.lock b/Cargo.lock index c2d2eb3e9644..58b8b222cce4 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -899,6 +899,7 @@ dependencies = [ "pallet-xcm-benchmarks 7.0.0", "pallet-xcm-bridge-hub-router 0.5.0", "parachains-common 7.0.0", + "parachains-runtimes-test-utils 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "polkadot-runtime-common 7.0.0", @@ -1036,6 +1037,7 @@ dependencies = [ "pallet-xcm-benchmarks 7.0.0", "pallet-xcm-bridge-hub-router 0.5.0", "parachains-common 7.0.0", + "parachains-runtimes-test-utils 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "polkadot-runtime-common 7.0.0", @@ -1077,6 +1079,7 @@ dependencies = [ "frame-support 28.0.0", "frame-system 28.0.0", "hex-literal", + "pallet-asset-conversion 10.0.0", "pallet-assets 29.1.0", "pallet-balances 28.0.0", "pallet-collator-selection 9.0.0", @@ -1094,6 +1097,7 @@ dependencies = [ "staging-xcm-builder 7.0.0", "staging-xcm-executor 7.0.0", "substrate-wasm-builder 17.0.0", + "xcm-runtime-apis 0.1.0", ] [[package]] @@ -2578,6 +2582,7 @@ dependencies = [ "pallet-xcm-benchmarks 7.0.0", "pallet-xcm-bridge-hub 0.2.0", "parachains-common 7.0.0", + "parachains-runtimes-test-utils 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "polkadot-runtime-common 7.0.0", @@ -2815,6 +2820,7 @@ dependencies = [ "pallet-xcm-benchmarks 7.0.0", "pallet-xcm-bridge-hub 0.2.0", "parachains-common 7.0.0", + "parachains-runtimes-test-utils 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "polkadot-runtime-common 7.0.0", @@ -3550,6 +3556,7 @@ dependencies = [ "pallet-utility 28.0.0", "pallet-xcm 7.0.0", "parachains-common 7.0.0", + "parachains-runtimes-test-utils 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "polkadot-runtime-common 7.0.0", @@ -3991,6 +3998,7 @@ dependencies = [ "pallet-xcm 7.0.0", "pallet-xcm-benchmarks 7.0.0", "parachains-common 7.0.0", + "parachains-runtimes-test-utils 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "polkadot-runtime-common 7.0.0", @@ -4090,6 +4098,7 @@ dependencies = [ "pallet-xcm 7.0.0", "pallet-xcm-benchmarks 7.0.0", "parachains-common 7.0.0", + "parachains-runtimes-test-utils 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "polkadot-runtime-common 7.0.0", @@ -16165,6 +16174,7 @@ dependencies = [ "pallet-session 28.0.0", "pallet-timestamp 27.0.0", "pallet-xcm 7.0.0", + "parachains-common 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "sp-consensus-aura 0.32.0", @@ -16176,6 +16186,7 @@ dependencies = [ "staging-xcm 7.0.0", "staging-xcm-executor 7.0.0", "substrate-wasm-builder 17.0.0", + "xcm-runtime-apis 0.1.0", ] [[package]] @@ -16574,6 +16585,7 @@ dependencies = [ "pallet-xcm 7.0.0", "pallet-xcm-benchmarks 7.0.0", "parachains-common 7.0.0", + "parachains-runtimes-test-utils 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "polkadot-runtime-common 7.0.0", @@ -16675,6 +16687,7 @@ dependencies = [ "pallet-xcm 7.0.0", "pallet-xcm-benchmarks 7.0.0", "parachains-common 7.0.0", + "parachains-runtimes-test-utils 7.0.0", "parity-scale-codec", "polkadot-parachain-primitives 6.0.0", "polkadot-runtime-common 7.0.0", diff --git a/cumulus/parachains/runtimes/assets/asset-hub-rococo/Cargo.toml b/cumulus/parachains/runtimes/assets/asset-hub-rococo/Cargo.toml index 42adaba7a27c..bfe8ed869758 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-rococo/Cargo.toml +++ b/cumulus/parachains/runtimes/assets/asset-hub-rococo/Cargo.toml @@ -99,6 +99,7 @@ snowbridge-router-primitives = { workspace = true } [dev-dependencies] asset-test-utils = { workspace = true, default-features = true } +parachains-runtimes-test-utils = { workspace = true, default-features = true } [build-dependencies] substrate-wasm-builder = { optional = true, workspace = true, default-features = true } diff --git a/cumulus/parachains/runtimes/assets/asset-hub-rococo/src/lib.rs b/cumulus/parachains/runtimes/assets/asset-hub-rococo/src/lib.rs index bc48c2d805fd..b6f3ccd3901b 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/assets/asset-hub-rococo/src/lib.rs @@ -1415,37 +1415,31 @@ impl_runtime_apis! { // We accept the native token to pay fees. let mut acceptable_assets = vec![AssetId(native_token.clone())]; // We also accept all assets in a pool with the native token. - let assets_in_pool_with_native = assets_common::get_assets_in_pool_with::< - Runtime, - xcm::v5::Location - >(&native_token).map_err(|()| XcmPaymentApiError::VersionedConversionFailed)?.into_iter(); - acceptable_assets.extend(assets_in_pool_with_native); + acceptable_assets.extend( + assets_common::PoolAdapter::::get_assets_in_pool_with(native_token) + .map_err(|()| XcmPaymentApiError::VersionedConversionFailed)? + ); PolkadotXcm::query_acceptable_payment_assets(xcm_version, acceptable_assets) } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { let native_asset = xcm_config::TokenLocation::get(); let fee_in_native = WeightToFee::weight_to_fee(&weight); - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == native_asset => { // for native token Ok(fee_in_native) }, Ok(asset_id) => { - let assets_in_pool_with_this_asset: Vec<_> = assets_common::get_assets_in_pool_with::< - Runtime, - xcm::v5::Location - >(&asset_id.0).map_err(|()| XcmPaymentApiError::VersionedConversionFailed)?; - if assets_in_pool_with_this_asset - .into_iter() - .map(|asset_id| asset_id.0) - .any(|location| location == native_asset) { - pallet_asset_conversion::Pallet::::quote_price_tokens_for_exact_tokens( - asset_id.clone().0, + // Try to get current price of `asset_id` in `native_asset`. + if let Ok(Some(swapped_in_native)) = assets_common::PoolAdapter::::quote_price_tokens_for_exact_tokens( + asset_id.0.clone(), native_asset, fee_in_native, true, // We include the fee. - ).ok_or(XcmPaymentApiError::AssetNotFound) + ) { + Ok(swapped_in_native) } else { log::trace!(target: "xcm::xcm_runtime_apis", "query_weight_to_asset_fee - unhandled asset_id: {asset_id:?}!"); Err(XcmPaymentApiError::AssetNotFound) diff --git a/cumulus/parachains/runtimes/assets/asset-hub-rococo/tests/tests.rs b/cumulus/parachains/runtimes/assets/asset-hub-rococo/tests/tests.rs index 5da8b45417a3..d056405adff8 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-rococo/tests/tests.rs +++ b/cumulus/parachains/runtimes/assets/asset-hub-rococo/tests/tests.rs @@ -24,10 +24,10 @@ use asset_hub_rococo_runtime::{ ForeignAssetFeeAsExistentialDepositMultiplierFeeCharger, LocationToAccountId, StakingPot, TokenLocation, TrustBackedAssetsPalletLocation, XcmConfig, }, - AllPalletsWithoutSystem, AssetConversion, AssetDeposit, Assets, Balances, CollatorSelection, - ExistentialDeposit, ForeignAssets, ForeignAssetsInstance, MetadataDepositBase, - MetadataDepositPerByte, ParachainSystem, Runtime, RuntimeCall, RuntimeEvent, RuntimeOrigin, - SessionKeys, TrustBackedAssetsInstance, XcmpQueue, + AllPalletsWithoutSystem, AssetConversion, AssetDeposit, Assets, Balances, Block, + CollatorSelection, ExistentialDeposit, ForeignAssets, ForeignAssetsInstance, + MetadataDepositBase, MetadataDepositPerByte, ParachainSystem, Runtime, RuntimeCall, + RuntimeEvent, RuntimeOrigin, SessionKeys, TrustBackedAssetsInstance, XcmpQueue, }; use asset_test_utils::{ test_cases_over_bridge::TestBridgingConfig, CollatorSessionKey, CollatorSessionKeys, @@ -1471,3 +1471,19 @@ fn location_conversion_works() { assert_eq!(got, expected, "{}", tc.description); } } + +#[test] +fn xcm_payment_api_works() { + parachains_runtimes_test_utils::test_cases::xcm_payment_api_with_native_token_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); + asset_test_utils::test_cases::xcm_payment_api_with_pools_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); +} diff --git a/cumulus/parachains/runtimes/assets/asset-hub-westend/Cargo.toml b/cumulus/parachains/runtimes/assets/asset-hub-westend/Cargo.toml index d5eaa43ab834..a3eaebb59153 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/assets/asset-hub-westend/Cargo.toml @@ -101,6 +101,7 @@ snowbridge-router-primitives = { workspace = true } [dev-dependencies] asset-test-utils = { workspace = true, default-features = true } +parachains-runtimes-test-utils = { workspace = true, default-features = true } [build-dependencies] substrate-wasm-builder = { optional = true, workspace = true, default-features = true } diff --git a/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs b/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs index cafea3b6ff8b..f20b6b1fece0 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs @@ -1528,38 +1528,31 @@ impl_runtime_apis! { // We accept the native token to pay fees. let mut acceptable_assets = vec![AssetId(native_token.clone())]; // We also accept all assets in a pool with the native token. - let assets_in_pool_with_native = assets_common::get_assets_in_pool_with::< - Runtime, - xcm::v5::Location - >(&native_token).map_err(|()| XcmPaymentApiError::VersionedConversionFailed)?.into_iter(); - acceptable_assets.extend(assets_in_pool_with_native); + acceptable_assets.extend( + assets_common::PoolAdapter::::get_assets_in_pool_with(native_token) + .map_err(|()| XcmPaymentApiError::VersionedConversionFailed)? + ); PolkadotXcm::query_acceptable_payment_assets(xcm_version, acceptable_assets) } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { let native_asset = xcm_config::WestendLocation::get(); let fee_in_native = WeightToFee::weight_to_fee(&weight); - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == native_asset => { // for native asset Ok(fee_in_native) }, Ok(asset_id) => { - // We recognize assets in a pool with the native one. - let assets_in_pool_with_this_asset: Vec<_> = assets_common::get_assets_in_pool_with::< - Runtime, - xcm::v5::Location - >(&asset_id.0).map_err(|()| XcmPaymentApiError::VersionedConversionFailed)?; - if assets_in_pool_with_this_asset - .into_iter() - .map(|asset_id| asset_id.0) - .any(|location| location == native_asset) { - pallet_asset_conversion::Pallet::::quote_price_tokens_for_exact_tokens( - asset_id.clone().0, + // Try to get current price of `asset_id` in `native_asset`. + if let Ok(Some(swapped_in_native)) = assets_common::PoolAdapter::::quote_price_tokens_for_exact_tokens( + asset_id.0.clone(), native_asset, fee_in_native, true, // We include the fee. - ).ok_or(XcmPaymentApiError::AssetNotFound) + ) { + Ok(swapped_in_native) } else { log::trace!(target: "xcm::xcm_runtime_apis", "query_weight_to_asset_fee - unhandled asset_id: {asset_id:?}!"); Err(XcmPaymentApiError::AssetNotFound) diff --git a/cumulus/parachains/runtimes/assets/asset-hub-westend/tests/tests.rs b/cumulus/parachains/runtimes/assets/asset-hub-westend/tests/tests.rs index 5d0f843554a1..109a5dd2c029 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-westend/tests/tests.rs +++ b/cumulus/parachains/runtimes/assets/asset-hub-westend/tests/tests.rs @@ -24,7 +24,7 @@ use asset_hub_westend_runtime::{ ForeignAssetFeeAsExistentialDepositMultiplierFeeCharger, LocationToAccountId, StakingPot, TrustBackedAssetsPalletLocation, WestendLocation, XcmConfig, }, - AllPalletsWithoutSystem, Assets, Balances, ExistentialDeposit, ForeignAssets, + AllPalletsWithoutSystem, Assets, Balances, Block, ExistentialDeposit, ForeignAssets, ForeignAssetsInstance, MetadataDepositBase, MetadataDepositPerByte, ParachainSystem, PolkadotXcm, Runtime, RuntimeCall, RuntimeEvent, RuntimeOrigin, SessionKeys, TrustBackedAssetsInstance, XcmpQueue, @@ -1446,3 +1446,19 @@ fn location_conversion_works() { assert_eq!(got, expected, "{}", tc.description); } } + +#[test] +fn xcm_payment_api_works() { + parachains_runtimes_test_utils::test_cases::xcm_payment_api_with_native_token_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); + asset_test_utils::test_cases::xcm_payment_api_with_pools_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); +} diff --git a/cumulus/parachains/runtimes/assets/common/src/lib.rs b/cumulus/parachains/runtimes/assets/common/src/lib.rs index 1d2d45b42c5d..25c2df6b68d1 100644 --- a/cumulus/parachains/runtimes/assets/common/src/lib.rs +++ b/cumulus/parachains/runtimes/assets/common/src/lib.rs @@ -28,7 +28,7 @@ extern crate alloc; use crate::matching::{LocalLocationPattern, ParentLocation}; use alloc::vec::Vec; use codec::{Decode, EncodeLike}; -use core::cmp::PartialEq; +use core::{cmp::PartialEq, marker::PhantomData}; use frame_support::traits::{Equals, EverythingBut}; use parachains_common::{AssetIdForTrustBackedAssets, CollectionId, ItemId}; use sp_runtime::traits::TryConvertInto; @@ -137,24 +137,62 @@ pub type PoolAssetsConvertedConcreteId = TryConvertInto, >; -/// Returns an iterator of all assets in a pool with `asset`. -/// -/// Should only be used in runtime APIs since it iterates over the whole -/// `pallet_asset_conversion::Pools` map. -/// -/// It takes in any version of an XCM Location but always returns the latest one. -/// This is to allow some margin of migrating the pools when updating the XCM version. -/// -/// An error of type `()` is returned if the version conversion fails for XCM locations. -/// This error should be mapped by the caller to a more descriptive one. -pub fn get_assets_in_pool_with< - Runtime: pallet_asset_conversion::Config, - L: TryInto + Clone + Decode + EncodeLike + PartialEq, ->( - asset: &L, -) -> Result, ()> { - pallet_asset_conversion::Pools::::iter_keys() - .filter_map(|(asset_1, asset_2)| { +/// Adapter implementation for accessing pools (`pallet_asset_conversion`) that uses `AssetKind` as +/// a `xcm::v*` which could be different from the `xcm::latest`. +pub struct PoolAdapter(PhantomData); +impl< + Runtime: pallet_asset_conversion::Config, + L: TryFrom + TryInto + Clone + Decode + EncodeLike + PartialEq, + > PoolAdapter +{ + /// Returns a vector of all assets in a pool with `asset`. + /// + /// Should only be used in runtime APIs since it iterates over the whole + /// `pallet_asset_conversion::Pools` map. + /// + /// It takes in any version of an XCM Location but always returns the latest one. + /// This is to allow some margin of migrating the pools when updating the XCM version. + /// + /// An error of type `()` is returned if the version conversion fails for XCM locations. + /// This error should be mapped by the caller to a more descriptive one. + pub fn get_assets_in_pool_with(asset: Location) -> Result, ()> { + // convert latest to the `L` version. + let asset: L = asset.try_into().map_err(|_| ())?; + Self::iter_assets_in_pool_with(&asset) + .map(|location| { + // convert `L` to the latest `AssetId` + location.try_into().map_err(|_| ()).map(AssetId) + }) + .collect::, _>>() + } + + /// Provides a current prices. Wrapper over + /// `pallet_asset_conversion::Pallet::::quote_price_tokens_for_exact_tokens`. + /// + /// An error of type `()` is returned if the version conversion fails for XCM locations. + /// This error should be mapped by the caller to a more descriptive one. + pub fn quote_price_tokens_for_exact_tokens( + asset_1: Location, + asset_2: Location, + amount: Runtime::Balance, + include_fees: bool, + ) -> Result, ()> { + // Convert latest to the `L` version. + let asset_1: L = asset_1.try_into().map_err(|_| ())?; + let asset_2: L = asset_2.try_into().map_err(|_| ())?; + + // Quote swap price. + Ok(pallet_asset_conversion::Pallet::::quote_price_tokens_for_exact_tokens( + asset_1, + asset_2, + amount, + include_fees, + )) + } + + /// Helper function for filtering pool. + pub fn iter_assets_in_pool_with(asset: &L) -> impl Iterator + '_ { + pallet_asset_conversion::Pools::::iter_keys().filter_map(|(asset_1, asset_2)| { if asset_1 == *asset { Some(asset_2) } else if asset_2 == *asset { @@ -163,8 +201,7 @@ pub fn get_assets_in_pool_with< None } }) - .map(|location| location.try_into().map_err(|_| ()).map(AssetId)) - .collect::, _>>() + } } #[cfg(test)] diff --git a/cumulus/parachains/runtimes/assets/test-utils/Cargo.toml b/cumulus/parachains/runtimes/assets/test-utils/Cargo.toml index 529d6460fc4e..f6b3c13e8102 100644 --- a/cumulus/parachains/runtimes/assets/test-utils/Cargo.toml +++ b/cumulus/parachains/runtimes/assets/test-utils/Cargo.toml @@ -16,6 +16,7 @@ codec = { features = ["derive", "max-encoded-len"], workspace = true } frame-support = { workspace = true } frame-system = { workspace = true } pallet-assets = { workspace = true } +pallet-asset-conversion = { workspace = true } pallet-balances = { workspace = true } pallet-timestamp = { workspace = true } pallet-session = { workspace = true } @@ -36,6 +37,7 @@ xcm = { workspace = true } xcm-builder = { workspace = true } xcm-executor = { workspace = true } pallet-xcm = { workspace = true } +xcm-runtime-apis = { workspace = true } # Bridges pallet-xcm-bridge-hub-router = { workspace = true } @@ -55,6 +57,7 @@ std = [ "cumulus-primitives-core/std", "frame-support/std", "frame-system/std", + "pallet-asset-conversion/std", "pallet-assets/std", "pallet-balances/std", "pallet-collator-selection/std", @@ -69,5 +72,6 @@ std = [ "sp-runtime/std", "xcm-builder/std", "xcm-executor/std", + "xcm-runtime-apis/std", "xcm/std", ] diff --git a/cumulus/parachains/runtimes/assets/test-utils/src/test_cases.rs b/cumulus/parachains/runtimes/assets/test-utils/src/test_cases.rs index 8dc720e27753..aeacc1a5471e 100644 --- a/cumulus/parachains/runtimes/assets/test-utils/src/test_cases.rs +++ b/cumulus/parachains/runtimes/assets/test-utils/src/test_cases.rs @@ -34,11 +34,14 @@ use parachains_runtimes_test_utils::{ CollatorSessionKeys, ExtBuilder, SlotDurations, ValidatorIdOf, XcmReceivedFrom, }; use sp_runtime::{ - traits::{MaybeEquivalence, StaticLookup, Zero}, + traits::{Block as BlockT, MaybeEquivalence, StaticLookup, Zero}, DispatchError, Saturating, }; use xcm::{latest::prelude::*, VersionedAssets}; use xcm_executor::{traits::ConvertLocation, XcmExecutor}; +use xcm_runtime_apis::fees::{ + runtime_decl_for_xcm_payment_api::XcmPaymentApiV1, Error as XcmPaymentApiError, +}; type RuntimeHelper = parachains_runtimes_test_utils::RuntimeHelper; @@ -1584,3 +1587,108 @@ pub fn reserve_transfer_native_asset_to_non_teleport_para_works< ); }) } + +pub fn xcm_payment_api_with_pools_works() +where + Runtime: XcmPaymentApiV1 + + frame_system::Config + + pallet_balances::Config + + pallet_session::Config + + pallet_xcm::Config + + parachain_info::Config + + pallet_collator_selection::Config + + cumulus_pallet_parachain_system::Config + + cumulus_pallet_xcmp_queue::Config + + pallet_timestamp::Config + + pallet_assets::Config< + pallet_assets::Instance1, + AssetId = u32, + Balance = ::Balance, + > + pallet_asset_conversion::Config< + AssetKind = xcm::v5::Location, + Balance = ::Balance, + >, + ValidatorIdOf: From>, + RuntimeOrigin: OriginTrait::AccountId>, + <::Lookup as StaticLookup>::Source: + From<::AccountId>, + Block: BlockT, +{ + use xcm::prelude::*; + + ExtBuilder::::default().build().execute_with(|| { + let test_account = AccountId::from([0u8; 32]); + let transfer_amount = 100u128; + let xcm_to_weigh = Xcm::::builder_unsafe() + .withdraw_asset((Here, transfer_amount)) + .buy_execution((Here, transfer_amount), Unlimited) + .deposit_asset(AllCounted(1), [1u8; 32]) + .build(); + let versioned_xcm_to_weigh = VersionedXcm::from(xcm_to_weigh.clone().into()); + + let xcm_weight = Runtime::query_xcm_weight(versioned_xcm_to_weigh); + assert!(xcm_weight.is_ok()); + let native_token: Location = Parent.into(); + let native_token_versioned = VersionedAssetId::from(AssetId(native_token.clone())); + let execution_fees = + Runtime::query_weight_to_asset_fee(xcm_weight.unwrap(), native_token_versioned); + assert!(execution_fees.is_ok()); + + // We need some balance to create an asset. + assert_ok!( + pallet_balances::Pallet::::mint_into(&test_account, 3_000_000_000_000,) + ); + + // Now we try to use an asset that's not in a pool. + let asset_id = 1984u32; // USDT. + let asset_not_in_pool: Location = + (PalletInstance(50), GeneralIndex(asset_id.into())).into(); + assert_ok!(pallet_assets::Pallet::::create( + RuntimeOrigin::signed(test_account.clone()), + asset_id.into(), + test_account.clone().into(), + 1000 + )); + let execution_fees = Runtime::query_weight_to_asset_fee( + xcm_weight.unwrap(), + asset_not_in_pool.clone().into(), + ); + assert_eq!(execution_fees, Err(XcmPaymentApiError::AssetNotFound)); + + // We add it to a pool with native. + assert_ok!(pallet_asset_conversion::Pallet::::create_pool( + RuntimeOrigin::signed(test_account.clone()), + native_token.clone().try_into().unwrap(), + asset_not_in_pool.clone().try_into().unwrap() + )); + let execution_fees = Runtime::query_weight_to_asset_fee( + xcm_weight.unwrap(), + asset_not_in_pool.clone().into(), + ); + // Still not enough because it doesn't have any liquidity. + assert_eq!(execution_fees, Err(XcmPaymentApiError::AssetNotFound)); + + // We mint some of the asset... + assert_ok!(pallet_assets::Pallet::::mint( + RuntimeOrigin::signed(test_account.clone()), + asset_id.into(), + test_account.clone().into(), + 3_000_000_000_000, + )); + // ...so we can add liquidity to the pool. + assert_ok!(pallet_asset_conversion::Pallet::::add_liquidity( + RuntimeOrigin::signed(test_account.clone()), + native_token.try_into().unwrap(), + asset_not_in_pool.clone().try_into().unwrap(), + 1_000_000_000_000, + 2_000_000_000_000, + 0, + 0, + test_account + )); + let execution_fees = + Runtime::query_weight_to_asset_fee(xcm_weight.unwrap(), asset_not_in_pool.into()); + // Now it works! + assert_ok!(execution_fees); + }); +} diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/Cargo.toml b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/Cargo.toml index 4af8a9f43850..3eb06e3a18c1 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/Cargo.toml +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/Cargo.toml @@ -122,6 +122,7 @@ bridge-hub-test-utils = { workspace = true, default-features = true } bridge-runtime-common = { features = ["integrity-test"], workspace = true, default-features = true } pallet-bridge-relayers = { features = ["integrity-test"], workspace = true } snowbridge-runtime-test-common = { workspace = true, default-features = true } +parachains-runtimes-test-utils = { workspace = true, default-features = true } [features] default = ["std"] diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs index 3f3316d0be49..598afeddb984 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs @@ -847,7 +847,8 @@ impl_runtime_apis! { } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == xcm_config::TokenLocation::get() => { // for native token Ok(WeightToFee::weight_to_fee(&weight)) diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs index 6ca858e961d3..29f9615bff6a 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs @@ -20,9 +20,9 @@ use bp_polkadot_core::Signature; use bridge_hub_rococo_runtime::{ bridge_common_config, bridge_to_bulletin_config, bridge_to_westend_config, xcm_config::{RelayNetwork, TokenLocation, XcmConfig}, - AllPalletsWithoutSystem, BridgeRejectObsoleteHeadersAndMessages, Executive, ExistentialDeposit, - ParachainSystem, PolkadotXcm, Runtime, RuntimeCall, RuntimeEvent, RuntimeOrigin, SessionKeys, - TransactionPayment, TxExtension, UncheckedExtrinsic, + AllPalletsWithoutSystem, Block, BridgeRejectObsoleteHeadersAndMessages, Executive, + ExistentialDeposit, ParachainSystem, PolkadotXcm, Runtime, RuntimeCall, RuntimeEvent, + RuntimeOrigin, SessionKeys, TransactionPayment, TxExtension, UncheckedExtrinsic, }; use bridge_hub_test_utils::SlotDurations; use codec::{Decode, Encode}; @@ -838,3 +838,13 @@ fn location_conversion_works() { assert_eq!(got, expected, "{}", tc.description); } } + +#[test] +fn xcm_payment_api_works() { + parachains_runtimes_test_utils::test_cases::xcm_payment_api_with_native_token_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); +} diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/Cargo.toml b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/Cargo.toml index 637e7c710640..871bf44ec5b2 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/Cargo.toml @@ -121,6 +121,7 @@ bridge-hub-test-utils = { workspace = true, default-features = true } bridge-runtime-common = { features = ["integrity-test"], workspace = true, default-features = true } pallet-bridge-relayers = { features = ["integrity-test"], workspace = true } snowbridge-runtime-test-common = { workspace = true, default-features = true } +parachains-runtimes-test-utils = { workspace = true, default-features = true } [features] default = ["std"] diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/lib.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/lib.rs index 65e7d291dc37..ae3dbfa06cba 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/src/lib.rs @@ -779,7 +779,8 @@ impl_runtime_apis! { } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == xcm_config::WestendLocation::get() => { // for native token Ok(WeightToFee::weight_to_fee(&weight)) diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/tests/tests.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/tests/tests.rs index 84025c4cefeb..d7e70ed769b1 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/tests/tests.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/tests/tests.rs @@ -27,9 +27,9 @@ use bridge_hub_westend_runtime::{ bridge_common_config, bridge_to_rococo_config, bridge_to_rococo_config::RococoGlobalConsensusNetwork, xcm_config::{LocationToAccountId, RelayNetwork, WestendLocation, XcmConfig}, - AllPalletsWithoutSystem, BridgeRejectObsoleteHeadersAndMessages, Executive, ExistentialDeposit, - ParachainSystem, PolkadotXcm, Runtime, RuntimeCall, RuntimeEvent, RuntimeOrigin, SessionKeys, - TransactionPayment, TxExtension, UncheckedExtrinsic, + AllPalletsWithoutSystem, Block, BridgeRejectObsoleteHeadersAndMessages, Executive, + ExistentialDeposit, ParachainSystem, PolkadotXcm, Runtime, RuntimeCall, RuntimeEvent, + RuntimeOrigin, SessionKeys, TransactionPayment, TxExtension, UncheckedExtrinsic, }; use bridge_to_rococo_config::{ BridgeGrandpaRococoInstance, BridgeHubRococoLocation, BridgeParachainRococoInstance, @@ -525,3 +525,13 @@ fn location_conversion_works() { assert_eq!(got, expected, "{}", tc.description); } } + +#[test] +fn xcm_payment_api_works() { + parachains_runtimes_test_utils::test_cases::xcm_payment_api_with_native_token_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); +} diff --git a/cumulus/parachains/runtimes/collectives/collectives-westend/Cargo.toml b/cumulus/parachains/runtimes/collectives/collectives-westend/Cargo.toml index e03fc934ceaf..810abcf572d4 100644 --- a/cumulus/parachains/runtimes/collectives/collectives-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/collectives/collectives-westend/Cargo.toml @@ -94,6 +94,7 @@ substrate-wasm-builder = { optional = true, workspace = true, default-features = [dev-dependencies] sp-io = { features = ["std"], workspace = true, default-features = true } +parachains-runtimes-test-utils = { workspace = true, default-features = true } [features] default = ["std"] diff --git a/cumulus/parachains/runtimes/collectives/collectives-westend/src/lib.rs b/cumulus/parachains/runtimes/collectives/collectives-westend/src/lib.rs index 0ee3a4068718..f4c62f212e8c 100644 --- a/cumulus/parachains/runtimes/collectives/collectives-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/collectives/collectives-westend/src/lib.rs @@ -963,7 +963,8 @@ impl_runtime_apis! { } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == xcm_config::WndLocation::get() => { // for native token Ok(WeightToFee::weight_to_fee(&weight)) diff --git a/cumulus/parachains/runtimes/collectives/collectives-westend/tests/tests.rs b/cumulus/parachains/runtimes/collectives/collectives-westend/tests/tests.rs index 7add10559d84..c9191eba49f6 100644 --- a/cumulus/parachains/runtimes/collectives/collectives-westend/tests/tests.rs +++ b/cumulus/parachains/runtimes/collectives/collectives-westend/tests/tests.rs @@ -16,7 +16,9 @@ #![cfg(test)] -use collectives_westend_runtime::xcm_config::LocationToAccountId; +use collectives_westend_runtime::{ + xcm_config::LocationToAccountId, Block, Runtime, RuntimeCall, RuntimeOrigin, +}; use parachains_common::AccountId; use sp_core::crypto::Ss58Codec; use xcm::latest::prelude::*; @@ -132,3 +134,13 @@ fn location_conversion_works() { assert_eq!(got, expected, "{}", tc.description); } } + +#[test] +fn xcm_payment_api_works() { + parachains_runtimes_test_utils::test_cases::xcm_payment_api_with_native_token_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); +} diff --git a/cumulus/parachains/runtimes/coretime/coretime-rococo/Cargo.toml b/cumulus/parachains/runtimes/coretime/coretime-rococo/Cargo.toml index a38b7400cfa3..02807827cf92 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-rococo/Cargo.toml +++ b/cumulus/parachains/runtimes/coretime/coretime-rococo/Cargo.toml @@ -80,6 +80,9 @@ parachain-info = { workspace = true } parachains-common = { workspace = true } testnet-parachains-constants = { features = ["rococo"], workspace = true } +[dev-dependencies] +parachains-runtimes-test-utils = { workspace = true } + [features] default = ["std"] std = [ @@ -120,6 +123,7 @@ std = [ "pallet-xcm/std", "parachain-info/std", "parachains-common/std", + "parachains-runtimes-test-utils/std", "polkadot-parachain-primitives/std", "polkadot-runtime-common/std", "rococo-runtime-constants/std", diff --git a/cumulus/parachains/runtimes/coretime/coretime-rococo/src/lib.rs b/cumulus/parachains/runtimes/coretime/coretime-rococo/src/lib.rs index 3f3126b749d8..ae3ad93a9e85 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/coretime/coretime-rococo/src/lib.rs @@ -835,7 +835,8 @@ impl_runtime_apis! { } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == xcm_config::RocRelayLocation::get() => { // for native token Ok(WeightToFee::weight_to_fee(&weight)) diff --git a/cumulus/parachains/runtimes/coretime/coretime-rococo/tests/tests.rs b/cumulus/parachains/runtimes/coretime/coretime-rococo/tests/tests.rs index 2cabce567b6e..89a593ab0f57 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-rococo/tests/tests.rs +++ b/cumulus/parachains/runtimes/coretime/coretime-rococo/tests/tests.rs @@ -16,7 +16,9 @@ #![cfg(test)] -use coretime_rococo_runtime::xcm_config::LocationToAccountId; +use coretime_rococo_runtime::{ + xcm_config::LocationToAccountId, Block, Runtime, RuntimeCall, RuntimeOrigin, +}; use parachains_common::AccountId; use sp_core::crypto::Ss58Codec; use xcm::latest::prelude::*; @@ -132,3 +134,13 @@ fn location_conversion_works() { assert_eq!(got, expected, "{}", tc.description); } } + +#[test] +fn xcm_payment_api_works() { + parachains_runtimes_test_utils::test_cases::xcm_payment_api_with_native_token_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); +} diff --git a/cumulus/parachains/runtimes/coretime/coretime-westend/Cargo.toml b/cumulus/parachains/runtimes/coretime/coretime-westend/Cargo.toml index 149fa5d0b045..34353d312b1f 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/coretime/coretime-westend/Cargo.toml @@ -80,6 +80,9 @@ parachain-info = { workspace = true } parachains-common = { workspace = true } testnet-parachains-constants = { features = ["westend"], workspace = true } +[dev-dependencies] +parachains-runtimes-test-utils = { workspace = true, default-features = true } + [features] default = ["std"] std = [ diff --git a/cumulus/parachains/runtimes/coretime/coretime-westend/src/lib.rs b/cumulus/parachains/runtimes/coretime/coretime-westend/src/lib.rs index 098a17cc9984..39ea39f25a8b 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/coretime/coretime-westend/src/lib.rs @@ -827,7 +827,8 @@ impl_runtime_apis! { } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == xcm_config::TokenRelayLocation::get() => { // for native token Ok(WeightToFee::weight_to_fee(&weight)) diff --git a/cumulus/parachains/runtimes/coretime/coretime-westend/tests/tests.rs b/cumulus/parachains/runtimes/coretime/coretime-westend/tests/tests.rs index e391d71a9ab7..976ce23d6e87 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-westend/tests/tests.rs +++ b/cumulus/parachains/runtimes/coretime/coretime-westend/tests/tests.rs @@ -16,7 +16,9 @@ #![cfg(test)] -use coretime_westend_runtime::xcm_config::LocationToAccountId; +use coretime_westend_runtime::{ + xcm_config::LocationToAccountId, Block, Runtime, RuntimeCall, RuntimeOrigin, +}; use parachains_common::AccountId; use sp_core::crypto::Ss58Codec; use xcm::latest::prelude::*; @@ -132,3 +134,13 @@ fn location_conversion_works() { assert_eq!(got, expected, "{}", tc.description); } } + +#[test] +fn xcm_payment_api_works() { + parachains_runtimes_test_utils::test_cases::xcm_payment_api_with_native_token_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); +} diff --git a/cumulus/parachains/runtimes/people/people-rococo/Cargo.toml b/cumulus/parachains/runtimes/people/people-rococo/Cargo.toml index 34458c2352fb..a55143b62071 100644 --- a/cumulus/parachains/runtimes/people/people-rococo/Cargo.toml +++ b/cumulus/parachains/runtimes/people/people-rococo/Cargo.toml @@ -77,6 +77,9 @@ parachain-info = { workspace = true } parachains-common = { workspace = true } testnet-parachains-constants = { features = ["rococo"], workspace = true } +[dev-dependencies] +parachains-runtimes-test-utils = { workspace = true, default-features = true } + [features] default = ["std"] std = [ diff --git a/cumulus/parachains/runtimes/people/people-rococo/src/lib.rs b/cumulus/parachains/runtimes/people/people-rococo/src/lib.rs index 7921030f2bb8..dc5f2ac0997c 100644 --- a/cumulus/parachains/runtimes/people/people-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/people/people-rococo/src/lib.rs @@ -783,7 +783,8 @@ impl_runtime_apis! { } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == xcm_config::RelayLocation::get() => { // for native token Ok(WeightToFee::weight_to_fee(&weight)) diff --git a/cumulus/parachains/runtimes/people/people-rococo/tests/tests.rs b/cumulus/parachains/runtimes/people/people-rococo/tests/tests.rs index 3627d9c40ec2..00fe7781822a 100644 --- a/cumulus/parachains/runtimes/people/people-rococo/tests/tests.rs +++ b/cumulus/parachains/runtimes/people/people-rococo/tests/tests.rs @@ -17,7 +17,9 @@ #![cfg(test)] use parachains_common::AccountId; -use people_rococo_runtime::xcm_config::LocationToAccountId; +use people_rococo_runtime::{ + xcm_config::LocationToAccountId, Block, Runtime, RuntimeCall, RuntimeOrigin, +}; use sp_core::crypto::Ss58Codec; use xcm::latest::prelude::*; use xcm_runtime_apis::conversions::LocationToAccountHelper; @@ -132,3 +134,13 @@ fn location_conversion_works() { assert_eq!(got, expected, "{}", tc.description); } } + +#[test] +fn xcm_payment_api_works() { + parachains_runtimes_test_utils::test_cases::xcm_payment_api_with_native_token_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); +} diff --git a/cumulus/parachains/runtimes/people/people-westend/Cargo.toml b/cumulus/parachains/runtimes/people/people-westend/Cargo.toml index 6840b97d8c3f..4d66332e96dd 100644 --- a/cumulus/parachains/runtimes/people/people-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/people/people-westend/Cargo.toml @@ -77,6 +77,9 @@ parachain-info = { workspace = true } parachains-common = { workspace = true } testnet-parachains-constants = { features = ["westend"], workspace = true } +[dev-dependencies] +parachains-runtimes-test-utils = { workspace = true, default-features = true } + [features] default = ["std"] std = [ diff --git a/cumulus/parachains/runtimes/people/people-westend/src/lib.rs b/cumulus/parachains/runtimes/people/people-westend/src/lib.rs index 19a64ab8d6e8..1b9a3b60a2c4 100644 --- a/cumulus/parachains/runtimes/people/people-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/people/people-westend/src/lib.rs @@ -781,7 +781,8 @@ impl_runtime_apis! { } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == xcm_config::RelayLocation::get() => { // for native token Ok(WeightToFee::weight_to_fee(&weight)) diff --git a/cumulus/parachains/runtimes/people/people-westend/tests/tests.rs b/cumulus/parachains/runtimes/people/people-westend/tests/tests.rs index fa9331952b4b..5cefec44b1cd 100644 --- a/cumulus/parachains/runtimes/people/people-westend/tests/tests.rs +++ b/cumulus/parachains/runtimes/people/people-westend/tests/tests.rs @@ -17,7 +17,9 @@ #![cfg(test)] use parachains_common::AccountId; -use people_westend_runtime::xcm_config::LocationToAccountId; +use people_westend_runtime::{ + xcm_config::LocationToAccountId, Block, Runtime, RuntimeCall, RuntimeOrigin, +}; use sp_core::crypto::Ss58Codec; use xcm::latest::prelude::*; use xcm_runtime_apis::conversions::LocationToAccountHelper; @@ -132,3 +134,13 @@ fn location_conversion_works() { assert_eq!(got, expected, "{}", tc.description); } } + +#[test] +fn xcm_payment_api_works() { + parachains_runtimes_test_utils::test_cases::xcm_payment_api_with_native_token_works::< + Runtime, + RuntimeCall, + RuntimeOrigin, + Block, + >(); +} diff --git a/cumulus/parachains/runtimes/test-utils/Cargo.toml b/cumulus/parachains/runtimes/test-utils/Cargo.toml index 01d7fcc2b5c8..e9d666617ee2 100644 --- a/cumulus/parachains/runtimes/test-utils/Cargo.toml +++ b/cumulus/parachains/runtimes/test-utils/Cargo.toml @@ -29,6 +29,7 @@ cumulus-pallet-parachain-system = { workspace = true } cumulus-pallet-xcmp-queue = { workspace = true } pallet-collator-selection = { workspace = true } parachain-info = { workspace = true } +parachains-common = { workspace = true } cumulus-primitives-core = { workspace = true } cumulus-primitives-parachain-inherent = { workspace = true } cumulus-test-relay-sproof-builder = { workspace = true } @@ -37,6 +38,7 @@ cumulus-test-relay-sproof-builder = { workspace = true } xcm = { workspace = true } xcm-executor = { workspace = true } pallet-xcm = { workspace = true } +xcm-runtime-apis = { workspace = true } polkadot-parachain-primitives = { workspace = true } [dev-dependencies] @@ -62,11 +64,13 @@ std = [ "pallet-timestamp/std", "pallet-xcm/std", "parachain-info/std", + "parachains-common/std", "polkadot-parachain-primitives/std", "sp-consensus-aura/std", "sp-core/std", "sp-io/std", "sp-runtime/std", "xcm-executor/std", + "xcm-runtime-apis/std", "xcm/std", ] diff --git a/cumulus/parachains/runtimes/test-utils/src/test_cases.rs b/cumulus/parachains/runtimes/test-utils/src/test_cases.rs index a66163154cf6..6bdf3ef09d1b 100644 --- a/cumulus/parachains/runtimes/test-utils/src/test_cases.rs +++ b/cumulus/parachains/runtimes/test-utils/src/test_cases.rs @@ -18,7 +18,15 @@ use crate::{AccountIdOf, CollatorSessionKeys, ExtBuilder, ValidatorIdOf}; use codec::Encode; -use frame_support::{assert_ok, traits::Get}; +use frame_support::{ + assert_ok, + traits::{Get, OriginTrait}, +}; +use parachains_common::AccountId; +use sp_runtime::traits::{Block as BlockT, StaticLookup}; +use xcm_runtime_apis::fees::{ + runtime_decl_for_xcm_payment_api::XcmPaymentApiV1, Error as XcmPaymentApiError, +}; type RuntimeHelper = crate::RuntimeHelper; @@ -128,3 +136,60 @@ pub fn set_storage_keys_by_governance_works( assert_storage(); }); } + +pub fn xcm_payment_api_with_native_token_works() +where + Runtime: XcmPaymentApiV1 + + frame_system::Config + + pallet_balances::Config + + pallet_session::Config + + pallet_xcm::Config + + parachain_info::Config + + pallet_collator_selection::Config + + cumulus_pallet_parachain_system::Config + + cumulus_pallet_xcmp_queue::Config + + pallet_timestamp::Config, + ValidatorIdOf: From>, + RuntimeOrigin: OriginTrait::AccountId>, + <::Lookup as StaticLookup>::Source: + From<::AccountId>, + Block: BlockT, +{ + use xcm::prelude::*; + ExtBuilder::::default().build().execute_with(|| { + let transfer_amount = 100u128; + let xcm_to_weigh = Xcm::::builder_unsafe() + .withdraw_asset((Here, transfer_amount)) + .buy_execution((Here, transfer_amount), Unlimited) + .deposit_asset(AllCounted(1), [1u8; 32]) + .build(); + let versioned_xcm_to_weigh = VersionedXcm::from(xcm_to_weigh.clone().into()); + + // We first try calling it with a lower XCM version. + let lower_version_xcm_to_weigh = + versioned_xcm_to_weigh.clone().into_version(XCM_VERSION - 1).unwrap(); + let xcm_weight = Runtime::query_xcm_weight(lower_version_xcm_to_weigh); + assert!(xcm_weight.is_ok()); + let native_token: Location = Parent.into(); + let native_token_versioned = VersionedAssetId::from(AssetId(native_token)); + let lower_version_native_token = + native_token_versioned.clone().into_version(XCM_VERSION - 1).unwrap(); + let execution_fees = + Runtime::query_weight_to_asset_fee(xcm_weight.unwrap(), lower_version_native_token); + assert!(execution_fees.is_ok()); + + // Now we call it with the latest version. + let xcm_weight = Runtime::query_xcm_weight(versioned_xcm_to_weigh); + assert!(xcm_weight.is_ok()); + let execution_fees = + Runtime::query_weight_to_asset_fee(xcm_weight.unwrap(), native_token_versioned); + assert!(execution_fees.is_ok()); + + // If we call it with anything other than the native token it will error. + let non_existent_token: Location = Here.into(); + let non_existent_token_versioned = VersionedAssetId::from(AssetId(non_existent_token)); + let execution_fees = + Runtime::query_weight_to_asset_fee(xcm_weight.unwrap(), non_existent_token_versioned); + assert_eq!(execution_fees, Err(XcmPaymentApiError::AssetNotFound)); + }); +} diff --git a/polkadot/xcm/xcm-runtime-apis/tests/fee_estimation.rs b/polkadot/xcm/xcm-runtime-apis/tests/fee_estimation.rs index 2d14b4e571c6..c3046b134d1f 100644 --- a/polkadot/xcm/xcm-runtime-apis/tests/fee_estimation.rs +++ b/polkadot/xcm/xcm-runtime-apis/tests/fee_estimation.rs @@ -353,3 +353,26 @@ fn dry_run_xcm() { ); }); } + +#[test] +fn calling_payment_api_with_a_lower_version_works() { + let transfer_amount = 100u128; + let xcm_to_weigh = Xcm::::builder_unsafe() + .withdraw_asset((Here, transfer_amount)) + .buy_execution((Here, transfer_amount), Unlimited) + .deposit_asset(AllCounted(1), [1u8; 32]) + .build(); + let versioned_xcm_to_weigh = VersionedXcm::from(xcm_to_weigh.clone().into()); + let lower_version_xcm_to_weigh = versioned_xcm_to_weigh.into_version(XCM_VERSION - 1).unwrap(); + let client = TestClient; + let runtime_api = client.runtime_api(); + let xcm_weight = + runtime_api.query_xcm_weight(H256::zero(), lower_version_xcm_to_weigh).unwrap(); + assert!(xcm_weight.is_ok()); + let native_token = VersionedAssetId::from(AssetId(Here.into())); + let lower_version_native_token = native_token.into_version(XCM_VERSION - 1).unwrap(); + let execution_fees = runtime_api + .query_weight_to_asset_fee(H256::zero(), xcm_weight.unwrap(), lower_version_native_token) + .unwrap(); + assert!(execution_fees.is_ok()); +} diff --git a/polkadot/xcm/xcm-runtime-apis/tests/mock.rs b/polkadot/xcm/xcm-runtime-apis/tests/mock.rs index f0a5be908f69..fb5d1ae7c0e5 100644 --- a/polkadot/xcm/xcm-runtime-apis/tests/mock.rs +++ b/polkadot/xcm/xcm-runtime-apis/tests/mock.rs @@ -453,7 +453,8 @@ sp_api::mock_impl_runtime_apis! { } fn query_weight_to_asset_fee(weight: Weight, asset: VersionedAssetId) -> Result { - match asset.try_as::() { + let latest_asset_id: Result = asset.clone().try_into(); + match latest_asset_id { Ok(asset_id) if asset_id.0 == HereLocation::get() => { Ok(WeightToFee::weight_to_fee(&weight)) }, diff --git a/prdoc/pr_6459.prdoc b/prdoc/pr_6459.prdoc new file mode 100644 index 000000000000..592ba4c6b29d --- /dev/null +++ b/prdoc/pr_6459.prdoc @@ -0,0 +1,22 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: Fix version conversion in XcmPaymentApi::query_weight_to_asset_fee. + +doc: + - audience: Runtime Dev + description: | + The `query_weight_to_asset_fee` function of the `XcmPaymentApi` was trying + to convert versions in the wrong way. + This resulted in all calls made with lower versions failing. + The version conversion is now done correctly and these same calls will now succeed. + +crates: + - name: asset-hub-westend-runtime + bump: patch + - name: asset-hub-rococo-runtime + bump: patch + - name: xcm-runtime-apis + bump: patch + - name: assets-common + bump: patch From 445c1c80d438d5b937c347b04e4daa66ad25d878 Mon Sep 17 00:00:00 2001 From: Branislav Kontur Date: Wed, 27 Nov 2024 10:28:26 +0100 Subject: [PATCH 34/64] Add stable2412 to target_branches for command-backport.yml (#6666) The backport bot opens PR for `A4-needs-backport` only for stable2407 stable2409, but we have already stable2412. The question is, when should we append a new `stable*` branch here? Should it be done when a new `stable*` branch is created? Can we automate this process somehow? --- .github/workflows/command-backport.yml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/.github/workflows/command-backport.yml b/.github/workflows/command-backport.yml index 8f23bcd75f01..eecf0ac72d2c 100644 --- a/.github/workflows/command-backport.yml +++ b/.github/workflows/command-backport.yml @@ -40,7 +40,7 @@ jobs: uses: korthout/backport-action@v3 id: backport with: - target_branches: stable2407 stable2409 + target_branches: stable2407 stable2409 stable2412 merge_commits: skip github_token: ${{ steps.generate_token.outputs.token }} pull_description: | From 2a0b2680b8df9c18d2543f82629917f759827e1c Mon Sep 17 00:00:00 2001 From: Alexandru Vasile <60601340+lexnv@users.noreply.github.com> Date: Wed, 27 Nov 2024 13:11:01 +0200 Subject: [PATCH 35/64] litep2p/req-resp: Always provide main protocol name in responses (#6603) Request responses are initialized with a main protocol name, and optional protocol names as a fallback. Running litep2p in kusama as a validator has surfaced a `debug_asserts` coming from the sync component: https://github.com/paritytech/polkadot-sdk/blob/3906c578c96d97a8a099a4bdac4685acbe375a7c/substrate/client/network/sync/src/strategy/chain_sync.rs#L640-L646 The issue is that we initiate a request-response over the main protocol name `/genesis/sync/2` but receive a response over the legacy procotol `ksm/sync/2`. This behavior is correct because litep2p propagates to the higher levels the protocol that responded. In contrast, libp2p provides the main protocol name regardless of negotiating a legacy protocol. Because of this, higher level components assume that only the main protocol name will respond. To not break this assumption, this PR alings litep2p shim layer with the libp2p behavior. Closes: https://github.com/paritytech/polkadot-sdk/issues/6581 --------- Signed-off-by: Alexandru Vasile Co-authored-by: Dmitry Markin --- prdoc/pr_6603.prdoc | 16 ++++++++++++++++ .../src/litep2p/shim/request_response/mod.rs | 7 ++----- 2 files changed, 18 insertions(+), 5 deletions(-) create mode 100644 prdoc/pr_6603.prdoc diff --git a/prdoc/pr_6603.prdoc b/prdoc/pr_6603.prdoc new file mode 100644 index 000000000000..20c5e7294dfa --- /dev/null +++ b/prdoc/pr_6603.prdoc @@ -0,0 +1,16 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: Always provide main protocol name in litep2p responses + +doc: + - audience: [ Node Dev, Node Operator ] + description: | + This PR aligns litep2p behavior with libp2p. Previously, litep2p network backend + would provide the actual negotiated request-response protocol that produced a + response message. After this PR, only the main protocol name is reported to other + subsystems. + +crates: + - name: sc-network + bump: patch diff --git a/substrate/client/network/src/litep2p/shim/request_response/mod.rs b/substrate/client/network/src/litep2p/shim/request_response/mod.rs index bfd7a60ef9fe..146f2e4add97 100644 --- a/substrate/client/network/src/litep2p/shim/request_response/mod.rs +++ b/substrate/client/network/src/litep2p/shim/request_response/mod.rs @@ -320,7 +320,7 @@ impl RequestResponseProtocol { &mut self, peer: litep2p::PeerId, request_id: RequestId, - fallback: Option, + _fallback: Option, response: Vec, ) { match self.pending_inbound_responses.remove(&request_id) { @@ -337,10 +337,7 @@ impl RequestResponseProtocol { response.len(), ); - let _ = tx.send(Ok(( - response, - fallback.map_or_else(|| self.protocol.clone(), Into::into), - ))); + let _ = tx.send(Ok((response, self.protocol.clone()))); self.metrics.register_outbound_request_success(started.elapsed()); }, } From 5b1b34db0c03057c7962eb9682b4d581c324ae26 Mon Sep 17 00:00:00 2001 From: Alexandru Vasile <60601340+lexnv@users.noreply.github.com> Date: Wed, 27 Nov 2024 14:10:36 +0200 Subject: [PATCH 36/64] v16: Expose the unstable metadata v16 (#5732) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit This PR exposes the *unstable* metadata V16. The metadata is exposed under the unstable u32::MAX number. Developers can start experimenting with the new features of the metadata v16. *Please note that this metadata is under development and expect breaking changes until stabilization.* The `ExtrinsicMetadata` trait receives a breaking change. Its associated type `VERSION` is rename to `VERSIONS` and now supports a constant static list of metadata versions. The versions implemented for `UncheckedExtrinsic` are v4 (legacy version) and v5 (new version). For metadata collection, it is assumed that all `TransactionExtensions` are under version 0. Builds on top of: https://github.com/paritytech/polkadot-sdk/pull/5274 Closes: https://github.com/paritytech/polkadot-sdk/issues/5980 Closes: https://github.com/paritytech/polkadot-sdk/issues/5347 Closes: https://github.com/paritytech/polkadot-sdk/issues/5285 cc @paritytech/subxt-team --------- Signed-off-by: Alexandru Vasile Co-authored-by: Niklas Adolfsson Co-authored-by: Bastian Köcher Co-authored-by: James Wilson Co-authored-by: GitHub Action --- Cargo.lock | 28 ++- Cargo.toml | 4 +- prdoc/pr_5732.prdoc | 29 +++ .../frame/metadata-hash-extension/Cargo.toml | 2 +- substrate/frame/revive/src/evm/runtime.rs | 8 +- substrate/frame/support/Cargo.toml | 1 + .../src/construct_runtime/expand/metadata.rs | 2 +- substrate/frame/support/test/Cargo.toml | 2 +- substrate/frame/support/test/tests/pallet.rs | 8 +- substrate/primitives/metadata-ir/Cargo.toml | 2 +- substrate/primitives/metadata-ir/src/lib.rs | 25 ++- substrate/primitives/metadata-ir/src/types.rs | 6 +- .../primitives/metadata-ir/src/unstable.rs | 211 ++++++++++++++++++ substrate/primitives/metadata-ir/src/v14.rs | 5 +- substrate/primitives/metadata-ir/src/v15.rs | 2 +- .../src/generic/unchecked_extrinsic.rs | 3 +- .../primitives/runtime/src/traits/mod.rs | 6 +- .../src/overhead/remark_builder.rs | 8 +- .../src/overhead/runtime_utilities.rs | 15 +- substrate/utils/wasm-builder/Cargo.toml | 2 +- 20 files changed, 329 insertions(+), 40 deletions(-) create mode 100644 prdoc/pr_5732.prdoc create mode 100644 substrate/primitives/metadata-ir/src/unstable.rs diff --git a/Cargo.lock b/Cargo.lock index 58b8b222cce4..2c938ec17bd0 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -7224,6 +7224,18 @@ dependencies = [ "serde", ] +[[package]] +name = "frame-metadata" +version = "18.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "daaf440c68eb2c3d88e5760fe8c7af3f9fee9181fab6c2f2c4e7cc48dcc40bb8" +dependencies = [ + "cfg-if", + "parity-scale-codec", + "scale-info", + "serde", +] + [[package]] name = "frame-metadata-hash-extension" version = "0.1.0" @@ -7231,7 +7243,7 @@ dependencies = [ "array-bytes", "const-hex", "docify", - "frame-metadata 16.0.0", + "frame-metadata 18.0.0", "frame-support 28.0.0", "frame-system 28.0.0", "log", @@ -7316,7 +7328,7 @@ dependencies = [ "bitflags 1.3.2", "docify", "environmental", - "frame-metadata 16.0.0", + "frame-metadata 18.0.0", "frame-support-procedural 23.0.0", "frame-system 28.0.0", "impl-trait-for-tuples", @@ -7494,7 +7506,7 @@ version = "3.0.0" dependencies = [ "frame-benchmarking 28.0.0", "frame-executive 28.0.0", - "frame-metadata 16.0.0", + "frame-metadata 18.0.0", "frame-support 28.0.0", "frame-support-test-pallet", "frame-system 28.0.0", @@ -10520,13 +10532,13 @@ dependencies = [ [[package]] name = "merkleized-metadata" -version = "0.1.0" +version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f313fcff1d2a4bcaa2deeaa00bf7530d77d5f7bd0467a117dde2e29a75a7a17a" +checksum = "943f6d92804ed0100803d51fa9b21fd9432b5d122ba4c713dc26fe6d2f619cf6" dependencies = [ "array-bytes", "blake3", - "frame-metadata 16.0.0", + "frame-metadata 18.0.0", "parity-scale-codec", "scale-decode 0.13.1", "scale-info", @@ -26664,7 +26676,7 @@ dependencies = [ name = "sp-metadata-ir" version = "0.6.0" dependencies = [ - "frame-metadata 16.0.0", + "frame-metadata 18.0.0", "parity-scale-codec", "scale-info", ] @@ -28601,7 +28613,7 @@ dependencies = [ "cargo_metadata", "console", "filetime", - "frame-metadata 16.0.0", + "frame-metadata 18.0.0", "jobserver", "merkleized-metadata", "parity-scale-codec", diff --git a/Cargo.toml b/Cargo.toml index 53f95406e79a..b1a52712e736 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -779,7 +779,7 @@ frame-benchmarking-pallet-pov = { default-features = false, path = "substrate/fr frame-election-provider-solution-type = { path = "substrate/frame/election-provider-support/solution-type", default-features = false } frame-election-provider-support = { path = "substrate/frame/election-provider-support", default-features = false } frame-executive = { path = "substrate/frame/executive", default-features = false } -frame-metadata = { version = "16.0.0", default-features = false } +frame-metadata = { version = "18.0.0", default-features = false } frame-metadata-hash-extension = { path = "substrate/frame/metadata-hash-extension", default-features = false } frame-support = { path = "substrate/frame/support", default-features = false } frame-support-procedural = { path = "substrate/frame/support/procedural", default-features = false } @@ -854,7 +854,7 @@ macro_magic = { version = "0.5.1" } maplit = { version = "1.0.2" } memmap2 = { version = "0.9.3" } memory-db = { version = "0.32.0", default-features = false } -merkleized-metadata = { version = "0.1.0" } +merkleized-metadata = { version = "0.1.2" } merlin = { version = "3.0", default-features = false } messages-relay = { path = "bridges/relays/messages" } metered = { version = "0.6.1", default-features = false, package = "prioritized-metered-channel" } diff --git a/prdoc/pr_5732.prdoc b/prdoc/pr_5732.prdoc new file mode 100644 index 000000000000..6f3f9b8a1668 --- /dev/null +++ b/prdoc/pr_5732.prdoc @@ -0,0 +1,29 @@ +title: Expose the unstable metadata v16 +doc: +- audience: Node Dev + description: | + This PR exposes the *unstable* metadata V16. The metadata is exposed under the unstable u32::MAX number. + Developers can start experimenting with the new features of the metadata v16. *Please note that this metadata is under development and expect breaking changes until stabilization.* + The `ExtrinsicMetadata` trait receives a breaking change. Its associated type `VERSION` is rename to `VERSIONS` and now supports a constant static list of metadata versions. + The versions implemented for `UncheckedExtrinsic` are v4 (legacy version) and v5 (new version). + For metadata collection, it is assumed that all `TransactionExtensions` are under version 0. + +crates: + - name: sp-metadata-ir + bump: major + - name: frame-support-procedural + bump: patch + - name: frame-support + bump: minor + - name: frame-support-test + bump: major + - name: frame-metadata-hash-extension + bump: patch + - name: substrate-wasm-builder + bump: minor + - name: pallet-revive + bump: minor + - name: sp-runtime + bump: major + - name: frame-benchmarking-cli + bump: patch diff --git a/substrate/frame/metadata-hash-extension/Cargo.toml b/substrate/frame/metadata-hash-extension/Cargo.toml index bca2c3ffb198..8f4ba922984c 100644 --- a/substrate/frame/metadata-hash-extension/Cargo.toml +++ b/substrate/frame/metadata-hash-extension/Cargo.toml @@ -25,7 +25,7 @@ substrate-test-runtime-client = { workspace = true } sp-api = { workspace = true, default-features = true } sp-transaction-pool = { workspace = true, default-features = true } merkleized-metadata = { workspace = true } -frame-metadata = { features = ["current"], workspace = true, default-features = true } +frame-metadata = { features = ["current", "unstable"], workspace = true, default-features = true } sp-tracing = { workspace = true, default-features = true } [features] diff --git a/substrate/frame/revive/src/evm/runtime.rs b/substrate/frame/revive/src/evm/runtime.rs index 40c210304ca2..b5dc9a36065b 100644 --- a/substrate/frame/revive/src/evm/runtime.rs +++ b/substrate/frame/revive/src/evm/runtime.rs @@ -92,8 +92,12 @@ impl ExtrinsicLike impl ExtrinsicMetadata for UncheckedExtrinsic { - const VERSION: u8 = - generic::UncheckedExtrinsic::, Signature, E::Extension>::VERSION; + const VERSIONS: &'static [u8] = generic::UncheckedExtrinsic::< + Address, + CallOf, + Signature, + E::Extension, + >::VERSIONS; type TransactionExtensions = E::Extension; } diff --git a/substrate/frame/support/Cargo.toml b/substrate/frame/support/Cargo.toml index d7da034b3492..d48c80510581 100644 --- a/substrate/frame/support/Cargo.toml +++ b/substrate/frame/support/Cargo.toml @@ -28,6 +28,7 @@ scale-info = { features = [ ], workspace = true } frame-metadata = { features = [ "current", + "unstable", ], workspace = true } sp-api = { features = [ "frame-metadata", diff --git a/substrate/frame/support/procedural/src/construct_runtime/expand/metadata.rs b/substrate/frame/support/procedural/src/construct_runtime/expand/metadata.rs index c12fc20bc8b8..4590a3a7f490 100644 --- a/substrate/frame/support/procedural/src/construct_runtime/expand/metadata.rs +++ b/substrate/frame/support/procedural/src/construct_runtime/expand/metadata.rs @@ -117,7 +117,7 @@ pub fn expand_runtime_metadata( pallets: #scrate::__private::vec![ #(#pallets),* ], extrinsic: #scrate::__private::metadata_ir::ExtrinsicMetadataIR { ty, - version: <#extrinsic as #scrate::sp_runtime::traits::ExtrinsicMetadata>::VERSION, + versions: <#extrinsic as #scrate::sp_runtime::traits::ExtrinsicMetadata>::VERSIONS.into_iter().map(|ref_version| *ref_version).collect(), address_ty, call_ty, signature_ty, diff --git a/substrate/frame/support/test/Cargo.toml b/substrate/frame/support/test/Cargo.toml index 2187ee22b395..17ee3130b741 100644 --- a/substrate/frame/support/test/Cargo.toml +++ b/substrate/frame/support/test/Cargo.toml @@ -19,7 +19,7 @@ static_assertions = { workspace = true, default-features = true } serde = { features = ["derive"], workspace = true } codec = { features = ["derive"], workspace = true } scale-info = { features = ["derive"], workspace = true } -frame-metadata = { features = ["current"], workspace = true } +frame-metadata = { features = ["current", "unstable"], workspace = true } sp-api = { workspace = true } sp-arithmetic = { workspace = true } sp-io = { workspace = true } diff --git a/substrate/frame/support/test/tests/pallet.rs b/substrate/frame/support/test/tests/pallet.rs index de7f7eb4bc97..9df1f461bba2 100644 --- a/substrate/frame/support/test/tests/pallet.rs +++ b/substrate/frame/support/test/tests/pallet.rs @@ -53,6 +53,9 @@ parameter_types! { /// Latest stable metadata version used for testing. const LATEST_METADATA_VERSION: u32 = 15; +/// Unstable metadata version. +const UNSTABLE_METADATA_VERSION: u32 = u32::MAX; + pub struct SomeType1; impl From for u64 { fn from(_t: SomeType1) -> Self { @@ -1977,7 +1980,10 @@ fn metadata_at_version() { #[test] fn metadata_versions() { - assert_eq!(vec![14, LATEST_METADATA_VERSION], Runtime::metadata_versions()); + assert_eq!( + vec![14, LATEST_METADATA_VERSION, UNSTABLE_METADATA_VERSION], + Runtime::metadata_versions() + ); } #[test] diff --git a/substrate/primitives/metadata-ir/Cargo.toml b/substrate/primitives/metadata-ir/Cargo.toml index d7786347dd02..046441104b88 100644 --- a/substrate/primitives/metadata-ir/Cargo.toml +++ b/substrate/primitives/metadata-ir/Cargo.toml @@ -17,7 +17,7 @@ targets = ["x86_64-unknown-linux-gnu"] [dependencies] codec = { workspace = true } -frame-metadata = { features = ["current"], workspace = true } +frame-metadata = { features = ["current", "unstable"], workspace = true } scale-info = { features = ["derive"], workspace = true } [features] diff --git a/substrate/primitives/metadata-ir/src/lib.rs b/substrate/primitives/metadata-ir/src/lib.rs index 4bd13b935afd..bf234432a1a6 100644 --- a/substrate/primitives/metadata-ir/src/lib.rs +++ b/substrate/primitives/metadata-ir/src/lib.rs @@ -30,6 +30,7 @@ mod types; use frame_metadata::RuntimeMetadataPrefixed; pub use types::*; +mod unstable; mod v14; mod v15; @@ -39,23 +40,33 @@ const V14: u32 = 14; /// Metadata V15. const V15: u32 = 15; +/// Unstable metadata V16. +const UNSTABLE_V16: u32 = u32::MAX; + /// Transform the IR to the specified version. /// /// Use [`supported_versions`] to find supported versions. pub fn into_version(metadata: MetadataIR, version: u32) -> Option { // Note: Unstable metadata version is `u32::MAX` until stabilized. match version { - // Latest stable version. + // Version V14. This needs to be around until the + // deprecation of the `Metadata_metadata` runtime call in favor of + // `Metadata_metadata_at_version. V14 => Some(into_v14(metadata)), - // Unstable metadata. + + // Version V15 - latest stable. V15 => Some(into_latest(metadata)), + + // Unstable metadata under `u32::MAX`. + UNSTABLE_V16 => Some(into_unstable(metadata)), + _ => None, } } /// Returns the supported metadata versions. pub fn supported_versions() -> alloc::vec::Vec { - alloc::vec![V14, V15] + alloc::vec![V14, V15, UNSTABLE_V16] } /// Transform the IR to the latest stable metadata version. @@ -70,6 +81,12 @@ pub fn into_v14(metadata: MetadataIR) -> RuntimeMetadataPrefixed { latest.into() } +/// Transform the IR to unstable metadata version 16. +pub fn into_unstable(metadata: MetadataIR) -> RuntimeMetadataPrefixed { + let latest: frame_metadata::v16::RuntimeMetadataV16 = metadata.into(); + latest.into() +} + #[cfg(test)] mod test { use super::*; @@ -81,7 +98,7 @@ mod test { pallets: vec![], extrinsic: ExtrinsicMetadataIR { ty: meta_type::<()>(), - version: 0, + versions: vec![0], address_ty: meta_type::<()>(), call_ty: meta_type::<()>(), signature_ty: meta_type::<()>(), diff --git a/substrate/primitives/metadata-ir/src/types.rs b/substrate/primitives/metadata-ir/src/types.rs index 199b692fbd8c..af217ffe16ee 100644 --- a/substrate/primitives/metadata-ir/src/types.rs +++ b/substrate/primitives/metadata-ir/src/types.rs @@ -170,8 +170,8 @@ pub struct ExtrinsicMetadataIR { /// /// Note: Field used for metadata V14 only. pub ty: T::Type, - /// Extrinsic version. - pub version: u8, + /// Extrinsic versions. + pub versions: Vec, /// The type of the address that signs the extrinsic pub address_ty: T::Type, /// The type of the outermost Call enum. @@ -191,7 +191,7 @@ impl IntoPortable for ExtrinsicMetadataIR { fn into_portable(self, registry: &mut Registry) -> Self::Output { ExtrinsicMetadataIR { ty: registry.register_type(&self.ty), - version: self.version, + versions: self.versions, address_ty: registry.register_type(&self.address_ty), call_ty: registry.register_type(&self.call_ty), signature_ty: registry.register_type(&self.signature_ty), diff --git a/substrate/primitives/metadata-ir/src/unstable.rs b/substrate/primitives/metadata-ir/src/unstable.rs new file mode 100644 index 000000000000..d46ce3ec6a7d --- /dev/null +++ b/substrate/primitives/metadata-ir/src/unstable.rs @@ -0,0 +1,211 @@ +// This file is part of Substrate. + +// Copyright (C) Parity Technologies (UK) Ltd. +// SPDX-License-Identifier: Apache-2.0 + +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +//! Convert the IR to V16 metadata. + +use crate::{ + DeprecationInfoIR, DeprecationStatusIR, OuterEnumsIR, PalletAssociatedTypeMetadataIR, + PalletCallMetadataIR, PalletConstantMetadataIR, PalletErrorMetadataIR, PalletEventMetadataIR, + PalletStorageMetadataIR, StorageEntryMetadataIR, +}; + +use super::types::{ + ExtrinsicMetadataIR, MetadataIR, PalletMetadataIR, RuntimeApiMetadataIR, + RuntimeApiMethodMetadataIR, RuntimeApiMethodParamMetadataIR, TransactionExtensionMetadataIR, +}; + +use frame_metadata::v16::{ + CustomMetadata, DeprecationInfo, DeprecationStatus, ExtrinsicMetadata, OuterEnums, + PalletAssociatedTypeMetadata, PalletCallMetadata, PalletConstantMetadata, PalletErrorMetadata, + PalletEventMetadata, PalletMetadata, PalletStorageMetadata, RuntimeApiMetadata, + RuntimeApiMethodMetadata, RuntimeApiMethodParamMetadata, RuntimeMetadataV16, + StorageEntryMetadata, TransactionExtensionMetadata, +}; + +impl From for RuntimeMetadataV16 { + fn from(ir: MetadataIR) -> Self { + RuntimeMetadataV16::new( + ir.pallets.into_iter().map(Into::into).collect(), + ir.extrinsic.into(), + ir.apis.into_iter().map(Into::into).collect(), + ir.outer_enums.into(), + // Substrate does not collect yet the custom metadata fields. + // This allows us to extend the V16 easily. + CustomMetadata { map: Default::default() }, + ) + } +} + +impl From for RuntimeApiMetadata { + fn from(ir: RuntimeApiMetadataIR) -> Self { + RuntimeApiMetadata { + name: ir.name, + methods: ir.methods.into_iter().map(Into::into).collect(), + docs: ir.docs, + deprecation_info: ir.deprecation_info.into(), + } + } +} + +impl From for RuntimeApiMethodMetadata { + fn from(ir: RuntimeApiMethodMetadataIR) -> Self { + RuntimeApiMethodMetadata { + name: ir.name, + inputs: ir.inputs.into_iter().map(Into::into).collect(), + output: ir.output, + docs: ir.docs, + deprecation_info: ir.deprecation_info.into(), + } + } +} + +impl From for RuntimeApiMethodParamMetadata { + fn from(ir: RuntimeApiMethodParamMetadataIR) -> Self { + RuntimeApiMethodParamMetadata { name: ir.name, ty: ir.ty } + } +} + +impl From for PalletMetadata { + fn from(ir: PalletMetadataIR) -> Self { + PalletMetadata { + name: ir.name, + storage: ir.storage.map(Into::into), + calls: ir.calls.map(Into::into), + event: ir.event.map(Into::into), + constants: ir.constants.into_iter().map(Into::into).collect(), + error: ir.error.map(Into::into), + index: ir.index, + docs: ir.docs, + associated_types: ir.associated_types.into_iter().map(Into::into).collect(), + deprecation_info: ir.deprecation_info.into(), + } + } +} + +impl From for PalletStorageMetadata { + fn from(ir: PalletStorageMetadataIR) -> Self { + PalletStorageMetadata { + prefix: ir.prefix, + entries: ir.entries.into_iter().map(Into::into).collect(), + } + } +} + +impl From for StorageEntryMetadata { + fn from(ir: StorageEntryMetadataIR) -> Self { + StorageEntryMetadata { + name: ir.name, + modifier: ir.modifier.into(), + ty: ir.ty.into(), + default: ir.default, + docs: ir.docs, + deprecation_info: ir.deprecation_info.into(), + } + } +} + +impl From for PalletAssociatedTypeMetadata { + fn from(ir: PalletAssociatedTypeMetadataIR) -> Self { + PalletAssociatedTypeMetadata { name: ir.name, ty: ir.ty, docs: ir.docs } + } +} + +impl From for PalletErrorMetadata { + fn from(ir: PalletErrorMetadataIR) -> Self { + PalletErrorMetadata { ty: ir.ty, deprecation_info: ir.deprecation_info.into() } + } +} + +impl From for PalletEventMetadata { + fn from(ir: PalletEventMetadataIR) -> Self { + PalletEventMetadata { ty: ir.ty, deprecation_info: ir.deprecation_info.into() } + } +} + +impl From for PalletCallMetadata { + fn from(ir: PalletCallMetadataIR) -> Self { + PalletCallMetadata { ty: ir.ty, deprecation_info: ir.deprecation_info.into() } + } +} + +impl From for PalletConstantMetadata { + fn from(ir: PalletConstantMetadataIR) -> Self { + PalletConstantMetadata { + name: ir.name, + ty: ir.ty, + value: ir.value, + docs: ir.docs, + deprecation_info: ir.deprecation_info.into(), + } + } +} + +impl From for TransactionExtensionMetadata { + fn from(ir: TransactionExtensionMetadataIR) -> Self { + TransactionExtensionMetadata { identifier: ir.identifier, ty: ir.ty, implicit: ir.implicit } + } +} + +impl From for ExtrinsicMetadata { + fn from(ir: ExtrinsicMetadataIR) -> Self { + // Assume version 0 for all extensions. + let indexes = (0..ir.extensions.len()).map(|index| index as u32).collect(); + let transaction_extensions_by_version = [(0, indexes)].iter().cloned().collect(); + + ExtrinsicMetadata { + versions: ir.versions, + address_ty: ir.address_ty, + signature_ty: ir.signature_ty, + transaction_extensions_by_version, + transaction_extensions: ir.extensions.into_iter().map(Into::into).collect(), + } + } +} + +impl From for OuterEnums { + fn from(ir: OuterEnumsIR) -> Self { + OuterEnums { + call_enum_ty: ir.call_enum_ty, + event_enum_ty: ir.event_enum_ty, + error_enum_ty: ir.error_enum_ty, + } + } +} + +impl From for DeprecationStatus { + fn from(ir: DeprecationStatusIR) -> Self { + match ir { + DeprecationStatusIR::NotDeprecated => DeprecationStatus::NotDeprecated, + DeprecationStatusIR::DeprecatedWithoutNote => DeprecationStatus::DeprecatedWithoutNote, + DeprecationStatusIR::Deprecated { since, note } => + DeprecationStatus::Deprecated { since, note }, + } + } +} + +impl From for DeprecationInfo { + fn from(ir: DeprecationInfoIR) -> Self { + match ir { + DeprecationInfoIR::NotDeprecated => DeprecationInfo::NotDeprecated, + DeprecationInfoIR::ItemDeprecated(status) => + DeprecationInfo::ItemDeprecated(status.into()), + DeprecationInfoIR::VariantsDeprecated(btree) => DeprecationInfo::VariantsDeprecated( + btree.into_iter().map(|(key, value)| (key.0, value.into())).collect(), + ), + } + } +} diff --git a/substrate/primitives/metadata-ir/src/v14.rs b/substrate/primitives/metadata-ir/src/v14.rs index 70e84532add9..f3cb5973f5bd 100644 --- a/substrate/primitives/metadata-ir/src/v14.rs +++ b/substrate/primitives/metadata-ir/src/v14.rs @@ -149,9 +149,12 @@ impl From for SignedExtensionMetadata { impl From for ExtrinsicMetadata { fn from(ir: ExtrinsicMetadataIR) -> Self { + let lowest_supported_version = + ir.versions.iter().min().expect("Metadata V14 supports one version; qed"); + ExtrinsicMetadata { ty: ir.ty, - version: ir.version, + version: *lowest_supported_version, signed_extensions: ir.extensions.into_iter().map(Into::into).collect(), } } diff --git a/substrate/primitives/metadata-ir/src/v15.rs b/substrate/primitives/metadata-ir/src/v15.rs index 4b3b6106d27f..ed315a31e6dc 100644 --- a/substrate/primitives/metadata-ir/src/v15.rs +++ b/substrate/primitives/metadata-ir/src/v15.rs @@ -100,7 +100,7 @@ impl From for SignedExtensionMetadata { impl From for ExtrinsicMetadata { fn from(ir: ExtrinsicMetadataIR) -> Self { ExtrinsicMetadata { - version: ir.version, + version: *ir.versions.iter().min().expect("Metadata V15 supports only one version"), address_ty: ir.address_ty, call_ty: ir.call_ty, signature_ty: ir.signature_ty, diff --git a/substrate/primitives/runtime/src/generic/unchecked_extrinsic.rs b/substrate/primitives/runtime/src/generic/unchecked_extrinsic.rs index 91ba37451909..d8510a60a789 100644 --- a/substrate/primitives/runtime/src/generic/unchecked_extrinsic.rs +++ b/substrate/primitives/runtime/src/generic/unchecked_extrinsic.rs @@ -389,8 +389,7 @@ where impl> ExtrinsicMetadata for UncheckedExtrinsic { - // TODO: Expose both version 4 and version 5 in metadata v16. - const VERSION: u8 = LEGACY_EXTRINSIC_FORMAT_VERSION; + const VERSIONS: &'static [u8] = &[LEGACY_EXTRINSIC_FORMAT_VERSION, EXTRINSIC_FORMAT_VERSION]; type TransactionExtensions = Extension; } diff --git a/substrate/primitives/runtime/src/traits/mod.rs b/substrate/primitives/runtime/src/traits/mod.rs index 02bc7adc8ba5..cfcc3e5a354d 100644 --- a/substrate/primitives/runtime/src/traits/mod.rs +++ b/substrate/primitives/runtime/src/traits/mod.rs @@ -1410,10 +1410,10 @@ impl SignaturePayload for () { /// Implementor is an [`Extrinsic`] and provides metadata about this extrinsic. pub trait ExtrinsicMetadata { - /// The format version of the `Extrinsic`. + /// The format versions of the `Extrinsic`. /// - /// By format is meant the encoded representation of the `Extrinsic`. - const VERSION: u8; + /// By format we mean the encoded representation of the `Extrinsic`. + const VERSIONS: &'static [u8]; /// Transaction extensions attached to this `Extrinsic`. type TransactionExtensions; diff --git a/substrate/utils/frame/benchmarking-cli/src/overhead/remark_builder.rs b/substrate/utils/frame/benchmarking-cli/src/overhead/remark_builder.rs index a1d5f282d9f8..3a2d8776d1e1 100644 --- a/substrate/utils/frame/benchmarking-cli/src/overhead/remark_builder.rs +++ b/substrate/utils/frame/benchmarking-cli/src/overhead/remark_builder.rs @@ -54,13 +54,15 @@ impl> DynamicRemarkBuilder { log::debug!("Found metadata API version {}.", metadata_api_version); let opaque_metadata = if metadata_api_version > 1 { - let Ok(mut supported_metadata_versions) = api.metadata_versions(genesis) else { + let Ok(supported_metadata_versions) = api.metadata_versions(genesis) else { return Err("Unable to fetch metadata versions".to_string().into()); }; let latest = supported_metadata_versions - .pop() - .ok_or("No metadata version supported".to_string())?; + .into_iter() + .filter(|v| *v != u32::MAX) + .max() + .ok_or("No stable metadata versions supported".to_string())?; api.metadata_at_version(genesis, latest) .map_err(|e| format!("Unable to fetch metadata: {:?}", e))? diff --git a/substrate/utils/frame/benchmarking-cli/src/overhead/runtime_utilities.rs b/substrate/utils/frame/benchmarking-cli/src/overhead/runtime_utilities.rs index c498da38afb0..3081197dc033 100644 --- a/substrate/utils/frame/benchmarking-cli/src/overhead/runtime_utilities.rs +++ b/substrate/utils/frame/benchmarking-cli/src/overhead/runtime_utilities.rs @@ -35,14 +35,19 @@ pub fn fetch_latest_metadata_from_code_blob( let opaque_metadata: OpaqueMetadata = match version_result { Ok(supported_versions) => { - let latest_version = Vec::::decode(&mut supported_versions.as_slice()) - .map_err(|e| format!("Unable to decode version list: {e}"))? - .pop() - .ok_or("No metadata versions supported".to_string())?; + let supported_versions = Vec::::decode(&mut supported_versions.as_slice()) + .map_err(|e| format!("Unable to decode version list: {e}"))?; + + let latest_stable = supported_versions + .into_iter() + .filter(|v| *v != u32::MAX) + .max() + .ok_or("No stable metadata versions supported".to_string())?; let encoded = runtime_caller - .call("Metadata_metadata_at_version", latest_version) + .call("Metadata_metadata_at_version", latest_stable) .map_err(|_| "Unable to fetch metadata from blob".to_string())?; + Option::::decode(&mut encoded.as_slice())? .ok_or_else(|| "Metadata not found".to_string())? }, diff --git a/substrate/utils/wasm-builder/Cargo.toml b/substrate/utils/wasm-builder/Cargo.toml index 8f0e8a23e54a..fb15e8619a38 100644 --- a/substrate/utils/wasm-builder/Cargo.toml +++ b/substrate/utils/wasm-builder/Cargo.toml @@ -35,7 +35,7 @@ sc-executor = { optional = true, workspace = true, default-features = true } sp-core = { optional = true, workspace = true, default-features = true } sp-io = { optional = true, workspace = true, default-features = true } sp-version = { optional = true, workspace = true, default-features = true } -frame-metadata = { features = ["current"], optional = true, workspace = true, default-features = true } +frame-metadata = { features = ["current", "unstable"], optional = true, workspace = true, default-features = true } codec = { optional = true, workspace = true, default-features = true } array-bytes = { optional = true, workspace = true, default-features = true } sp-tracing = { optional = true, workspace = true, default-features = true } From afd065fa7267494246a9a8d767dfd030e2681fce Mon Sep 17 00:00:00 2001 From: Alexandru Vasile <60601340+lexnv@users.noreply.github.com> Date: Wed, 27 Nov 2024 20:12:39 +0200 Subject: [PATCH 37/64] rpc-v2: Implement `archive_unstable_storageDiff` (#5997) This PR implements the `archive_unstable_storageDiff`. The implementation follows the rpc-v2 spec from: - https://github.com/paritytech/json-rpc-interface-spec/pull/159. - builds on top of https://github.com/paritytech/json-rpc-interface-spec/pull/161 cc @paritytech/subxt-team --------- Signed-off-by: Alexandru Vasile Co-authored-by: James Wilson --- Cargo.lock | 7 +- prdoc/pr_5997.prdoc | 18 + substrate/client/rpc-spec-v2/Cargo.toml | 1 + .../client/rpc-spec-v2/src/archive/api.rs | 22 +- .../client/rpc-spec-v2/src/archive/archive.rs | 89 +- .../src/archive/archive_storage.rs | 829 +++++++++++++++++- .../client/rpc-spec-v2/src/archive/tests.rs | 277 +++++- .../client/rpc-spec-v2/src/common/events.rs | 208 ++++- .../client/rpc-spec-v2/src/common/storage.rs | 15 + substrate/client/service/src/builder.rs | 1 + 10 files changed, 1449 insertions(+), 18 deletions(-) create mode 100644 prdoc/pr_5997.prdoc diff --git a/Cargo.lock b/Cargo.lock index 2c938ec17bd0..12e642bc9d06 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -20959,7 +20959,7 @@ checksum = "b544ef1b4eac5dc2db33ea63606ae9ffcfac26c1416a2806ae0bf5f56b201191" dependencies = [ "aho-corasick", "memchr", - "regex-automata 0.4.9", + "regex-automata 0.4.8", "regex-syntax 0.8.5", ] @@ -20980,9 +20980,9 @@ checksum = "fed1ceff11a1dddaee50c9dc8e4938bd106e9d89ae372f192311e7da498e3b69" [[package]] name = "regex-automata" -version = "0.4.9" +version = "0.4.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "809e8dc61f6de73b46c85f4c96486310fe304c434cfa43669d7b40f711150908" +checksum = "368758f23274712b504848e9d5a6f010445cc8b87a7cdb4d7cbee666c1288da3" dependencies = [ "aho-corasick", "memchr", @@ -23277,6 +23277,7 @@ dependencies = [ "futures", "futures-util", "hex", + "itertools 0.11.0", "jsonrpsee", "log", "parity-scale-codec", diff --git a/prdoc/pr_5997.prdoc b/prdoc/pr_5997.prdoc new file mode 100644 index 000000000000..6bac36a44586 --- /dev/null +++ b/prdoc/pr_5997.prdoc @@ -0,0 +1,18 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: Implement archive_unstable_storageDiff method + +doc: + - audience: Node Dev + description: | + This PR implements the `archive_unstable_storageDiff` rpc-v2 method. + Developers can use this method to fetch the storage differences + between two blocks. This is useful for oracles and archive nodes. + For more details see: https://github.com/paritytech/json-rpc-interface-spec/blob/main/src/api/archive_unstable_storageDiff.md. + +crates: + - name: sc-rpc-spec-v2 + bump: major + - name: sc-service + bump: patch diff --git a/substrate/client/rpc-spec-v2/Cargo.toml b/substrate/client/rpc-spec-v2/Cargo.toml index daa805912fb9..b304bc905925 100644 --- a/substrate/client/rpc-spec-v2/Cargo.toml +++ b/substrate/client/rpc-spec-v2/Cargo.toml @@ -42,6 +42,7 @@ log = { workspace = true, default-features = true } futures-util = { workspace = true } rand = { workspace = true, default-features = true } schnellru = { workspace = true } +itertools = { workspace = true } [dev-dependencies] async-trait = { workspace = true } diff --git a/substrate/client/rpc-spec-v2/src/archive/api.rs b/substrate/client/rpc-spec-v2/src/archive/api.rs index b19738304000..dcfeaecb147b 100644 --- a/substrate/client/rpc-spec-v2/src/archive/api.rs +++ b/substrate/client/rpc-spec-v2/src/archive/api.rs @@ -19,7 +19,10 @@ //! API trait of the archive methods. use crate::{ - common::events::{ArchiveStorageResult, PaginatedStorageQuery}, + common::events::{ + ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageResult, + PaginatedStorageQuery, + }, MethodResult, }; use jsonrpsee::{core::RpcResult, proc_macros::rpc}; @@ -104,4 +107,21 @@ pub trait ArchiveApi { items: Vec>, child_trie: Option, ) -> RpcResult; + + /// Returns the storage difference between two blocks. + /// + /// # Unstable + /// + /// This method is unstable and can change in minor or patch releases. + #[subscription( + name = "archive_unstable_storageDiff" => "archive_unstable_storageDiffEvent", + unsubscribe = "archive_unstable_storageDiff_stopStorageDiff", + item = ArchiveStorageDiffEvent, + )] + fn archive_unstable_storage_diff( + &self, + hash: Hash, + items: Vec>, + previous_hash: Option, + ); } diff --git a/substrate/client/rpc-spec-v2/src/archive/archive.rs b/substrate/client/rpc-spec-v2/src/archive/archive.rs index dd6c566a76ed..55054d91d85d 100644 --- a/substrate/client/rpc-spec-v2/src/archive/archive.rs +++ b/substrate/client/rpc-spec-v2/src/archive/archive.rs @@ -19,17 +19,29 @@ //! API implementation for `archive`. use crate::{ - archive::{error::Error as ArchiveError, ArchiveApiServer}, - common::events::{ArchiveStorageResult, PaginatedStorageQuery}, - hex_string, MethodResult, + archive::{ + archive_storage::{ArchiveStorage, ArchiveStorageDiff}, + error::Error as ArchiveError, + ArchiveApiServer, + }, + common::events::{ + ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageResult, + PaginatedStorageQuery, + }, + hex_string, MethodResult, SubscriptionTaskExecutor, }; use codec::Encode; -use jsonrpsee::core::{async_trait, RpcResult}; +use futures::FutureExt; +use jsonrpsee::{ + core::{async_trait, RpcResult}, + PendingSubscriptionSink, +}; use sc_client_api::{ Backend, BlockBackend, BlockchainEvents, CallExecutor, ChildInfo, ExecutorProvider, StorageKey, StorageProvider, }; +use sc_rpc::utils::Subscription; use sp_api::{CallApiAt, CallContext}; use sp_blockchain::{ Backend as BlockChainBackend, Error as BlockChainError, HeaderBackend, HeaderMetadata, @@ -41,7 +53,9 @@ use sp_runtime::{ }; use std::{collections::HashSet, marker::PhantomData, sync::Arc}; -use super::archive_storage::ArchiveStorage; +use tokio::sync::mpsc; + +pub(crate) const LOG_TARGET: &str = "rpc-spec-v2::archive"; /// The configuration of [`Archive`]. pub struct ArchiveConfig { @@ -64,6 +78,12 @@ const MAX_DESCENDANT_RESPONSES: usize = 5; /// `MAX_DESCENDANT_RESPONSES`. const MAX_QUERIED_ITEMS: usize = 8; +/// The buffer capacity for each storage query. +/// +/// This is small because the underlying JSON-RPC server has +/// its down buffer capacity per connection as well. +const STORAGE_QUERY_BUF: usize = 16; + impl Default for ArchiveConfig { fn default() -> Self { Self { @@ -79,6 +99,8 @@ pub struct Archive, Block: BlockT, Client> { client: Arc, /// Backend of the chain. backend: Arc, + /// Executor to spawn subscriptions. + executor: SubscriptionTaskExecutor, /// The hexadecimal encoded hash of the genesis block. genesis_hash: String, /// The maximum number of items the `archive_storage` can return for a descendant query before @@ -96,12 +118,14 @@ impl, Block: BlockT, Client> Archive { client: Arc, backend: Arc, genesis_hash: GenesisHash, + executor: SubscriptionTaskExecutor, config: ArchiveConfig, ) -> Self { let genesis_hash = hex_string(&genesis_hash.as_ref()); Self { client, backend, + executor, genesis_hash, storage_max_descendant_responses: config.max_descendant_responses, storage_max_queried_items: config.max_queried_items, @@ -278,4 +302,59 @@ where Ok(storage_client.handle_query(hash, items, child_trie)) } + + fn archive_unstable_storage_diff( + &self, + pending: PendingSubscriptionSink, + hash: Block::Hash, + items: Vec>, + previous_hash: Option, + ) { + let storage_client = ArchiveStorageDiff::new(self.client.clone()); + let client = self.client.clone(); + + log::trace!(target: LOG_TARGET, "Storage diff subscription started"); + + let fut = async move { + let Ok(mut sink) = pending.accept().await.map(Subscription::from) else { return }; + + let previous_hash = if let Some(previous_hash) = previous_hash { + previous_hash + } else { + let Ok(Some(current_header)) = client.header(hash) else { + let message = format!("Block header is not present: {hash}"); + let _ = sink.send(&ArchiveStorageDiffEvent::err(message)).await; + return + }; + *current_header.parent_hash() + }; + + let (tx, mut rx) = tokio::sync::mpsc::channel(STORAGE_QUERY_BUF); + let storage_fut = + storage_client.handle_trie_queries(hash, items, previous_hash, tx.clone()); + + // We don't care about the return value of this join: + // - process_events might encounter an error (if the client disconnected) + // - storage_fut might encounter an error while processing a trie queries and + // the error is propagated via the sink. + let _ = futures::future::join(storage_fut, process_events(&mut rx, &mut sink)).await; + }; + + self.executor.spawn("substrate-rpc-subscription", Some("rpc"), fut.boxed()); + } +} + +/// Sends all the events to the sink. +async fn process_events(rx: &mut mpsc::Receiver, sink: &mut Subscription) { + while let Some(event) = rx.recv().await { + if event.is_done() { + log::debug!(target: LOG_TARGET, "Finished processing partial trie query"); + } else if event.is_err() { + log::debug!(target: LOG_TARGET, "Error encountered while processing partial trie query"); + } + + if sink.send(&event).await.is_err() { + return + } + } } diff --git a/substrate/client/rpc-spec-v2/src/archive/archive_storage.rs b/substrate/client/rpc-spec-v2/src/archive/archive_storage.rs index 26e7c299de41..5a3920882f00 100644 --- a/substrate/client/rpc-spec-v2/src/archive/archive_storage.rs +++ b/substrate/client/rpc-spec-v2/src/archive/archive_storage.rs @@ -18,15 +18,28 @@ //! Implementation of the `archive_storage` method. -use std::sync::Arc; +use std::{ + collections::{hash_map::Entry, HashMap}, + sync::Arc, +}; +use itertools::Itertools; use sc_client_api::{Backend, ChildInfo, StorageKey, StorageProvider}; use sp_runtime::traits::Block as BlockT; -use crate::common::{ - events::{ArchiveStorageResult, PaginatedStorageQuery, StorageQueryType}, - storage::{IterQueryType, QueryIter, Storage}, +use super::error::Error as ArchiveError; +use crate::{ + archive::archive::LOG_TARGET, + common::{ + events::{ + ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageDiffOperationType, + ArchiveStorageDiffResult, ArchiveStorageDiffType, ArchiveStorageResult, + PaginatedStorageQuery, StorageQueryType, StorageResult, + }, + storage::{IterQueryType, QueryIter, Storage}, + }, }; +use tokio::sync::mpsc; /// Generates the events of the `archive_storage` method. pub struct ArchiveStorage { @@ -127,3 +140,811 @@ where ArchiveStorageResult::ok(storage_results, discarded_items) } } + +/// Parse hex-encoded string parameter as raw bytes. +/// +/// If the parsing fails, returns an error propagated to the RPC method. +pub fn parse_hex_param(param: String) -> Result, ArchiveError> { + // Methods can accept empty parameters. + if param.is_empty() { + return Ok(Default::default()) + } + + array_bytes::hex2bytes(¶m).map_err(|_| ArchiveError::InvalidParam(param)) +} + +#[derive(Debug, PartialEq, Clone)] +pub struct DiffDetails { + key: StorageKey, + return_type: ArchiveStorageDiffType, + child_trie_key: Option, + child_trie_key_string: Option, +} + +/// The type of storage query. +#[derive(Debug, PartialEq, Clone, Copy)] +enum FetchStorageType { + /// Only fetch the value. + Value, + /// Only fetch the hash. + Hash, + /// Fetch both the value and the hash. + Both, +} + +/// The return value of the `fetch_storage` method. +#[derive(Debug, PartialEq, Clone)] +enum FetchedStorage { + /// Storage value under a key. + Value(StorageResult), + /// Storage hash under a key. + Hash(StorageResult), + /// Both storage value and hash under a key. + Both { value: StorageResult, hash: StorageResult }, +} + +pub struct ArchiveStorageDiff { + client: Storage, +} + +impl ArchiveStorageDiff { + pub fn new(client: Arc) -> Self { + Self { client: Storage::new(client) } + } +} + +impl ArchiveStorageDiff +where + Block: BlockT + 'static, + BE: Backend + 'static, + Client: StorageProvider + Send + Sync + 'static, +{ + /// Fetch the storage from the given key. + fn fetch_storage( + &self, + hash: Block::Hash, + key: StorageKey, + maybe_child_trie: Option, + ty: FetchStorageType, + ) -> Result, String> { + match ty { + FetchStorageType::Value => { + let result = self.client.query_value(hash, &key, maybe_child_trie.as_ref())?; + + Ok(result.map(FetchedStorage::Value)) + }, + + FetchStorageType::Hash => { + let result = self.client.query_hash(hash, &key, maybe_child_trie.as_ref())?; + + Ok(result.map(FetchedStorage::Hash)) + }, + + FetchStorageType::Both => { + let Some(value) = self.client.query_value(hash, &key, maybe_child_trie.as_ref())? + else { + return Ok(None); + }; + + let Some(hash) = self.client.query_hash(hash, &key, maybe_child_trie.as_ref())? + else { + return Ok(None); + }; + + Ok(Some(FetchedStorage::Both { value, hash })) + }, + } + } + + /// Check if the key belongs to the provided query items. + /// + /// A key belongs to the query items when: + /// - the provided key is a prefix of the key in the query items. + /// - the query items are empty. + /// + /// Returns an optional `FetchStorageType` based on the query items. + /// If the key does not belong to the query items, returns `None`. + fn belongs_to_query(key: &StorageKey, items: &[DiffDetails]) -> Option { + // User has requested all keys, by default this fallbacks to fetching the value. + if items.is_empty() { + return Some(FetchStorageType::Value) + } + + let mut value = false; + let mut hash = false; + + for item in items { + if key.as_ref().starts_with(&item.key.as_ref()) { + match item.return_type { + ArchiveStorageDiffType::Value => value = true, + ArchiveStorageDiffType::Hash => hash = true, + } + } + } + + match (value, hash) { + (true, true) => Some(FetchStorageType::Both), + (true, false) => Some(FetchStorageType::Value), + (false, true) => Some(FetchStorageType::Hash), + (false, false) => None, + } + } + + /// Send the provided result to the `tx` sender. + /// + /// Returns `false` if the sender has been closed. + fn send_result( + tx: &mpsc::Sender, + result: FetchedStorage, + operation_type: ArchiveStorageDiffOperationType, + child_trie_key: Option, + ) -> bool { + let items = match result { + FetchedStorage::Value(storage_result) | FetchedStorage::Hash(storage_result) => + vec![storage_result], + FetchedStorage::Both { value, hash } => vec![value, hash], + }; + + for item in items { + let res = ArchiveStorageDiffEvent::StorageDiff(ArchiveStorageDiffResult { + key: item.key, + result: item.result, + operation_type, + child_trie_key: child_trie_key.clone(), + }); + if tx.blocking_send(res).is_err() { + return false + } + } + + true + } + + fn handle_trie_queries_inner( + &self, + hash: Block::Hash, + previous_hash: Block::Hash, + items: Vec, + tx: &mpsc::Sender, + ) -> Result<(), String> { + // Parse the child trie key as `ChildInfo` and `String`. + let maybe_child_trie = items.first().and_then(|item| item.child_trie_key.clone()); + let maybe_child_trie_str = + items.first().and_then(|item| item.child_trie_key_string.clone()); + + // Iterator over the current block and previous block + // at the same time to compare the keys. This approach effectively + // leverages backpressure to avoid memory consumption. + let keys_iter = self.client.raw_keys_iter(hash, maybe_child_trie.clone())?; + let previous_keys_iter = + self.client.raw_keys_iter(previous_hash, maybe_child_trie.clone())?; + + let mut diff_iter = lexicographic_diff(keys_iter, previous_keys_iter); + + while let Some(item) = diff_iter.next() { + let (operation_type, key) = match item { + Diff::Added(key) => (ArchiveStorageDiffOperationType::Added, key), + Diff::Deleted(key) => (ArchiveStorageDiffOperationType::Deleted, key), + Diff::Equal(key) => (ArchiveStorageDiffOperationType::Modified, key), + }; + + let Some(fetch_type) = Self::belongs_to_query(&key, &items) else { + // The key does not belong the the query items. + continue; + }; + + let maybe_result = match operation_type { + ArchiveStorageDiffOperationType::Added => + self.fetch_storage(hash, key.clone(), maybe_child_trie.clone(), fetch_type)?, + ArchiveStorageDiffOperationType::Deleted => self.fetch_storage( + previous_hash, + key.clone(), + maybe_child_trie.clone(), + fetch_type, + )?, + ArchiveStorageDiffOperationType::Modified => { + let Some(storage_result) = self.fetch_storage( + hash, + key.clone(), + maybe_child_trie.clone(), + fetch_type, + )? + else { + continue + }; + + let Some(previous_storage_result) = self.fetch_storage( + previous_hash, + key.clone(), + maybe_child_trie.clone(), + fetch_type, + )? + else { + continue + }; + + // For modified records we need to check the actual storage values. + if storage_result == previous_storage_result { + continue + } + + Some(storage_result) + }, + }; + + if let Some(storage_result) = maybe_result { + if !Self::send_result( + &tx, + storage_result, + operation_type, + maybe_child_trie_str.clone(), + ) { + return Ok(()) + } + } + } + + Ok(()) + } + + /// This method will iterate over the keys of the main trie or a child trie and fetch the + /// given keys. The fetched keys will be sent to the provided `tx` sender to leverage + /// the backpressure mechanism. + pub async fn handle_trie_queries( + &self, + hash: Block::Hash, + items: Vec>, + previous_hash: Block::Hash, + tx: mpsc::Sender, + ) -> Result<(), tokio::task::JoinError> { + let this = ArchiveStorageDiff { client: self.client.clone() }; + + tokio::task::spawn_blocking(move || { + // Deduplicate the items. + let mut trie_items = match deduplicate_storage_diff_items(items) { + Ok(items) => items, + Err(error) => { + let _ = tx.blocking_send(ArchiveStorageDiffEvent::err(error.to_string())); + return + }, + }; + // Default to using the main storage trie if no items are provided. + if trie_items.is_empty() { + trie_items.push(Vec::new()); + } + log::trace!(target: LOG_TARGET, "Storage diff deduplicated items: {:?}", trie_items); + + for items in trie_items { + log::trace!( + target: LOG_TARGET, + "handle_trie_queries: hash={:?}, previous_hash={:?}, items={:?}", + hash, + previous_hash, + items + ); + + let result = this.handle_trie_queries_inner(hash, previous_hash, items, &tx); + + if let Err(error) = result { + log::trace!( + target: LOG_TARGET, + "handle_trie_queries: sending error={:?}", + error, + ); + + let _ = tx.blocking_send(ArchiveStorageDiffEvent::err(error)); + + return + } else { + log::trace!( + target: LOG_TARGET, + "handle_trie_queries: sending storage diff done", + ); + } + } + + let _ = tx.blocking_send(ArchiveStorageDiffEvent::StorageDiffDone); + }) + .await?; + + Ok(()) + } +} + +/// The result of the `lexicographic_diff` method. +#[derive(Debug, PartialEq)] +enum Diff { + Added(T), + Deleted(T), + Equal(T), +} + +/// Compare two iterators lexicographically and return the differences. +fn lexicographic_diff( + mut left: LeftIter, + mut right: RightIter, +) -> impl Iterator> +where + T: Ord, + LeftIter: Iterator, + RightIter: Iterator, +{ + let mut a = left.next(); + let mut b = right.next(); + + core::iter::from_fn(move || match (a.take(), b.take()) { + (Some(a_value), Some(b_value)) => + if a_value < b_value { + b = Some(b_value); + a = left.next(); + + Some(Diff::Added(a_value)) + } else if a_value > b_value { + a = Some(a_value); + b = right.next(); + + Some(Diff::Deleted(b_value)) + } else { + a = left.next(); + b = right.next(); + + Some(Diff::Equal(a_value)) + }, + (Some(a_value), None) => { + a = left.next(); + Some(Diff::Added(a_value)) + }, + (None, Some(b_value)) => { + b = right.next(); + Some(Diff::Deleted(b_value)) + }, + (None, None) => None, + }) +} + +/// Deduplicate the provided items and return a list of `DiffDetails`. +/// +/// Each list corresponds to a single child trie or the main trie. +fn deduplicate_storage_diff_items( + items: Vec>, +) -> Result>, ArchiveError> { + let mut deduplicated: HashMap, Vec> = HashMap::new(); + + for diff_item in items { + // Ensure the provided hex keys are valid before deduplication. + let key = StorageKey(parse_hex_param(diff_item.key)?); + let child_trie_key_string = diff_item.child_trie_key.clone(); + let child_trie_key = diff_item + .child_trie_key + .map(|child_trie_key| parse_hex_param(child_trie_key)) + .transpose()? + .map(ChildInfo::new_default_from_vec); + + let diff_item = DiffDetails { + key, + return_type: diff_item.return_type, + child_trie_key: child_trie_key.clone(), + child_trie_key_string, + }; + + match deduplicated.entry(child_trie_key.clone()) { + Entry::Occupied(mut entry) => { + let mut should_insert = true; + + for existing in entry.get() { + // This points to a different return type. + if existing.return_type != diff_item.return_type { + continue + } + // Keys and return types are identical. + if existing.key == diff_item.key { + should_insert = false; + break + } + + // The following two conditions ensure that we keep the shortest key. + + // The current key is a longer prefix of the existing key. + if diff_item.key.as_ref().starts_with(&existing.key.as_ref()) { + should_insert = false; + break + } + + // The existing key is a longer prefix of the current key. + // We need to keep the current key and remove the existing one. + if existing.key.as_ref().starts_with(&diff_item.key.as_ref()) { + let to_remove = existing.clone(); + entry.get_mut().retain(|item| item != &to_remove); + break; + } + } + + if should_insert { + entry.get_mut().push(diff_item); + } + }, + Entry::Vacant(entry) => { + entry.insert(vec![diff_item]); + }, + } + } + + Ok(deduplicated + .into_iter() + .sorted_by_key(|(child_trie_key, _)| child_trie_key.clone()) + .map(|(_, values)| values) + .collect()) +} + +#[cfg(test)] +mod tests { + use super::*; + + #[test] + fn dedup_empty() { + let items = vec![]; + let result = deduplicate_storage_diff_items(items).unwrap(); + assert!(result.is_empty()); + } + + #[test] + fn dedup_single() { + let items = vec![ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }]; + let result = deduplicate_storage_diff_items(items).unwrap(); + assert_eq!(result.len(), 1); + assert_eq!(result[0].len(), 1); + + let expected = DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + child_trie_key_string: None, + }; + assert_eq!(result[0][0], expected); + } + + #[test] + fn dedup_with_different_keys() { + let items = vec![ + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ArchiveStorageDiffItem { + key: "0x02".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ]; + let result = deduplicate_storage_diff_items(items).unwrap(); + assert_eq!(result.len(), 1); + assert_eq!(result[0].len(), 2); + + let expected = vec![ + DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + child_trie_key_string: None, + }, + DiffDetails { + key: StorageKey(vec![2]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + child_trie_key_string: None, + }, + ]; + assert_eq!(result[0], expected); + } + + #[test] + fn dedup_with_same_keys() { + // Identical keys. + let items = vec![ + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ]; + let result = deduplicate_storage_diff_items(items).unwrap(); + assert_eq!(result.len(), 1); + assert_eq!(result[0].len(), 1); + + let expected = vec![DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + child_trie_key_string: None, + }]; + assert_eq!(result[0], expected); + } + + #[test] + fn dedup_with_same_prefix() { + // Identical keys. + let items = vec![ + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ArchiveStorageDiffItem { + key: "0x01ff".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ]; + let result = deduplicate_storage_diff_items(items).unwrap(); + assert_eq!(result.len(), 1); + assert_eq!(result[0].len(), 1); + + let expected = vec![DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + child_trie_key_string: None, + }]; + assert_eq!(result[0], expected); + } + + #[test] + fn dedup_with_different_return_types() { + let items = vec![ + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Hash, + child_trie_key: None, + }, + ]; + let result = deduplicate_storage_diff_items(items).unwrap(); + assert_eq!(result.len(), 1); + assert_eq!(result[0].len(), 2); + + let expected = vec![ + DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + child_trie_key_string: None, + }, + DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Hash, + child_trie_key: None, + child_trie_key_string: None, + }, + ]; + assert_eq!(result[0], expected); + } + + #[test] + fn dedup_with_different_child_tries() { + let items = vec![ + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some("0x01".into()), + }, + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some("0x02".into()), + }, + ]; + let result = deduplicate_storage_diff_items(items).unwrap(); + assert_eq!(result.len(), 2); + assert_eq!(result[0].len(), 1); + assert_eq!(result[1].len(), 1); + + let expected = vec![ + vec![DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some(ChildInfo::new_default_from_vec(vec![1])), + child_trie_key_string: Some("0x01".into()), + }], + vec![DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some(ChildInfo::new_default_from_vec(vec![2])), + child_trie_key_string: Some("0x02".into()), + }], + ]; + assert_eq!(result, expected); + } + + #[test] + fn dedup_with_same_child_tries() { + let items = vec![ + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some("0x01".into()), + }, + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some("0x01".into()), + }, + ]; + let result = deduplicate_storage_diff_items(items).unwrap(); + assert_eq!(result.len(), 1); + assert_eq!(result[0].len(), 1); + + let expected = vec![DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some(ChildInfo::new_default_from_vec(vec![1])), + child_trie_key_string: Some("0x01".into()), + }]; + assert_eq!(result[0], expected); + } + + #[test] + fn dedup_with_shorter_key_reverse_order() { + let items = vec![ + ArchiveStorageDiffItem { + key: "0x01ff".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ]; + let result = deduplicate_storage_diff_items(items).unwrap(); + assert_eq!(result.len(), 1); + assert_eq!(result[0].len(), 1); + + let expected = vec![DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + child_trie_key_string: None, + }]; + assert_eq!(result[0], expected); + } + + #[test] + fn dedup_multiple_child_tries() { + let items = vec![ + ArchiveStorageDiffItem { + key: "0x02".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some("0x01".into()), + }, + ArchiveStorageDiffItem { + key: "0x02".into(), + return_type: ArchiveStorageDiffType::Hash, + child_trie_key: Some("0x01".into()), + }, + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some("0x02".into()), + }, + ArchiveStorageDiffItem { + key: "0x01".into(), + return_type: ArchiveStorageDiffType::Hash, + child_trie_key: Some("0x02".into()), + }, + ArchiveStorageDiffItem { + key: "0x01ff".into(), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some("0x02".into()), + }, + ]; + + let result = deduplicate_storage_diff_items(items).unwrap(); + + let expected = vec![ + vec![DiffDetails { + key: StorageKey(vec![2]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + child_trie_key_string: None, + }], + vec![ + DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some(ChildInfo::new_default_from_vec(vec![1])), + child_trie_key_string: Some("0x01".into()), + }, + DiffDetails { + key: StorageKey(vec![2]), + return_type: ArchiveStorageDiffType::Hash, + child_trie_key: Some(ChildInfo::new_default_from_vec(vec![1])), + child_trie_key_string: Some("0x01".into()), + }, + ], + vec![ + DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some(ChildInfo::new_default_from_vec(vec![2])), + child_trie_key_string: Some("0x02".into()), + }, + DiffDetails { + key: StorageKey(vec![1]), + return_type: ArchiveStorageDiffType::Hash, + child_trie_key: Some(ChildInfo::new_default_from_vec(vec![2])), + child_trie_key_string: Some("0x02".into()), + }, + ], + ]; + + assert_eq!(result, expected); + } + + #[test] + fn test_lexicographic_diff() { + let left = vec![1, 2, 3, 4, 5]; + let right = vec![2, 3, 4, 5, 6]; + + let diff = lexicographic_diff(left.into_iter(), right.into_iter()).collect::>(); + let expected = vec![ + Diff::Added(1), + Diff::Equal(2), + Diff::Equal(3), + Diff::Equal(4), + Diff::Equal(5), + Diff::Deleted(6), + ]; + assert_eq!(diff, expected); + } + + #[test] + fn test_lexicographic_diff_one_side_empty() { + let left = vec![]; + let right = vec![1, 2, 3, 4, 5, 6]; + + let diff = lexicographic_diff(left.into_iter(), right.into_iter()).collect::>(); + let expected = vec![ + Diff::Deleted(1), + Diff::Deleted(2), + Diff::Deleted(3), + Diff::Deleted(4), + Diff::Deleted(5), + Diff::Deleted(6), + ]; + assert_eq!(diff, expected); + + let left = vec![1, 2, 3, 4, 5, 6]; + let right = vec![]; + + let diff = lexicographic_diff(left.into_iter(), right.into_iter()).collect::>(); + let expected = vec![ + Diff::Added(1), + Diff::Added(2), + Diff::Added(3), + Diff::Added(4), + Diff::Added(5), + Diff::Added(6), + ]; + assert_eq!(diff, expected); + } +} diff --git a/substrate/client/rpc-spec-v2/src/archive/tests.rs b/substrate/client/rpc-spec-v2/src/archive/tests.rs index 078016f5b3e2..994c5d28bd61 100644 --- a/substrate/client/rpc-spec-v2/src/archive/tests.rs +++ b/substrate/client/rpc-spec-v2/src/archive/tests.rs @@ -18,8 +18,9 @@ use crate::{ common::events::{ - ArchiveStorageMethodOk, ArchiveStorageResult, PaginatedStorageQuery, StorageQueryType, - StorageResultType, + ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageDiffOperationType, + ArchiveStorageDiffResult, ArchiveStorageDiffType, ArchiveStorageMethodOk, + ArchiveStorageResult, PaginatedStorageQuery, StorageQueryType, StorageResultType, }, hex_string, MethodResult, }; @@ -32,10 +33,13 @@ use super::{ use assert_matches::assert_matches; use codec::{Decode, Encode}; use jsonrpsee::{ - core::EmptyServerParams as EmptyParams, rpc_params, MethodsError as Error, RpcModule, + core::{server::Subscription as RpcSubscription, EmptyServerParams as EmptyParams}, + rpc_params, MethodsError as Error, RpcModule, }; + use sc_block_builder::BlockBuilderBuilder; use sc_client_api::ChildInfo; +use sc_rpc::testing::TokioTestExecutor; use sp_blockchain::HeaderBackend; use sp_consensus::BlockOrigin; use sp_core::{Blake2Hasher, Hasher}; @@ -78,6 +82,7 @@ fn setup_api( client.clone(), backend, CHAIN_GENESIS, + Arc::new(TokioTestExecutor::default()), ArchiveConfig { max_descendant_responses, max_queried_items }, ) .into_rpc(); @@ -85,6 +90,15 @@ fn setup_api( (client, api) } +async fn get_next_event(sub: &mut RpcSubscription) -> T { + let (event, _sub_id) = tokio::time::timeout(std::time::Duration::from_secs(60), sub.next()) + .await + .unwrap() + .unwrap() + .unwrap(); + event +} + #[tokio::test] async fn archive_genesis() { let (_client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); @@ -838,3 +852,260 @@ async fn archive_storage_discarded_items() { _ => panic!("Unexpected result"), }; } + +#[tokio::test] +async fn archive_storage_diff_main_trie() { + let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + + let mut builder = BlockBuilderBuilder::new(&*client) + .on_parent_block(client.chain_info().genesis_hash) + .with_parent_block_number(0) + .build() + .unwrap(); + builder.push_storage_change(b":A".to_vec(), Some(b"B".to_vec())).unwrap(); + builder.push_storage_change(b":AA".to_vec(), Some(b"BB".to_vec())).unwrap(); + let prev_block = builder.build().unwrap().block; + let prev_hash = format!("{:?}", prev_block.header.hash()); + client.import(BlockOrigin::Own, prev_block.clone()).await.unwrap(); + + let mut builder = BlockBuilderBuilder::new(&*client) + .on_parent_block(prev_block.hash()) + .with_parent_block_number(1) + .build() + .unwrap(); + builder.push_storage_change(b":A".to_vec(), Some(b"11".to_vec())).unwrap(); + builder.push_storage_change(b":AA".to_vec(), Some(b"22".to_vec())).unwrap(); + builder.push_storage_change(b":AAA".to_vec(), Some(b"222".to_vec())).unwrap(); + let block = builder.build().unwrap().block; + let block_hash = format!("{:?}", block.header.hash()); + client.import(BlockOrigin::Own, block.clone()).await.unwrap(); + + // Search for items in the main trie: + // - values of keys under ":A" + // - hashes of keys under ":AA" + let items = vec![ + ArchiveStorageDiffItem:: { + key: hex_string(b":A"), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }, + ArchiveStorageDiffItem:: { + key: hex_string(b":AA"), + return_type: ArchiveStorageDiffType::Hash, + child_trie_key: None, + }, + ]; + let mut sub = api + .subscribe_unbounded( + "archive_unstable_storageDiff", + rpc_params![&block_hash, items.clone(), &prev_hash], + ) + .await + .unwrap(); + + let event = get_next_event::(&mut sub).await; + assert_eq!( + ArchiveStorageDiffEvent::StorageDiff(ArchiveStorageDiffResult { + key: hex_string(b":A"), + result: StorageResultType::Value(hex_string(b"11")), + operation_type: ArchiveStorageDiffOperationType::Modified, + child_trie_key: None, + }), + event, + ); + + let event = get_next_event::(&mut sub).await; + assert_eq!( + ArchiveStorageDiffEvent::StorageDiff(ArchiveStorageDiffResult { + key: hex_string(b":AA"), + result: StorageResultType::Value(hex_string(b"22")), + operation_type: ArchiveStorageDiffOperationType::Modified, + child_trie_key: None, + }), + event, + ); + + let event = get_next_event::(&mut sub).await; + assert_eq!( + ArchiveStorageDiffEvent::StorageDiff(ArchiveStorageDiffResult { + key: hex_string(b":AA"), + result: StorageResultType::Hash(format!("{:?}", Blake2Hasher::hash(b"22"))), + operation_type: ArchiveStorageDiffOperationType::Modified, + child_trie_key: None, + }), + event, + ); + + // Added key. + let event = get_next_event::(&mut sub).await; + assert_eq!( + ArchiveStorageDiffEvent::StorageDiff(ArchiveStorageDiffResult { + key: hex_string(b":AAA"), + result: StorageResultType::Value(hex_string(b"222")), + operation_type: ArchiveStorageDiffOperationType::Added, + child_trie_key: None, + }), + event, + ); + + let event = get_next_event::(&mut sub).await; + assert_eq!( + ArchiveStorageDiffEvent::StorageDiff(ArchiveStorageDiffResult { + key: hex_string(b":AAA"), + result: StorageResultType::Hash(format!("{:?}", Blake2Hasher::hash(b"222"))), + operation_type: ArchiveStorageDiffOperationType::Added, + child_trie_key: None, + }), + event, + ); + + let event = get_next_event::(&mut sub).await; + assert_eq!(ArchiveStorageDiffEvent::StorageDiffDone, event); +} + +#[tokio::test] +async fn archive_storage_diff_no_changes() { + let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + + // Build 2 identical blocks. + let mut builder = BlockBuilderBuilder::new(&*client) + .on_parent_block(client.chain_info().genesis_hash) + .with_parent_block_number(0) + .build() + .unwrap(); + builder.push_storage_change(b":A".to_vec(), Some(b"B".to_vec())).unwrap(); + builder.push_storage_change(b":AA".to_vec(), Some(b"BB".to_vec())).unwrap(); + builder.push_storage_change(b":B".to_vec(), Some(b"CC".to_vec())).unwrap(); + builder.push_storage_change(b":BA".to_vec(), Some(b"CC".to_vec())).unwrap(); + let prev_block = builder.build().unwrap().block; + let prev_hash = format!("{:?}", prev_block.header.hash()); + client.import(BlockOrigin::Own, prev_block.clone()).await.unwrap(); + + let mut builder = BlockBuilderBuilder::new(&*client) + .on_parent_block(prev_block.hash()) + .with_parent_block_number(1) + .build() + .unwrap(); + builder.push_storage_change(b":A".to_vec(), Some(b"B".to_vec())).unwrap(); + builder.push_storage_change(b":AA".to_vec(), Some(b"BB".to_vec())).unwrap(); + let block = builder.build().unwrap().block; + let block_hash = format!("{:?}", block.header.hash()); + client.import(BlockOrigin::Own, block.clone()).await.unwrap(); + + // Search for items in the main trie with keys prefixed with ":A". + let items = vec![ArchiveStorageDiffItem:: { + key: hex_string(b":A"), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }]; + let mut sub = api + .subscribe_unbounded( + "archive_unstable_storageDiff", + rpc_params![&block_hash, items.clone(), &prev_hash], + ) + .await + .unwrap(); + + let event = get_next_event::(&mut sub).await; + assert_eq!(ArchiveStorageDiffEvent::StorageDiffDone, event); +} + +#[tokio::test] +async fn archive_storage_diff_deleted_changes() { + let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + + // Blocks are imported as forks. + let mut builder = BlockBuilderBuilder::new(&*client) + .on_parent_block(client.chain_info().genesis_hash) + .with_parent_block_number(0) + .build() + .unwrap(); + builder.push_storage_change(b":A".to_vec(), Some(b"B".to_vec())).unwrap(); + builder.push_storage_change(b":AA".to_vec(), Some(b"BB".to_vec())).unwrap(); + builder.push_storage_change(b":B".to_vec(), Some(b"CC".to_vec())).unwrap(); + builder.push_storage_change(b":BA".to_vec(), Some(b"CC".to_vec())).unwrap(); + let prev_block = builder.build().unwrap().block; + let prev_hash = format!("{:?}", prev_block.header.hash()); + client.import(BlockOrigin::Own, prev_block.clone()).await.unwrap(); + + let mut builder = BlockBuilderBuilder::new(&*client) + .on_parent_block(client.chain_info().genesis_hash) + .with_parent_block_number(0) + .build() + .unwrap(); + builder + .push_transfer(Transfer { + from: AccountKeyring::Alice.into(), + to: AccountKeyring::Ferdie.into(), + amount: 41, + nonce: 0, + }) + .unwrap(); + builder.push_storage_change(b":A".to_vec(), Some(b"B".to_vec())).unwrap(); + let block = builder.build().unwrap().block; + let block_hash = format!("{:?}", block.header.hash()); + client.import(BlockOrigin::Own, block.clone()).await.unwrap(); + + // Search for items in the main trie with keys prefixed with ":A". + let items = vec![ArchiveStorageDiffItem:: { + key: hex_string(b":A"), + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }]; + + let mut sub = api + .subscribe_unbounded( + "archive_unstable_storageDiff", + rpc_params![&block_hash, items.clone(), &prev_hash], + ) + .await + .unwrap(); + + let event = get_next_event::(&mut sub).await; + assert_eq!( + ArchiveStorageDiffEvent::StorageDiff(ArchiveStorageDiffResult { + key: hex_string(b":AA"), + result: StorageResultType::Value(hex_string(b"BB")), + operation_type: ArchiveStorageDiffOperationType::Deleted, + child_trie_key: None, + }), + event, + ); + + let event = get_next_event::(&mut sub).await; + assert_eq!(ArchiveStorageDiffEvent::StorageDiffDone, event); +} + +#[tokio::test] +async fn archive_storage_diff_invalid_params() { + let invalid_hash = hex_string(&INVALID_HASH); + let (_, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + + // Invalid shape for parameters. + let items: Vec> = Vec::new(); + let err = api + .subscribe_unbounded( + "archive_unstable_storageDiff", + rpc_params!["123", items.clone(), &invalid_hash], + ) + .await + .unwrap_err(); + assert_matches!(err, + Error::JsonRpc(ref err) if err.code() == crate::chain_head::error::json_rpc_spec::INVALID_PARAM_ERROR && err.message() == "Invalid params" + ); + + // The shape is right, but the block hash is invalid. + let items: Vec> = Vec::new(); + let mut sub = api + .subscribe_unbounded( + "archive_unstable_storageDiff", + rpc_params![&invalid_hash, items.clone(), &invalid_hash], + ) + .await + .unwrap(); + + let event = get_next_event::(&mut sub).await; + assert_matches!(event, + ArchiveStorageDiffEvent::StorageDiffError(ref err) if err.error.contains("Header was not found") + ); +} diff --git a/substrate/client/rpc-spec-v2/src/common/events.rs b/substrate/client/rpc-spec-v2/src/common/events.rs index b1627d74c844..198a60bf4cac 100644 --- a/substrate/client/rpc-spec-v2/src/common/events.rs +++ b/substrate/client/rpc-spec-v2/src/common/events.rs @@ -81,7 +81,7 @@ pub struct StorageResult { } /// The type of the storage query. -#[derive(Debug, Clone, PartialEq, Serialize, Deserialize)] +#[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)] #[serde(rename_all = "camelCase")] pub enum StorageResultType { /// Fetch the value of the provided key. @@ -136,17 +136,221 @@ pub struct ArchiveStorageMethodOk { } /// The error of a storage call. -#[derive(Debug, Clone, PartialEq, Serialize, Deserialize)] +#[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)] #[serde(rename_all = "camelCase")] pub struct ArchiveStorageMethodErr { /// Reported error. pub error: String, } +/// The type of the archive storage difference query. +#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash, Serialize, Deserialize)] +#[serde(rename_all = "camelCase")] +pub enum ArchiveStorageDiffType { + /// The result is provided as value of the key. + Value, + /// The result the hash of the value of the key. + Hash, +} + +/// The storage item to query. +#[derive(Debug, Clone, PartialEq, Serialize, Deserialize)] +#[serde(rename_all = "camelCase")] +pub struct ArchiveStorageDiffItem { + /// The provided key. + pub key: Key, + /// The type of the storage query. + pub return_type: ArchiveStorageDiffType, + /// The child trie key if provided. + #[serde(skip_serializing_if = "Option::is_none")] + #[serde(default)] + pub child_trie_key: Option, +} + +/// The result of a storage difference call. +#[derive(Debug, Clone, PartialEq, Serialize, Deserialize)] +#[serde(rename_all = "camelCase")] +pub struct ArchiveStorageDiffMethodResult { + /// Reported results. + pub result: Vec, +} + +/// The result of a storage difference call operation type. +#[derive(Debug, Clone, Copy, PartialEq, Eq, Serialize, Deserialize)] +#[serde(rename_all = "camelCase")] +pub enum ArchiveStorageDiffOperationType { + /// The key is added. + Added, + /// The key is modified. + Modified, + /// The key is removed. + Deleted, +} + +/// The result of an individual storage difference key. +#[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)] +#[serde(rename_all = "camelCase")] +pub struct ArchiveStorageDiffResult { + /// The hex-encoded key of the result. + pub key: String, + /// The result of the query. + #[serde(flatten)] + pub result: StorageResultType, + /// The operation type. + #[serde(rename = "type")] + pub operation_type: ArchiveStorageDiffOperationType, + /// The child trie key if provided. + #[serde(skip_serializing_if = "Option::is_none")] + #[serde(default)] + pub child_trie_key: Option, +} + +/// The event generated by the `archive_storageDiff` method. +/// +/// The `archive_storageDiff` can generate the following events: +/// - `storageDiff` event - generated when a `ArchiveStorageDiffResult` is produced. +/// - `storageDiffError` event - generated when an error is produced. +/// - `storageDiffDone` event - generated when the `archive_storageDiff` method completed. +#[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)] +#[serde(rename_all = "camelCase")] +#[serde(tag = "event")] +pub enum ArchiveStorageDiffEvent { + /// The `storageDiff` event. + StorageDiff(ArchiveStorageDiffResult), + /// The `storageDiffError` event. + StorageDiffError(ArchiveStorageMethodErr), + /// The `storageDiffDone` event. + StorageDiffDone, +} + +impl ArchiveStorageDiffEvent { + /// Create a new `ArchiveStorageDiffEvent::StorageDiffError` event. + pub fn err(error: String) -> Self { + Self::StorageDiffError(ArchiveStorageMethodErr { error }) + } + + /// Checks if the event is a `StorageDiffDone` event. + pub fn is_done(&self) -> bool { + matches!(self, Self::StorageDiffDone) + } + + /// Checks if the event is a `StorageDiffError` event. + pub fn is_err(&self) -> bool { + matches!(self, Self::StorageDiffError(_)) + } +} + #[cfg(test)] mod tests { use super::*; + #[test] + fn archive_diff_input() { + // Item with Value. + let item = ArchiveStorageDiffItem { + key: "0x1", + return_type: ArchiveStorageDiffType::Value, + child_trie_key: None, + }; + // Encode + let ser = serde_json::to_string(&item).unwrap(); + let exp = r#"{"key":"0x1","returnType":"value"}"#; + assert_eq!(ser, exp); + // Decode + let dec: ArchiveStorageDiffItem<&str> = serde_json::from_str(exp).unwrap(); + assert_eq!(dec, item); + + // Item with Hash. + let item = ArchiveStorageDiffItem { + key: "0x1", + return_type: ArchiveStorageDiffType::Hash, + child_trie_key: None, + }; + // Encode + let ser = serde_json::to_string(&item).unwrap(); + let exp = r#"{"key":"0x1","returnType":"hash"}"#; + assert_eq!(ser, exp); + // Decode + let dec: ArchiveStorageDiffItem<&str> = serde_json::from_str(exp).unwrap(); + assert_eq!(dec, item); + + // Item with Value and child trie key. + let item = ArchiveStorageDiffItem { + key: "0x1", + return_type: ArchiveStorageDiffType::Value, + child_trie_key: Some("0x2"), + }; + // Encode + let ser = serde_json::to_string(&item).unwrap(); + let exp = r#"{"key":"0x1","returnType":"value","childTrieKey":"0x2"}"#; + assert_eq!(ser, exp); + // Decode + let dec: ArchiveStorageDiffItem<&str> = serde_json::from_str(exp).unwrap(); + assert_eq!(dec, item); + + // Item with Hash and child trie key. + let item = ArchiveStorageDiffItem { + key: "0x1", + return_type: ArchiveStorageDiffType::Hash, + child_trie_key: Some("0x2"), + }; + // Encode + let ser = serde_json::to_string(&item).unwrap(); + let exp = r#"{"key":"0x1","returnType":"hash","childTrieKey":"0x2"}"#; + assert_eq!(ser, exp); + // Decode + let dec: ArchiveStorageDiffItem<&str> = serde_json::from_str(exp).unwrap(); + assert_eq!(dec, item); + } + + #[test] + fn archive_diff_output() { + // Item with Value. + let item = ArchiveStorageDiffResult { + key: "0x1".into(), + result: StorageResultType::Value("res".into()), + operation_type: ArchiveStorageDiffOperationType::Added, + child_trie_key: None, + }; + // Encode + let ser = serde_json::to_string(&item).unwrap(); + let exp = r#"{"key":"0x1","value":"res","type":"added"}"#; + assert_eq!(ser, exp); + // Decode + let dec: ArchiveStorageDiffResult = serde_json::from_str(exp).unwrap(); + assert_eq!(dec, item); + + // Item with Hash. + let item = ArchiveStorageDiffResult { + key: "0x1".into(), + result: StorageResultType::Hash("res".into()), + operation_type: ArchiveStorageDiffOperationType::Modified, + child_trie_key: None, + }; + // Encode + let ser = serde_json::to_string(&item).unwrap(); + let exp = r#"{"key":"0x1","hash":"res","type":"modified"}"#; + assert_eq!(ser, exp); + // Decode + let dec: ArchiveStorageDiffResult = serde_json::from_str(exp).unwrap(); + assert_eq!(dec, item); + + // Item with Hash, child trie key and removed. + let item = ArchiveStorageDiffResult { + key: "0x1".into(), + result: StorageResultType::Hash("res".into()), + operation_type: ArchiveStorageDiffOperationType::Deleted, + child_trie_key: Some("0x2".into()), + }; + // Encode + let ser = serde_json::to_string(&item).unwrap(); + let exp = r#"{"key":"0x1","hash":"res","type":"deleted","childTrieKey":"0x2"}"#; + assert_eq!(ser, exp); + // Decode + let dec: ArchiveStorageDiffResult = serde_json::from_str(exp).unwrap(); + assert_eq!(dec, item); + } + #[test] fn storage_result() { // Item with Value. diff --git a/substrate/client/rpc-spec-v2/src/common/storage.rs b/substrate/client/rpc-spec-v2/src/common/storage.rs index 2e24a8da8ca8..673e20b2bc78 100644 --- a/substrate/client/rpc-spec-v2/src/common/storage.rs +++ b/substrate/client/rpc-spec-v2/src/common/storage.rs @@ -248,4 +248,19 @@ where }); Ok((ret, maybe_next_query)) } + + /// Raw iterator over the keys. + pub fn raw_keys_iter( + &self, + hash: Block::Hash, + child_key: Option, + ) -> Result, String> { + let keys_iter = if let Some(child_key) = child_key { + self.client.child_storage_keys(hash, child_key, None, None) + } else { + self.client.storage_keys(hash, None, None) + }; + + keys_iter.map_err(|err| err.to_string()) + } } diff --git a/substrate/client/service/src/builder.rs b/substrate/client/service/src/builder.rs index ac9371a8941b..027a444012af 100644 --- a/substrate/client/service/src/builder.rs +++ b/substrate/client/service/src/builder.rs @@ -755,6 +755,7 @@ where client.clone(), backend.clone(), genesis_hash, + task_executor.clone(), // Defaults to sensible limits for the `Archive`. sc_rpc_spec_v2::archive::ArchiveConfig::default(), ) From 2ef2723126584dfcd6d2a9272282ee78375dbcd3 Mon Sep 17 00:00:00 2001 From: Michal Kucharczyk <1728078+michalkucharczyk@users.noreply.github.com> Date: Wed, 27 Nov 2024 21:40:23 +0100 Subject: [PATCH 38/64] chain-spec-guide-runtime: path to wasm blob fixed (#6673) In `chain-spec-guide-runtime` crate's tests, there was assumption that release version of wasm blob exists. This PR uses `chain_spec_guide_runtime::runtime::WASM_BINARY_PATH` const to use correct path to runtime blob. --------- Co-authored-by: GitHub Action --- .../tests/chain_spec_builder_tests.rs | 14 ++++++++------ prdoc/pr_6673.prdoc | 7 +++++++ 2 files changed, 15 insertions(+), 6 deletions(-) create mode 100644 prdoc/pr_6673.prdoc diff --git a/docs/sdk/src/reference_docs/chain_spec_runtime/tests/chain_spec_builder_tests.rs b/docs/sdk/src/reference_docs/chain_spec_runtime/tests/chain_spec_builder_tests.rs index c2fe5a6727e6..df400b68f79d 100644 --- a/docs/sdk/src/reference_docs/chain_spec_runtime/tests/chain_spec_builder_tests.rs +++ b/docs/sdk/src/reference_docs/chain_spec_runtime/tests/chain_spec_builder_tests.rs @@ -1,8 +1,10 @@ use serde_json::{json, Value}; use std::{process::Command, str}; -const WASM_FILE_PATH: &str = - "../../../../../target/release/wbuild/chain-spec-guide-runtime/chain_spec_guide_runtime.wasm"; +fn wasm_file_path() -> &'static str { + chain_spec_guide_runtime::runtime::WASM_BINARY_PATH + .expect("chain_spec_guide_runtime wasm should exist. qed") +} const CHAIN_SPEC_BUILDER_PATH: &str = "../../../../../target/release/chain-spec-builder"; @@ -26,7 +28,7 @@ fn list_presets() { let output = Command::new(get_chain_spec_builder_path()) .arg("list-presets") .arg("-r") - .arg(WASM_FILE_PATH) + .arg(wasm_file_path()) .output() .expect("Failed to execute command"); @@ -50,7 +52,7 @@ fn get_preset() { let output = Command::new(get_chain_spec_builder_path()) .arg("display-preset") .arg("-r") - .arg(WASM_FILE_PATH) + .arg(wasm_file_path()) .arg("-p") .arg("preset_2") .output() @@ -83,7 +85,7 @@ fn generate_chain_spec() { .arg("/dev/stdout") .arg("create") .arg("-r") - .arg(WASM_FILE_PATH) + .arg(wasm_file_path()) .arg("named-preset") .arg("preset_2") .output() @@ -140,7 +142,7 @@ fn generate_para_chain_spec() { .arg("-p") .arg("1000") .arg("-r") - .arg(WASM_FILE_PATH) + .arg(wasm_file_path()) .arg("named-preset") .arg("preset_2") .output() diff --git a/prdoc/pr_6673.prdoc b/prdoc/pr_6673.prdoc new file mode 100644 index 000000000000..d2ca3c61ff39 --- /dev/null +++ b/prdoc/pr_6673.prdoc @@ -0,0 +1,7 @@ +title: 'chain-spec-guide-runtime: path to wasm blob fixed' +doc: +- audience: Runtime Dev + description: In `chain-spec-guide-runtime` crate's tests, there was assumption that + release version of wasm blob exists. This PR uses `chain_spec_guide_runtime::runtime::WASM_BINARY_PATH` + const to use correct path to runtime blob. +crates: [] From 51c3e95a05c528b3869ad267aeb5c356551e38db Mon Sep 17 00:00:00 2001 From: Alexandru Vasile <60601340+lexnv@users.noreply.github.com> Date: Thu, 28 Nov 2024 11:16:06 +0200 Subject: [PATCH 39/64] chore: Update litep2p to v0.8.2 (#6677) This includes a critical fix for debug release versions of litep2p (which are running in Kusama as validators). While at it, have stopped the oncall pain of alerts around `incoming_connections_total`. We can rethink the metric expose of litep2p in Q1. ## [0.8.2] - 2024-11-27 This release ensures that the provided peer identity is verified at the crypto/noise protocol level, enhancing security and preventing potential misuses. The release also includes a fix that caused `TransportService` component to panic on debug builds. ### Fixed - req-resp: Fix panic on connection closed for substream open failure ([#291](https://github.com/paritytech/litep2p/pull/291)) - crypto/noise: Verify crypto/noise signature payload ([#278](https://github.com/paritytech/litep2p/pull/278)) ### Changed - transport_service/logs: Provide less details for trace logs ([#292](https://github.com/paritytech/litep2p/pull/292)) ## Testing Done This has been extensively tested in Kusama on all validators, that are now running litep2p. Deployed PR: https://github.com/paritytech/polkadot-sdk/pull/6638 ### Litep2p Dashboards ![Screenshot 2024-11-26 at 19 19 41](https://github.com/user-attachments/assets/e00b2b2b-7e64-4d96-ab26-165e2b8d0dc9) ### Libp2p vs Litep2p CPU usage After deploying litep2p we have reduced CPU usage from around 300-400% to 200%, this is a significant boost in performance, freeing resources for other subcomponents to function more optimally. ![image(1)](https://github.com/user-attachments/assets/fa793df5-4d58-4601-963d-246e56dd2a26) cc @paritytech/sdk-node --------- Signed-off-by: Alexandru Vasile Co-authored-by: GitHub Action --- Cargo.lock | 4 ++-- Cargo.toml | 2 +- prdoc/pr_6677.prdoc | 11 +++++++++++ substrate/client/network/src/litep2p/mod.rs | 11 ++++++++++- 4 files changed, 24 insertions(+), 4 deletions(-) create mode 100644 prdoc/pr_6677.prdoc diff --git a/Cargo.lock b/Cargo.lock index 12e642bc9d06..84477cd05416 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -10216,9 +10216,9 @@ dependencies = [ [[package]] name = "litep2p" -version = "0.8.1" +version = "0.8.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5b67484b8ac41e1cfdf012f65fa81e88c2ef5f8a7d6dec0e2678c2d06dc04530" +checksum = "569e7dbec8a0d4b08d30f4942cd579cfe8db5d3f83f8604abe61697c38d17e73" dependencies = [ "async-trait", "bs58", diff --git a/Cargo.toml b/Cargo.toml index b1a52712e736..964964908a9b 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -848,7 +848,7 @@ linked-hash-map = { version = "0.5.4" } linked_hash_set = { version = "0.1.4" } linregress = { version = "0.5.1" } lite-json = { version = "0.2.0", default-features = false } -litep2p = { version = "0.8.1", features = ["websocket"] } +litep2p = { version = "0.8.2", features = ["websocket"] } log = { version = "0.4.22", default-features = false } macro_magic = { version = "0.5.1" } maplit = { version = "1.0.2" } diff --git a/prdoc/pr_6677.prdoc b/prdoc/pr_6677.prdoc new file mode 100644 index 000000000000..c6766889e68d --- /dev/null +++ b/prdoc/pr_6677.prdoc @@ -0,0 +1,11 @@ +title: 'chore: Update litep2p to v0.8.2' +doc: +- audience: Node Dev + description: |- + This includes a critical fix for debug release versions of litep2p (which are running in Kusama as validators). + + While at it, have stopped the oncall pain of alerts around `incoming_connections_total`. We can rethink the metric expose of litep2p in Q1. + +crates: +- name: sc-network + bump: minor diff --git a/substrate/client/network/src/litep2p/mod.rs b/substrate/client/network/src/litep2p/mod.rs index 10cf9f4da36d..6d3575fc2b6b 100644 --- a/substrate/client/network/src/litep2p/mod.rs +++ b/substrate/client/network/src/litep2p/mod.rs @@ -986,7 +986,15 @@ impl NetworkBackend for Litep2pNetworkBac let direction = match endpoint { Endpoint::Dialer { .. } => "out", - Endpoint::Listener { .. } => "in", + Endpoint::Listener { .. } => { + // Increment incoming connections counter. + // + // Note: For litep2p these are represented by established negotiated connections, + // while for libp2p (legacy) these represent not-yet-negotiated connections. + metrics.incoming_connections_total.inc(); + + "in" + }, }; metrics.connections_opened_total.with_label_values(&[direction]).inc(); @@ -1058,6 +1066,7 @@ impl NetworkBackend for Litep2pNetworkBac NegotiationError::ParseError(_) => "parse-error", NegotiationError::IoError(_) => "io-error", NegotiationError::WebSocket(_) => "webscoket-error", + NegotiationError::BadSignature => "bad-signature", } }; From 9ec8009c5a8fdf89499fcd2a40df0292d3950efa Mon Sep 17 00:00:00 2001 From: Branislav Kontur Date: Thu, 28 Nov 2024 12:41:09 +0100 Subject: [PATCH 40/64] Multiple instances for pallet-bridge-relayers fix (#6684) Previously, we added multi-instance pallet support for `pallet-bridge-relayers`, but missed fixing it in this one place. --------- Co-authored-by: GitHub Action Co-authored-by: Adrian Catangiu --- bridges/modules/relayers/src/extension/mod.rs | 18 ++++++++++++------ 1 file changed, 12 insertions(+), 6 deletions(-) diff --git a/bridges/modules/relayers/src/extension/mod.rs b/bridges/modules/relayers/src/extension/mod.rs index 34d280d26d6e..d562ed9bcd0e 100644 --- a/bridges/modules/relayers/src/extension/mod.rs +++ b/bridges/modules/relayers/src/extension/mod.rs @@ -129,7 +129,7 @@ pub struct BridgeRelayersTransactionExtension( impl BridgeRelayersTransactionExtension where Self: 'static + Send + Sync, - R: RelayersConfig + R: RelayersConfig + BridgeMessagesConfig + TransactionPaymentConfig, C: ExtensionConfig, @@ -250,7 +250,7 @@ where // let's also replace the weight of slashing relayer with the weight of rewarding relayer if call_info.is_receive_messages_proof_call() { post_info_weight = post_info_weight.saturating_sub( - ::WeightInfo::extra_weight_of_successful_receive_messages_proof_call(), + >::WeightInfo::extra_weight_of_successful_receive_messages_proof_call(), ); } @@ -278,7 +278,7 @@ impl TransactionExtension for BridgeRelayersTransactionExtension where Self: 'static + Send + Sync, - R: RelayersConfig + R: RelayersConfig + BridgeMessagesConfig + TransactionPaymentConfig, C: ExtensionConfig, @@ -326,7 +326,9 @@ where }; // we only boost priority if relayer has staked required balance - if !RelayersPallet::::is_registration_active(&data.relayer) { + if !RelayersPallet::::is_registration_active( + &data.relayer, + ) { return Ok((Default::default(), Some(data), origin)) } @@ -382,7 +384,11 @@ where match call_result { RelayerAccountAction::None => (), RelayerAccountAction::Reward(relayer, reward_account, reward) => { - RelayersPallet::::register_relayer_reward(reward_account, &relayer, reward); + RelayersPallet::::register_relayer_reward( + reward_account, + &relayer, + reward, + ); log::trace!( target: LOG_TARGET, @@ -394,7 +400,7 @@ where ); }, RelayerAccountAction::Slash(relayer, slash_account) => - RelayersPallet::::slash_and_deregister( + RelayersPallet::::slash_and_deregister( &relayer, ExplicitOrAccountParams::Params(slash_account), ), From 23369acd34411cfae924718a2834df1a7ea8bc05 Mon Sep 17 00:00:00 2001 From: Ludovic_Domingues Date: Thu, 28 Nov 2024 15:27:49 +0100 Subject: [PATCH 41/64] Migrating pallet-xcm-benchmarks to V2 (#6618) # Description Migrated pallet-xcm-benchmarks to benchmaking syntax V2 This is part of #6202 --------- Co-authored-by: Giuseppe Re --- .../src/generic/benchmarking.rs | 652 +++++++++++------- 1 file changed, 394 insertions(+), 258 deletions(-) diff --git a/polkadot/xcm/pallet-xcm-benchmarks/src/generic/benchmarking.rs b/polkadot/xcm/pallet-xcm-benchmarks/src/generic/benchmarking.rs index 87bf27e4ff18..f4836b7cdde1 100644 --- a/polkadot/xcm/pallet-xcm-benchmarks/src/generic/benchmarking.rs +++ b/polkadot/xcm/pallet-xcm-benchmarks/src/generic/benchmarking.rs @@ -13,12 +13,13 @@ // You should have received a copy of the GNU General Public License // along with Polkadot. If not, see . +#![cfg(feature = "runtime-benchmarks")] use super::*; use crate::{account_and_location, new_executor, EnsureDelivery, XcmCallOf}; use alloc::{vec, vec::Vec}; use codec::Encode; -use frame_benchmarking::{benchmarks, BenchmarkError}; +use frame_benchmarking::v2::*; use frame_support::traits::fungible::Inspect; use xcm::{ latest::{prelude::*, MaxDispatchErrorLen, MaybeErrorCode, Weight, MAX_ITEMS_IN_ASSETS}, @@ -29,16 +30,21 @@ use xcm_executor::{ ExecutorError, FeesMode, }; -benchmarks! { - report_holding { +#[benchmarks] +mod benchmarks { + use super::*; + + #[benchmark] + fn report_holding() -> Result<(), BenchmarkError> { let (sender_account, sender_location) = account_and_location::(1); let destination = T::valid_destination().map_err(|_| BenchmarkError::Skip)?; - let (expected_fees_mode, expected_assets_in_holding) = T::DeliveryHelper::ensure_successful_delivery( - &sender_location, - &destination, - FeeReason::Report, - ); + let (expected_fees_mode, expected_assets_in_holding) = + T::DeliveryHelper::ensure_successful_delivery( + &sender_location, + &destination, + FeeReason::Report, + ); let sender_account_balance_before = T::TransactAsset::balance(&sender_account); // generate holding and add possible required fees @@ -64,21 +70,33 @@ benchmarks! { query_id: Default::default(), max_weight: Weight::MAX, }, - // Worst case is looking through all holdings for every asset explicitly - respecting the limit `MAX_ITEMS_IN_ASSETS`. - assets: Definite(holding.into_inner().into_iter().take(MAX_ITEMS_IN_ASSETS).collect::>().into()), + // Worst case is looking through all holdings for every asset explicitly - respecting + // the limit `MAX_ITEMS_IN_ASSETS`. + assets: Definite( + holding + .into_inner() + .into_iter() + .take(MAX_ITEMS_IN_ASSETS) + .collect::>() + .into(), + ), }; let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } // Check we charged the delivery fees assert!(T::TransactAsset::balance(&sender_account) <= sender_account_balance_before); + + Ok(()) } // This benchmark does not use any additional orders or instructions. This should be managed // by the `deep` and `shallow` implementation. - buy_execution { + #[benchmark] + fn buy_execution() -> Result<(), BenchmarkError> { let holding = T::worst_case_holding(0).into(); let mut executor = new_executor::(Default::default()); @@ -92,13 +110,16 @@ benchmarks! { }; let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } + Ok(()) } - pay_fees { + #[benchmark] + fn pay_fees() -> Result<(), BenchmarkError> { let holding = T::worst_case_holding(0).into(); let mut executor = new_executor::(Default::default()); @@ -111,40 +132,53 @@ benchmarks! { let instruction = Instruction::>::PayFees { asset: fee_asset }; let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify {} + #[block] + { + executor.bench_process(xcm)?; + } + Ok(()) + } - set_asset_claimer { + #[benchmark] + fn set_asset_claimer() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let (_, sender_location) = account_and_location::(1); - let instruction = Instruction::SetAssetClaimer{ location:sender_location.clone() }; + let instruction = Instruction::SetAssetClaimer { location: sender_location.clone() }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.asset_claimer(), Some(sender_location.clone())); + + Ok(()) } - query_response { + #[benchmark] + fn query_response() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let (query_id, response) = T::worst_case_response(); let max_weight = Weight::MAX; let querier: Option = Some(Here.into()); let instruction = Instruction::QueryResponse { query_id, response, max_weight, querier }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + + #[block] + { + executor.bench_process(xcm)?; + } // The assert above is enough to show this XCM succeeded + + Ok(()) } // We don't care about the call itself, since that is accounted for in the weight parameter // and included in the final weight calculation. So this is just the overhead of submitting // a noop call. - transact { + #[benchmark] + fn transact() -> Result<(), BenchmarkError> { let (origin, noop_call) = T::transact_origin_and_runtime_call()?; let mut executor = new_executor::(origin); let double_encoded_noop_call: DoubleEncoded<_> = noop_call.encode().into(); @@ -154,119 +188,145 @@ benchmarks! { call: double_encoded_noop_call, }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } // TODO Make the assertion configurable? + + Ok(()) } - refund_surplus { + #[benchmark] + fn refund_surplus() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let holding_assets = T::worst_case_holding(1); // We can already buy execution since we'll load the holding register manually let asset_for_fees = T::fee_asset().unwrap(); - let previous_xcm = Xcm(vec![BuyExecution { fees: asset_for_fees, weight_limit: Limited(Weight::from_parts(1337, 1337)) }]); + let previous_xcm = Xcm(vec![BuyExecution { + fees: asset_for_fees, + weight_limit: Limited(Weight::from_parts(1337, 1337)), + }]); executor.set_holding(holding_assets.into()); executor.set_total_surplus(Weight::from_parts(1337, 1337)); executor.set_total_refunded(Weight::zero()); - executor.bench_process(previous_xcm).expect("Holding has been loaded, so we can buy execution here"); + executor + .bench_process(previous_xcm) + .expect("Holding has been loaded, so we can buy execution here"); let instruction = Instruction::>::RefundSurplus; let xcm = Xcm(vec![instruction]); - } : { - let result = executor.bench_process(xcm)?; - } verify { + #[block] + { + let _result = executor.bench_process(xcm)?; + } assert_eq!(executor.total_surplus(), &Weight::from_parts(1337, 1337)); assert_eq!(executor.total_refunded(), &Weight::from_parts(1337, 1337)); + + Ok(()) } - set_error_handler { + #[benchmark] + fn set_error_handler() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let instruction = Instruction::>::SetErrorHandler(Xcm(vec![])); let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.error_handler(), &Xcm(vec![])); + + Ok(()) } - set_appendix { + #[benchmark] + fn set_appendix() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let appendix = Xcm(vec![]); let instruction = Instruction::>::SetAppendix(appendix); let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.appendix(), &Xcm(vec![])); + Ok(()) } - clear_error { + #[benchmark] + fn clear_error() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); executor.set_error(Some((5u32, XcmError::Overflow))); let instruction = Instruction::>::ClearError; let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify { - assert!(executor.error().is_none()) + #[block] + { + executor.bench_process(xcm)?; + } + assert!(executor.error().is_none()); + Ok(()) } - descend_origin { + #[benchmark] + fn descend_origin() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let who = Junctions::from([OnlyChild, OnlyChild]); let instruction = Instruction::DescendOrigin(who.clone()); let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify { - assert_eq!( - executor.origin(), - &Some(Location { - parents: 0, - interior: who, - }), - ); + #[block] + { + executor.bench_process(xcm)?; + } + assert_eq!(executor.origin(), &Some(Location { parents: 0, interior: who }),); + + Ok(()) } - execute_with_origin { + #[benchmark] + fn execute_with_origin() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let who: Junctions = Junctions::from([AccountId32 { id: [0u8; 32], network: None }]); - let instruction = Instruction::ExecuteWithOrigin { descendant_origin: Some(who.clone()), xcm: Xcm(vec![]) }; + let instruction = Instruction::ExecuteWithOrigin { + descendant_origin: Some(who.clone()), + xcm: Xcm(vec![]), + }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { - assert_eq!( - executor.origin(), - &Some(Location { - parents: 0, - interior: Here, - }), - ); + #[block] + { + executor.bench_process(xcm)?; + } + assert_eq!(executor.origin(), &Some(Location { parents: 0, interior: Here }),); + + Ok(()) } - clear_origin { + #[benchmark] + fn clear_origin() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let instruction = Instruction::ClearOrigin; let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.origin(), &None); + Ok(()) } - report_error { + #[benchmark] + fn report_error() -> Result<(), BenchmarkError> { let (sender_account, sender_location) = account_and_location::(1); let query_id = Default::default(); let max_weight = Default::default(); let destination = T::valid_destination().map_err(|_| BenchmarkError::Skip)?; - let (expected_fees_mode, expected_assets_in_holding) = T::DeliveryHelper::ensure_successful_delivery( - &sender_location, - &destination, - FeeReason::Report, - ); + let (expected_fees_mode, expected_assets_in_holding) = + T::DeliveryHelper::ensure_successful_delivery( + &sender_location, + &destination, + FeeReason::Report, + ); let sender_account_balance_before = T::TransactAsset::balance(&sender_account); let mut executor = new_executor::(sender_location); @@ -278,18 +338,21 @@ benchmarks! { } executor.set_error(Some((0u32, XcmError::Unimplemented))); - let instruction = Instruction::ReportError(QueryResponseInfo { - query_id, destination, max_weight - }); + let instruction = + Instruction::ReportError(QueryResponseInfo { query_id, destination, max_weight }); let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } // Check we charged the delivery fees assert!(T::TransactAsset::balance(&sender_account) <= sender_account_balance_before); + + Ok(()) } - claim_asset { + #[benchmark] + fn claim_asset() -> Result<(), BenchmarkError> { use xcm_executor::traits::DropAssets; let (origin, ticket, assets) = T::claimable_asset()?; @@ -298,11 +361,7 @@ benchmarks! { ::AssetTrap::drop_assets( &origin, assets.clone().into(), - &XcmContext { - origin: Some(origin.clone()), - message_id: [0; 32], - topic: None, - }, + &XcmContext { origin: Some(origin.clone()), message_id: [0; 32], topic: None }, ); // Assets should be in the trap now. @@ -310,28 +369,32 @@ benchmarks! { let mut executor = new_executor::(origin); let instruction = Instruction::ClaimAsset { assets: assets.clone(), ticket }; let xcm = Xcm(vec![instruction]); - } :{ - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert!(executor.holding().ensure_contains(&assets).is_ok()); + Ok(()) } - trap { + #[benchmark] + fn trap() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let instruction = Instruction::Trap(10); let xcm = Xcm(vec![instruction]); // In order to access result in the verification below, it needs to be defined here. - let mut _result = Ok(()); - } : { - _result = executor.bench_process(xcm); - } verify { - assert!(matches!(_result, Err(ExecutorError { - xcm_error: XcmError::Trap(10), - .. - }))); + let result; + #[block] + { + result = executor.bench_process(xcm); + } + assert!(matches!(result, Err(ExecutorError { xcm_error: XcmError::Trap(10), .. }))); + + Ok(()) } - subscribe_version { + #[benchmark] + fn subscribe_version() -> Result<(), BenchmarkError> { use xcm_executor::traits::VersionChangeNotifier; let origin = T::subscribe_origin()?; let query_id = Default::default(); @@ -339,13 +402,18 @@ benchmarks! { let mut executor = new_executor::(origin.clone()); let instruction = Instruction::SubscribeVersion { query_id, max_response_weight }; let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify { - assert!(::SubscriptionService::is_subscribed(&origin)); + #[block] + { + executor.bench_process(xcm)?; + } + assert!(::SubscriptionService::is_subscribed( + &origin + )); + Ok(()) } - unsubscribe_version { + #[benchmark] + fn unsubscribe_version() -> Result<(), BenchmarkError> { use xcm_executor::traits::VersionChangeNotifier; // First we need to subscribe to notifications. let (origin, _) = T::transact_origin_and_runtime_call()?; @@ -355,24 +423,28 @@ benchmarks! { &origin, query_id, max_response_weight, - &XcmContext { - origin: Some(origin.clone()), - message_id: [0; 32], - topic: None, - }, - ).map_err(|_| "Could not start subscription")?; - assert!(::SubscriptionService::is_subscribed(&origin)); + &XcmContext { origin: Some(origin.clone()), message_id: [0; 32], topic: None }, + ) + .map_err(|_| "Could not start subscription")?; + assert!(::SubscriptionService::is_subscribed( + &origin + )); let mut executor = new_executor::(origin.clone()); let instruction = Instruction::UnsubscribeVersion; let xcm = Xcm(vec![instruction]); - } : { - executor.bench_process(xcm)?; - } verify { - assert!(!::SubscriptionService::is_subscribed(&origin)); + #[block] + { + executor.bench_process(xcm)?; + } + assert!(!::SubscriptionService::is_subscribed( + &origin + )); + Ok(()) } - burn_asset { + #[benchmark] + fn burn_asset() -> Result<(), BenchmarkError> { let holding = T::worst_case_holding(0); let assets = holding.clone(); @@ -381,13 +453,16 @@ benchmarks! { let instruction = Instruction::BurnAsset(assets.into()); let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert!(executor.holding().is_empty()); + Ok(()) } - expect_asset { + #[benchmark] + fn expect_asset() -> Result<(), BenchmarkError> { let holding = T::worst_case_holding(0); let assets = holding.clone(); @@ -396,71 +471,86 @@ benchmarks! { let instruction = Instruction::ExpectAsset(assets.into()); let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } // `execute` completing successfully is as good as we can check. + + Ok(()) } - expect_origin { + #[benchmark] + fn expect_origin() -> Result<(), BenchmarkError> { let expected_origin = Parent.into(); let mut executor = new_executor::(Default::default()); let instruction = Instruction::ExpectOrigin(Some(expected_origin)); let xcm = Xcm(vec![instruction]); let mut _result = Ok(()); - }: { - _result = executor.bench_process(xcm); - } verify { - assert!(matches!(_result, Err(ExecutorError { - xcm_error: XcmError::ExpectationFalse, - .. - }))); + #[block] + { + _result = executor.bench_process(xcm); + } + assert!(matches!( + _result, + Err(ExecutorError { xcm_error: XcmError::ExpectationFalse, .. }) + )); + + Ok(()) } - expect_error { + #[benchmark] + fn expect_error() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); executor.set_error(Some((3u32, XcmError::Overflow))); let instruction = Instruction::ExpectError(None); let xcm = Xcm(vec![instruction]); let mut _result = Ok(()); - }: { - _result = executor.bench_process(xcm); - } verify { - assert!(matches!(_result, Err(ExecutorError { - xcm_error: XcmError::ExpectationFalse, - .. - }))); + #[block] + { + _result = executor.bench_process(xcm); + } + assert!(matches!( + _result, + Err(ExecutorError { xcm_error: XcmError::ExpectationFalse, .. }) + )); + + Ok(()) } - expect_transact_status { + #[benchmark] + fn expect_transact_status() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); - let worst_error = || -> MaybeErrorCode { - vec![0; MaxDispatchErrorLen::get() as usize].into() - }; + let worst_error = + || -> MaybeErrorCode { vec![0; MaxDispatchErrorLen::get() as usize].into() }; executor.set_transact_status(worst_error()); let instruction = Instruction::ExpectTransactStatus(worst_error()); let xcm = Xcm(vec![instruction]); let mut _result = Ok(()); - }: { - _result = executor.bench_process(xcm); - } verify { + #[block] + { + _result = executor.bench_process(xcm); + } assert!(matches!(_result, Ok(..))); + Ok(()) } - query_pallet { + #[benchmark] + fn query_pallet() -> Result<(), BenchmarkError> { let (sender_account, sender_location) = account_and_location::(1); let query_id = Default::default(); let destination = T::valid_destination().map_err(|_| BenchmarkError::Skip)?; let max_weight = Default::default(); - let (expected_fees_mode, expected_assets_in_holding) = T::DeliveryHelper::ensure_successful_delivery( - &sender_location, - &destination, - FeeReason::QueryPallet, - ); + let (expected_fees_mode, expected_assets_in_holding) = + T::DeliveryHelper::ensure_successful_delivery( + &sender_location, + &destination, + FeeReason::QueryPallet, + ); let sender_account_balance_before = T::TransactAsset::balance(&sender_account); let mut executor = new_executor::(sender_location); if let Some(expected_fees_mode) = expected_fees_mode { @@ -476,15 +566,19 @@ benchmarks! { response_info: QueryResponseInfo { destination, query_id, max_weight }, }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } // Check we charged the delivery fees assert!(T::TransactAsset::balance(&sender_account) <= sender_account_balance_before); // TODO: Potentially add new trait to XcmSender to detect a queued outgoing message. #4426 + + Ok(()) } - expect_pallet { + #[benchmark] + fn expect_pallet() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let valid_pallet = T::valid_pallet(); let instruction = Instruction::ExpectPallet { @@ -495,23 +589,27 @@ benchmarks! { min_crate_minor: valid_pallet.crate_version.minor.into(), }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } // the execution succeeding is all we need to verify this xcm was successful + Ok(()) } - report_transact_status { + #[benchmark] + fn report_transact_status() -> Result<(), BenchmarkError> { let (sender_account, sender_location) = account_and_location::(1); let query_id = Default::default(); let destination = T::valid_destination().map_err(|_| BenchmarkError::Skip)?; let max_weight = Default::default(); - let (expected_fees_mode, expected_assets_in_holding) = T::DeliveryHelper::ensure_successful_delivery( - &sender_location, - &destination, - FeeReason::Report, - ); + let (expected_fees_mode, expected_assets_in_holding) = + T::DeliveryHelper::ensure_successful_delivery( + &sender_location, + &destination, + FeeReason::Report, + ); let sender_account_balance_before = T::TransactAsset::balance(&sender_account); let mut executor = new_executor::(sender_location); @@ -529,84 +627,102 @@ benchmarks! { max_weight, }); let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } // Check we charged the delivery fees assert!(T::TransactAsset::balance(&sender_account) <= sender_account_balance_before); // TODO: Potentially add new trait to XcmSender to detect a queued outgoing message. #4426 + Ok(()) } - clear_transact_status { + #[benchmark] + fn clear_transact_status() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); executor.set_transact_status(b"MyError".to_vec().into()); let instruction = Instruction::ClearTransactStatus; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.transact_status(), &MaybeErrorCode::Success); + Ok(()) } - set_topic { + #[benchmark] + fn set_topic() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); let instruction = Instruction::SetTopic([1; 32]); let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.topic(), &Some([1; 32])); + Ok(()) } - clear_topic { + #[benchmark] + fn clear_topic() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); executor.set_topic(Some([2; 32])); let instruction = Instruction::ClearTopic; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.topic(), &None); + Ok(()) } - exchange_asset { + #[benchmark] + fn exchange_asset() -> Result<(), BenchmarkError> { let (give, want) = T::worst_case_asset_exchange().map_err(|_| BenchmarkError::Skip)?; let assets = give.clone(); let mut executor = new_executor::(Default::default()); executor.set_holding(give.into()); - let instruction = Instruction::ExchangeAsset { - give: assets.into(), - want: want.clone(), - maximal: true, - }; + let instruction = + Instruction::ExchangeAsset { give: assets.into(), want: want.clone(), maximal: true }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.holding(), &want.into()); + Ok(()) } - universal_origin { + #[benchmark] + fn universal_origin() -> Result<(), BenchmarkError> { let (origin, alias) = T::universal_alias().map_err(|_| BenchmarkError::Skip)?; let mut executor = new_executor::(origin); let instruction = Instruction::UniversalOrigin(alias); let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } use frame_support::traits::Get; let universal_location = ::UniversalLocation::get(); - assert_eq!(executor.origin(), &Some(Junctions::from([alias]).relative_to(&universal_location))); + assert_eq!( + executor.origin(), + &Some(Junctions::from([alias]).relative_to(&universal_location)) + ); + + Ok(()) } - export_message { - let x in 1 .. 1000; + #[benchmark] + fn export_message(x: Linear<1, 1000>) -> Result<(), BenchmarkError> { // The `inner_xcm` influences `ExportMessage` total weight based on // `inner_xcm.encoded_size()`, so for this benchmark use smallest encoded instruction // to approximate weight per "unit" of encoded size; then actual weight can be estimated @@ -616,11 +732,12 @@ benchmarks! { // Get `origin`, `network` and `destination` from configured runtime. let (origin, network, destination) = T::export_message_origin_and_destination()?; - let (expected_fees_mode, expected_assets_in_holding) = T::DeliveryHelper::ensure_successful_delivery( - &origin, - &destination.clone().into(), - FeeReason::Export { network, destination: destination.clone() }, - ); + let (expected_fees_mode, expected_assets_in_holding) = + T::DeliveryHelper::ensure_successful_delivery( + &origin, + &destination.clone().into(), + FeeReason::Export { network, destination: destination.clone() }, + ); let sender_account = T::AccountIdConverter::convert_location(&origin).unwrap(); let sender_account_balance_before = T::TransactAsset::balance(&sender_account); @@ -631,37 +748,39 @@ benchmarks! { if let Some(expected_assets_in_holding) = expected_assets_in_holding { executor.set_holding(expected_assets_in_holding.into()); } - let xcm = Xcm(vec![ExportMessage { - network, destination: destination.clone(), xcm: inner_xcm, - }]); - }: { - executor.bench_process(xcm)?; - } verify { + let xcm = + Xcm(vec![ExportMessage { network, destination: destination.clone(), xcm: inner_xcm }]); + #[block] + { + executor.bench_process(xcm)?; + } // Check we charged the delivery fees assert!(T::TransactAsset::balance(&sender_account) <= sender_account_balance_before); // TODO: Potentially add new trait to XcmSender to detect a queued outgoing message. #4426 + Ok(()) } - set_fees_mode { + #[benchmark] + fn set_fees_mode() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); executor.set_fees_mode(FeesMode { jit_withdraw: false }); let instruction = Instruction::SetFeesMode { jit_withdraw: true }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.fees_mode(), &FeesMode { jit_withdraw: true }); + Ok(()) } - lock_asset { + #[benchmark] + fn lock_asset() -> Result<(), BenchmarkError> { let (unlocker, owner, asset) = T::unlockable_asset()?; - let (expected_fees_mode, expected_assets_in_holding) = T::DeliveryHelper::ensure_successful_delivery( - &owner, - &unlocker, - FeeReason::LockAsset, - ); + let (expected_fees_mode, expected_assets_in_holding) = + T::DeliveryHelper::ensure_successful_delivery(&owner, &unlocker, FeeReason::LockAsset); let sender_account = T::AccountIdConverter::convert_location(&owner).unwrap(); let sender_account_balance_before = T::TransactAsset::balance(&sender_account); @@ -681,15 +800,18 @@ benchmarks! { let instruction = Instruction::LockAsset { asset, unlocker }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } // Check delivery fees assert!(T::TransactAsset::balance(&sender_account) <= sender_account_balance_before); // TODO: Potentially add new trait to XcmSender to detect a queued outgoing message. #4426 + Ok(()) } - unlock_asset { + #[benchmark] + fn unlock_asset() -> Result<(), BenchmarkError> { use xcm_executor::traits::{AssetLock, Enact}; let (unlocker, owner, asset) = T::unlockable_asset()?; @@ -709,13 +831,15 @@ benchmarks! { // ... then unlock them with the UnlockAsset instruction. let instruction = Instruction::UnlockAsset { asset, target: owner }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { - + #[block] + { + executor.bench_process(xcm)?; + } + Ok(()) } - note_unlockable { + #[benchmark] + fn note_unlockable() -> Result<(), BenchmarkError> { use xcm_executor::traits::{AssetLock, Enact}; let (unlocker, owner, asset) = T::unlockable_asset()?; @@ -735,13 +859,15 @@ benchmarks! { // ... then note them as unlockable with the NoteUnlockable instruction. let instruction = Instruction::NoteUnlockable { asset, owner }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { - + #[block] + { + executor.bench_process(xcm)?; + } + Ok(()) } - request_unlock { + #[benchmark] + fn request_unlock() -> Result<(), BenchmarkError> { use xcm_executor::traits::{AssetLock, Enact}; let (locker, owner, asset) = T::unlockable_asset()?; @@ -756,11 +882,12 @@ benchmarks! { .enact() .map_err(|_| BenchmarkError::Skip)?; - let (expected_fees_mode, expected_assets_in_holding) = T::DeliveryHelper::ensure_successful_delivery( - &owner, - &locker, - FeeReason::RequestUnlock, - ); + let (expected_fees_mode, expected_assets_in_holding) = + T::DeliveryHelper::ensure_successful_delivery( + &owner, + &locker, + FeeReason::RequestUnlock, + ); let sender_account = T::AccountIdConverter::convert_location(&owner).unwrap(); let sender_account_balance_before = T::TransactAsset::balance(&sender_account); @@ -774,15 +901,18 @@ benchmarks! { } let instruction = Instruction::RequestUnlock { asset, locker }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } // Check we charged the delivery fees assert!(T::TransactAsset::balance(&sender_account) <= sender_account_balance_before); // TODO: Potentially add new trait to XcmSender to detect a queued outgoing message. #4426 + Ok(()) } - unpaid_execution { + #[benchmark] + fn unpaid_execution() -> Result<(), BenchmarkError> { let mut executor = new_executor::(Default::default()); executor.set_origin(Some(Here.into())); @@ -792,21 +922,27 @@ benchmarks! { }; let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; + #[block] + { + executor.bench_process(xcm)?; + } + Ok(()) } - alias_origin { + #[benchmark] + fn alias_origin() -> Result<(), BenchmarkError> { let (origin, target) = T::alias_origin().map_err(|_| BenchmarkError::Skip)?; let mut executor = new_executor::(origin); let instruction = Instruction::AliasOrigin(target.clone()); let xcm = Xcm(vec![instruction]); - }: { - executor.bench_process(xcm)?; - } verify { + #[block] + { + executor.bench_process(xcm)?; + } assert_eq!(executor.origin(), &Some(target)); + Ok(()) } impl_benchmark_test_suite!( From fdb264d0df6fdbed32f001ba43c3282a01dd3d65 Mon Sep 17 00:00:00 2001 From: Ludovic_Domingues Date: Thu, 28 Nov 2024 17:18:30 +0100 Subject: [PATCH 42/64] Migrating pallet-state-trie-migration to benchmarking V2 (#6617) # Description Migrated pallet-state-trie-migration benchmarking to the new benchmarking syntax v2. This is part of #6202 Co-authored-by: Shawn Tabrizi Co-authored-by: Giuseppe Re --- .../frame/state-trie-migration/src/lib.rs | 176 +++++++++++------- 1 file changed, 108 insertions(+), 68 deletions(-) diff --git a/substrate/frame/state-trie-migration/src/lib.rs b/substrate/frame/state-trie-migration/src/lib.rs index 3fe5abb81031..61323b70b33d 100644 --- a/substrate/frame/state-trie-migration/src/lib.rs +++ b/substrate/frame/state-trie-migration/src/lib.rs @@ -249,13 +249,13 @@ pub mod pallet { if limits.item.is_zero() || limits.size.is_zero() { // handle this minor edge case, else we would call `migrate_tick` at least once. log!(warn, "limits are zero. stopping"); - return Ok(()) + return Ok(()); } while !self.exhausted(limits) && !self.finished() { if let Err(e) = self.migrate_tick() { log!(error, "migrate_until_exhaustion failed: {:?}", e); - return Err(e) + return Err(e); } } @@ -332,7 +332,7 @@ pub mod pallet { _ => { // defensive: there must be an ongoing top migration. frame_support::defensive!("cannot migrate child key."); - return Ok(()) + return Ok(()); }, }; @@ -374,7 +374,7 @@ pub mod pallet { Progress::Complete => { // defensive: there must be an ongoing top migration. frame_support::defensive!("cannot migrate top key."); - return Ok(()) + return Ok(()); }, }; @@ -669,7 +669,7 @@ pub mod pallet { // ensure that the migration witness data was correct. if real_size_upper < task.dyn_size { Self::slash(who, deposit)?; - return Ok(().into()) + return Ok(().into()); } Self::deposit_event(Event::::Migrated { @@ -957,6 +957,7 @@ pub mod pallet { mod benchmarks { use super::{pallet::Pallet as StateTrieMigration, *}; use alloc::vec; + use frame_benchmarking::v2::*; use frame_support::traits::fungible::{Inspect, Mutate}; // The size of the key seemingly makes no difference in the read/write time, so we make it @@ -970,8 +971,12 @@ mod benchmarks { stash } - frame_benchmarking::benchmarks! { - continue_migrate { + #[benchmarks] + mod inner_benchmarks { + use super::*; + + #[benchmark] + fn continue_migrate() -> Result<(), BenchmarkError> { // note that this benchmark should migrate nothing, as we only want the overhead weight // of the bookkeeping, and the migration cost itself is noted via the `dynamic_weight` // function. @@ -980,116 +985,151 @@ mod benchmarks { let stash = set_balance_for_deposit::(&caller, null.item); // Allow signed migrations. SignedMigrationMaxLimits::::put(MigrationLimits { size: 1024, item: 5 }); - }: _(frame_system::RawOrigin::Signed(caller.clone()), null, 0, StateTrieMigration::::migration_process()) - verify { + + #[extrinsic_call] + _( + frame_system::RawOrigin::Signed(caller.clone()), + null, + 0, + StateTrieMigration::::migration_process(), + ); + assert_eq!(StateTrieMigration::::migration_process(), Default::default()); - assert_eq!(T::Currency::balance(&caller), stash) + assert_eq!(T::Currency::balance(&caller), stash); + + Ok(()) } - continue_migrate_wrong_witness { + #[benchmark] + fn continue_migrate_wrong_witness() -> Result<(), BenchmarkError> { let null = MigrationLimits::default(); let caller = frame_benchmarking::whitelisted_caller(); - let bad_witness = MigrationTask { progress_top: Progress::LastKey(vec![1u8].try_into().unwrap()), ..Default::default() }; - }: { - assert!( - StateTrieMigration::::continue_migrate( + let bad_witness = MigrationTask { + progress_top: Progress::LastKey(vec![1u8].try_into().unwrap()), + ..Default::default() + }; + #[block] + { + assert!(StateTrieMigration::::continue_migrate( frame_system::RawOrigin::Signed(caller).into(), null, 0, bad_witness, ) - .is_err() - ) - } - verify { - assert_eq!(StateTrieMigration::::migration_process(), Default::default()) + .is_err()); + } + + assert_eq!(StateTrieMigration::::migration_process(), Default::default()); + + Ok(()) } - migrate_custom_top_success { + #[benchmark] + fn migrate_custom_top_success() -> Result<(), BenchmarkError> { let null = MigrationLimits::default(); let caller: T::AccountId = frame_benchmarking::whitelisted_caller(); let stash = set_balance_for_deposit::(&caller, null.item); - }: migrate_custom_top(frame_system::RawOrigin::Signed(caller.clone()), Default::default(), 0) - verify { + #[extrinsic_call] + migrate_custom_top( + frame_system::RawOrigin::Signed(caller.clone()), + Default::default(), + 0, + ); + assert_eq!(StateTrieMigration::::migration_process(), Default::default()); - assert_eq!(T::Currency::balance(&caller), stash) + assert_eq!(T::Currency::balance(&caller), stash); + Ok(()) } - migrate_custom_top_fail { + #[benchmark] + fn migrate_custom_top_fail() -> Result<(), BenchmarkError> { let null = MigrationLimits::default(); let caller: T::AccountId = frame_benchmarking::whitelisted_caller(); let stash = set_balance_for_deposit::(&caller, null.item); // for tests, we need to make sure there is _something_ in storage that is being // migrated. - sp_io::storage::set(b"foo", vec![1u8;33].as_ref()); - }: { - assert!( - StateTrieMigration::::migrate_custom_top( + sp_io::storage::set(b"foo", vec![1u8; 33].as_ref()); + #[block] + { + assert!(StateTrieMigration::::migrate_custom_top( frame_system::RawOrigin::Signed(caller.clone()).into(), vec![b"foo".to_vec()], 1, - ).is_ok() - ); + ) + .is_ok()); + + frame_system::Pallet::::assert_last_event( + ::RuntimeEvent::from(crate::Event::Slashed { + who: caller.clone(), + amount: StateTrieMigration::::calculate_deposit_for(1u32), + }) + .into(), + ); + } - frame_system::Pallet::::assert_last_event( - ::RuntimeEvent::from(crate::Event::Slashed { - who: caller.clone(), - amount: StateTrieMigration::::calculate_deposit_for(1u32), - }).into(), - ); - } - verify { assert_eq!(StateTrieMigration::::migration_process(), Default::default()); // must have gotten slashed - assert!(T::Currency::balance(&caller) < stash) + assert!(T::Currency::balance(&caller) < stash); + + Ok(()) } - migrate_custom_child_success { + #[benchmark] + fn migrate_custom_child_success() -> Result<(), BenchmarkError> { let caller: T::AccountId = frame_benchmarking::whitelisted_caller(); let stash = set_balance_for_deposit::(&caller, 0); - }: migrate_custom_child( - frame_system::RawOrigin::Signed(caller.clone()), - StateTrieMigration::::childify(Default::default()), - Default::default(), - 0 - ) - verify { + + #[extrinsic_call] + migrate_custom_child( + frame_system::RawOrigin::Signed(caller.clone()), + StateTrieMigration::::childify(Default::default()), + Default::default(), + 0, + ); + assert_eq!(StateTrieMigration::::migration_process(), Default::default()); assert_eq!(T::Currency::balance(&caller), stash); + + Ok(()) } - migrate_custom_child_fail { + #[benchmark] + fn migrate_custom_child_fail() -> Result<(), BenchmarkError> { let caller: T::AccountId = frame_benchmarking::whitelisted_caller(); let stash = set_balance_for_deposit::(&caller, 1); // for tests, we need to make sure there is _something_ in storage that is being // migrated. - sp_io::default_child_storage::set(b"top", b"foo", vec![1u8;33].as_ref()); - }: { - assert!( - StateTrieMigration::::migrate_custom_child( + sp_io::default_child_storage::set(b"top", b"foo", vec![1u8; 33].as_ref()); + + #[block] + { + assert!(StateTrieMigration::::migrate_custom_child( frame_system::RawOrigin::Signed(caller.clone()).into(), StateTrieMigration::::childify("top"), vec![b"foo".to_vec()], 1, - ).is_ok() - ) - } - verify { + ) + .is_ok()); + } assert_eq!(StateTrieMigration::::migration_process(), Default::default()); // must have gotten slashed - assert!(T::Currency::balance(&caller) < stash) + assert!(T::Currency::balance(&caller) < stash); + Ok(()) } - process_top_key { - let v in 1 .. (4 * 1024 * 1024); - + #[benchmark] + fn process_top_key(v: Linear<1, { 4 * 1024 * 1024 }>) -> Result<(), BenchmarkError> { let value = alloc::vec![1u8; v as usize]; sp_io::storage::set(KEY, &value); - }: { - let data = sp_io::storage::get(KEY).unwrap(); - sp_io::storage::set(KEY, &data); - let _next = sp_io::storage::next_key(KEY); - assert_eq!(data, value); + #[block] + { + let data = sp_io::storage::get(KEY).unwrap(); + sp_io::storage::set(KEY, &data); + let _next = sp_io::storage::next_key(KEY); + assert_eq!(data, value); + } + + Ok(()) } impl_benchmark_test_suite!( @@ -1741,7 +1781,7 @@ pub(crate) mod remote_tests { let ((finished, weight), proof) = ext.execute_and_prove(|| { let weight = run_to_block::(now + One::one()).1; if StateTrieMigration::::migration_process().finished() { - return (true, weight) + return (true, weight); } duration += One::one(); now += One::one(); @@ -1768,7 +1808,7 @@ pub(crate) mod remote_tests { ext.commit_all().unwrap(); if finished { - break + break; } } From 6416b280a7d0032ba3c265e4506504c6d6536637 Mon Sep 17 00:00:00 2001 From: Cyrill Leutwiler Date: Thu, 28 Nov 2024 19:01:41 +0100 Subject: [PATCH 43/64] [pallet-revive] bugfix decoding 64bit args in the decoder (#6695) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit The argument index of the next argument is dictated by the size of the current one. --------- Signed-off-by: xermicus Co-authored-by: GitHub Action Co-authored-by: Alexander Theißen --- prdoc/pr_6695.prdoc | 8 ++++++++ substrate/frame/revive/proc-macro/src/lib.rs | 4 +++- 2 files changed, 11 insertions(+), 1 deletion(-) create mode 100644 prdoc/pr_6695.prdoc diff --git a/prdoc/pr_6695.prdoc b/prdoc/pr_6695.prdoc new file mode 100644 index 000000000000..7a950e8546cd --- /dev/null +++ b/prdoc/pr_6695.prdoc @@ -0,0 +1,8 @@ +title: '[pallet-revive] bugfix decoding 64bit args in the decoder' +doc: +- audience: Runtime Dev + description: The argument index of the next argument is dictated by the size of + the current one. +crates: +- name: pallet-revive-proc-macro + bump: patch diff --git a/substrate/frame/revive/proc-macro/src/lib.rs b/substrate/frame/revive/proc-macro/src/lib.rs index 012b4bfab9a9..7232c6342824 100644 --- a/substrate/frame/revive/proc-macro/src/lib.rs +++ b/substrate/frame/revive/proc-macro/src/lib.rs @@ -342,7 +342,8 @@ where const ALLOWED_REGISTERS: u32 = 6; let mut registers_used = 0; let mut bindings = vec![]; - for (idx, (name, ty)) in param_names.clone().zip(param_types.clone()).enumerate() { + let mut idx = 0; + for (name, ty) in param_names.clone().zip(param_types.clone()) { let syn::Type::Path(path) = &**ty else { panic!("Type needs to be path"); }; @@ -380,6 +381,7 @@ where } }; bindings.push(binding); + idx += size; } quote! { #( #bindings )* From 72fb8bd3cd4a5051bb855415b360657d7ce247fb Mon Sep 17 00:00:00 2001 From: Rodrigo Quelhas <22591718+RomarQ@users.noreply.github.com> Date: Fri, 29 Nov 2024 10:33:46 +0000 Subject: [PATCH 44/64] Expose types from `sc-service` (#5855) # Description At moonbeam we have worked on a `lazy-loading` feature which is a client mode that forks a live parachain and fetches its state on-demand, we have been able to do this by duplicating some code from `sc_service::client`. The objective of this PR is to simplify the implementation by making public some types in polkadot-sdk. - Modules: - `sc_service::client` **I do not see a point to only expose this type when `test-helpers` feature is enabled** ## Integration Not applicable, the PR just makes some types public. ## Review Notes The changes included in this PR give more flexibility for client developers by exposing important types. --- prdoc/pr_5855.prdoc | 15 +++++++ substrate/bin/node/testing/Cargo.toml | 2 +- substrate/client/network/test/Cargo.toml | 2 +- substrate/client/rpc-spec-v2/Cargo.toml | 2 +- .../src/chain_head/subscription/inner.rs | 6 +-- .../rpc-spec-v2/src/chain_head/tests.rs | 6 +-- substrate/client/service/Cargo.toml | 2 - substrate/client/service/src/client/client.rs | 40 +------------------ substrate/client/service/src/client/mod.rs | 3 +- substrate/client/service/src/lib.rs | 5 +-- substrate/client/service/test/Cargo.toml | 2 +- .../client/service/test/src/client/mod.rs | 6 +-- substrate/test-utils/client/Cargo.toml | 4 +- substrate/test-utils/runtime/Cargo.toml | 2 +- 14 files changed, 34 insertions(+), 63 deletions(-) create mode 100644 prdoc/pr_5855.prdoc diff --git a/prdoc/pr_5855.prdoc b/prdoc/pr_5855.prdoc new file mode 100644 index 000000000000..7735cfee9f37 --- /dev/null +++ b/prdoc/pr_5855.prdoc @@ -0,0 +1,15 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: Remove feature `test-helpers` from sc-service + +doc: + - audience: Node Dev + description: | + Removes feature `test-helpers` from sc-service. + +crates: + - name: sc-service + bump: major + - name: sc-rpc-spec-v2 + bump: major diff --git a/substrate/bin/node/testing/Cargo.toml b/substrate/bin/node/testing/Cargo.toml index 16112386ad7c..1972c03a368b 100644 --- a/substrate/bin/node/testing/Cargo.toml +++ b/substrate/bin/node/testing/Cargo.toml @@ -37,7 +37,7 @@ sc-client-api = { workspace = true, default-features = true } sc-client-db = { features = ["rocksdb"], workspace = true, default-features = true } sc-consensus = { workspace = true, default-features = true } sc-executor = { workspace = true, default-features = true } -sc-service = { features = ["rocksdb", "test-helpers"], workspace = true, default-features = true } +sc-service = { features = ["rocksdb"], workspace = true, default-features = true } sp-api = { workspace = true, default-features = true } sp-block-builder = { workspace = true, default-features = true } sp-blockchain = { workspace = true, default-features = true } diff --git a/substrate/client/network/test/Cargo.toml b/substrate/client/network/test/Cargo.toml index ebece1762f29..6340d1dfb2f4 100644 --- a/substrate/client/network/test/Cargo.toml +++ b/substrate/client/network/test/Cargo.toml @@ -33,7 +33,7 @@ sc-network-types = { workspace = true, default-features = true } sc-utils = { workspace = true, default-features = true } sc-network-light = { workspace = true, default-features = true } sc-network-sync = { workspace = true, default-features = true } -sc-service = { features = ["test-helpers"], workspace = true } +sc-service = { workspace = true } sp-blockchain = { workspace = true, default-features = true } sp-consensus = { workspace = true, default-features = true } sp-core = { workspace = true, default-features = true } diff --git a/substrate/client/rpc-spec-v2/Cargo.toml b/substrate/client/rpc-spec-v2/Cargo.toml index b304bc905925..70f68436767f 100644 --- a/substrate/client/rpc-spec-v2/Cargo.toml +++ b/substrate/client/rpc-spec-v2/Cargo.toml @@ -56,7 +56,7 @@ sp-consensus = { workspace = true, default-features = true } sp-externalities = { workspace = true, default-features = true } sp-maybe-compressed-blob = { workspace = true, default-features = true } sc-block-builder = { workspace = true, default-features = true } -sc-service = { features = ["test-helpers"], workspace = true, default-features = true } +sc-service = { workspace = true, default-features = true } sc-rpc = { workspace = true, default-features = true, features = ["test-helpers"] } assert_matches = { workspace = true } pretty_assertions = { workspace = true } diff --git a/substrate/client/rpc-spec-v2/src/chain_head/subscription/inner.rs b/substrate/client/rpc-spec-v2/src/chain_head/subscription/inner.rs index 95a7c7fe1832..3e1bd23776d3 100644 --- a/substrate/client/rpc-spec-v2/src/chain_head/subscription/inner.rs +++ b/substrate/client/rpc-spec-v2/src/chain_head/subscription/inner.rs @@ -784,7 +784,7 @@ mod tests { use super::*; use jsonrpsee::ConnectionId; use sc_block_builder::BlockBuilderBuilder; - use sc_service::client::new_in_mem; + use sc_service::client::new_with_backend; use sp_consensus::BlockOrigin; use sp_core::{testing::TaskExecutor, H256}; use substrate_test_runtime_client::{ @@ -811,13 +811,13 @@ mod tests { ) .unwrap(); let client = Arc::new( - new_in_mem::<_, Block, _, RuntimeApi>( + new_with_backend::<_, _, Block, _, RuntimeApi>( backend.clone(), executor, genesis_block_builder, + Box::new(TaskExecutor::new()), None, None, - Box::new(TaskExecutor::new()), client_config, ) .unwrap(), diff --git a/substrate/client/rpc-spec-v2/src/chain_head/tests.rs b/substrate/client/rpc-spec-v2/src/chain_head/tests.rs index c505566d887d..21e8365622a1 100644 --- a/substrate/client/rpc-spec-v2/src/chain_head/tests.rs +++ b/substrate/client/rpc-spec-v2/src/chain_head/tests.rs @@ -34,7 +34,7 @@ use jsonrpsee::{ use sc_block_builder::BlockBuilderBuilder; use sc_client_api::ChildInfo; use sc_rpc::testing::TokioTestExecutor; -use sc_service::client::new_in_mem; +use sc_service::client::new_with_backend; use sp_blockchain::HeaderBackend; use sp_consensus::BlockOrigin; use sp_core::{ @@ -2547,13 +2547,13 @@ async fn pin_block_references() { .unwrap(); let client = Arc::new( - new_in_mem::<_, Block, _, RuntimeApi>( + new_with_backend::<_, _, Block, _, RuntimeApi>( backend.clone(), executor, genesis_block_builder, + Box::new(TokioTestExecutor::default()), None, None, - Box::new(TokioTestExecutor::default()), client_config, ) .unwrap(), diff --git a/substrate/client/service/Cargo.toml b/substrate/client/service/Cargo.toml index f2fc65ef2439..3981395d9768 100644 --- a/substrate/client/service/Cargo.toml +++ b/substrate/client/service/Cargo.toml @@ -20,8 +20,6 @@ default = ["rocksdb"] # The RocksDB feature activates the RocksDB database backend. If it is not activated, and you pass # a path to a database, an error will be produced at runtime. rocksdb = ["sc-client-db/rocksdb"] -# exposes the client type -test-helpers = [] runtime-benchmarks = [ "sc-client-db/runtime-benchmarks", "sp-runtime/runtime-benchmarks", diff --git a/substrate/client/service/src/client/client.rs b/substrate/client/service/src/client/client.rs index ce5b92551bf2..eddbb9260c05 100644 --- a/substrate/client/service/src/client/client.rs +++ b/substrate/client/service/src/client/client.rs @@ -85,10 +85,8 @@ use std::{ sync::Arc, }; -#[cfg(feature = "test-helpers")] -use { - super::call_executor::LocalCallExecutor, sc_client_api::in_mem, sp_core::traits::CodeExecutor, -}; +use super::call_executor::LocalCallExecutor; +use sp_core::traits::CodeExecutor; type NotificationSinks = Mutex>>; @@ -152,39 +150,6 @@ enum PrepareStorageChangesResult { Discard(ImportResult), Import(Option>), } - -/// Create an instance of in-memory client. -#[cfg(feature = "test-helpers")] -pub fn new_in_mem( - backend: Arc>, - executor: E, - genesis_block_builder: G, - prometheus_registry: Option, - telemetry: Option, - spawn_handle: Box, - config: ClientConfig, -) -> sp_blockchain::Result< - Client, LocalCallExecutor, E>, Block, RA>, -> -where - E: CodeExecutor + sc_executor::RuntimeVersionOf, - Block: BlockT, - G: BuildGenesisBlock< - Block, - BlockImportOperation = as backend::Backend>::BlockImportOperation, - >, -{ - new_with_backend( - backend, - executor, - genesis_block_builder, - spawn_handle, - prometheus_registry, - telemetry, - config, - ) -} - /// Client configuration items. #[derive(Debug, Clone)] pub struct ClientConfig { @@ -218,7 +183,6 @@ impl Default for ClientConfig { /// Create a client with the explicitly provided backend. /// This is useful for testing backend implementations. -#[cfg(feature = "test-helpers")] pub fn new_with_backend( backend: Arc, executor: E, diff --git a/substrate/client/service/src/client/mod.rs b/substrate/client/service/src/client/mod.rs index ec77a92f162f..3020b3d296f4 100644 --- a/substrate/client/service/src/client/mod.rs +++ b/substrate/client/service/src/client/mod.rs @@ -56,5 +56,4 @@ pub use call_executor::LocalCallExecutor; pub use client::{Client, ClientConfig}; pub(crate) use code_provider::CodeProvider; -#[cfg(feature = "test-helpers")] -pub use self::client::{new_in_mem, new_with_backend}; +pub use self::client::new_with_backend; diff --git a/substrate/client/service/src/lib.rs b/substrate/client/service/src/lib.rs index 9c01d7288a81..b5a38d875e3b 100644 --- a/substrate/client/service/src/lib.rs +++ b/substrate/client/service/src/lib.rs @@ -23,14 +23,11 @@ #![recursion_limit = "1024"] pub mod chain_ops; +pub mod client; pub mod config; pub mod error; mod builder; -#[cfg(feature = "test-helpers")] -pub mod client; -#[cfg(not(feature = "test-helpers"))] -mod client; mod metrics; mod task_manager; diff --git a/substrate/client/service/test/Cargo.toml b/substrate/client/service/test/Cargo.toml index 0edfc5b19314..632b98104f6b 100644 --- a/substrate/client/service/test/Cargo.toml +++ b/substrate/client/service/test/Cargo.toml @@ -31,7 +31,7 @@ sc-consensus = { workspace = true, default-features = true } sc-executor = { workspace = true, default-features = true } sc-network = { workspace = true, default-features = true } sc-network-sync = { workspace = true, default-features = true } -sc-service = { features = ["test-helpers"], workspace = true, default-features = true } +sc-service = { workspace = true, default-features = true } sc-transaction-pool-api = { workspace = true, default-features = true } sp-api = { workspace = true, default-features = true } sp-blockchain = { workspace = true, default-features = true } diff --git a/substrate/client/service/test/src/client/mod.rs b/substrate/client/service/test/src/client/mod.rs index 55bbfcdd8594..ead90c4c65d8 100644 --- a/substrate/client/service/test/src/client/mod.rs +++ b/substrate/client/service/test/src/client/mod.rs @@ -29,7 +29,7 @@ use sc_consensus::{ BlockCheckParams, BlockImport, BlockImportParams, ForkChoiceStrategy, ImportResult, }; use sc_executor::WasmExecutor; -use sc_service::client::{new_in_mem, Client, LocalCallExecutor}; +use sc_service::client::{new_with_backend, Client, LocalCallExecutor}; use sp_api::ProvideRuntimeApi; use sp_consensus::{BlockOrigin, Error as ConsensusError, SelectChain}; use sp_core::{testing::TaskExecutor, traits::CallContext, H256}; @@ -2087,13 +2087,13 @@ fn cleans_up_closed_notification_sinks_on_block_import() { // NOTE: we need to build the client here instead of using the client // provided by test_runtime_client otherwise we can't access the private // `import_notification_sinks` and `finality_notification_sinks` fields. - let mut client = new_in_mem::<_, Block, _, RuntimeApi>( + let mut client = new_with_backend::<_, _, Block, _, RuntimeApi>( backend, executor, genesis_block_builder, + Box::new(TaskExecutor::new()), None, None, - Box::new(TaskExecutor::new()), client_config, ) .unwrap(); diff --git a/substrate/test-utils/client/Cargo.toml b/substrate/test-utils/client/Cargo.toml index ebd1eab5980d..a67c91fc5f79 100644 --- a/substrate/test-utils/client/Cargo.toml +++ b/substrate/test-utils/client/Cargo.toml @@ -29,9 +29,7 @@ sc-client-db = { features = [ sc-consensus = { workspace = true, default-features = true } sc-executor = { workspace = true, default-features = true } sc-offchain = { workspace = true, default-features = true } -sc-service = { features = [ - "test-helpers", -], workspace = true } +sc-service = { workspace = true } sp-blockchain = { workspace = true, default-features = true } sp-consensus = { workspace = true, default-features = true } sp-core = { workspace = true, default-features = true } diff --git a/substrate/test-utils/runtime/Cargo.toml b/substrate/test-utils/runtime/Cargo.toml index 1c82c73072bc..96a888052876 100644 --- a/substrate/test-utils/runtime/Cargo.toml +++ b/substrate/test-utils/runtime/Cargo.toml @@ -45,7 +45,7 @@ sp-consensus-grandpa = { features = ["serde"], workspace = true } sp-trie = { workspace = true } sp-transaction-pool = { workspace = true } trie-db = { workspace = true } -sc-service = { features = ["test-helpers"], optional = true, workspace = true } +sc-service = { optional = true, workspace = true } sp-state-machine = { workspace = true } sp-externalities = { workspace = true } From 1dd21bcc1406e0f07f70e604f9cef4dc2115c989 Mon Sep 17 00:00:00 2001 From: Alexander Samusev <41779041+alvicsam@users.noreply.github.com> Date: Fri, 29 Nov 2024 12:00:52 +0100 Subject: [PATCH 45/64] ci: update nightly in ci-unified to 2024-11-19 (#6691) cc https://github.com/paritytech/ci_cd/issues/1088 --- .github/env | 2 +- .gitlab-ci.yml | 2 +- docs/contributor/container.md | 2 +- 3 files changed, 3 insertions(+), 3 deletions(-) diff --git a/.github/env b/.github/env index bb61e1f4cd99..730c37f1db80 100644 --- a/.github/env +++ b/.github/env @@ -1 +1 @@ -IMAGE="docker.io/paritytech/ci-unified:bullseye-1.81.0-2024-09-11-v202409111034" +IMAGE="docker.io/paritytech/ci-unified:bullseye-1.81.0-2024-11-19-v202411281558" diff --git a/.gitlab-ci.yml b/.gitlab-ci.yml index f508404f1efa..42a7e87bda43 100644 --- a/.gitlab-ci.yml +++ b/.gitlab-ci.yml @@ -22,7 +22,7 @@ workflow: variables: # CI_IMAGE: !reference [ .ci-unified, variables, CI_IMAGE ] - CI_IMAGE: "docker.io/paritytech/ci-unified:bullseye-1.81.0-2024-09-11-v202409111034" + CI_IMAGE: "docker.io/paritytech/ci-unified:bullseye-1.81.0-2024-11-19-v202411281558" # BUILDAH_IMAGE is defined in group variables BUILDAH_COMMAND: "buildah --storage-driver overlay2" RELENG_SCRIPTS_BRANCH: "master" diff --git a/docs/contributor/container.md b/docs/contributor/container.md index ec51b8b9d7cc..e387f568d7b5 100644 --- a/docs/contributor/container.md +++ b/docs/contributor/container.md @@ -24,7 +24,7 @@ The command below allows building a Linux binary without having to even install docker run --rm -it \ -w /polkadot-sdk \ -v $(pwd):/polkadot-sdk \ - docker.io/paritytech/ci-unified:bullseye-1.77.0-2024-04-10-v20240408 \ + docker.io/paritytech/ci-unified:bullseye-1.81.0-2024-11-19-v202411281558 \ cargo build --release --locked -p polkadot-parachain-bin --bin polkadot-parachain sudo chown -R $(id -u):$(id -g) target/ ``` From b3ab312724ee8c3a0c7f3d9b5ea6c98513b5c951 Mon Sep 17 00:00:00 2001 From: Xavier Lau Date: Fri, 29 Nov 2024 20:02:59 +0800 Subject: [PATCH 46/64] Migrate pallet-preimage to benchmark v2 (#6277) Part of: - #6202. --------- Co-authored-by: Giuseppe Re Co-authored-by: command-bot <> --- substrate/frame/preimage/src/benchmarking.rs | 296 ++++++++++--------- substrate/frame/preimage/src/weights.rs | 150 +++++----- 2 files changed, 231 insertions(+), 215 deletions(-) diff --git a/substrate/frame/preimage/src/benchmarking.rs b/substrate/frame/preimage/src/benchmarking.rs index 3d0c5b900579..ea635bf3ef77 100644 --- a/substrate/frame/preimage/src/benchmarking.rs +++ b/substrate/frame/preimage/src/benchmarking.rs @@ -17,14 +17,13 @@ //! Preimage pallet benchmarking. -use super::*; use alloc::vec; -use frame_benchmarking::v1::{account, benchmarks, whitelisted_caller, BenchmarkError}; +use frame_benchmarking::v2::*; use frame_support::assert_ok; use frame_system::RawOrigin; use sp_runtime::traits::Bounded; -use crate::Pallet as Preimage; +use crate::*; fn funded_account() -> T::AccountId { let caller: T::AccountId = whitelisted_caller(); @@ -43,206 +42,225 @@ fn sized_preimage_and_hash(size: u32) -> (Vec, T::Hash) { (preimage, hash) } -benchmarks! { +fn insert_old_unrequested(s: u32) -> ::Hash { + let acc = account("old", s, 0); + T::Currency::make_free_balance_be(&acc, BalanceOf::::max_value() / 2u32.into()); + + // The preimage size does not matter here as it is not touched. + let preimage = s.to_le_bytes(); + let hash = ::Hashing::hash(&preimage[..]); + + #[allow(deprecated)] + StatusFor::::insert( + &hash, + OldRequestStatus::Unrequested { deposit: (acc, 123u32.into()), len: preimage.len() as u32 }, + ); + hash +} + +#[benchmarks] +mod benchmarks { + use super::*; + // Expensive note - will reserve. - note_preimage { - let s in 0 .. MAX_SIZE; + #[benchmark] + fn note_preimage(s: Linear<0, MAX_SIZE>) { let caller = funded_account::(); let (preimage, hash) = sized_preimage_and_hash::(s); - }: _(RawOrigin::Signed(caller), preimage) - verify { - assert!(Preimage::::have_preimage(&hash)); + + #[extrinsic_call] + _(RawOrigin::Signed(caller), preimage); + + assert!(Pallet::::have_preimage(&hash)); } + // Cheap note - will not reserve since it was requested. - note_requested_preimage { - let s in 0 .. MAX_SIZE; + #[benchmark] + fn note_requested_preimage(s: Linear<0, MAX_SIZE>) { let caller = funded_account::(); let (preimage, hash) = sized_preimage_and_hash::(s); - assert_ok!(Preimage::::request_preimage( + assert_ok!(Pallet::::request_preimage( T::ManagerOrigin::try_successful_origin() .expect("ManagerOrigin has no successful origin required for the benchmark"), hash, )); - }: note_preimage(RawOrigin::Signed(caller), preimage) - verify { - assert!(Preimage::::have_preimage(&hash)); + + #[extrinsic_call] + note_preimage(RawOrigin::Signed(caller), preimage); + + assert!(Pallet::::have_preimage(&hash)); } + // Cheap note - will not reserve since it's the manager. - note_no_deposit_preimage { - let s in 0 .. MAX_SIZE; + #[benchmark] + fn note_no_deposit_preimage(s: Linear<0, MAX_SIZE>) { + let o = T::ManagerOrigin::try_successful_origin() + .expect("ManagerOrigin has no successful origin required for the benchmark"); let (preimage, hash) = sized_preimage_and_hash::(s); - assert_ok!(Preimage::::request_preimage( - T::ManagerOrigin::try_successful_origin() - .expect("ManagerOrigin has no successful origin required for the benchmark"), - hash, - )); - }: note_preimage( - T::ManagerOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?, - preimage - ) verify { - assert!(Preimage::::have_preimage(&hash)); + assert_ok!(Pallet::::request_preimage(o.clone(), hash,)); + + #[extrinsic_call] + note_preimage(o as T::RuntimeOrigin, preimage); + + assert!(Pallet::::have_preimage(&hash)); } // Expensive unnote - will unreserve. - unnote_preimage { + #[benchmark] + fn unnote_preimage() { let caller = funded_account::(); let (preimage, hash) = preimage_and_hash::(); - assert_ok!(Preimage::::note_preimage(RawOrigin::Signed(caller.clone()).into(), preimage)); - }: _(RawOrigin::Signed(caller), hash) - verify { - assert!(!Preimage::::have_preimage(&hash)); + assert_ok!(Pallet::::note_preimage(RawOrigin::Signed(caller.clone()).into(), preimage)); + + #[extrinsic_call] + _(RawOrigin::Signed(caller), hash); + + assert!(!Pallet::::have_preimage(&hash)); } + // Cheap unnote - will not unreserve since there's no deposit held. - unnote_no_deposit_preimage { + #[benchmark] + fn unnote_no_deposit_preimage() { + let o = T::ManagerOrigin::try_successful_origin() + .expect("ManagerOrigin has no successful origin required for the benchmark"); let (preimage, hash) = preimage_and_hash::(); - assert_ok!(Preimage::::note_preimage( - T::ManagerOrigin::try_successful_origin() - .expect("ManagerOrigin has no successful origin required for the benchmark"), - preimage, - )); - }: unnote_preimage( - T::ManagerOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?, - hash - ) verify { - assert!(!Preimage::::have_preimage(&hash)); + assert_ok!(Pallet::::note_preimage(o.clone(), preimage,)); + + #[extrinsic_call] + unnote_preimage(o as T::RuntimeOrigin, hash); + + assert!(!Pallet::::have_preimage(&hash)); } // Expensive request - will unreserve the noter's deposit. - request_preimage { + #[benchmark] + fn request_preimage() { + let o = T::ManagerOrigin::try_successful_origin() + .expect("ManagerOrigin has no successful origin required for the benchmark"); let (preimage, hash) = preimage_and_hash::(); let noter = funded_account::(); - assert_ok!(Preimage::::note_preimage(RawOrigin::Signed(noter.clone()).into(), preimage)); - }: _( - T::ManagerOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?, - hash - ) verify { - let ticket = TicketOf::::new(¬er, Footprint { count: 1, size: MAX_SIZE as u64 }).unwrap(); - let s = RequestStatus::Requested { maybe_ticket: Some((noter, ticket)), count: 1, maybe_len: Some(MAX_SIZE) }; + assert_ok!(Pallet::::note_preimage(RawOrigin::Signed(noter.clone()).into(), preimage)); + + #[extrinsic_call] + _(o as T::RuntimeOrigin, hash); + + let ticket = + TicketOf::::new(¬er, Footprint { count: 1, size: MAX_SIZE as u64 }).unwrap(); + let s = RequestStatus::Requested { + maybe_ticket: Some((noter, ticket)), + count: 1, + maybe_len: Some(MAX_SIZE), + }; assert_eq!(RequestStatusFor::::get(&hash), Some(s)); } + // Cheap request - would unreserve the deposit but none was held. - request_no_deposit_preimage { + #[benchmark] + fn request_no_deposit_preimage() { + let o = T::ManagerOrigin::try_successful_origin() + .expect("ManagerOrigin has no successful origin required for the benchmark"); let (preimage, hash) = preimage_and_hash::(); - assert_ok!(Preimage::::note_preimage( - T::ManagerOrigin::try_successful_origin() - .expect("ManagerOrigin has no successful origin required for the benchmark"), - preimage, - )); - }: request_preimage( - T::ManagerOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?, - hash - ) verify { - let s = RequestStatus::Requested { maybe_ticket: None, count: 2, maybe_len: Some(MAX_SIZE) }; + assert_ok!(Pallet::::note_preimage(o.clone(), preimage,)); + + #[extrinsic_call] + request_preimage(o as T::RuntimeOrigin, hash); + + let s = + RequestStatus::Requested { maybe_ticket: None, count: 2, maybe_len: Some(MAX_SIZE) }; assert_eq!(RequestStatusFor::::get(&hash), Some(s)); } + // Cheap request - the preimage is not yet noted, so deposit to unreserve. - request_unnoted_preimage { + #[benchmark] + fn request_unnoted_preimage() { + let o = T::ManagerOrigin::try_successful_origin() + .expect("ManagerOrigin has no successful origin required for the benchmark"); let (_, hash) = preimage_and_hash::(); - }: request_preimage( - T::ManagerOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?, - hash - ) verify { + + #[extrinsic_call] + request_preimage(o as T::RuntimeOrigin, hash); + let s = RequestStatus::Requested { maybe_ticket: None, count: 1, maybe_len: None }; assert_eq!(RequestStatusFor::::get(&hash), Some(s)); } + // Cheap request - the preimage is already requested, so just a counter bump. - request_requested_preimage { + #[benchmark] + fn request_requested_preimage() { + let o = T::ManagerOrigin::try_successful_origin() + .expect("ManagerOrigin has no successful origin required for the benchmark"); let (_, hash) = preimage_and_hash::(); - assert_ok!(Preimage::::request_preimage( - T::ManagerOrigin::try_successful_origin() - .expect("ManagerOrigin has no successful origin required for the benchmark"), - hash, - )); - }: request_preimage( - T::ManagerOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?, - hash - ) verify { + assert_ok!(Pallet::::request_preimage(o.clone(), hash,)); + + #[extrinsic_call] + request_preimage(o as T::RuntimeOrigin, hash); + let s = RequestStatus::Requested { maybe_ticket: None, count: 2, maybe_len: None }; assert_eq!(RequestStatusFor::::get(&hash), Some(s)); } // Expensive unrequest - last reference and it's noted, so will destroy the preimage. - unrequest_preimage { + #[benchmark] + fn unrequest_preimage() { + let o = T::ManagerOrigin::try_successful_origin() + .expect("ManagerOrigin has no successful origin required for the benchmark"); let (preimage, hash) = preimage_and_hash::(); - assert_ok!(Preimage::::request_preimage( - T::ManagerOrigin::try_successful_origin() - .expect("ManagerOrigin has no successful origin required for the benchmark"), - hash, - )); - assert_ok!(Preimage::::note_preimage( - T::ManagerOrigin::try_successful_origin() - .expect("ManagerOrigin has no successful origin required for the benchmark"), - preimage, - )); - }: _( - T::ManagerOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?, - hash - ) verify { + assert_ok!(Pallet::::request_preimage(o.clone(), hash,)); + assert_ok!(Pallet::::note_preimage(o.clone(), preimage)); + + #[extrinsic_call] + _(o as T::RuntimeOrigin, hash); + assert_eq!(RequestStatusFor::::get(&hash), None); } + // Cheap unrequest - last reference, but it's not noted. - unrequest_unnoted_preimage { + #[benchmark] + fn unrequest_unnoted_preimage() { + let o = T::ManagerOrigin::try_successful_origin() + .expect("ManagerOrigin has no successful origin required for the benchmark"); let (_, hash) = preimage_and_hash::(); - assert_ok!(Preimage::::request_preimage( - T::ManagerOrigin::try_successful_origin() - .expect("ManagerOrigin has no successful origin required for the benchmark"), - hash, - )); - }: unrequest_preimage( - T::ManagerOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?, - hash - ) verify { + assert_ok!(Pallet::::request_preimage(o.clone(), hash,)); + + #[extrinsic_call] + unrequest_preimage(o as T::RuntimeOrigin, hash); + assert_eq!(RequestStatusFor::::get(&hash), None); } + // Cheap unrequest - not the last reference. - unrequest_multi_referenced_preimage { + #[benchmark] + fn unrequest_multi_referenced_preimage() { + let o = T::ManagerOrigin::try_successful_origin() + .expect("ManagerOrigin has no successful origin required for the benchmark"); let (_, hash) = preimage_and_hash::(); - assert_ok!(Preimage::::request_preimage( - T::ManagerOrigin::try_successful_origin() - .expect("ManagerOrigin has no successful origin required for the benchmark"), - hash, - )); - assert_ok!(Preimage::::request_preimage( - T::ManagerOrigin::try_successful_origin() - .expect("ManagerOrigin has no successful origin required for the benchmark"), - hash, - )); - }: unrequest_preimage( - T::ManagerOrigin::try_successful_origin().map_err(|_| BenchmarkError::Weightless)?, - hash - ) verify { + assert_ok!(Pallet::::request_preimage(o.clone(), hash,)); + assert_ok!(Pallet::::request_preimage(o.clone(), hash,)); + + #[extrinsic_call] + unrequest_preimage(o as T::RuntimeOrigin, hash); + let s = RequestStatus::Requested { maybe_ticket: None, count: 1, maybe_len: None }; assert_eq!(RequestStatusFor::::get(&hash), Some(s)); } - ensure_updated { - let n in 1..MAX_HASH_UPGRADE_BULK_COUNT; - + #[benchmark] + fn ensure_updated(n: Linear<1, MAX_HASH_UPGRADE_BULK_COUNT>) { let caller = funded_account::(); let hashes = (0..n).map(|i| insert_old_unrequested::(i)).collect::>(); - }: _(RawOrigin::Signed(caller), hashes) - verify { + + #[extrinsic_call] + _(RawOrigin::Signed(caller), hashes); + assert_eq!(RequestStatusFor::::iter_keys().count(), n as usize); #[allow(deprecated)] let c = StatusFor::::iter_keys().count(); assert_eq!(c, 0); } - impl_benchmark_test_suite!(Preimage, crate::mock::new_test_ext(), crate::mock::Test); -} - -fn insert_old_unrequested(s: u32) -> ::Hash { - let acc = account("old", s, 0); - T::Currency::make_free_balance_be(&acc, BalanceOf::::max_value() / 2u32.into()); - - // The preimage size does not matter here as it is not touched. - let preimage = s.to_le_bytes(); - let hash = ::Hashing::hash(&preimage[..]); - - #[allow(deprecated)] - StatusFor::::insert( - &hash, - OldRequestStatus::Unrequested { deposit: (acc, 123u32.into()), len: preimage.len() as u32 }, - ); - hash + impl_benchmark_test_suite! { + Pallet, + mock::new_test_ext(), + mock::Test + } } diff --git a/substrate/frame/preimage/src/weights.rs b/substrate/frame/preimage/src/weights.rs index edb2eed9c75a..a3aec7e7546e 100644 --- a/substrate/frame/preimage/src/weights.rs +++ b/substrate/frame/preimage/src/weights.rs @@ -18,27 +18,25 @@ //! Autogenerated weights for `pallet_preimage` //! //! THIS FILE WAS AUTO-GENERATED USING THE SUBSTRATE BENCHMARK CLI VERSION 32.0.0 -//! DATE: 2024-11-08, STEPS: `50`, REPEAT: `20`, LOW RANGE: `[]`, HIGH RANGE: `[]` +//! DATE: 2024-11-28, STEPS: `50`, REPEAT: `20`, LOW RANGE: `[]`, HIGH RANGE: `[]` //! WORST CASE MAP SIZE: `1000000` //! HOSTNAME: `runner-wiukf8gn-project-674-concurrent-0`, CPU: `Intel(R) Xeon(R) CPU @ 2.60GHz` //! WASM-EXECUTION: `Compiled`, CHAIN: `Some("dev")`, DB CACHE: `1024` // Executed Command: -// ./target/production/substrate-node +// target/production/substrate-node // benchmark // pallet -// --chain=dev // --steps=50 // --repeat=20 -// --pallet=pallet_preimage -// --no-storage-info -// --no-median-slopes -// --no-min-squares // --extrinsic=* // --wasm-execution=compiled // --heap-pages=4096 -// --output=./substrate/frame/preimage/src/weights.rs +// --json-file=/builds/parity/mirrors/polkadot-sdk/.git/.artifacts/bench.json +// --pallet=pallet_preimage +// --chain=dev // --header=./substrate/HEADER-APACHE2 +// --output=./substrate/frame/preimage/src/weights.rs // --template=./substrate/.maintain/frame-weight-template.hbs #![cfg_attr(rustfmt, rustfmt_skip)] @@ -84,10 +82,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `7` // Estimated: `6012` - // Minimum execution time: 51_981_000 picoseconds. - Weight::from_parts(52_228_000, 6012) - // Standard Error: 6 - .saturating_add(Weight::from_parts(2_392, 0).saturating_mul(s.into())) + // Minimum execution time: 51_305_000 picoseconds. + Weight::from_parts(51_670_000, 6012) + // Standard Error: 5 + .saturating_add(Weight::from_parts(2_337, 0).saturating_mul(s.into())) .saturating_add(T::DbWeight::get().reads(5_u64)) .saturating_add(T::DbWeight::get().writes(3_u64)) } @@ -102,10 +100,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 15_835_000 picoseconds. - Weight::from_parts(16_429_000, 3556) - // Standard Error: 8 - .saturating_add(Weight::from_parts(2_647, 0).saturating_mul(s.into())) + // Minimum execution time: 16_204_000 picoseconds. + Weight::from_parts(16_613_000, 3556) + // Standard Error: 6 + .saturating_add(Weight::from_parts(2_503, 0).saturating_mul(s.into())) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(2_u64)) } @@ -120,10 +118,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 15_263_000 picoseconds. - Weight::from_parts(15_578_000, 3556) - // Standard Error: 7 - .saturating_add(Weight::from_parts(2_598, 0).saturating_mul(s.into())) + // Minimum execution time: 15_118_000 picoseconds. + Weight::from_parts(15_412_000, 3556) + // Standard Error: 6 + .saturating_add(Weight::from_parts(2_411, 0).saturating_mul(s.into())) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(2_u64)) } @@ -139,8 +137,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `206` // Estimated: `3820` - // Minimum execution time: 64_189_000 picoseconds. - Weight::from_parts(70_371_000, 3820) + // Minimum execution time: 57_218_000 picoseconds. + Weight::from_parts(61_242_000, 3820) .saturating_add(T::DbWeight::get().reads(3_u64)) .saturating_add(T::DbWeight::get().writes(3_u64)) } @@ -154,8 +152,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `106` // Estimated: `3556` - // Minimum execution time: 27_582_000 picoseconds. - Weight::from_parts(31_256_000, 3556) + // Minimum execution time: 25_140_000 picoseconds. + Weight::from_parts(27_682_000, 3556) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(2_u64)) } @@ -167,8 +165,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `150` // Estimated: `3556` - // Minimum execution time: 27_667_000 picoseconds. - Weight::from_parts(32_088_000, 3556) + // Minimum execution time: 25_296_000 picoseconds. + Weight::from_parts(27_413_000, 3556) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -180,8 +178,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `106` // Estimated: `3556` - // Minimum execution time: 16_065_000 picoseconds. - Weight::from_parts(20_550_000, 3556) + // Minimum execution time: 15_011_000 picoseconds. + Weight::from_parts(16_524_000, 3556) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -193,8 +191,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `4` // Estimated: `3556` - // Minimum execution time: 13_638_000 picoseconds. - Weight::from_parts(16_979_000, 3556) + // Minimum execution time: 14_649_000 picoseconds. + Weight::from_parts(15_439_000, 3556) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -206,8 +204,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 11_383_000 picoseconds. - Weight::from_parts(12_154_000, 3556) + // Minimum execution time: 10_914_000 picoseconds. + Weight::from_parts(11_137_000, 3556) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -221,8 +219,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `106` // Estimated: `3556` - // Minimum execution time: 22_832_000 picoseconds. - Weight::from_parts(30_716_000, 3556) + // Minimum execution time: 22_512_000 picoseconds. + Weight::from_parts(24_376_000, 3556) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(2_u64)) } @@ -234,8 +232,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 10_685_000 picoseconds. - Weight::from_parts(12_129_000, 3556) + // Minimum execution time: 10_571_000 picoseconds. + Weight::from_parts(10_855_000, 3556) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -247,8 +245,8 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 10_394_000 picoseconds. - Weight::from_parts(10_951_000, 3556) + // Minimum execution time: 10_312_000 picoseconds. + Weight::from_parts(10_653_000, 3556) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().writes(1_u64)) } @@ -267,10 +265,10 @@ impl WeightInfo for SubstrateWeight { // Proof Size summary in bytes: // Measured: `0 + n * (227 ±0)` // Estimated: `6012 + n * (2830 ±0)` - // Minimum execution time: 62_203_000 picoseconds. - Weight::from_parts(63_735_000, 6012) - // Standard Error: 59_589 - .saturating_add(Weight::from_parts(59_482_352, 0).saturating_mul(n.into())) + // Minimum execution time: 61_990_000 picoseconds. + Weight::from_parts(62_751_000, 6012) + // Standard Error: 44_079 + .saturating_add(Weight::from_parts(57_343_378, 0).saturating_mul(n.into())) .saturating_add(T::DbWeight::get().reads(2_u64)) .saturating_add(T::DbWeight::get().reads((3_u64).saturating_mul(n.into()))) .saturating_add(T::DbWeight::get().writes((4_u64).saturating_mul(n.into()))) @@ -295,10 +293,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `7` // Estimated: `6012` - // Minimum execution time: 51_981_000 picoseconds. - Weight::from_parts(52_228_000, 6012) - // Standard Error: 6 - .saturating_add(Weight::from_parts(2_392, 0).saturating_mul(s.into())) + // Minimum execution time: 51_305_000 picoseconds. + Weight::from_parts(51_670_000, 6012) + // Standard Error: 5 + .saturating_add(Weight::from_parts(2_337, 0).saturating_mul(s.into())) .saturating_add(RocksDbWeight::get().reads(5_u64)) .saturating_add(RocksDbWeight::get().writes(3_u64)) } @@ -313,10 +311,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 15_835_000 picoseconds. - Weight::from_parts(16_429_000, 3556) - // Standard Error: 8 - .saturating_add(Weight::from_parts(2_647, 0).saturating_mul(s.into())) + // Minimum execution time: 16_204_000 picoseconds. + Weight::from_parts(16_613_000, 3556) + // Standard Error: 6 + .saturating_add(Weight::from_parts(2_503, 0).saturating_mul(s.into())) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(2_u64)) } @@ -331,10 +329,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 15_263_000 picoseconds. - Weight::from_parts(15_578_000, 3556) - // Standard Error: 7 - .saturating_add(Weight::from_parts(2_598, 0).saturating_mul(s.into())) + // Minimum execution time: 15_118_000 picoseconds. + Weight::from_parts(15_412_000, 3556) + // Standard Error: 6 + .saturating_add(Weight::from_parts(2_411, 0).saturating_mul(s.into())) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(2_u64)) } @@ -350,8 +348,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `206` // Estimated: `3820` - // Minimum execution time: 64_189_000 picoseconds. - Weight::from_parts(70_371_000, 3820) + // Minimum execution time: 57_218_000 picoseconds. + Weight::from_parts(61_242_000, 3820) .saturating_add(RocksDbWeight::get().reads(3_u64)) .saturating_add(RocksDbWeight::get().writes(3_u64)) } @@ -365,8 +363,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `106` // Estimated: `3556` - // Minimum execution time: 27_582_000 picoseconds. - Weight::from_parts(31_256_000, 3556) + // Minimum execution time: 25_140_000 picoseconds. + Weight::from_parts(27_682_000, 3556) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(2_u64)) } @@ -378,8 +376,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `150` // Estimated: `3556` - // Minimum execution time: 27_667_000 picoseconds. - Weight::from_parts(32_088_000, 3556) + // Minimum execution time: 25_296_000 picoseconds. + Weight::from_parts(27_413_000, 3556) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -391,8 +389,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `106` // Estimated: `3556` - // Minimum execution time: 16_065_000 picoseconds. - Weight::from_parts(20_550_000, 3556) + // Minimum execution time: 15_011_000 picoseconds. + Weight::from_parts(16_524_000, 3556) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -404,8 +402,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `4` // Estimated: `3556` - // Minimum execution time: 13_638_000 picoseconds. - Weight::from_parts(16_979_000, 3556) + // Minimum execution time: 14_649_000 picoseconds. + Weight::from_parts(15_439_000, 3556) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -417,8 +415,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 11_383_000 picoseconds. - Weight::from_parts(12_154_000, 3556) + // Minimum execution time: 10_914_000 picoseconds. + Weight::from_parts(11_137_000, 3556) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -432,8 +430,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `106` // Estimated: `3556` - // Minimum execution time: 22_832_000 picoseconds. - Weight::from_parts(30_716_000, 3556) + // Minimum execution time: 22_512_000 picoseconds. + Weight::from_parts(24_376_000, 3556) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(2_u64)) } @@ -445,8 +443,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 10_685_000 picoseconds. - Weight::from_parts(12_129_000, 3556) + // Minimum execution time: 10_571_000 picoseconds. + Weight::from_parts(10_855_000, 3556) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -458,8 +456,8 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `68` // Estimated: `3556` - // Minimum execution time: 10_394_000 picoseconds. - Weight::from_parts(10_951_000, 3556) + // Minimum execution time: 10_312_000 picoseconds. + Weight::from_parts(10_653_000, 3556) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().writes(1_u64)) } @@ -478,10 +476,10 @@ impl WeightInfo for () { // Proof Size summary in bytes: // Measured: `0 + n * (227 ±0)` // Estimated: `6012 + n * (2830 ±0)` - // Minimum execution time: 62_203_000 picoseconds. - Weight::from_parts(63_735_000, 6012) - // Standard Error: 59_589 - .saturating_add(Weight::from_parts(59_482_352, 0).saturating_mul(n.into())) + // Minimum execution time: 61_990_000 picoseconds. + Weight::from_parts(62_751_000, 6012) + // Standard Error: 44_079 + .saturating_add(Weight::from_parts(57_343_378, 0).saturating_mul(n.into())) .saturating_add(RocksDbWeight::get().reads(2_u64)) .saturating_add(RocksDbWeight::get().reads((3_u64).saturating_mul(n.into()))) .saturating_add(RocksDbWeight::get().writes((4_u64).saturating_mul(n.into()))) From 447902eff4a574e66894ad60cb41999b05bf5e84 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Alexander=20Thei=C3=9Fen?= Date: Fri, 29 Nov 2024 13:46:31 +0100 Subject: [PATCH 47/64] pallet_revive: Switch to 64bit RISC-V (#6565) This PR updates pallet_revive to the newest PolkaVM version and adapts the test fixtures and syscall interface to work under 64bit. Please note that after this PR no 32bit contracts can be deployed (they will be rejected at deploy time). Pre-deployed 32bit contracts are now considered defunct since we changes how parameters are passed for functions with more than 6 arguments. ## Fixtures The fixtures are now built for the 64bit target. I also removed the temporary directory mechanism that triggered a full rebuild every time. It also makes it easier to find the compiled fixtures since they are now always in `target/pallet-revive-fixtures`. ## Syscall interface ### Passing pointer Registers and pointers are now 64bit wide. This allows us to pass u64 arguments in a single register. Before we needed two registers to pass them. This means that just as before we need one register per pointer we pass. We keep pointers as `u32` argument by truncating the register. This is done since the memory space of PolkaVM is 32bit. ### Functions with more than 6 arguments We only have 6 registers to pass arguments. This is why we pass a pointer to a struct when we need more than 6. Before this PR we expected a packed struct and interpreted it as SCALE encoded tuple. However, this was buggy because the `MaxEncodedLen` returned something that was larger than the packed size of the structure. This wasn't a problem before. But now the memory space changed in a way that things were placed at the edges of the memory space and those extra bytes lead to an out of bound access. This is why this PR drops SCALE and expects the arguments to be passed as a pointer to a `C` aligned struct. This avoids unaligned accesses. However, revive needs to adapt its codegen to properly align the structure fields. ## TODO - [ ] Add multi block migration that wipes all existing contracts as we made breaking changes to the syscall interface --------- Co-authored-by: GitHub Action --- .github/workflows/checks-quick.yml | 1 - Cargo.lock | 72 +++++++------- prdoc/pr_6565.prdoc | 35 +++++++ substrate/frame/revive/Cargo.toml | 2 +- substrate/frame/revive/fixtures/Cargo.toml | 4 +- substrate/frame/revive/fixtures/build.rs | 96 +++++++++++++------ .../build/{Cargo.toml => _Cargo.toml} | 5 +- .../fixtures/build/_rust-toolchain.toml | 4 + .../riscv32emac-unknown-none-polkavm.json | 26 ----- substrate/frame/revive/fixtures/src/lib.rs | 13 +-- substrate/frame/revive/proc-macro/src/lib.rs | 91 ++++++++++-------- substrate/frame/revive/rpc/src/tests.rs | 6 ++ substrate/frame/revive/src/chain_extension.rs | 12 +-- substrate/frame/revive/src/limits.rs | 21 +++- substrate/frame/revive/src/wasm/mod.rs | 20 +++- substrate/frame/revive/src/wasm/runtime.rs | 33 ++----- substrate/frame/revive/uapi/Cargo.toml | 6 +- substrate/frame/revive/uapi/src/host.rs | 4 +- .../uapi/src/host/{riscv32.rs => riscv64.rs} | 86 ++++++++--------- substrate/frame/revive/uapi/src/lib.rs | 6 ++ 20 files changed, 309 insertions(+), 234 deletions(-) create mode 100644 prdoc/pr_6565.prdoc rename substrate/frame/revive/fixtures/build/{Cargo.toml => _Cargo.toml} (80%) create mode 100644 substrate/frame/revive/fixtures/build/_rust-toolchain.toml delete mode 100644 substrate/frame/revive/fixtures/riscv32emac-unknown-none-polkavm.json rename substrate/frame/revive/uapi/src/host/{riscv32.rs => riscv64.rs} (93%) diff --git a/.github/workflows/checks-quick.yml b/.github/workflows/checks-quick.yml index c733a2517cb8..4c26b85a6303 100644 --- a/.github/workflows/checks-quick.yml +++ b/.github/workflows/checks-quick.yml @@ -97,7 +97,6 @@ jobs: --exclude "substrate/frame/contracts/fixtures/build" "substrate/frame/contracts/fixtures/contracts/common" - "substrate/frame/revive/fixtures/build" "substrate/frame/revive/fixtures/contracts/common" - name: deny git deps run: python3 .github/scripts/deny-git-deps.py . diff --git a/Cargo.lock b/Cargo.lock index 84477cd05416..e1abeea49283 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -5975,6 +5975,15 @@ dependencies = [ "dirs-sys-next", ] +[[package]] +name = "dirs" +version = "5.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "44c45a9d03d6676652bcb5e724c7e988de1acad23a711b5217ab9cbecbec2225" +dependencies = [ + "dirs-sys", +] + [[package]] name = "dirs-sys" version = "0.4.1" @@ -14646,7 +14655,7 @@ dependencies = [ "pallet-utility 28.0.0", "parity-scale-codec", "paste", - "polkavm 0.13.0", + "polkavm 0.17.0", "pretty_assertions", "rlp 0.6.1", "scale-info", @@ -14742,12 +14751,10 @@ dependencies = [ "anyhow", "frame-system 28.0.0", "log", - "parity-wasm", - "polkavm-linker 0.14.0", + "polkavm-linker 0.17.0", "sp-core 28.0.0", "sp-io 30.0.0", "sp-runtime 31.0.1", - "tempfile", "toml 0.8.12", ] @@ -14864,7 +14871,7 @@ dependencies = [ "bitflags 1.3.2", "parity-scale-codec", "paste", - "polkavm-derive 0.14.0", + "polkavm-derive 0.17.0", "scale-info", ] @@ -19699,15 +19706,15 @@ dependencies = [ [[package]] name = "polkavm" -version = "0.13.0" +version = "0.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "57e79a14b15ed38cb5b9a1e38d02e933f19e3d180ae5b325fed606c5e5b9177e" +checksum = "84979be196ba2855f73616413e7b1d18258128aa396b3dc23f520a00a807720e" dependencies = [ "libc", "log", - "polkavm-assembler 0.13.0", - "polkavm-common 0.13.0", - "polkavm-linux-raw 0.13.0", + "polkavm-assembler 0.17.0", + "polkavm-common 0.17.0", + "polkavm-linux-raw 0.17.0", ] [[package]] @@ -19730,9 +19737,9 @@ dependencies = [ [[package]] name = "polkavm-assembler" -version = "0.13.0" +version = "0.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4e8da55465000feb0a61bbf556ed03024db58f3420eca37721fc726b3b2136bf" +checksum = "0ba7b434ff630b0f73a1560e8baea807246ca22098abe49f97821e0e2d2accc4" dependencies = [ "log", ] @@ -19764,20 +19771,14 @@ dependencies = [ [[package]] name = "polkavm-common" -version = "0.13.0" +version = "0.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "084b4339aae7dfdaaa5aa7d634110afd95970e0737b6fb2a0cb10db8b56b753c" +checksum = "8f0dbafef4ab6ceecb4982ac3b550df430ef4f9fdbf07c108b7d4f91a0682fce" dependencies = [ "log", - "polkavm-assembler 0.13.0", + "polkavm-assembler 0.17.0", ] -[[package]] -name = "polkavm-common" -version = "0.14.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "711952a783e9c5ad407cdacb1ed147f36d37c5d43417c1091d86456d2999417b" - [[package]] name = "polkavm-derive" version = "0.8.0" @@ -19807,11 +19808,11 @@ dependencies = [ [[package]] name = "polkavm-derive" -version = "0.14.0" +version = "0.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b4832a0aebf6cefc988bb7b2d74ea8c86c983164672e2fc96300f356a1babfc1" +checksum = "c0c3dbb6c8c7bd3e5f5b05aa7fc9355acf14df7ce5d392911e77d01090a38d0d" dependencies = [ - "polkavm-derive-impl-macro 0.14.0", + "polkavm-derive-impl-macro 0.17.0", ] [[package]] @@ -19852,11 +19853,11 @@ dependencies = [ [[package]] name = "polkavm-derive-impl" -version = "0.14.0" +version = "0.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e339fc7c11310fe5adf711d9342278ac44a75c9784947937cce12bd4f30842f2" +checksum = "42565aed4adbc4034612d0b17dea8db3681fb1bd1aed040d6edc5455a9f478a1" dependencies = [ - "polkavm-common 0.14.0", + "polkavm-common 0.17.0", "proc-macro2 1.0.86", "quote 1.0.37", "syn 2.0.87", @@ -19894,11 +19895,11 @@ dependencies = [ [[package]] name = "polkavm-derive-impl-macro" -version = "0.14.0" +version = "0.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b569754b15060d03000c09e3bf11509d527f60b75d79b4c30c3625b5071d9702" +checksum = "86d9838e95241b0bce4fe269cdd4af96464160505840ed5a8ac8536119ba19e2" dependencies = [ - "polkavm-derive-impl 0.14.0", + "polkavm-derive-impl 0.17.0", "syn 2.0.87", ] @@ -19934,15 +19935,16 @@ dependencies = [ [[package]] name = "polkavm-linker" -version = "0.14.0" +version = "0.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0959ac3b0f4fd5caf5c245c637705f19493efe83dba31a83bbba928b93b0116a" +checksum = "d359dc721d2cc9b555ebb3558c305112ddc5bdac09d26f95f2f7b49c1f2db7e9" dependencies = [ + "dirs", "gimli 0.31.1", "hashbrown 0.14.5", "log", "object 0.36.1", - "polkavm-common 0.14.0", + "polkavm-common 0.17.0", "regalloc2 0.9.3", "rustc-demangle", ] @@ -19961,9 +19963,9 @@ checksum = "26e45fa59c7e1bb12ef5289080601e9ec9b31435f6e32800a5c90c132453d126" [[package]] name = "polkavm-linux-raw" -version = "0.13.0" +version = "0.17.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "686c4dd9c9c16cc22565b51bdbb269792318d0fd2e6b966b5f6c788534cad0e9" +checksum = "e64c3d93a58ffbc3099d1227f0da9675a025a9ea6c917038f266920c1de1e568" [[package]] name = "polling" diff --git a/prdoc/pr_6565.prdoc b/prdoc/pr_6565.prdoc new file mode 100644 index 000000000000..f9a75a16a6a7 --- /dev/null +++ b/prdoc/pr_6565.prdoc @@ -0,0 +1,35 @@ +title: 'pallet_revive: Switch to 64bit RISC-V' +doc: +- audience: Runtime Dev + description: |- + This PR updates pallet_revive to the newest PolkaVM version and adapts the test fixtures and syscall interface to work under 64bit. + + Please note that after this PR no 32bit contracts can be deployed (they will be rejected at deploy time). Pre-deployed 32bit contracts are now considered defunct since we changes how parameters are passed for functions with more than 6 arguments. + + ## Fixtures + + The fixtures are now built for the 64bit target. I also removed the temporary directory mechanism that triggered a full rebuild every time. It also makes it easier to find the compiled fixtures since they are now always in `target/pallet-revive-fixtures`. + + ## Syscall interface + + ### Passing pointer + + Registers and pointers are now 64bit wide. This allows us to pass u64 arguments in a single register. Before we needed two registers to pass them. This means that just as before we need one register per pointer we pass. We keep pointers as `u32` argument by truncating the register. This is done since the memory space of PolkaVM is 32bit. + + ### Functions with more than 6 arguments + + We only have 6 registers to pass arguments. This is why we pass a pointer to a struct when we need more than 6. Before this PR we expected a packed struct and interpreted it as SCALE encoded tuple. However, this was buggy because the `MaxEncodedLen` returned something that was larger than the packed size of the structure. This wasn't a problem before. But now the memory space changed in a way that things were placed at the edges of the memory space and those extra bytes lead to an out of bound access. + + This is why this PR drops SCALE and expects the arguments to be passed as a pointer to a `C` aligned struct. This avoids unaligned accesses. However, revive needs to adapt its codegen to properly align the structure fields. + + ## TODO + - [ ] Add multi block migration that wipes all existing contracts as we made breaking changes to the syscall interface +crates: +- name: pallet-revive + bump: major +- name: pallet-revive-fixtures + bump: major +- name: pallet-revive-proc-macro + bump: major +- name: pallet-revive-uapi + bump: major diff --git a/substrate/frame/revive/Cargo.toml b/substrate/frame/revive/Cargo.toml index 81fbbc8cf38e..677ef0e1367f 100644 --- a/substrate/frame/revive/Cargo.toml +++ b/substrate/frame/revive/Cargo.toml @@ -19,7 +19,7 @@ targets = ["x86_64-unknown-linux-gnu"] [dependencies] environmental = { workspace = true } paste = { workspace = true } -polkavm = { version = "0.13.0", default-features = false } +polkavm = { version = "0.17.0", default-features = false } bitflags = { workspace = true } codec = { features = ["derive", "max-encoded-len"], workspace = true } scale-info = { features = ["derive"], workspace = true } diff --git a/substrate/frame/revive/fixtures/Cargo.toml b/substrate/frame/revive/fixtures/Cargo.toml index 7a5452853d65..798ed8c75a5a 100644 --- a/substrate/frame/revive/fixtures/Cargo.toml +++ b/substrate/frame/revive/fixtures/Cargo.toml @@ -18,10 +18,8 @@ anyhow = { workspace = true, default-features = true, optional = true } log = { workspace = true } [build-dependencies] -parity-wasm = { workspace = true } -tempfile = { workspace = true } toml = { workspace = true } -polkavm-linker = { version = "0.14.0" } +polkavm-linker = { version = "0.17.0" } anyhow = { workspace = true, default-features = true } [features] diff --git a/substrate/frame/revive/fixtures/build.rs b/substrate/frame/revive/fixtures/build.rs index 3472e0846efd..46cd5760ca4e 100644 --- a/substrate/frame/revive/fixtures/build.rs +++ b/substrate/frame/revive/fixtures/build.rs @@ -20,7 +20,8 @@ use anyhow::Result; use anyhow::{bail, Context}; use std::{ - cfg, env, fs, + env, fs, + io::Write, path::{Path, PathBuf}, process::Command, }; @@ -82,7 +83,7 @@ fn create_cargo_toml<'a>( entries: impl Iterator, output_dir: &Path, ) -> Result<()> { - let mut cargo_toml: toml::Value = toml::from_str(include_str!("./build/Cargo.toml"))?; + let mut cargo_toml: toml::Value = toml::from_str(include_str!("./build/_Cargo.toml"))?; let mut set_dep = |name, path| -> Result<()> { cargo_toml["dependencies"][name]["path"] = toml::Value::String( fixtures_dir.join(path).canonicalize()?.to_str().unwrap().to_string(), @@ -108,21 +109,24 @@ fn create_cargo_toml<'a>( let cargo_toml = toml::to_string_pretty(&cargo_toml)?; fs::write(output_dir.join("Cargo.toml"), cargo_toml.clone()) .with_context(|| format!("Failed to write {cargo_toml:?}"))?; + fs::copy( + fixtures_dir.join("build/_rust-toolchain.toml"), + output_dir.join("rust-toolchain.toml"), + ) + .context("Failed to write toolchain file")?; Ok(()) } -fn invoke_build(target: &Path, current_dir: &Path) -> Result<()> { +fn invoke_build(current_dir: &Path) -> Result<()> { let encoded_rustflags = ["-Dwarnings"].join("\x1f"); - let mut build_command = Command::new(env::var("CARGO")?); + let mut build_command = Command::new("cargo"); build_command .current_dir(current_dir) .env_clear() .env("PATH", env::var("PATH").unwrap_or_default()) .env("CARGO_ENCODED_RUSTFLAGS", encoded_rustflags) - .env("RUSTC_BOOTSTRAP", "1") .env("RUSTUP_HOME", env::var("RUSTUP_HOME").unwrap_or_default()) - .env("RUSTUP_TOOLCHAIN", env::var("RUSTUP_TOOLCHAIN").unwrap_or_default()) .args([ "build", "--release", @@ -130,7 +134,7 @@ fn invoke_build(target: &Path, current_dir: &Path) -> Result<()> { "-Zbuild-std-features=panic_immediate_abort", ]) .arg("--target") - .arg(target); + .arg(polkavm_linker::target_json_64_path().unwrap()); if let Ok(toolchain) = env::var(OVERRIDE_RUSTUP_TOOLCHAIN_ENV_VAR) { build_command.env("RUSTUP_TOOLCHAIN", &toolchain); @@ -168,7 +172,7 @@ fn write_output(build_dir: &Path, out_dir: &Path, entries: Vec) -> Result for entry in entries { post_process( &build_dir - .join("target/riscv32emac-unknown-none-polkavm/release") + .join("target/riscv64emac-unknown-none-polkavm/release") .join(entry.name()), &out_dir.join(entry.out_filename()), )?; @@ -177,11 +181,61 @@ fn write_output(build_dir: &Path, out_dir: &Path, entries: Vec) -> Result Ok(()) } +/// Create a directory in the `target` as output directory +fn create_out_dir() -> Result { + let temp_dir: PathBuf = env::var("OUT_DIR")?.into(); + + // this is set in case the user has overriden the target directory + let out_dir = if let Ok(path) = env::var("CARGO_TARGET_DIR") { + path.into() + } else { + // otherwise just traverse up from the out dir + let mut out_dir: PathBuf = temp_dir.clone(); + loop { + if !out_dir.pop() { + bail!("Cannot find project root.") + } + if out_dir.join("Cargo.lock").exists() { + break; + } + } + out_dir.join("target") + } + .join("pallet-revive-fixtures"); + + // clean up some leftover symlink from previous versions of this script + if out_dir.exists() && !out_dir.is_dir() { + fs::remove_file(&out_dir)?; + } + fs::create_dir_all(&out_dir).context("Failed to create output directory")?; + + // write the location of the out dir so it can be found later + let mut file = fs::File::create(temp_dir.join("fixture_location.rs")) + .context("Failed to create fixture_location.rs")?; + write!( + file, + r#" + #[allow(dead_code)] + const FIXTURE_DIR: &str = "{0}"; + macro_rules! fixture {{ + ($name: literal) => {{ + include_bytes!(concat!("{0}", "/", $name, ".polkavm")) + }}; + }} + "#, + out_dir.display() + ) + .context("Failed to write to fixture_location.rs")?; + + Ok(out_dir) +} + pub fn main() -> Result<()> { let fixtures_dir: PathBuf = env::var("CARGO_MANIFEST_DIR")?.into(); let contracts_dir = fixtures_dir.join("contracts"); - let out_dir: PathBuf = env::var("OUT_DIR")?.into(); - let target = fixtures_dir.join("riscv32emac-unknown-none-polkavm.json"); + let out_dir = create_out_dir().context("Cannot determine output directory")?; + let build_dir = out_dir.join("build"); + fs::create_dir_all(&build_dir).context("Failed to create build directory")?; println!("cargo::rerun-if-env-changed={OVERRIDE_RUSTUP_TOOLCHAIN_ENV_VAR}"); println!("cargo::rerun-if-env-changed={OVERRIDE_STRIP_ENV_VAR}"); @@ -199,25 +253,9 @@ pub fn main() -> Result<()> { return Ok(()) } - let tmp_dir = tempfile::tempdir()?; - let tmp_dir_path = tmp_dir.path(); - - create_cargo_toml(&fixtures_dir, entries.iter(), tmp_dir.path())?; - invoke_build(&target, tmp_dir_path)?; - - write_output(tmp_dir_path, &out_dir, entries)?; - - #[cfg(unix)] - if let Ok(symlink_dir) = env::var("CARGO_WORKSPACE_ROOT_DIR") { - let symlink_dir: PathBuf = symlink_dir.into(); - let symlink_dir: PathBuf = symlink_dir.join("target").join("pallet-revive-fixtures"); - if symlink_dir.is_symlink() { - fs::remove_file(&symlink_dir) - .with_context(|| format!("Failed to remove_file {symlink_dir:?}"))?; - } - std::os::unix::fs::symlink(&out_dir, &symlink_dir) - .with_context(|| format!("Failed to symlink {out_dir:?} -> {symlink_dir:?}"))?; - } + create_cargo_toml(&fixtures_dir, entries.iter(), &build_dir)?; + invoke_build(&build_dir)?; + write_output(&build_dir, &out_dir, entries)?; Ok(()) } diff --git a/substrate/frame/revive/fixtures/build/Cargo.toml b/substrate/frame/revive/fixtures/build/_Cargo.toml similarity index 80% rename from substrate/frame/revive/fixtures/build/Cargo.toml rename to substrate/frame/revive/fixtures/build/_Cargo.toml index 5d0e256e2e73..beaabd83403e 100644 --- a/substrate/frame/revive/fixtures/build/Cargo.toml +++ b/substrate/frame/revive/fixtures/build/_Cargo.toml @@ -4,6 +4,9 @@ publish = false version = "1.0.0" edition = "2021" +# Make sure this is not included into the workspace +[workspace] + # Binary targets are injected dynamically by the build script. [[bin]] @@ -11,7 +14,7 @@ edition = "2021" [dependencies] uapi = { package = 'pallet-revive-uapi', path = "", default-features = false } common = { package = 'pallet-revive-fixtures-common', path = "" } -polkavm-derive = { version = "0.14.0" } +polkavm-derive = { version = "0.17.0" } [profile.release] opt-level = 3 diff --git a/substrate/frame/revive/fixtures/build/_rust-toolchain.toml b/substrate/frame/revive/fixtures/build/_rust-toolchain.toml new file mode 100644 index 000000000000..4c757c708d58 --- /dev/null +++ b/substrate/frame/revive/fixtures/build/_rust-toolchain.toml @@ -0,0 +1,4 @@ +[toolchain] +channel = "nightly-2024-11-19" +components = ["rust-src"] +profile = "minimal" diff --git a/substrate/frame/revive/fixtures/riscv32emac-unknown-none-polkavm.json b/substrate/frame/revive/fixtures/riscv32emac-unknown-none-polkavm.json deleted file mode 100644 index bbd54cdefbac..000000000000 --- a/substrate/frame/revive/fixtures/riscv32emac-unknown-none-polkavm.json +++ /dev/null @@ -1,26 +0,0 @@ -{ - "arch": "riscv32", - "cpu": "generic-rv32", - "crt-objects-fallback": "false", - "data-layout": "e-m:e-p:32:32-i64:64-n32-S32", - "eh-frame-header": false, - "emit-debug-gdb-scripts": false, - "features": "+e,+m,+a,+c,+lui-addi-fusion,+fast-unaligned-access,+xtheadcondmov", - "linker": "rust-lld", - "linker-flavor": "ld.lld", - "llvm-abiname": "ilp32e", - "llvm-target": "riscv32", - "max-atomic-width": 32, - "panic-strategy": "abort", - "relocation-model": "pie", - "target-pointer-width": "32", - "singlethread": true, - "pre-link-args": { - "ld": [ - "--emit-relocs", - "--unique", - "--relocatable" - ] - }, - "env": "polkavm" -} diff --git a/substrate/frame/revive/fixtures/src/lib.rs b/substrate/frame/revive/fixtures/src/lib.rs index cc84daec9b59..24f6ee547dc7 100644 --- a/substrate/frame/revive/fixtures/src/lib.rs +++ b/substrate/frame/revive/fixtures/src/lib.rs @@ -19,10 +19,13 @@ extern crate alloc; +// generated file that tells us where to find the fixtures +include!(concat!(env!("OUT_DIR"), "/fixture_location.rs")); + /// Load a given wasm module and returns a wasm binary contents along with it's hash. #[cfg(feature = "std")] pub fn compile_module(fixture_name: &str) -> anyhow::Result<(Vec, sp_core::H256)> { - let out_dir: std::path::PathBuf = env!("OUT_DIR").into(); + let out_dir: std::path::PathBuf = FIXTURE_DIR.into(); let fixture_path = out_dir.join(format!("{fixture_name}.polkavm")); log::debug!("Loading fixture from {fixture_path:?}"); let binary = std::fs::read(fixture_path)?; @@ -36,12 +39,6 @@ pub fn compile_module(fixture_name: &str) -> anyhow::Result<(Vec, sp_core::H /// available in no-std environments (runtime benchmarks). pub mod bench { use alloc::vec::Vec; - - macro_rules! fixture { - ($name: literal) => { - include_bytes!(concat!(env!("OUT_DIR"), "/", $name, ".polkavm")) - }; - } pub const DUMMY: &[u8] = fixture!("dummy"); pub const NOOP: &[u8] = fixture!("noop"); pub const INSTR: &[u8] = fixture!("instr_benchmark"); @@ -61,7 +58,7 @@ pub mod bench { mod test { #[test] fn out_dir_should_have_compiled_mocks() { - let out_dir: std::path::PathBuf = env!("OUT_DIR").into(); + let out_dir: std::path::PathBuf = crate::FIXTURE_DIR.into(); assert!(out_dir.join("dummy.polkavm").exists()); } } diff --git a/substrate/frame/revive/proc-macro/src/lib.rs b/substrate/frame/revive/proc-macro/src/lib.rs index 7232c6342824..6814add128d9 100644 --- a/substrate/frame/revive/proc-macro/src/lib.rs +++ b/substrate/frame/revive/proc-macro/src/lib.rs @@ -79,6 +79,7 @@ use syn::{parse_quote, punctuated::Punctuated, spanned::Spanned, token::Comma, F /// - `Result<(), TrapReason>`, /// - `Result`, /// - `Result`. +/// - `Result`. /// /// The macro expands to `pub struct Env` declaration, with the following traits implementations: /// - `pallet_revive::wasm::Environment> where E: Ext` @@ -127,6 +128,7 @@ struct HostFn { enum HostFnReturn { Unit, U32, + U64, ReturnCode, } @@ -134,8 +136,7 @@ impl HostFnReturn { fn map_output(&self) -> TokenStream2 { match self { Self::Unit => quote! { |_| None }, - Self::U32 => quote! { |ret_val| Some(ret_val) }, - Self::ReturnCode => quote! { |ret_code| Some(ret_code.into()) }, + _ => quote! { |ret_val| Some(ret_val.into()) }, } } @@ -143,6 +144,7 @@ impl HostFnReturn { match self { Self::Unit => syn::ReturnType::Default, Self::U32 => parse_quote! { -> u32 }, + Self::U64 => parse_quote! { -> u64 }, Self::ReturnCode => parse_quote! { -> ReturnErrorCode }, } } @@ -243,7 +245,8 @@ impl HostFn { let msg = r#"Should return one of the following: - Result<(), TrapReason>, - Result, - - Result"#; + - Result, + - Result"#; let ret_ty = match item.clone().sig.output { syn::ReturnType::Type(_, ty) => Ok(ty.clone()), _ => Err(err(span, &msg)), @@ -305,6 +308,7 @@ impl HostFn { let returns = match ok_ty_str.as_str() { "()" => Ok(HostFnReturn::Unit), "u32" => Ok(HostFnReturn::U32), + "u64" => Ok(HostFnReturn::U64), "ReturnErrorCode" => Ok(HostFnReturn::ReturnCode), _ => Err(err(arg1.span(), &msg)), }?; @@ -339,50 +343,61 @@ where P: Iterator> + Clone, I: Iterator> + Clone, { - const ALLOWED_REGISTERS: u32 = 6; - let mut registers_used = 0; - let mut bindings = vec![]; - let mut idx = 0; - for (name, ty) in param_names.clone().zip(param_types.clone()) { + const ALLOWED_REGISTERS: usize = 6; + + // all of them take one register but we truncate them before passing into the function + // it is important to not allow any type which has illegal bit patterns like 'bool' + if !param_types.clone().all(|ty| { let syn::Type::Path(path) = &**ty else { panic!("Type needs to be path"); }; let Some(ident) = path.path.get_ident() else { panic!("Type needs to be ident"); }; - let size = if ident == "i8" || - ident == "i16" || - ident == "i32" || - ident == "u8" || - ident == "u16" || - ident == "u32" - { - 1 - } else if ident == "i64" || ident == "u64" { - 2 - } else { - panic!("Pass by value only supports primitives"); - }; - registers_used += size; - if registers_used > ALLOWED_REGISTERS { - return quote! { - let (#( #param_names, )*): (#( #param_types, )*) = memory.read_as(__a0__)?; - } - } - let this_reg = quote::format_ident!("__a{}__", idx); - let next_reg = quote::format_ident!("__a{}__", idx + 1); - let binding = if size == 1 { + matches!(ident.to_string().as_ref(), "u8" | "u16" | "u32" | "u64") + }) { + panic!("Only primitive unsigned integers are allowed as arguments to syscalls"); + } + + // too many arguments: pass as pointer to a struct in memory + if param_names.clone().count() > ALLOWED_REGISTERS { + let fields = param_names.clone().zip(param_types.clone()).map(|(name, ty)| { quote! { - let #name = #this_reg as #ty; + #name: #ty, } - } else { - quote! { - let #name = (#this_reg as #ty) | ((#next_reg as #ty) << 32); + }); + return quote! { + #[derive(Default)] + #[repr(C)] + struct Args { + #(#fields)* } - }; - bindings.push(binding); - idx += size; + let Args { #(#param_names,)* } = { + let len = ::core::mem::size_of::(); + let mut args = Args::default(); + let ptr = &mut args as *mut Args as *mut u8; + // Safety + // 1. The struct is initialized at all times. + // 2. We only allow primitive integers (no bools) as arguments so every bit pattern is safe. + // 3. The reference doesn't outlive the args field. + // 4. There is only the single reference to the args field. + // 5. The length of the generated slice is the same as the struct. + let reference = unsafe { + ::core::slice::from_raw_parts_mut(ptr, len) + }; + memory.read_into_buf(__a0__ as _, reference)?; + args + }; + } } + + // otherwise: one argument per register + let bindings = param_names.zip(param_types).enumerate().map(|(idx, (name, ty))| { + let reg = quote::format_ident!("__a{}__", idx); + quote! { + let #name = #reg as #ty; + } + }); quote! { #( #bindings )* } @@ -409,7 +424,7 @@ fn expand_env(def: &EnvDef) -> TokenStream2 { memory: &mut M, __syscall_symbol__: &[u8], __available_api_version__: ApiVersion, - ) -> Result, TrapReason> + ) -> Result, TrapReason> { #impls } diff --git a/substrate/frame/revive/rpc/src/tests.rs b/substrate/frame/revive/rpc/src/tests.rs index 7734c8c57209..920318b26f71 100644 --- a/substrate/frame/revive/rpc/src/tests.rs +++ b/substrate/frame/revive/rpc/src/tests.rs @@ -218,6 +218,8 @@ async fn deploy_and_call() -> anyhow::Result<()> { Ok(()) } +/// TODO: enable ( https://github.com/paritytech/contract-issues/issues/12 ) +#[ignore] #[tokio::test] async fn revert_call() -> anyhow::Result<()> { let _lock = SHARED_RESOURCES.write(); @@ -240,6 +242,8 @@ async fn revert_call() -> anyhow::Result<()> { Ok(()) } +/// TODO: enable ( https://github.com/paritytech/contract-issues/issues/12 ) +#[ignore] #[tokio::test] async fn event_logs() -> anyhow::Result<()> { let _lock = SHARED_RESOURCES.write(); @@ -279,6 +283,8 @@ async fn invalid_transaction() -> anyhow::Result<()> { Ok(()) } +/// TODO: enable ( https://github.com/paritytech/contract-issues/issues/12 ) +#[ignore] #[tokio::test] async fn native_evm_ratio_works() -> anyhow::Result<()> { let _lock = SHARED_RESOURCES.write(); diff --git a/substrate/frame/revive/src/chain_extension.rs b/substrate/frame/revive/src/chain_extension.rs index ccea12945054..5b3e886a5628 100644 --- a/substrate/frame/revive/src/chain_extension.rs +++ b/substrate/frame/revive/src/chain_extension.rs @@ -75,7 +75,7 @@ use crate::{ Error, }; use alloc::vec::Vec; -use codec::{Decode, MaxEncodedLen}; +use codec::Decode; use frame_support::weights::Weight; use sp_runtime::DispatchError; @@ -304,16 +304,6 @@ impl<'a, 'b, E: Ext, M: ?Sized + Memory> Environment<'a, 'b, E, M> { Ok(()) } - /// Reads and decodes a type with a size fixed at compile time from contract memory. - /// - /// This function is secure and recommended for all input types of fixed size - /// as long as the cost of reading the memory is included in the overall already charged - /// weight of the chain extension. This should usually be the case when fixed input types - /// are used. - pub fn read_as(&mut self) -> Result { - self.memory.read_as(self.input_ptr) - } - /// Reads and decodes a type with a dynamic size from contract memory. /// /// Make sure to include `len` in your weight calculations. diff --git a/substrate/frame/revive/src/limits.rs b/substrate/frame/revive/src/limits.rs index 64e66382b9ab..5ce96f59c14d 100644 --- a/substrate/frame/revive/src/limits.rs +++ b/substrate/frame/revive/src/limits.rs @@ -129,23 +129,36 @@ pub mod code { Error::::CodeRejected })?; + if !program.is_64_bit() { + log::debug!(target: LOG_TARGET, "32bit programs are not supported."); + Err(Error::::CodeRejected)?; + } + // This scans the whole program but we only do it once on code deployment. // It is safe to do unchecked math in u32 because the size of the program // was already checked above. - use polkavm::program::ISA32_V1_NoSbrk as ISA; + use polkavm::program::ISA64_V1 as ISA; let mut num_instructions: u32 = 0; let mut max_basic_block_size: u32 = 0; let mut basic_block_size: u32 = 0; for inst in program.instructions(ISA) { + use polkavm::program::Instruction; num_instructions += 1; basic_block_size += 1; if inst.kind.opcode().starts_new_basic_block() { max_basic_block_size = max_basic_block_size.max(basic_block_size); basic_block_size = 0; } - if matches!(inst.kind, polkavm::program::Instruction::invalid) { - log::debug!(target: LOG_TARGET, "invalid instruction at offset {}", inst.offset); - return Err(>::InvalidInstruction.into()) + match inst.kind { + Instruction::invalid => { + log::debug!(target: LOG_TARGET, "invalid instruction at offset {}", inst.offset); + return Err(>::InvalidInstruction.into()) + }, + Instruction::sbrk(_, _) => { + log::debug!(target: LOG_TARGET, "sbrk instruction is not allowed. offset {}", inst.offset); + return Err(>::InvalidInstruction.into()) + }, + _ => (), } } diff --git a/substrate/frame/revive/src/wasm/mod.rs b/substrate/frame/revive/src/wasm/mod.rs index f10c4f5fddf8..d87ec7112286 100644 --- a/substrate/frame/revive/src/wasm/mod.rs +++ b/substrate/frame/revive/src/wasm/mod.rs @@ -293,8 +293,15 @@ impl WasmBlob { ) -> Result, ExecError> { let mut config = polkavm::Config::default(); config.set_backend(Some(polkavm::BackendKind::Interpreter)); - let engine = - polkavm::Engine::new(&config).expect("interpreter is available on all plattforms; qed"); + config.set_cache_enabled(false); + #[cfg(feature = "std")] + if std::env::var_os("REVIVE_USE_COMPILER").is_some() { + config.set_backend(Some(polkavm::BackendKind::Compiler)); + } + let engine = polkavm::Engine::new(&config).expect( + "on-chain (no_std) use of interpreter is hard coded. + interpreter is available on all plattforms; qed", + ); let mut module_config = polkavm::ModuleConfig::new(); module_config.set_page_size(limits::PAGE_SIZE); @@ -306,6 +313,15 @@ impl WasmBlob { Error::::CodeRejected })?; + // This is checked at deploy time but we also want to reject pre-existing + // 32bit programs. + // TODO: Remove when we reset the test net. + // https://github.com/paritytech/contract-issues/issues/11 + if !module.is_64_bit() { + log::debug!(target: LOG_TARGET, "32bit programs are not supported."); + Err(Error::::CodeRejected)?; + } + let entry_program_counter = module .exports() .find(|export| export.symbol().as_bytes() == entry_point.identifier().as_bytes()) diff --git a/substrate/frame/revive/src/wasm/runtime.rs b/substrate/frame/revive/src/wasm/runtime.rs index 3e2c83db1ebd..7ea518081e23 100644 --- a/substrate/frame/revive/src/wasm/runtime.rs +++ b/substrate/frame/revive/src/wasm/runtime.rs @@ -27,7 +27,7 @@ use crate::{ Config, Error, LOG_TARGET, SENTINEL, }; use alloc::{boxed::Box, vec, vec::Vec}; -use codec::{Decode, DecodeLimit, Encode, MaxEncodedLen}; +use codec::{Decode, DecodeLimit, Encode}; use core::{fmt, marker::PhantomData, mem}; use frame_support::{ dispatch::DispatchInfo, ensure, pallet_prelude::DispatchResultWithPostInfo, parameter_types, @@ -126,34 +126,13 @@ pub trait Memory { /// /// # Note /// - /// There must be an extra benchmark for determining the influence of `len` with - /// regard to the overall weight. + /// Make sure to charge a proportional amount of weight if `len` is not fixed. fn read_as_unbounded(&self, ptr: u32, len: u32) -> Result { let buf = self.read(ptr, len)?; let decoded = D::decode_all_with_depth_limit(MAX_DECODE_NESTING, &mut buf.as_ref()) .map_err(|_| DispatchError::from(Error::::DecodingFailed))?; Ok(decoded) } - - /// Reads and decodes a type with a size fixed at compile time from contract memory. - /// - /// # Only use on fixed size types - /// - /// Don't use this for types where the encoded size is not fixed but merely bounded. Otherwise - /// this implementation will out of bound access the buffer declared by the guest. Some examples - /// of those bounded but not fixed types: Enums with data, `BoundedVec` or any compact encoded - /// integer. - /// - /// # Note - /// - /// The weight of reading a fixed value is included in the overall weight of any - /// contract callable function. - fn read_as(&self, ptr: u32) -> Result { - let buf = self.read(ptr, D::max_encoded_len() as u32)?; - let decoded = D::decode_with_depth_limit(MAX_DECODE_NESTING, &mut buf.as_ref()) - .map_err(|_| DispatchError::from(Error::::DecodingFailed))?; - Ok(decoded) - } } /// Allows syscalls access to the PolkaVM instance they are executing in. @@ -164,8 +143,8 @@ pub trait Memory { pub trait PolkaVmInstance: Memory { fn gas(&self) -> polkavm::Gas; fn set_gas(&mut self, gas: polkavm::Gas); - fn read_input_regs(&self) -> (u32, u32, u32, u32, u32, u32); - fn write_output(&mut self, output: u32); + fn read_input_regs(&self) -> (u64, u64, u64, u64, u64, u64); + fn write_output(&mut self, output: u64); } // Memory implementation used in benchmarking where guest memory is mapped into the host. @@ -214,7 +193,7 @@ impl PolkaVmInstance for polkavm::RawInstance { self.set_gas(gas) } - fn read_input_regs(&self) -> (u32, u32, u32, u32, u32, u32) { + fn read_input_regs(&self) -> (u64, u64, u64, u64, u64, u64) { ( self.reg(polkavm::Reg::A0), self.reg(polkavm::Reg::A1), @@ -225,7 +204,7 @@ impl PolkaVmInstance for polkavm::RawInstance { ) } - fn write_output(&mut self, output: u32) { + fn write_output(&mut self, output: u64) { self.set_reg(polkavm::Reg::A0, output); } } diff --git a/substrate/frame/revive/uapi/Cargo.toml b/substrate/frame/revive/uapi/Cargo.toml index 0c7461a35d69..b55391dd5d6c 100644 --- a/substrate/frame/revive/uapi/Cargo.toml +++ b/substrate/frame/revive/uapi/Cargo.toml @@ -20,11 +20,11 @@ codec = { features = [ "max-encoded-len", ], optional = true, workspace = true } -[target.'cfg(target_arch = "riscv32")'.dependencies] -polkavm-derive = { version = "0.14.0" } +[target.'cfg(target_arch = "riscv64")'.dependencies] +polkavm-derive = { version = "0.17.0" } [package.metadata.docs.rs] -default-target = ["wasm32-unknown-unknown"] +default-target = ["riscv64imac-unknown-none-elf"] [features] default = ["scale"] diff --git a/substrate/frame/revive/uapi/src/host.rs b/substrate/frame/revive/uapi/src/host.rs index 6b3a8b07f040..d3fd4ac8d03e 100644 --- a/substrate/frame/revive/uapi/src/host.rs +++ b/substrate/frame/revive/uapi/src/host.rs @@ -14,8 +14,8 @@ use crate::{CallFlags, Result, ReturnFlags, StorageFlags}; use paste::paste; -#[cfg(target_arch = "riscv32")] -mod riscv32; +#[cfg(target_arch = "riscv64")] +mod riscv64; macro_rules! hash_fn { ( $name:ident, $bytes:literal ) => { diff --git a/substrate/frame/revive/uapi/src/host/riscv32.rs b/substrate/frame/revive/uapi/src/host/riscv64.rs similarity index 93% rename from substrate/frame/revive/uapi/src/host/riscv32.rs rename to substrate/frame/revive/uapi/src/host/riscv64.rs index e8b27057ed18..3cba14db6a04 100644 --- a/substrate/frame/revive/uapi/src/host/riscv32.rs +++ b/substrate/frame/revive/uapi/src/host/riscv64.rs @@ -26,10 +26,10 @@ mod sys { mod abi {} impl abi::FromHost for ReturnCode { - type Regs = (u32,); + type Regs = (u64,); fn from_host((a0,): Self::Regs) -> Self { - ReturnCode(a0) + ReturnCode(a0 as _) } } @@ -207,33 +207,33 @@ impl HostFn for HostFnImpl { let (output_ptr, mut output_len) = ptr_len_or_sentinel(&mut output); let deposit_limit_ptr = ptr_or_sentinel(&deposit_limit); let salt_ptr = ptr_or_sentinel(&salt); - #[repr(packed)] + #[repr(C)] #[allow(dead_code)] struct Args { - code_hash: *const u8, + code_hash: u32, ref_time_limit: u64, proof_size_limit: u64, - deposit_limit: *const u8, - value: *const u8, - input: *const u8, + deposit_limit: u32, + value: u32, + input: u32, input_len: u32, - address: *const u8, - output: *mut u8, - output_len: *mut u32, - salt: *const u8, + address: u32, + output: u32, + output_len: u32, + salt: u32, } let args = Args { - code_hash: code_hash.as_ptr(), + code_hash: code_hash.as_ptr() as _, ref_time_limit, proof_size_limit, - deposit_limit: deposit_limit_ptr, - value: value.as_ptr(), - input: input.as_ptr(), + deposit_limit: deposit_limit_ptr as _, + value: value.as_ptr() as _, + input: input.as_ptr() as _, input_len: input.len() as _, - address, - output: output_ptr, - output_len: &mut output_len as *mut _, - salt: salt_ptr, + address: address as _, + output: output_ptr as _, + output_len: &mut output_len as *mut _ as _, + salt: salt_ptr as _, }; let ret_code = { unsafe { sys::instantiate(&args as *const Args as *const _) } }; @@ -257,31 +257,31 @@ impl HostFn for HostFnImpl { ) -> Result { let (output_ptr, mut output_len) = ptr_len_or_sentinel(&mut output); let deposit_limit_ptr = ptr_or_sentinel(&deposit_limit); - #[repr(packed)] + #[repr(C)] #[allow(dead_code)] struct Args { flags: u32, - callee: *const u8, + callee: u32, ref_time_limit: u64, proof_size_limit: u64, - deposit_limit: *const u8, - value: *const u8, - input: *const u8, + deposit_limit: u32, + value: u32, + input: u32, input_len: u32, - output: *mut u8, - output_len: *mut u32, + output: u32, + output_len: u32, } let args = Args { flags: flags.bits(), - callee: callee.as_ptr(), + callee: callee.as_ptr() as _, ref_time_limit, proof_size_limit, - deposit_limit: deposit_limit_ptr, - value: value.as_ptr(), - input: input.as_ptr(), + deposit_limit: deposit_limit_ptr as _, + value: value.as_ptr() as _, + input: input.as_ptr() as _, input_len: input.len() as _, - output: output_ptr, - output_len: &mut output_len as *mut _, + output: output_ptr as _, + output_len: &mut output_len as *mut _ as _, }; let ret_code = { unsafe { sys::call(&args as *const Args as *const _) } }; @@ -308,29 +308,29 @@ impl HostFn for HostFnImpl { ) -> Result { let (output_ptr, mut output_len) = ptr_len_or_sentinel(&mut output); let deposit_limit_ptr = ptr_or_sentinel(&deposit_limit); - #[repr(packed)] + #[repr(C)] #[allow(dead_code)] struct Args { flags: u32, - address: *const u8, + address: u32, ref_time_limit: u64, proof_size_limit: u64, - deposit_limit: *const u8, - input: *const u8, + deposit_limit: u32, + input: u32, input_len: u32, - output: *mut u8, - output_len: *mut u32, + output: u32, + output_len: u32, } let args = Args { flags: flags.bits(), - address: address.as_ptr(), + address: address.as_ptr() as _, ref_time_limit, proof_size_limit, - deposit_limit: deposit_limit_ptr, - input: input.as_ptr(), + deposit_limit: deposit_limit_ptr as _, + input: input.as_ptr() as _, input_len: input.len() as _, - output: output_ptr, - output_len: &mut output_len as *mut _, + output: output_ptr as _, + output_len: &mut output_len as *mut _ as _, }; let ret_code = { unsafe { sys::delegate_call(&args as *const Args as *const _) } }; diff --git a/substrate/frame/revive/uapi/src/lib.rs b/substrate/frame/revive/uapi/src/lib.rs index e660ce36ef75..91c2543bb719 100644 --- a/substrate/frame/revive/uapi/src/lib.rs +++ b/substrate/frame/revive/uapi/src/lib.rs @@ -65,6 +65,12 @@ impl From for u32 { } } +impl From for u64 { + fn from(error: ReturnErrorCode) -> Self { + u32::from(error).into() + } +} + define_error_codes! { /// The called function trapped and has its state changes reverted. /// In this case no output buffer is returned. From 1e89a311471eba937a9552d7d1f55af1661feb08 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Bastian=20K=C3=B6cher?= Date: Fri, 29 Nov 2024 14:09:49 +0100 Subject: [PATCH 48/64] Fix runtime api impl detection by construct runtime (#6665) Construct runtime uses autoref-based specialization to fetch the metadata about the implemented runtime apis. This is done to not fail to compile when there are no runtime apis implemented. However, there was an issue with detecting runtime apis when they were implemented in a different file. The problem is solved by moving the trait implemented by `impl_runtime_apis!` to the metadata ir crate. Closes: https://github.com/paritytech/polkadot-sdk/issues/6659 --------- Co-authored-by: GitHub Action --- Cargo.lock | 1 + prdoc/pr_6665.prdoc | 15 ++++++ .../src/construct_runtime/expand/metadata.rs | 2 + .../procedural/src/construct_runtime/mod.rs | 3 +- .../support/test/tests/runtime_metadata.rs | 49 ++++++++++--------- .../api/proc-macro/src/runtime_metadata.rs | 6 +-- substrate/primitives/api/test/Cargo.toml | 3 +- .../api/test/tests/decl_and_impl.rs | 2 + substrate/primitives/metadata-ir/src/lib.rs | 10 ++++ 9 files changed, 62 insertions(+), 29 deletions(-) create mode 100644 prdoc/pr_6665.prdoc diff --git a/Cargo.lock b/Cargo.lock index e1abeea49283..5e4e9c267b08 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -25548,6 +25548,7 @@ dependencies = [ "sp-api 26.0.0", "sp-consensus", "sp-core 28.0.0", + "sp-metadata-ir 0.6.0", "sp-runtime 31.0.1", "sp-state-machine 0.35.0", "sp-tracing 16.0.0", diff --git a/prdoc/pr_6665.prdoc b/prdoc/pr_6665.prdoc new file mode 100644 index 000000000000..b5aaf8a3b184 --- /dev/null +++ b/prdoc/pr_6665.prdoc @@ -0,0 +1,15 @@ +title: Fix runtime api impl detection by construct runtime +doc: +- audience: Runtime Dev + description: |- + Construct runtime uses autoref-based specialization to fetch the metadata about the implemented runtime apis. This is done to not fail to compile when there are no runtime apis implemented. However, there was an issue with detecting runtime apis when they were implemented in a different file. The problem is solved by moving the trait implemented by `impl_runtime_apis!` to the metadata ir crate. + + + Closes: https://github.com/paritytech/polkadot-sdk/issues/6659 +crates: +- name: frame-support-procedural + bump: patch +- name: sp-api-proc-macro + bump: patch +- name: sp-metadata-ir + bump: patch diff --git a/substrate/frame/support/procedural/src/construct_runtime/expand/metadata.rs b/substrate/frame/support/procedural/src/construct_runtime/expand/metadata.rs index 4590a3a7f490..0b3bd5168865 100644 --- a/substrate/frame/support/procedural/src/construct_runtime/expand/metadata.rs +++ b/substrate/frame/support/procedural/src/construct_runtime/expand/metadata.rs @@ -113,6 +113,8 @@ pub fn expand_runtime_metadata( <#extrinsic as #scrate::traits::SignedTransactionBuilder>::Extension >(); + use #scrate::__private::metadata_ir::InternalImplRuntimeApis; + #scrate::__private::metadata_ir::MetadataIR { pallets: #scrate::__private::vec![ #(#pallets),* ], extrinsic: #scrate::__private::metadata_ir::ExtrinsicMetadataIR { diff --git a/substrate/frame/support/procedural/src/construct_runtime/mod.rs b/substrate/frame/support/procedural/src/construct_runtime/mod.rs index 17042c248780..087faf37252d 100644 --- a/substrate/frame/support/procedural/src/construct_runtime/mod.rs +++ b/substrate/frame/support/procedural/src/construct_runtime/mod.rs @@ -466,7 +466,6 @@ fn construct_runtime_final_expansion( // Therefore, the `Deref` trait will resolve the `runtime_metadata` from `impl_runtime_apis!` // when both macros are called; and will resolve an empty `runtime_metadata` when only the `construct_runtime!` // is called. - #[doc(hidden)] trait InternalConstructRuntime { #[inline(always)] @@ -477,6 +476,8 @@ fn construct_runtime_final_expansion( #[doc(hidden)] impl InternalConstructRuntime for &#name {} + use #scrate::__private::metadata_ir::InternalImplRuntimeApis; + #outer_event #outer_error diff --git a/substrate/frame/support/test/tests/runtime_metadata.rs b/substrate/frame/support/test/tests/runtime_metadata.rs index 7523a415d458..a098643abb91 100644 --- a/substrate/frame/support/test/tests/runtime_metadata.rs +++ b/substrate/frame/support/test/tests/runtime_metadata.rs @@ -80,34 +80,39 @@ sp_api::decl_runtime_apis! { } } -sp_api::impl_runtime_apis! { - impl self::Api for Runtime { - fn test(_data: u64) { - unimplemented!() - } +// Module to emulate having the implementation in a different file. +mod apis { + use super::{Block, BlockT, Runtime}; - fn something_with_block(_: Block) -> Block { - unimplemented!() - } + sp_api::impl_runtime_apis! { + impl crate::Api for Runtime { + fn test(_data: u64) { + unimplemented!() + } - fn function_with_two_args(_: u64, _: Block) { - unimplemented!() - } + fn something_with_block(_: Block) -> Block { + unimplemented!() + } - fn same_name() {} + fn function_with_two_args(_: u64, _: Block) { + unimplemented!() + } - fn wild_card(_: u32) {} - } + fn same_name() {} - impl sp_api::Core for Runtime { - fn version() -> sp_version::RuntimeVersion { - unimplemented!() - } - fn execute_block(_: Block) { - unimplemented!() + fn wild_card(_: u32) {} } - fn initialize_block(_: &::Header) -> sp_runtime::ExtrinsicInclusionMode { - unimplemented!() + + impl sp_api::Core for Runtime { + fn version() -> sp_version::RuntimeVersion { + unimplemented!() + } + fn execute_block(_: Block) { + unimplemented!() + } + fn initialize_block(_: &::Header) -> sp_runtime::ExtrinsicInclusionMode { + unimplemented!() + } } } } diff --git a/substrate/primitives/api/proc-macro/src/runtime_metadata.rs b/substrate/primitives/api/proc-macro/src/runtime_metadata.rs index 6be396339259..1706f8ca6fbb 100644 --- a/substrate/primitives/api/proc-macro/src/runtime_metadata.rs +++ b/substrate/primitives/api/proc-macro/src/runtime_metadata.rs @@ -298,18 +298,14 @@ pub fn generate_impl_runtime_metadata(impls: &[ItemImpl]) -> Result #crate_::vec::Vec<#crate_::metadata_ir::RuntimeApiMetadataIR> { #crate_::vec![ #( #metadata, )* ] } } - #[doc(hidden)] - impl InternalImplRuntimeApis for #runtime_name {} } )) } diff --git a/substrate/primitives/api/test/Cargo.toml b/substrate/primitives/api/test/Cargo.toml index 1d21f23eb804..27f6dafa24bf 100644 --- a/substrate/primitives/api/test/Cargo.toml +++ b/substrate/primitives/api/test/Cargo.toml @@ -21,6 +21,7 @@ sp-version = { workspace = true, default-features = true } sp-tracing = { workspace = true, default-features = true } sp-runtime = { workspace = true, default-features = true } sp-consensus = { workspace = true, default-features = true } +sp-metadata-ir = { workspace = true, default-features = true } sc-block-builder = { workspace = true, default-features = true } codec = { workspace = true, default-features = true } sp-state-machine = { workspace = true, default-features = true } @@ -40,5 +41,5 @@ name = "bench" harness = false [features] -"enable-staging-api" = [] +enable-staging-api = [] disable-ui-tests = [] diff --git a/substrate/primitives/api/test/tests/decl_and_impl.rs b/substrate/primitives/api/test/tests/decl_and_impl.rs index 890cf6eccdbc..2e5a078cb382 100644 --- a/substrate/primitives/api/test/tests/decl_and_impl.rs +++ b/substrate/primitives/api/test/tests/decl_and_impl.rs @@ -309,6 +309,8 @@ fn mock_runtime_api_works_with_advanced() { #[test] fn runtime_api_metadata_matches_version_implemented() { + use sp_metadata_ir::InternalImplRuntimeApis; + let rt = Runtime {}; let runtime_metadata = rt.runtime_metadata(); diff --git a/substrate/primitives/metadata-ir/src/lib.rs b/substrate/primitives/metadata-ir/src/lib.rs index bf234432a1a6..dc01f7eaadb3 100644 --- a/substrate/primitives/metadata-ir/src/lib.rs +++ b/substrate/primitives/metadata-ir/src/lib.rs @@ -87,6 +87,16 @@ pub fn into_unstable(metadata: MetadataIR) -> RuntimeMetadataPrefixed { latest.into() } +/// INTERNAL USE ONLY +/// +/// Special trait that is used together with `InternalConstructRuntime` by `construct_runtime!` to +/// fetch the runtime api metadata without exploding when there is no runtime api implementation +/// available. +#[doc(hidden)] +pub trait InternalImplRuntimeApis { + fn runtime_metadata(&self) -> alloc::vec::Vec; +} + #[cfg(test)] mod test { use super::*; From 4e7c968ae97c66812df989117ad251cba3864632 Mon Sep 17 00:00:00 2001 From: Alexandru Vasile <60601340+lexnv@users.noreply.github.com> Date: Fri, 29 Nov 2024 16:49:45 +0200 Subject: [PATCH 49/64] archive: Refactor `archive_storage` method into subscription (#6483) This PR adapts the `archive_storage` implementation from a method to a subscription. This keeps the archive APIs uniform and consistent. Builds on: https://github.com/paritytech/polkadot-sdk/pull/5997 cc @paritytech/subxt-team --------- Signed-off-by: Alexandru Vasile Co-authored-by: James Wilson --- .../client/rpc-spec-v2/src/archive/api.rs | 13 +- .../client/rpc-spec-v2/src/archive/archive.rs | 202 +++---- .../src/archive/archive_storage.rs | 105 +--- .../client/rpc-spec-v2/src/archive/mod.rs | 2 +- .../client/rpc-spec-v2/src/archive/tests.rs | 500 +++++++----------- .../rpc-spec-v2/src/chain_head/event.rs | 3 +- .../client/rpc-spec-v2/src/common/events.rs | 59 ++- .../client/rpc-spec-v2/src/common/storage.rs | 151 ++++-- substrate/client/service/src/builder.rs | 2 - 9 files changed, 458 insertions(+), 579 deletions(-) diff --git a/substrate/client/rpc-spec-v2/src/archive/api.rs b/substrate/client/rpc-spec-v2/src/archive/api.rs index dcfeaecb147b..a205d0502c93 100644 --- a/substrate/client/rpc-spec-v2/src/archive/api.rs +++ b/substrate/client/rpc-spec-v2/src/archive/api.rs @@ -20,8 +20,7 @@ use crate::{ common::events::{ - ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageResult, - PaginatedStorageQuery, + ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageEvent, StorageQuery, }, MethodResult, }; @@ -100,13 +99,17 @@ pub trait ArchiveApi { /// # Unstable /// /// This method is unstable and subject to change in the future. - #[method(name = "archive_unstable_storage", blocking)] + #[subscription( + name = "archive_unstable_storage" => "archive_unstable_storageEvent", + unsubscribe = "archive_unstable_stopStorage", + item = ArchiveStorageEvent, + )] fn archive_unstable_storage( &self, hash: Hash, - items: Vec>, + items: Vec>, child_trie: Option, - ) -> RpcResult; + ); /// Returns the storage difference between two blocks. /// diff --git a/substrate/client/rpc-spec-v2/src/archive/archive.rs b/substrate/client/rpc-spec-v2/src/archive/archive.rs index 55054d91d85d..62e44a016241 100644 --- a/substrate/client/rpc-spec-v2/src/archive/archive.rs +++ b/substrate/client/rpc-spec-v2/src/archive/archive.rs @@ -20,13 +20,13 @@ use crate::{ archive::{ - archive_storage::{ArchiveStorage, ArchiveStorageDiff}, - error::Error as ArchiveError, - ArchiveApiServer, + archive_storage::ArchiveStorageDiff, error::Error as ArchiveError, ArchiveApiServer, }, - common::events::{ - ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageResult, - PaginatedStorageQuery, + common::{ + events::{ + ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageEvent, StorageQuery, + }, + storage::{QueryResult, StorageSubscriptionClient}, }, hex_string, MethodResult, SubscriptionTaskExecutor, }; @@ -57,42 +57,12 @@ use tokio::sync::mpsc; pub(crate) const LOG_TARGET: &str = "rpc-spec-v2::archive"; -/// The configuration of [`Archive`]. -pub struct ArchiveConfig { - /// The maximum number of items the `archive_storage` can return for a descendant query before - /// pagination is required. - pub max_descendant_responses: usize, - /// The maximum number of queried items allowed for the `archive_storage` at a time. - pub max_queried_items: usize, -} - -/// The maximum number of items the `archive_storage` can return for a descendant query before -/// pagination is required. -/// -/// Note: this is identical to the `chainHead` value. -const MAX_DESCENDANT_RESPONSES: usize = 5; - -/// The maximum number of queried items allowed for the `archive_storage` at a time. -/// -/// Note: A queried item can also be a descendant query which can return up to -/// `MAX_DESCENDANT_RESPONSES`. -const MAX_QUERIED_ITEMS: usize = 8; - /// The buffer capacity for each storage query. /// /// This is small because the underlying JSON-RPC server has /// its down buffer capacity per connection as well. const STORAGE_QUERY_BUF: usize = 16; -impl Default for ArchiveConfig { - fn default() -> Self { - Self { - max_descendant_responses: MAX_DESCENDANT_RESPONSES, - max_queried_items: MAX_QUERIED_ITEMS, - } - } -} - /// An API for archive RPC calls. pub struct Archive, Block: BlockT, Client> { /// Substrate client. @@ -103,11 +73,6 @@ pub struct Archive, Block: BlockT, Client> { executor: SubscriptionTaskExecutor, /// The hexadecimal encoded hash of the genesis block. genesis_hash: String, - /// The maximum number of items the `archive_storage` can return for a descendant query before - /// pagination is required. - storage_max_descendant_responses: usize, - /// The maximum number of queried items allowed for the `archive_storage` at a time. - storage_max_queried_items: usize, /// Phantom member to pin the block type. _phantom: PhantomData, } @@ -119,18 +84,9 @@ impl, Block: BlockT, Client> Archive { backend: Arc, genesis_hash: GenesisHash, executor: SubscriptionTaskExecutor, - config: ArchiveConfig, ) -> Self { let genesis_hash = hex_string(&genesis_hash.as_ref()); - Self { - client, - backend, - executor, - genesis_hash, - storage_max_descendant_responses: config.max_descendant_responses, - storage_max_queried_items: config.max_queried_items, - _phantom: PhantomData, - } + Self { client, backend, executor, genesis_hash, _phantom: PhantomData } } } @@ -260,47 +216,53 @@ where fn archive_unstable_storage( &self, + pending: PendingSubscriptionSink, hash: Block::Hash, - items: Vec>, + items: Vec>, child_trie: Option, - ) -> RpcResult { - let items = items - .into_iter() - .map(|query| { - let key = StorageKey(parse_hex_param(query.key)?); - let pagination_start_key = query - .pagination_start_key - .map(|key| parse_hex_param(key).map(|key| StorageKey(key))) - .transpose()?; - - // Paginated start key is only supported - if pagination_start_key.is_some() && !query.query_type.is_descendant_query() { - return Err(ArchiveError::InvalidParam( - "Pagination start key is only supported for descendants queries" - .to_string(), - )) - } + ) { + let mut storage_client = + StorageSubscriptionClient::::new(self.client.clone()); + + let fut = async move { + let Ok(mut sink) = pending.accept().await.map(Subscription::from) else { return }; - Ok(PaginatedStorageQuery { - key, - query_type: query.query_type, - pagination_start_key, + let items = match items + .into_iter() + .map(|query| { + let key = StorageKey(parse_hex_param(query.key)?); + Ok(StorageQuery { key, query_type: query.query_type }) }) - }) - .collect::, ArchiveError>>()?; + .collect::, ArchiveError>>() + { + Ok(items) => items, + Err(error) => { + let _ = sink.send(&ArchiveStorageEvent::err(error.to_string())); + return + }, + }; - let child_trie = child_trie - .map(|child_trie| parse_hex_param(child_trie)) - .transpose()? - .map(ChildInfo::new_default_from_vec); + let child_trie = child_trie.map(|child_trie| parse_hex_param(child_trie)).transpose(); + let child_trie = match child_trie { + Ok(child_trie) => child_trie.map(ChildInfo::new_default_from_vec), + Err(error) => { + let _ = sink.send(&ArchiveStorageEvent::err(error.to_string())); + return + }, + }; - let storage_client = ArchiveStorage::new( - self.client.clone(), - self.storage_max_descendant_responses, - self.storage_max_queried_items, - ); + let (tx, mut rx) = tokio::sync::mpsc::channel(STORAGE_QUERY_BUF); + let storage_fut = storage_client.generate_events(hash, items, child_trie, tx); - Ok(storage_client.handle_query(hash, items, child_trie)) + // We don't care about the return value of this join: + // - process_events might encounter an error (if the client disconnected) + // - storage_fut might encounter an error while processing a trie queries and + // the error is propagated via the sink. + let _ = futures::future::join(storage_fut, process_storage_events(&mut rx, &mut sink)) + .await; + }; + + self.executor.spawn("substrate-rpc-subscription", Some("rpc"), fut.boxed()); } fn archive_unstable_storage_diff( @@ -337,24 +299,74 @@ where // - process_events might encounter an error (if the client disconnected) // - storage_fut might encounter an error while processing a trie queries and // the error is propagated via the sink. - let _ = futures::future::join(storage_fut, process_events(&mut rx, &mut sink)).await; + let _ = + futures::future::join(storage_fut, process_storage_diff_events(&mut rx, &mut sink)) + .await; }; self.executor.spawn("substrate-rpc-subscription", Some("rpc"), fut.boxed()); } } -/// Sends all the events to the sink. -async fn process_events(rx: &mut mpsc::Receiver, sink: &mut Subscription) { - while let Some(event) = rx.recv().await { - if event.is_done() { - log::debug!(target: LOG_TARGET, "Finished processing partial trie query"); - } else if event.is_err() { - log::debug!(target: LOG_TARGET, "Error encountered while processing partial trie query"); +/// Sends all the events of the storage_diff method to the sink. +async fn process_storage_diff_events( + rx: &mut mpsc::Receiver, + sink: &mut Subscription, +) { + loop { + tokio::select! { + _ = sink.closed() => { + return + }, + + maybe_event = rx.recv() => { + let Some(event) = maybe_event else { + break; + }; + + if event.is_done() { + log::debug!(target: LOG_TARGET, "Finished processing partial trie query"); + } else if event.is_err() { + log::debug!(target: LOG_TARGET, "Error encountered while processing partial trie query"); + } + + if sink.send(&event).await.is_err() { + return + } + } } + } +} + +/// Sends all the events of the storage method to the sink. +async fn process_storage_events(rx: &mut mpsc::Receiver, sink: &mut Subscription) { + loop { + tokio::select! { + _ = sink.closed() => { + break + } + + maybe_storage = rx.recv() => { + let Some(event) = maybe_storage else { + break; + }; + + match event { + Ok(None) => continue, + + Ok(Some(event)) => + if sink.send(&ArchiveStorageEvent::result(event)).await.is_err() { + return + }, - if sink.send(&event).await.is_err() { - return + Err(error) => { + let _ = sink.send(&ArchiveStorageEvent::err(error)).await; + return + } + } + } } } + + let _ = sink.send(&ArchiveStorageEvent::StorageDone).await; } diff --git a/substrate/client/rpc-spec-v2/src/archive/archive_storage.rs b/substrate/client/rpc-spec-v2/src/archive/archive_storage.rs index 5a3920882f00..390db765a48f 100644 --- a/substrate/client/rpc-spec-v2/src/archive/archive_storage.rs +++ b/substrate/client/rpc-spec-v2/src/archive/archive_storage.rs @@ -33,114 +33,13 @@ use crate::{ common::{ events::{ ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageDiffOperationType, - ArchiveStorageDiffResult, ArchiveStorageDiffType, ArchiveStorageResult, - PaginatedStorageQuery, StorageQueryType, StorageResult, + ArchiveStorageDiffResult, ArchiveStorageDiffType, StorageResult, }, - storage::{IterQueryType, QueryIter, Storage}, + storage::Storage, }, }; use tokio::sync::mpsc; -/// Generates the events of the `archive_storage` method. -pub struct ArchiveStorage { - /// Storage client. - client: Storage, - /// The maximum number of responses the API can return for a descendant query at a time. - storage_max_descendant_responses: usize, - /// The maximum number of queried items allowed for the `archive_storage` at a time. - storage_max_queried_items: usize, -} - -impl ArchiveStorage { - /// Constructs a new [`ArchiveStorage`]. - pub fn new( - client: Arc, - storage_max_descendant_responses: usize, - storage_max_queried_items: usize, - ) -> Self { - Self { - client: Storage::new(client), - storage_max_descendant_responses, - storage_max_queried_items, - } - } -} - -impl ArchiveStorage -where - Block: BlockT + 'static, - BE: Backend + 'static, - Client: StorageProvider + 'static, -{ - /// Generate the response of the `archive_storage` method. - pub fn handle_query( - &self, - hash: Block::Hash, - mut items: Vec>, - child_key: Option, - ) -> ArchiveStorageResult { - let discarded_items = items.len().saturating_sub(self.storage_max_queried_items); - items.truncate(self.storage_max_queried_items); - - let mut storage_results = Vec::with_capacity(items.len()); - for item in items { - match item.query_type { - StorageQueryType::Value => { - match self.client.query_value(hash, &item.key, child_key.as_ref()) { - Ok(Some(value)) => storage_results.push(value), - Ok(None) => continue, - Err(error) => return ArchiveStorageResult::err(error), - } - }, - StorageQueryType::Hash => - match self.client.query_hash(hash, &item.key, child_key.as_ref()) { - Ok(Some(value)) => storage_results.push(value), - Ok(None) => continue, - Err(error) => return ArchiveStorageResult::err(error), - }, - StorageQueryType::ClosestDescendantMerkleValue => - match self.client.query_merkle_value(hash, &item.key, child_key.as_ref()) { - Ok(Some(value)) => storage_results.push(value), - Ok(None) => continue, - Err(error) => return ArchiveStorageResult::err(error), - }, - StorageQueryType::DescendantsValues => { - match self.client.query_iter_pagination( - QueryIter { - query_key: item.key, - ty: IterQueryType::Value, - pagination_start_key: item.pagination_start_key, - }, - hash, - child_key.as_ref(), - self.storage_max_descendant_responses, - ) { - Ok((results, _)) => storage_results.extend(results), - Err(error) => return ArchiveStorageResult::err(error), - } - }, - StorageQueryType::DescendantsHashes => { - match self.client.query_iter_pagination( - QueryIter { - query_key: item.key, - ty: IterQueryType::Hash, - pagination_start_key: item.pagination_start_key, - }, - hash, - child_key.as_ref(), - self.storage_max_descendant_responses, - ) { - Ok((results, _)) => storage_results.extend(results), - Err(error) => return ArchiveStorageResult::err(error), - } - }, - }; - } - - ArchiveStorageResult::ok(storage_results, discarded_items) - } -} - /// Parse hex-encoded string parameter as raw bytes. /// /// If the parsing fails, returns an error propagated to the RPC method. diff --git a/substrate/client/rpc-spec-v2/src/archive/mod.rs b/substrate/client/rpc-spec-v2/src/archive/mod.rs index 5f020c203eab..14fa104c113a 100644 --- a/substrate/client/rpc-spec-v2/src/archive/mod.rs +++ b/substrate/client/rpc-spec-v2/src/archive/mod.rs @@ -32,4 +32,4 @@ pub mod archive; pub mod error; pub use api::ArchiveApiServer; -pub use archive::{Archive, ArchiveConfig}; +pub use archive::Archive; diff --git a/substrate/client/rpc-spec-v2/src/archive/tests.rs b/substrate/client/rpc-spec-v2/src/archive/tests.rs index 994c5d28bd61..cddaafde6659 100644 --- a/substrate/client/rpc-spec-v2/src/archive/tests.rs +++ b/substrate/client/rpc-spec-v2/src/archive/tests.rs @@ -19,16 +19,13 @@ use crate::{ common::events::{ ArchiveStorageDiffEvent, ArchiveStorageDiffItem, ArchiveStorageDiffOperationType, - ArchiveStorageDiffResult, ArchiveStorageDiffType, ArchiveStorageMethodOk, - ArchiveStorageResult, PaginatedStorageQuery, StorageQueryType, StorageResultType, + ArchiveStorageDiffResult, ArchiveStorageDiffType, ArchiveStorageEvent, StorageQuery, + StorageQueryType, StorageResult, StorageResultType, }, hex_string, MethodResult, }; -use super::{ - archive::{Archive, ArchiveConfig}, - *, -}; +use super::{archive::Archive, *}; use assert_matches::assert_matches; use codec::{Decode, Encode}; @@ -55,8 +52,6 @@ use substrate_test_runtime_client::{ const CHAIN_GENESIS: [u8; 32] = [0; 32]; const INVALID_HASH: [u8; 32] = [1; 32]; -const MAX_PAGINATION_LIMIT: usize = 5; -const MAX_QUERIED_LIMIT: usize = 5; const KEY: &[u8] = b":mock"; const VALUE: &[u8] = b"hello world"; const CHILD_STORAGE_KEY: &[u8] = b"child"; @@ -65,10 +60,7 @@ const CHILD_VALUE: &[u8] = b"child value"; type Header = substrate_test_runtime_client::runtime::Header; type Block = substrate_test_runtime_client::runtime::Block; -fn setup_api( - max_descendant_responses: usize, - max_queried_items: usize, -) -> (Arc>, RpcModule>>) { +fn setup_api() -> (Arc>, RpcModule>>) { let child_info = ChildInfo::new_default(CHILD_STORAGE_KEY); let builder = TestClientBuilder::new().add_extra_child_storage( &child_info, @@ -83,7 +75,6 @@ fn setup_api( backend, CHAIN_GENESIS, Arc::new(TokioTestExecutor::default()), - ArchiveConfig { max_descendant_responses, max_queried_items }, ) .into_rpc(); @@ -101,7 +92,7 @@ async fn get_next_event(sub: &mut RpcSubscriptio #[tokio::test] async fn archive_genesis() { - let (_client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (_client, api) = setup_api(); let genesis: String = api.call("archive_unstable_genesisHash", EmptyParams::new()).await.unwrap(); @@ -110,7 +101,7 @@ async fn archive_genesis() { #[tokio::test] async fn archive_body() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); // Invalid block hash. let invalid_hash = hex_string(&INVALID_HASH); @@ -144,7 +135,7 @@ async fn archive_body() { #[tokio::test] async fn archive_header() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); // Invalid block hash. let invalid_hash = hex_string(&INVALID_HASH); @@ -178,7 +169,7 @@ async fn archive_header() { #[tokio::test] async fn archive_finalized_height() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); let client_height: u32 = client.info().finalized_number.saturated_into(); @@ -190,7 +181,7 @@ async fn archive_finalized_height() { #[tokio::test] async fn archive_hash_by_height() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); // Genesis height. let hashes: Vec = api.call("archive_unstable_hashByHeight", [0]).await.unwrap(); @@ -296,7 +287,7 @@ async fn archive_hash_by_height() { #[tokio::test] async fn archive_call() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); let invalid_hash = hex_string(&INVALID_HASH); // Invalid parameter (non-hex). @@ -355,7 +346,7 @@ async fn archive_call() { #[tokio::test] async fn archive_storage_hashes_values() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); let block = BlockBuilderBuilder::new(&*client) .on_parent_block(client.chain_info().genesis_hash) @@ -369,42 +360,23 @@ async fn archive_storage_hashes_values() { let block_hash = format!("{:?}", block.header.hash()); let key = hex_string(&KEY); - let items: Vec> = vec![ - PaginatedStorageQuery { - key: key.clone(), - query_type: StorageQueryType::DescendantsHashes, - pagination_start_key: None, - }, - PaginatedStorageQuery { - key: key.clone(), - query_type: StorageQueryType::DescendantsValues, - pagination_start_key: None, - }, - PaginatedStorageQuery { - key: key.clone(), - query_type: StorageQueryType::Hash, - pagination_start_key: None, - }, - PaginatedStorageQuery { - key: key.clone(), - query_type: StorageQueryType::Value, - pagination_start_key: None, - }, + let items: Vec> = vec![ + StorageQuery { key: key.clone(), query_type: StorageQueryType::DescendantsHashes }, + StorageQuery { key: key.clone(), query_type: StorageQueryType::DescendantsValues }, + StorageQuery { key: key.clone(), query_type: StorageQueryType::Hash }, + StorageQuery { key: key.clone(), query_type: StorageQueryType::Value }, ]; - let result: ArchiveStorageResult = api - .call("archive_unstable_storage", rpc_params![&block_hash, items.clone()]) + let mut sub = api + .subscribe_unbounded("archive_unstable_storage", rpc_params![&block_hash, items.clone()]) .await .unwrap(); - match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, discarded_items }) => { - // Key has not been imported yet. - assert_eq!(result.len(), 0); - assert_eq!(discarded_items, 0); - }, - _ => panic!("Unexpected result"), - }; + // Key has not been imported yet. + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::StorageDone, + ); // Import a block with the given key value pair. let mut builder = BlockBuilderBuilder::new(&*client) @@ -420,32 +392,103 @@ async fn archive_storage_hashes_values() { let expected_hash = format!("{:?}", Blake2Hasher::hash(&VALUE)); let expected_value = hex_string(&VALUE); - let result: ArchiveStorageResult = api - .call("archive_unstable_storage", rpc_params![&block_hash, items]) + let mut sub = api + .subscribe_unbounded("archive_unstable_storage", rpc_params![&block_hash, items]) .await .unwrap(); - match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, discarded_items }) => { - assert_eq!(result.len(), 4); - assert_eq!(discarded_items, 0); - - assert_eq!(result[0].key, key); - assert_eq!(result[0].result, StorageResultType::Hash(expected_hash.clone())); - assert_eq!(result[1].key, key); - assert_eq!(result[1].result, StorageResultType::Value(expected_value.clone())); - assert_eq!(result[2].key, key); - assert_eq!(result[2].result, StorageResultType::Hash(expected_hash)); - assert_eq!(result[3].key, key); - assert_eq!(result[3].result, StorageResultType::Value(expected_value)); - }, - _ => panic!("Unexpected result"), - }; + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: key.clone(), + result: StorageResultType::Hash(expected_hash.clone()), + child_trie_key: None, + }), + ); + + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: key.clone(), + result: StorageResultType::Value(expected_value.clone()), + child_trie_key: None, + }), + ); + + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: key.clone(), + result: StorageResultType::Hash(expected_hash), + child_trie_key: None, + }), + ); + + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: key.clone(), + result: StorageResultType::Value(expected_value), + child_trie_key: None, + }), + ); + + assert_matches!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::StorageDone + ); +} + +#[tokio::test] +async fn archive_storage_hashes_values_child_trie() { + let (client, api) = setup_api(); + + // Get child storage values set in `setup_api`. + let child_info = hex_string(&CHILD_STORAGE_KEY); + let key = hex_string(&KEY); + let genesis_hash = format!("{:?}", client.genesis_hash()); + let expected_hash = format!("{:?}", Blake2Hasher::hash(&CHILD_VALUE)); + let expected_value = hex_string(&CHILD_VALUE); + + let items: Vec> = vec![ + StorageQuery { key: key.clone(), query_type: StorageQueryType::DescendantsHashes }, + StorageQuery { key: key.clone(), query_type: StorageQueryType::DescendantsValues }, + ]; + let mut sub = api + .subscribe_unbounded( + "archive_unstable_storage", + rpc_params![&genesis_hash, items, &child_info], + ) + .await + .unwrap(); + + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: key.clone(), + result: StorageResultType::Hash(expected_hash.clone()), + child_trie_key: Some(child_info.clone()), + }) + ); + + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: key.clone(), + result: StorageResultType::Value(expected_value.clone()), + child_trie_key: Some(child_info.clone()), + }) + ); + + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::StorageDone, + ); } #[tokio::test] async fn archive_storage_closest_merkle_value() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); /// The core of this test. /// @@ -457,55 +500,47 @@ async fn archive_storage_closest_merkle_value() { api: &RpcModule>>, block_hash: String, ) -> HashMap { - let result: ArchiveStorageResult = api - .call( + let mut sub = api + .subscribe_unbounded( "archive_unstable_storage", rpc_params![ &block_hash, vec![ - PaginatedStorageQuery { + StorageQuery { key: hex_string(b":AAAA"), query_type: StorageQueryType::ClosestDescendantMerkleValue, - pagination_start_key: None, }, - PaginatedStorageQuery { + StorageQuery { key: hex_string(b":AAAB"), query_type: StorageQueryType::ClosestDescendantMerkleValue, - pagination_start_key: None, }, // Key with descendant. - PaginatedStorageQuery { + StorageQuery { key: hex_string(b":A"), query_type: StorageQueryType::ClosestDescendantMerkleValue, - pagination_start_key: None, }, - PaginatedStorageQuery { + StorageQuery { key: hex_string(b":AA"), query_type: StorageQueryType::ClosestDescendantMerkleValue, - pagination_start_key: None, }, // Keys below this comment do not produce a result. // Key that exceed the keyspace of the trie. - PaginatedStorageQuery { + StorageQuery { key: hex_string(b":AAAAX"), query_type: StorageQueryType::ClosestDescendantMerkleValue, - pagination_start_key: None, }, - PaginatedStorageQuery { + StorageQuery { key: hex_string(b":AAABX"), query_type: StorageQueryType::ClosestDescendantMerkleValue, - pagination_start_key: None, }, // Key that are not part of the trie. - PaginatedStorageQuery { + StorageQuery { key: hex_string(b":AAX"), query_type: StorageQueryType::ClosestDescendantMerkleValue, - pagination_start_key: None, }, - PaginatedStorageQuery { + StorageQuery { key: hex_string(b":AAAX"), query_type: StorageQueryType::ClosestDescendantMerkleValue, - pagination_start_key: None, }, ] ], @@ -513,19 +548,21 @@ async fn archive_storage_closest_merkle_value() { .await .unwrap(); - let merkle_values: HashMap<_, _> = match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, .. }) => result - .into_iter() - .map(|res| { - let value = match res.result { + let mut merkle_values = HashMap::new(); + loop { + let event = get_next_event::(&mut sub).await; + match event { + ArchiveStorageEvent::Storage(result) => { + let str_result = match result.result { StorageResultType::ClosestDescendantMerkleValue(value) => value, - _ => panic!("Unexpected StorageResultType"), + _ => panic!("Unexpected result type"), }; - (res.key, value) - }) - .collect(), - _ => panic!("Unexpected result"), - }; + merkle_values.insert(result.key, str_result); + }, + ArchiveStorageEvent::StorageError(err) => panic!("Unexpected error {err:?}"), + ArchiveStorageEvent::StorageDone => break, + } + } // Response for AAAA, AAAB, A and AA. assert_eq!(merkle_values.len(), 4); @@ -604,9 +641,9 @@ async fn archive_storage_closest_merkle_value() { } #[tokio::test] -async fn archive_storage_paginate_iterations() { +async fn archive_storage_iterations() { // 1 iteration allowed before pagination kicks in. - let (client, api) = setup_api(1, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); // Import a new block with storage changes. let mut builder = BlockBuilderBuilder::new(&*client) @@ -625,237 +662,94 @@ async fn archive_storage_paginate_iterations() { // Calling with an invalid hash. let invalid_hash = hex_string(&INVALID_HASH); - let result: ArchiveStorageResult = api - .call( + let mut sub = api + .subscribe_unbounded( "archive_unstable_storage", rpc_params![ &invalid_hash, - vec![PaginatedStorageQuery { - key: hex_string(b":m"), - query_type: StorageQueryType::DescendantsValues, - pagination_start_key: None, - }] - ], - ) - .await - .unwrap(); - match result { - ArchiveStorageResult::Err(_) => (), - _ => panic!("Unexpected result"), - }; - - // Valid call with storage at the key. - let result: ArchiveStorageResult = api - .call( - "archive_unstable_storage", - rpc_params![ - &block_hash, - vec![PaginatedStorageQuery { - key: hex_string(b":m"), - query_type: StorageQueryType::DescendantsValues, - pagination_start_key: None, - }] - ], - ) - .await - .unwrap(); - match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, discarded_items }) => { - assert_eq!(result.len(), 1); - assert_eq!(discarded_items, 0); - - assert_eq!(result[0].key, hex_string(b":m")); - assert_eq!(result[0].result, StorageResultType::Value(hex_string(b"a"))); - }, - _ => panic!("Unexpected result"), - }; - - // Continue with pagination. - let result: ArchiveStorageResult = api - .call( - "archive_unstable_storage", - rpc_params![ - &block_hash, - vec![PaginatedStorageQuery { - key: hex_string(b":m"), - query_type: StorageQueryType::DescendantsValues, - pagination_start_key: Some(hex_string(b":m")), - }] - ], - ) - .await - .unwrap(); - match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, discarded_items }) => { - assert_eq!(result.len(), 1); - assert_eq!(discarded_items, 0); - - assert_eq!(result[0].key, hex_string(b":mo")); - assert_eq!(result[0].result, StorageResultType::Value(hex_string(b"ab"))); - }, - _ => panic!("Unexpected result"), - }; - - // Continue with pagination. - let result: ArchiveStorageResult = api - .call( - "archive_unstable_storage", - rpc_params![ - &block_hash, - vec![PaginatedStorageQuery { + vec![StorageQuery { key: hex_string(b":m"), query_type: StorageQueryType::DescendantsValues, - pagination_start_key: Some(hex_string(b":mo")), }] ], ) .await .unwrap(); - match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, discarded_items }) => { - assert_eq!(result.len(), 1); - assert_eq!(discarded_items, 0); - - assert_eq!(result[0].key, hex_string(b":moD")); - assert_eq!(result[0].result, StorageResultType::Value(hex_string(b"abcmoD"))); - }, - _ => panic!("Unexpected result"), - }; - // Continue with pagination. - let result: ArchiveStorageResult = api - .call( - "archive_unstable_storage", - rpc_params![ - &block_hash, - vec![PaginatedStorageQuery { - key: hex_string(b":m"), - query_type: StorageQueryType::DescendantsValues, - pagination_start_key: Some(hex_string(b":moD")), - }] - ], - ) - .await - .unwrap(); - match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, discarded_items }) => { - assert_eq!(result.len(), 1); - assert_eq!(discarded_items, 0); - - assert_eq!(result[0].key, hex_string(b":moc")); - assert_eq!(result[0].result, StorageResultType::Value(hex_string(b"abc"))); - }, - _ => panic!("Unexpected result"), - }; + assert_matches!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::StorageError(_) + ); - // Continue with pagination. - let result: ArchiveStorageResult = api - .call( + // Valid call with storage at the key. + let mut sub = api + .subscribe_unbounded( "archive_unstable_storage", rpc_params![ &block_hash, - vec![PaginatedStorageQuery { + vec![StorageQuery { key: hex_string(b":m"), query_type: StorageQueryType::DescendantsValues, - pagination_start_key: Some(hex_string(b":moc")), }] ], ) .await .unwrap(); - match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, discarded_items }) => { - assert_eq!(result.len(), 1); - assert_eq!(discarded_items, 0); - assert_eq!(result[0].key, hex_string(b":mock")); - assert_eq!(result[0].result, StorageResultType::Value(hex_string(b"abcd"))); - }, - _ => panic!("Unexpected result"), - }; + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: hex_string(b":m"), + result: StorageResultType::Value(hex_string(b"a")), + child_trie_key: None, + }) + ); - // Continue with pagination until no keys are returned. - let result: ArchiveStorageResult = api - .call( - "archive_unstable_storage", - rpc_params![ - &block_hash, - vec![PaginatedStorageQuery { - key: hex_string(b":m"), - query_type: StorageQueryType::DescendantsValues, - pagination_start_key: Some(hex_string(b":mock")), - }] - ], - ) - .await - .unwrap(); - match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, discarded_items }) => { - assert_eq!(result.len(), 0); - assert_eq!(discarded_items, 0); - }, - _ => panic!("Unexpected result"), - }; -} + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: hex_string(b":mo"), + result: StorageResultType::Value(hex_string(b"ab")), + child_trie_key: None, + }) + ); -#[tokio::test] -async fn archive_storage_discarded_items() { - // One query at a time - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, 1); + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: hex_string(b":moD"), + result: StorageResultType::Value(hex_string(b"abcmoD")), + child_trie_key: None, + }) + ); - // Import a new block with storage changes. - let mut builder = BlockBuilderBuilder::new(&*client) - .on_parent_block(client.chain_info().genesis_hash) - .with_parent_block_number(0) - .build() - .unwrap(); - builder.push_storage_change(b":m".to_vec(), Some(b"a".to_vec())).unwrap(); - let block = builder.build().unwrap().block; - let block_hash = format!("{:?}", block.header.hash()); - client.import(BlockOrigin::Own, block.clone()).await.unwrap(); + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: hex_string(b":moc"), + result: StorageResultType::Value(hex_string(b"abc")), + child_trie_key: None, + }) + ); - // Valid call with storage at the key. - let result: ArchiveStorageResult = api - .call( - "archive_unstable_storage", - rpc_params![ - &block_hash, - vec![ - PaginatedStorageQuery { - key: hex_string(b":m"), - query_type: StorageQueryType::Value, - pagination_start_key: None, - }, - PaginatedStorageQuery { - key: hex_string(b":m"), - query_type: StorageQueryType::Hash, - pagination_start_key: None, - }, - PaginatedStorageQuery { - key: hex_string(b":m"), - query_type: StorageQueryType::Hash, - pagination_start_key: None, - } - ] - ], - ) - .await - .unwrap(); - match result { - ArchiveStorageResult::Ok(ArchiveStorageMethodOk { result, discarded_items }) => { - assert_eq!(result.len(), 1); - assert_eq!(discarded_items, 2); + assert_eq!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::Storage(StorageResult { + key: hex_string(b":mock"), + result: StorageResultType::Value(hex_string(b"abcd")), + child_trie_key: None, + }) + ); - assert_eq!(result[0].key, hex_string(b":m")); - assert_eq!(result[0].result, StorageResultType::Value(hex_string(b"a"))); - }, - _ => panic!("Unexpected result"), - }; + assert_matches!( + get_next_event::(&mut sub).await, + ArchiveStorageEvent::StorageDone + ); } #[tokio::test] async fn archive_storage_diff_main_trie() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); let mut builder = BlockBuilderBuilder::new(&*client) .on_parent_block(client.chain_info().genesis_hash) @@ -965,7 +859,7 @@ async fn archive_storage_diff_main_trie() { #[tokio::test] async fn archive_storage_diff_no_changes() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); // Build 2 identical blocks. let mut builder = BlockBuilderBuilder::new(&*client) @@ -1012,7 +906,7 @@ async fn archive_storage_diff_no_changes() { #[tokio::test] async fn archive_storage_diff_deleted_changes() { - let (client, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (client, api) = setup_api(); // Blocks are imported as forks. let mut builder = BlockBuilderBuilder::new(&*client) @@ -1079,7 +973,7 @@ async fn archive_storage_diff_deleted_changes() { #[tokio::test] async fn archive_storage_diff_invalid_params() { let invalid_hash = hex_string(&INVALID_HASH); - let (_, api) = setup_api(MAX_PAGINATION_LIMIT, MAX_QUERIED_LIMIT); + let (_, api) = setup_api(); // Invalid shape for parameters. let items: Vec> = Vec::new(); diff --git a/substrate/client/rpc-spec-v2/src/chain_head/event.rs b/substrate/client/rpc-spec-v2/src/chain_head/event.rs index bd9863060910..de74145a3f08 100644 --- a/substrate/client/rpc-spec-v2/src/chain_head/event.rs +++ b/substrate/client/rpc-spec-v2/src/chain_head/event.rs @@ -235,7 +235,7 @@ pub struct OperationCallDone { pub output: String, } -/// The response of the `chainHead_call` method. +/// The response of the `chainHead_storage` method. #[derive(Debug, Clone, PartialEq, Serialize, Deserialize)] #[serde(rename_all = "camelCase")] pub struct OperationStorageItems { @@ -536,6 +536,7 @@ mod tests { items: vec![StorageResult { key: "0x1".into(), result: StorageResultType::Value("0x123".to_string()), + child_trie_key: None, }], }); diff --git a/substrate/client/rpc-spec-v2/src/common/events.rs b/substrate/client/rpc-spec-v2/src/common/events.rs index 198a60bf4cac..44f722c0c61b 100644 --- a/substrate/client/rpc-spec-v2/src/common/events.rs +++ b/substrate/client/rpc-spec-v2/src/common/events.rs @@ -78,6 +78,10 @@ pub struct StorageResult { /// The result of the query. #[serde(flatten)] pub result: StorageResultType, + /// The child trie key if provided. + #[serde(skip_serializing_if = "Option::is_none")] + #[serde(default)] + pub child_trie_key: Option, } /// The type of the storage query. @@ -105,23 +109,41 @@ pub struct StorageResultErr { /// The result of a storage call. #[derive(Debug, Clone, PartialEq, Serialize, Deserialize)] -#[serde(untagged)] -pub enum ArchiveStorageResult { +#[serde(rename_all = "camelCase")] +#[serde(tag = "event")] +pub enum ArchiveStorageEvent { /// Query generated a result. - Ok(ArchiveStorageMethodOk), + Storage(StorageResult), /// Query encountered an error. - Err(ArchiveStorageMethodErr), + StorageError(ArchiveStorageMethodErr), + /// Operation storage is done. + StorageDone, } -impl ArchiveStorageResult { - /// Create a new `ArchiveStorageResult::Ok` result. - pub fn ok(result: Vec, discarded_items: usize) -> Self { - Self::Ok(ArchiveStorageMethodOk { result, discarded_items }) +impl ArchiveStorageEvent { + /// Create a new `ArchiveStorageEvent::StorageErr` event. + pub fn err(error: String) -> Self { + Self::StorageError(ArchiveStorageMethodErr { error }) } - /// Create a new `ArchiveStorageResult::Err` result. - pub fn err(error: String) -> Self { - Self::Err(ArchiveStorageMethodErr { error }) + /// Create a new `ArchiveStorageEvent::StorageResult` event. + pub fn result(result: StorageResult) -> Self { + Self::Storage(result) + } + + /// Checks if the event is a `StorageDone` event. + pub fn is_done(&self) -> bool { + matches!(self, Self::StorageDone) + } + + /// Checks if the event is a `StorageErr` event. + pub fn is_err(&self) -> bool { + matches!(self, Self::StorageError(_)) + } + + /// Checks if the event is a `StorageResult` event. + pub fn is_result(&self) -> bool { + matches!(self, Self::Storage(_)) } } @@ -354,8 +376,11 @@ mod tests { #[test] fn storage_result() { // Item with Value. - let item = - StorageResult { key: "0x1".into(), result: StorageResultType::Value("res".into()) }; + let item = StorageResult { + key: "0x1".into(), + result: StorageResultType::Value("res".into()), + child_trie_key: None, + }; // Encode let ser = serde_json::to_string(&item).unwrap(); let exp = r#"{"key":"0x1","value":"res"}"#; @@ -365,8 +390,11 @@ mod tests { assert_eq!(dec, item); // Item with Hash. - let item = - StorageResult { key: "0x1".into(), result: StorageResultType::Hash("res".into()) }; + let item = StorageResult { + key: "0x1".into(), + result: StorageResultType::Hash("res".into()), + child_trie_key: None, + }; // Encode let ser = serde_json::to_string(&item).unwrap(); let exp = r#"{"key":"0x1","hash":"res"}"#; @@ -379,6 +407,7 @@ mod tests { let item = StorageResult { key: "0x1".into(), result: StorageResultType::ClosestDescendantMerkleValue("res".into()), + child_trie_key: None, }; // Encode let ser = serde_json::to_string(&item).unwrap(); diff --git a/substrate/client/rpc-spec-v2/src/common/storage.rs b/substrate/client/rpc-spec-v2/src/common/storage.rs index 673e20b2bc78..a1e34d51530e 100644 --- a/substrate/client/rpc-spec-v2/src/common/storage.rs +++ b/substrate/client/rpc-spec-v2/src/common/storage.rs @@ -24,7 +24,7 @@ use sc_client_api::{Backend, ChildInfo, StorageKey, StorageProvider}; use sp_runtime::traits::Block as BlockT; use tokio::sync::mpsc; -use super::events::{StorageResult, StorageResultType}; +use super::events::{StorageQuery, StorageQueryType, StorageResult, StorageResultType}; use crate::hex_string; /// Call into the storage of blocks. @@ -70,9 +70,6 @@ pub enum IterQueryType { /// The result of making a query call. pub type QueryResult = Result, String>; -/// The result of iterating over keys. -pub type QueryIterResult = Result<(Vec, Option), String>; - impl Storage where Block: BlockT + 'static, @@ -97,6 +94,7 @@ where QueryResult::Ok(opt.map(|storage_data| StorageResult { key: hex_string(&key.0), result: StorageResultType::Value(hex_string(&storage_data.0)), + child_trie_key: child_key.map(|c| hex_string(&c.storage_key())), })) }) .unwrap_or_else(|error| QueryResult::Err(error.to_string())) @@ -120,6 +118,7 @@ where QueryResult::Ok(opt.map(|storage_data| StorageResult { key: hex_string(&key.0), result: StorageResultType::Hash(hex_string(&storage_data.as_ref())), + child_trie_key: child_key.map(|c| hex_string(&c.storage_key())), })) }) .unwrap_or_else(|error| QueryResult::Err(error.to_string())) @@ -149,6 +148,7 @@ where StorageResult { key: hex_string(&key.0), result: StorageResultType::ClosestDescendantMerkleValue(result), + child_trie_key: child_key.map(|c| hex_string(&c.storage_key())), } })) }) @@ -199,56 +199,6 @@ where } } - /// Iterate over at most the provided number of keys. - /// - /// Returns the storage result with a potential next key to resume iteration. - pub fn query_iter_pagination( - &self, - query: QueryIter, - hash: Block::Hash, - child_key: Option<&ChildInfo>, - count: usize, - ) -> QueryIterResult { - let QueryIter { ty, query_key, pagination_start_key } = query; - - let mut keys_iter = if let Some(child_key) = child_key { - self.client.child_storage_keys( - hash, - child_key.to_owned(), - Some(&query_key), - pagination_start_key.as_ref(), - ) - } else { - self.client.storage_keys(hash, Some(&query_key), pagination_start_key.as_ref()) - } - .map_err(|err| err.to_string())?; - - let mut ret = Vec::with_capacity(count); - let mut next_pagination_key = None; - for _ in 0..count { - let Some(key) = keys_iter.next() else { break }; - - next_pagination_key = Some(key.clone()); - - let result = match ty { - IterQueryType::Value => self.query_value(hash, &key, child_key), - IterQueryType::Hash => self.query_hash(hash, &key, child_key), - }?; - - if let Some(value) = result { - ret.push(value); - } - } - - // Save the next key if any to continue the iteration. - let maybe_next_query = keys_iter.next().map(|_| QueryIter { - ty, - query_key, - pagination_start_key: next_pagination_key, - }); - Ok((ret, maybe_next_query)) - } - /// Raw iterator over the keys. pub fn raw_keys_iter( &self, @@ -264,3 +214,96 @@ where keys_iter.map_err(|err| err.to_string()) } } + +/// Generates storage events for `chainHead_storage` and `archive_storage` subscriptions. +pub struct StorageSubscriptionClient { + /// Storage client. + client: Storage, + _phandom: PhantomData<(BE, Block)>, +} + +impl Clone for StorageSubscriptionClient { + fn clone(&self) -> Self { + Self { client: self.client.clone(), _phandom: PhantomData } + } +} + +impl StorageSubscriptionClient { + /// Constructs a new [`StorageSubscriptionClient`]. + pub fn new(client: Arc) -> Self { + Self { client: Storage::new(client), _phandom: PhantomData } + } +} + +impl StorageSubscriptionClient +where + Block: BlockT + 'static, + BE: Backend + 'static, + Client: StorageProvider + Send + Sync + 'static, +{ + /// Generate storage events to the provided sender. + pub async fn generate_events( + &mut self, + hash: Block::Hash, + items: Vec>, + child_key: Option, + tx: mpsc::Sender, + ) -> Result<(), tokio::task::JoinError> { + let this = self.clone(); + + tokio::task::spawn_blocking(move || { + for item in items { + match item.query_type { + StorageQueryType::Value => { + let rp = this.client.query_value(hash, &item.key, child_key.as_ref()); + if tx.blocking_send(rp).is_err() { + break; + } + }, + StorageQueryType::Hash => { + let rp = this.client.query_hash(hash, &item.key, child_key.as_ref()); + if tx.blocking_send(rp).is_err() { + break; + } + }, + StorageQueryType::ClosestDescendantMerkleValue => { + let rp = + this.client.query_merkle_value(hash, &item.key, child_key.as_ref()); + if tx.blocking_send(rp).is_err() { + break; + } + }, + StorageQueryType::DescendantsValues => { + let query = QueryIter { + query_key: item.key, + ty: IterQueryType::Value, + pagination_start_key: None, + }; + this.client.query_iter_pagination_with_producer( + query, + hash, + child_key.as_ref(), + &tx, + ) + }, + StorageQueryType::DescendantsHashes => { + let query = QueryIter { + query_key: item.key, + ty: IterQueryType::Hash, + pagination_start_key: None, + }; + this.client.query_iter_pagination_with_producer( + query, + hash, + child_key.as_ref(), + &tx, + ) + }, + } + } + }) + .await?; + + Ok(()) + } +} diff --git a/substrate/client/service/src/builder.rs b/substrate/client/service/src/builder.rs index 027a444012af..a47a05c0a190 100644 --- a/substrate/client/service/src/builder.rs +++ b/substrate/client/service/src/builder.rs @@ -756,8 +756,6 @@ where backend.clone(), genesis_hash, task_executor.clone(), - // Defaults to sensible limits for the `Archive`. - sc_rpc_spec_v2::archive::ArchiveConfig::default(), ) .into_rpc(); rpc_api.merge(archive_v2).map_err(|e| Error::Application(e.into()))?; From 1d519a1054d2edb8fc0b868eba6318fb3d448b33 Mon Sep 17 00:00:00 2001 From: Pavlo Khrystenko <45178695+pkhry@users.noreply.github.com> Date: Fri, 29 Nov 2024 16:24:58 +0100 Subject: [PATCH 50/64] Update scale-info to 2.11.6 (#6681) # Description Updates scale-info to from 2.11.5 2.11.6, so that generated code is annotated with `allow(deprecated)` Pre-requisite for https://github.com/paritytech/polkadot-sdk/pull/6312 --- Cargo.lock | 8 +- Cargo.toml | 2 +- prdoc/pr_6681.prdoc | 406 ++++++++++++++++++++++++++++++++++++++++++++ 3 files changed, 411 insertions(+), 5 deletions(-) create mode 100644 prdoc/pr_6681.prdoc diff --git a/Cargo.lock b/Cargo.lock index 5e4e9c267b08..1fe2d766f16a 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -23715,9 +23715,9 @@ dependencies = [ [[package]] name = "scale-info" -version = "2.11.5" +version = "2.11.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1aa7ffc1c0ef49b0452c6e2986abf2b07743320641ffd5fc63d552458e3b779b" +checksum = "346a3b32eba2640d17a9cb5927056b08f3de90f65b72fe09402c2ad07d684d0b" dependencies = [ "bitvec", "cfg-if", @@ -23729,9 +23729,9 @@ dependencies = [ [[package]] name = "scale-info-derive" -version = "2.11.5" +version = "2.11.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "46385cc24172cf615450267463f937c10072516359b3ff1cb24228a4a08bf951" +checksum = "c6630024bf739e2179b91fb424b28898baf819414262c5d376677dbff1fe7ebf" dependencies = [ "proc-macro-crate 3.1.0", "proc-macro2 1.0.86", diff --git a/Cargo.toml b/Cargo.toml index 964964908a9b..ecc385504181 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -1197,7 +1197,7 @@ sc-tracing-proc-macro = { path = "substrate/client/tracing/proc-macro", default- sc-transaction-pool = { path = "substrate/client/transaction-pool", default-features = false } sc-transaction-pool-api = { path = "substrate/client/transaction-pool/api", default-features = false } sc-utils = { path = "substrate/client/utils", default-features = false } -scale-info = { version = "2.11.1", default-features = false } +scale-info = { version = "2.11.6", default-features = false } schemars = { version = "0.8.13", default-features = false } schnellru = { version = "0.2.3" } schnorrkel = { version = "0.11.4", default-features = false } diff --git a/prdoc/pr_6681.prdoc b/prdoc/pr_6681.prdoc new file mode 100644 index 000000000000..93a967d4a66c --- /dev/null +++ b/prdoc/pr_6681.prdoc @@ -0,0 +1,406 @@ +# Schema: Polkadot SDK PRDoc Schema (prdoc) v1.0.0 +# See doc at https://raw.githubusercontent.com/paritytech/polkadot-sdk/master/prdoc/schema_user.json + +title: update scale-info to 2.11.6 + +doc: + - audience: Runtime Dev + description: | + Updates scale-info to 2.11.1 from 2.11.5. + Updated version of scale-info annotates generated code with `allow(deprecated)` + +crates: + - name: bridge-runtime-common + bump: none + - name: bp-header-chain + bump: none + - name: bp-runtime + bump: none + - name: frame-support + bump: none + - name: sp-core + bump: none + - name: sp-trie + bump: none + - name: sp-runtime + bump: none + - name: sp-application-crypto + bump: none + - name: sp-arithmetic + bump: none + - name: sp-weights + bump: none + - name: sp-api + bump: none + - name: sp-metadata-ir + bump: none + - name: sp-version + bump: none + - name: sp-inherents + bump: none + - name: frame-executive + bump: none + - name: frame-system + bump: none + - name: pallet-balances + bump: none + - name: frame-benchmarking + bump: none + - name: pallet-migrations + bump: none + - name: cumulus-pallet-parachain-system + bump: none + - name: cumulus-primitives-core + bump: none + - name: polkadot-core-primitives + bump: none + - name: polkadot-parachain-primitives + bump: none + - name: polkadot-primitives + bump: none + - name: sp-authority-discovery + bump: none + - name: sp-consensus-slots + bump: none + - name: sp-staking + bump: none + - name: staging-xcm + bump: none + - name: cumulus-primitives-parachain-inherent + bump: none + - name: pallet-message-queue + bump: none + - name: polkadot-runtime-common + bump: none + - name: frame-election-provider-support + bump: none + - name: sp-npos-elections + bump: none + - name: sp-consensus-grandpa + bump: none + - name: polkadot-primitives + bump: none + - name: sp-authority-discovery + bump: none + - name: sp-consensus-grandpa + bump: none + - name: sp-genesis-builder + bump: none + - name: sp-consensus-babe + bump: none + - name: sp-mixnet + bump: none + - name: sc-rpc-api + bump: none + - name: sp-session + bump: none + - name: sp-statement-store + bump: none + - name: sp-transaction-storage-proof + bump: none + - name: pallet-asset-rate + bump: none + - name: pallet-authorship + bump: none + - name: pallet-babe + bump: none + - name: pallet-session + bump: none + - name: pallet-timestamp + bump: none + - name: pallet-offences + bump: none + - name: pallet-staking + bump: none + - name: pallet-bags-list + bump: none + - name: pallet-broker + bump: none + - name: pallet-election-provider-multi-phase + bump: none + - name: pallet-fast-unstake + bump: none + - name: pallet-identity + bump: none + - name: pallet-transaction-payment + bump: none + - name: pallet-treasury + bump: none + - name: pallet-utility + bump: none + - name: pallet-collective + bump: none + - name: pallet-root-testing + bump: none + - name: pallet-vesting + bump: none + - name: polkadot-runtime-parachains + bump: none + - name: pallet-authority-discovery + bump: none + - name: pallet-mmr + bump: none + - name: sp-mmr-primitives + bump: none + - name: staging-xcm-executor + bump: none + - name: staging-xcm-builder + bump: none + - name: pallet-asset-conversion + bump: none + - name: pallet-assets + bump: none + - name: pallet-salary + bump: none + - name: pallet-ranked-collective + bump: none + - name: pallet-xcm + bump: none + - name: xcm-runtime-apis + bump: none + - name: pallet-grandpa + bump: none + - name: pallet-indices + bump: none + - name: pallet-sudo + bump: none + - name: sp-consensus-beefy + bump: none + - name: cumulus-primitives-storage-weight-reclaim + bump: none + - name: cumulus-pallet-aura-ext + bump: none + - name: pallet-aura + bump: none + - name: sp-consensus-aura + bump: none + - name: pallet-collator-selection + bump: none + - name: pallet-glutton + bump: none + - name: staging-parachain-info + bump: none + - name: westend-runtime + bump: none + - name: frame-metadata-hash-extension + bump: none + - name: frame-system-benchmarking + bump: none + - name: pallet-beefy + bump: none + - name: pallet-beefy-mmr + bump: none + - name: pallet-conviction-voting + bump: none + - name: pallet-scheduler + bump: none + - name: pallet-preimage + bump: none + - name: pallet-delegated-staking + bump: none + - name: pallet-nomination-pools + bump: none + - name: pallet-democracy + bump: none + - name: pallet-elections-phragmen + bump: none + - name: pallet-membership + bump: none + - name: pallet-multisig + bump: none + - name: polkadot-sdk-frame + bump: none + - name: pallet-dev-mode + bump: none + - name: pallet-verify-signature + bump: none + - name: pallet-nomination-pools-benchmarking + bump: none + - name: pallet-offences-benchmarking + bump: none + - name: pallet-im-online + bump: none + - name: pallet-parameters + bump: none + - name: pallet-proxy + bump: none + - name: pallet-recovery + bump: none + - name: pallet-referenda + bump: none + - name: pallet-society + bump: none + - name: pallet-state-trie-migration + bump: none + - name: pallet-whitelist + bump: none + - name: pallet-xcm-benchmarks + bump: none + - name: rococo-runtime + bump: none + - name: pallet-bounties + bump: none + - name: pallet-child-bounties + bump: none + - name: pallet-nis + bump: none + - name: pallet-tips + bump: none + - name: parachains-common + bump: none + - name: pallet-asset-tx-payment + bump: none + - name: cumulus-pallet-xcmp-queue + bump: none + - name: bp-xcm-bridge-hub-router + bump: none + - name: pallet-xcm-bridge-hub-router + bump: none + - name: assets-common + bump: none + - name: bp-messages + bump: none + - name: bp-parachains + bump: none + - name: bp-polkadot-core + bump: none + - name: bp-relayers + bump: none + - name: bp-xcm-bridge-hub + bump: none + - name: bridge-hub-common + bump: none + - name: snowbridge-core + bump: none + - name: snowbridge-beacon-primitives + bump: none + - name: snowbridge-ethereum + bump: none + - name: pallet-bridge-grandpa + bump: none + - name: pallet-bridge-messages + bump: none + - name: pallet-bridge-parachains + bump: none + - name: pallet-bridge-relayers + bump: none + - name: pallet-xcm-bridge-hub + bump: none + - name: cumulus-pallet-dmp-queue + bump: none + - name: cumulus-pallet-solo-to-para + bump: none + - name: cumulus-pallet-xcm + bump: none + - name: cumulus-ping + bump: none + - name: frame-benchmarking-pallet-pov + bump: none + - name: pallet-alliance + bump: none + - name: pallet-asset-conversion-ops + bump: none + - name: pallet-asset-conversion-tx-payment + bump: none + - name: pallet-assets-freezer + bump: none + - name: pallet-atomic-swap + bump: none + - name: pallet-collective-content + bump: none + - name: pallet-contracts + bump: none + - name: pallet-contracts-uapi + bump: none + - name: pallet-insecure-randomness-collective-flip + bump: none + - name: pallet-contracts-mock-network + bump: none + - name: xcm-simulator + bump: none + - name: pallet-core-fellowship + bump: none + - name: pallet-lottery + bump: none + - name: pallet-mixnet + bump: none + - name: pallet-nft-fractionalization + bump: none + - name: pallet-nfts + bump: none + - name: pallet-node-authorization + bump: none + - name: pallet-paged-list + bump: none + - name: pallet-remark + bump: none + - name: pallet-revive + bump: none + - name: pallet-revive-uapi + bump: none + - name: pallet-revive-eth-rpc + bump: none + - name: pallet-skip-feeless-payment + bump: none + - name: pallet-revive-mock-network + bump: none + - name: pallet-root-offences + bump: none + - name: pallet-safe-mode + bump: none + - name: pallet-scored-pool + bump: none + - name: pallet-statement + bump: none + - name: pallet-transaction-storage + bump: none + - name: pallet-tx-pause + bump: none + - name: pallet-uniques + bump: none + - name: snowbridge-outbound-queue-merkle-tree + bump: none + - name: snowbridge-pallet-ethereum-client + bump: none + - name: snowbridge-pallet-inbound-queue + bump: none + - name: snowbridge-router-primitives + bump: none + - name: snowbridge-pallet-outbound-queue + bump: none + - name: snowbridge-pallet-system + bump: none + - name: bp-asset-hub-rococo + bump: none + - name: bp-asset-hub-westend + bump: none + - name: bp-polkadot-bulletin + bump: none + - name: asset-hub-rococo-runtime + bump: none + - name: asset-hub-westend-runtime + bump: none + - name: bridge-hub-rococo-runtime + bump: none + - name: bridge-hub-westend-runtime + bump: none + - name: collectives-westend-runtime + bump: none + - name: coretime-rococo-runtime + bump: none + - name: coretime-westend-runtime + bump: none + - name: people-rococo-runtime + bump: none + - name: people-westend-runtime + bump: none + - name: penpal-runtime + bump: none + - name: contracts-rococo-runtime + bump: none + - name: glutton-westend-runtime + bump: none + - name: rococo-parachain-runtime + bump: none + - name: xcm-simulator-example + bump: none \ No newline at end of file From 5ad8780b653350050c6a854205de20c439aa7b65 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Alexandre=20R=2E=20Bald=C3=A9?= Date: Fri, 29 Nov 2024 19:35:06 +0000 Subject: [PATCH 51/64] People chain integration tests (#6377) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit # Description Made as a follow-up of https://github.com/polkadot-fellows/runtimes/pull/499 ## Integration N/A ## Review Notes N/A --------- Co-authored-by: Dónal Murray --- Cargo.lock | 1 + .../tests/people/people-westend/Cargo.toml | 1 + .../people-westend/src/tests/governance.rs | 503 ++++++++++++++++++ .../people/people-westend/src/tests/mod.rs | 1 + 4 files changed, 506 insertions(+) create mode 100644 cumulus/parachains/integration-tests/emulated/tests/people/people-westend/src/tests/governance.rs diff --git a/Cargo.lock b/Cargo.lock index 1fe2d766f16a..a945d148e051 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -16662,6 +16662,7 @@ dependencies = [ "sp-runtime 31.0.1", "staging-xcm 7.0.0", "staging-xcm-executor 7.0.0", + "westend-runtime", "westend-runtime-constants 7.0.0", "westend-system-emulated-network", ] diff --git a/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/Cargo.toml b/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/Cargo.toml index aa6eebc5458f..53acd038cdf5 100644 --- a/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/Cargo.toml +++ b/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/Cargo.toml @@ -21,6 +21,7 @@ sp-runtime = { workspace = true } # Polkadot polkadot-runtime-common = { workspace = true, default-features = true } westend-runtime-constants = { workspace = true, default-features = true } +westend-runtime = { workspace = true } xcm = { workspace = true } xcm-executor = { workspace = true } diff --git a/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/src/tests/governance.rs b/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/src/tests/governance.rs new file mode 100644 index 000000000000..3dadcdd94870 --- /dev/null +++ b/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/src/tests/governance.rs @@ -0,0 +1,503 @@ +// Copyright (C) Parity Technologies (UK) Ltd. +// SPDX-License-Identifier: Apache-2.0 + +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +use crate::imports::*; +use frame_support::traits::ProcessMessageError; + +use codec::Encode; +use frame_support::sp_runtime::traits::Dispatchable; +use parachains_common::AccountId; +use people_westend_runtime::people::IdentityInfo; +use westend_runtime::governance::pallet_custom_origins::Origin::GeneralAdmin as GeneralAdminOrigin; +use westend_system_emulated_network::people_westend_emulated_chain::people_westend_runtime; + +use pallet_identity::Data; + +use emulated_integration_tests_common::accounts::{ALICE, BOB}; + +#[test] +fn relay_commands_add_registrar() { + let (origin_kind, origin) = (OriginKind::Superuser, ::RuntimeOrigin::root()); + + let registrar: AccountId = [1; 32].into(); + Westend::execute_with(|| { + type Runtime = ::Runtime; + type RuntimeCall = ::RuntimeCall; + type RuntimeEvent = ::RuntimeEvent; + type PeopleCall = ::RuntimeCall; + type PeopleRuntime = ::Runtime; + + let add_registrar_call = + PeopleCall::Identity(pallet_identity::Call::::add_registrar { + account: registrar.into(), + }); + + let xcm_message = RuntimeCall::XcmPallet(pallet_xcm::Call::::send { + dest: bx!(VersionedLocation::from(Location::new(0, [Parachain(1004)]))), + message: bx!(VersionedXcm::from(Xcm(vec![ + UnpaidExecution { weight_limit: Unlimited, check_origin: None }, + Transact { origin_kind, call: add_registrar_call.encode().into() } + ]))), + }); + + assert_ok!(xcm_message.dispatch(origin)); + + assert_expected_events!( + Westend, + vec![ + RuntimeEvent::XcmPallet(pallet_xcm::Event::Sent { .. }) => {}, + ] + ); + }); + + PeopleWestend::execute_with(|| { + type RuntimeEvent = ::RuntimeEvent; + + assert_expected_events!( + PeopleWestend, + vec![ + RuntimeEvent::Identity(pallet_identity::Event::RegistrarAdded { .. }) => {}, + RuntimeEvent::MessageQueue(pallet_message_queue::Event::Processed { success: true, .. }) => {}, + ] + ); + }); +} + +#[test] +fn relay_commands_add_registrar_wrong_origin() { + let people_westend_alice = PeopleWestend::account_id_of(ALICE); + + let origins = vec![ + ( + OriginKind::SovereignAccount, + ::RuntimeOrigin::signed(people_westend_alice), + ), + (OriginKind::Xcm, GeneralAdminOrigin.into()), + ]; + + let mut signed_origin = true; + + for (origin_kind, origin) in origins { + let registrar: AccountId = [1; 32].into(); + Westend::execute_with(|| { + type Runtime = ::Runtime; + type RuntimeCall = ::RuntimeCall; + type RuntimeEvent = ::RuntimeEvent; + type PeopleCall = ::RuntimeCall; + type PeopleRuntime = ::Runtime; + + let add_registrar_call = + PeopleCall::Identity(pallet_identity::Call::::add_registrar { + account: registrar.into(), + }); + + let xcm_message = RuntimeCall::XcmPallet(pallet_xcm::Call::::send { + dest: bx!(VersionedLocation::from(Location::new(0, [Parachain(1004)]))), + message: bx!(VersionedXcm::from(Xcm(vec![ + UnpaidExecution { weight_limit: Unlimited, check_origin: None }, + Transact { origin_kind, call: add_registrar_call.encode().into() } + ]))), + }); + + assert_ok!(xcm_message.dispatch(origin)); + assert_expected_events!( + Westend, + vec![ + RuntimeEvent::XcmPallet(pallet_xcm::Event::Sent { .. }) => {}, + ] + ); + }); + + PeopleWestend::execute_with(|| { + type RuntimeEvent = ::RuntimeEvent; + + if signed_origin { + assert_expected_events!( + PeopleWestend, + vec![ + RuntimeEvent::MessageQueue(pallet_message_queue::Event::ProcessingFailed { error: ProcessMessageError::Unsupported, .. }) => {}, + ] + ); + } else { + assert_expected_events!( + PeopleWestend, + vec![ + RuntimeEvent::MessageQueue(pallet_message_queue::Event::Processed { success: true, .. }) => {}, + ] + ); + } + }); + + signed_origin = false; + } +} + +#[test] +fn relay_commands_kill_identity() { + // To kill an identity, first one must be set + PeopleWestend::execute_with(|| { + type PeopleRuntime = ::Runtime; + type PeopleRuntimeEvent = ::RuntimeEvent; + + let people_westend_alice = + ::RuntimeOrigin::signed(PeopleWestend::account_id_of(ALICE)); + + let identity_info = IdentityInfo { + email: Data::Raw(b"test@test.io".to_vec().try_into().unwrap()), + ..Default::default() + }; + let identity: Box<::IdentityInformation> = + Box::new(identity_info); + + assert_ok!(::Identity::set_identity( + people_westend_alice, + identity + )); + + assert_expected_events!( + PeopleWestend, + vec![ + PeopleRuntimeEvent::Identity(pallet_identity::Event::IdentitySet { .. }) => {}, + ] + ); + }); + + let (origin_kind, origin) = (OriginKind::Superuser, ::RuntimeOrigin::root()); + + Westend::execute_with(|| { + type Runtime = ::Runtime; + type RuntimeCall = ::RuntimeCall; + type PeopleCall = ::RuntimeCall; + type RuntimeEvent = ::RuntimeEvent; + type PeopleRuntime = ::Runtime; + + let kill_identity_call = + PeopleCall::Identity(pallet_identity::Call::::kill_identity { + target: people_westend_runtime::MultiAddress::Id(PeopleWestend::account_id_of( + ALICE, + )), + }); + + let xcm_message = RuntimeCall::XcmPallet(pallet_xcm::Call::::send { + dest: bx!(VersionedLocation::from(Location::new(0, [Parachain(1004)]))), + message: bx!(VersionedXcm::from(Xcm(vec![ + UnpaidExecution { weight_limit: Unlimited, check_origin: None }, + Transact { origin_kind, call: kill_identity_call.encode().into() } + ]))), + }); + + assert_ok!(xcm_message.dispatch(origin)); + + assert_expected_events!( + Westend, + vec![ + RuntimeEvent::XcmPallet(pallet_xcm::Event::Sent { .. }) => {}, + ] + ); + }); + + PeopleWestend::execute_with(|| { + type RuntimeEvent = ::RuntimeEvent; + + assert_expected_events!( + PeopleWestend, + vec![ + RuntimeEvent::Identity(pallet_identity::Event::IdentityKilled { .. }) => {}, + RuntimeEvent::MessageQueue(pallet_message_queue::Event::Processed { success: true, .. }) => {}, + ] + ); + }); +} + +#[test] +fn relay_commands_kill_identity_wrong_origin() { + let people_westend_alice = PeopleWestend::account_id_of(BOB); + + let origins = vec![ + ( + OriginKind::SovereignAccount, + ::RuntimeOrigin::signed(people_westend_alice), + ), + (OriginKind::Xcm, GeneralAdminOrigin.into()), + ]; + + for (origin_kind, origin) in origins { + Westend::execute_with(|| { + type Runtime = ::Runtime; + type RuntimeCall = ::RuntimeCall; + type PeopleCall = ::RuntimeCall; + type RuntimeEvent = ::RuntimeEvent; + type PeopleRuntime = ::Runtime; + + let kill_identity_call = + PeopleCall::Identity(pallet_identity::Call::::kill_identity { + target: people_westend_runtime::MultiAddress::Id(PeopleWestend::account_id_of( + ALICE, + )), + }); + + let xcm_message = RuntimeCall::XcmPallet(pallet_xcm::Call::::send { + dest: bx!(VersionedLocation::from(Location::new(0, [Parachain(1004)]))), + message: bx!(VersionedXcm::from(Xcm(vec![ + UnpaidExecution { weight_limit: Unlimited, check_origin: None }, + Transact { origin_kind, call: kill_identity_call.encode().into() } + ]))), + }); + + assert_ok!(xcm_message.dispatch(origin)); + assert_expected_events!( + Westend, + vec![ + RuntimeEvent::XcmPallet(pallet_xcm::Event::Sent { .. }) => {}, + ] + ); + }); + + PeopleWestend::execute_with(|| { + assert_expected_events!(PeopleWestend, vec![]); + }); + } +} + +#[test] +fn relay_commands_add_remove_username_authority() { + let people_westend_alice = PeopleWestend::account_id_of(ALICE); + let people_westend_bob = PeopleWestend::account_id_of(BOB); + + let (origin_kind, origin, usr) = + (OriginKind::Superuser, ::RuntimeOrigin::root(), "rootusername"); + + // First, add a username authority. + Westend::execute_with(|| { + type Runtime = ::Runtime; + type RuntimeCall = ::RuntimeCall; + type RuntimeEvent = ::RuntimeEvent; + type PeopleCall = ::RuntimeCall; + type PeopleRuntime = ::Runtime; + + let add_username_authority = + PeopleCall::Identity(pallet_identity::Call::::add_username_authority { + authority: people_westend_runtime::MultiAddress::Id(people_westend_alice.clone()), + suffix: b"suffix1".into(), + allocation: 10, + }); + + let add_authority_xcm_msg = RuntimeCall::XcmPallet(pallet_xcm::Call::::send { + dest: bx!(VersionedLocation::from(Location::new(0, [Parachain(1004)]))), + message: bx!(VersionedXcm::from(Xcm(vec![ + UnpaidExecution { weight_limit: Unlimited, check_origin: None }, + Transact { origin_kind, call: add_username_authority.encode().into() } + ]))), + }); + + assert_ok!(add_authority_xcm_msg.dispatch(origin.clone())); + + assert_expected_events!( + Westend, + vec![ + RuntimeEvent::XcmPallet(pallet_xcm::Event::Sent { .. }) => {}, + ] + ); + }); + + // Check events system-parachain-side + PeopleWestend::execute_with(|| { + type RuntimeEvent = ::RuntimeEvent; + + assert_expected_events!( + PeopleWestend, + vec![ + RuntimeEvent::Identity(pallet_identity::Event::AuthorityAdded { .. }) => {}, + RuntimeEvent::MessageQueue(pallet_message_queue::Event::Processed { success: true, .. }) => {}, + ] + ); + }); + + // Now, use the previously added username authority to concede a username to an account. + PeopleWestend::execute_with(|| { + type PeopleRuntimeEvent = ::RuntimeEvent; + let full_username = [usr.to_owned(), ".suffix1".to_owned()].concat().into_bytes(); + + assert_ok!(::Identity::set_username_for( + ::RuntimeOrigin::signed(people_westend_alice.clone()), + people_westend_runtime::MultiAddress::Id(people_westend_bob.clone()), + full_username, + None, + true + )); + + assert_expected_events!( + PeopleWestend, + vec![ + PeopleRuntimeEvent::Identity(pallet_identity::Event::UsernameQueued { .. }) => {}, + ] + ); + }); + + // Accept the given username + PeopleWestend::execute_with(|| { + type PeopleRuntimeEvent = ::RuntimeEvent; + let full_username = [usr.to_owned(), ".suffix1".to_owned()].concat().into_bytes(); + + assert_ok!(::Identity::accept_username( + ::RuntimeOrigin::signed(people_westend_bob.clone()), + full_username.try_into().unwrap(), + )); + + assert_expected_events!( + PeopleWestend, + vec![ + PeopleRuntimeEvent::Identity(pallet_identity::Event::UsernameSet { .. }) => {}, + ] + ); + }); + + // Now, remove the username authority with another priviledged XCM call. + Westend::execute_with(|| { + type Runtime = ::Runtime; + type RuntimeCall = ::RuntimeCall; + type RuntimeEvent = ::RuntimeEvent; + type PeopleCall = ::RuntimeCall; + type PeopleRuntime = ::Runtime; + + let remove_username_authority = PeopleCall::Identity(pallet_identity::Call::< + PeopleRuntime, + >::remove_username_authority { + authority: people_westend_runtime::MultiAddress::Id(people_westend_alice.clone()), + suffix: b"suffix1".into(), + }); + + let remove_authority_xcm_msg = RuntimeCall::XcmPallet(pallet_xcm::Call::::send { + dest: bx!(VersionedLocation::from(Location::new(0, [Parachain(1004)]))), + message: bx!(VersionedXcm::from(Xcm(vec![ + UnpaidExecution { weight_limit: Unlimited, check_origin: None }, + Transact { origin_kind, call: remove_username_authority.encode().into() } + ]))), + }); + + assert_ok!(remove_authority_xcm_msg.dispatch(origin)); + + assert_expected_events!( + Westend, + vec![ + RuntimeEvent::XcmPallet(pallet_xcm::Event::Sent { .. }) => {}, + ] + ); + }); + + // Final event check. + PeopleWestend::execute_with(|| { + type RuntimeEvent = ::RuntimeEvent; + + assert_expected_events!( + PeopleWestend, + vec![ + RuntimeEvent::Identity(pallet_identity::Event::AuthorityRemoved { .. }) => {}, + RuntimeEvent::MessageQueue(pallet_message_queue::Event::Processed { success: true, .. }) => {}, + ] + ); + }); +} + +#[test] +fn relay_commands_add_remove_username_authority_wrong_origin() { + let people_westend_alice = PeopleWestend::account_id_of(ALICE); + + let origins = vec![ + ( + OriginKind::SovereignAccount, + ::RuntimeOrigin::signed(people_westend_alice.clone()), + ), + (OriginKind::Xcm, GeneralAdminOrigin.into()), + ]; + + for (origin_kind, origin) in origins { + Westend::execute_with(|| { + type Runtime = ::Runtime; + type RuntimeCall = ::RuntimeCall; + type RuntimeEvent = ::RuntimeEvent; + type PeopleCall = ::RuntimeCall; + type PeopleRuntime = ::Runtime; + + let add_username_authority = PeopleCall::Identity(pallet_identity::Call::< + PeopleRuntime, + >::add_username_authority { + authority: people_westend_runtime::MultiAddress::Id(people_westend_alice.clone()), + suffix: b"suffix1".into(), + allocation: 10, + }); + + let add_authority_xcm_msg = RuntimeCall::XcmPallet(pallet_xcm::Call::::send { + dest: bx!(VersionedLocation::from(Location::new(0, [Parachain(1004)]))), + message: bx!(VersionedXcm::from(Xcm(vec![ + UnpaidExecution { weight_limit: Unlimited, check_origin: None }, + Transact { origin_kind, call: add_username_authority.encode().into() } + ]))), + }); + + assert_ok!(add_authority_xcm_msg.dispatch(origin.clone())); + assert_expected_events!( + Westend, + vec![ + RuntimeEvent::XcmPallet(pallet_xcm::Event::Sent { .. }) => {}, + ] + ); + }); + + // Check events system-parachain-side + PeopleWestend::execute_with(|| { + assert_expected_events!(PeopleWestend, vec![]); + }); + + Westend::execute_with(|| { + type Runtime = ::Runtime; + type RuntimeCall = ::RuntimeCall; + type RuntimeEvent = ::RuntimeEvent; + type PeopleCall = ::RuntimeCall; + type PeopleRuntime = ::Runtime; + + let remove_username_authority = PeopleCall::Identity(pallet_identity::Call::< + PeopleRuntime, + >::remove_username_authority { + authority: people_westend_runtime::MultiAddress::Id(people_westend_alice.clone()), + suffix: b"suffix1".into(), + }); + + let remove_authority_xcm_msg = + RuntimeCall::XcmPallet(pallet_xcm::Call::::send { + dest: bx!(VersionedLocation::from(Location::new(0, [Parachain(1004)]))), + message: bx!(VersionedXcm::from(Xcm(vec![ + UnpaidExecution { weight_limit: Unlimited, check_origin: None }, + Transact { + origin_kind: OriginKind::SovereignAccount, + call: remove_username_authority.encode().into(), + } + ]))), + }); + + assert_ok!(remove_authority_xcm_msg.dispatch(origin)); + assert_expected_events!( + Westend, + vec![ + RuntimeEvent::XcmPallet(pallet_xcm::Event::Sent { .. }) => {}, + ] + ); + }); + + PeopleWestend::execute_with(|| { + assert_expected_events!(PeopleWestend, vec![]); + }); + } +} diff --git a/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/src/tests/mod.rs b/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/src/tests/mod.rs index 08749b295dc2..b9ad9e3db467 100644 --- a/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/src/tests/mod.rs +++ b/cumulus/parachains/integration-tests/emulated/tests/people/people-westend/src/tests/mod.rs @@ -14,4 +14,5 @@ // limitations under the License. mod claim_assets; +mod governance; mod teleport; From 8eac4e887c827ea0bac8915901c305a05457a8d9 Mon Sep 17 00:00:00 2001 From: Dmitry Markin Date: Fri, 29 Nov 2024 23:28:34 +0200 Subject: [PATCH 52/64] network/libp2p-backend: Suppress warning adding already reserved node as reserved (#6703) Fixes https://github.com/paritytech/polkadot-sdk/issues/6598. --------- Co-authored-by: GitHub Action --- prdoc/pr_6703.prdoc | 7 +++++++ substrate/client/network/src/protocol_controller.rs | 2 +- 2 files changed, 8 insertions(+), 1 deletion(-) create mode 100644 prdoc/pr_6703.prdoc diff --git a/prdoc/pr_6703.prdoc b/prdoc/pr_6703.prdoc new file mode 100644 index 000000000000..2dd0962a3eea --- /dev/null +++ b/prdoc/pr_6703.prdoc @@ -0,0 +1,7 @@ +title: 'network/libp2p-backend: Suppress warning adding already reserved node as reserved' +doc: +- audience: Node Dev + description: Fixes https://github.com/paritytech/polkadot-sdk/issues/6598. +crates: +- name: sc-network + bump: patch diff --git a/substrate/client/network/src/protocol_controller.rs b/substrate/client/network/src/protocol_controller.rs index af7adb50907f..11f5321294d0 100644 --- a/substrate/client/network/src/protocol_controller.rs +++ b/substrate/client/network/src/protocol_controller.rs @@ -464,7 +464,7 @@ impl ProtocolController { /// maintain connections with such peers. fn on_add_reserved_peer(&mut self, peer_id: PeerId) { if self.reserved_nodes.contains_key(&peer_id) { - warn!( + debug!( target: LOG_TARGET, "Trying to add an already reserved node {peer_id} as reserved on {:?}.", self.set_id, From 5e0bcb0ee9788b7bb16ccfbda4fdc153b24c6386 Mon Sep 17 00:00:00 2001 From: eskimor Date: Sat, 30 Nov 2024 00:31:27 +0100 Subject: [PATCH 53/64] Let's be a bit less strict here. (#6662) This might actually happen in non malicious cases. Co-authored-by: eskimor --- polkadot/node/network/collator-protocol/src/error.rs | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/polkadot/node/network/collator-protocol/src/error.rs b/polkadot/node/network/collator-protocol/src/error.rs index ae7f9a8c1fbc..598cdcf43900 100644 --- a/polkadot/node/network/collator-protocol/src/error.rs +++ b/polkadot/node/network/collator-protocol/src/error.rs @@ -122,7 +122,7 @@ impl SecondingError { PersistedValidationDataMismatch | CandidateHashMismatch | RelayParentMismatch | - Duplicate | ParentHeadDataMismatch | + ParentHeadDataMismatch | InvalidCoreIndex(_, _) | InvalidSessionIndex(_, _) | InvalidReceiptVersion(_) From d1fafa85fa1254af143b8e9b0ebf5d2731f8d91a Mon Sep 17 00:00:00 2001 From: PG Herveou Date: Sun, 1 Dec 2024 17:30:09 +0100 Subject: [PATCH 54/64] [pallet-revive] eth-prc fix geth diff (#6608) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit * Add a bunch of differential tests to ensure that responses from eth-rpc matches the one from `geth` - These [tests](https://github.com/paritytech/polkadot-sdk/blob/pg/fix-geth-diff/substrate/frame/revive/rpc/examples/js/src/geth-diff.test.ts) are not run in CI for now but can be run locally with ```bash cd revive/rpc/examples/js bun test ``` * EVM RPC server will not fail gas_estimation if no gas is specified, I updated pallet-revive to add an extra `skip_transfer` boolean check to replicate this behavior in our pallet * `eth_transact` and `bare_eth_transact` api have been updated to use `GenericTransaction` directly as this is what is used by `eth_estimateGas` and `eth_call` ## TODO - [ ] Add tests the new `skip_transfer` flag --------- Co-authored-by: GitHub Action Co-authored-by: Alexander Theißen --- Cargo.lock | 1 + .../assets/asset-hub-westend/src/lib.rs | 30 +- prdoc/pr_6608.prdoc | 14 + substrate/bin/node/runtime/src/lib.rs | 25 +- substrate/frame/revive/Cargo.toml | 1 + .../frame/revive/mock-network/src/tests.rs | 4 +- substrate/frame/revive/rpc/Cargo.toml | 2 +- .../revive/rpc/examples/js/abi/errorTester.ts | 106 ++++++ .../revive/rpc/examples/js/abi/event.json | 34 -- .../frame/revive/rpc/examples/js/abi/event.ts | 34 ++ .../revive/rpc/examples/js/abi/piggyBank.json | 65 ---- .../piggyBank.ts} | 19 +- .../revive/rpc/examples/js/abi/revert.json | 14 - .../frame/revive/rpc/examples/js/bun.lockb | Bin 45391 -> 33662 bytes .../rpc/examples/js/contracts/.solhint.json | 3 + .../rpc/examples/js/contracts/ErrorTester.sol | 51 +++ .../rpc/examples/js/contracts/PiggyBank.sol | 8 +- .../frame/revive/rpc/examples/js/package.json | 41 ++- .../rpc/examples/js/pvm/errorTester.polkavm | Bin 0 -> 12890 bytes .../revive/rpc/examples/js/src/balance.ts | 8 + .../rpc/examples/js/src/build-contracts.ts | 27 +- .../frame/revive/rpc/examples/js/src/event.ts | 40 +- .../rpc/examples/js/src/geth-diff-setup.ts | 162 ++++++++ .../rpc/examples/js/src/geth-diff.test.ts | 245 +++++++++++++ .../frame/revive/rpc/examples/js/src/lib.ts | 126 ++++--- .../revive/rpc/examples/js/src/piggy-bank.ts | 81 +++- .../revive/rpc/examples/js/src/revert.ts | 10 - .../revive/rpc/examples/js/src/transfer.ts | 15 +- .../js/types/ethers-contracts/Event.ts | 117 ------ .../js/types/ethers-contracts/PiggyBank.ts | 96 ----- .../js/types/ethers-contracts/Revert.ts | 78 ---- .../js/types/ethers-contracts/common.ts | 100 ----- .../factories/Event__factory.ts | 51 --- .../factories/Revert__factory.ts | 31 -- .../types/ethers-contracts/factories/index.ts | 6 - .../js/types/ethers-contracts/index.ts | 10 - .../frame/revive/rpc/revive_chain.metadata | Bin 658056 -> 659977 bytes substrate/frame/revive/rpc/src/client.rs | 125 ++++--- substrate/frame/revive/rpc/src/lib.rs | 44 +-- .../frame/revive/rpc/src/rpc_methods_gen.rs | 1 + .../frame/revive/rpc/src/subxt_client.rs | 12 +- substrate/frame/revive/rpc/src/tests.rs | 3 +- .../frame/revive/src/benchmarking/mod.rs | 2 +- .../frame/revive/src/evm/api/rlp_codec.rs | 18 +- .../frame/revive/src/evm/api/rpc_types.rs | 148 ++++---- .../frame/revive/src/evm/api/rpc_types_gen.rs | 24 +- substrate/frame/revive/src/evm/runtime.rs | 345 ++++++++++-------- substrate/frame/revive/src/exec.rs | 73 +++- substrate/frame/revive/src/lib.rs | 215 +++++++---- substrate/frame/revive/src/primitives.rs | 45 ++- substrate/frame/revive/src/storage/meter.rs | 52 ++- .../frame/revive/src/test_utils/builder.rs | 11 +- substrate/frame/revive/src/tests.rs | 12 +- .../frame/revive/src/tests/test_debug.rs | 5 +- substrate/frame/revive/src/wasm/mod.rs | 11 +- 55 files changed, 1553 insertions(+), 1248 deletions(-) create mode 100644 prdoc/pr_6608.prdoc create mode 100644 substrate/frame/revive/rpc/examples/js/abi/errorTester.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/abi/event.json create mode 100644 substrate/frame/revive/rpc/examples/js/abi/event.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/abi/piggyBank.json rename substrate/frame/revive/rpc/examples/js/{types/ethers-contracts/factories/PiggyBank__factory.ts => abi/piggyBank.ts} (62%) delete mode 100644 substrate/frame/revive/rpc/examples/js/abi/revert.json create mode 100644 substrate/frame/revive/rpc/examples/js/contracts/.solhint.json create mode 100644 substrate/frame/revive/rpc/examples/js/contracts/ErrorTester.sol create mode 100644 substrate/frame/revive/rpc/examples/js/pvm/errorTester.polkavm create mode 100644 substrate/frame/revive/rpc/examples/js/src/balance.ts create mode 100644 substrate/frame/revive/rpc/examples/js/src/geth-diff-setup.ts create mode 100644 substrate/frame/revive/rpc/examples/js/src/geth-diff.test.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/src/revert.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/types/ethers-contracts/Event.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/types/ethers-contracts/PiggyBank.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/types/ethers-contracts/Revert.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/types/ethers-contracts/common.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/Event__factory.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/Revert__factory.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/index.ts delete mode 100644 substrate/frame/revive/rpc/examples/js/types/ethers-contracts/index.ts diff --git a/Cargo.lock b/Cargo.lock index a945d148e051..bc2ebb2a057d 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -14633,6 +14633,7 @@ dependencies = [ "assert_matches", "bitflags 1.3.2", "derive_more 0.99.17", + "env_logger 0.11.3", "environmental", "ethereum-types 0.15.1", "frame-benchmarking 28.0.0", diff --git a/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs b/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs index f20b6b1fece0..98d647d868db 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs @@ -124,7 +124,7 @@ pub const VERSION: RuntimeVersion = RuntimeVersion { spec_name: alloc::borrow::Cow::Borrowed("westmint"), impl_name: alloc::borrow::Cow::Borrowed("westmint"), authoring_version: 1, - spec_version: 1_016_006, + spec_version: 1_016_008, impl_version: 0, apis: RUNTIME_API_VERSIONS, transaction_version: 16, @@ -2081,18 +2081,10 @@ impl_runtime_apis! { let account = ::AddressMapper::to_account_id(&address); System::account_nonce(account) } - fn eth_transact( - from: H160, - dest: Option, - value: U256, - input: Vec, - gas_limit: Option, - storage_deposit_limit: Option, - ) -> pallet_revive::EthContractResult + + fn eth_transact(tx: pallet_revive::evm::GenericTransaction) -> Result, pallet_revive::EthTransactError> { - use pallet_revive::AddressMapper; - let blockweights = ::BlockWeights::get(); - let origin = ::AddressMapper::to_account_id(&from); + let blockweights: BlockWeights = ::BlockWeights::get(); let encoded_size = |pallet_call| { let call = RuntimeCall::Revive(pallet_call); @@ -2101,15 +2093,9 @@ impl_runtime_apis! { }; Revive::bare_eth_transact( - origin, - dest, - value, - input, - gas_limit.unwrap_or(blockweights.max_block), - storage_deposit_limit.unwrap_or(u128::MAX), + tx, + blockweights.max_block, encoded_size, - pallet_revive::DebugInfo::UnsafeDebug, - pallet_revive::CollectEvents::UnsafeCollect, ) } @@ -2127,7 +2113,7 @@ impl_runtime_apis! { dest, value, gas_limit.unwrap_or(blockweights.max_block), - storage_deposit_limit.unwrap_or(u128::MAX), + pallet_revive::DepositLimit::Balance(storage_deposit_limit.unwrap_or(u128::MAX)), input_data, pallet_revive::DebugInfo::UnsafeDebug, pallet_revive::CollectEvents::UnsafeCollect, @@ -2149,7 +2135,7 @@ impl_runtime_apis! { RuntimeOrigin::signed(origin), value, gas_limit.unwrap_or(blockweights.max_block), - storage_deposit_limit.unwrap_or(u128::MAX), + pallet_revive::DepositLimit::Balance(storage_deposit_limit.unwrap_or(u128::MAX)), code, data, salt, diff --git a/prdoc/pr_6608.prdoc b/prdoc/pr_6608.prdoc new file mode 100644 index 000000000000..b9cd7008de47 --- /dev/null +++ b/prdoc/pr_6608.prdoc @@ -0,0 +1,14 @@ +title: '[pallet-revive] eth-prc fix geth diff' +doc: +- audience: Runtime Dev + description: |- + * Add a bunch of differential tests to ensure that responses from eth-rpc matches the one from `geth` + * EVM RPC server will not fail gas_estimation if no gas is specified, I updated pallet-revive to add an extra `skip_transfer` boolean check to replicate this behavior in our pallet + * `eth_transact` and `bare_eth_transact` api have been updated to use `GenericTransaction` directly as this is what is used by `eth_estimateGas` and `eth_call` +crates: +- name: pallet-revive-eth-rpc + bump: minor +- name: pallet-revive + bump: minor +- name: asset-hub-westend-runtime + bump: minor diff --git a/substrate/bin/node/runtime/src/lib.rs b/substrate/bin/node/runtime/src/lib.rs index bff263548087..faffcd23fbcf 100644 --- a/substrate/bin/node/runtime/src/lib.rs +++ b/substrate/bin/node/runtime/src/lib.rs @@ -3218,18 +3218,9 @@ impl_runtime_apis! { System::account_nonce(account) } - fn eth_transact( - from: H160, - dest: Option, - value: U256, - input: Vec, - gas_limit: Option, - storage_deposit_limit: Option, - ) -> pallet_revive::EthContractResult + fn eth_transact(tx: pallet_revive::evm::GenericTransaction) -> Result, pallet_revive::EthTransactError> { - use pallet_revive::AddressMapper; let blockweights: BlockWeights = ::BlockWeights::get(); - let origin = ::AddressMapper::to_account_id(&from); let encoded_size = |pallet_call| { let call = RuntimeCall::Revive(pallet_call); @@ -3238,15 +3229,9 @@ impl_runtime_apis! { }; Revive::bare_eth_transact( - origin, - dest, - value, - input, - gas_limit.unwrap_or(blockweights.max_block), - storage_deposit_limit.unwrap_or(u128::MAX), + tx, + blockweights.max_block, encoded_size, - pallet_revive::DebugInfo::UnsafeDebug, - pallet_revive::CollectEvents::UnsafeCollect, ) } @@ -3263,7 +3248,7 @@ impl_runtime_apis! { dest, value, gas_limit.unwrap_or(RuntimeBlockWeights::get().max_block), - storage_deposit_limit.unwrap_or(u128::MAX), + pallet_revive::DepositLimit::Balance(storage_deposit_limit.unwrap_or(u128::MAX)), input_data, pallet_revive::DebugInfo::UnsafeDebug, pallet_revive::CollectEvents::UnsafeCollect, @@ -3284,7 +3269,7 @@ impl_runtime_apis! { RuntimeOrigin::signed(origin), value, gas_limit.unwrap_or(RuntimeBlockWeights::get().max_block), - storage_deposit_limit.unwrap_or(u128::MAX), + pallet_revive::DepositLimit::Balance(storage_deposit_limit.unwrap_or(u128::MAX)), code, data, salt, diff --git a/substrate/frame/revive/Cargo.toml b/substrate/frame/revive/Cargo.toml index 677ef0e1367f..098a66df8dee 100644 --- a/substrate/frame/revive/Cargo.toml +++ b/substrate/frame/revive/Cargo.toml @@ -65,6 +65,7 @@ pallet-revive-fixtures = { workspace = true, default-features = true } secp256k1 = { workspace = true, features = ["recovery"] } serde_json = { workspace = true } hex-literal = { workspace = true } +env_logger = { workspace = true } # Polkadot SDK Dependencies pallet-balances = { workspace = true, default-features = true } diff --git a/substrate/frame/revive/mock-network/src/tests.rs b/substrate/frame/revive/mock-network/src/tests.rs index bd05726a1a45..34f797c2b530 100644 --- a/substrate/frame/revive/mock-network/src/tests.rs +++ b/substrate/frame/revive/mock-network/src/tests.rs @@ -24,7 +24,7 @@ use frame_support::traits::{fungibles::Mutate, Currency}; use frame_system::RawOrigin; use pallet_revive::{ test_utils::{self, builder::*}, - Code, + Code, DepositLimit, }; use pallet_revive_fixtures::compile_module; use pallet_revive_uapi::ReturnErrorCode; @@ -52,7 +52,7 @@ fn instantiate_test_contract(name: &str) -> Contract { RawOrigin::Signed(ALICE).into(), Code::Upload(wasm), ) - .storage_deposit_limit(1_000_000_000_000) + .storage_deposit_limit(DepositLimit::Balance(1_000_000_000_000)) .build_and_unwrap_contract() }); diff --git a/substrate/frame/revive/rpc/Cargo.toml b/substrate/frame/revive/rpc/Cargo.toml index 9f89b74c668f..fe9cc82dd4d9 100644 --- a/substrate/frame/revive/rpc/Cargo.toml +++ b/substrate/frame/revive/rpc/Cargo.toml @@ -67,13 +67,13 @@ hex = { workspace = true } hex-literal = { workspace = true, optional = true } scale-info = { workspace = true } secp256k1 = { workspace = true, optional = true, features = ["recovery"] } -env_logger = { workspace = true } ethabi = { version = "18.0.0" } [features] example = ["hex-literal", "rlp", "secp256k1", "subxt-signer"] [dev-dependencies] +env_logger = { workspace = true } static_init = { workspace = true } hex-literal = { workspace = true } pallet-revive-fixtures = { workspace = true } diff --git a/substrate/frame/revive/rpc/examples/js/abi/errorTester.ts b/substrate/frame/revive/rpc/examples/js/abi/errorTester.ts new file mode 100644 index 000000000000..93daf34e02b6 --- /dev/null +++ b/substrate/frame/revive/rpc/examples/js/abi/errorTester.ts @@ -0,0 +1,106 @@ +export const abi = [ + { + inputs: [ + { + internalType: 'string', + name: 'message', + type: 'string', + }, + ], + name: 'CustomError', + type: 'error', + }, + { + inputs: [ + { + internalType: 'bool', + name: 'newState', + type: 'bool', + }, + ], + name: 'setState', + outputs: [], + stateMutability: 'nonpayable', + type: 'function', + }, + { + inputs: [], + name: 'state', + outputs: [ + { + internalType: 'bool', + name: '', + type: 'bool', + }, + ], + stateMutability: 'view', + type: 'function', + }, + { + inputs: [], + name: 'triggerAssertError', + outputs: [], + stateMutability: 'pure', + type: 'function', + }, + { + inputs: [], + name: 'triggerCustomError', + outputs: [], + stateMutability: 'pure', + type: 'function', + }, + { + inputs: [], + name: 'triggerDivisionByZero', + outputs: [ + { + internalType: 'uint256', + name: '', + type: 'uint256', + }, + ], + stateMutability: 'pure', + type: 'function', + }, + { + inputs: [], + name: 'triggerOutOfBoundsError', + outputs: [ + { + internalType: 'uint256', + name: '', + type: 'uint256', + }, + ], + stateMutability: 'pure', + type: 'function', + }, + { + inputs: [], + name: 'triggerRequireError', + outputs: [], + stateMutability: 'pure', + type: 'function', + }, + { + inputs: [], + name: 'triggerRevertError', + outputs: [], + stateMutability: 'pure', + type: 'function', + }, + { + inputs: [ + { + internalType: 'uint256', + name: 'value', + type: 'uint256', + }, + ], + name: 'valueMatch', + outputs: [], + stateMutability: 'payable', + type: 'function', + }, +] as const diff --git a/substrate/frame/revive/rpc/examples/js/abi/event.json b/substrate/frame/revive/rpc/examples/js/abi/event.json deleted file mode 100644 index d36089fbc84e..000000000000 --- a/substrate/frame/revive/rpc/examples/js/abi/event.json +++ /dev/null @@ -1,34 +0,0 @@ -[ - { - "anonymous": false, - "inputs": [ - { - "indexed": true, - "internalType": "address", - "name": "sender", - "type": "address" - }, - { - "indexed": false, - "internalType": "uint256", - "name": "value", - "type": "uint256" - }, - { - "indexed": false, - "internalType": "string", - "name": "message", - "type": "string" - } - ], - "name": "ExampleEvent", - "type": "event" - }, - { - "inputs": [], - "name": "triggerEvent", - "outputs": [], - "stateMutability": "nonpayable", - "type": "function" - } -] diff --git a/substrate/frame/revive/rpc/examples/js/abi/event.ts b/substrate/frame/revive/rpc/examples/js/abi/event.ts new file mode 100644 index 000000000000..c389e2daf1da --- /dev/null +++ b/substrate/frame/revive/rpc/examples/js/abi/event.ts @@ -0,0 +1,34 @@ +export const abi = [ + { + anonymous: false, + inputs: [ + { + indexed: true, + internalType: 'address', + name: 'sender', + type: 'address', + }, + { + indexed: false, + internalType: 'uint256', + name: 'value', + type: 'uint256', + }, + { + indexed: false, + internalType: 'string', + name: 'message', + type: 'string', + }, + ], + name: 'ExampleEvent', + type: 'event', + }, + { + inputs: [], + name: 'triggerEvent', + outputs: [], + stateMutability: 'nonpayable', + type: 'function', + }, +] as const diff --git a/substrate/frame/revive/rpc/examples/js/abi/piggyBank.json b/substrate/frame/revive/rpc/examples/js/abi/piggyBank.json deleted file mode 100644 index 2c2cfd5f7533..000000000000 --- a/substrate/frame/revive/rpc/examples/js/abi/piggyBank.json +++ /dev/null @@ -1,65 +0,0 @@ -[ - { - "inputs": [], - "stateMutability": "nonpayable", - "type": "constructor" - }, - { - "inputs": [], - "name": "deposit", - "outputs": [ - { - "internalType": "uint256", - "name": "", - "type": "uint256" - } - ], - "stateMutability": "payable", - "type": "function" - }, - { - "inputs": [], - "name": "getDeposit", - "outputs": [ - { - "internalType": "uint256", - "name": "", - "type": "uint256" - } - ], - "stateMutability": "view", - "type": "function" - }, - { - "inputs": [], - "name": "owner", - "outputs": [ - { - "internalType": "address", - "name": "", - "type": "address" - } - ], - "stateMutability": "view", - "type": "function" - }, - { - "inputs": [ - { - "internalType": "uint256", - "name": "withdrawAmount", - "type": "uint256" - } - ], - "name": "withdraw", - "outputs": [ - { - "internalType": "uint256", - "name": "remainingBal", - "type": "uint256" - } - ], - "stateMutability": "nonpayable", - "type": "function" - } -] diff --git a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/PiggyBank__factory.ts b/substrate/frame/revive/rpc/examples/js/abi/piggyBank.ts similarity index 62% rename from substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/PiggyBank__factory.ts rename to substrate/frame/revive/rpc/examples/js/abi/piggyBank.ts index 0efea80ed2dc..3d44cd998ad1 100644 --- a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/PiggyBank__factory.ts +++ b/substrate/frame/revive/rpc/examples/js/abi/piggyBank.ts @@ -1,11 +1,4 @@ -/* Autogenerated file. Do not edit manually. */ -/* tslint:disable */ -/* eslint-disable */ - -import { Contract, Interface, type ContractRunner } from 'ethers' -import type { PiggyBank, PiggyBankInterface } from '../PiggyBank' - -const _abi = [ +export const abi = [ { inputs: [], stateMutability: 'nonpayable', @@ -70,13 +63,3 @@ const _abi = [ type: 'function', }, ] as const - -export class PiggyBank__factory { - static readonly abi = _abi - static createInterface(): PiggyBankInterface { - return new Interface(_abi) as PiggyBankInterface - } - static connect(address: string, runner?: ContractRunner | null): PiggyBank { - return new Contract(address, _abi, runner) as unknown as PiggyBank - } -} diff --git a/substrate/frame/revive/rpc/examples/js/abi/revert.json b/substrate/frame/revive/rpc/examples/js/abi/revert.json deleted file mode 100644 index be2945fcc0a5..000000000000 --- a/substrate/frame/revive/rpc/examples/js/abi/revert.json +++ /dev/null @@ -1,14 +0,0 @@ -[ - { - "inputs": [], - "stateMutability": "nonpayable", - "type": "constructor" - }, - { - "inputs": [], - "name": "doRevert", - "outputs": [], - "stateMutability": "nonpayable", - "type": "function" - } -] diff --git a/substrate/frame/revive/rpc/examples/js/bun.lockb b/substrate/frame/revive/rpc/examples/js/bun.lockb index 700dca51da2ad3f843e890258b59c16fd4df6457..0ff3d54157db21a636e30076634343a24c812dca 100755 GIT binary patch delta 9083 zcmeG?X;@UpvgZr~3@FH^4u~MAfFQ##AUh)niZIIJ!ib8>GK5h!83aV*0Ad7{1S~O% zpc2<;Hkah8i3@5pafwT!*EL=f;~HENm*9U39E zSNC*xaq0&_$6JCr$)KX9gr5`ge;?ae+b?_Z>T92NPgpE(-Sy$9H=3Pp4H{e(a=(({ zQgXf0SvzmMuD~#vs@!~{i`A-J!lein3{yTskEiJI7{uMNzJz6%Ziq+d%W3KAqS*y1 zMy<&&(O?~yA8RuV9yC`$A=O^+2i ztSt{fq9+QtBDO2(bcOo8ucp2h;h>P|0 zV-feqvM*v+#5RbX5&w#v5I%?4NsGj1`ie%x)R7i(AH;=-Y2r~o&crkgNS8l%(9P!` zr%sL^(LC3GH_>Wj?&=*KjV(s|e(lw|es;}r@y@5BfP?!TFPlEE{BZBowl{~b*)Z?+ z#gWlTM~i#?J;ZbHyc6;jvyM&vt?%Yi^KmI#bC!AuH%)7G5~O@~Ol2yJeRJ2_VaIp0 zx3s@EO`iRZ`ISJ6+)|%SHEk-lG>;hghp~r8M`YyDss0=9^l>#>leE_Vr}LJTq#}{oS6B{34hwAeKrN`>VG$@;W(?1<@-|imVWknU4uOJxCJ@qFF32%~GDIs)U=O0>Ch#1Qi7AAL z<$^d(Lh=bhhJ`R!eXQ2XZDMfb+ z<4UY$pjjD~{5d5m>;eV5%^;+Y+;|Tz=XeP36KX8NO>h)Pjq9Y=c2YlgQbFkRahzNw zQX@I)SSMwJJD9F+Vkh-pCv~@zlJ(%_$~vioNR80xg5IK|;ybBjozx|yqB%JyYo1E) zq&9X^cXgCg7;6I|E^=cPI_D$^cL_BWYvW%her4Di!v+gb8tHRC86e zNTqSqeWX%3N`d?58yvMADHTWc7BkFLjwaesEOnd#X5Enyi462a z#sOEF7vS2nK8UsC6SOjjLtS`j(a#tH+S$;C46YQ~ySYS|6rv8O9?iie!nk;7>*eaP zVNMQrOsO|0wxFKAe&X;+2uXN;MtA3!J8_y0QM zkAi1`1Hs?qN6D|ZFK9Y&>!i~c)!*3kxjVq;$&QrN z@rs?ygCA0#{cwZ3We+^jm`q`2PIC_j7o z*4XKn1CFjs+~zdSwsg&+I@fL!8w#&UZJY}Vd%SgfQ{auW|M+C8&0UZ5yPH(ILi2mt z;c8)-jvgI|X`|+o@VtC|MDjl)9qzaNPy?zv9+#_)Q|49{REC$| zYjCqqsQL%n^GHLf`-rG|Z|S!mw7r=b*Y@B>?{aukBG$$yFC1R*ebuV^A1#51#eX+WIbz=Ftq1UGV@cgNL$=#-( zjYo73Ef{{ctmbj))rHNEqsKS8+MWV$AF=jPWy`y*3#-o#-7vbrcZ>6k%-bLD_&Qqj zFyfQQJ%cjc&$jgRQSDUGiO}_VXo)C;!&lvx|1Ldif-L z82e>n>NlOEoZ?j-N_v|)2?edLBMdA|gCIRwu%EB_;SYg<+wl2~1cUY@flYwXVVN9_;ZElk?b=DE@R=$QAfbkPpac%4bO?9ss)?xklJ z?EUo@|2@AsIBuwnYxm2@J6@Z9`EPz3?=7kOE%)@zvJCs$zo|FG@2+XM;gy{GJo3ec zXKR;xGikqzGoV(AwoAU2^5}T(7m{l~mIZCKl+~ps)btLMwmvzSd2xGLqjR37x2oy# z(Q^;Bw$zxfxHkHz#rAjP=T82(ckRzlPc#P&?V=qXHanAWdcyBs(YYJN;rohW8+J6S zwMlJXZ|jla8h0UMLRMYT*MU8D%@8Esw)eZg_{hBLfz2yt%(<8PbWT~xjX533Z`VW} zf^c6kv_&gM;B7X}Q7^z@;!puk|?84HyNX2M65b#O3ct(`Jh2@P!CqnnlX?T7$ zvaacp-${#jHO%E8zl`MvqXi{bA(@B~%AnzzZx5gxDA*1cg|@hcOD)9ol1*tOq2GRI-EMeat<9 zja9NV2lk_stUt`eduVK zRv|t_s?U;{*q_Iji7T(7^4%l%@RskuPkAiKOj|Q{x zN;V$SFi(Kp;}gvIO)(KJdMmX_{L~>9dS?2L6!)AksBE~`>W{`8$r{t^%`2In8$Ucd zcl5ofTRva%sYmc*N$QXHUnIQSx+#0_r5EvU*{jC7Ikit;{aJnA=to^#e@xeQ^Y$ek z6CU)^f{>o%7;jrgt}=^3J6?=fySEHrl{#=HIWc z|I#5jf0bwdpB_w3*x#k$v0WS9_VuA#->Ih!opq$tD^hTzE@97@ZQl(IT%^iQTVmIE zrD*-ZfYTbSd}~p*OOo_Uw*HVt{>}=uzma^oammbyUX3gsYIu8$>)Nne;*!u?Ek(o3 zw^6dJ4 zMbE6eW$U{rJicqY?;RRiF>P$vW>e*tH{$QyD)SYdaXtR!-6d|?Cb`>b=TOVgi&@v&D ztDKxH5?#Pw6udK14EwPeLo&0mzM_5OKJL;#N z&~^4ORV0$&xdiX5<*33qmK6ePb&;RVutdI)3Zy$A}m+Mt0!zBK`UyP@D7}wMRCl0n@#rS%)BprBUN{1I1$hT~ z33*Ep0vR{}VF&_w26>1Kfha3`7MGGjsDq@M-slmO&P{2Bhmo_|9{j-Leoz-g|dmXAO1 z&%MZ$No2kf|3E&Hz`xrHSSj{L=HX)v{L8L@4U+fnGYn(}lLvPLW)Jzeqnj+KX_3TV97J3_N_I=tS|pL6&Dz4nckou}vV0UrK2T|gXP z3A*X)Dj}$>ayVlU*UmdDem2MboS$-zk0o^^|$9pl++EzQ(L!kR%`QwaRv7VeH z!z@J!vRt<2qnFQnY*pK_Q_wmRTtQ99!JVc2^bosoDOVnw^8LuV`hu1V6`<4U{e%|D ztG<97&KYQVyy^?c;U?mB`yl5}?8CRlhsDzQD1?Be`KE=>N6z>-1*e=Z@m@6@Z#mL| z503HS3ho;jP2LeB$g30!P8mUUrA%dE@oJMF#ntMo!neYX>GmUIXVHS z*Axci^Tm#@Pq{CyWm=WvO`veTr(l{1tezhd@IRRsxhYsyiS7Ti3uvvn7r@7j_&AFl z8-_bQZs6q!h`AZsHB0kV&^Z~p0`3<$vCJe9{IEdg$VdA$H6uHAZWu6EXIWac*F_+G zOB}!l(Z2tFfAdz^-e4iFP;3CVXFklP-W|5t-z4{@fn#S5^YBwXFxUE1{bt+VG0zMF zeCRG<)QQhpmhLPwaN^A2#9LxVKGyf%`}3yX7Y#gX5GXKTx=ZGR5e5N1AbELy)(GF_ms$;+o9588Q0&M@ zFw=YeZq~!u?x{h*vKySnw)v3fS5M2G=dK?Q1_3@Oy1I{a&$o9nCK@=3Zs1fc4&cM6 z7QLhItp2F@s6l`av~C@tPAwej-elm^c7vR1u_GUuJ=0><_pryE1cN}K4Xmw}Ir8zx z&+U5Iq`tGVQpoyCWZXJ!w1NBBIUlf0YP^3xV(pm@g8&!PL`O0yI-8mE&94Fj=T{pD zs}Vc$LC~Owa}q4A7M?K(_}W52jW~dhn*KIrW?cBIWpWLaJ%8d z@O&bcESS4!7#vt6b(o9CELzD`K|@ZkrIsBJ^&&Sb z!F;isZ3O-2fyO6&Rvt%W6sim0QJtd?oh5v{IpnQBL`aI>D2vc!%qmp*q^k@3WL@ZB zIJwHfqC}ORHmfK*&$~c2Bmk_J_v!yi4L0{m*;`7xG*o=(0!htcyueq~xn9J#Em@R5gwYry(!Qy zzZ3=XOL26#V^SmBze}ic)kQ_BLcfT#%)+#+tl2)QJdJl=eqnA}j=GH0ha=6SoL>>e zW?m_K4_Ugb|BlL)<5>81Spb}G{GfZfI?snc62i7M&QP_)&WMhKX)9fzc~u{{y($Wx zHTT&urD-&~BW(2?8#uimALh@E{S?4O|C9$s(jW_4`TvvD%UhyyJQ*qP) delta 15944 zcmc(G2VB$1vv?8`AyT9lr6W~BuhN?!qF8_kNC^-i5Nc>P0-gmGMO_hy-@E&N-dmWR-I?9lnc4C!nQz}*TFVpK5-ao9I@cc* zPpLoS7!^}Itw%0A{M`#~XU}Nfum`0IS*E{kYi^(rsc>r%>ZLVc$ul(Twb1lmzm7xrKIK+=5n&Lr&1_cnTcF1 zFIm76a*OhEIk!N4Y{5myu;4U7R%SAf&rRYcRh_jT+TdXu!K=7iE!44J z){F5x!0J#3+bF7NCUuzbm5Qjv6TsNwOipGNFNs3o3KH^p{3ObDXs!YD)qru&Sz^o= z;|MYK0jvgm7GS)lw8WSp#&3X$>1|?sPK1Red&PumFO372$Ch%X<4B2qN8v*MB zE)~;b0UJTx9k3x_9l+4Hqz|NG{0K0RN{)%^n*rm2762XwcqU*x2TQL z$YV23`u&Z@C6*(EbGQjUuZokunT%lEkF}Y&Ys7&?KQj}U7QXr$>7dJE6Nf zJF>Z(vF<^a*||kC6f|fzir5pbkBxbI?y=IE4h_wR*HhFsTORLxa^?ETb$2eC&M5eD zw!yb@brEN9%*^XU3@2!fUwjBYjo?4s3P?eM!x+0~CUQ2l^Rt&!HET2(i-FNZ^dl{wb$!;5Z2^BqJ z1Tmdp8;yjil|ec3&a`?8>d^9(e+fiiAW8$KAY0iHNPm!wyek}aEBdxm1KAVU6!d10 zGcyEg?ogv6Tc$H}CDcIA5(e5S@65aiHGin}i)Jd)$<}X}&hjBpv%`EChz>nOYSsZ2 zs|nhINjnFL)cgWef01Mu)eFvcY@igWG_w#WSSu;CQ^8sOIMlFFSO&A-Eec=}))iAl zhUv>QWq=qAL{M45nb`ofAgF;kvd+w2sCh$8G|VGKrVRKQOOOKhIWzO1hOMO&T2#pp zY-|u1Bje1x4{WTmG~o<=8Ij7O#xP6F$w0v>i^f_BHLNlXJ5ug8)JRp4jkG167^W^9 z)(+5wikA8lQ>8Q!D1-)J5uCylHPFNqJAERds6 zB32)%CZiWqP?xkD!v-!C4!9K~2}(AICGEys4kg@PnvnApYTjs@jGK}X9AsWVhnc6~ zB_bNRN|h-C4BTPBm1}?^a=h&jXZedzvjjfwB%Wv36un|`mHu_E5n0H2(o~dC8lV6r zR12s?33UKEse~-#J!uSOlm^IK8Px)su8cZlJmt^8RU-gY1YIcody%H0f;!|qnF6>Z zi5$37)|pnPg3=T`X`fY4Eg&~l)B$LYDzX>?L#U#(A)bs=>J-X2lrhAOp#qoB5TX>< zU#jabed;gyX~L=}+AV@o5K+3(U((ScY25zOw*JxwqQp{jrw=8Y&FL>)g3>6FDsVj# zl_L8~8~aPopyW@qGuI|d8U3Z5{iP3Ni58@T($qW|*>D+*Mj2{uj0;eTMBCKe>G~u| z2&G8`^D2~Lh?2Ddg~B6BtD(dpN}r)5;zk%!C@BQ(2$Z-)$lov9BgAz{ zj1^#s`Bq{+#<;z;7{h@>BpVoCT=*--UV)Q~NRk)}at6Qyxf0wTW6XCG^D)N#+ySr$ z;LsqFmw0@FfE#!NVC(~clO)DRBpiwae>7%7`k!FjA1+&j;uCRaNJ6rJF&=mlrb3d$ zm>xz@MVJBQNB}qoDO@ofV{BQfxc(yydz*APiG^h0{|JNs$tn0xFy0AE#TNd5!FbSr zDhTU=7b%8+x_yOsTm6guORSlHv3*5O|L6M`w1+gXp9kvy+4dDr`j7VUf3$x^m#rS`B|NnLSf*SvH`~BN~6iVNaK6FYy)%(mB z#e}Bp_uJn#7uI)=bTM~)|C`|(*S>23d^6psr=#?w-*FB;8S+b4^h)>2c)P{5+ntXe zoV0$1=95&nkCRNFK5tmdeTaDD?Z(Afbj*yE zyO!MgOSwkq2e@=lv7LbNRf9})y&aLq+@0$u+?&g*tjsef$EuYwKml6plV$xT7o)T>|Ygc3M6-BRlmcHtU7b zsP>VK>tbU3f9_y6zug_GZ5Cwg`jOon6%*Ea-RGlAvA}ZE)|P<0JMWg8ubgsXERW@1 zog|?h-dtp&Hxx$({odE*zin5P@xJ)SuS^fjY}W9c@V4sfwJnzA2THb0J9MFQ<94l# zh-rS?rl_}aJGpiyZ1=D0=mF|SRXkuhVhz_6E~yzyG3n7gU~Z(a)#JHTaEkA^uIjvFFVE#(%kf>a zVn@>|-N|2M&VB24d$eZ9vtM6C@NG|oO3inhw^rfE@}<8tNN9&IK4hX7d>UVJ<&sIo zVd?Zz-v#TlVq(V|I2tn^H`z2Z*Tx@Ns~i4cQv9hGT6Lj24g~%hvtKy6>qw5%^2QIJ z;^#S?9@Jxq+CV$S4XTb6*Kf8}{J|T!sg`wM<}5+p?;Dk~8!pMW)~R&ePTw<=yEnvd z<4;j5OibLz)(sBe<@|B0UB_mKG-HcP%u@;N;GwEN(H-}POm|NcKG0rw>!xMXjXv`| z6Piob?|W}Jm(%RB;a#`1>HLenug+*4vhq;(SuL|{-&tmA%G3>Ix+P&pH)rm0Y(k5S zHHCJ!n}m0G!*AJWER0~cT;Ar;r7>A+;ft^8HM!KgR@-W(sBy+mj%jkD%nR21joDnL zs@(D6Q039FIl2C-PgX5EAfX++UhPlxBYRTobps|acC6SoZPH0$?VveECi}MXUn}fR zX0Barv9E2k-=LR^BDG|al%{@GiWs(dN$HC9-N*cj{YL-pSo=0j9eJ2&3Vj_DkKH)C zf04UQS;@vExA8<|aEY=8@}C5T+ux5Aa(Vn%x<5YZ?6R>6Hymv7w(~DRHGGe{qdXf`6u$q zGv+rRdYV>z)K+=L;wzuN?b_ir{ek)!l^XZ@nQA%#tMs?Ij=$tO%UdhCc-e*<(L>RCQ%zw{%GGH_AtyL@Y#jrO^gYbXYZT|ciyCfO z{;*W%X!MwSoj21net(&)L|TouLYZ{ueG>dZHRZg9?!ediV@=Z2- z=OQNh2HK4qvr}pgZRFQXx$TR%bB?D)+pD{%HM~w(CnYxD4EtoG-xDsi{jg_`(vt4JE1ACs z?HM=S(qr&)htA23t0lC97X$r?Uc02^h}O(q_ZI7ZTCl75%=+UKn)>o?ZW@|he`R@3 zpS9eSPhA%GXm7QeOCB~obogrj;_jNogO0~2Sm;kln%Ud=IuONJXbM%#nW66;EgWv< z-sP2)=+89TvuATAH|TN6`48Q}=wPDpOX;5bzRD|}xz((&ug*RdLcJzuB|oyXIYrG` z`E!Vegm&x7gS(D>cn*!ln4b@%uvMCum3BpPM}-XPVRf=$Pd+ ztqpmbt{<@NEqOWT+B5a_`|dHkEz4q)mMbeG`4O7J0418|*)I!v-ej#A%(=kOvEZrR zc~#L@;2PFy-em8!#x#x*@X#^2a-@9ri_@}?mMW|||83li$M5tXo(^PI8=FgLr`N9= zoG5v(n(oW4Y}?l0xG&J~sn%v^{qppMlfIN%e_5Nebf#;;iJ#9reAHv76|uob7`SoF zh1t~$Ts>u6kt0eA#%@39X&H8UsLqt|MWv zzkOxZmXr5-^nd;|N!UfDR~Ys@(^I=Wy0RuVTzXoSOkVvl7Sds93aJsV+k6YA-|XmI zc$H`Ey*BXa^htN$t~_1i@T#)#uA!0nh9klgV0JX70i7GC zHTu^sO&jD@TD4uioX@-IcH`@a=%UYW%7>s!pq=T#X%AErXzq>{zKAm!{9A~y>N#UYD|J~Pi|%iFJ0zI{0_nm*KvW^7=< zoHNJOOF}UD_6zGxM_*3!ioFsd_D8#y4}O2ewLn*YdWTD0%2ticOSZ!H%gePc$__U> z8+m)j>~)&U?C+lrp2a9S&mN)Pm_M)5VDN@x5`xLcZ;{}(vTsM+>&mUw&uGXT>L@;T zeEY~#J!Y$R%9cfZ@PGBtDO$Luc3t;`E78Sj>n^;B3>5YnNkn$rpxL zI6Z#JU73~s>$KKo$rl!X^0vQXIymYa6#Jr~Zs~ z%*H!6&n?u|xV(bVs=A-s_+B+ZK}PoOZ-2CXjUUIUqWMknY^}e(OhPXC<^#*72ke^K z=Q=0*ny)b1aq7>v&^qOFU#Htg#ti8xxZlg}U2olK;iobNUl+T^-8EmL!&)-klV84h$)!Wv=ROgt{>lhg z+oB@q);U=ozV2Z|($g*gHv1IA6(_XcSAwV@dU$%#?8Hn^V8M`Z&$FnQsjQM zq_$K-uDyg@A^l~f;J}^>Ng3zv?6?%BZ(J0VczJv3Y3kclV~=xlda@5$S4Ye<+41Uy z+S$$zx4h~EU3xi`&cO9X&3mT@v?WcFyiiH=FKFHtsoCJAK8DQj_7I=%v03AJkNI_8vB3o^tx=7rx9idqLJO@e&$4 zqDo^n)d{_U+!>8FVN+dDHRP`7Gvp&tjVYVzhNxz2sym8=+ygPq*+|n#9%Y!1p?aYM z=4`4rQnFxEeGm_FUvvy|KcqE+P4!1PkO!dl;q1s!{p!P1YCQgBd5;l;$LEC?e=NQ0 zsXNyA*0g%sq9=EZwceV>g}KcO2`!!2^6)CR?a}t-ucy|$3hIdn&>QruLRV|bt(T1w z`Uj$OFh&qEuw+w5qp6SwqgKerAafR*8iGn8AB*llJ`UMhv8kbGKIG%kW5_2US8FzP zB3cUhB-9Rh81k`UQ^QduCZin4Q_wlcQ;~r)o618| zAx}fCkf$Sa7dDlTN+HiccOcJ1wytby7Mc%vHhK(s4sspIrskrhkPA>d*pH*TTmDMJ;0t)wgB*Q@XVUxKe>IGP46@i)T^r0*@GWdRPwMEtf9A8|N}MF?0O zJ@%fod%T}F6~%iN;pXyW6ptzh8$7_qlK5W!40#YkkfFm_bj4eaCZ~cPcqgbALI?;J zi-#cNSPrNHD}t2oPN-w)C&O@syT>77*$&j*E&-zyiAF!l;P)e?!SMwk6{kW}7VeJU z>h=90N|=}l0LI`@7b4+0eo2K@!M`G5UXHkq>EwOCKup7Lr}f3~TRHI0Q7iD@>N2}yM-N{jGR!@pug0Yn2#0l>dm5SOvh*eL7(Y&bRwI|Vxs z-@;)BVk5E9*pb+Y*qOKub}$A!GkAuu^N1fQ@f6|da|0L&fGu?ez+T6*gJ&QBz#jlF zSswsz051SM-Qqp@hcA>dAA3m(0DF@PfW5;77z;2O052J`&mV{tsUZvj${2uPfFyuK zfCK;zKs-PkKrBEEz!ZRJfGB`SfXM)CfCzwafG~hb0C;gu02mJt3NQ|!0057k50D2S z0LaCL4;5V{NQla5FNFlZ+fA zMB74BNAem$#+Cuc7DU5F5rPTWax$C_ICfTcSQ;7sN(S5!970h9edM8!I3!QV02bC1 zY`_VeSwe*ELDZfi)zbr;2l9TvvA2S56f$m=43q+6#7@{-DphoB@D_cVx&i86*iDY$_bM5WFlTqL;~dNkSaqZZeLU44fo7 zxnjM^0Aw|E7 zivf-!xL(0k5iXu3WaQ~UCo)u=j7_CcVHD!P_li{rd#};o_G8~-@fCUcdhL_f#`_M&46I@!!5Os)&9YF-eLMME}!y+c5 z&Z~7k25&ezD;PL1j1^py3lxw|tR_vUfP!P~XcY>mI5vcKUIAT<)zl_~&dE4hVowk* zTCcb)PE(rBGt*Nh?tr`Ul0|ku`ZycwsVNG|pcU5cO zKm+pAgF$&$llYh4(FQnuI%r0crZ)Mlg3Igap$dxgS_c}q>!JpbO@7?a8(UfIuFe$TQg&6(`#b ztpW<(N3&fVFH(yX`fL`8n(S{t=aWsG;KIulBK7DTyb@ zvrgpmFj%Dt5S2eHbf7)Uy1&fA``*qfFJ&4bPhd^nPUZ<%iCGyLoXjK^pO?vHadJ}x zK;sGo+{`>4hc7_<(nP24DApiXvIPs@Y}#Yl3A{`eDOjuyddF8~!D$PB(4Y{$N8++F zIJxObS%sN|_TQ7ly|_P8OEm6Zv<2z-E)=Byh4mdFU%*M>3i5J!nJKK~tlSJv9(I?( zcN7@nyE@3WK|5y{ppASPFTy{B6lnHW(JXw!OSplPo6DKXO5h}>=W!DFTo#`*H7lPO zZKNat+atke!67M{qQb1)Bz#Rx6C`oD+4w1ho0)`_)sd(}Z;2WUZb7l4)&qT^!9azD zueyYja=A(QiClb-m;_TYh$SRxUB^{H$D9`+cC*tRps7gS=^k7G#kHcX^m+BcUmXEU zKkZ*UeIlKbd9bf@x!HV9B3E>4VU-BN_=zYhRoC=83P*qk{4)t=&>lNLPf`-JldO_X z`rB0i4+dDq57rr8AHY%ietp3GJzh2c&xvyutVn&kq_)-%+;Dazxf!Nv(c=9wv4hD{>09wEs0Xth_VxOlw zx!`vTz{Lp8Rk)4E(ldCOJUFisQv z63Z4Fq$42+8cEcMT?12M)juZi`^zxZ_}&>CoC`||j;3tv(k$W}@&6MII{t}5EMi+? zwvZ1zE%g zmK8A(D&(UZ!4-WVi^lLwl!=dIfhc;YA%!X6=OUnD1T@qz!_a|zK?G#7NL&gD`%L14Vpt(@@^lg|(UF+%`;z^BPEp+34&I!KGWW&@8bLJMcnd9!<2S{M~+ z^Xrjgnl`e`7^=oe%H<>{PqpS|3Rs!=O3LR=Q6GH?R}1NGm`fYEUM-rbccR7Mj#SN|7sAwr`7 diff --git a/substrate/frame/revive/rpc/examples/js/contracts/.solhint.json b/substrate/frame/revive/rpc/examples/js/contracts/.solhint.json new file mode 100644 index 000000000000..ce2220e0b756 --- /dev/null +++ b/substrate/frame/revive/rpc/examples/js/contracts/.solhint.json @@ -0,0 +1,3 @@ +{ + "extends": "solhint:recommended" +} diff --git a/substrate/frame/revive/rpc/examples/js/contracts/ErrorTester.sol b/substrate/frame/revive/rpc/examples/js/contracts/ErrorTester.sol new file mode 100644 index 000000000000..f1fdd219624a --- /dev/null +++ b/substrate/frame/revive/rpc/examples/js/contracts/ErrorTester.sol @@ -0,0 +1,51 @@ +// SPDX-License-Identifier: MIT +pragma solidity ^0.8.0; + +contract ErrorTester { + bool public state; + + // Payable function that can be used to test insufficient funds errors + function valueMatch(uint256 value) public payable { + require(msg.value == value , "msg.value does not match value"); + } + + function setState(bool newState) public { + state = newState; + } + + // Trigger a require statement failure with a custom error message + function triggerRequireError() public pure { + require(false, "This is a require error"); + } + + // Trigger an assert statement failure + function triggerAssertError() public pure { + assert(false); + } + + // Trigger a revert statement with a custom error message + function triggerRevertError() public pure { + revert("This is a revert error"); + } + + // Trigger a division by zero error + function triggerDivisionByZero() public pure returns (uint256) { + uint256 a = 1; + uint256 b = 0; + return a / b; + } + + // Trigger an out-of-bounds array access + function triggerOutOfBoundsError() public pure returns (uint256) { + uint256[] memory arr = new uint256[](1); + return arr[2]; + } + + // Trigger a custom error + error CustomError(string message); + + function triggerCustomError() public pure { + revert CustomError("This is a custom error"); + } +} + diff --git a/substrate/frame/revive/rpc/examples/js/contracts/PiggyBank.sol b/substrate/frame/revive/rpc/examples/js/contracts/PiggyBank.sol index 1906c4658889..0c8a4d26f4dc 100644 --- a/substrate/frame/revive/rpc/examples/js/contracts/PiggyBank.sol +++ b/substrate/frame/revive/rpc/examples/js/contracts/PiggyBank.sol @@ -3,7 +3,7 @@ pragma solidity ^0.8.0; contract PiggyBank { - uint private balance; + uint256 private balance; address public owner; constructor() { @@ -11,16 +11,16 @@ contract PiggyBank { balance = 0; } - function deposit() public payable returns (uint) { + function deposit() public payable returns (uint256) { balance += msg.value; return balance; } - function getDeposit() public view returns (uint) { + function getDeposit() public view returns (uint256) { return balance; } - function withdraw(uint withdrawAmount) public returns (uint remainingBal) { + function withdraw(uint256 withdrawAmount) public returns (uint256 remainingBal) { require(msg.sender == owner); balance -= withdrawAmount; (bool success, ) = payable(msg.sender).call{value: withdrawAmount}(""); diff --git a/substrate/frame/revive/rpc/examples/js/package.json b/substrate/frame/revive/rpc/examples/js/package.json index 3ae1f0fbd799..6d8d00fd4214 100644 --- a/substrate/frame/revive/rpc/examples/js/package.json +++ b/substrate/frame/revive/rpc/examples/js/package.json @@ -1,22 +1,23 @@ { - "name": "demo", - "private": true, - "version": "0.0.0", - "type": "module", - "scripts": { - "dev": "vite", - "build": "tsc && vite build", - "preview": "vite preview", - "generate-types": "typechain --target=ethers-v6 'abi/*.json'" - }, - "dependencies": { - "@typechain/ethers-v6": "^0.5.1", - "ethers": "^6.13.4", - "solc": "^0.8.28", - "typechain": "^8.3.2" - }, - "devDependencies": { - "typescript": "^5.5.3", - "vite": "^5.4.8" - } + "name": "demo", + "private": true, + "version": "0.0.0", + "type": "module", + "scripts": { + "dev": "vite", + "build": "tsc && vite build", + "preview": "vite preview" + }, + "dependencies": { + "ethers": "^6.13.4", + "solc": "^0.8.28", + "viem": "^2.21.47", + "@parity/revive": "^0.0.5" + }, + "devDependencies": { + "prettier": "^3.3.3", + "@types/bun": "^1.1.13", + "typescript": "^5.5.3", + "vite": "^5.4.8" + } } diff --git a/substrate/frame/revive/rpc/examples/js/pvm/errorTester.polkavm b/substrate/frame/revive/rpc/examples/js/pvm/errorTester.polkavm new file mode 100644 index 0000000000000000000000000000000000000000..aebe24c4c0f597fb3d0171a9f527bc86d2d77b93 GIT binary patch literal 12890 zcmds73v?URnVvg$tb0cq$+9w*M$$m!Fl3xG(7>8vsJkmtQ>0*Wyw+^0a=c3tVr(ZN zq_$(rk3(r<;z!cfh?F=Xv?&QmoP;gqWE%o$PulL1@Yu8MS^5GBp}b$G910X@+U$2n zvh!##ER8g&lh0EKoX=-b0T3k{l?_RH5y>QvG-J3m&n^r8luG{my2mVRky}eo5E!`#k zm$Zb8$@j~@mEV#LT2^v)NvUTEyPj|4>(raQ8+^BETm2oShlBIVE)D&2s4H}H=)0kZ zLeGcjl&Mp`QZ9wh46lro8STa+h8F#7v^lya`b5khzbKxKf7iVHj62T=oO$rfOQ+_h z4o$sh>N8Vm;>wD*Dzek|PgBlHoOR(@4QKt)+JE*1(|>A5DsQWNu9D0+Z^ptI-7^Mf z+&1II8T~V#oVoc^cYLa$JJ1tUSgH3C#VbkV)590>AubP04Rsy)?1kv?Dr}16<&q@N z$mwB*?}nVhf|AS!066|@iX@jEp+S?D8#JuT<%v+)kx(a5n8H0l`L;0QlI$mvBHo}4 z#ynC+BGc(Cg-)lH;$ewLLOe|IFvLSwXqW{R$~?>yR8&vUbGa;+9i+h;T3$`VRdRU} zR2sqxODa6!3G&YzV=OEy9JHp>#gdH8zF|6DApUCNBP}Lb6(p<4kWPk8vQ{JO6f$6tL9X5F z)gDl_F;yF2+F4vYH?UH6J=R~Cn)lW}GuBH;vq3uQ$%-WD&62(p>2XL~9cix(RPxZE zbW94&Ftkw~nt`9{My^gXw7iNA+F}N(ix?NV7#9^W{?5>DR<$7-*jWURx!|!Pc$XpO zG$aQO7r_s>;0KD}hYd07AuVuE5xn08?=OPyGqnAJd_d))jpz&bL`TRc!1r-gGPJvV z=m=cSL-z^rTmyUvU0wv&8roi;U<_t(m}402e3dLQ#lNGxlrJYO;9O&1s5thpm}+Q1 zyxhgrL8HJ!?1&H`t?^Hc)p)rk$&C9HHd~?dXc;L01OEWvR54t$$#Wbcr_Phh3X&H* z>rbUjkzA2b7*SM33IQmWZTT||HWFH%B{b|1xqJbED2?xy{_4@fTM$04kU$z~^m-tZ zUJcUeRUo!r31aK@LSnr_cI~w7bJ9NhLVL`)P}P#m=~bzb^>WCteaK$q9Fj?-G2W$2 z?IrdAHR_xJ9}U-Q_cN!>r+uE$n4@8N1I+36DNr{^=LeEsS9qE4r-~v&uP|4M26DyC z>@_s(Yq#JiWU0%5NNNKrjit^_zkBm-KRS<`o4)hKTa>R*mi||KZ}G77aQqhQc3zr} z8vmHNLGf4A5PwBAS{2%Cv{`7CXck(6$dLpQY7v@Eh>;*9T17~#hLHFyLQIR0a5W*3 zN^)E|nweHPp&Y9MB$6dfqoeJsV^4g=;TF%$_oCtO;3ihr%rd=P-f;|4VC7hRC(-*k&#A!Aba8Di zi+2&dUFD0fQEF0gIn7WHNw%5+v&6!0^YgL^MUhOAL z^QjOBC+98o-pvZDkG=H{W7?mNuU=@%zH8qxy1TL1Y4W%CER(TVf5m3WUoncd9&H3| z9oisTKiUnF9JxVq#bQJv#tjmQu9rw`vqa+SBx3eUBs?mS$e{EdV(}kfSC(wi$quqx zBV!8L!(G-kg0;Mx%l*g9_1s#oW(HLG&@sM&TabX9ObsV~i0HkHx5?(+%(|OqIw{#5 zG}md`A(rW;^1frdonqJH`-wiH@@~!A?8$U_$PR;ynVQcRzl-S1$G`8fzVEXb)4Lhp z$3M5$ZgtkG_H6s1%t4>FM(C$~8HqN=HzuZTB+g|jw#?pU+Zl^#Gri6ZRlAxAa|ccC zRZG>M!&nIeX5RWXW8eGZNvvh*KSB-9QA*SMSL}YL3@Y_;s@s6~lc8?su-p9wo}4-G z2gYuD_e7p3QljJqc=E)viI0~X-&8*-+*n;&;KsD>w;21zJ126Z%vH9JQz&+E63&ul z(xQ=8g)HH6?@2efb-V_5a}%9vp>neH-l!wAavHL3;u18MGrX zx?Gwa>g`t8z%v|(3W4Sj^;sS}(k~W33>!d>?D@@XpAbp&48YCAC?BJnZ5sU9I zw0$hJyBLcj4?rNkgCUL$4De8wz(ByggN23##x6JD-YL8mjbsDOMT`~^goj!L#voU( zF|?Kfh7&kc#5n9?94=xYop3!LjnoHN5rexJyoiC6;fBH(b%D!@7%3McRm4En&|ko) z4P02nsCF@`ix^0GRu?dm0lSD%>0(qCF_1Q`@@So&4{A3eh*=H9tcYLDW=3KNUE@jf z9zlc{wdN>CNN0}0(^nIuE+mSORzMK-#_NUoizD_m9TTaPK+2jsIf*p_pn;=Edj=R| zrJnKJV%ANsF}CCPB$6U+^`t#XIOf$cnW4b~ArBG;;hwu>cQ!&PkH z60f$&b4t2&^6nu~G#Wojsy8GBQpMyU?Ph{$K_1Bic4a*hMP>3V)H_)k+wc$)O>GaS z!K|i;6c9m_NH1Fp>EJhCr?Dh8>u9)^>h(145F_=z>7fT{e?zk;c<$$Z$5`fdyn>9t zZK1pZ=gq^Mx~$gpLB1LTNJAWdtA?ZR0Pa4oU+E;FfiiqX0O$QG_8)? z@OD~enwGgngRUVQxBAeZ<+fsVcrw#G{A$UX%}6MTV3P*r$O0NtJi*zHL1K$3GN9-J z5^N#yWyGjAhnY1j)95Tr4tWSQsxvv67d|lU=xaPyAIDSQ%k@6QfR4UGq$ng_1@}zivvs&(+lQxaGsrVBYxDy?Vpi)9`5?J4 z5yZ&CZHs*>RyAIFO$e_sOV4>4T0Ft?55CISFJ41-O^nKh)``@+YA5=C_}WR9t6Uij3p|H@H2h>oV(3pq0`UOK=OB^*WMokgp zVgo@FEC!8c1KmZ89=8b6BQSPx8cC{s6G%>ACJ*frgl37p&@6#;KPNXRG*qYB29jUb zz#lignt{wGq!q}KVNF%ta!&!UNsJ^!-PQX# z?INM{kSDtf9?4%}BKI-SbhIFvhQ`qpGzo3;(8pi#D}+Fgqx}@^5wyc-52O7%+CdaC zWkW*g=a?KroD@HZs^vTqLQFK}1;j~+k79_K;)t0{#7u6SbW{=rEv!RZ>w7;ZLL&zx z8oo!O=3a@$?viM9k3^^JlxS$1MB`f|8I=*2_7+L;B|ut1d{Zb2)~mI*q?{SJ}zkm3Pw0rfklt**28*$XnwlJ5m!ynC_1S{V~lSqkzQ@eXjwWsd!Jp`9i}x&xxgLFF_goVbdQr{9)Z6 z4*J8IKg|7M#qXJy>isfw1TT1k&Vw%cZ(j6=6JSv2w67@K5<}1bmW%tn7mxc9%XO0l zJ&bl(ew9ld0-9sQSwUEC+1KmCp_xYGq6eBRyB|8122w{1ChKlh<6=c4&f ziydlx?gYyzV*39Z%lZ1VlUdHi_x@JQ?LVJA#jbsL%ee|e!8T7=&TFzRg{7xbhHPA_);3`}+nP#tzwZIj`$u;7AVNEUb{E=S zw4G>s(6*s%aU-{4^n@S|!4$$LUl_4mF@RcfsXOEBGw^bM)fme2%=^bsurer?c!J9g z9uaK&@26pt?3_pwJ3TnRJe>o!2;o??-6pj_$Gtd*APp9mH%Q5>8QIPoCHdWGZKeVaJ?S4WC#SfqQe=${; zJvEuB>M3>SHtngunyLEbk&{hT-<`h^t3QbDzfzF5(xotAs;;kd30x%zoM@^}4Dvdg z+ByoBs!SeSNOR&EN20Yo;b%@uYrDc1W6qugjw{`v^dqinEG9QMPDlC{8>*@$XR4c~_f zlS;$0NF>QOc&tt>vr)_3haywGTVw)GoqJ5oGWQ{2c6g3jt9>NY$nTab8}W2Us+)p_uiLy2a8_F#yWC8%3c{%gK|5e~8|ii*L8MZ?_cRE)<0k zy^WU?cDmr5MKH>isDTc!056smy`m%J6<`#dQ4ZcBs-%Ir#nJ|9D7XYNw+Kenahs@+ zAWNcSjdW+0?r`Y#dJ>*R_teqbQ*qjmOZW&?`4j=cj_ zOM7!>gQjg_{;8DqAJ_bG?vE=t%C}qM_7S9B;))0Aj1Z71j2{3S%VP^;eRpIlfxdSuFe}(V9Y!pmqT;p^64FI#IuhW^oCE44GuuAZvB9E=Vzv z9)tGkv@b}8G&0P|T7?W!%%g|XUWMkyIk!&w*{=odryqyEBOPRgLOMC-D{gY+f}~H! zeGVb3qKFkhSqf(iGmHBPS-pMy6k@!#k17~2E-qrAw!gK2k)4po2VIN@ix@a#K-H{= zPI`=y;}gQZ$$fiM@ofk@viNR!LYkMj;3Y*cq#0HA9?!(-1;iDz^A^DcaqT&t=+wFO zvy(48?PGSYtvS7#z0{uREcI$De9i%{z1FUAaA7Q-wfDNW2dKC`uvf)VhO+PM0U|?ehW_LYG|_p z+ew>I8mG-1+E1H>^`y-~SaaH}L#HV2*hL!Mi(`p~4W7h$Dd7%u{-cVDOuwN;*mpPQ zPuwDvxS)ub+G)=X{QQKZKQSu({1<{V&;Q!R7m5G*r+uxE_$M|=cewcbetq15ScGaag_>OD6ge)6Yc{AAR4WrdZm{3X-idV zCTL9P1ueI@xZkNvZ1!KDqHzNe35uJZ=lDbZ`%HBlFXUDTg zPY=Ir)&Mhbjm2w=eMP|z@g)I|P+a|60IgZEBsq>X3{&Hb<&-9lY{&L-4 z9`u)M{&Maw$EMGYcO7&!0`ebp6+t6W#TkWaaAytkmz1&xP`;flH;Jl>7<#*8W9Yro z#Lz37FmM9bcrp0Gj;mWh;JS{)wII^eo>&e-O^Lo2*sz4=^u(E@7`#H@-B z;PRF?Gw3A|gYUrYGPr7!@58~6Cv%@CvkS7BK-_P20-=)c!1+;0W>*P`SXh*`5}mVn z51zD*cEgr(iW^>?L1AuJ8nnkG!6YfK!F@TotagfoEXR}BDeZj(5s4?UOWOU2bVt9X z&b0J~)Y<9$aPT|fIlQ8Ogs1cCQSlSM`z-)At+Ysjk2Tj@EWyrrg7`F^YLyFyLp zNBXUFY7T$}kRA$cnv-`vwK&yUTWhJ&Ibxu>XQy{sGX#b^Zm`0#D$=2#_>|%EwZXx` zRNlJDMFG~tU-`6cRh)CcCc4CrhVw6@Jpo#t!$ z$ukvOpLZWZazIqjPnU~d?oJBc;*$uuTuuo_xSyLg70|I%3?SC)O*dTO&P)vSUZRO% z@h1cn61Q#r`usN0Beot5l)vi2#XqUMQb2CVZv$t!vPyh`4=EW#+-O+^VkdE0Ol4dF z1Oc%n7^LAQF|QEVihuR|NELSI_!M2?KV<_1+}#GOEIrcDFgGvuqoLSNn3|wc)Q5B) zR4z#bt#KCNdsV9TESDJGObNyoR*tb}s5j~OKc7(3i8NN&zYQxsMT$WYOoKT?}1i8fRf-*mjwgy>*{?hrx+#BHgDpx~@{`_lZX)SN_+EAl1o P|DsnIq4bp_3F&_TlmMih literal 0 HcmV?d00001 diff --git a/substrate/frame/revive/rpc/examples/js/src/balance.ts b/substrate/frame/revive/rpc/examples/js/src/balance.ts new file mode 100644 index 000000000000..1261dcab7812 --- /dev/null +++ b/substrate/frame/revive/rpc/examples/js/src/balance.ts @@ -0,0 +1,8 @@ +import { walletClient } from './lib.ts' + +const recipient = '0x8D97689C9818892B700e27F316cc3E41e17fBeb9' +try { + console.log(`Recipient balance: ${await walletClient.getBalance({ address: recipient })}`) +} catch (err) { + console.error(err) +} diff --git a/substrate/frame/revive/rpc/examples/js/src/build-contracts.ts b/substrate/frame/revive/rpc/examples/js/src/build-contracts.ts index c6b7700d1ccf..b25b5a7f2199 100644 --- a/substrate/frame/revive/rpc/examples/js/src/build-contracts.ts +++ b/substrate/frame/revive/rpc/examples/js/src/build-contracts.ts @@ -1,11 +1,23 @@ import { compile } from '@parity/revive' +import { format } from 'prettier' +import { parseArgs } from 'node:util' import solc from 'solc' import { readFileSync, writeFileSync } from 'fs' import { join } from 'path' type CompileInput = Parameters[0] -type CompileOutput = Awaited> -type Abi = CompileOutput['contracts'][string][string]['abi'] + +const { + values: { filter }, +} = parseArgs({ + args: process.argv.slice(2), + options: { + filter: { + type: 'string', + short: 'f', + }, + }, +}) function evmCompile(sources: CompileInput) { const input = { @@ -27,9 +39,9 @@ console.log('Compiling contracts...') const input = [ { file: 'Event.sol', contract: 'EventExample', keypath: 'event' }, - { file: 'Revert.sol', contract: 'RevertExample', keypath: 'revert' }, { file: 'PiggyBank.sol', contract: 'PiggyBank', keypath: 'piggyBank' }, -] + { file: 'ErrorTester.sol', contract: 'ErrorTester', keypath: 'errorTester' }, +].filter(({ keypath }) => !filter || keypath.includes(filter)) for (const { keypath, contract, file } of input) { const input = { @@ -41,7 +53,12 @@ for (const { keypath, contract, file } of input) { const out = JSON.parse(evmCompile(input)) const entry = out.contracts[file][contract] writeFileSync(join('evm', `${keypath}.bin`), Buffer.from(entry.evm.bytecode.object, 'hex')) - writeFileSync(join('abi', `${keypath}.json`), JSON.stringify(entry.abi, null, 2)) + writeFileSync( + join('abi', `${keypath}.ts`), + await format(`export const abi = ${JSON.stringify(entry.abi, null, 2)} as const`, { + parser: 'typescript', + }) + ) } { diff --git a/substrate/frame/revive/rpc/examples/js/src/event.ts b/substrate/frame/revive/rpc/examples/js/src/event.ts index 94cc2560272e..2e672a9772ff 100644 --- a/substrate/frame/revive/rpc/examples/js/src/event.ts +++ b/substrate/frame/revive/rpc/examples/js/src/event.ts @@ -1,15 +1,29 @@ //! Run with bun run script-event.ts -import { call, getContract, deploy } from './lib.ts' - -try { - const { abi, bytecode } = getContract('event') - const contract = await deploy(bytecode, abi) - const receipt = await call('triggerEvent', await contract.getAddress(), abi) - if (receipt) { - for (const log of receipt.logs) { - console.log('Event log:', JSON.stringify(log, null, 2)) - } - } -} catch (err) { - console.error(err) + +import { abi } from '../abi/event.ts' +import { assert, getByteCode, walletClient } from './lib.ts' + +const deployHash = await walletClient.deployContract({ + abi, + bytecode: getByteCode('event'), +}) +const deployReceipt = await walletClient.waitForTransactionReceipt({ hash: deployHash }) +const contractAddress = deployReceipt.contractAddress +console.log('Contract deployed:', contractAddress) +assert(contractAddress, 'Contract address should be set') + +const { request } = await walletClient.simulateContract({ + account: walletClient.account, + address: contractAddress, + abi, + functionName: 'triggerEvent', +}) + +const hash = await walletClient.writeContract(request) +const receipt = await walletClient.waitForTransactionReceipt({ hash }) +console.log(`Receipt: ${receipt.status}`) +console.log(`Logs receipt: ${receipt.status}`) + +for (const log of receipt.logs) { + console.log('Event log:', log) } diff --git a/substrate/frame/revive/rpc/examples/js/src/geth-diff-setup.ts b/substrate/frame/revive/rpc/examples/js/src/geth-diff-setup.ts new file mode 100644 index 000000000000..92b20473d165 --- /dev/null +++ b/substrate/frame/revive/rpc/examples/js/src/geth-diff-setup.ts @@ -0,0 +1,162 @@ +import { spawn, spawnSync, Subprocess } from 'bun' +import { join, resolve } from 'path' +import { readFileSync } from 'fs' +import { createWalletClient, defineChain, Hex, http, publicActions } from 'viem' +import { privateKeyToAccount } from 'viem/accounts' + +export function getByteCode(name: string, evm: boolean): Hex { + const bytecode = evm ? readFileSync(`evm/${name}.bin`) : readFileSync(`pvm/${name}.polkavm`) + return `0x${Buffer.from(bytecode).toString('hex')}` +} + +export type JsonRpcError = { + code: number + message: string + data: Hex +} + +export function killProcessOnPort(port: number) { + // Check which process is using the specified port + const result = spawnSync(['lsof', '-ti', `:${port}`]) + const output = result.stdout.toString().trim() + + if (output) { + console.log(`Port ${port} is in use. Killing process...`) + const pids = output.split('\n') + + // Kill each process using the port + for (const pid of pids) { + spawnSync(['kill', '-9', pid]) + console.log(`Killed process with PID: ${pid}`) + } + } +} + +export let jsonRpcErrors: JsonRpcError[] = [] +export async function createEnv(name: 'geth' | 'kitchensink') { + const gethPort = process.env.GETH_PORT || '8546' + const kitchensinkPort = process.env.KITCHENSINK_PORT || '8545' + const url = `http://localhost:${name == 'geth' ? gethPort : kitchensinkPort}` + const chain = defineChain({ + id: name == 'geth' ? 1337 : 420420420, + name, + nativeCurrency: { + name: 'Westie', + symbol: 'WST', + decimals: 18, + }, + rpcUrls: { + default: { + http: [url], + }, + }, + testnet: true, + }) + + const transport = http(url, { + onFetchResponse: async (response) => { + const raw = await response.clone().json() + if (raw.error) { + jsonRpcErrors.push(raw.error as JsonRpcError) + } + }, + }) + + const wallet = createWalletClient({ + transport, + chain, + }) + + const [account] = await wallet.getAddresses() + const serverWallet = createWalletClient({ + account, + transport, + chain, + }).extend(publicActions) + + const accountWallet = createWalletClient({ + account: privateKeyToAccount( + '0xa872f6cbd25a0e04a08b1e21098017a9e6194d101d75e13111f71410c59cd57f' + ), + transport, + chain, + }).extend(publicActions) + + return { serverWallet, accountWallet, evm: name == 'geth' } +} + +// wait for http request to return 200 +export function waitForHealth(url: string) { + return new Promise((resolve, reject) => { + const start = Date.now() + const interval = setInterval(() => { + fetch(url) + .then((res) => { + if (res.status === 200) { + clearInterval(interval) + resolve() + } + }) + .catch(() => { + const elapsed = Date.now() - start + if (elapsed > 30_000) { + clearInterval(interval) + reject(new Error('hit timeout')) + } + }) + }, 1000) + }) +} + +export const procs: Subprocess[] = [] +const polkadotSdkPath = resolve(__dirname, '../../../../../../..') +if (!process.env.USE_LIVE_SERVERS) { + procs.push( + // Run geth on port 8546 + // + (() => { + killProcessOnPort(8546) + return spawn( + 'geth --http --http.api web3,eth,debug,personal,net --http.port 8546 --dev --verbosity 0'.split( + ' ' + ), + { stdout: Bun.file('/tmp/geth.out.log'), stderr: Bun.file('/tmp/geth.err.log') } + ) + })(), + //Run the substate node + (() => { + killProcessOnPort(9944) + return spawn( + [ + './target/debug/substrate-node', + '--dev', + '-l=error,evm=debug,sc_rpc_server=info,runtime::revive=debug', + ], + { + stdout: Bun.file('/tmp/kitchensink.out.log'), + stderr: Bun.file('/tmp/kitchensink.err.log'), + cwd: polkadotSdkPath, + } + ) + })(), + // Run eth-rpc on 8545 + await (async () => { + killProcessOnPort(8545) + const proc = spawn( + [ + './target/debug/eth-rpc', + '--dev', + '--node-rpc-url=ws://localhost:9944', + '-l=rpc-metrics=debug,eth-rpc=debug', + ], + { + stdout: Bun.file('/tmp/eth-rpc.out.log'), + stderr: Bun.file('/tmp/eth-rpc.err.log'), + cwd: polkadotSdkPath, + } + ) + await waitForHealth('http://localhost:8545/health').catch() + return proc + })() + ) +} diff --git a/substrate/frame/revive/rpc/examples/js/src/geth-diff.test.ts b/substrate/frame/revive/rpc/examples/js/src/geth-diff.test.ts new file mode 100644 index 000000000000..468e7860bb9a --- /dev/null +++ b/substrate/frame/revive/rpc/examples/js/src/geth-diff.test.ts @@ -0,0 +1,245 @@ +import { jsonRpcErrors, procs, createEnv, getByteCode } from './geth-diff-setup.ts' +import { afterAll, afterEach, beforeAll, describe, expect, test } from 'bun:test' +import { encodeFunctionData, Hex, parseEther } from 'viem' +import { abi } from '../abi/errorTester' + +afterEach(() => { + jsonRpcErrors.length = 0 +}) + +afterAll(async () => { + procs.forEach((proc) => proc.kill()) +}) + +const envs = await Promise.all([createEnv('geth'), createEnv('kitchensink')]) + +for (const env of envs) { + describe(env.serverWallet.chain.name, () => { + let errorTesterAddr: Hex = '0x' + beforeAll(async () => { + const hash = await env.serverWallet.deployContract({ + abi, + bytecode: getByteCode('errorTester', env.evm), + }) + const deployReceipt = await env.serverWallet.waitForTransactionReceipt({ hash }) + if (!deployReceipt.contractAddress) throw new Error('Contract address should be set') + errorTesterAddr = deployReceipt.contractAddress + }) + + test('triggerAssertError', async () => { + expect.assertions(3) + try { + await env.accountWallet.readContract({ + address: errorTesterAddr, + abi, + functionName: 'triggerAssertError', + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(3) + expect(lastJsonRpcError?.data).toBe( + '0x4e487b710000000000000000000000000000000000000000000000000000000000000001' + ) + expect(lastJsonRpcError?.message).toBe('execution reverted: assert(false)') + } + }) + + test('triggerRevertError', async () => { + expect.assertions(3) + try { + await env.accountWallet.readContract({ + address: errorTesterAddr, + abi, + functionName: 'triggerRevertError', + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(3) + expect(lastJsonRpcError?.message).toBe('execution reverted: This is a revert error') + expect(lastJsonRpcError?.data).toBe( + '0x08c379a00000000000000000000000000000000000000000000000000000000000000020000000000000000000000000000000000000000000000000000000000000001654686973206973206120726576657274206572726f7200000000000000000000' + ) + } + }) + + test('triggerDivisionByZero', async () => { + expect.assertions(3) + try { + await env.accountWallet.readContract({ + address: errorTesterAddr, + abi, + functionName: 'triggerDivisionByZero', + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(3) + expect(lastJsonRpcError?.data).toBe( + '0x4e487b710000000000000000000000000000000000000000000000000000000000000012' + ) + expect(lastJsonRpcError?.message).toBe( + 'execution reverted: division or modulo by zero' + ) + } + }) + + test('triggerOutOfBoundsError', async () => { + expect.assertions(3) + try { + await env.accountWallet.readContract({ + address: errorTesterAddr, + abi, + functionName: 'triggerOutOfBoundsError', + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(3) + expect(lastJsonRpcError?.data).toBe( + '0x4e487b710000000000000000000000000000000000000000000000000000000000000032' + ) + expect(lastJsonRpcError?.message).toBe( + 'execution reverted: out-of-bounds access of an array or bytesN' + ) + } + }) + + test('triggerCustomError', async () => { + expect.assertions(3) + try { + await env.accountWallet.readContract({ + address: errorTesterAddr, + abi, + functionName: 'triggerCustomError', + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(3) + expect(lastJsonRpcError?.data).toBe( + '0x8d6ea8be0000000000000000000000000000000000000000000000000000000000000020000000000000000000000000000000000000000000000000000000000000001654686973206973206120637573746f6d206572726f7200000000000000000000' + ) + expect(lastJsonRpcError?.message).toBe('execution reverted') + } + }) + + test('eth_call (not enough funds)', async () => { + expect.assertions(3) + try { + await env.accountWallet.simulateContract({ + address: errorTesterAddr, + abi, + functionName: 'valueMatch', + value: parseEther('10'), + args: [parseEther('10')], + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(-32000) + expect(lastJsonRpcError?.message).toInclude('insufficient funds') + expect(lastJsonRpcError?.data).toBeUndefined() + } + }) + + test('eth_call transfer (not enough funds)', async () => { + expect.assertions(3) + try { + await env.accountWallet.sendTransaction({ + to: '0x75E480dB528101a381Ce68544611C169Ad7EB342', + value: parseEther('10'), + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(-32000) + expect(lastJsonRpcError?.message).toInclude('insufficient funds') + expect(lastJsonRpcError?.data).toBeUndefined() + } + }) + + test('eth_estimate (not enough funds)', async () => { + expect.assertions(3) + try { + await env.accountWallet.estimateContractGas({ + address: errorTesterAddr, + abi, + functionName: 'valueMatch', + value: parseEther('10'), + args: [parseEther('10')], + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(-32000) + expect(lastJsonRpcError?.message).toInclude('insufficient funds') + expect(lastJsonRpcError?.data).toBeUndefined() + } + }) + + test('eth_estimate (revert)', async () => { + expect.assertions(3) + try { + await env.serverWallet.estimateContractGas({ + address: errorTesterAddr, + abi, + functionName: 'valueMatch', + value: parseEther('11'), + args: [parseEther('10')], + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(3) + expect(lastJsonRpcError?.message).toBe( + 'execution reverted: msg.value does not match value' + ) + expect(lastJsonRpcError?.data).toBe( + '0x08c379a00000000000000000000000000000000000000000000000000000000000000020000000000000000000000000000000000000000000000000000000000000001e6d73672e76616c756520646f6573206e6f74206d617463682076616c75650000' + ) + } + }) + + test('eth_get_balance (no account)', async () => { + const balance = await env.serverWallet.getBalance({ + address: '0x0000000000000000000000000000000000000123', + }) + expect(balance).toBe(0n) + }) + + test('eth_estimate (not enough funds to cover gas specified)', async () => { + expect.assertions(4) + try { + let balance = await env.serverWallet.getBalance(env.accountWallet.account) + expect(balance).toBe(0n) + + await env.accountWallet.estimateContractGas({ + address: errorTesterAddr, + abi, + functionName: 'setState', + args: [true], + }) + } catch (err) { + const lastJsonRpcError = jsonRpcErrors.pop() + expect(lastJsonRpcError?.code).toBe(-32000) + expect(lastJsonRpcError?.message).toInclude('insufficient funds') + expect(lastJsonRpcError?.data).toBeUndefined() + } + }) + + test('eth_estimate (no gas specified)', async () => { + let balance = await env.serverWallet.getBalance(env.accountWallet.account) + expect(balance).toBe(0n) + + const data = encodeFunctionData({ + abi, + functionName: 'setState', + args: [true], + }) + + await env.accountWallet.request({ + method: 'eth_estimateGas', + params: [ + { + data, + from: env.accountWallet.account.address, + to: errorTesterAddr, + }, + ], + }) + }) + }) +} diff --git a/substrate/frame/revive/rpc/examples/js/src/lib.ts b/substrate/frame/revive/rpc/examples/js/src/lib.ts index 975d8faf15b3..e1f0e780d95b 100644 --- a/substrate/frame/revive/rpc/examples/js/src/lib.ts +++ b/substrate/frame/revive/rpc/examples/js/src/lib.ts @@ -1,22 +1,11 @@ -import { - Contract, - ContractFactory, - JsonRpcProvider, - TransactionReceipt, - TransactionResponse, - Wallet, -} from 'ethers' import { readFileSync } from 'node:fs' -import type { compile } from '@parity/revive' import { spawn } from 'node:child_process' import { parseArgs } from 'node:util' -import { BaseContract } from 'ethers' - -type CompileOutput = Awaited> -type Abi = CompileOutput['contracts'][string][string]['abi'] +import { createWalletClient, defineChain, Hex, http, parseEther, publicActions } from 'viem' +import { privateKeyToAccount } from 'viem/accounts' const { - values: { geth, westend, ['private-key']: privateKey }, + values: { geth, proxy, westend, endowment, ['private-key']: privateKey }, } = parseArgs({ args: process.argv.slice(2), options: { @@ -24,6 +13,13 @@ const { type: 'string', short: 'k', }, + endowment: { + type: 'string', + short: 'e', + }, + proxy: { + type: 'boolean', + }, geth: { type: 'boolean', }, @@ -42,7 +38,7 @@ if (geth) { '--http.api', 'web3,eth,debug,personal,net', '--http.port', - '8546', + process.env.GETH_PORT ?? '8546', '--dev', '--verbosity', '0', @@ -55,56 +51,78 @@ if (geth) { await new Promise((resolve) => setTimeout(resolve, 500)) } -export const provider = new JsonRpcProvider( - westend +const rpcUrl = proxy + ? 'http://localhost:8080' + : westend ? 'https://westend-asset-hub-eth-rpc.polkadot.io' : geth ? 'http://localhost:8546' : 'http://localhost:8545' -) -export const signer = privateKey ? new Wallet(privateKey, provider) : await provider.getSigner() -console.log(`Signer address: ${await signer.getAddress()}, Nonce: ${await signer.getNonce()}`) +export const chain = defineChain({ + id: geth ? 1337 : 420420420, + name: 'Asset Hub Westend', + network: 'asset-hub', + nativeCurrency: { + name: 'Westie', + symbol: 'WST', + decimals: 18, + }, + rpcUrls: { + default: { + http: [rpcUrl], + }, + }, + testnet: true, +}) + +const wallet = createWalletClient({ + transport: http(), + chain, +}) +const [account] = await wallet.getAddresses() +export const serverWalletClient = createWalletClient({ + account, + transport: http(), + chain, +}) + +export const walletClient = await (async () => { + if (privateKey) { + const account = privateKeyToAccount(`0x${privateKey}`) + console.log(`Wallet address ${account.address}`) + + const wallet = createWalletClient({ + account, + transport: http(), + chain, + }) + + if (endowment) { + await serverWalletClient.sendTransaction({ + to: account.address, + value: parseEther(endowment), + }) + console.log(`Endowed address ${account.address} with: ${endowment}`) + } + + return wallet.extend(publicActions) + } else { + return serverWalletClient.extend(publicActions) + } +})() /** * Get one of the pre-built contracts * @param name - the contract name */ -export function getContract(name: string): { abi: Abi; bytecode: string } { +export function getByteCode(name: string): Hex { const bytecode = geth ? readFileSync(`evm/${name}.bin`) : readFileSync(`pvm/${name}.polkavm`) - const abi = JSON.parse(readFileSync(`abi/${name}.json`, 'utf8')) as Abi - return { abi, bytecode: Buffer.from(bytecode).toString('hex') } + return `0x${Buffer.from(bytecode).toString('hex')}` } -/** - * Deploy a contract - * @returns the contract address - **/ -export async function deploy(bytecode: string, abi: Abi, args: any[] = []): Promise { - console.log('Deploying contract with', args) - const contractFactory = new ContractFactory(abi, bytecode, signer) - - const contract = await contractFactory.deploy(args) - await contract.waitForDeployment() - const address = await contract.getAddress() - console.log(`Contract deployed: ${address}`) - - return contract -} - -/** - * Call a contract - **/ -export async function call( - method: string, - address: string, - abi: Abi, - args: any[] = [], - opts: { value?: bigint } = {} -): Promise { - console.log(`Calling ${method} at ${address} with`, args, opts) - const contract = new Contract(address, abi, signer) - const tx = (await contract[method](...args, opts)) as TransactionResponse - console.log('Call transaction hash:', tx.hash) - return tx.wait() +export function assert(condition: any, message: string): asserts condition { + if (!condition) { + throw new Error(message) + } } diff --git a/substrate/frame/revive/rpc/examples/js/src/piggy-bank.ts b/substrate/frame/revive/rpc/examples/js/src/piggy-bank.ts index 7a8edbde3662..0040b0c78dc4 100644 --- a/substrate/frame/revive/rpc/examples/js/src/piggy-bank.ts +++ b/substrate/frame/revive/rpc/examples/js/src/piggy-bank.ts @@ -1,24 +1,69 @@ -import { provider, call, getContract, deploy } from './lib.ts' -import { parseEther } from 'ethers' -import { PiggyBank } from '../types/ethers-contracts/PiggyBank' +import { assert, getByteCode, walletClient } from './lib.ts' +import { abi } from '../abi/piggyBank.ts' +import { parseEther } from 'viem' -try { - const { abi, bytecode } = getContract('piggyBank') - const contract = (await deploy(bytecode, abi)) as PiggyBank - const address = await contract.getAddress() +const hash = await walletClient.deployContract({ + abi, + bytecode: getByteCode('piggyBank'), +}) +const deployReceipt = await walletClient.waitForTransactionReceipt({ hash }) +const contractAddress = deployReceipt.contractAddress +console.log('Contract deployed:', contractAddress) +assert(contractAddress, 'Contract address should be set') - let receipt = await call('deposit', address, abi, [], { - value: parseEther('10.0'), +// Deposit 10 WST +{ + const result = await walletClient.estimateContractGas({ + account: walletClient.account, + address: contractAddress, + abi, + functionName: 'deposit', + value: parseEther('10'), }) - console.log('Deposit receipt:', receipt?.status) - console.log(`Contract balance: ${await provider.getBalance(address)}`) - console.log('deposit: ', await contract.getDeposit()) + console.log(`Gas estimate: ${result}`) - receipt = await call('withdraw', address, abi, [parseEther('5.0')]) - console.log('Withdraw receipt:', receipt?.status) - console.log(`Contract balance: ${await provider.getBalance(address)}`) - console.log('deposit: ', await contract.getDeposit()) -} catch (err) { - console.error(err) + const { request } = await walletClient.simulateContract({ + account: walletClient.account, + address: contractAddress, + abi, + functionName: 'deposit', + value: parseEther('10'), + }) + + request.nonce = 0 + const hash = await walletClient.writeContract(request) + + const receipt = await walletClient.waitForTransactionReceipt({ hash }) + console.log(`Deposit receipt: ${receipt.status}`) + if (process.env.STOP) { + process.exit(0) + } +} + +// Withdraw 5 WST +{ + const { request } = await walletClient.simulateContract({ + account: walletClient.account, + address: contractAddress, + abi, + functionName: 'withdraw', + args: [parseEther('5')], + }) + + const hash = await walletClient.writeContract(request) + const receipt = await walletClient.waitForTransactionReceipt({ hash }) + console.log(`Withdraw receipt: ${receipt.status}`) + + // Check remaining balance + const balance = await walletClient.readContract({ + address: contractAddress, + abi, + functionName: 'getDeposit', + }) + + console.log(`Get deposit: ${balance}`) + console.log( + `Get contract balance: ${await walletClient.getBalance({ address: contractAddress })}` + ) } diff --git a/substrate/frame/revive/rpc/examples/js/src/revert.ts b/substrate/frame/revive/rpc/examples/js/src/revert.ts deleted file mode 100644 index ea1bf4eceeb9..000000000000 --- a/substrate/frame/revive/rpc/examples/js/src/revert.ts +++ /dev/null @@ -1,10 +0,0 @@ -//! Run with bun run script-revert.ts -import { call, getContract, deploy } from './lib.ts' - -try { - const { abi, bytecode } = getContract('revert') - const contract = await deploy(bytecode, abi) - await call('doRevert', await contract.getAddress(), abi) -} catch (err) { - console.error(err) -} diff --git a/substrate/frame/revive/rpc/examples/js/src/transfer.ts b/substrate/frame/revive/rpc/examples/js/src/transfer.ts index ae2dd50f2af8..aef9a487b0c0 100644 --- a/substrate/frame/revive/rpc/examples/js/src/transfer.ts +++ b/substrate/frame/revive/rpc/examples/js/src/transfer.ts @@ -1,17 +1,18 @@ -import { parseEther } from 'ethers' -import { provider, signer } from './lib.ts' +import { parseEther } from 'viem' +import { walletClient } from './lib.ts' const recipient = '0x75E480dB528101a381Ce68544611C169Ad7EB342' try { - console.log(`Signer balance: ${await provider.getBalance(signer.address)}`) - console.log(`Recipient balance: ${await provider.getBalance(recipient)}`) - await signer.sendTransaction({ + console.log(`Signer balance: ${await walletClient.getBalance(walletClient.account)}`) + console.log(`Recipient balance: ${await walletClient.getBalance({ address: recipient })}`) + + await walletClient.sendTransaction({ to: recipient, value: parseEther('1.0'), }) console.log(`Sent: ${parseEther('1.0')}`) - console.log(`Signer balance: ${await provider.getBalance(signer.address)}`) - console.log(`Recipient balance: ${await provider.getBalance(recipient)}`) + console.log(`Signer balance: ${await walletClient.getBalance(walletClient.account)}`) + console.log(`Recipient balance: ${await walletClient.getBalance({ address: recipient })}`) } catch (err) { console.error(err) } diff --git a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/Event.ts b/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/Event.ts deleted file mode 100644 index d65f953969f0..000000000000 --- a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/Event.ts +++ /dev/null @@ -1,117 +0,0 @@ -/* Autogenerated file. Do not edit manually. */ -/* tslint:disable */ -/* eslint-disable */ -import type { - BaseContract, - BigNumberish, - BytesLike, - FunctionFragment, - Result, - Interface, - EventFragment, - AddressLike, - ContractRunner, - ContractMethod, - Listener, -} from 'ethers' -import type { - TypedContractEvent, - TypedDeferredTopicFilter, - TypedEventLog, - TypedLogDescription, - TypedListener, - TypedContractMethod, -} from './common' - -export interface EventInterface extends Interface { - getFunction(nameOrSignature: 'triggerEvent'): FunctionFragment - - getEvent(nameOrSignatureOrTopic: 'ExampleEvent'): EventFragment - - encodeFunctionData(functionFragment: 'triggerEvent', values?: undefined): string - - decodeFunctionResult(functionFragment: 'triggerEvent', data: BytesLike): Result -} - -export namespace ExampleEventEvent { - export type InputTuple = [sender: AddressLike, value: BigNumberish, message: string] - export type OutputTuple = [sender: string, value: bigint, message: string] - export interface OutputObject { - sender: string - value: bigint - message: string - } - export type Event = TypedContractEvent - export type Filter = TypedDeferredTopicFilter - export type Log = TypedEventLog - export type LogDescription = TypedLogDescription -} - -export interface Event extends BaseContract { - connect(runner?: ContractRunner | null): Event - waitForDeployment(): Promise - - interface: EventInterface - - queryFilter( - event: TCEvent, - fromBlockOrBlockhash?: string | number | undefined, - toBlock?: string | number | undefined - ): Promise>> - queryFilter( - filter: TypedDeferredTopicFilter, - fromBlockOrBlockhash?: string | number | undefined, - toBlock?: string | number | undefined - ): Promise>> - - on( - event: TCEvent, - listener: TypedListener - ): Promise - on( - filter: TypedDeferredTopicFilter, - listener: TypedListener - ): Promise - - once( - event: TCEvent, - listener: TypedListener - ): Promise - once( - filter: TypedDeferredTopicFilter, - listener: TypedListener - ): Promise - - listeners( - event: TCEvent - ): Promise>> - listeners(eventName?: string): Promise> - removeAllListeners(event?: TCEvent): Promise - - triggerEvent: TypedContractMethod<[], [void], 'nonpayable'> - - getFunction(key: string | FunctionFragment): T - - getFunction(nameOrSignature: 'triggerEvent'): TypedContractMethod<[], [void], 'nonpayable'> - - getEvent( - key: 'ExampleEvent' - ): TypedContractEvent< - ExampleEventEvent.InputTuple, - ExampleEventEvent.OutputTuple, - ExampleEventEvent.OutputObject - > - - filters: { - 'ExampleEvent(address,uint256,string)': TypedContractEvent< - ExampleEventEvent.InputTuple, - ExampleEventEvent.OutputTuple, - ExampleEventEvent.OutputObject - > - ExampleEvent: TypedContractEvent< - ExampleEventEvent.InputTuple, - ExampleEventEvent.OutputTuple, - ExampleEventEvent.OutputObject - > - } -} diff --git a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/PiggyBank.ts b/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/PiggyBank.ts deleted file mode 100644 index ca137fcc8b30..000000000000 --- a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/PiggyBank.ts +++ /dev/null @@ -1,96 +0,0 @@ -/* Autogenerated file. Do not edit manually. */ -/* tslint:disable */ -/* eslint-disable */ -import type { - BaseContract, - BigNumberish, - BytesLike, - FunctionFragment, - Result, - Interface, - ContractRunner, - ContractMethod, - Listener, -} from 'ethers' -import type { - TypedContractEvent, - TypedDeferredTopicFilter, - TypedEventLog, - TypedListener, - TypedContractMethod, -} from './common' - -export interface PiggyBankInterface extends Interface { - getFunction(nameOrSignature: 'deposit' | 'getDeposit' | 'owner' | 'withdraw'): FunctionFragment - - encodeFunctionData(functionFragment: 'deposit', values?: undefined): string - encodeFunctionData(functionFragment: 'getDeposit', values?: undefined): string - encodeFunctionData(functionFragment: 'owner', values?: undefined): string - encodeFunctionData(functionFragment: 'withdraw', values: [BigNumberish]): string - - decodeFunctionResult(functionFragment: 'deposit', data: BytesLike): Result - decodeFunctionResult(functionFragment: 'getDeposit', data: BytesLike): Result - decodeFunctionResult(functionFragment: 'owner', data: BytesLike): Result - decodeFunctionResult(functionFragment: 'withdraw', data: BytesLike): Result -} - -export interface PiggyBank extends BaseContract { - connect(runner?: ContractRunner | null): PiggyBank - waitForDeployment(): Promise - - interface: PiggyBankInterface - - queryFilter( - event: TCEvent, - fromBlockOrBlockhash?: string | number | undefined, - toBlock?: string | number | undefined - ): Promise>> - queryFilter( - filter: TypedDeferredTopicFilter, - fromBlockOrBlockhash?: string | number | undefined, - toBlock?: string | number | undefined - ): Promise>> - - on( - event: TCEvent, - listener: TypedListener - ): Promise - on( - filter: TypedDeferredTopicFilter, - listener: TypedListener - ): Promise - - once( - event: TCEvent, - listener: TypedListener - ): Promise - once( - filter: TypedDeferredTopicFilter, - listener: TypedListener - ): Promise - - listeners( - event: TCEvent - ): Promise>> - listeners(eventName?: string): Promise> - removeAllListeners(event?: TCEvent): Promise - - deposit: TypedContractMethod<[], [bigint], 'payable'> - - getDeposit: TypedContractMethod<[], [bigint], 'view'> - - owner: TypedContractMethod<[], [string], 'view'> - - withdraw: TypedContractMethod<[withdrawAmount: BigNumberish], [bigint], 'nonpayable'> - - getFunction(key: string | FunctionFragment): T - - getFunction(nameOrSignature: 'deposit'): TypedContractMethod<[], [bigint], 'payable'> - getFunction(nameOrSignature: 'getDeposit'): TypedContractMethod<[], [bigint], 'view'> - getFunction(nameOrSignature: 'owner'): TypedContractMethod<[], [string], 'view'> - getFunction( - nameOrSignature: 'withdraw' - ): TypedContractMethod<[withdrawAmount: BigNumberish], [bigint], 'nonpayable'> - - filters: {} -} diff --git a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/Revert.ts b/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/Revert.ts deleted file mode 100644 index ad6e23b38a65..000000000000 --- a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/Revert.ts +++ /dev/null @@ -1,78 +0,0 @@ -/* Autogenerated file. Do not edit manually. */ -/* tslint:disable */ -/* eslint-disable */ -import type { - BaseContract, - BytesLike, - FunctionFragment, - Result, - Interface, - ContractRunner, - ContractMethod, - Listener, -} from 'ethers' -import type { - TypedContractEvent, - TypedDeferredTopicFilter, - TypedEventLog, - TypedListener, - TypedContractMethod, -} from './common' - -export interface RevertInterface extends Interface { - getFunction(nameOrSignature: 'doRevert'): FunctionFragment - - encodeFunctionData(functionFragment: 'doRevert', values?: undefined): string - - decodeFunctionResult(functionFragment: 'doRevert', data: BytesLike): Result -} - -export interface Revert extends BaseContract { - connect(runner?: ContractRunner | null): Revert - waitForDeployment(): Promise - - interface: RevertInterface - - queryFilter( - event: TCEvent, - fromBlockOrBlockhash?: string | number | undefined, - toBlock?: string | number | undefined - ): Promise>> - queryFilter( - filter: TypedDeferredTopicFilter, - fromBlockOrBlockhash?: string | number | undefined, - toBlock?: string | number | undefined - ): Promise>> - - on( - event: TCEvent, - listener: TypedListener - ): Promise - on( - filter: TypedDeferredTopicFilter, - listener: TypedListener - ): Promise - - once( - event: TCEvent, - listener: TypedListener - ): Promise - once( - filter: TypedDeferredTopicFilter, - listener: TypedListener - ): Promise - - listeners( - event: TCEvent - ): Promise>> - listeners(eventName?: string): Promise> - removeAllListeners(event?: TCEvent): Promise - - doRevert: TypedContractMethod<[], [void], 'nonpayable'> - - getFunction(key: string | FunctionFragment): T - - getFunction(nameOrSignature: 'doRevert'): TypedContractMethod<[], [void], 'nonpayable'> - - filters: {} -} diff --git a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/common.ts b/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/common.ts deleted file mode 100644 index 247b9468ece2..000000000000 --- a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/common.ts +++ /dev/null @@ -1,100 +0,0 @@ -/* Autogenerated file. Do not edit manually. */ -/* tslint:disable */ -/* eslint-disable */ -import type { - FunctionFragment, - Typed, - EventFragment, - ContractTransaction, - ContractTransactionResponse, - DeferredTopicFilter, - EventLog, - TransactionRequest, - LogDescription, -} from 'ethers' - -export interface TypedDeferredTopicFilter<_TCEvent extends TypedContractEvent> - extends DeferredTopicFilter {} - -export interface TypedContractEvent< - InputTuple extends Array = any, - OutputTuple extends Array = any, - OutputObject = any, -> { - ( - ...args: Partial - ): TypedDeferredTopicFilter> - name: string - fragment: EventFragment - getFragment(...args: Partial): EventFragment -} - -type __TypechainAOutputTuple = T extends TypedContractEvent ? W : never -type __TypechainOutputObject = - T extends TypedContractEvent ? V : never - -export interface TypedEventLog extends Omit { - args: __TypechainAOutputTuple & __TypechainOutputObject -} - -export interface TypedLogDescription - extends Omit { - args: __TypechainAOutputTuple & __TypechainOutputObject -} - -export type TypedListener = ( - ...listenerArg: [...__TypechainAOutputTuple, TypedEventLog, ...undefined[]] -) => void - -export type MinEthersFactory = { - deploy(...a: ARGS[]): Promise -} - -export type GetContractTypeFromFactory = F extends MinEthersFactory ? C : never -export type GetARGsTypeFromFactory = - F extends MinEthersFactory ? Parameters : never - -export type StateMutability = 'nonpayable' | 'payable' | 'view' - -export type BaseOverrides = Omit -export type NonPayableOverrides = Omit -export type PayableOverrides = Omit -export type ViewOverrides = Omit -export type Overrides = S extends 'nonpayable' - ? NonPayableOverrides - : S extends 'payable' - ? PayableOverrides - : ViewOverrides - -export type PostfixOverrides, S extends StateMutability> = - | A - | [...A, Overrides] -export type ContractMethodArgs, S extends StateMutability> = PostfixOverrides< - { [I in keyof A]-?: A[I] | Typed }, - S -> - -export type DefaultReturnType = R extends Array ? R[0] : R - -// export interface ContractMethod = Array, R = any, D extends R | ContractTransactionResponse = R | ContractTransactionResponse> { -export interface TypedContractMethod< - A extends Array = Array, - R = any, - S extends StateMutability = 'payable', -> { - ( - ...args: ContractMethodArgs - ): S extends 'view' ? Promise> : Promise - - name: string - - fragment: FunctionFragment - - getFragment(...args: ContractMethodArgs): FunctionFragment - - populateTransaction(...args: ContractMethodArgs): Promise - staticCall(...args: ContractMethodArgs): Promise> - send(...args: ContractMethodArgs): Promise - estimateGas(...args: ContractMethodArgs): Promise - staticCallResult(...args: ContractMethodArgs): Promise -} diff --git a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/Event__factory.ts b/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/Event__factory.ts deleted file mode 100644 index 2e16b18a7ed8..000000000000 --- a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/Event__factory.ts +++ /dev/null @@ -1,51 +0,0 @@ -/* Autogenerated file. Do not edit manually. */ -/* tslint:disable */ -/* eslint-disable */ - -import { Contract, Interface, type ContractRunner } from 'ethers' -import type { Event, EventInterface } from '../Event' - -const _abi = [ - { - anonymous: false, - inputs: [ - { - indexed: true, - internalType: 'address', - name: 'sender', - type: 'address', - }, - { - indexed: false, - internalType: 'uint256', - name: 'value', - type: 'uint256', - }, - { - indexed: false, - internalType: 'string', - name: 'message', - type: 'string', - }, - ], - name: 'ExampleEvent', - type: 'event', - }, - { - inputs: [], - name: 'triggerEvent', - outputs: [], - stateMutability: 'nonpayable', - type: 'function', - }, -] as const - -export class Event__factory { - static readonly abi = _abi - static createInterface(): EventInterface { - return new Interface(_abi) as EventInterface - } - static connect(address: string, runner?: ContractRunner | null): Event { - return new Contract(address, _abi, runner) as unknown as Event - } -} diff --git a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/Revert__factory.ts b/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/Revert__factory.ts deleted file mode 100644 index ece1c6b5426e..000000000000 --- a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/Revert__factory.ts +++ /dev/null @@ -1,31 +0,0 @@ -/* Autogenerated file. Do not edit manually. */ -/* tslint:disable */ -/* eslint-disable */ - -import { Contract, Interface, type ContractRunner } from 'ethers' -import type { Revert, RevertInterface } from '../Revert' - -const _abi = [ - { - inputs: [], - stateMutability: 'nonpayable', - type: 'constructor', - }, - { - inputs: [], - name: 'doRevert', - outputs: [], - stateMutability: 'nonpayable', - type: 'function', - }, -] as const - -export class Revert__factory { - static readonly abi = _abi - static createInterface(): RevertInterface { - return new Interface(_abi) as RevertInterface - } - static connect(address: string, runner?: ContractRunner | null): Revert { - return new Contract(address, _abi, runner) as unknown as Revert - } -} diff --git a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/index.ts b/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/index.ts deleted file mode 100644 index 67370dba411c..000000000000 --- a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/factories/index.ts +++ /dev/null @@ -1,6 +0,0 @@ -/* Autogenerated file. Do not edit manually. */ -/* tslint:disable */ -/* eslint-disable */ -export { Event__factory } from './Event__factory' -export { PiggyBank__factory } from './PiggyBank__factory' -export { Revert__factory } from './Revert__factory' diff --git a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/index.ts b/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/index.ts deleted file mode 100644 index 3e324e80dcb1..000000000000 --- a/substrate/frame/revive/rpc/examples/js/types/ethers-contracts/index.ts +++ /dev/null @@ -1,10 +0,0 @@ -/* Autogenerated file. Do not edit manually. */ -/* tslint:disable */ -/* eslint-disable */ -export type { Event } from './Event' -export type { PiggyBank } from './PiggyBank' -export type { Revert } from './Revert' -export * as factories from './factories' -export { Event__factory } from './factories/Event__factory' -export { PiggyBank__factory } from './factories/PiggyBank__factory' -export { Revert__factory } from './factories/Revert__factory' diff --git a/substrate/frame/revive/rpc/revive_chain.metadata b/substrate/frame/revive/rpc/revive_chain.metadata index 3560b3b90407acce7f602ce91ac089843be8dea8..64b1f2014dd06815fcea6a87bc96306eb00eda8b 100644 GIT binary patch delta 13838 zcmbt*4OmrG*6`Wq-h1}h_a6lX0llcGC?F^(D41xZSR|-ezKM8+i{6BL;r^&hkul{Y zjWikIip-KJGG}s(96MPtMrM;GCY6m;_%o$xrD~dt*uWbXI?LQ8 z&VbiW$n z&*w@|q3Uby7`ZDetvteL0ZAYGR)C2W!Y z!^31Gd>LnW{EkAhV1>(3;qsKYJbGN*rq!&&YPdIAn_sUv{j%3WNjj`E;CfLe37 zDud24hZj4%J{JNwJ&vW>Yux^T%M)-r%Wia4c>V6c(!_iMdCLu#>fd70#+Mud`(76bGLv zR6K2nQQ&DqWH<>`cD-tdB*wffkHcA9jFX10*9;3Ci?bZ7ya8A5^;Yg(s$!zs?o}aU&D(C+KB+0}~pUd5piJ$RBX7L|sLBOG{mzVpqmo zt)1^$g`)?m5L$SXMCG}B%iLvUg3!p|_--;(x!WxbXVF`bn%Kky{2^7LT_-fFPup3V zupM6YN#n#F44euXto-VeZYE+2t8coLG;uf6&*zl)FcQAdRh+S4njq}vm}YybC}1~| z#rIZ~SQ`r$+EhF!dWj4q`=Mr)6anU-G@TrP+@R#fM(sKrl%5D{XC!Tbv#hKtV}`TL ziBm$_?fiQ&>EO*k_-U1N3poPWtEF4TlMD)T=uq(#gX$bQ0*Z^;tAoLhSJ7_i`sYVKL~|J zMKUS-s-)Wu;w5dqo_spcd|3q+x*7hUs8hN_Bt|%}R@$lTyifW{gyD}#Nx&hE7Ne?$ z^+Jg9!hO;ik%eK07-1A5py>}%6^Z6e6ij|VS}MjE>&MR@skA;I4b_uah&ios^0V!VQ8uUzA2d#zRslNmue8lDb8b33E3}wIoZW zQ$P38K#~nZACbZN%)QlNBil131+h@;IUh2VNj zdYm|4YLr3VIOTQNSNA(v)x@Pe@_V{kSxbRA~cO!@(y|E-!4B29p|id$Tkw zYMqfR$np3CzMyJ!x4GQQR|Nd(LaouDhdm)ZPuB70nWPr%Tcl)C2Q#)v@nj=-w@9N& z1Hcw(n!eFUK7_~dGZ>$g>|_f>J}D)VCYbXi!qmasr?3%V*i+It5)La!sUADj5&IMNJvVIyug!h2K12w+cBlXCDWDK>=cfNx)r%3=PC(o`{>z{4*} zgAM6K*ki1Z@J7Ps36#O7Ez)Yzs)-df86VbWyk>=Me8qI=g#GZ>7bSn_0aa#;NSe^D zNzX2HaLiNty>OBbgRiI5 zp766q;jBhhweWN5^R$aSBrf+NfqmgxeAVk0kV{4)+i&%HTqqj*d~dl+FI+;3Xs?%g zIP>k6R2 zt~3lAJ{8T$xZ%ZjRe&GfmC~#(6N$RX=fsU=&&S*1$#{;$hkHc zgev&zuryYzHq{r_Mkq-g(f|>Smk*J-u15lOz0k0)*TSjoua#P)i(09LmJg)Mtd5Ve z&LnK)uLI$&52bvu!Bl_j!AK?Lh_slHM%eg~^dp*c?Z2ctH0LK|8UtxZrIGktcoc2A z8P*+@Qip8Ek>U$HK1_66nAMcXBs}0QUg-+#fDeyK(?|;p?3Ct^?XaX%T0C(Fm!&Lh zHwi6$_}$T;Uk-}=?$&g%M@jxzdQ3F6ss!3h7&28^gzfK<#erV3*bhUxq>Td)@Hy@` z3GFIQ2jX;SI7fPLI(y+90sS%Q9%CoRIbssJOpx?}7^cOn=Z{HaMB_=740_#DaO{Ni z9BG3GPD*3QS>=V3(h@y62e#7~S1!UoPD^p*qH^XmCIsY?%D#BnR3G#B5ctbJ$*eqe zMtV;q-QfL7`a&e;`e{!NQaoQv-Gmr`T#%xa_2(rA8NkdWKFjZS1?C5wfgmm%#=j1N z!{10r#KNB|BSXw2B}+}ku0WA+pUdg@dcvUYf^-83(QrPyfZjVydmeXD+H8uz^^C~~ zF8OHaxG0sOm8!%Sd@GID$C`yuXtL4hVIF6>D;CF?fyo{wneziaOr-=8?yo9e<}Hhb zec!5<-6qjwnEN0dK;o3l@1%tiN$6>lfq!d=qVk|r^EJ~>#o@(Hose#Z{FilMyXVqF zqL^uh7g|XuOw>^xXcl-SaY2rnhTm zk!CJexojhLp|aSz1gP9oH)phL%XqM50w)qGb#O@BJCFo_*J1|vnm zjsFW>Jv>Cv4sud^<`NG-Wk!f3l9Go>xhrs!3$4|M0s9mODG<+^>s#I%q)dyXLrmx+ zLPpbJux1o}3_S!sPvagUZw!5(T!s;G)H$@evBe~zPD zL}F30#?p~G(O{|H`dv7zO`v5~X5nJ9h#{h2v6${~|!+;NUbm0#o)2)95HMM}vl> z8|W+q+j;{XJvQIcJJJ?d`sF_bC?H%g1uAX?{QCyFXyT$iNQM283N<9&pu?*sf>YI7 z-1Quoi)+Ab5%7n=jilTnl=m=tVmduNveH6AX9j(%Tmp$NcYBKb!HNp6FL13}sO$k3 zXV5pM2Q9>LlY5P;Bxh2JKpbm|aIcJU=QrI|*Xzd3Y|v64^GHkt$3;7+vJkVIKUN`c z2D4CYseky_NToGMcj?gMS!U4}&FfUQg+?OOTA<@C{SY`ci_XWrLi%i)joxbQY&t=# z>-p5q`!>SB96B5Q+~OQ`rA=^m4jqY|d|{7i=vml}y%u(ZI)Xh_5*qPI#Mdo7NM+w#T19Y6!ui!U7Ht-# zPCRSr@1@UL`g&=5&t@|L^B>`y1uDlIBH*(^IvjHyX$jgzH{7}eC-z+tj`sKxIul*m zu_e?YUdAltUs%&pMjE0ZsfY&g!?Q&+7Jc2pBDCplmDW%gxRm}uBvzU0u%eKm`)J}=?GCIca`~JVxZp&EvL57l%jgVZfwroi zNzP?f&Fh6&`_D7P+JBzRifcH`iWBAki4j%-f7~GPL$uWlP03iEyZ0A8RrjRi(QR{! zDJ3yV-ksE?pAkQw7X%l0y|;K*3o-iVcm=IbjSvfV0k79l=3R{~FAq8^D$3lhlEjRx zGR)gbs$ig(j)$*3G>MFWXfIueg~x!GF4e{K8TB617D4Aib z)c&xZ=ES?Kz5Te`+Ru->ky+%~eHGhQOLO(*S6>6Q^lse7U9818R;f-$AGDgak(8m7R^|eI0-YaM zRoH=^nYH(t*#Qk~_G7ewwey)BunHZ@vyagmjhMrI^=EpQ*lC5B6ls+5(9?7bAzi8h zVB$6!0;XpAI60*}+f41e&Zay|)5ux%J7!=h+vqa%T(Aut*x#Z3De1DZ>p40Pgs%YkcMjvz0nqY;<*suFxbtcddxHUbm};2V)9 zMqc7F8+qB$Zegaaw{fN0 z`WaU`qM>nRA>2HdKUfx!G1tBy4+ydmR-U_3FWisB1)Q-Db3qL_8xjxG;qcCTbQGp; z7vH19BXezJc7bQ52lp?%6^4{^6a>~2bcooFfQ23OR?P64J5Uw{@NNekn_OV)8vttb z80pe*T8nTv^*^!DCg2YPK#e{PGqO?d(|H5)Z6qnjv%=-WBb*zZ0aS=f<7>zJbW)PL z&xFcty=PR;>GqvcxrUnh0eu1Xeu$H!AJXKcU>_n?oJjQ*u~hXUQjO0z)hc-XLmC6M zAJR#rnm;eWRBPA~bd2jD=Ln6BtL>wWn*Q3T(FoN69HAd$X65^c9*S$|gVop{t5L&h z1oyva2Ifu&kJ6#Ap$naG6Kw6Gi*aw*-9DtOVqRsS(hI-~xOszX1ql-ok>9P^W9l=Q{QynRVxSvHh zogVR$@I&=Boe+nN{65?Rn>47K01alwXU8y)317}8Ht6S9+il8#tQ z?7iJbckl7K`;BL?ho)4hoAe@|Yn6MI%j{ZJZgy64Ift-epC2wCKlp>MAM1v-=e;e~f{Q z9t_Fc51eDLvG#FpyX7TvLR{%0+lCTcpn8 zy0kNTfvqjNF33_2g2Q|H3F}po*98src<~6cKbLaAd%X!`d2<9;RGcQGwJ2p(fLy8= zyo3EI2@IErHd9{BvDo`XA`6y5(TVa#46zF#|F>15>V2)I_-qXPc#{k zlq8TOKi=%Rt`q8~+ z*4f|Zb)pI2%wp^SC+Vosv3(>F(O(kC2*N}0DLSt3e=rr5A3NuVvm+BZh&e!VA1h3? zqi0G->S`2EMVeP)Ub;$ONVS9gI2{t5ksVlZC1~e(O1=81o)c}{RolVxZ<-n#<-&a) zE*zYkog0Hd?08+q*;@?h8nw04dr`xr!Rr%H(>y-+m6{Nhi>8C>&>Jr=u}R$^V>Ah%4x$v_<`uwn(G7h@(ERxUdhnvp={~1Luui z4i6VxeGuIJ5!@Pr+b%;3FV8=HijKvN-632gx^k^^ARc|-jPb4b+{cv5A#^ zq>zH*3|?6i`~bKo4GL=1gK*+BeQj-3ADpD#I7$6*s`~)faD`nRp$5tRW(eM;m)F_r z?7}*H6l?85tzEtmuZWbF`?$9%cf&WQsR0~kFzVHDhC*S{8O(^|;O;XtD{*6=@z(bq zZhgPe8sMulG-qHV`l9`4KSSJdG3MjP+Q*fzWShSp5c!<>|2DJROgV{I&B~bS;4M z=jlY8%J6S!0*;dR4KlO`s=vW+A+Ylsge-*PyeS9U1#GI}h6}jL8lZwVjnKq9_dv%5 zMDK!Md2<#LF5I3VBBG&p||52zCOGrA|3^(_vU4}ouSHCMt@ zylH@UzQvu`S@;3LG5s0;9i58Bb}0J}`Lw{+?`W1j+CrX#*OO5QzkY|M$OIVnJ?=F# z;g#>{WaRMM?~$h(7=DRP5_enbo2=2W`Vx&oHXpr2CyQ;CtMUT#54bz+g6JRUWPP-i zJOR^hmm;9@2c((|8-Jh+u{KhlWRHed&rx&zBKsh$h16Htqu{0=@jg$XwSI>^9ParM z!GrMRk2D2q4Ili7ldlH-Pgv@!ff+yHTL<`mq7!h-{OnIS?N0dmCpra>9!6iL8(7X8 zTfZn3OoC(1_6{=e*PegFod+TWVtUyN+Y-sZQtjWf#3VfSqbk!-RCdtEf+M{WT95TXC$MnJ&C8kiW;Jfnpm9k?{?|W&E;KT_I zH=Z-DftDrm$RVFP)a^LG9jV?etKdnSH|Q^`f^U|{L)QxV#DPK9%}W>jK2*HJ6lD|0OU%~i0aj@2vN#VaBRUaG^f{CuzCSb?QFKff!c z-nPTrb9h}%y-4O5hL`yQj^*BfdOhtLt5NGe};}e#ARdO4;4=CL$V)a3LQpHR2vQMr20FxCe#}#yb!p#M&`F6y*2U@H2Xs}a;T__Hr~%ik5Q!i9(klZLwP@Zp;hv^MY>@h>ki)@_o^A`CAf|fA#DY*$Pq3bDmA6i1wR(UuUg5KOJ zpQU(->2J@;r%?e7+vQU9JHKp~XObPt^uNffMX7}oKMa*_IaKL*UjCV&$+rJZoA|G{5?6Ml)We)Be*lU`S0>U+!clI zmQU)tjd&ZUd$+t0FXAW#FUj{2JiY5wMo@PMjd*{dUDBSUH{20ZK=gS|< z>GpQxZbTJGw1LzS0p&O36I5v{q<68+3Qmz-# z<2HXLuSAiBd@fJLg`NAkJQH z`YsT?Xg8SQx$kkxco_4&e5)?P91WkIlP~LHur8bb3k_4wotGamU`V+4dwG=je}Nt; zD!2V4dvxgQ-}+hR&iVAuayhQ<1;5A{23*w}2@4QiruhYKHt~?6V_DbUp3$+Fq%1Rv z^m*tAkt6F9f1&VuJ&VL8|D>Kx;WhP61H*Gp<-a6`J^=Mf@oRzdHDw#aQLpzn*espP zyp>ZQ0~Z`DgSa6fhLs}9qcQ9v*XAEavl7(iSEHE&ZJ;udHK0=Icvc0GaqL+`H6I_Q zCb3lbIgW*4YzP_4(y=&{l*~p^vnYzS<~mrC%u-O(JI1o7br=it6WK6Sv_?!pV&l?7F*IMJcRYy=K^-H#VGxnb2H{CP5*?>IU~car2=&Q0%_DFqnSDgMl;#O+v;ohi z+9$JQRQ#`#*>v=5)6Z%_@>~j7GyGq^3N$OR^;*ed`{1x5L& zVkT{7HPyyAkVHwLcth3ZwG{+C2#cVU#uDnpp8bq=iZYo6y?tz+8)Ilq> zl(KtpB7GhD&2F{|W&ehoJ%nB=|4#NhUAv_N4&BL4(Kd{`vWvjnKcR;?ypoklM>vmf z^Nuhjzl=SN<#XjyIXl1=v)9kIp(!p8u)FY3PWe253dRGumsYW5I$UzaRqRF`O6Vk_Fxz9_n$EW-z3~ zclR-m84rh$(L%y+oj@?hnm7{em-GKHnpq_1w;l4_r!;6L;VND^zrt0#P^(XM zTkUCT--0zgJ;Y{DQhRs_%ol>ta~2ewEEbSN!R#Xzi&G_8Qxz zPq*neKu9Ya1pj`GjU$~i5BDO~RlJmMYh zfTI|*PCWF*^b*CX{yj#NR`pZZd+bR)uIlGLU^)?3)$>Q#TKz_w{!OU-h>d`GAE6O$ zgz}Hr!x)4A^AStZ=^8cuy&`E-nm%P42nMLcW9$W7g~yMv?Y2FdfYR)KXIUVv6<+>~ z&4H80S(bRf1|6TXyJ71ICXo(h+X)_bIwAVs>?GPhN48(;ja-8<7_o1Y^(bP4J=qQg zpR?bgzdQUnyI;(=at- z$}bT=Upf6HE8t!t;~e{gs*nBW*qvf{xjh3*Wkvi-8sC_Ey``utnyPXL=6V}{V$B#5CtqfhFcx|)vpX@t>AcL|vaYj-szmGT z8||UrL)I^Bi1N?>hbC$2^+n121+5dq;1Atwh8}n8FT=h6VbQSYKWqd_xcWcrHqxvd o`43yCM>D@eXKW&Sly05zBHr^*zA+dv9<(WQnQ;=)?Y9g64VE!@asU7T delta 11763 zcmb_?eO#1P_V{z3nYs75^NxTF0yd+f;47#osHiAtn5g)=Zjp>I>Ll+BDw!FT-^9W+ z!jq;c-_|uMw^-L6*#I5pw%{xJ2F z7|2~~^4tZkB~A~d9wWUEY)+SpV2MW;avOjCLPwf+Z=Uepk^a_-wGwer+}@8kjB zk+sRN+{r>j-3q84EG9mqi4tW^lxFT-6<#hJp?$1B(ZP+m+7XafqoH!-JneH-!6bjQ zSo_(hBotm5tlObkK;}bVqb?Rc9-`}I&vs=mbrslGI19r_VV1LSh24{DU+S_u^YXIX zuFRoe7^({k^sI2%^PB}9d+sv3Qdein>xb&btO*JvgYD^g&f=_GXJ-01`+OXpJ9Ex3 z_~1`E2c79!?#w8bzyFgi#73;LwpJHHESU*8c4tOLZc&a0u{j~~UERXq^aT5=T#rlX z@E`%M9D9K)J9m{UvwUl=Lr(seuJsN1$(3|658KKGL9E~c{sgTg)N6$8YHb&f6?VZl z9y)|n%7!AELBzcr9Cx%)qpG-e9!?hab7EWQ%9t>Jq99Z$Kt^kfC}1~Y#CElc=ODKU z2RV?maFvt!t=17V3m|*U%Z_QC=Q4JqR4dbUHZ> z?qWJiJjtQt0oGSM!=ds4)*tQ^(}#c8*-u9V;kcL3f%QH@8@do$uTo|GR%lSj#MVjg zn!VQ2$%t58bLCn(#lKOV7$cq+n!F&mi`2C=uzcbqE}vUVojTGClS^o#p+y}RTDi~) z&zI1L#5N8sCG;(^otKkYq43cnW|U9NWB(FKhZlnARc3D#bo$@T;2eiUlU^{vq*59R zO&e(%@l)!LX#({|NGPR!;JjXB@;9Z_t|h_SHq%5gOb-wD5&J;;W?D`haBDN&M#ACQ z=V>O1gd5M(7%@_>$Sx30B+~(qzJ&&e!}R479}JeC-$E~nBpM3KX{i{a&WeKJFQPEw zV9Ja1I*Etq3L1*VtO`1xB*3c`bTCPhKdGQ|H6&SfY^VK+n4$tsA*oQhgYF;;z`Tow zz@(SyZL%1~?4&8;;!XlG*+4kFlNtik^dxr5`~sIN#hEwZfuZ(=s77gUekTnIav~E1 z<)7%%3;09L9BmWa3Rahx?OQ7!ZoGmV`eGLiB1Ld*7rl=ZgYgyG2V3gM)K}=6*oF0} zWF3s&O`}N(EZa?ok_}M4n+_tS@Q>YeqP9#=zJPae7>4hmRm;?w%K_ecW#bWJD)V` ziDaFXo8v-WSm)(tyRVh}f={Hu(Gyoo4IM zlf*d%xvSinu7U|uoLSDC3>WH3hj(AeHFUO-7!>y-SUdEBPX1F3O=5(@mBTcZm|#L3 zjf^xIy3*xm=s}ksVnDk5U~?TEM*`t^9gQKuaJP?>#yai^TV6Hjh?- zA`L!};kM@G1BXqnzUR?x1)3%L!;Ea*dSO*RHiG-Sqy#kEC|MYg66##^6Sxn7Aw>y zk~BC~kGK{?pHFD4d9i_nPAhP`axx3iD&_P~Xu6iTpzbpo7wGP?CAUJoPA6o8<#Re% z%s0TKYB5Nj`#E|Wv`K|$@x?x#m2`o_zAiemuBU9)A!3xxIyiZfw(}BYnPLN)4xxUp(8^RKu1aOUxZhBI{e?bq z-q&=UXsA}P95mnwsO~e5Z<^*Bg94n9KIsj~;Eg(3}x`dc&@ zi_5q0a0@mnhuahqCOg~cLP{LoQVdu7qhPYgq`*kyJu8jGMZ_~2VVImIvTsE(+PLkQ zCIA-cSSg8tCLP;jj8o{4tno%6-iM`@GO2e$7c2=1mKq`?86oOJO%N1+LJe{UWtBus z_QLf3Z!RLmI~JH~^tz7)T~MaN5Y86y1q$X=qp%pBeYB$WWvdw6Z$`rV5 z#Vr>r^&R$g>O|`?ClN~2H5!Ob*r3*IZwjTx^5^S<;qOmUqr9XSi_nT?MkraX?F;*Q zv)9F~YQrC%aBEF{DvYRv5{aFfi^OFpr@`FZEIb4%e3SMBv1oC-ukl?F>ld`kI3OV} z51qU-tB_P01tST_U7h2Ctrux)ixLx(1xZfz?Pw@iBglZqD*}-gu zc+l6l63l`^YK%kYc?#S)%V)Z?-5voq-AP>yg!W-0#Tp}2XKMo>vk%MaQ>!4fT8}l7 z1|rm{*w2uoM&YOrWk(!Gs2ajTv3P$7+a-J4&@_s@r8k*S=ebGnGlAm@3zXj) z&5nv_`z5i=A2yCfl@0dR2gkD6QkXJ3N^mG$Q5fs~HI^;GLY*8Q$7W&N>xpA;;SoAu z92<_sym73JM9azJSt3CjcP1fLdm^K-ZvtD3r)&Rs_5?<^=O?lVEcQ%fgWy&?v;D3s zZ6XWq)-|bHYY;?DLYTNN=+76iInXu%&!W#KvF9<2Zd%2nJ6HJUWTwZ1`-91BCP{&S z1oX!7U0~-Yu<4Nrrmm-Bys5_l6pyUH11Jf0Ca^(x{@>f0ZVLP3sFZH-sXgISz3@tb z4sRV17O1j{_;0>zvBLH=lYl>*yq!2rg0stl+Ntcj{w@;RM<{1d{{q|*}*&mwW9>mX0Rj-30|GS zMq*1HxjlnT#;d{D2iW}>Mm+HVyANINo(I?f>{PUOP^nLQ%erW9sfynkLxnP|iP+q# zU<-lRnQR)uV|^*Eqb?w(u%~{9d6yS+r4RGoE|@D-%-hii?^Q5kv&xHk_Xk=Ahn}Ps zdHyW6N<;R`AEmMiLaG&9iQ+-i@9va%?^ei%!wc~ktnIQwt%5g|3U$!9kWC^-z0+nb zV*Yq(P(Z@m)N8NxU7+d}C^yBZwE?a3hOYD(F<~x=H_J1$<57D951o2c6(MVaTPcT1Z1*l znvPC@qD(ebBxc_w8+Sdc!zWUmx#zZZ=I*DD6;GcI6Dl(|BO{c5qRA}aPq9cG@H4{` z^}2rW#%#*TmVJdT#z>&-$zm>TuL%iR7*k~yr?{6ZThBzFxHg}K!;E|u1q1T&5ZsfG z9;ZKime10~Koyf6<`*zo3^v2_6WB6{TE!eF;LzDQ%X9H4(+XiwS@{3W9g1PuV>@53IA!%k7T{%KdooW7&_vK8&PK+ z&!EL8!?b7ER3vB9Gb~a}_K|bx8Rjph_!?@GBvnS30itGsS%Mos>jL4?P0WoKr*Aj0 zDThjA)Kg5H||?5RL0T>^Bqm0o;FFR>iMUR9!26mFFl!51&#(YRl! zk3j#Hx*a`(TJ*vEBF@zrgoECR`?s^5VvTPrwZ5&?b=gX-cix|Oum$=$Wh=F2;iws| zo2X3=dzlT~VCSo`D;l!5VeW*~1vYb9-${oY{n{Gi_s+ApM8+2Vi}bE~<{+-~kL z>nz-2vIJU$7Bi3&$P{xeixOLXjm5QWh}h<9?5<^l#CBh!sh0H8TN>C5jM2_Eu*ikcmaaxK%+kYX zh9MXlO$^SP>nbeD@<^CzdRm)A;&84sd!<%*8j%agiUO?==ban}=Rafp;IYrt2 zha}*>7v!wW!E46+0%uO4Q@y7snB!%ftR+fh_ZeoHr7tjGNP-4|?dbh4$p z|1Qy@1CPaRrQmYvKQYxJ;1B(Gi8dA^s?%Svx&BEO5|x~@!d2kP@gzDuD5=F>x|W<| zW1`Z!ZOCcqx+AB8xBHfyUeL=Y+1uzO`h1BIX3Z%)m)uP`_oaE5&nS=tS%tS3~N z7pe?GzG4&5b3A^Q^@R^EV6agEXD_ga&=I_Kp2b@#EJQn3AU4-3WK-c@Xli6(!z;Qm zXS>3j6+UTi@3O@e>JGOnxMMNXBcEjsEY6%|;}N^M;MYwoIcje=TB~}}TIHoxDa1L# zelO^UUn838E_5I4M)$%0M)$#Pbk}sHyQT--HD25^&f$$^I~1Q|!-m&(gRkofU)KY^ z&I_N|j4oUHh9w3Z?FQXUk!!~x{Tmh_9rtb!bHj=hc6`I;VQ%>PH!P%2gN4{1EE+R< zynS?^#f*kVdZv z8ewA-i-msYSr{}nvHOQ#>PFa^uG>1(V_VH$ggF;jJREL96e0vQ$0sqmTkAd_{-=oI#gt%5|cbDrsn2&3eZvb{7$GZ8BJ{3 zx#W@s^Qy*WE|-mT_Jipn8w`2hGh;mFy%bkIcaHTLc$L0$ zg^i31Mr`-8^WdJWI{B8Y8a;lpFP?Qyi?2XPhEvn$Unoo>*(OdQ;}&H`X} z3wv#Sd^fpJkE|_wUwGy0lWVHPtF4V^vJC3Mp18u`q8*c6Py% zyaG)Bz}@Ri2OnKWQ%F^)8biWh&<`wO_=0XrZS13RX zhgHH0KVmF%iI-2t^zfMa4ykuplD6JV-c&-% z5IA@jslOzDc9%WJ?^~K;%MuKNeMVIS@xSZ)n=<{GV1XE-ZtsJ2T(avs+mHVO`?xer zgKhasE*%`DJ$<3_IeAOG)KBBBzB5_!>#wUPS|L>aI77-KNLpEeG|Pf^V$UmZt#aoU z6=oH$fohl3SI$``jn|Vh`Sm<0h>)%Fzw@O}2p+Fn3#B=zMHdRC$MNKHdZdMOG44sOfU1YekNM|K< z06tV=a$3n^3(XvMZIIT9EgVAsNBRjr3y|xdlC}}W2wWSaF=B^z0=}7S&EY@$#vKI4 zY(y$_@a9ITKfaB8x>0(VaCtrQXSO>>hYl@;RPuGCchxr(W^UO zK*%uo@&zdj)wk^hDGqPXBg&<vu~{Xo1c>(h$59m+g`67gO~xw1!WR{VSzlEmh;GI5{u9x99Yn$(Z{MGk*WYG(KfZ+Tn#4w--ZZD|==a$2=C6+bVj ztd>@bWUn0jH{2pB_3(G3kxDk}9cdI674JwhQ6v}Mkv#ah$Rb(Vgx`r=kfkaoRE-?NdVpMb zQ97wb7m@tEG*ENWa7HfpUMd&SbJ45PN^_I4{u=ufu56!6m06nv5@%6fB>~E5Upr!HvqqbtRQghmNZLa zGWtP$o7AoeG|oX)4v(K^lG^N@===XQQ4U z)bI&9)bE=T_n>|o-$wL9p+e6S{?pJI_&X@ie;W7{RPwt9K2FICFAwLLDAJiDxE&23 zdjzjQ$*vf~i{Y^-{%2jj5%~%`$MP6>D4GYNJAW{i-v?Wxc^|xUZH?svnNbwQb;c6- zS1ccmGB=OpuWB5n#^Hi>)-q2aQU6bfxc8o>a<L{n?5^DP3mVsZP&VMH81MH*x}jt|n2lQ4V|k4A+^pTsAludAHI4a!Y; z|789L^e;4l$6_%lfv@U&$rvTr=HcfU1;xZyO1927;b!c9%pb$| z-3`ecPbG)^!y=CEBofXn;SZ2zIXs;&(cni+8#3@qvls}=*%JrnoT1c{JufJ!l_c@V6KF)5IyqRq!|+nnK|YzQ>{XCT)~`bc%b59p870 zT*HUXbQUakEmZ0w@wrtV{W1!fWXo+kc?iXHrr)c4unxsD;WfS#EoAp=d<90FQWa`> z8N^oc*{JIqtB@@f=Izi@#W&$WzUFm43lH)SUgwP{y1j4k2T^q7O}-MPll>+?gwh$f zpMQspH2sB}2_7DyZ}BJb@Ywwp59N6K{pTSbuB7`m??E?y5{A_9xp<^JUW3}$C?Bao zW{XW`*!5>=ll;Ozcp1fOul?WLvA)?n;QpyATp26zL#IEw3UcS+hcd2$7W2l*YVW)} zSH?nDffC5Knys;F-~2Vco;I^JO6{5M%5fFC3){`3y)#nq#mt%I_7r!RM@MvG&v5B1 z8;7c`MK1U96&`NcI0p{@n+NnZSvDrB11b3ZY$oQG?#HiB1L4ZQaT8$>{~nrcB&>Rm zAHbk`@DZMfPocR-_L6T(wxIW-50gEk?XN|)W zu{0|;W91Tzu~v*ulb0RiQ$>r*GN2GY0&!(yrsgPf%ZEPXuZx-@OR;>TiHC^r#0m5P z>*U|=@Et^+)4;#eirSB%`U@Vo?G*3LeBaB;$4>EAw5Vsx&vK23f?nCk*K0Rev_~N7 z9PbZ)=g<;1z|eDi3v}G!(`C&!{EDb4^DdJsl7n*kxBNMR2SUpw{x<5yE8p=d%YN@Z zVyzgBd19+!^;JFt_FU!(7)4yT%%37hTJTLM%~uD1lZbMlHjvC#K2A0T#E;M7(AC_0JMYiI{tK6Q;hP9%rL znB~f``oTljd2nYdP+oVPZxoSe+R87XU0-WO$Uu4dO};=xVb$K^|D&>US{r{vv_)Gd ztaKGGQ9g=LuA8~J%aF|$dpsn!@uBjqpU@{zwI@yO0r7}t07PBjlHBqO#}H1Hg1<() z&LSlN>EHnsk^0Rfrs9x(42iG!LH`IE_8*DB!v1}z3PU+eXixbWi!eJdd)a-K<#UV4N4 MsTJ4Mlv;)V0}5B>2><{9 diff --git a/substrate/frame/revive/rpc/src/client.rs b/substrate/frame/revive/rpc/src/client.rs index d37f1d760065..901c15e9756b 100644 --- a/substrate/frame/revive/rpc/src/client.rs +++ b/substrate/frame/revive/rpc/src/client.rs @@ -32,7 +32,7 @@ use pallet_revive::{ Block, BlockNumberOrTag, BlockNumberOrTagOrHash, Bytes256, GenericTransaction, Log, ReceiptInfo, SyncingProgress, SyncingStatus, TransactionSigned, H160, H256, U256, }, - EthContractResult, + EthTransactError, EthTransactInfo, }; use sp_core::keccak_256; use sp_weights::Weight; @@ -116,18 +116,42 @@ fn unwrap_call_err(err: &subxt::error::RpcError) -> Option { /// Extract the revert message from a revert("msg") solidity statement. fn extract_revert_message(exec_data: &[u8]) -> Option { - let function_selector = exec_data.get(0..4)?; - - // keccak256("Error(string)") - let expected_selector = [0x08, 0xC3, 0x79, 0xA0]; - if function_selector != expected_selector { - return None; - } + let error_selector = exec_data.get(0..4)?; + + match error_selector { + // assert(false) + [0x4E, 0x48, 0x7B, 0x71] => { + let panic_code: u32 = U256::from_big_endian(exec_data.get(4..36)?).try_into().ok()?; + + // See https://docs.soliditylang.org/en/latest/control-structures.html#panic-via-assert-and-error-via-require + let msg = match panic_code { + 0x00 => "generic panic", + 0x01 => "assert(false)", + 0x11 => "arithmetic underflow or overflow", + 0x12 => "division or modulo by zero", + 0x21 => "enum overflow", + 0x22 => "invalid encoded storage byte array accessed", + 0x31 => "out-of-bounds array access; popping on an empty array", + 0x32 => "out-of-bounds access of an array or bytesN", + 0x41 => "out of memory", + 0x51 => "uninitialized function", + code => return Some(format!("execution reverted: unknown panic code: {code:#x}")), + }; - let decoded = ethabi::decode(&[ethabi::ParamType::String], &exec_data[4..]).ok()?; - match decoded.first()? { - ethabi::Token::String(msg) => Some(msg.to_string()), - _ => None, + Some(format!("execution reverted: {msg}")) + }, + // revert(string) + [0x08, 0xC3, 0x79, 0xA0] => { + let decoded = ethabi::decode(&[ethabi::ParamType::String], &exec_data[4..]).ok()?; + if let Some(ethabi::Token::String(msg)) = decoded.first() { + return Some(format!("execution reverted: {msg}")) + } + Some("execution reverted".to_string()) + }, + _ => { + log::debug!(target: LOG_TARGET, "Unknown revert function selector: {error_selector:?}"); + Some("execution reverted".to_string()) + }, } } @@ -146,42 +170,46 @@ pub enum ClientError { /// A [`codec::Error`] wrapper error. #[error(transparent)] CodecError(#[from] codec::Error), - /// The dry run failed. - #[error("Dry run failed: {0}")] - DryRunFailed(String), /// Contract reverted - #[error("Execution reverted: {}", extract_revert_message(.0).unwrap_or_default())] - Reverted(Vec), + #[error("contract reverted")] + Reverted(EthTransactError), /// A decimal conversion failed. - #[error("Conversion failed")] + #[error("conversion failed")] ConversionFailed, /// The block hash was not found. - #[error("Hash not found")] + #[error("hash not found")] BlockNotFound, /// The transaction fee could not be found - #[error("TransactionFeePaid event not found")] + #[error("transactionFeePaid event not found")] TxFeeNotFound, /// The cache is empty. - #[error("Cache is empty")] + #[error("cache is empty")] CacheEmpty, } -// TODO convert error code to https://eips.ethereum.org/EIPS/eip-1474#error-codes +const REVERT_CODE: i32 = 3; impl From for ErrorObjectOwned { fn from(err: ClientError) -> Self { - let msg = err.to_string(); match err { ClientError::SubxtError(subxt::Error::Rpc(err)) | ClientError::RpcError(err) => { if let Some(err) = unwrap_call_err(&err) { return err; } - ErrorObjectOwned::owned::>(CALL_EXECUTION_FAILED_CODE, msg, None) + ErrorObjectOwned::owned::>( + CALL_EXECUTION_FAILED_CODE, + err.to_string(), + None, + ) }, - ClientError::Reverted(data) => { + ClientError::Reverted(EthTransactError::Data(data)) => { + let msg = extract_revert_message(&data).unwrap_or_default(); let data = format!("0x{}", hex::encode(data)); - ErrorObjectOwned::owned::(CALL_EXECUTION_FAILED_CODE, msg, Some(data)) + ErrorObjectOwned::owned::(REVERT_CODE, msg, Some(data)) }, - _ => ErrorObjectOwned::owned::(CALL_EXECUTION_FAILED_CODE, msg, None), + ClientError::Reverted(EthTransactError::Message(msg)) => + ErrorObjectOwned::owned::(CALL_EXECUTION_FAILED_CODE, msg, None), + _ => + ErrorObjectOwned::owned::(CALL_EXECUTION_FAILED_CODE, err.to_string(), None), } } } @@ -634,54 +662,25 @@ impl Client { Ok(result) } - /// Dry run a transaction and returns the [`EthContractResult`] for the transaction. + /// Dry run a transaction and returns the [`EthTransactInfo`] for the transaction. pub async fn dry_run( &self, - tx: &GenericTransaction, + tx: GenericTransaction, block: BlockNumberOrTagOrHash, - ) -> Result>, ClientError> { + ) -> Result, ClientError> { let runtime_api = self.runtime_api(&block).await?; + let payload = subxt_client::apis().revive_api().eth_transact(tx.into()); - // TODO: remove once subxt is updated - let value = subxt::utils::Static(tx.value.unwrap_or_default()); - let from = tx.from.map(|v| v.0.into()); - let to = tx.to.map(|v| v.0.into()); - - let payload = subxt_client::apis().revive_api().eth_transact( - from.unwrap_or_default(), - to, - value, - tx.input.clone().unwrap_or_default().0, - None, - None, - ); - - let EthContractResult { fee, gas_required, storage_deposit, result } = - runtime_api.call(payload).await?.0; + let result = runtime_api.call(payload).await?; match result { Err(err) => { log::debug!(target: LOG_TARGET, "Dry run failed {err:?}"); - Err(ClientError::DryRunFailed(format!("{err:?}"))) + Err(ClientError::Reverted(err.0)) }, - Ok(result) if result.did_revert() => { - log::debug!(target: LOG_TARGET, "Dry run reverted"); - Err(ClientError::Reverted(result.0.data)) - }, - Ok(result) => - Ok(EthContractResult { fee, gas_required, storage_deposit, result: result.0.data }), + Ok(result) => Ok(result.0), } } - /// Dry run a transaction and returns the gas estimate for the transaction. - pub async fn estimate_gas( - &self, - tx: &GenericTransaction, - block: BlockNumberOrTagOrHash, - ) -> Result { - let dry_run = self.dry_run(tx, block).await?; - Ok(U256::from(dry_run.fee / GAS_PRICE as u128) + GAS_PRICE) - } - /// Get the nonce of the given address. pub async fn nonce( &self, diff --git a/substrate/frame/revive/rpc/src/lib.rs b/substrate/frame/revive/rpc/src/lib.rs index 6a324e63a857..ccd8bb043e90 100644 --- a/substrate/frame/revive/rpc/src/lib.rs +++ b/substrate/frame/revive/rpc/src/lib.rs @@ -23,7 +23,7 @@ use jsonrpsee::{ core::{async_trait, RpcResult}, types::{ErrorCode, ErrorObjectOwned}, }; -use pallet_revive::{evm::*, EthContractResult}; +use pallet_revive::evm::*; use sp_core::{keccak_256, H160, H256, U256}; use thiserror::Error; @@ -128,10 +128,22 @@ impl EthRpcServer for EthRpcServerImpl { async fn estimate_gas( &self, transaction: GenericTransaction, - _block: Option, + block: Option, ) -> RpcResult { - let result = self.client.estimate_gas(&transaction, BlockTag::Latest.into()).await?; - Ok(result) + let dry_run = self.client.dry_run(transaction, block.unwrap_or_default().into()).await?; + Ok(dry_run.eth_gas) + } + + async fn call( + &self, + transaction: GenericTransaction, + block: Option, + ) -> RpcResult { + let dry_run = self + .client + .dry_run(transaction, block.unwrap_or_else(|| BlockTag::Latest.into())) + .await?; + Ok(dry_run.data.into()) } async fn send_raw_transaction(&self, transaction: Bytes) -> RpcResult { @@ -150,15 +162,17 @@ impl EthRpcServer for EthRpcServerImpl { let tx = GenericTransaction::from_signed(tx, Some(eth_addr)); // Dry run the transaction to get the weight limit and storage deposit limit - let dry_run = self.client.dry_run(&tx, BlockTag::Latest.into()).await?; + let dry_run = self.client.dry_run(tx, BlockTag::Latest.into()).await?; - let EthContractResult { gas_required, storage_deposit, .. } = dry_run; let call = subxt_client::tx().revive().eth_transact( transaction.0, - gas_required.into(), - storage_deposit, + dry_run.gas_required.into(), + dry_run.storage_deposit, ); - self.client.submit(call).await?; + self.client.submit(call).await.map_err(|err| { + log::debug!(target: LOG_TARGET, "submit call failed: {err:?}"); + err + })?; log::debug!(target: LOG_TARGET, "send_raw_transaction hash: {hash:?}"); Ok(hash) } @@ -234,18 +248,6 @@ impl EthRpcServer for EthRpcServerImpl { Ok(self.accounts.iter().map(|account| account.address()).collect()) } - async fn call( - &self, - transaction: GenericTransaction, - block: Option, - ) -> RpcResult { - let dry_run = self - .client - .dry_run(&transaction, block.unwrap_or_else(|| BlockTag::Latest.into())) - .await?; - Ok(dry_run.result.into()) - } - async fn get_block_by_number( &self, block: BlockNumberOrTag, diff --git a/substrate/frame/revive/rpc/src/rpc_methods_gen.rs b/substrate/frame/revive/rpc/src/rpc_methods_gen.rs index 339080368969..ad34dbfdfb49 100644 --- a/substrate/frame/revive/rpc/src/rpc_methods_gen.rs +++ b/substrate/frame/revive/rpc/src/rpc_methods_gen.rs @@ -14,6 +14,7 @@ // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. + //! Generated JSON-RPC methods. #![allow(missing_docs)] diff --git a/substrate/frame/revive/rpc/src/subxt_client.rs b/substrate/frame/revive/rpc/src/subxt_client.rs index a232b231bc7c..1e1c395028a4 100644 --- a/substrate/frame/revive/rpc/src/subxt_client.rs +++ b/substrate/frame/revive/rpc/src/subxt_client.rs @@ -27,8 +27,16 @@ use subxt::config::{signed_extensions, Config, PolkadotConfig}; with = "::subxt::utils::Static<::sp_core::U256>" ), substitute_type( - path = "pallet_revive::primitives::EthContractResult", - with = "::subxt::utils::Static<::pallet_revive::EthContractResult>" + path = "pallet_revive::evm::api::rpc_types_gen::GenericTransaction", + with = "::subxt::utils::Static<::pallet_revive::evm::GenericTransaction>" + ), + substitute_type( + path = "pallet_revive::primitives::EthTransactInfo", + with = "::subxt::utils::Static<::pallet_revive::EthTransactInfo>" + ), + substitute_type( + path = "pallet_revive::primitives::EthTransactError", + with = "::subxt::utils::Static<::pallet_revive::EthTransactError>" ), substitute_type( path = "pallet_revive::primitives::ExecReturnValue", diff --git a/substrate/frame/revive/rpc/src/tests.rs b/substrate/frame/revive/rpc/src/tests.rs index 920318b26f71..7f2d4e683c31 100644 --- a/substrate/frame/revive/rpc/src/tests.rs +++ b/substrate/frame/revive/rpc/src/tests.rs @@ -238,7 +238,8 @@ async fn revert_call() -> anyhow::Result<()> { .unwrap_err(); let call_err = unwrap_call_err!(err.source().unwrap()); - assert_eq!(call_err.message(), "Execution reverted: revert message"); + assert_eq!(call_err.message(), "execution reverted: revert message"); + assert_eq!(call_err.code(), 3); Ok(()) } diff --git a/substrate/frame/revive/src/benchmarking/mod.rs b/substrate/frame/revive/src/benchmarking/mod.rs index 9c4d817a07de..b73815bfb9ea 100644 --- a/substrate/frame/revive/src/benchmarking/mod.rs +++ b/substrate/frame/revive/src/benchmarking/mod.rs @@ -103,7 +103,7 @@ where origin, 0u32.into(), Weight::MAX, - default_deposit_limit::(), + DepositLimit::Balance(default_deposit_limit::()), Code::Upload(module.code), data, salt, diff --git a/substrate/frame/revive/src/evm/api/rlp_codec.rs b/substrate/frame/revive/src/evm/api/rlp_codec.rs index 3442ed73acca..9b61cd042ec5 100644 --- a/substrate/frame/revive/src/evm/api/rlp_codec.rs +++ b/substrate/frame/revive/src/evm/api/rlp_codec.rs @@ -88,14 +88,14 @@ impl TransactionSigned { } } -impl TransactionLegacyUnsigned { - /// Get the rlp encoded bytes of a signed transaction with a dummy 65 bytes signature. +impl TransactionUnsigned { + /// Get a signed transaction payload with a dummy 65 bytes signature. pub fn dummy_signed_payload(&self) -> Vec { - let mut s = rlp::RlpStream::new(); - s.append(self); const DUMMY_SIGNATURE: [u8; 65] = [0u8; 65]; - s.append_raw(&DUMMY_SIGNATURE.as_ref(), 1); - s.out().to_vec() + self.unsigned_payload() + .into_iter() + .chain(DUMMY_SIGNATURE.iter().copied()) + .collect::>() } } @@ -567,7 +567,7 @@ mod test { #[test] fn dummy_signed_payload_works() { - let tx = TransactionLegacyUnsigned { + let tx: TransactionUnsigned = TransactionLegacyUnsigned { chain_id: Some(596.into()), gas: U256::from(21000), nonce: U256::from(1), @@ -576,10 +576,10 @@ mod test { value: U256::from(123123), input: Bytes(vec![]), r#type: TypeLegacy, - }; + } + .into(); let dummy_signed_payload = tx.dummy_signed_payload(); - let tx: TransactionUnsigned = tx.into(); let payload = Account::default().sign_transaction(tx).signed_payload(); assert_eq!(dummy_signed_payload.len(), payload.len()); } diff --git a/substrate/frame/revive/src/evm/api/rpc_types.rs b/substrate/frame/revive/src/evm/api/rpc_types.rs index 1cf8d984b68b..ed046cb4da44 100644 --- a/substrate/frame/revive/src/evm/api/rpc_types.rs +++ b/substrate/frame/revive/src/evm/api/rpc_types.rs @@ -19,6 +19,27 @@ use super::*; use alloc::vec::Vec; use sp_core::{H160, U256}; +impl From for BlockNumberOrTagOrHash { + fn from(b: BlockNumberOrTag) -> Self { + match b { + BlockNumberOrTag::U256(n) => BlockNumberOrTagOrHash::U256(n), + BlockNumberOrTag::BlockTag(t) => BlockNumberOrTagOrHash::BlockTag(t), + } + } +} + +impl From for TransactionUnsigned { + fn from(tx: TransactionSigned) -> Self { + use TransactionSigned::*; + match tx { + Transaction4844Signed(tx) => tx.transaction_4844_unsigned.into(), + Transaction1559Signed(tx) => tx.transaction_1559_unsigned.into(), + Transaction2930Signed(tx) => tx.transaction_2930_unsigned.into(), + TransactionLegacySigned(tx) => tx.transaction_legacy_unsigned.into(), + } + } +} + impl TransactionInfo { /// Create a new [`TransactionInfo`] from a receipt and a signed transaction. pub fn new(receipt: ReceiptInfo, transaction_signed: TransactionSigned) -> Self { @@ -143,76 +164,69 @@ fn logs_bloom_works() { impl GenericTransaction { /// Create a new [`GenericTransaction`] from a signed transaction. pub fn from_signed(tx: TransactionSigned, from: Option) -> Self { - use TransactionSigned::*; + Self::from_unsigned(tx.into(), from) + } + + /// Create a new [`GenericTransaction`] from a unsigned transaction. + pub fn from_unsigned(tx: TransactionUnsigned, from: Option) -> Self { + use TransactionUnsigned::*; match tx { - TransactionLegacySigned(tx) => { - let tx = tx.transaction_legacy_unsigned; - GenericTransaction { - from, - r#type: Some(tx.r#type.as_byte()), - chain_id: tx.chain_id, - input: Some(tx.input), - nonce: Some(tx.nonce), - value: Some(tx.value), - to: tx.to, - gas: Some(tx.gas), - gas_price: Some(tx.gas_price), - ..Default::default() - } + TransactionLegacyUnsigned(tx) => GenericTransaction { + from, + r#type: Some(tx.r#type.as_byte()), + chain_id: tx.chain_id, + input: Some(tx.input), + nonce: Some(tx.nonce), + value: Some(tx.value), + to: tx.to, + gas: Some(tx.gas), + gas_price: Some(tx.gas_price), + ..Default::default() }, - Transaction4844Signed(tx) => { - let tx = tx.transaction_4844_unsigned; - GenericTransaction { - from, - r#type: Some(tx.r#type.as_byte()), - chain_id: Some(tx.chain_id), - input: Some(tx.input), - nonce: Some(tx.nonce), - value: Some(tx.value), - to: Some(tx.to), - gas: Some(tx.gas), - gas_price: Some(tx.max_fee_per_blob_gas), - access_list: Some(tx.access_list), - blob_versioned_hashes: Some(tx.blob_versioned_hashes), - max_fee_per_blob_gas: Some(tx.max_fee_per_blob_gas), - max_fee_per_gas: Some(tx.max_fee_per_gas), - max_priority_fee_per_gas: Some(tx.max_priority_fee_per_gas), - ..Default::default() - } + Transaction4844Unsigned(tx) => GenericTransaction { + from, + r#type: Some(tx.r#type.as_byte()), + chain_id: Some(tx.chain_id), + input: Some(tx.input), + nonce: Some(tx.nonce), + value: Some(tx.value), + to: Some(tx.to), + gas: Some(tx.gas), + gas_price: Some(tx.max_fee_per_blob_gas), + access_list: Some(tx.access_list), + blob_versioned_hashes: tx.blob_versioned_hashes, + max_fee_per_blob_gas: Some(tx.max_fee_per_blob_gas), + max_fee_per_gas: Some(tx.max_fee_per_gas), + max_priority_fee_per_gas: Some(tx.max_priority_fee_per_gas), + ..Default::default() }, - Transaction1559Signed(tx) => { - let tx = tx.transaction_1559_unsigned; - GenericTransaction { - from, - r#type: Some(tx.r#type.as_byte()), - chain_id: Some(tx.chain_id), - input: Some(tx.input), - nonce: Some(tx.nonce), - value: Some(tx.value), - to: tx.to, - gas: Some(tx.gas), - gas_price: Some(tx.gas_price), - access_list: Some(tx.access_list), - max_fee_per_gas: Some(tx.max_fee_per_gas), - max_priority_fee_per_gas: Some(tx.max_priority_fee_per_gas), - ..Default::default() - } + Transaction1559Unsigned(tx) => GenericTransaction { + from, + r#type: Some(tx.r#type.as_byte()), + chain_id: Some(tx.chain_id), + input: Some(tx.input), + nonce: Some(tx.nonce), + value: Some(tx.value), + to: tx.to, + gas: Some(tx.gas), + gas_price: Some(tx.gas_price), + access_list: Some(tx.access_list), + max_fee_per_gas: Some(tx.max_fee_per_gas), + max_priority_fee_per_gas: Some(tx.max_priority_fee_per_gas), + ..Default::default() }, - Transaction2930Signed(tx) => { - let tx = tx.transaction_2930_unsigned; - GenericTransaction { - from, - r#type: Some(tx.r#type.as_byte()), - chain_id: Some(tx.chain_id), - input: Some(tx.input), - nonce: Some(tx.nonce), - value: Some(tx.value), - to: tx.to, - gas: Some(tx.gas), - gas_price: Some(tx.gas_price), - access_list: Some(tx.access_list), - ..Default::default() - } + Transaction2930Unsigned(tx) => GenericTransaction { + from, + r#type: Some(tx.r#type.as_byte()), + chain_id: Some(tx.chain_id), + input: Some(tx.input), + nonce: Some(tx.nonce), + value: Some(tx.value), + to: tx.to, + gas: Some(tx.gas), + gas_price: Some(tx.gas_price), + access_list: Some(tx.access_list), + ..Default::default() }, } } @@ -269,7 +283,7 @@ impl GenericTransaction { max_fee_per_blob_gas: self.max_fee_per_blob_gas.unwrap_or_default(), max_priority_fee_per_gas: self.max_priority_fee_per_gas.unwrap_or_default(), access_list: self.access_list.unwrap_or_default(), - blob_versioned_hashes: self.blob_versioned_hashes.unwrap_or_default(), + blob_versioned_hashes: self.blob_versioned_hashes, } .into()), _ => Err(()), diff --git a/substrate/frame/revive/src/evm/api/rpc_types_gen.rs b/substrate/frame/revive/src/evm/api/rpc_types_gen.rs index 5037ec05d881..1d65fdefdde6 100644 --- a/substrate/frame/revive/src/evm/api/rpc_types_gen.rs +++ b/substrate/frame/revive/src/evm/api/rpc_types_gen.rs @@ -94,8 +94,8 @@ pub struct Block { /// Uncles pub uncles: Vec, /// Withdrawals - #[serde(skip_serializing_if = "Option::is_none")] - pub withdrawals: Option>, + #[serde(default, skip_serializing_if = "Vec::is_empty")] + pub withdrawals: Vec, /// Withdrawals root #[serde(rename = "withdrawalsRoot", skip_serializing_if = "Option::is_none")] pub withdrawals_root: Option, @@ -114,7 +114,7 @@ pub enum BlockNumberOrTag { } impl Default for BlockNumberOrTag { fn default() -> Self { - BlockNumberOrTag::U256(Default::default()) + BlockNumberOrTag::BlockTag(Default::default()) } } @@ -133,7 +133,7 @@ pub enum BlockNumberOrTagOrHash { } impl Default for BlockNumberOrTagOrHash { fn default() -> Self { - BlockNumberOrTagOrHash::U256(Default::default()) + BlockNumberOrTagOrHash::BlockTag(Default::default()) } } @@ -148,12 +148,12 @@ pub struct GenericTransaction { pub access_list: Option, /// blobVersionedHashes /// List of versioned blob hashes associated with the transaction's EIP-4844 data blobs. - #[serde(rename = "blobVersionedHashes", skip_serializing_if = "Option::is_none")] - pub blob_versioned_hashes: Option>, + #[serde(rename = "blobVersionedHashes", default, skip_serializing_if = "Vec::is_empty")] + pub blob_versioned_hashes: Vec, /// blobs /// Raw blob data. - #[serde(skip_serializing_if = "Option::is_none")] - pub blobs: Option>, + #[serde(default, skip_serializing_if = "Vec::is_empty")] + pub blobs: Vec, /// chainId /// Chain ID that this transaction is valid on. #[serde(rename = "chainId", skip_serializing_if = "Option::is_none")] @@ -319,7 +319,7 @@ pub enum TransactionUnsigned { } impl Default for TransactionUnsigned { fn default() -> Self { - TransactionUnsigned::Transaction4844Unsigned(Default::default()) + TransactionUnsigned::TransactionLegacyUnsigned(Default::default()) } } @@ -341,13 +341,13 @@ pub type AccessList = Vec; )] pub enum BlockTag { #[serde(rename = "earliest")] - #[default] Earliest, #[serde(rename = "finalized")] Finalized, #[serde(rename = "safe")] Safe, #[serde(rename = "latest")] + #[default] Latest, #[serde(rename = "pending")] Pending, @@ -392,7 +392,7 @@ pub struct Log { #[serde(skip_serializing_if = "Option::is_none")] pub removed: Option, /// topics - #[serde(skip_serializing_if = "Vec::is_empty")] + #[serde(default, skip_serializing_if = "Vec::is_empty")] pub topics: Vec, /// transaction hash #[serde(rename = "transactionHash")] @@ -574,7 +574,7 @@ pub enum TransactionSigned { } impl Default for TransactionSigned { fn default() -> Self { - TransactionSigned::Transaction4844Signed(Default::default()) + TransactionSigned::TransactionLegacySigned(Default::default()) } } diff --git a/substrate/frame/revive/src/evm/runtime.rs b/substrate/frame/revive/src/evm/runtime.rs index b5dc9a36065b..24b75de83569 100644 --- a/substrate/frame/revive/src/evm/runtime.rs +++ b/substrate/frame/revive/src/evm/runtime.rs @@ -455,236 +455,265 @@ mod test { /// A builder for creating an unchecked extrinsic, and test that the check function works. #[derive(Clone)] struct UncheckedExtrinsicBuilder { - tx: TransactionLegacyUnsigned, + tx: GenericTransaction, gas_limit: Weight, storage_deposit_limit: BalanceOf, + before_validate: Option>, } impl UncheckedExtrinsicBuilder { /// Create a new builder with default values. fn new() -> Self { Self { - tx: TransactionLegacyUnsigned { + tx: GenericTransaction { + from: Some(Account::default().address()), chain_id: Some(::ChainId::get().into()), - gas_price: U256::from(GAS_PRICE), + gas_price: Some(U256::from(GAS_PRICE)), ..Default::default() }, gas_limit: Weight::zero(), storage_deposit_limit: 0, + before_validate: None, } } fn estimate_gas(&mut self) { - let dry_run = crate::Pallet::::bare_eth_transact( - Account::default().substrate_account(), - self.tx.to, - self.tx.value.try_into().unwrap(), - self.tx.input.clone().0, - Weight::MAX, - u64::MAX, - |call| { + let dry_run = + crate::Pallet::::bare_eth_transact(self.tx.clone(), Weight::MAX, |call| { let call = RuntimeCall::Contracts(call); let uxt: Ex = sp_runtime::generic::UncheckedExtrinsic::new_bare(call).into(); uxt.encoded_size() as u32 + }); + + match dry_run { + Ok(dry_run) => { + log::debug!(target: LOG_TARGET, "Estimated gas: {:?}", dry_run.eth_gas); + self.tx.gas = Some(dry_run.eth_gas); + }, + Err(err) => { + log::debug!(target: LOG_TARGET, "Failed to estimate gas: {:?}", err); }, - crate::DebugInfo::Skip, - crate::CollectEvents::Skip, - ); - self.tx.gas = ((dry_run.fee + GAS_PRICE as u64) / (GAS_PRICE as u64)).into(); + } } /// Create a new builder with a call to the given address. fn call_with(dest: H160) -> Self { let mut builder = Self::new(); builder.tx.to = Some(dest); - builder.estimate_gas(); + ExtBuilder::default().build().execute_with(|| builder.estimate_gas()); builder } /// Create a new builder with an instantiate call. fn instantiate_with(code: Vec, data: Vec) -> Self { let mut builder = Self::new(); - builder.tx.input = Bytes(code.into_iter().chain(data.into_iter()).collect()); - builder.estimate_gas(); + builder.tx.input = Some(Bytes(code.into_iter().chain(data.into_iter()).collect())); + ExtBuilder::default().build().execute_with(|| builder.estimate_gas()); builder } /// Update the transaction with the given function. - fn update(mut self, f: impl FnOnce(&mut TransactionLegacyUnsigned) -> ()) -> Self { + fn update(mut self, f: impl FnOnce(&mut GenericTransaction) -> ()) -> Self { f(&mut self.tx); self } + /// Set before_validate function. + fn before_validate(mut self, f: impl Fn() + Send + Sync + 'static) -> Self { + self.before_validate = Some(std::sync::Arc::new(f)); + self + } /// Call `check` on the unchecked extrinsic, and `pre_dispatch` on the signed extension. fn check(&self) -> Result<(RuntimeCall, SignedExtra), TransactionValidityError> { - let UncheckedExtrinsicBuilder { tx, gas_limit, storage_deposit_limit } = self.clone(); - - // Fund the account. - let account = Account::default(); - let _ = ::Currency::set_balance( - &account.substrate_account(), - 100_000_000_000_000, - ); - - let payload = account.sign_transaction(tx.into()).signed_payload(); - let call = RuntimeCall::Contracts(crate::Call::eth_transact { - payload, - gas_limit, - storage_deposit_limit, - }); - - let encoded_len = call.encoded_size(); - let uxt: Ex = generic::UncheckedExtrinsic::new_bare(call).into(); - let result: CheckedExtrinsic<_, _, _> = uxt.check(&TestContext {})?; - let (account_id, extra): (AccountId32, SignedExtra) = match result.format { - ExtrinsicFormat::Signed(signer, extra) => (signer, extra), - _ => unreachable!(), - }; - - extra.clone().validate_and_prepare( - RuntimeOrigin::signed(account_id), - &result.function, - &result.function.get_dispatch_info(), - encoded_len, - 0, - )?; + ExtBuilder::default().build().execute_with(|| { + let UncheckedExtrinsicBuilder { + tx, + gas_limit, + storage_deposit_limit, + before_validate, + } = self.clone(); + + // Fund the account. + let account = Account::default(); + let _ = ::Currency::set_balance( + &account.substrate_account(), + 100_000_000_000_000, + ); + + let payload = + account.sign_transaction(tx.try_into_unsigned().unwrap()).signed_payload(); + let call = RuntimeCall::Contracts(crate::Call::eth_transact { + payload, + gas_limit, + storage_deposit_limit, + }); + + let encoded_len = call.encoded_size(); + let uxt: Ex = generic::UncheckedExtrinsic::new_bare(call).into(); + let result: CheckedExtrinsic<_, _, _> = uxt.check(&TestContext {})?; + let (account_id, extra): (AccountId32, SignedExtra) = match result.format { + ExtrinsicFormat::Signed(signer, extra) => (signer, extra), + _ => unreachable!(), + }; - Ok((result.function, extra)) + before_validate.map(|f| f()); + extra.clone().validate_and_prepare( + RuntimeOrigin::signed(account_id), + &result.function, + &result.function.get_dispatch_info(), + encoded_len, + 0, + )?; + + Ok((result.function, extra)) + }) } } #[test] fn check_eth_transact_call_works() { - ExtBuilder::default().build().execute_with(|| { - let builder = UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])); - assert_eq!( - builder.check().unwrap().0, - crate::Call::call:: { - dest: builder.tx.to.unwrap(), - value: builder.tx.value.as_u64(), - gas_limit: builder.gas_limit, - storage_deposit_limit: builder.storage_deposit_limit, - data: builder.tx.input.0 - } - .into() - ); - }); + let builder = UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])); + assert_eq!( + builder.check().unwrap().0, + crate::Call::call:: { + dest: builder.tx.to.unwrap(), + value: builder.tx.value.unwrap_or_default().as_u64(), + gas_limit: builder.gas_limit, + storage_deposit_limit: builder.storage_deposit_limit, + data: builder.tx.input.unwrap_or_default().0 + } + .into() + ); } #[test] fn check_eth_transact_instantiate_works() { - ExtBuilder::default().build().execute_with(|| { - let (code, _) = compile_module("dummy").unwrap(); - let data = vec![]; - let builder = UncheckedExtrinsicBuilder::instantiate_with(code.clone(), data.clone()); - - assert_eq!( - builder.check().unwrap().0, - crate::Call::instantiate_with_code:: { - value: builder.tx.value.as_u64(), - gas_limit: builder.gas_limit, - storage_deposit_limit: builder.storage_deposit_limit, - code, - data, - salt: None - } - .into() - ); - }); + let (code, _) = compile_module("dummy").unwrap(); + let data = vec![]; + let builder = UncheckedExtrinsicBuilder::instantiate_with(code.clone(), data.clone()); + + assert_eq!( + builder.check().unwrap().0, + crate::Call::instantiate_with_code:: { + value: builder.tx.value.unwrap_or_default().as_u64(), + gas_limit: builder.gas_limit, + storage_deposit_limit: builder.storage_deposit_limit, + code, + data, + salt: None + } + .into() + ); } #[test] fn check_eth_transact_nonce_works() { - ExtBuilder::default().build().execute_with(|| { - let builder = UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])) - .update(|tx| tx.nonce = 1u32.into()); - - assert_eq!( - builder.check(), - Err(TransactionValidityError::Invalid(InvalidTransaction::Future)) - ); - - >::inc_account_nonce(Account::default().substrate_account()); - - let builder = UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])); - assert_eq!( - builder.check(), - Err(TransactionValidityError::Invalid(InvalidTransaction::Stale)) - ); - }); + let builder = UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])) + .update(|tx| tx.nonce = Some(1u32.into())); + + assert_eq!( + builder.check(), + Err(TransactionValidityError::Invalid(InvalidTransaction::Future)) + ); + + let builder = + UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])).before_validate(|| { + >::inc_account_nonce(Account::default().substrate_account()); + }); + + assert_eq!( + builder.check(), + Err(TransactionValidityError::Invalid(InvalidTransaction::Stale)) + ); } #[test] fn check_eth_transact_chain_id_works() { - ExtBuilder::default().build().execute_with(|| { - let builder = UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])) - .update(|tx| tx.chain_id = Some(42.into())); - - assert_eq!( - builder.check(), - Err(TransactionValidityError::Invalid(InvalidTransaction::Call)) - ); - }); + let builder = UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])) + .update(|tx| tx.chain_id = Some(42.into())); + + assert_eq!( + builder.check(), + Err(TransactionValidityError::Invalid(InvalidTransaction::Call)) + ); } #[test] fn check_instantiate_data() { - ExtBuilder::default().build().execute_with(|| { - let code = b"invalid code".to_vec(); - let data = vec![1]; - let builder = UncheckedExtrinsicBuilder::instantiate_with(code.clone(), data.clone()); - - // Fail because the tx input fail to get the blob length - assert_eq!( - builder.clone().update(|tx| tx.input = Bytes(vec![1, 2, 3])).check(), - Err(TransactionValidityError::Invalid(InvalidTransaction::Call)) - ); - }); + let code = b"invalid code".to_vec(); + let data = vec![1]; + let builder = UncheckedExtrinsicBuilder::instantiate_with(code.clone(), data.clone()); + + // Fail because the tx input fail to get the blob length + assert_eq!( + builder.clone().update(|tx| tx.input = Some(Bytes(vec![1, 2, 3]))).check(), + Err(TransactionValidityError::Invalid(InvalidTransaction::Call)) + ); } #[test] fn check_transaction_fees() { - ExtBuilder::default().build().execute_with(|| { - let scenarios: [(_, Box, _); 5] = [ - ("Eth fees too low", Box::new(|tx| tx.gas_price /= 2), InvalidTransaction::Payment), - ("Gas fees too high", Box::new(|tx| tx.gas *= 2), InvalidTransaction::Call), - ("Gas fees too low", Box::new(|tx| tx.gas *= 2), InvalidTransaction::Call), - ( - "Diff > 10%", - Box::new(|tx| tx.gas = tx.gas * 111 / 100), - InvalidTransaction::Call, - ), - ( - "Diff < 10%", - Box::new(|tx| { - tx.gas_price *= 2; - tx.gas = tx.gas * 89 / 100 - }), - InvalidTransaction::Call, - ), - ]; - - for (msg, update_tx, err) in scenarios { - let builder = - UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])).update(update_tx); - - assert_eq!(builder.check(), Err(TransactionValidityError::Invalid(err)), "{}", msg); - } - }); + let scenarios: [(_, Box, _); 5] = [ + ( + "Eth fees too low", + Box::new(|tx| { + tx.gas_price = Some(tx.gas_price.unwrap() / 2); + }), + InvalidTransaction::Payment, + ), + ( + "Gas fees too high", + Box::new(|tx| { + tx.gas = Some(tx.gas.unwrap() * 2); + }), + InvalidTransaction::Call, + ), + ( + "Gas fees too low", + Box::new(|tx| { + tx.gas = Some(tx.gas.unwrap() * 2); + }), + InvalidTransaction::Call, + ), + ( + "Diff > 10%", + Box::new(|tx| { + tx.gas = Some(tx.gas.unwrap() * 111 / 100); + }), + InvalidTransaction::Call, + ), + ( + "Diff < 10%", + Box::new(|tx| { + tx.gas_price = Some(tx.gas_price.unwrap() * 2); + tx.gas = Some(tx.gas.unwrap() * 89 / 100); + }), + InvalidTransaction::Call, + ), + ]; + + for (msg, update_tx, err) in scenarios { + let builder = + UncheckedExtrinsicBuilder::call_with(H160::from([1u8; 20])).update(update_tx); + + assert_eq!(builder.check(), Err(TransactionValidityError::Invalid(err)), "{}", msg); + } } #[test] fn check_transaction_tip() { - ExtBuilder::default().build().execute_with(|| { - let (code, _) = compile_module("dummy").unwrap(); - let data = vec![]; - let builder = UncheckedExtrinsicBuilder::instantiate_with(code.clone(), data.clone()) - .update(|tx| tx.gas_price = tx.gas_price * 103 / 100); - - let tx = &builder.tx; - let expected_tip = tx.gas_price * tx.gas - U256::from(GAS_PRICE) * tx.gas; - let (_, extra) = builder.check().unwrap(); - assert_eq!(U256::from(extra.1.tip()), expected_tip); - }); + let (code, _) = compile_module("dummy").unwrap(); + let data = vec![]; + let builder = UncheckedExtrinsicBuilder::instantiate_with(code.clone(), data.clone()) + .update(|tx| { + tx.gas_price = Some(tx.gas_price.unwrap() * 103 / 100); + log::debug!(target: LOG_TARGET, "Gas price: {:?}", tx.gas_price); + }); + + let tx = &builder.tx; + let expected_tip = + tx.gas_price.unwrap() * tx.gas.unwrap() - U256::from(GAS_PRICE) * tx.gas.unwrap(); + let (_, extra) = builder.check().unwrap(); + assert_eq!(U256::from(extra.1.tip()), expected_tip); } } diff --git a/substrate/frame/revive/src/exec.rs b/substrate/frame/revive/src/exec.rs index 49c08166483e..b23d7e4e60ef 100644 --- a/substrate/frame/revive/src/exec.rs +++ b/substrate/frame/revive/src/exec.rs @@ -562,6 +562,9 @@ pub struct Stack<'a, T: Config, E> { debug_message: Option<&'a mut DebugBuffer>, /// Transient storage used to store data, which is kept for the duration of a transaction. transient_storage: TransientStorage, + /// Whether or not actual transfer of funds should be performed. + /// This is set to `true` exclusively when we simulate a call through eth_transact. + skip_transfer: bool, /// No executable is held by the struct but influences its behaviour. _phantom: PhantomData, } @@ -777,6 +780,7 @@ where storage_meter: &'a mut storage::meter::Meter, value: U256, input_data: Vec, + skip_transfer: bool, debug_message: Option<&'a mut DebugBuffer>, ) -> ExecResult { let dest = T::AddressMapper::to_account_id(&dest); @@ -786,6 +790,7 @@ where gas_meter, storage_meter, value, + skip_transfer, debug_message, )? { stack.run(executable, input_data).map(|_| stack.first_frame.last_frame_output) @@ -812,6 +817,7 @@ where value: U256, input_data: Vec, salt: Option<&[u8; 32]>, + skip_transfer: bool, debug_message: Option<&'a mut DebugBuffer>, ) -> Result<(H160, ExecReturnValue), ExecError> { let (mut stack, executable) = Self::new( @@ -825,6 +831,7 @@ where gas_meter, storage_meter, value, + skip_transfer, debug_message, )? .expect(FRAME_ALWAYS_EXISTS_ON_INSTANTIATE); @@ -853,6 +860,7 @@ where gas_meter, storage_meter, value.into(), + false, debug_message, ) .unwrap() @@ -869,6 +877,7 @@ where gas_meter: &'a mut GasMeter, storage_meter: &'a mut storage::meter::Meter, value: U256, + skip_transfer: bool, debug_message: Option<&'a mut DebugBuffer>, ) -> Result, ExecError> { origin.ensure_mapped()?; @@ -896,6 +905,7 @@ where frames: Default::default(), debug_message, transient_storage: TransientStorage::new(limits::TRANSIENT_STORAGE_BYTES), + skip_transfer, _phantom: Default::default(), }; @@ -1073,6 +1083,7 @@ where &frame.account_id, frame.contract_info.get(&frame.account_id), executable.code_info(), + self.skip_transfer, )?; // Needs to be incremented before calling into the code so that it is visible // in case of recursion. @@ -2101,6 +2112,7 @@ mod tests { &mut storage_meter, value.into(), vec![], + false, None, ), Ok(_) @@ -2193,6 +2205,7 @@ mod tests { &mut storage_meter, value.into(), vec![], + false, None, ) .unwrap(); @@ -2233,6 +2246,7 @@ mod tests { &mut storage_meter, value.into(), vec![], + false, None, )); @@ -2269,6 +2283,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ), ExecError { @@ -2286,6 +2301,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, )); }); @@ -2314,6 +2330,7 @@ mod tests { &mut storage_meter, 55u64.into(), vec![], + false, None, ) .unwrap(); @@ -2363,6 +2380,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ); @@ -2392,6 +2410,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ); @@ -2421,6 +2440,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![1, 2, 3, 4], + false, None, ); assert_matches!(result, Ok(_)); @@ -2457,6 +2477,7 @@ mod tests { min_balance.into(), vec![1, 2, 3, 4], Some(&[0; 32]), + false, None, ); assert_matches!(result, Ok(_)); @@ -2511,6 +2532,7 @@ mod tests { &mut storage_meter, value.into(), vec![], + false, None, ); @@ -2575,6 +2597,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ); @@ -2640,6 +2663,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ); @@ -2672,6 +2696,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ); assert_matches!(result, Ok(_)); @@ -2709,6 +2734,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ); assert_matches!(result, Ok(_)); @@ -2735,6 +2761,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ); assert_matches!(result, Ok(_)); @@ -2779,6 +2806,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ); assert_matches!(result, Ok(_)); @@ -2805,6 +2833,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ); assert_matches!(result, Ok(_)); @@ -2831,6 +2860,7 @@ mod tests { &mut storage_meter, 1u64.into(), vec![0], + false, None, ); assert_matches!(result, Err(_)); @@ -2875,6 +2905,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ); assert_matches!(result, Ok(_)); @@ -2920,6 +2951,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ); @@ -2946,6 +2978,7 @@ mod tests { U256::zero(), // <- zero value vec![], Some(&[0; 32]), + false, None, ), Err(_) @@ -2981,6 +3014,7 @@ mod tests { min_balance.into(), vec![], Some(&[0 ;32]), + false, None, ), Ok((address, ref output)) if output.data == vec![80, 65, 83, 83] => address @@ -3032,10 +3066,10 @@ mod tests { executable, &mut gas_meter, &mut storage_meter, - min_balance.into(), vec![], Some(&[0; 32]), + false, None, ), Ok((address, ref output)) if output.data == vec![70, 65, 73, 76] => address @@ -3100,6 +3134,7 @@ mod tests { &mut storage_meter, (min_balance * 10).into(), vec![], + false, None, ), Ok(_) @@ -3180,6 +3215,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ), Ok(_) @@ -3223,6 +3259,7 @@ mod tests { 100u64.into(), vec![], Some(&[0; 32]), + false, None, ), Err(Error::::TerminatedInConstructor.into()) @@ -3287,6 +3324,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ); assert_matches!(result, Ok(_)); @@ -3349,6 +3387,7 @@ mod tests { 10u64.into(), vec![], Some(&[0; 32]), + false, None, ); assert_matches!(result, Ok(_)); @@ -3395,6 +3434,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ) .unwrap(); @@ -3426,6 +3466,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, Some(&mut debug_buffer), ) .unwrap(); @@ -3459,6 +3500,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, Some(&mut debug_buffer), ); assert!(result.is_err()); @@ -3492,6 +3534,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, Some(&mut debug_buf_after), ) .unwrap(); @@ -3525,6 +3568,7 @@ mod tests { &mut storage_meter, U256::zero(), CHARLIE_ADDR.as_bytes().to_vec(), + false, None, )); @@ -3537,6 +3581,7 @@ mod tests { &mut storage_meter, U256::zero(), BOB_ADDR.as_bytes().to_vec(), + false, None, ) .map_err(|e| e.error), @@ -3587,6 +3632,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ) .map_err(|e| e.error), @@ -3621,6 +3667,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ) .unwrap(); @@ -3705,6 +3752,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ) .unwrap(); @@ -3831,6 +3879,7 @@ mod tests { (min_balance * 100).into(), vec![], Some(&[0; 32]), + false, None, ) .ok(); @@ -3844,6 +3893,7 @@ mod tests { (min_balance * 100).into(), vec![], Some(&[0; 32]), + false, None, )); assert_eq!(System::account_nonce(&ALICE), 1); @@ -3856,6 +3906,7 @@ mod tests { (min_balance * 200).into(), vec![], Some(&[0; 32]), + false, None, )); assert_eq!(System::account_nonce(&ALICE), 2); @@ -3868,6 +3919,7 @@ mod tests { (min_balance * 200).into(), vec![], Some(&[0; 32]), + false, None, )); assert_eq!(System::account_nonce(&ALICE), 3); @@ -3936,6 +3988,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, )); }); @@ -4047,6 +4100,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, )); }); @@ -4086,6 +4140,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, )); }); @@ -4125,6 +4180,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, )); }); @@ -4178,6 +4234,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, )); }); @@ -4234,6 +4291,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, )); }); @@ -4309,6 +4367,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, )); }); @@ -4379,6 +4438,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ); assert_matches!(result, Ok(_)); @@ -4417,6 +4477,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, )); }); @@ -4479,6 +4540,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ); assert_matches!(result, Ok(_)); @@ -4512,6 +4574,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ); assert_matches!(result, Ok(_)); @@ -4595,6 +4658,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ) .unwrap() @@ -4663,6 +4727,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ); assert_matches!(result, Ok(_)); @@ -4734,6 +4799,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ); assert_matches!(result, Ok(_)); @@ -4785,6 +4851,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ) .unwrap() @@ -4854,6 +4921,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ) .unwrap() @@ -4900,6 +4968,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ) .unwrap() @@ -4944,6 +5013,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![], + false, None, ) .unwrap() @@ -4999,6 +5069,7 @@ mod tests { &mut storage_meter, U256::zero(), vec![0], + false, None, ), Ok(_) diff --git a/substrate/frame/revive/src/lib.rs b/substrate/frame/revive/src/lib.rs index b55854e2eec5..1dee1da03bc4 100644 --- a/substrate/frame/revive/src/lib.rs +++ b/substrate/frame/revive/src/lib.rs @@ -41,13 +41,13 @@ pub mod test_utils; pub mod weights; use crate::{ - evm::{runtime::GAS_PRICE, TransactionLegacyUnsigned}, + evm::{runtime::GAS_PRICE, GenericTransaction}, exec::{AccountIdOf, ExecError, Executable, Ext, Key, Origin, Stack as ExecStack}, gas::GasMeter, storage::{meter::Meter as StorageMeter, ContractInfo, DeletionQueueManager}, wasm::{CodeInfo, RuntimeCosts, WasmBlob}, }; -use alloc::boxed::Box; +use alloc::{boxed::Box, format, vec}; use codec::{Codec, Decode, Encode}; use environmental::*; use frame_support::{ @@ -74,7 +74,7 @@ use pallet_transaction_payment::OnChargeTransaction; use scale_info::TypeInfo; use sp_core::{H160, H256, U256}; use sp_runtime::{ - traits::{BadOrigin, Convert, Dispatchable, Saturating, Zero}, + traits::{BadOrigin, Bounded, Convert, Dispatchable, Saturating, Zero}, DispatchError, }; @@ -823,7 +823,7 @@ pub mod pallet { dest, value, gas_limit, - storage_deposit_limit, + DepositLimit::Balance(storage_deposit_limit), data, DebugInfo::Skip, CollectEvents::Skip, @@ -859,7 +859,7 @@ pub mod pallet { origin, value, gas_limit, - storage_deposit_limit, + DepositLimit::Balance(storage_deposit_limit), Code::Existing(code_hash), data, salt, @@ -925,7 +925,7 @@ pub mod pallet { origin, value, gas_limit, - storage_deposit_limit, + DepositLimit::Balance(storage_deposit_limit), Code::Upload(code), data, salt, @@ -1083,7 +1083,7 @@ fn dispatch_result( impl Pallet where - BalanceOf: Into + TryFrom, + BalanceOf: Into + TryFrom + Bounded, MomentOf: Into, T::Hash: frame_support::traits::IsType, { @@ -1098,7 +1098,7 @@ where dest: H160, value: BalanceOf, gas_limit: Weight, - storage_deposit_limit: BalanceOf, + storage_deposit_limit: DepositLimit>, data: Vec, debug: DebugInfo, collect_events: CollectEvents, @@ -1112,7 +1112,10 @@ where }; let try_call = || { let origin = Origin::from_runtime_origin(origin)?; - let mut storage_meter = StorageMeter::new(&origin, storage_deposit_limit, value)?; + let mut storage_meter = match storage_deposit_limit { + DepositLimit::Balance(limit) => StorageMeter::new(&origin, limit, value)?, + DepositLimit::Unchecked => StorageMeter::new_unchecked(BalanceOf::::max_value()), + }; let result = ExecStack::>::run_call( origin.clone(), dest, @@ -1120,9 +1123,14 @@ where &mut storage_meter, Self::convert_native_to_evm(value), data, + storage_deposit_limit.is_unchecked(), debug_message.as_mut(), )?; - storage_deposit = storage_meter.try_into_deposit(&origin)?; + storage_deposit = storage_meter + .try_into_deposit(&origin, storage_deposit_limit.is_unchecked()) + .inspect_err(|err| { + log::error!(target: LOG_TARGET, "Failed to transfer deposit: {err:?}"); + })?; Ok(result) }; let result = Self::run_guarded(try_call); @@ -1151,7 +1159,7 @@ where origin: OriginFor, value: BalanceOf, gas_limit: Weight, - mut storage_deposit_limit: BalanceOf, + storage_deposit_limit: DepositLimit>, code: Code, data: Vec, salt: Option<[u8; 32]>, @@ -1162,13 +1170,24 @@ where let mut storage_deposit = Default::default(); let mut debug_message = if debug == DebugInfo::UnsafeDebug { Some(DebugBuffer::default()) } else { None }; + + let unchecked_deposit_limit = storage_deposit_limit.is_unchecked(); + let mut storage_deposit_limit = match storage_deposit_limit { + DepositLimit::Balance(limit) => limit, + DepositLimit::Unchecked => BalanceOf::::max_value(), + }; + let try_instantiate = || { let instantiate_account = T::InstantiateOrigin::ensure_origin(origin.clone())?; let (executable, upload_deposit) = match code { Code::Upload(code) => { let upload_account = T::UploadOrigin::ensure_origin(origin)?; - let (executable, upload_deposit) = - Self::try_upload_code(upload_account, code, storage_deposit_limit)?; + let (executable, upload_deposit) = Self::try_upload_code( + upload_account, + code, + storage_deposit_limit, + unchecked_deposit_limit, + )?; storage_deposit_limit.saturating_reduce(upload_deposit); (executable, upload_deposit) }, @@ -1176,8 +1195,12 @@ where (WasmBlob::from_storage(code_hash, &mut gas_meter)?, Default::default()), }; let instantiate_origin = Origin::from_account_id(instantiate_account.clone()); - let mut storage_meter = - StorageMeter::new(&instantiate_origin, storage_deposit_limit, value)?; + let mut storage_meter = if unchecked_deposit_limit { + StorageMeter::new_unchecked(storage_deposit_limit) + } else { + StorageMeter::new(&instantiate_origin, storage_deposit_limit, value)? + }; + let result = ExecStack::>::run_instantiate( instantiate_account, executable, @@ -1186,10 +1209,11 @@ where Self::convert_native_to_evm(value), data, salt.as_ref(), + unchecked_deposit_limit, debug_message.as_mut(), ); storage_deposit = storage_meter - .try_into_deposit(&instantiate_origin)? + .try_into_deposit(&instantiate_origin, unchecked_deposit_limit)? .saturating_add(&StorageDeposit::Charge(upload_deposit)); result }; @@ -1215,28 +1239,15 @@ where /// /// # Parameters /// - /// - `origin`: The origin of the call. - /// - `dest`: The destination address of the call. - /// - `value`: The EVM value to transfer. - /// - `input`: The input data. + /// - `tx`: The Ethereum transaction to simulate. /// - `gas_limit`: The gas limit enforced during contract execution. - /// - `storage_deposit_limit`: The maximum balance that can be charged to the caller for storage - /// usage. /// - `utx_encoded_size`: A function that takes a call and returns the encoded size of the /// unchecked extrinsic. - /// - `debug`: Debugging configuration. - /// - `collect_events`: Event collection configuration. pub fn bare_eth_transact( - origin: T::AccountId, - dest: Option, - value: U256, - input: Vec, + mut tx: GenericTransaction, gas_limit: Weight, - storage_deposit_limit: BalanceOf, utx_encoded_size: impl Fn(Call) -> u32, - debug: DebugInfo, - collect_events: CollectEvents, - ) -> EthContractResult> + ) -> Result>, EthTransactError> where T: pallet_transaction_payment::Config, ::RuntimeCall: @@ -1247,26 +1258,58 @@ where T::Nonce: Into, T::Hash: frame_support::traits::IsType, { - log::debug!(target: LOG_TARGET, "bare_eth_transact: dest: {dest:?} value: {value:?} - gas_limit: {gas_limit:?} storage_deposit_limit: {storage_deposit_limit:?}"); + log::debug!(target: LOG_TARGET, "bare_eth_transact: tx: {tx:?} gas_limit: {gas_limit:?}"); + + let from = tx.from.unwrap_or_default(); + let origin = T::AddressMapper::to_account_id(&from); - // Get the nonce to encode in the tx. - let nonce: T::Nonce = >::account_nonce(&origin); + let storage_deposit_limit = if tx.gas.is_some() { + DepositLimit::Balance(BalanceOf::::max_value()) + } else { + DepositLimit::Unchecked + }; + + // TODO remove once we have revisited how we encode the gas limit. + if tx.nonce.is_none() { + tx.nonce = Some(>::account_nonce(&origin).into()); + } + if tx.gas_price.is_none() { + tx.gas_price = Some(GAS_PRICE.into()); + } + if tx.chain_id.is_none() { + tx.chain_id = Some(T::ChainId::get().into()); + } // Convert the value to the native balance type. - let native_value = match Self::convert_evm_to_native(value) { + let evm_value = tx.value.unwrap_or_default(); + let native_value = match Self::convert_evm_to_native(evm_value) { Ok(v) => v, - Err(err) => - return EthContractResult { - gas_required: Default::default(), - storage_deposit: Default::default(), - fee: Default::default(), - result: Err(err.into()), - }, + Err(_) => return Err(EthTransactError::Message("Failed to convert value".into())), + }; + + let input = tx.input.clone().unwrap_or_default().0; + let debug = DebugInfo::Skip; + let collect_events = CollectEvents::Skip; + + let extract_error = |err| { + if err == Error::::TransferFailed.into() || + err == Error::::StorageDepositNotEnoughFunds.into() || + err == Error::::StorageDepositLimitExhausted.into() + { + let balance = Self::evm_balance(&from); + return Err(EthTransactError::Message( + format!("insufficient funds for gas * price + value: address {from:?} have {balance} (supplied gas {})", + tx.gas.unwrap_or_default())) + ); + } + + return Err(EthTransactError::Message(format!( + "Failed to instantiate contract: {err:?}" + ))); }; // Dry run the call - let (mut result, dispatch_info) = match dest { + let (mut result, dispatch_info) = match tx.to { // A contract call. Some(dest) => { // Dry run the call. @@ -1281,11 +1324,24 @@ where collect_events, ); - let result = EthContractResult { + let data = match result.result { + Ok(return_value) => { + if return_value.did_revert() { + return Err(EthTransactError::Data(return_value.data)); + } + return_value.data + }, + Err(err) => { + log::debug!(target: LOG_TARGET, "Failed to execute call: {err:?}"); + return extract_error(err) + }, + }; + + let result = EthTransactInfo { gas_required: result.gas_required, storage_deposit: result.storage_deposit.charge_or_zero(), - result: result.result, - fee: Default::default(), + data, + eth_gas: Default::default(), }; // Get the dispatch info of the call. let dispatch_call: ::RuntimeCall = crate::Call::::call { @@ -1326,11 +1382,24 @@ where collect_events, ); - let result = EthContractResult { + let returned_data = match result.result { + Ok(return_value) => { + if return_value.result.did_revert() { + return Err(EthTransactError::Data(return_value.result.data)); + } + return_value.result.data + }, + Err(err) => { + log::debug!(target: LOG_TARGET, "Failed to instantiate: {err:?}"); + return extract_error(err) + }, + }; + + let result = EthTransactInfo { gas_required: result.gas_required, storage_deposit: result.storage_deposit.charge_or_zero(), - result: result.result.map(|v| v.result), - fee: Default::default(), + data: returned_data, + eth_gas: Default::default(), }; // Get the dispatch info of the call. @@ -1348,23 +1417,18 @@ where }, }; - let mut tx = TransactionLegacyUnsigned { - value, - input: input.into(), - nonce: nonce.into(), - chain_id: Some(T::ChainId::get().into()), - gas_price: GAS_PRICE.into(), - to: dest, - ..Default::default() - }; - // The transaction fees depend on the extrinsic's length, which in turn is influenced by // the encoded length of the gas limit specified in the transaction (tx.gas). // We iteratively compute the fee by adjusting tx.gas until the fee stabilizes. // with a maximum of 3 iterations to avoid an infinite loop. for _ in 0..3 { + let Ok(unsigned_tx) = tx.clone().try_into_unsigned() else { + log::debug!(target: LOG_TARGET, "Failed to convert to unsigned"); + return Err(EthTransactError::Message("Invalid transaction".into())); + }; + let eth_dispatch_call = crate::Call::::eth_transact { - payload: tx.dummy_signed_payload(), + payload: unsigned_tx.dummy_signed_payload(), gas_limit: result.gas_required, storage_deposit_limit: result.storage_deposit, }; @@ -1375,17 +1439,18 @@ where 0u32.into(), ) .into(); + let eth_gas: U256 = (fee / GAS_PRICE.into()).into(); - if fee == result.fee { - log::trace!(target: LOG_TARGET, "bare_eth_call: encoded_len: {encoded_len:?} fee: {fee:?}"); + if eth_gas == result.eth_gas { + log::trace!(target: LOG_TARGET, "bare_eth_call: encoded_len: {encoded_len:?} eth_gas: {eth_gas:?}"); break; } - result.fee = fee; - tx.gas = (fee / GAS_PRICE.into()).into(); - log::debug!(target: LOG_TARGET, "Adjusting Eth gas to: {:?}", tx.gas); + result.eth_gas = eth_gas; + tx.gas = Some(eth_gas.into()); + log::debug!(target: LOG_TARGET, "Adjusting Eth gas to: {eth_gas:?}"); } - result + Ok(result) } /// Get the balance with EVM decimals of the given `address`. @@ -1403,7 +1468,7 @@ where storage_deposit_limit: BalanceOf, ) -> CodeUploadResult> { let origin = T::UploadOrigin::ensure_origin(origin)?; - let (module, deposit) = Self::try_upload_code(origin, code, storage_deposit_limit)?; + let (module, deposit) = Self::try_upload_code(origin, code, storage_deposit_limit, false)?; Ok(CodeUploadReturnValue { code_hash: *module.code_hash(), deposit }) } @@ -1421,9 +1486,10 @@ where origin: T::AccountId, code: Vec, storage_deposit_limit: BalanceOf, + skip_transfer: bool, ) -> Result<(WasmBlob, BalanceOf), DispatchError> { let mut module = WasmBlob::from_code(code, origin)?; - let deposit = module.store_code()?; + let deposit = module.store_code(skip_transfer)?; ensure!(storage_deposit_limit >= deposit, >::StorageDepositLimitExhausted); Ok((module, deposit)) } @@ -1527,14 +1593,7 @@ sp_api::decl_runtime_apis! { /// Perform an Ethereum call. /// /// See [`crate::Pallet::bare_eth_transact`] - fn eth_transact( - origin: H160, - dest: Option, - value: U256, - input: Vec, - gas_limit: Option, - storage_deposit_limit: Option, - ) -> EthContractResult; + fn eth_transact(tx: GenericTransaction) -> Result, EthTransactError>; /// Upload new code without instantiating a contract from it. /// diff --git a/substrate/frame/revive/src/primitives.rs b/substrate/frame/revive/src/primitives.rs index 024b1f3448e1..a7127f812b4b 100644 --- a/substrate/frame/revive/src/primitives.rs +++ b/substrate/frame/revive/src/primitives.rs @@ -17,8 +17,8 @@ //! A crate that hosts a common definitions that are relevant for the pallet-revive. -use crate::H160; -use alloc::vec::Vec; +use crate::{H160, U256}; +use alloc::{string::String, vec::Vec}; use codec::{Decode, Encode, MaxEncodedLen}; use frame_support::weights::Weight; use pallet_revive_uapi::ReturnFlags; @@ -28,6 +28,30 @@ use sp_runtime::{ DispatchError, RuntimeDebug, }; +#[derive(Clone, Eq, PartialEq, Encode, Decode, RuntimeDebug, TypeInfo)] +pub enum DepositLimit { + /// Allows bypassing all balance transfer checks. + Unchecked, + + /// Specifies a maximum allowable balance for a deposit. + Balance(Balance), +} + +impl DepositLimit { + pub fn is_unchecked(&self) -> bool { + match self { + Self::Unchecked => true, + _ => false, + } + } +} + +impl From for DepositLimit { + fn from(value: T) -> Self { + Self::Balance(value) + } +} + /// Result type of a `bare_call` or `bare_instantiate` call as well as `ContractsApi::call` and /// `ContractsApi::instantiate`. /// @@ -84,15 +108,22 @@ pub struct ContractResult { /// The result of the execution of a `eth_transact` call. #[derive(Clone, Eq, PartialEq, Encode, Decode, RuntimeDebug, TypeInfo)] -pub struct EthContractResult> { - /// The fee charged for the execution. - pub fee: Balance, +pub struct EthTransactInfo { /// The amount of gas that was necessary to execute the transaction. pub gas_required: Weight, /// Storage deposit charged. pub storage_deposit: Balance, - /// The execution result. - pub result: R, + /// The weight and deposit equivalent in EVM Gas. + pub eth_gas: U256, + /// The execution return value. + pub data: Vec, +} + +/// Error type of a `eth_transact` call. +#[derive(Clone, Eq, PartialEq, Encode, Decode, RuntimeDebug, TypeInfo)] +pub enum EthTransactError { + Data(Vec), + Message(String), } /// Result type of a `bare_code_upload` call. diff --git a/substrate/frame/revive/src/storage/meter.rs b/substrate/frame/revive/src/storage/meter.rs index 712010bc8257..6eddf048be98 100644 --- a/substrate/frame/revive/src/storage/meter.rs +++ b/substrate/frame/revive/src/storage/meter.rs @@ -373,24 +373,36 @@ where } } + /// Create new storage meter without checking the limit. + pub fn new_unchecked(limit: BalanceOf) -> Self { + return Self { limit, ..Default::default() } + } + /// The total amount of deposit that should change hands as result of the execution /// that this meter was passed into. This will also perform all the charges accumulated /// in the whole contract stack. /// /// This drops the root meter in order to make sure it is only called when the whole /// execution did finish. - pub fn try_into_deposit(self, origin: &Origin) -> Result, DispatchError> { - // Only refund or charge deposit if the origin is not root. - let origin = match origin { - Origin::Root => return Ok(Deposit::Charge(Zero::zero())), - Origin::Signed(o) => o, - }; - for charge in self.charges.iter().filter(|c| matches!(c.amount, Deposit::Refund(_))) { - E::charge(origin, &charge.contract, &charge.amount, &charge.state)?; - } - for charge in self.charges.iter().filter(|c| matches!(c.amount, Deposit::Charge(_))) { - E::charge(origin, &charge.contract, &charge.amount, &charge.state)?; + pub fn try_into_deposit( + self, + origin: &Origin, + skip_transfer: bool, + ) -> Result, DispatchError> { + if !skip_transfer { + // Only refund or charge deposit if the origin is not root. + let origin = match origin { + Origin::Root => return Ok(Deposit::Charge(Zero::zero())), + Origin::Signed(o) => o, + }; + for charge in self.charges.iter().filter(|c| matches!(c.amount, Deposit::Refund(_))) { + E::charge(origin, &charge.contract, &charge.amount, &charge.state)?; + } + for charge in self.charges.iter().filter(|c| matches!(c.amount, Deposit::Charge(_))) { + E::charge(origin, &charge.contract, &charge.amount, &charge.state)?; + } } + Ok(self.total_deposit) } } @@ -425,13 +437,18 @@ impl> RawMeter { contract: &T::AccountId, contract_info: &mut ContractInfo, code_info: &CodeInfo, + skip_transfer: bool, ) -> Result<(), DispatchError> { debug_assert!(matches!(self.contract_state(), ContractState::Alive)); // We need to make sure that the contract's account exists. let ed = Pallet::::min_balance(); self.total_deposit = Deposit::Charge(ed); - T::Currency::transfer(origin, contract, ed, Preservation::Preserve)?; + if skip_transfer { + T::Currency::set_balance(contract, ed); + } else { + T::Currency::transfer(origin, contract, ed, Preservation::Preserve)?; + } // A consumer is added at account creation and removed it on termination, otherwise the // runtime could remove the account. As long as a contract exists its account must exist. @@ -479,6 +496,7 @@ impl> RawMeter { } if let Deposit::Charge(amount) = total_deposit { if amount > self.limit { + log::debug!( target: LOG_TARGET, "Storage deposit limit exhausted: {:?} > {:?}", amount, self.limit); return Err(>::StorageDepositLimitExhausted.into()) } } @@ -811,7 +829,10 @@ mod tests { nested0.enforce_limit(Some(&mut nested0_info)).unwrap(); meter.absorb(nested0, &BOB, Some(&mut nested0_info)); - assert_eq!(meter.try_into_deposit(&test_case.origin).unwrap(), test_case.deposit); + assert_eq!( + meter.try_into_deposit(&test_case.origin, false).unwrap(), + test_case.deposit + ); assert_eq!(nested0_info.extra_deposit(), 112); assert_eq!(nested1_info.extra_deposit(), 110); @@ -882,7 +903,10 @@ mod tests { nested0.absorb(nested1, &CHARLIE, None); meter.absorb(nested0, &BOB, None); - assert_eq!(meter.try_into_deposit(&test_case.origin).unwrap(), test_case.deposit); + assert_eq!( + meter.try_into_deposit(&test_case.origin, false).unwrap(), + test_case.deposit + ); assert_eq!(TestExtTestValue::get(), test_case.expected) } } diff --git a/substrate/frame/revive/src/test_utils/builder.rs b/substrate/frame/revive/src/test_utils/builder.rs index e64f58894432..8ba5e7384070 100644 --- a/substrate/frame/revive/src/test_utils/builder.rs +++ b/substrate/frame/revive/src/test_utils/builder.rs @@ -18,7 +18,8 @@ use super::{deposit_limit, GAS_LIMIT}; use crate::{ address::AddressMapper, AccountIdOf, BalanceOf, Code, CollectEvents, Config, ContractResult, - DebugInfo, EventRecordOf, ExecReturnValue, InstantiateReturnValue, OriginFor, Pallet, Weight, + DebugInfo, DepositLimit, EventRecordOf, ExecReturnValue, InstantiateReturnValue, OriginFor, + Pallet, Weight, }; use frame_support::pallet_prelude::DispatchResultWithPostInfo; use paste::paste; @@ -133,7 +134,7 @@ builder!( origin: OriginFor, value: BalanceOf, gas_limit: Weight, - storage_deposit_limit: BalanceOf, + storage_deposit_limit: DepositLimit>, code: Code, data: Vec, salt: Option<[u8; 32]>, @@ -159,7 +160,7 @@ builder!( origin, value: 0u32.into(), gas_limit: GAS_LIMIT, - storage_deposit_limit: deposit_limit::(), + storage_deposit_limit: DepositLimit::Balance(deposit_limit::()), code, data: vec![], salt: Some([0; 32]), @@ -198,7 +199,7 @@ builder!( dest: H160, value: BalanceOf, gas_limit: Weight, - storage_deposit_limit: BalanceOf, + storage_deposit_limit: DepositLimit>, data: Vec, debug: DebugInfo, collect_events: CollectEvents, @@ -216,7 +217,7 @@ builder!( dest, value: 0u32.into(), gas_limit: GAS_LIMIT, - storage_deposit_limit: deposit_limit::(), + storage_deposit_limit: DepositLimit::Balance(deposit_limit::()), data: vec![], debug: DebugInfo::UnsafeDebug, collect_events: CollectEvents::Skip, diff --git a/substrate/frame/revive/src/tests.rs b/substrate/frame/revive/src/tests.rs index 34afe8aabfe6..1df300f031a7 100644 --- a/substrate/frame/revive/src/tests.rs +++ b/substrate/frame/revive/src/tests.rs @@ -1249,7 +1249,7 @@ fn transfer_expendable_cannot_kill_account() { test_utils::contract_info_storage_deposit(&addr) ); - // Some ot the total balance is held, so it can't be transferred. + // Some or the total balance is held, so it can't be transferred. assert_err!( <::Currency as Mutate>::transfer( &account, @@ -2290,7 +2290,7 @@ fn gas_estimation_for_subcalls() { // Make the same call using the estimated gas. Should succeed. let result = builder::bare_call(addr_caller) .gas_limit(result_orig.gas_required) - .storage_deposit_limit(result_orig.storage_deposit.charge_or_zero()) + .storage_deposit_limit(result_orig.storage_deposit.charge_or_zero().into()) .data(input.clone()) .build(); assert_ok!(&result.result); @@ -2298,7 +2298,7 @@ fn gas_estimation_for_subcalls() { // Check that it fails with too little ref_time let result = builder::bare_call(addr_caller) .gas_limit(result_orig.gas_required.sub_ref_time(1)) - .storage_deposit_limit(result_orig.storage_deposit.charge_or_zero()) + .storage_deposit_limit(result_orig.storage_deposit.charge_or_zero().into()) .data(input.clone()) .build(); assert_err!(result.result, error); @@ -2306,7 +2306,7 @@ fn gas_estimation_for_subcalls() { // Check that it fails with too little proof_size let result = builder::bare_call(addr_caller) .gas_limit(result_orig.gas_required.sub_proof_size(1)) - .storage_deposit_limit(result_orig.storage_deposit.charge_or_zero()) + .storage_deposit_limit(result_orig.storage_deposit.charge_or_zero().into()) .data(input.clone()) .build(); assert_err!(result.result, error); @@ -3592,7 +3592,7 @@ fn deposit_limit_in_nested_instantiate() { // Set enough deposit limit for the child instantiate. This should succeed. let result = builder::bare_call(addr_caller) .origin(RuntimeOrigin::signed(BOB)) - .storage_deposit_limit(callee_info_len + 2 + ED + 4 + 2) + .storage_deposit_limit((callee_info_len + 2 + ED + 4 + 2).into()) .data((1u32, &code_hash_callee, U256::from(callee_info_len + 2 + ED + 3 + 2)).encode()) .build(); @@ -3879,7 +3879,7 @@ fn locking_delegate_dependency_works() { // Locking a dependency with a storage limit too low should fail. assert_err!( builder::bare_call(addr_caller) - .storage_deposit_limit(dependency_deposit - 1) + .storage_deposit_limit((dependency_deposit - 1).into()) .data((1u32, hash2addr(&callee_hashes[0]), callee_hashes[0]).encode()) .build() .result, diff --git a/substrate/frame/revive/src/tests/test_debug.rs b/substrate/frame/revive/src/tests/test_debug.rs index 7c4fbba71f65..c9e19e52ace1 100644 --- a/substrate/frame/revive/src/tests/test_debug.rs +++ b/substrate/frame/revive/src/tests/test_debug.rs @@ -21,6 +21,7 @@ use crate::{ debug::{CallInterceptor, CallSpan, ExecResult, ExportedFunction, Tracing}, primitives::ExecReturnValue, test_utils::*, + DepositLimit, }; use frame_support::traits::Currency; use pretty_assertions::assert_eq; @@ -114,7 +115,7 @@ fn debugging_works() { RuntimeOrigin::signed(ALICE), 0, GAS_LIMIT, - deposit_limit::(), + DepositLimit::Balance(deposit_limit::()), Code::Upload(wasm), vec![], Some([0u8; 32]), @@ -198,7 +199,7 @@ fn call_interception_works() { RuntimeOrigin::signed(ALICE), 0, GAS_LIMIT, - deposit_limit::(), + deposit_limit::().into(), Code::Upload(wasm), vec![], // some salt to ensure that the address of this contract is unique among all tests diff --git a/substrate/frame/revive/src/wasm/mod.rs b/substrate/frame/revive/src/wasm/mod.rs index d87ec7112286..54fb02c866e1 100644 --- a/substrate/frame/revive/src/wasm/mod.rs +++ b/substrate/frame/revive/src/wasm/mod.rs @@ -183,7 +183,7 @@ where } /// Puts the module blob into storage, and returns the deposit collected for the storage. - pub fn store_code(&mut self) -> Result, Error> { + pub fn store_code(&mut self, skip_transfer: bool) -> Result, Error> { let code_hash = *self.code_hash(); >::mutate(code_hash, |stored_code_info| { match stored_code_info { @@ -195,15 +195,16 @@ where // the `owner` is always the origin of the current transaction. None => { let deposit = self.code_info.deposit; - T::Currency::hold( + + if !skip_transfer { + T::Currency::hold( &HoldReason::CodeUploadDepositReserve.into(), &self.code_info.owner, deposit, - ) - .map_err(|err| { - log::debug!(target: LOG_TARGET, "failed to store code for owner: {:?}: {err:?}", self.code_info.owner); + ) .map_err(|err| { log::debug!(target: LOG_TARGET, "failed to store code for owner: {:?}: {err:?}", self.code_info.owner); >::StorageDepositNotEnoughFunds })?; + } self.code_info.refcount = 0; >::insert(code_hash, &self.code); From c0921339f9d486981b3681760ee83ba9237f2eaa Mon Sep 17 00:00:00 2001 From: "dependabot[bot]" <49699333+dependabot[bot]@users.noreply.github.com> Date: Mon, 2 Dec 2024 07:20:56 +0000 Subject: [PATCH 55/64] Bump the ci_dependencies group across 1 directory with 3 updates (#6516) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Bumps the ci_dependencies group with 3 updates in the / directory: [lycheeverse/lychee-action](https://github.com/lycheeverse/lychee-action), [actions/attest-build-provenance](https://github.com/actions/attest-build-provenance) and [codecov/codecov-action](https://github.com/codecov/codecov-action). Updates `lycheeverse/lychee-action` from 2.0.2 to 2.1.0
Commits

Updates `actions/attest-build-provenance` from 1.4.3 to 1.4.4
Release notes

Sourced from actions/attest-build-provenance's releases.

v1.4.4

What's Changed

Full Changelog: https://github.com/actions/attest-build-provenance/compare/v1.4.3...v1.4.4

Commits
  • ef24412 bump predicate from 1.1.3 to 1.1.4 (#310)
  • 36fa7d0 bump @​actions/attest from 1.4.2 to 1.5.0 (#309)
  • 390c0bb Bump @​types/node from 22.8.1 to 22.8.7 in the npm-development group (#305)
  • 21da615 Bump the npm-development group with 3 updates (#299)
  • 0704961 Bump actions/publish-immutable-action in the actions-minor group (#298)
  • d01b070 Bump the npm-development group with 3 updates (#278)
  • b1d65e4 Add workflow file for publishing releases to immutable action package (#277)
  • 3a27694 Bump @​actions/core from 1.10.1 to 1.11.1 (#275)
  • dff1ae6 prevent e2e workflows on forks (#272)
  • e5892d0 Bump the npm-development group with 3 updates (#263)
  • Additional commits viewable in compare view

Updates `codecov/codecov-action` from 4 to 5
Release notes

Sourced from codecov/codecov-action's releases.

v5.0.0

v5 Release

v5 of the Codecov GitHub Action will use the Codecov Wrapper to encapsulate the CLI. This will help ensure that the Action gets updates quicker.

Migration Guide

The v5 release also coincides with the opt-out feature for tokens for public repositories. In the Global Upload Token section of the settings page of an organization in codecov.io, you can set the ability for Codecov to receive a coverage reports from any source. This will allow contributors or other members of a repository to upload without needing access to the Codecov token. For more details see how to upload without a token.

[!WARNING]
The following arguments have been changed

  • file (this has been deprecated in favor of files)
  • plugin (this has been deprecated in favor of plugins)

The following arguments have been added:

  • binary
  • gcov_args
  • gcov_executable
  • gcov_ignore
  • gcov_include
  • report_type
  • skip_validation
  • swift_project

You can see their usage in the action.yml file.

What's Changed

... (truncated)

Changelog

Sourced from codecov/codecov-action's changelog.

4.0.0-beta.2

Fixes

  • #1085 not adding -n if empty to do-upload command

4.0.0-beta.1

v4 represents a move from the universal uploader to the Codecov CLI. Although this will unlock new features for our users, the CLI is not yet at feature parity with the universal uploader.

Breaking Changes

  • No current support for aarch64 and alpine architectures.
  • Tokenless uploading is unsuported
  • Various arguments to the Action have been removed

3.1.4

Fixes

  • #967 Fix typo in README.md
  • #971 fix: add back in working dir
  • #969 fix: CLI option names for uploader

Dependencies

  • #970 build(deps-dev): bump @​types/node from 18.15.12 to 18.16.3
  • #979 build(deps-dev): bump @​types/node from 20.1.0 to 20.1.2
  • #981 build(deps-dev): bump @​types/node from 20.1.2 to 20.1.4

3.1.3

Fixes

  • #960 fix: allow for aarch64 build

Dependencies

  • #957 build(deps-dev): bump jest-junit from 15.0.0 to 16.0.0
  • #958 build(deps): bump openpgp from 5.7.0 to 5.8.0
  • #959 build(deps-dev): bump @​types/node from 18.15.10 to 18.15.12

3.1.2

Fixes

  • #718 Update README.md
  • #851 Remove unsupported path_to_write_report argument
  • #898 codeql-analysis.yml
  • #901 Update README to contain correct information - inputs and negate feature
  • #955 fix: add in all the extra arguments for uploader

Dependencies

  • #819 build(deps): bump openpgp from 5.4.0 to 5.5.0
  • #835 build(deps): bump node-fetch from 3.2.4 to 3.2.10
  • #840 build(deps): bump ossf/scorecard-action from 1.1.1 to 2.0.4
  • #841 build(deps): bump @​actions/core from 1.9.1 to 1.10.0
  • #843 build(deps): bump @​actions/github from 5.0.3 to 5.1.1
  • #869 build(deps): bump node-fetch from 3.2.10 to 3.3.0
  • #872 build(deps-dev): bump jest-junit from 13.2.0 to 15.0.0
  • #879 build(deps): bump decode-uri-component from 0.2.0 to 0.2.2

... (truncated)

Commits

Dependabot will resolve any conflicts with this PR as long as you don't alter it yourself. You can also trigger a rebase manually by commenting `@dependabot rebase`. [//]: # (dependabot-automerge-start) [//]: # (dependabot-automerge-end) ---
Dependabot commands and options
You can trigger Dependabot actions by commenting on this PR: - `@dependabot rebase` will rebase this PR - `@dependabot recreate` will recreate this PR, overwriting any edits that have been made to it - `@dependabot merge` will merge this PR after your CI passes on it - `@dependabot squash and merge` will squash and merge this PR after your CI passes on it - `@dependabot cancel merge` will cancel a previously requested merge and block automerging - `@dependabot reopen` will reopen this PR if it is closed - `@dependabot close` will close this PR and stop Dependabot recreating it. You can achieve the same result by closing it manually - `@dependabot show ignore conditions` will show all of the ignore conditions of the specified dependency - `@dependabot ignore major version` will close this group update PR and stop Dependabot creating any more for the specific dependency's major version (unless you unignore this specific dependency's major version or upgrade to it yourself) - `@dependabot ignore minor version` will close this group update PR and stop Dependabot creating any more for the specific dependency's minor version (unless you unignore this specific dependency's minor version or upgrade to it yourself) - `@dependabot ignore ` will close this group update PR and stop Dependabot creating any more for the specific dependency (unless you unignore this specific dependency or upgrade to it yourself) - `@dependabot unignore ` will remove all of the ignore conditions of the specified dependency - `@dependabot unignore ` will remove the ignore condition of the specified dependency and ignore conditions
Signed-off-by: dependabot[bot] Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> --- .github/workflows/check-links.yml | 2 +- .github/workflows/release-reusable-rc-buid.yml | 6 +++--- .github/workflows/tests-linux-stable-coverage.yml | 2 +- 3 files changed, 5 insertions(+), 5 deletions(-) diff --git a/.github/workflows/check-links.yml b/.github/workflows/check-links.yml index dd9d3eaf824f..cea6b9a8636a 100644 --- a/.github/workflows/check-links.yml +++ b/.github/workflows/check-links.yml @@ -33,7 +33,7 @@ jobs: - uses: actions/checkout@6d193bf28034eafb982f37bd894289fe649468fc # v4.1.0 (22. Sep 2023) - name: Lychee link checker - uses: lycheeverse/lychee-action@7cd0af4c74a61395d455af97419279d86aafaede # for v1.9.1 (10. Jan 2024) + uses: lycheeverse/lychee-action@f81112d0d2814ded911bd23e3beaa9dda9093915 # for v1.9.1 (10. Jan 2024) with: args: >- --config .config/lychee.toml diff --git a/.github/workflows/release-reusable-rc-buid.yml b/.github/workflows/release-reusable-rc-buid.yml index 7e31a4744b59..f5240878cba2 100644 --- a/.github/workflows/release-reusable-rc-buid.yml +++ b/.github/workflows/release-reusable-rc-buid.yml @@ -104,7 +104,7 @@ jobs: ./.github/scripts/release/build-linux-release.sh ${{ matrix.binaries }} ${{ inputs.package }} - name: Generate artifact attestation - uses: actions/attest-build-provenance@1c608d11d69870c2092266b3f9a6f3abbf17002c # v1.4.3 + uses: actions/attest-build-provenance@ef244123eb79f2f7a7e75d99086184180e6d0018 # v1.4.4 with: subject-path: /artifacts/${{ matrix.binaries }}/${{ matrix.binaries }} @@ -220,7 +220,7 @@ jobs: ./.github/scripts/release/build-macos-release.sh ${{ matrix.binaries }} ${{ inputs.package }} - name: Generate artifact attestation - uses: actions/attest-build-provenance@1c608d11d69870c2092266b3f9a6f3abbf17002c # v1.4.3 + uses: actions/attest-build-provenance@ef244123eb79f2f7a7e75d99086184180e6d0018 # v1.4.4 with: subject-path: ${{ env.ARTIFACTS_PATH }}/${{ matrix.binaries }} @@ -278,7 +278,7 @@ jobs: . "${GITHUB_WORKSPACE}"/.github/scripts/release/build-deb.sh ${{ inputs.package }} ${VERSION} - name: Generate artifact attestation - uses: actions/attest-build-provenance@1c608d11d69870c2092266b3f9a6f3abbf17002c # v1.4.3 + uses: actions/attest-build-provenance@ef244123eb79f2f7a7e75d99086184180e6d0018 # v1.4.4 with: subject-path: target/production/*.deb diff --git a/.github/workflows/tests-linux-stable-coverage.yml b/.github/workflows/tests-linux-stable-coverage.yml index c5af6bcae77f..61e01cda4428 100644 --- a/.github/workflows/tests-linux-stable-coverage.yml +++ b/.github/workflows/tests-linux-stable-coverage.yml @@ -102,7 +102,7 @@ jobs: merge-multiple: true - run: ls -al reports/ - name: Upload to Codecov - uses: codecov/codecov-action@v4 + uses: codecov/codecov-action@v5 with: token: ${{ secrets.CODECOV_TOKEN }} verbose: true From 0845044454c005b577eab7afaea18583bd7e3dd3 Mon Sep 17 00:00:00 2001 From: clangenb <37865735+clangenb@users.noreply.github.com> Date: Mon, 2 Dec 2024 17:07:21 +0100 Subject: [PATCH 56/64] migrate pallet-session-benchmarking to bench V2 syntax (#6294) Migrates pallet-session-benchmarking to bench V2 syntax. Part of: * #6202 --------- Co-authored-by: Shawn Tabrizi Co-authored-by: Giuseppe Re --- .../frame/session/benchmarking/src/inner.rs | 68 ++++++++++++------- .../frame/session/benchmarking/src/mock.rs | 6 +- 2 files changed, 48 insertions(+), 26 deletions(-) diff --git a/substrate/frame/session/benchmarking/src/inner.rs b/substrate/frame/session/benchmarking/src/inner.rs index 9ba47b34ed7a..9789b6bb593d 100644 --- a/substrate/frame/session/benchmarking/src/inner.rs +++ b/substrate/frame/session/benchmarking/src/inner.rs @@ -22,7 +22,7 @@ use alloc::{vec, vec::Vec}; use sp_runtime::traits::{One, StaticLookup, TrailingZeroInput}; use codec::Decode; -use frame_benchmarking::v1::benchmarks; +use frame_benchmarking::v2::*; use frame_support::traits::{Get, KeyOwnerProofSystem, OnInitialize}; use frame_system::{pallet_prelude::BlockNumberFor, RawOrigin}; use pallet_session::{historical::Pallet as Historical, Pallet as Session, *}; @@ -45,8 +45,12 @@ impl OnInitialize> for Pallet { } } -benchmarks! { - set_keys { +#[benchmarks] +mod benchmarks { + use super::*; + + #[benchmark] + fn set_keys() -> Result<(), BenchmarkError> { let n = MaxNominationsOf::::get(); let (v_stash, _) = create_validator_with_nominators::( n, @@ -58,13 +62,19 @@ benchmarks! { let v_controller = pallet_staking::Pallet::::bonded(&v_stash).ok_or("not stash")?; let keys = T::Keys::decode(&mut TrailingZeroInput::zeroes()).unwrap(); - let proof: Vec = vec![0,1,2,3]; + let proof: Vec = vec![0, 1, 2, 3]; // Whitelist controller account from further DB operations. let v_controller_key = frame_system::Account::::hashed_key_for(&v_controller); frame_benchmarking::benchmarking::add_to_whitelist(v_controller_key.into()); - }: _(RawOrigin::Signed(v_controller), keys, proof) - purge_keys { + #[extrinsic_call] + _(RawOrigin::Signed(v_controller), keys, proof); + + Ok(()) + } + + #[benchmark] + fn purge_keys() -> Result<(), BenchmarkError> { let n = MaxNominationsOf::::get(); let (v_stash, _) = create_validator_with_nominators::( n, @@ -75,30 +85,33 @@ benchmarks! { )?; let v_controller = pallet_staking::Pallet::::bonded(&v_stash).ok_or("not stash")?; let keys = T::Keys::decode(&mut TrailingZeroInput::zeroes()).unwrap(); - let proof: Vec = vec![0,1,2,3]; + let proof: Vec = vec![0, 1, 2, 3]; Session::::set_keys(RawOrigin::Signed(v_controller.clone()).into(), keys, proof)?; // Whitelist controller account from further DB operations. let v_controller_key = frame_system::Account::::hashed_key_for(&v_controller); frame_benchmarking::benchmarking::add_to_whitelist(v_controller_key.into()); - }: _(RawOrigin::Signed(v_controller)) - #[extra] - check_membership_proof_current_session { - let n in 2 .. MAX_VALIDATORS as u32; + #[extrinsic_call] + _(RawOrigin::Signed(v_controller)); + Ok(()) + } + + #[benchmark(extra)] + fn check_membership_proof_current_session(n: Linear<2, MAX_VALIDATORS>) { let (key, key_owner_proof1) = check_membership_proof_setup::(n); let key_owner_proof2 = key_owner_proof1.clone(); - }: { - Historical::::check_proof(key, key_owner_proof1); - } - verify { + + #[block] + { + Historical::::check_proof(key, key_owner_proof1); + } + assert!(Historical::::check_proof(key, key_owner_proof2).is_some()); } - #[extra] - check_membership_proof_historical_session { - let n in 2 .. MAX_VALIDATORS as u32; - + #[benchmark(extra)] + fn check_membership_proof_historical_session(n: Linear<2, MAX_VALIDATORS>) { let (key, key_owner_proof1) = check_membership_proof_setup::(n); // skip to the next session so that the session is historical @@ -106,14 +119,21 @@ benchmarks! { Session::::rotate_session(); let key_owner_proof2 = key_owner_proof1.clone(); - }: { - Historical::::check_proof(key, key_owner_proof1); - } - verify { + + #[block] + { + Historical::::check_proof(key, key_owner_proof1); + } + assert!(Historical::::check_proof(key, key_owner_proof2).is_some()); } - impl_benchmark_test_suite!(Pallet, crate::mock::new_test_ext(), crate::mock::Test, extra = false); + impl_benchmark_test_suite!( + Pallet, + crate::mock::new_test_ext(), + crate::mock::Test, + extra = false + ); } /// Sets up the benchmark for checking a membership proof. It creates the given diff --git a/substrate/frame/session/benchmarking/src/mock.rs b/substrate/frame/session/benchmarking/src/mock.rs index 2aec58cceded..346cd04c0fa9 100644 --- a/substrate/frame/session/benchmarking/src/mock.rs +++ b/substrate/frame/session/benchmarking/src/mock.rs @@ -27,7 +27,7 @@ use frame_support::{ derive_impl, parameter_types, traits::{ConstU32, ConstU64}, }; -use sp_runtime::{traits::IdentityLookup, BuildStorage}; +use sp_runtime::{traits::IdentityLookup, BuildStorage, KeyTypeId}; type AccountId = u64; type Nonce = u32; @@ -42,6 +42,7 @@ frame_support::construct_runtime!( Balances: pallet_balances, Staking: pallet_staking, Session: pallet_session, + Historical: pallet_session::historical } ); @@ -79,7 +80,8 @@ sp_runtime::impl_opaque_keys! { pub struct TestSessionHandler; impl pallet_session::SessionHandler for TestSessionHandler { - const KEY_TYPE_IDS: &'static [sp_runtime::KeyTypeId] = &[]; + // corresponds to the opaque key id above + const KEY_TYPE_IDS: &'static [KeyTypeId] = &[KeyTypeId([100u8, 117u8, 109u8, 121u8])]; fn on_genesis_session(_validators: &[(AccountId, Ks)]) {} From 3d8da815ecd12b8f04daf87d6ffba5ec4a181806 Mon Sep 17 00:00:00 2001 From: clangenb <37865735+clangenb@users.noreply.github.com> Date: Mon, 2 Dec 2024 17:36:52 +0100 Subject: [PATCH 57/64] migrate pallet-offences-benchmarking to benchmark v2 syntax (#6300) Migrates pallet-offences-benchmarking to benchmark v2 syntax. Part of: * #6202 --------- Co-authored-by: Giuseppe Re --- .../frame/offences/benchmarking/src/inner.rs | 107 +++++++++++------- .../frame/offences/benchmarking/src/mock.rs | 5 +- 2 files changed, 66 insertions(+), 46 deletions(-) diff --git a/substrate/frame/offences/benchmarking/src/inner.rs b/substrate/frame/offences/benchmarking/src/inner.rs index 573114de0742..75f3e9931e34 100644 --- a/substrate/frame/offences/benchmarking/src/inner.rs +++ b/substrate/frame/offences/benchmarking/src/inner.rs @@ -19,7 +19,7 @@ use alloc::{vec, vec::Vec}; -use frame_benchmarking::v1::{account, benchmarks}; +use frame_benchmarking::v2::*; use frame_support::traits::Get; use frame_system::{Config as SystemConfig, Pallet as System, RawOrigin}; @@ -144,7 +144,7 @@ fn create_offender(n: u32, nominators: u32) -> Result, &' fn make_offenders( num_offenders: u32, num_nominators: u32, -) -> Result<(Vec>, Vec>), &'static str> { +) -> Result>, &'static str> { Staking::::new_session(0); let mut offenders = vec![]; @@ -167,21 +167,50 @@ fn make_offenders( .expect("failed to convert validator id to full identification") }) .collect::>>(); - Ok((id_tuples, offenders)) + Ok(id_tuples) } -benchmarks! { - where_clause { - where +#[cfg(test)] +fn assert_all_slashes_applied(offender_count: usize) +where + T: Config, + ::RuntimeEvent: TryInto>, + ::RuntimeEvent: TryInto>, + ::RuntimeEvent: TryInto, + ::RuntimeEvent: TryInto>, +{ + // make sure that all slashes have been applied + // (n nominators + one validator) * (slashed + unlocked) + deposit to reporter + + // reporter account endowed + some funds rescinded from issuance. + assert_eq!( + System::::read_events_for_pallet::>().len(), + 2 * (offender_count + 1) + 3 + ); + // (n nominators + one validator) * slashed + Slash Reported + assert_eq!( + System::::read_events_for_pallet::>().len(), + 1 * (offender_count + 1) + 1 + ); + // offence + assert_eq!(System::::read_events_for_pallet::().len(), 1); + // reporter new account + assert_eq!(System::::read_events_for_pallet::>().len(), 1); +} + +#[benchmarks( + where ::RuntimeEvent: TryInto>, ::RuntimeEvent: TryInto>, ::RuntimeEvent: TryInto, ::RuntimeEvent: TryInto>, - } - - report_offence_grandpa { - let n in 0 .. MAX_NOMINATORS.min(MaxNominationsOf::::get()); - +)] +mod benchmarks { + use super::*; + + #[benchmark] + pub fn report_offence_grandpa( + n: Linear<0, { MAX_NOMINATORS.min(MaxNominationsOf::::get()) }>, + ) -> Result<(), BenchmarkError> { // for grandpa equivocation reports the number of reporters // and offenders is always 1 let reporters = vec![account("reporter", 1, SEED)]; @@ -189,7 +218,7 @@ benchmarks! { // make sure reporters actually get rewarded Staking::::set_slash_reward_fraction(Perbill::one()); - let (mut offenders, raw_offenders) = make_offenders::(1, n)?; + let mut offenders = make_offenders::(1, n)?; let validator_set_count = Session::::validators().len() as u32; let offence = GrandpaEquivocationOffence { @@ -199,28 +228,24 @@ benchmarks! { offender: T::convert(offenders.pop().unwrap()), }; assert_eq!(System::::event_count(), 0); - }: { - let _ = Offences::::report_offence(reporters, offence); - } - verify { + + #[block] + { + let _ = Offences::::report_offence(reporters, offence); + } + #[cfg(test)] { - // make sure that all slashes have been applied - // (n nominators + one validator) * (slashed + unlocked) + deposit to reporter + reporter - // account endowed + some funds rescinded from issuance. - assert_eq!(System::::read_events_for_pallet::>().len(), 2 * (n + 1) as usize + 3); - // (n nominators + one validator) * slashed + Slash Reported - assert_eq!(System::::read_events_for_pallet::>().len(), 1 * (n + 1) as usize + 1); - // offence - assert_eq!(System::::read_events_for_pallet::().len(), 1); - // reporter new account - assert_eq!(System::::read_events_for_pallet::>().len(), 1); + assert_all_slashes_applied::(n as usize); } - } - report_offence_babe { - let n in 0 .. MAX_NOMINATORS.min(MaxNominationsOf::::get()); + Ok(()) + } + #[benchmark] + fn report_offence_babe( + n: Linear<0, { MAX_NOMINATORS.min(MaxNominationsOf::::get()) }>, + ) -> Result<(), BenchmarkError> { // for babe equivocation reports the number of reporters // and offenders is always 1 let reporters = vec![account("reporter", 1, SEED)]; @@ -228,7 +253,7 @@ benchmarks! { // make sure reporters actually get rewarded Staking::::set_slash_reward_fraction(Perbill::one()); - let (mut offenders, raw_offenders) = make_offenders::(1, n)?; + let mut offenders = make_offenders::(1, n)?; let validator_set_count = Session::::validators().len() as u32; let offence = BabeEquivocationOffence { @@ -238,23 +263,17 @@ benchmarks! { offender: T::convert(offenders.pop().unwrap()), }; assert_eq!(System::::event_count(), 0); - }: { - let _ = Offences::::report_offence(reporters, offence); - } - verify { + + #[block] + { + let _ = Offences::::report_offence(reporters, offence); + } #[cfg(test)] { - // make sure that all slashes have been applied - // (n nominators + one validator) * (slashed + unlocked) + deposit to reporter + reporter - // account endowed + some funds rescinded from issuance. - assert_eq!(System::::read_events_for_pallet::>().len(), 2 * (n + 1) as usize + 3); - // (n nominators + one validator) * slashed + Slash Reported - assert_eq!(System::::read_events_for_pallet::>().len(), 1 * (n + 1) as usize + 1); - // offence - assert_eq!(System::::read_events_for_pallet::().len(), 1); - // reporter new account - assert_eq!(System::::read_events_for_pallet::>().len(), 1); + assert_all_slashes_applied::(n as usize); } + + Ok(()) } impl_benchmark_test_suite!(Pallet, crate::mock::new_test_ext(), crate::mock::Test); diff --git a/substrate/frame/offences/benchmarking/src/mock.rs b/substrate/frame/offences/benchmarking/src/mock.rs index efaec49a65b3..c5c178aa4443 100644 --- a/substrate/frame/offences/benchmarking/src/mock.rs +++ b/substrate/frame/offences/benchmarking/src/mock.rs @@ -29,7 +29,7 @@ use frame_system as system; use pallet_session::historical as pallet_session_historical; use sp_runtime::{ testing::{Header, UintAuthorityId}, - BuildStorage, Perbill, + BuildStorage, KeyTypeId, Perbill, }; type AccountId = u64; @@ -66,7 +66,8 @@ sp_runtime::impl_opaque_keys! { pub struct TestSessionHandler; impl pallet_session::SessionHandler for TestSessionHandler { - const KEY_TYPE_IDS: &'static [sp_runtime::KeyTypeId] = &[]; + // corresponds to the opaque key id above + const KEY_TYPE_IDS: &'static [KeyTypeId] = &[KeyTypeId([100u8, 117u8, 109u8, 121u8])]; fn on_genesis_session(_validators: &[(AccountId, Ks)]) {} From 8f1606e9f9bd6269a4c2631a161dcc73e969a302 Mon Sep 17 00:00:00 2001 From: Serban Iorga Date: Tue, 3 Dec 2024 12:55:50 +0200 Subject: [PATCH 58/64] Rococo People <> Bulletin bridge fixes (#6708) --- .../chains/chain-polkadot-bulletin/src/lib.rs | 2 +- bridges/relays/utils/src/initialize.rs | 7 ++-- .../src/bridge_to_bulletin_config.rs | 41 ++++--------------- .../src/genesis_config_presets.rs | 10 +++++ .../bridge-hubs/bridge-hub-rococo/src/lib.rs | 1 - .../bridge-hub-rococo/tests/tests.rs | 12 +++--- 6 files changed, 28 insertions(+), 45 deletions(-) diff --git a/bridges/chains/chain-polkadot-bulletin/src/lib.rs b/bridges/chains/chain-polkadot-bulletin/src/lib.rs index c5c18beb2cad..070bc7b0ba3d 100644 --- a/bridges/chains/chain-polkadot-bulletin/src/lib.rs +++ b/bridges/chains/chain-polkadot-bulletin/src/lib.rs @@ -225,4 +225,4 @@ impl ChainWithMessages for PolkadotBulletin { } decl_bridge_finality_runtime_apis!(polkadot_bulletin, grandpa); -decl_bridge_messages_runtime_apis!(polkadot_bulletin, bp_messages::HashedLaneId); +decl_bridge_messages_runtime_apis!(polkadot_bulletin, bp_messages::LegacyLaneId); diff --git a/bridges/relays/utils/src/initialize.rs b/bridges/relays/utils/src/initialize.rs index 564ed1f0e5cc..deb9b9d059d5 100644 --- a/bridges/relays/utils/src/initialize.rs +++ b/bridges/relays/utils/src/initialize.rs @@ -52,9 +52,10 @@ pub fn initialize_logger(with_timestamp: bool) { format, ); - let env_filter = EnvFilter::from_default_env() - .add_directive(Level::WARN.into()) - .add_directive("bridge=info".parse().expect("static filter string is valid")); + let env_filter = EnvFilter::builder() + .with_default_directive(Level::WARN.into()) + .with_default_directive("bridge=info".parse().expect("static filter string is valid")) + .from_env_lossy(); let builder = SubscriberBuilder::default().with_env_filter(env_filter); diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_bulletin_config.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_bulletin_config.rs index b284fa9e7af7..1e733503f43b 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_bulletin_config.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/bridge_to_bulletin_config.rs @@ -22,14 +22,13 @@ use crate::{ bridge_common_config::RelayersForPermissionlessLanesInstance, weights, xcm_config::UniversalLocation, AccountId, Balance, Balances, BridgeRococoBulletinGrandpa, - BridgeRococoBulletinMessages, PolkadotXcm, Runtime, RuntimeEvent, RuntimeHoldReason, - XcmOverRococoBulletin, XcmRouter, + BridgeRococoBulletinMessages, Runtime, RuntimeEvent, RuntimeHoldReason, XcmOverRococoBulletin, + XcmRouter, }; use bp_messages::{ source_chain::FromBridgedChainMessagesDeliveryProof, - target_chain::FromBridgedChainMessagesProof, HashedLaneId, + target_chain::FromBridgedChainMessagesProof, LegacyLaneId, }; -use bridge_hub_common::xcm_version::XcmVersionOfDestAndRemoteBridge; use frame_support::{ parameter_types, @@ -46,6 +45,7 @@ use testnet_parachains_constants::rococo::currency::UNITS as ROC; use xcm::{ latest::prelude::*, prelude::{InteriorLocation, NetworkId}, + AlwaysV5, }; use xcm_builder::{BridgeBlobDispatcher, ParentIsPreset, SiblingParachainConvertsVia}; @@ -120,7 +120,7 @@ impl pallet_bridge_messages::Config for Runt type OutboundPayload = XcmAsPlainPayload; type InboundPayload = XcmAsPlainPayload; - type LaneId = HashedLaneId; + type LaneId = LegacyLaneId; type DeliveryPayments = (); type DeliveryConfirmationPayments = (); @@ -139,8 +139,7 @@ impl pallet_xcm_bridge_hub::Config for Runtime type BridgeMessagesPalletInstance = WithRococoBulletinMessagesInstance; type MessageExportPrice = (); - type DestinationVersion = - XcmVersionOfDestAndRemoteBridge; + type DestinationVersion = AlwaysV5; type ForceOrigin = EnsureRoot; // We don't want to allow creating bridges for this instance. @@ -253,7 +252,7 @@ where let universal_source = [GlobalConsensus(ByGenesis(ROCOCO_GENESIS_HASH)), Parachain(sibling_para_id)].into(); let universal_destination = - [GlobalConsensus(RococoBulletinGlobalConsensusNetwork::get()), Parachain(2075)].into(); + [GlobalConsensus(RococoBulletinGlobalConsensusNetwork::get())].into(); let bridge_id = BridgeId::new(&universal_source, &universal_destination); // insert only bridge metadata, because the benchmarks create lanes @@ -279,29 +278,3 @@ where universal_source } - -/// Contains the migration for the PeopleRococo<>RococoBulletin bridge. -pub mod migration { - use super::*; - use frame_support::traits::ConstBool; - - parameter_types! { - pub BulletinRococoLocation: InteriorLocation = [GlobalConsensus(RococoBulletinGlobalConsensusNetwork::get())].into(); - pub RococoPeopleToRococoBulletinMessagesLane: HashedLaneId = pallet_xcm_bridge_hub::Pallet::< Runtime, XcmOverPolkadotBulletinInstance >::bridge_locations( - PeopleRococoLocation::get(), - BulletinRococoLocation::get() - ) - .unwrap() - .calculate_lane_id(xcm::latest::VERSION).expect("Valid locations"); - } - - /// Ensure that the existing lanes for the People<>Bulletin bridge are correctly configured. - pub type StaticToDynamicLanes = pallet_xcm_bridge_hub::migration::OpenBridgeForLane< - Runtime, - XcmOverPolkadotBulletinInstance, - RococoPeopleToRococoBulletinMessagesLane, - ConstBool, - PeopleRococoLocation, - BulletinRococoLocation, - >; -} diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/genesis_config_presets.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/genesis_config_presets.rs index 98e2450ee832..55fd499c2f54 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/genesis_config_presets.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/genesis_config_presets.rs @@ -61,10 +61,20 @@ fn bridge_hub_rococo_genesis( .collect(), }, polkadot_xcm: PolkadotXcmConfig { safe_xcm_version: Some(SAFE_XCM_VERSION) }, + bridge_polkadot_bulletin_grandpa: BridgePolkadotBulletinGrandpaConfig { + owner: bridges_pallet_owner.clone(), + }, bridge_westend_grandpa: BridgeWestendGrandpaConfig { owner: bridges_pallet_owner.clone() }, bridge_westend_messages: BridgeWestendMessagesConfig { owner: bridges_pallet_owner.clone(), }, + xcm_over_polkadot_bulletin: XcmOverPolkadotBulletinConfig { + opened_bridges: vec![( + Location::new(1, [Parachain(1004)]), + Junctions::from([GlobalConsensus(NetworkId::PolkadotBulletin).into()]), + Some(bp_messages::LegacyLaneId([0, 0, 0, 0])), + )], + }, xcm_over_bridge_hub_westend: XcmOverBridgeHubWestendConfig { opened_bridges }, ethereum_system: EthereumSystemConfig { para_id: id, asset_hub_para_id }, }) diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs index 598afeddb984..d87ff9b43fef 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/src/lib.rs @@ -169,7 +169,6 @@ pub type Migrations = ( bridge_to_westend_config::WithBridgeHubWestendMessagesInstance, >, bridge_to_westend_config::migration::StaticToDynamicLanes, - bridge_to_bulletin_config::migration::StaticToDynamicLanes, frame_support::migrations::RemoveStorage< BridgeWestendMessagesPalletName, OutboundLanesCongestedSignalsKey, diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs index 29f9615bff6a..44e69c31a560 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/tests/tests.rs @@ -501,10 +501,10 @@ mod bridge_hub_westend_tests { mod bridge_hub_bulletin_tests { use super::*; - use bp_messages::{HashedLaneId, LaneIdType}; + use bp_messages::LegacyLaneId; use bridge_common_config::BridgeGrandpaRococoBulletinInstance; use bridge_hub_rococo_runtime::{ - bridge_common_config::RelayersForPermissionlessLanesInstance, + bridge_common_config::RelayersForLegacyLaneIdsMessagesInstance, xcm_config::LocationToAccountId, }; use bridge_hub_test_utils::test_cases::from_grandpa_chain; @@ -528,7 +528,7 @@ mod bridge_hub_bulletin_tests { AllPalletsWithoutSystem, BridgeGrandpaRococoBulletinInstance, WithRococoBulletinMessagesInstance, - RelayersForPermissionlessLanesInstance, + RelayersForLegacyLaneIdsMessagesInstance, >; #[test] @@ -599,7 +599,7 @@ mod bridge_hub_bulletin_tests { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverPolkadotBulletinInstance - >(locations, HashedLaneId::try_new(1, 2).unwrap()) + >(locations, LegacyLaneId([0, 0, 0, 0])) } ).1 }, @@ -663,7 +663,7 @@ mod bridge_hub_bulletin_tests { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverPolkadotBulletinInstance, - >(locations, HashedLaneId::try_new(1, 2).unwrap()) + >(locations, LegacyLaneId([0, 0, 0, 0])) }, ) .1 @@ -697,7 +697,7 @@ mod bridge_hub_bulletin_tests { bridge_hub_test_utils::open_bridge_with_storage::< Runtime, XcmOverPolkadotBulletinInstance, - >(locations, HashedLaneId::try_new(1, 2).unwrap()) + >(locations, LegacyLaneId([0, 0, 0, 0])) }, ) .1 From 592bb3205be7569cf2d705b31a272340038bbed7 Mon Sep 17 00:00:00 2001 From: Egor_P Date: Tue, 3 Dec 2024 13:06:43 +0100 Subject: [PATCH 59/64] [Release/CICD] Re-worked Create Release Draft flow (#6734) This PR contains following changes in release pipelines: - re-built Create Release Draft workflow - binaries builds are moved completely to the `Release - Build node release candidate` flow - added upload of all the release artefacts to the S3 - adjusted `Release - Publish Docker Image` workflow, so that it will match now the new release flow. --- .github/scripts/common/lib.sh | 45 +++- .github/scripts/release/release_lib.sh | 22 ++ ...le.yml => release-10_branchoff-stable.yml} | 0 ...ation.yml => release-11_rc-automation.yml} | 0 ...e-build-rc.yml => release-20_build-rc.yml} | 96 +++++++- .../release-30_publish_release_draft.yml | 206 +++++++++++------- .../workflows/release-50_publish-docker.yml | 97 +++------ .../workflows/release-reusable-rc-buid.yml | 53 ++++- .github/workflows/release-srtool.yml | 18 +- 9 files changed, 373 insertions(+), 164 deletions(-) rename .github/workflows/{release-branchoff-stable.yml => release-10_branchoff-stable.yml} (100%) rename .github/workflows/{release-10_rc-automation.yml => release-11_rc-automation.yml} (100%) rename .github/workflows/{release-build-rc.yml => release-20_build-rc.yml} (62%) diff --git a/.github/scripts/common/lib.sh b/.github/scripts/common/lib.sh index 6b8f70a26d7e..41dc0ba06dd2 100755 --- a/.github/scripts/common/lib.sh +++ b/.github/scripts/common/lib.sh @@ -270,20 +270,19 @@ fetch_debian_package_from_s3() { } # Fetch the release artifacts like binary and signatures from S3. Assumes the ENV are set: -# - RELEASE_ID -# - GITHUB_TOKEN -# - REPO in the form paritytech/polkadot +# inputs: binary (polkadot), target(aarch64-apple-darwin) fetch_release_artifacts_from_s3() { BINARY=$1 - OUTPUT_DIR=${OUTPUT_DIR:-"./release-artifacts/${BINARY}"} + TARGET=$2 + OUTPUT_DIR=${OUTPUT_DIR:-"./release-artifacts/${TARGET}/${BINARY}"} echo "OUTPUT_DIR : $OUTPUT_DIR" URL_BASE=$(get_s3_url_base $BINARY) echo "URL_BASE=$URL_BASE" - URL_BINARY=$URL_BASE/$VERSION/$BINARY - URL_SHA=$URL_BASE/$VERSION/$BINARY.sha256 - URL_ASC=$URL_BASE/$VERSION/$BINARY.asc + URL_BINARY=$URL_BASE/$VERSION/$TARGET/$BINARY + URL_SHA=$URL_BASE/$VERSION/$TARGET/$BINARY.sha256 + URL_ASC=$URL_BASE/$VERSION/$TARGET/$BINARY.asc # Fetch artifacts mkdir -p "$OUTPUT_DIR" @@ -306,15 +305,26 @@ fetch_release_artifacts_from_s3() { function get_s3_url_base() { name=$1 case $name in - polkadot | polkadot-execute-worker | polkadot-prepare-worker | staking-miner) + polkadot | polkadot-execute-worker | polkadot-prepare-worker ) printf "https://releases.parity.io/polkadot" ;; - polkadot-parachain) - printf "https://releases.parity.io/cumulus" + polkadot-parachain) + printf "https://releases.parity.io/polkadot-parachain" + ;; + + polkadot-omni-node) + printf "https://releases.parity.io/polkadot-omni-node" + ;; + + chain-spec-builder) + printf "https://releases.parity.io/chain-spec-builder" ;; - *) + frame-omni-bencher) + printf "https://releases.parity.io/frame-omni-bencher" + ;; + *) printf "UNSUPPORTED BINARY $name" exit 1 ;; @@ -497,3 +507,16 @@ validate_stable_tag() { exit 1 fi } + +# Prepare docker stable tag form the polkadot stable tag +# input: tag (polkaodot-stableYYMM(-X) or polkadot-stableYYMM(-X)-rcX) +# output: stableYYMM(-X) or stableYYMM(-X)-rcX +prepare_docker_stable_tag() { + tag="$1" + if [[ "$tag" =~ stable[0-9]{4}(-[0-9]+)?(-rc[0-9]+)? ]]; then + echo "${BASH_REMATCH[0]}" + else + echo "Tag is invalid: $tag" + exit 1 + fi +} diff --git a/.github/scripts/release/release_lib.sh b/.github/scripts/release/release_lib.sh index 8b9254ec3f29..43227180cb7c 100644 --- a/.github/scripts/release/release_lib.sh +++ b/.github/scripts/release/release_lib.sh @@ -139,3 +139,25 @@ upload_s3_release() { aws s3 ls "s3://releases.parity.io/${product}/${version}/${target}" --recursive --human-readable --summarize echo "✅ The release should be at https://releases.parity.io/${product}/${version}/${target}" } + +# Upload runtimes artifacts to s3 release bucket +# +# input: version (stable release tage.g. polkadot-stable2412 or polkadot-stable2412-rc1) +# output: none +upload_s3_runtimes_release_artifacts() { + alias aws='podman run --rm -it docker.io/paritytech/awscli -e AWS_ACCESS_KEY_ID -e AWS_SECRET_ACCESS_KEY -e AWS_BUCKET aws' + + version=$1 + + echo "Working on version: $version " + + echo "Current content, should be empty on new uploads:" + aws s3 ls "s3://releases.parity.io/polkadot/runtimes/${version}/" --recursive --human-readable --summarize || true + echo "Content to be uploaded:" + artifacts="artifacts/runtimes/" + ls "$artifacts" + aws s3 sync --acl public-read "$artifacts" "s3://releases.parity.io/polkadot/runtimes/${version}/" + echo "Uploaded files:" + aws s3 ls "s3://releases.parity.io/polkadot/runtimes/${version}/" --recursive --human-readable --summarize + echo "✅ The release should be at https://releases.parity.io/polkadot/runtimes/${version}" +} diff --git a/.github/workflows/release-branchoff-stable.yml b/.github/workflows/release-10_branchoff-stable.yml similarity index 100% rename from .github/workflows/release-branchoff-stable.yml rename to .github/workflows/release-10_branchoff-stable.yml diff --git a/.github/workflows/release-10_rc-automation.yml b/.github/workflows/release-11_rc-automation.yml similarity index 100% rename from .github/workflows/release-10_rc-automation.yml rename to .github/workflows/release-11_rc-automation.yml diff --git a/.github/workflows/release-build-rc.yml b/.github/workflows/release-20_build-rc.yml similarity index 62% rename from .github/workflows/release-build-rc.yml rename to .github/workflows/release-20_build-rc.yml index a43c2b282a8d..d4c7055c37c5 100644 --- a/.github/workflows/release-build-rc.yml +++ b/.github/workflows/release-20_build-rc.yml @@ -11,10 +11,12 @@ on: - polkadot - polkadot-parachain - polkadot-omni-node + - frame-omni-bencher + - chain-spec-builder - all release_tag: - description: Tag matching the actual release candidate with the format stableYYMM-rcX or stableYYMM + description: Tag matching the actual release candidate with the format polkadot-stableYYMM(-X)-rcX or polkadot-stableYYMM(-X) type: string jobs: @@ -106,6 +108,50 @@ jobs: attestations: write contents: read + build-frame-omni-bencher-binary: + needs: [validate-inputs] + if: ${{ inputs.binary == 'frame-omni-bencher' || inputs.binary == 'all' }} + uses: "./.github/workflows/release-reusable-rc-buid.yml" + with: + binary: '["frame-omni-bencher"]' + package: "frame-omni-bencher" + release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: x86_64-unknown-linux-gnu + secrets: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + permissions: + id-token: write + attestations: write + contents: read + + build-chain-spec-builder-binary: + needs: [validate-inputs] + if: ${{ inputs.binary == 'chain-spec-builder' || inputs.binary == 'all' }} + uses: "./.github/workflows/release-reusable-rc-buid.yml" + with: + binary: '["chain-spec-builder"]' + package: staging-chain-spec-builder + release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: x86_64-unknown-linux-gnu + secrets: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + permissions: + id-token: write + attestations: write + contents: read + build-polkadot-macos-binary: needs: [validate-inputs] if: ${{ inputs.binary == 'polkadot' || inputs.binary == 'all' }} @@ -134,7 +180,7 @@ jobs: uses: "./.github/workflows/release-reusable-rc-buid.yml" with: binary: '["polkadot-parachain"]' - package: "polkadot-parachain-bin" + package: polkadot-parachain-bin release_tag: ${{ needs.validate-inputs.outputs.release_tag }} target: aarch64-apple-darwin secrets: @@ -156,7 +202,51 @@ jobs: uses: "./.github/workflows/release-reusable-rc-buid.yml" with: binary: '["polkadot-omni-node"]' - package: "polkadot-omni-node" + package: polkadot-omni-node + release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: aarch64-apple-darwin + secrets: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + permissions: + id-token: write + attestations: write + contents: read + + build-frame-omni-bencher-macos-binary: + needs: [validate-inputs] + if: ${{ inputs.binary == 'frame-omni-bencher' || inputs.binary == 'all' }} + uses: "./.github/workflows/release-reusable-rc-buid.yml" + with: + binary: '["frame-omni-bencher"]' + package: frame-omni-bencher + release_tag: ${{ needs.validate-inputs.outputs.release_tag }} + target: aarch64-apple-darwin + secrets: + PGP_KMS_KEY: ${{ secrets.PGP_KMS_KEY }} + PGP_KMS_HASH: ${{ secrets.PGP_KMS_HASH }} + AWS_ACCESS_KEY_ID: ${{ secrets.AWS_ACCESS_KEY_ID }} + AWS_SECRET_ACCESS_KEY: ${{ secrets.AWS_SECRET_ACCESS_KEY }} + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + permissions: + id-token: write + attestations: write + contents: read + + build-chain-spec-builder-macos-binary: + needs: [validate-inputs] + if: ${{ inputs.binary == 'chain-spec-builder' || inputs.binary == 'all' }} + uses: "./.github/workflows/release-reusable-rc-buid.yml" + with: + binary: '["chain-spec-builder"]' + package: staging-chain-spec-builder release_tag: ${{ needs.validate-inputs.outputs.release_tag }} target: aarch64-apple-darwin secrets: diff --git a/.github/workflows/release-30_publish_release_draft.yml b/.github/workflows/release-30_publish_release_draft.yml index 4364b4f80457..78ceea91f100 100644 --- a/.github/workflows/release-30_publish_release_draft.yml +++ b/.github/workflows/release-30_publish_release_draft.yml @@ -1,19 +1,46 @@ name: Release - Publish draft -on: - push: - tags: - # Catches v1.2.3 and v1.2.3-rc1 - - v[0-9]+.[0-9]+.[0-9]+* - # - polkadot-stable[0-9]+* Activate when the release process from release org is setteled +# This workflow runs in paritytech-release and creates full release draft with: +# - release notes +# - info about the runtimes +# - attached artifacts: +# - runtimes +# - binaries +# - signatures +on: workflow_dispatch: inputs: - version: - description: Current release/rc version + release_tag: + description: Tag matching the actual release candidate with the format polkadot-stableYYMM(-X)-rcX or polkadot-stableYYMM(-X) + required: true + type: string jobs: + check-synchronization: + uses: paritytech-release/sync-workflows/.github/workflows/check-syncronization.yml@main + + validate-inputs: + needs: [ check-synchronization ] + if: ${{ needs.check-synchronization.outputs.checks_passed }} == 'true' + runs-on: ubuntu-latest + outputs: + release_tag: ${{ steps.validate_inputs.outputs.release_tag }} + + steps: + - name: Checkout sources + uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2 + + - name: Validate inputs + id: validate_inputs + run: | + . ./.github/scripts/common/lib.sh + + RELEASE_TAG=$(validate_stable_tag ${{ inputs.release_tag }}) + echo "release_tag=${RELEASE_TAG}" >> $GITHUB_OUTPUT + get-rust-versions: + needs: [ validate-inputs ] runs-on: ubuntu-latest outputs: rustc-stable: ${{ steps.get-rust-versions.outputs.stable }} @@ -24,47 +51,28 @@ jobs: echo "stable=$RUST_STABLE_VERSION" >> $GITHUB_OUTPUT build-runtimes: + needs: [ validate-inputs ] uses: "./.github/workflows/release-srtool.yml" with: excluded_runtimes: "asset-hub-rococo bridge-hub-rococo contracts-rococo coretime-rococo people-rococo rococo rococo-parachain substrate-test bp cumulus-test kitchensink minimal-template parachain-template penpal polkadot-test seedling shell frame-try sp solochain-template polkadot-sdk-docs-first" build_opts: "--features on-chain-release-build" - - build-binaries: - runs-on: ubuntu-latest - strategy: - matrix: - # Tuples of [package, binary-name] - binary: [ [frame-omni-bencher, frame-omni-bencher], [staging-chain-spec-builder, chain-spec-builder] ] - steps: - - name: Checkout sources - uses: actions/checkout@6d193bf28034eafb982f37bd894289fe649468fc # v4.0.0 - - - name: Install protobuf-compiler - run: | - sudo apt update - sudo apt install -y protobuf-compiler - - - name: Build ${{ matrix.binary[1] }} binary - run: | - cargo build --locked --profile=production -p ${{ matrix.binary[0] }} --bin ${{ matrix.binary[1] }} - target/production/${{ matrix.binary[1] }} --version - - - name: Upload ${{ matrix.binary[1] }} binary - uses: actions/upload-artifact@5d5d22a31266ced268874388b861e4b58bb5c2f3 # v4.3.1 - with: - name: ${{ matrix.binary[1] }} - path: target/production/${{ matrix.binary[1] }} - + profile: production + permissions: + id-token: write + attestations: write + contents: read publish-release-draft: runs-on: ubuntu-latest - needs: [ get-rust-versions, build-runtimes ] + environment: release + needs: [ validate-inputs, get-rust-versions, build-runtimes ] outputs: release_url: ${{ steps.create-release.outputs.html_url }} asset_upload_url: ${{ steps.create-release.outputs.upload_url }} + steps: - name: Checkout - uses: actions/checkout@6d193bf28034eafb982f37bd894289fe649468fc # v4.0.0 + uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2 - name: Download artifacts uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8 @@ -87,20 +95,21 @@ jobs: GLUTTON_WESTEND_DIGEST: ${{ github.workspace}}/glutton-westend-runtime/glutton-westend-srtool-digest.json PEOPLE_WESTEND_DIGEST: ${{ github.workspace}}/people-westend-runtime/people-westend-srtool-digest.json WESTEND_DIGEST: ${{ github.workspace}}/westend-runtime/westend-srtool-digest.json + RELEASE_TAG: ${{ needs.validate-inputs.outputs.release_tag }} shell: bash run: | . ./.github/scripts/common/lib.sh export REF1=$(get_latest_release_tag) - if [[ -z "${{ inputs.version }}" ]]; then + if [[ -z "$RELEASE_TAG" ]]; then export REF2="${{ github.ref_name }}" echo "REF2: ${REF2}" else - export REF2="${{ inputs.version }}" + export REF2="$RELEASE_TAG" echo "REF2: ${REF2}" fi echo "REL_TAG=$REF2" >> $GITHUB_ENV - export VERSION=$(echo "$REF2" | sed -E 's/.*(stable[0-9]+).*$/\1/') + export VERSION=$(echo "$REF2" | sed -E 's/.*(stable[0-9]{4}(-[0-9]+)?).*$/\1/') ./scripts/release/build-changelogs.sh @@ -112,19 +121,29 @@ jobs: scripts/release/context.json **/*-srtool-digest.json + - name: Generate content write token for the release automation + id: generate_write_token + uses: actions/create-github-app-token@v1 + with: + app-id: ${{ vars.POLKADOT_SDK_RELEASE_RW_APP_ID }} + private-key: ${{ secrets.POLKADOT_SDK_RELEASE_RW_APP_KEY }} + owner: paritytech + repositories: polkadot-sdk + - name: Create draft release id: create-release - uses: actions/create-release@0cb9c9b65d5d1901c1f53e5e66eaf4afd303e70e # v1.1.4 env: - GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} - with: - tag_name: ${{ env.REL_TAG }} - release_name: Polkadot ${{ env.REL_TAG }} - body_path: ${{ github.workspace}}/scripts/release/RELEASE_DRAFT.md - draft: true + GITHUB_TOKEN: ${{ steps.generate_write_token.outputs.token }} + run: | + gh release create ${{ env.REL_TAG }} \ + --repo paritytech/polkadot-sdk \ + --draft \ + --title "Polkadot ${{ env.REL_TAG }}" \ + --notes-file ${{ github.workspace}}/scripts/release/RELEASE_DRAFT.md publish-runtimes: - needs: [ build-runtimes, publish-release-draft ] + needs: [ validate-inputs, build-runtimes, publish-release-draft ] + environment: release continue-on-error: true runs-on: ubuntu-latest strategy: @@ -132,7 +151,7 @@ jobs: steps: - name: Checkout sources - uses: actions/checkout@6d193bf28034eafb982f37bd894289fe649468fc # v4.0.0 + uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2 - name: Download artifacts uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8 @@ -144,44 +163,83 @@ jobs: >>$GITHUB_ENV echo ASSET=$(find ${{ matrix.chain }}-runtime -name '*.compact.compressed.wasm') >>$GITHUB_ENV echo SPEC=$(<${JSON} jq -r .runtimes.compact.subwasm.core_version.specVersion) + - name: Generate content write token for the release automation + id: generate_write_token + uses: actions/create-github-app-token@v1 + with: + app-id: ${{ vars.POLKADOT_SDK_RELEASE_RW_APP_ID }} + private-key: ${{ secrets.POLKADOT_SDK_RELEASE_RW_APP_KEY }} + owner: paritytech + repositories: polkadot-sdk + - name: Upload compressed ${{ matrix.chain }} v${{ env.SPEC }} wasm - if: ${{ matrix.chain != 'rococo-parachain' }} - uses: actions/upload-release-asset@e8f9f06c4b078e705bd2ea027f0926603fc9b4d5 #v1.0.2 env: - GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} - with: - upload_url: ${{ needs.publish-release-draft.outputs.asset_upload_url }} - asset_path: ${{ env.ASSET }} - asset_name: ${{ matrix.chain }}_runtime-v${{ env.SPEC }}.compact.compressed.wasm - asset_content_type: application/wasm + GITHUB_TOKEN: ${{ steps.generate_write_token.outputs.token }} + run: | + gh release upload ${{ needs.validate-inputs.outputs.release_tag }} \ + --repo paritytech/polkadot-sdk \ + '${{ env.ASSET }}#${{ matrix.chain }}_runtime-v${{ env.SPEC }}.compact.compressed.wasm' - publish-binaries: - needs: [ publish-release-draft, build-binaries ] + publish-release-artifacts: + needs: [ validate-inputs, publish-release-draft ] + environment: release continue-on-error: true runs-on: ubuntu-latest strategy: matrix: - binary: [frame-omni-bencher, chain-spec-builder] + binary: [ polkadot, polkadot-execute-worker, polkadot-prepare-worker, polkadot-parachain, polkadot-omni-node, frame-omni-bencher, chain-spec-builder ] + target: [ x86_64-unknown-linux-gnu, aarch64-apple-darwin ] steps: - - name: Download artifacts - uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8 + - name: Checkout sources + uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2 + + - name: Fetch binaries from s3 based on version + run: | + . ./.github/scripts/common/lib.sh + + VERSION="${{ needs.validate-inputs.outputs.release_tag }}" + fetch_release_artifacts_from_s3 ${{ matrix.binary }} ${{ matrix.target }} + + - name: Rename aarch64-apple-darwin binaries + if: ${{ matrix.target == 'aarch64-apple-darwin' }} + working-directory: ${{ github.workspace}}/release-artifacts/${{ matrix.target }}/${{ matrix.binary }} + run: | + mv ${{ matrix.binary }} ${{ matrix.binary }}-aarch64-apple-darwin + mv ${{ matrix.binary }}.asc ${{ matrix.binary }}-aarch64-apple-darwin.asc + mv ${{ matrix.binary }}.sha256 ${{ matrix.binary }}-aarch64-apple-darwin.sha256 + + - name: Generate content write token for the release automation + id: generate_write_token + uses: actions/create-github-app-token@v1 with: - name: ${{ matrix.binary }} + app-id: ${{ vars.POLKADOT_SDK_RELEASE_RW_APP_ID }} + private-key: ${{ secrets.POLKADOT_SDK_RELEASE_RW_APP_KEY }} + owner: paritytech + repositories: polkadot-sdk - - name: Upload ${{ matrix.binary }} binary - uses: actions/upload-release-asset@e8f9f06c4b078e705bd2ea027f0926603fc9b4d5 #v1.0.2 + - name: Upload ${{ matrix.binary }} binary to release draft env: - GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} - with: - upload_url: ${{ needs.publish-release-draft.outputs.asset_upload_url }} - asset_path: ${{ github.workspace}}/${{ matrix.binary }} - asset_name: ${{ matrix.binary }} - asset_content_type: application/octet-stream + GITHUB_TOKEN: ${{ steps.generate_write_token.outputs.token }} + working-directory: ${{ github.workspace}}/release-artifacts/${{ matrix.target }}/${{ matrix.binary }} + run: | + if [[ ${{ matrix.target }} == "aarch64-apple-darwin" ]]; then + gh release upload ${{ needs.validate-inputs.outputs.release_tag }} \ + --repo paritytech/polkadot-sdk \ + ${{ matrix.binary }}-aarch64-apple-darwin \ + ${{ matrix.binary }}-aarch64-apple-darwin.asc \ + ${{ matrix.binary }}-aarch64-apple-darwin.sha256 + else + gh release upload ${{ needs.validate-inputs.outputs.release_tag }} \ + --repo paritytech/polkadot-sdk \ + ${{ matrix.binary }} \ + ${{ matrix.binary }}.asc \ + ${{ matrix.binary }}.sha256 + fi post_to_matrix: runs-on: ubuntu-latest - needs: publish-release-draft + needs: [ validate-inputs, publish-release-draft ] environment: release strategy: matrix: @@ -197,5 +255,5 @@ jobs: access_token: ${{ secrets.RELEASENOTES_MATRIX_V2_ACCESS_TOKEN }} server: m.parity.io message: | - **New version of polkadot tagged**: ${{ github.ref_name }}
- Draft release created: ${{ needs.publish-release-draft.outputs.release_url }} + **New version of polkadot tagged**: ${{ needs.validate-inputs.outputs.release_tag }}
+ And release draft is release created in [polkadot-sdk repo](https://github.com/paritytech/polkadot-sdk/releases) diff --git a/.github/workflows/release-50_publish-docker.yml b/.github/workflows/release-50_publish-docker.yml index 627e53bacd88..5c3c3a6e854d 100644 --- a/.github/workflows/release-50_publish-docker.yml +++ b/.github/workflows/release-50_publish-docker.yml @@ -4,10 +4,6 @@ name: Release - Publish Docker Image # It builds and published releases and rc candidates. on: - #TODO: activate automated run later - # release: - # types: - # - published workflow_dispatch: inputs: image_type: @@ -30,16 +26,6 @@ on: - polkadot-parachain - chain-spec-builder - release_id: - description: | - Release ID. - You can find it using the command: - curl -s \ - -H "Authorization: Bearer ${GITHUB_TOKEN}" https://api.github.com/repos/$OWNER/$REPO/releases | \ - jq '.[] | { name: .name, id: .id }' - required: true - type: number - registry: description: Container registry required: true @@ -55,7 +41,7 @@ on: default: parity version: - description: version to build/release + description: Version of the polkadot node release in format v1.16.0 or v1.16.0-rc1 default: v0.9.18 required: true @@ -78,11 +64,15 @@ env: IMAGE_TYPE: ${{ inputs.image_type }} jobs: + check-synchronization: + uses: paritytech-release/sync-workflows/.github/workflows/check-syncronization.yml@main + validate-inputs: + needs: [check-synchronization] + if: ${{ needs.check-synchronization.outputs.checks_passed }} == 'true' runs-on: ubuntu-latest outputs: version: ${{ steps.validate_inputs.outputs.VERSION }} - release_id: ${{ steps.validate_inputs.outputs.RELEASE_ID }} stable_tag: ${{ steps.validate_inputs.outputs.stable_tag }} steps: @@ -97,11 +87,6 @@ jobs: VERSION=$(filter_version_from_input "${{ inputs.version }}") echo "VERSION=${VERSION}" >> $GITHUB_OUTPUT - RELEASE_ID=$(check_release_id "${{ inputs.release_id }}") - echo "RELEASE_ID=${RELEASE_ID}" >> $GITHUB_OUTPUT - - echo "Release ID: $RELEASE_ID" - STABLE_TAG=$(validate_stable_tag ${{ inputs.stable_tag }}) echo "stable_tag=${STABLE_TAG}" >> $GITHUB_OUTPUT @@ -114,50 +99,26 @@ jobs: - name: Checkout sources uses: actions/checkout@d632683dd7b4114ad314bca15554477dd762a938 # v4.2.0 - #TODO: this step will be needed when automated triggering will work - #this step runs only if the workflow is triggered automatically when new release is published - # if: ${{ env.EVENT_NAME == 'release' && env.EVENT_ACTION != '' && env.EVENT_ACTION == 'published' }} - # run: | - # mkdir -p release-artifacts && cd release-artifacts - - # for f in $BINARY $BINARY.asc $BINARY.sha256; do - # URL="https://github.com/${{ github.event.repository.full_name }}/releases/download/${{ github.event.release.tag_name }}/$f" - # echo " - Fetching $f from $URL" - # wget "$URL" -O "$f" - # done - # chmod a+x $BINARY - # ls -al - - name: Fetch rc artifacts or release artifacts from s3 based on version - #this step runs only if the workflow is triggered manually - if: ${{ env.EVENT_NAME == 'workflow_dispatch' && inputs.binary != 'polkadot-omni-node' && inputs.binary != 'chain-spec-builder'}} + # if: ${{ env.EVENT_NAME == 'workflow_dispatch' && inputs.binary != 'polkadot-omni-node' && inputs.binary != 'chain-spec-builder'}} run: | . ./.github/scripts/common/lib.sh - VERSION="${{ needs.validate-inputs.outputs.VERSION }}" + VERSION="${{ needs.validate-inputs.outputs.stable_tag }}" if [[ ${{ inputs.binary }} == 'polkadot' ]]; then bins=(polkadot polkadot-prepare-worker polkadot-execute-worker) for bin in "${bins[@]}"; do - fetch_release_artifacts_from_s3 $bin + fetch_release_artifacts_from_s3 $bin x86_64-unknown-linux-gnu done else - fetch_release_artifacts_from_s3 $BINARY + fetch_release_artifacts_from_s3 $BINARY x86_64-unknown-linux-gnu fi - - name: Fetch polkadot-omni-node/chain-spec-builder rc artifacts or release artifacts based on release id - #this step runs only if the workflow is triggered manually and only for chain-spec-builder - if: ${{ env.EVENT_NAME == 'workflow_dispatch' && (inputs.binary == 'polkadot-omni-node' || inputs.binary == 'chain-spec-builder') }} - run: | - . ./.github/scripts/common/lib.sh - - RELEASE_ID="${{ needs.validate-inputs.outputs.RELEASE_ID }}" - fetch_release_artifacts - - name: Upload artifacts uses: actions/upload-artifact@5d5d22a31266ced268874388b861e4b58bb5c2f3 # v4.3.1 with: name: release-artifacts - path: release-artifacts/${{ env.BINARY }}/**/* + path: release-artifacts/x86_64-unknown-linux-gnu/${{ env.BINARY }}/**/* build-container: # this job will be triggered for the polkadot-parachain rc and release or polkadot rc image build if: ${{ inputs.binary == 'polkadot-omni-node' || inputs.binary == 'polkadot-parachain' || inputs.binary == 'chain-spec-builder' || inputs.image_type == 'rc' }} @@ -173,7 +134,7 @@ jobs: uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8 - name: Check sha256 ${{ env.BINARY }} - if: ${{ inputs.binary == 'polkadot-parachain' || inputs.binary == 'polkadot' }} + # if: ${{ inputs.binary == 'polkadot-parachain' || inputs.binary == 'polkadot' }} working-directory: release-artifacts run: | . ../.github/scripts/common/lib.sh @@ -182,7 +143,7 @@ jobs: check_sha256 $BINARY && echo "OK" || echo "ERR" - name: Check GPG ${{ env.BINARY }} - if: ${{ inputs.binary == 'polkadot-parachain' || inputs.binary == 'polkadot' }} + # if: ${{ inputs.binary == 'polkadot-parachain' || inputs.binary == 'polkadot' }} working-directory: release-artifacts run: | . ../.github/scripts/common/lib.sh @@ -190,35 +151,29 @@ jobs: check_gpg $BINARY - name: Fetch rc commit and tag + working-directory: release-artifacts if: ${{ env.IMAGE_TYPE == 'rc' }} id: fetch_rc_refs + shell: bash run: | - . ./.github/scripts/common/lib.sh - - echo "release=${{ needs.validate-inputs.outputs.stable_tag }}" >> $GITHUB_OUTPUT + . ../.github/scripts/common/lib.sh commit=$(git rev-parse --short HEAD) && \ echo "commit=${commit}" >> $GITHUB_OUTPUT - - echo "tag=${{ needs.validate-inputs.outputs.version }}" >> $GITHUB_OUTPUT + echo "release=$(echo ${{ needs.validate-inputs.outputs.version }})" >> $GITHUB_OUTPUT + echo "tag=$(prepare_docker_stable_tag ${{ needs.validate-inputs.outputs.stable_tag }})" >> $GITHUB_OUTPUT - name: Fetch release tags working-directory: release-artifacts if: ${{ env.IMAGE_TYPE == 'release'}} id: fetch_release_refs + shell: bash run: | - chmod a+rx $BINARY - - if [[ $BINARY != 'chain-spec-builder' ]]; then - VERSION=$(./$BINARY --version | awk '{ print $2 }' ) - release=$( echo $VERSION | cut -f1 -d- ) - else - release=$(echo ${{ needs.validate-inputs.outputs.VERSION }} | sed 's/^v//') - fi + . ../.github/scripts/common/lib.sh echo "tag=latest" >> $GITHUB_OUTPUT - echo "release=${release}" >> $GITHUB_OUTPUT - echo "stable=${{ needs.validate-inputs.outputs.stable_tag }}" >> $GITHUB_OUTPUT + echo "release=$(echo ${{ needs.validate-inputs.outputs.version }})" >> $GITHUB_OUTPUT + echo "stable=$(prepare_docker_stable_tag ${{ needs.validate-inputs.outputs.stable_tag }})" >> $GITHUB_OUTPUT - name: Build Injected Container image for polkadot rc if: ${{ env.BINARY == 'polkadot' }} @@ -342,8 +297,10 @@ jobs: - name: Fetch values id: fetch-data run: | + . ./.github/scripts/common/lib.sh date=$(date -u '+%Y-%m-%dT%H:%M:%SZ') echo "date=$date" >> $GITHUB_OUTPUT + echo "stable=$(prepare_docker_stable_tag ${{ needs.validate-inputs.outputs.stable_tag }})" >> $GITHUB_OUTPUT - name: Build and push id: docker_build @@ -354,9 +311,9 @@ jobs: # TODO: The owner should be used below but buildx does not resolve the VARs # TODO: It would be good to get rid of this GHA that we don't really need. tags: | - parity/polkadot:${{ needs.validate-inputs.outputs.stable_tag }} - parity/polkadot:latest - parity/polkadot:${{ needs.fetch-latest-debian-package-version.outputs.polkadot_container_tag }} + egorpop/polkadot:${{ steps.fetch-data.outputs.stable }} + egorpop/polkadot:latest + egorpop/polkadot:${{ needs.fetch-latest-debian-package-version.outputs.polkadot_container_tag }} build-args: | VCS_REF=${{ github.ref }} POLKADOT_VERSION=${{ needs.fetch-latest-debian-package-version.outputs.polkadot_apt_version }} diff --git a/.github/workflows/release-reusable-rc-buid.yml b/.github/workflows/release-reusable-rc-buid.yml index f5240878cba2..dc1b4553eb9b 100644 --- a/.github/workflows/release-reusable-rc-buid.yml +++ b/.github/workflows/release-reusable-rc-buid.yml @@ -302,7 +302,6 @@ jobs: AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} - upload-polkadot-parachain-artifacts-to-s3: if: ${{ inputs.package == 'polkadot-parachain-bin' && inputs.target == 'x86_64-unknown-linux-gnu' }} needs: [build-rc] @@ -329,6 +328,32 @@ jobs: AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + upload-frame-omni-bencher-artifacts-to-s3: + if: ${{ inputs.package == 'frame-omni-bencher' && inputs.target == 'x86_64-unknown-linux-gnu' }} + needs: [build-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: ${{ inputs.package }} + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + + upload-chain-spec-builder-artifacts-to-s3: + if: ${{ inputs.package == 'staging-chain-spec-builder' && inputs.target == 'x86_64-unknown-linux-gnu' }} + needs: [build-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: chain-spec-builder + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + upload-polkadot-macos-artifacts-to-s3: if: ${{ inputs.package == 'polkadot' && inputs.target == 'aarch64-apple-darwin' }} # TODO: add and use a `build-polkadot-homebrew-package` which packs all `polkadot` binaries: @@ -395,3 +420,29 @@ jobs: AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + + upload-frame-omni-bencher-macos-artifacts-to-s3: + if: ${{ inputs.package == 'frame-omni-bencher' && inputs.target == 'aarch64-apple-darwin' }} + needs: [build-macos-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: ${{ inputs.package }} + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} + + upload-chain-spec-builder-macos-artifacts-to-s3: + if: ${{ inputs.package == 'staging-chain-spec-builder' && inputs.target == 'aarch64-apple-darwin' }} + needs: [build-macos-rc] + uses: ./.github/workflows/release-reusable-s3-upload.yml + with: + package: chain-spec-builder + release_tag: ${{ inputs.release_tag }} + target: ${{ inputs.target }} + secrets: + AWS_DEFAULT_REGION: ${{ secrets.AWS_DEFAULT_REGION }} + AWS_RELEASE_ACCESS_KEY_ID: ${{ secrets.AWS_RELEASE_ACCESS_KEY_ID }} + AWS_RELEASE_SECRET_ACCESS_KEY: ${{ secrets.AWS_RELEASE_SECRET_ACCESS_KEY }} diff --git a/.github/workflows/release-srtool.yml b/.github/workflows/release-srtool.yml index 9a29b46d2fc3..fc10496d481b 100644 --- a/.github/workflows/release-srtool.yml +++ b/.github/workflows/release-srtool.yml @@ -1,7 +1,7 @@ name: Srtool build env: - SUBWASM_VERSION: 0.20.0 + SUBWASM_VERSION: 0.21.0 TOML_CLI_VERSION: 0.2.4 on: @@ -11,14 +11,16 @@ on: type: string build_opts: type: string + profile: + type: string outputs: published_runtimes: value: ${{ jobs.find-runtimes.outputs.runtime }} - schedule: - - cron: "00 02 * * 1" # 2AM weekly on monday - - workflow_dispatch: +permissions: + id-token: write + attestations: write + contents: read jobs: find-runtimes: @@ -75,6 +77,7 @@ jobs: with: chain: ${{ matrix.chain }} runtime_dir: ${{ matrix.runtime_dir }} + profile: ${{ inputs.profile }} - name: Summary run: | @@ -83,6 +86,11 @@ jobs: echo "Compact Runtime: ${{ steps.srtool_build.outputs.wasm }}" echo "Compressed Runtime: ${{ steps.srtool_build.outputs.wasm_compressed }}" + - name: Generate artifact attestation + uses: actions/attest-build-provenance@1c608d11d69870c2092266b3f9a6f3abbf17002c # v1.4.3 + with: + subject-path: ${{ steps.srtool_build.outputs.wasm }} + # We now get extra information thanks to subwasm - name: Install subwasm run: | From 76a292b23bf6f35156fd3dd832e9c4ec31b24b2c Mon Sep 17 00:00:00 2001 From: Lulu Date: Tue, 3 Dec 2024 13:22:45 +0100 Subject: [PATCH 60/64] Update parity-publish (#6549) --- .github/workflows/check-semver.yml | 4 +- .github/workflows/publish-check-crates.yml | 2 +- .github/workflows/publish-claim-crates.yml | 2 +- .../snowbridge/runtime/test-common/Cargo.toml | 2 + cumulus/client/cli/Cargo.toml | 2 + cumulus/client/collator/Cargo.toml | 2 + cumulus/client/consensus/aura/Cargo.toml | 2 + cumulus/client/consensus/common/Cargo.toml | 2 + cumulus/client/consensus/proposer/Cargo.toml | 2 + .../client/consensus/relay-chain/Cargo.toml | 2 + cumulus/client/network/Cargo.toml | 2 + cumulus/client/parachain-inherent/Cargo.toml | 2 + cumulus/client/pov-recovery/Cargo.toml | 2 + .../Cargo.toml | 2 + .../client/relay-chain-interface/Cargo.toml | 2 + .../relay-chain-minimal-node/Cargo.toml | 2 + .../relay-chain-rpc-interface/Cargo.toml | 2 + cumulus/client/service/Cargo.toml | 2 + cumulus/pallets/aura-ext/Cargo.toml | 2 + cumulus/pallets/parachain-system/Cargo.toml | 2 + .../parachain-system/proc-macro/Cargo.toml | 2 + cumulus/pallets/solo-to-para/Cargo.toml | 2 + cumulus/pallets/xcm/Cargo.toml | 2 + cumulus/pallets/xcmp-queue/Cargo.toml | 2 + cumulus/parachains/common/Cargo.toml | 2 + .../emulated/common/Cargo.toml | 2 + .../pallets/collective-content/Cargo.toml | 2 + .../pallets/parachain-info/Cargo.toml | 2 + cumulus/parachains/pallets/ping/Cargo.toml | 2 + .../assets/asset-hub-rococo/Cargo.toml | 2 + .../assets/asset-hub-westend/Cargo.toml | 2 + .../runtimes/assets/common/Cargo.toml | 2 + .../runtimes/assets/test-utils/Cargo.toml | 2 + .../bridge-hubs/bridge-hub-rococo/Cargo.toml | 2 + .../bridge-hubs/bridge-hub-westend/Cargo.toml | 2 + .../runtimes/bridge-hubs/common/Cargo.toml | 2 + .../bridge-hubs/test-utils/Cargo.toml | 2 + .../collectives-westend/Cargo.toml | 2 + .../parachains/runtimes/constants/Cargo.toml | 2 + .../contracts/contracts-rococo/Cargo.toml | 2 + .../coretime/coretime-rococo/Cargo.toml | 2 + .../coretime/coretime-westend/Cargo.toml | 2 + .../glutton/glutton-westend/Cargo.toml | 2 + .../runtimes/people/people-rococo/Cargo.toml | 2 + .../runtimes/people/people-westend/Cargo.toml | 2 + .../parachains/runtimes/test-utils/Cargo.toml | 2 + .../testing/rococo-parachain/Cargo.toml | 2 + cumulus/polkadot-omni-node/Cargo.toml | 2 + cumulus/polkadot-omni-node/lib/Cargo.toml | 2 + cumulus/polkadot-parachain/Cargo.toml | 2 + cumulus/primitives/aura/Cargo.toml | 2 + cumulus/primitives/core/Cargo.toml | 2 + .../primitives/parachain-inherent/Cargo.toml | 2 + .../proof-size-hostfunction/Cargo.toml | 2 + .../storage-weight-reclaim/Cargo.toml | 2 + cumulus/primitives/timestamp/Cargo.toml | 2 + cumulus/primitives/utility/Cargo.toml | 2 + cumulus/test/relay-sproof-builder/Cargo.toml | 2 + cumulus/xcm/xcm-emulator/Cargo.toml | 2 + polkadot/Cargo.toml | 2 + polkadot/cli/Cargo.toml | 2 + polkadot/core-primitives/Cargo.toml | 2 + polkadot/erasure-coding/Cargo.toml | 2 + polkadot/node/collation-generation/Cargo.toml | 2 + .../core/approval-voting-parallel/Cargo.toml | 2 + polkadot/node/core/approval-voting/Cargo.toml | 2 + polkadot/node/core/av-store/Cargo.toml | 2 + polkadot/node/core/backing/Cargo.toml | 2 + .../node/core/bitfield-signing/Cargo.toml | 2 + .../node/core/candidate-validation/Cargo.toml | 2 + polkadot/node/core/chain-api/Cargo.toml | 2 + polkadot/node/core/chain-selection/Cargo.toml | 2 + .../node/core/dispute-coordinator/Cargo.toml | 2 + .../node/core/parachains-inherent/Cargo.toml | 2 + .../core/prospective-parachains/Cargo.toml | 2 + polkadot/node/core/provisioner/Cargo.toml | 2 + polkadot/node/core/pvf-checker/Cargo.toml | 2 + polkadot/node/core/pvf/Cargo.toml | 2 + polkadot/node/core/pvf/common/Cargo.toml | 2 + .../node/core/pvf/execute-worker/Cargo.toml | 2 + .../node/core/pvf/prepare-worker/Cargo.toml | 2 + polkadot/node/core/runtime-api/Cargo.toml | 2 + polkadot/node/gum/Cargo.toml | 2 + polkadot/node/gum/proc-macro/Cargo.toml | 2 + polkadot/node/metrics/Cargo.toml | 2 + .../network/approval-distribution/Cargo.toml | 2 + .../availability-distribution/Cargo.toml | 2 + .../network/availability-recovery/Cargo.toml | 2 + .../network/bitfield-distribution/Cargo.toml | 2 + polkadot/node/network/bridge/Cargo.toml | 2 + .../node/network/collator-protocol/Cargo.toml | 2 + .../network/dispute-distribution/Cargo.toml | 2 + .../node/network/gossip-support/Cargo.toml | 2 + polkadot/node/network/protocol/Cargo.toml | 2 + .../network/statement-distribution/Cargo.toml | 2 + polkadot/node/overseer/Cargo.toml | 2 + polkadot/node/primitives/Cargo.toml | 2 + polkadot/node/service/Cargo.toml | 2 + polkadot/node/subsystem-types/Cargo.toml | 2 + polkadot/node/subsystem-util/Cargo.toml | 2 + polkadot/node/subsystem/Cargo.toml | 2 + polkadot/node/tracking-allocator/Cargo.toml | 2 + polkadot/parachain/Cargo.toml | 2 + polkadot/primitives/Cargo.toml | 2 + polkadot/rpc/Cargo.toml | 2 + polkadot/runtime/common/Cargo.toml | 2 + .../common/slot_range_helper/Cargo.toml | 2 + polkadot/runtime/metrics/Cargo.toml | 2 + polkadot/runtime/parachains/Cargo.toml | 2 + polkadot/runtime/rococo/Cargo.toml | 2 + polkadot/runtime/rococo/constants/Cargo.toml | 2 + polkadot/runtime/westend/Cargo.toml | 2 + polkadot/runtime/westend/constants/Cargo.toml | 2 + polkadot/statement-table/Cargo.toml | 2 + polkadot/utils/generate-bags/Cargo.toml | 2 + polkadot/xcm/Cargo.toml | 2 + polkadot/xcm/pallet-xcm-benchmarks/Cargo.toml | 2 + polkadot/xcm/pallet-xcm/Cargo.toml | 2 + polkadot/xcm/procedural/Cargo.toml | 2 + polkadot/xcm/xcm-builder/Cargo.toml | 2 + polkadot/xcm/xcm-executor/Cargo.toml | 2 + polkadot/xcm/xcm-simulator/Cargo.toml | 2 + polkadot/xcm/xcm-simulator/example/Cargo.toml | 2 + prdoc/pr_6549.prdoc | 247 ++++++++++++++++++ scripts/generate-umbrella.py | 2 + substrate/frame/revive/fixtures/Cargo.toml | 2 + umbrella/Cargo.toml | 6 + 127 files changed, 501 insertions(+), 4 deletions(-) create mode 100644 prdoc/pr_6549.prdoc diff --git a/.github/workflows/check-semver.yml b/.github/workflows/check-semver.yml index 8d77b6a31b75..e9bedd16e6d1 100644 --- a/.github/workflows/check-semver.yml +++ b/.github/workflows/check-semver.yml @@ -11,7 +11,7 @@ concurrency: cancel-in-progress: true env: - TOOLCHAIN: nightly-2024-10-19 + TOOLCHAIN: nightly-2024-11-19 jobs: preflight: @@ -74,7 +74,7 @@ jobs: - name: install parity-publish # Set the target dir to cache the build. - run: CARGO_TARGET_DIR=./target/ cargo install parity-publish@0.10.1 --locked -q + run: CARGO_TARGET_DIR=./target/ cargo install parity-publish@0.10.2 --locked -q - name: check semver run: | diff --git a/.github/workflows/publish-check-crates.yml b/.github/workflows/publish-check-crates.yml index 3fad3b641474..1e5a8054e2c7 100644 --- a/.github/workflows/publish-check-crates.yml +++ b/.github/workflows/publish-check-crates.yml @@ -24,7 +24,7 @@ jobs: cache-on-failure: true - name: install parity-publish - run: cargo install parity-publish@0.8.0 --locked -q + run: cargo install parity-publish@0.10.2 --locked -q - name: parity-publish check run: parity-publish --color always check --allow-unpublished diff --git a/.github/workflows/publish-claim-crates.yml b/.github/workflows/publish-claim-crates.yml index 37bf06bb82d8..845b57a61b96 100644 --- a/.github/workflows/publish-claim-crates.yml +++ b/.github/workflows/publish-claim-crates.yml @@ -18,7 +18,7 @@ jobs: cache-on-failure: true - name: install parity-publish - run: cargo install parity-publish@0.8.0 --locked -q + run: cargo install parity-publish@0.10.2 --locked -q - name: parity-publish claim env: diff --git a/bridges/snowbridge/runtime/test-common/Cargo.toml b/bridges/snowbridge/runtime/test-common/Cargo.toml index 6f8e586bf5ff..9f47f158ed4a 100644 --- a/bridges/snowbridge/runtime/test-common/Cargo.toml +++ b/bridges/snowbridge/runtime/test-common/Cargo.toml @@ -6,6 +6,8 @@ authors = ["Snowfork "] edition.workspace = true license = "Apache-2.0" categories = ["cryptography::cryptocurrencies"] +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/cli/Cargo.toml b/cumulus/client/cli/Cargo.toml index 9b6f6b73960b..198f9428f1dd 100644 --- a/cumulus/client/cli/Cargo.toml +++ b/cumulus/client/cli/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Parachain node CLI utilities." license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/collator/Cargo.toml b/cumulus/client/collator/Cargo.toml index 6ebde0c2c653..83a3f2661e7a 100644 --- a/cumulus/client/collator/Cargo.toml +++ b/cumulus/client/collator/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Common node-side functionality and glue code to collate parachain blocks." license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/consensus/aura/Cargo.toml b/cumulus/client/consensus/aura/Cargo.toml index 0bb2de6bb9b8..6e0c124591cb 100644 --- a/cumulus/client/consensus/aura/Cargo.toml +++ b/cumulus/client/consensus/aura/Cargo.toml @@ -5,6 +5,8 @@ version = "0.7.0" authors.workspace = true edition.workspace = true license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/consensus/common/Cargo.toml b/cumulus/client/consensus/common/Cargo.toml index 4bc2f1d1e600..0f532a2101c4 100644 --- a/cumulus/client/consensus/common/Cargo.toml +++ b/cumulus/client/consensus/common/Cargo.toml @@ -5,6 +5,8 @@ version = "0.7.0" authors.workspace = true edition.workspace = true license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/consensus/proposer/Cargo.toml b/cumulus/client/consensus/proposer/Cargo.toml index bb760ae03f4d..e391481bc445 100644 --- a/cumulus/client/consensus/proposer/Cargo.toml +++ b/cumulus/client/consensus/proposer/Cargo.toml @@ -5,6 +5,8 @@ version = "0.7.0" authors.workspace = true edition.workspace = true license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/consensus/relay-chain/Cargo.toml b/cumulus/client/consensus/relay-chain/Cargo.toml index f3ee6fc2f7d2..7f0f4333c961 100644 --- a/cumulus/client/consensus/relay-chain/Cargo.toml +++ b/cumulus/client/consensus/relay-chain/Cargo.toml @@ -5,6 +5,8 @@ version = "0.7.0" authors.workspace = true edition.workspace = true license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/network/Cargo.toml b/cumulus/client/network/Cargo.toml index bc67678eedeb..b78df8d73eae 100644 --- a/cumulus/client/network/Cargo.toml +++ b/cumulus/client/network/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true description = "Cumulus-specific networking protocol" edition.workspace = true license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/parachain-inherent/Cargo.toml b/cumulus/client/parachain-inherent/Cargo.toml index 0d82cf648743..4f53e2bc1bc2 100644 --- a/cumulus/client/parachain-inherent/Cargo.toml +++ b/cumulus/client/parachain-inherent/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Inherent that needs to be present in every parachain block. Contains messages and a relay chain storage-proof." license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [dependencies] async-trait = { workspace = true } diff --git a/cumulus/client/pov-recovery/Cargo.toml b/cumulus/client/pov-recovery/Cargo.toml index 3127dd26fcaa..762837e0bb11 100644 --- a/cumulus/client/pov-recovery/Cargo.toml +++ b/cumulus/client/pov-recovery/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true description = "Parachain PoV recovery" edition.workspace = true license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/relay-chain-inprocess-interface/Cargo.toml b/cumulus/client/relay-chain-inprocess-interface/Cargo.toml index 6f1b74191be7..9e6e8da929bb 100644 --- a/cumulus/client/relay-chain-inprocess-interface/Cargo.toml +++ b/cumulus/client/relay-chain-inprocess-interface/Cargo.toml @@ -5,6 +5,8 @@ version = "0.7.0" edition.workspace = true description = "Implementation of the RelayChainInterface trait for Polkadot full-nodes." license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/relay-chain-interface/Cargo.toml b/cumulus/client/relay-chain-interface/Cargo.toml index a496fab050dd..2b9e72bbeca6 100644 --- a/cumulus/client/relay-chain-interface/Cargo.toml +++ b/cumulus/client/relay-chain-interface/Cargo.toml @@ -5,6 +5,8 @@ version = "0.7.0" edition.workspace = true description = "Common interface for different relay chain datasources." license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/relay-chain-minimal-node/Cargo.toml b/cumulus/client/relay-chain-minimal-node/Cargo.toml index 95ecadc8bd06..0fad188bb1ab 100644 --- a/cumulus/client/relay-chain-minimal-node/Cargo.toml +++ b/cumulus/client/relay-chain-minimal-node/Cargo.toml @@ -5,6 +5,8 @@ version = "0.7.0" edition.workspace = true description = "Minimal node implementation to be used in tandem with RPC or light-client mode." license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/relay-chain-rpc-interface/Cargo.toml b/cumulus/client/relay-chain-rpc-interface/Cargo.toml index fb4cb4ceed4e..162f5ad0e9e8 100644 --- a/cumulus/client/relay-chain-rpc-interface/Cargo.toml +++ b/cumulus/client/relay-chain-rpc-interface/Cargo.toml @@ -5,6 +5,8 @@ version = "0.7.0" edition.workspace = true description = "Implementation of the RelayChainInterface trait that connects to a remote RPC-node." license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/client/service/Cargo.toml b/cumulus/client/service/Cargo.toml index 0a77b465d96a..193283648f19 100644 --- a/cumulus/client/service/Cargo.toml +++ b/cumulus/client/service/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Common functions used to assemble the components of a parachain node." license = "GPL-3.0-or-later WITH Classpath-exception-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/pallets/aura-ext/Cargo.toml b/cumulus/pallets/aura-ext/Cargo.toml index c08148928b7c..fcda79f1d5c1 100644 --- a/cumulus/pallets/aura-ext/Cargo.toml +++ b/cumulus/pallets/aura-ext/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "AURA consensus extension pallet for parachains" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/pallets/parachain-system/Cargo.toml b/cumulus/pallets/parachain-system/Cargo.toml index 3cb0394c4b95..05498a474e42 100644 --- a/cumulus/pallets/parachain-system/Cargo.toml +++ b/cumulus/pallets/parachain-system/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Base pallet for cumulus-based parachains" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/pallets/parachain-system/proc-macro/Cargo.toml b/cumulus/pallets/parachain-system/proc-macro/Cargo.toml index da6f0fd03efb..629818f9c4cc 100644 --- a/cumulus/pallets/parachain-system/proc-macro/Cargo.toml +++ b/cumulus/pallets/parachain-system/proc-macro/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Proc macros provided by the parachain-system pallet" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/pallets/solo-to-para/Cargo.toml b/cumulus/pallets/solo-to-para/Cargo.toml index 5fd1939e93a0..2088361bf11a 100644 --- a/cumulus/pallets/solo-to-para/Cargo.toml +++ b/cumulus/pallets/solo-to-para/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Adds functionality to migrate from a Solo to a Parachain" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/pallets/xcm/Cargo.toml b/cumulus/pallets/xcm/Cargo.toml index 35d7a083b061..ff9be866d48f 100644 --- a/cumulus/pallets/xcm/Cargo.toml +++ b/cumulus/pallets/xcm/Cargo.toml @@ -5,6 +5,8 @@ name = "cumulus-pallet-xcm" version = "0.7.0" license = "Apache-2.0" description = "Pallet for stuff specific to parachains' usage of XCM" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/pallets/xcmp-queue/Cargo.toml b/cumulus/pallets/xcmp-queue/Cargo.toml index 9c7470eda6da..af70a3169d8e 100644 --- a/cumulus/pallets/xcmp-queue/Cargo.toml +++ b/cumulus/pallets/xcmp-queue/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Pallet to queue outbound and inbound XCMP messages." license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/common/Cargo.toml b/cumulus/parachains/common/Cargo.toml index 6d436bdf799a..641693a6a01b 100644 --- a/cumulus/parachains/common/Cargo.toml +++ b/cumulus/parachains/common/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Logic which is common to all parachain runtimes" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/integration-tests/emulated/common/Cargo.toml b/cumulus/parachains/integration-tests/emulated/common/Cargo.toml index 23edaf6bfe65..8282d12d317f 100644 --- a/cumulus/parachains/integration-tests/emulated/common/Cargo.toml +++ b/cumulus/parachains/integration-tests/emulated/common/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license = "Apache-2.0" description = "Common resources for integration testing with xcm-emulator" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/pallets/collective-content/Cargo.toml b/cumulus/parachains/pallets/collective-content/Cargo.toml index c52021f67e36..09301bd738f3 100644 --- a/cumulus/parachains/pallets/collective-content/Cargo.toml +++ b/cumulus/parachains/pallets/collective-content/Cargo.toml @@ -5,6 +5,8 @@ authors = ["Parity Technologies "] edition.workspace = true description = "Managed content" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/pallets/parachain-info/Cargo.toml b/cumulus/parachains/pallets/parachain-info/Cargo.toml index e0bed23c4f8c..604441c65f29 100644 --- a/cumulus/parachains/pallets/parachain-info/Cargo.toml +++ b/cumulus/parachains/pallets/parachain-info/Cargo.toml @@ -5,6 +5,8 @@ name = "staging-parachain-info" version = "0.7.0" license = "Apache-2.0" description = "Pallet to store the parachain ID" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/pallets/ping/Cargo.toml b/cumulus/parachains/pallets/ping/Cargo.toml index 51fc384a4f14..ceb38f39fd80 100644 --- a/cumulus/parachains/pallets/ping/Cargo.toml +++ b/cumulus/parachains/pallets/ping/Cargo.toml @@ -5,6 +5,8 @@ name = "cumulus-ping" version = "0.7.0" license = "Apache-2.0" description = "Ping Pallet for Cumulus XCM/UMP testing." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/assets/asset-hub-rococo/Cargo.toml b/cumulus/parachains/runtimes/assets/asset-hub-rococo/Cargo.toml index bfe8ed869758..949640dd4be6 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-rococo/Cargo.toml +++ b/cumulus/parachains/runtimes/assets/asset-hub-rococo/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Rococo variant of Asset Hub parachain runtime" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/assets/asset-hub-westend/Cargo.toml b/cumulus/parachains/runtimes/assets/asset-hub-westend/Cargo.toml index a3eaebb59153..8e47146a06c3 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/assets/asset-hub-westend/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Westend variant of Asset Hub parachain runtime" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/assets/common/Cargo.toml b/cumulus/parachains/runtimes/assets/common/Cargo.toml index fb66f0de2322..fa9efbca7a39 100644 --- a/cumulus/parachains/runtimes/assets/common/Cargo.toml +++ b/cumulus/parachains/runtimes/assets/common/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Assets common utilities" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/assets/test-utils/Cargo.toml b/cumulus/parachains/runtimes/assets/test-utils/Cargo.toml index f6b3c13e8102..393d06f95b15 100644 --- a/cumulus/parachains/runtimes/assets/test-utils/Cargo.toml +++ b/cumulus/parachains/runtimes/assets/test-utils/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Test utils for Asset Hub runtimes." license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/Cargo.toml b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/Cargo.toml index 3eb06e3a18c1..a7710783a1e0 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/Cargo.toml +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-rococo/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Rococo's BridgeHub parachain runtime" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/Cargo.toml b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/Cargo.toml index 871bf44ec5b2..91900c830ba6 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/bridge-hubs/bridge-hub-westend/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Westend's BridgeHub parachain runtime" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/bridge-hubs/common/Cargo.toml b/cumulus/parachains/runtimes/bridge-hubs/common/Cargo.toml index 9cb24a2b2820..76a89bcb2e72 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/common/Cargo.toml +++ b/cumulus/parachains/runtimes/bridge-hubs/common/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Bridge hub common utilities" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [dependencies] codec = { features = ["derive"], workspace = true } diff --git a/cumulus/parachains/runtimes/bridge-hubs/test-utils/Cargo.toml b/cumulus/parachains/runtimes/bridge-hubs/test-utils/Cargo.toml index 915b3090092f..16fef951f328 100644 --- a/cumulus/parachains/runtimes/bridge-hubs/test-utils/Cargo.toml +++ b/cumulus/parachains/runtimes/bridge-hubs/test-utils/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Utils for BridgeHub testing" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/collectives/collectives-westend/Cargo.toml b/cumulus/parachains/runtimes/collectives/collectives-westend/Cargo.toml index 810abcf572d4..dc4b73db69e3 100644 --- a/cumulus/parachains/runtimes/collectives/collectives-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/collectives/collectives-westend/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license = "Apache-2.0" description = "Westend Collectives Parachain Runtime" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/constants/Cargo.toml b/cumulus/parachains/runtimes/constants/Cargo.toml index d54f1e7db6c1..01b023e0fb89 100644 --- a/cumulus/parachains/runtimes/constants/Cargo.toml +++ b/cumulus/parachains/runtimes/constants/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Common constants for Testnet Parachains runtimes" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/contracts/contracts-rococo/Cargo.toml b/cumulus/parachains/runtimes/contracts/contracts-rococo/Cargo.toml index c98ca7ba3e74..1aeff5eb2e48 100644 --- a/cumulus/parachains/runtimes/contracts/contracts-rococo/Cargo.toml +++ b/cumulus/parachains/runtimes/contracts/contracts-rococo/Cargo.toml @@ -5,6 +5,8 @@ description = "Parachain testnet runtime for FRAME Contracts pallet." authors.workspace = true edition.workspace = true license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/coretime/coretime-rococo/Cargo.toml b/cumulus/parachains/runtimes/coretime/coretime-rococo/Cargo.toml index 02807827cf92..ab621134b252 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-rococo/Cargo.toml +++ b/cumulus/parachains/runtimes/coretime/coretime-rococo/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Rococo's Coretime parachain runtime" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/coretime/coretime-westend/Cargo.toml b/cumulus/parachains/runtimes/coretime/coretime-westend/Cargo.toml index 34353d312b1f..44dfbf93c30e 100644 --- a/cumulus/parachains/runtimes/coretime/coretime-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/coretime/coretime-westend/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Westend's Coretime parachain runtime" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/glutton/glutton-westend/Cargo.toml b/cumulus/parachains/runtimes/glutton/glutton-westend/Cargo.toml index 09b4ef679d24..9bbdb8d2ee08 100644 --- a/cumulus/parachains/runtimes/glutton/glutton-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/glutton/glutton-westend/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license = "Apache-2.0" description = "Glutton parachain runtime." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/people/people-rococo/Cargo.toml b/cumulus/parachains/runtimes/people/people-rococo/Cargo.toml index a55143b62071..893133bf3c1a 100644 --- a/cumulus/parachains/runtimes/people/people-rococo/Cargo.toml +++ b/cumulus/parachains/runtimes/people/people-rococo/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Rococo's People parachain runtime" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [build-dependencies] substrate-wasm-builder = { optional = true, workspace = true, default-features = true } diff --git a/cumulus/parachains/runtimes/people/people-westend/Cargo.toml b/cumulus/parachains/runtimes/people/people-westend/Cargo.toml index 4d66332e96dd..66b324b51af4 100644 --- a/cumulus/parachains/runtimes/people/people-westend/Cargo.toml +++ b/cumulus/parachains/runtimes/people/people-westend/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Westend's People parachain runtime" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [build-dependencies] substrate-wasm-builder = { optional = true, workspace = true, default-features = true } diff --git a/cumulus/parachains/runtimes/test-utils/Cargo.toml b/cumulus/parachains/runtimes/test-utils/Cargo.toml index e9d666617ee2..17c81ae4921a 100644 --- a/cumulus/parachains/runtimes/test-utils/Cargo.toml +++ b/cumulus/parachains/runtimes/test-utils/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Utils for Runtimes testing" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/parachains/runtimes/testing/rococo-parachain/Cargo.toml b/cumulus/parachains/runtimes/testing/rococo-parachain/Cargo.toml index b0581c8d43ff..4713f4398eaa 100644 --- a/cumulus/parachains/runtimes/testing/rococo-parachain/Cargo.toml +++ b/cumulus/parachains/runtimes/testing/rococo-parachain/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Simple runtime used by the rococo parachain(s)" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/polkadot-omni-node/Cargo.toml b/cumulus/polkadot-omni-node/Cargo.toml index a736e1ef80c5..8b46bc882868 100644 --- a/cumulus/polkadot-omni-node/Cargo.toml +++ b/cumulus/polkadot-omni-node/Cargo.toml @@ -6,6 +6,8 @@ edition.workspace = true build = "build.rs" description = "Generic binary that can run a parachain node with u32 block number and Aura consensus" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/polkadot-omni-node/lib/Cargo.toml b/cumulus/polkadot-omni-node/lib/Cargo.toml index a690229f1695..cca4ac3b2b69 100644 --- a/cumulus/polkadot-omni-node/lib/Cargo.toml +++ b/cumulus/polkadot-omni-node/lib/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Helper library that can be used to build a parachain node" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/polkadot-parachain/Cargo.toml b/cumulus/polkadot-parachain/Cargo.toml index 5520126d0742..f5ce040bb530 100644 --- a/cumulus/polkadot-parachain/Cargo.toml +++ b/cumulus/polkadot-parachain/Cargo.toml @@ -6,6 +6,8 @@ edition.workspace = true build = "build.rs" description = "Runs a polkadot parachain node" license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/primitives/aura/Cargo.toml b/cumulus/primitives/aura/Cargo.toml index 185b2d40833f..715ce3e1a03e 100644 --- a/cumulus/primitives/aura/Cargo.toml +++ b/cumulus/primitives/aura/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license = "Apache-2.0" description = "Core primitives for Aura in Cumulus" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/primitives/core/Cargo.toml b/cumulus/primitives/core/Cargo.toml index 533d368d3b00..b5bfe4fbc889 100644 --- a/cumulus/primitives/core/Cargo.toml +++ b/cumulus/primitives/core/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license = "Apache-2.0" description = "Cumulus related core primitive types and traits" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/primitives/parachain-inherent/Cargo.toml b/cumulus/primitives/parachain-inherent/Cargo.toml index a4271d3fd9cc..2ff990b8d514 100644 --- a/cumulus/primitives/parachain-inherent/Cargo.toml +++ b/cumulus/primitives/parachain-inherent/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Inherent that needs to be present in every parachain block. Contains messages and a relay chain storage-proof." license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/primitives/proof-size-hostfunction/Cargo.toml b/cumulus/primitives/proof-size-hostfunction/Cargo.toml index e61c865d05fb..6e8168091892 100644 --- a/cumulus/primitives/proof-size-hostfunction/Cargo.toml +++ b/cumulus/primitives/proof-size-hostfunction/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Hostfunction exposing storage proof size to the runtime." license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/primitives/storage-weight-reclaim/Cargo.toml b/cumulus/primitives/storage-weight-reclaim/Cargo.toml index e1ae6743335a..3c358bc25edb 100644 --- a/cumulus/primitives/storage-weight-reclaim/Cargo.toml +++ b/cumulus/primitives/storage-weight-reclaim/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Utilities to reclaim storage weight." license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/primitives/timestamp/Cargo.toml b/cumulus/primitives/timestamp/Cargo.toml index cb328e2f2cc6..70cb3e607b98 100644 --- a/cumulus/primitives/timestamp/Cargo.toml +++ b/cumulus/primitives/timestamp/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true description = "Provides timestamp related functionality for parachains." license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/primitives/utility/Cargo.toml b/cumulus/primitives/utility/Cargo.toml index 2ca8b82001d5..1444571edbe0 100644 --- a/cumulus/primitives/utility/Cargo.toml +++ b/cumulus/primitives/utility/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license = "Apache-2.0" description = "Helper datatypes for Cumulus" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/test/relay-sproof-builder/Cargo.toml b/cumulus/test/relay-sproof-builder/Cargo.toml index e266b5807081..c1efa141a45d 100644 --- a/cumulus/test/relay-sproof-builder/Cargo.toml +++ b/cumulus/test/relay-sproof-builder/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license = "Apache-2.0" description = "Mocked relay state proof builder for testing Cumulus." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/cumulus/xcm/xcm-emulator/Cargo.toml b/cumulus/xcm/xcm-emulator/Cargo.toml index 8598481fae76..d0c637d64d01 100644 --- a/cumulus/xcm/xcm-emulator/Cargo.toml +++ b/cumulus/xcm/xcm-emulator/Cargo.toml @@ -5,6 +5,8 @@ version = "0.5.0" authors.workspace = true edition.workspace = true license = "Apache-2.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/Cargo.toml b/polkadot/Cargo.toml index 3a939464868f..101caac0e313 100644 --- a/polkadot/Cargo.toml +++ b/polkadot/Cargo.toml @@ -20,6 +20,8 @@ authors.workspace = true edition.workspace = true version = "6.0.0" default-run = "polkadot" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/cli/Cargo.toml b/polkadot/cli/Cargo.toml index da37f6062c57..3eff525b7b1e 100644 --- a/polkadot/cli/Cargo.toml +++ b/polkadot/cli/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/core-primitives/Cargo.toml b/polkadot/core-primitives/Cargo.toml index 42ca27953738..33869f216f78 100644 --- a/polkadot/core-primitives/Cargo.toml +++ b/polkadot/core-primitives/Cargo.toml @@ -5,6 +5,8 @@ description = "Core Polkadot types used by Relay Chains and parachains." authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/erasure-coding/Cargo.toml b/polkadot/erasure-coding/Cargo.toml index 969742c5bb0a..528b955c4db3 100644 --- a/polkadot/erasure-coding/Cargo.toml +++ b/polkadot/erasure-coding/Cargo.toml @@ -5,6 +5,8 @@ description = "Erasure coding used for Polkadot's availability system" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/collation-generation/Cargo.toml b/polkadot/node/collation-generation/Cargo.toml index 777458673f5b..c1716e2e6eb8 100644 --- a/polkadot/node/collation-generation/Cargo.toml +++ b/polkadot/node/collation-generation/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Collator-side subsystem that handles incoming candidate submissions from the parachain." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/approval-voting-parallel/Cargo.toml b/polkadot/node/core/approval-voting-parallel/Cargo.toml index 3a98cce80e92..995687fb4c11 100644 --- a/polkadot/node/core/approval-voting-parallel/Cargo.toml +++ b/polkadot/node/core/approval-voting-parallel/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Approval Voting Subsystem running approval work in parallel" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/approval-voting/Cargo.toml b/polkadot/node/core/approval-voting/Cargo.toml index f9754d2babc9..80f5dcb7f318 100644 --- a/polkadot/node/core/approval-voting/Cargo.toml +++ b/polkadot/node/core/approval-voting/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Approval Voting Subsystem of the Polkadot node" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/av-store/Cargo.toml b/polkadot/node/core/av-store/Cargo.toml index 1d14e4cfba37..9f6864269cef 100644 --- a/polkadot/node/core/av-store/Cargo.toml +++ b/polkadot/node/core/av-store/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/backing/Cargo.toml b/polkadot/node/core/backing/Cargo.toml index cd1acf9daa93..a81fe9486c63 100644 --- a/polkadot/node/core/backing/Cargo.toml +++ b/polkadot/node/core/backing/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "The Candidate Backing Subsystem. Tracks parachain candidates that can be backed, as well as the issuance of statements about candidates." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/bitfield-signing/Cargo.toml b/polkadot/node/core/bitfield-signing/Cargo.toml index 126a18a14166..f00ba5712661 100644 --- a/polkadot/node/core/bitfield-signing/Cargo.toml +++ b/polkadot/node/core/bitfield-signing/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Bitfield signing subsystem for the Polkadot node" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/candidate-validation/Cargo.toml b/polkadot/node/core/candidate-validation/Cargo.toml index 87855dbce415..fea16b1c7604 100644 --- a/polkadot/node/core/candidate-validation/Cargo.toml +++ b/polkadot/node/core/candidate-validation/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/chain-api/Cargo.toml b/polkadot/node/core/chain-api/Cargo.toml index a8e911e0c5c9..0f443868dada 100644 --- a/polkadot/node/core/chain-api/Cargo.toml +++ b/polkadot/node/core/chain-api/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "The Chain API subsystem provides access to chain related utility functions like block number to hash conversions." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/chain-selection/Cargo.toml b/polkadot/node/core/chain-selection/Cargo.toml index 755d5cadeaaf..d2cc425a4816 100644 --- a/polkadot/node/core/chain-selection/Cargo.toml +++ b/polkadot/node/core/chain-selection/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/dispute-coordinator/Cargo.toml b/polkadot/node/core/dispute-coordinator/Cargo.toml index 344b66af1933..11b4ac645c23 100644 --- a/polkadot/node/core/dispute-coordinator/Cargo.toml +++ b/polkadot/node/core/dispute-coordinator/Cargo.toml @@ -5,6 +5,8 @@ description = "The node-side components that participate in disputes" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/parachains-inherent/Cargo.toml b/polkadot/node/core/parachains-inherent/Cargo.toml index 1e4953f40d0b..b1cd5e971b00 100644 --- a/polkadot/node/core/parachains-inherent/Cargo.toml +++ b/polkadot/node/core/parachains-inherent/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Parachains inherent data provider for Polkadot node" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/prospective-parachains/Cargo.toml b/polkadot/node/core/prospective-parachains/Cargo.toml index 5629e4ef7fbe..ced6c30c64b6 100644 --- a/polkadot/node/core/prospective-parachains/Cargo.toml +++ b/polkadot/node/core/prospective-parachains/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "The Prospective Parachains subsystem. Tracks and handles prospective parachain fragments." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/provisioner/Cargo.toml b/polkadot/node/core/provisioner/Cargo.toml index 64a598b420f7..26dca1adbc79 100644 --- a/polkadot/node/core/provisioner/Cargo.toml +++ b/polkadot/node/core/provisioner/Cargo.toml @@ -5,6 +5,8 @@ description = "Responsible for assembling a relay chain block from a set of avai authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/pvf-checker/Cargo.toml b/polkadot/node/core/pvf-checker/Cargo.toml index 73ef17a2843a..cb7e3eadcf0a 100644 --- a/polkadot/node/core/pvf-checker/Cargo.toml +++ b/polkadot/node/core/pvf-checker/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/pvf/Cargo.toml b/polkadot/node/core/pvf/Cargo.toml index 37d5878ea597..1b2a16ae8b55 100644 --- a/polkadot/node/core/pvf/Cargo.toml +++ b/polkadot/node/core/pvf/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/pvf/common/Cargo.toml b/polkadot/node/core/pvf/common/Cargo.toml index 903c8dd1af29..d058d582fc26 100644 --- a/polkadot/node/core/pvf/common/Cargo.toml +++ b/polkadot/node/core/pvf/common/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/pvf/execute-worker/Cargo.toml b/polkadot/node/core/pvf/execute-worker/Cargo.toml index 6ad340d25612..8327cf8058cd 100644 --- a/polkadot/node/core/pvf/execute-worker/Cargo.toml +++ b/polkadot/node/core/pvf/execute-worker/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/pvf/prepare-worker/Cargo.toml b/polkadot/node/core/pvf/prepare-worker/Cargo.toml index 56235bd82192..9dc800a8ef56 100644 --- a/polkadot/node/core/pvf/prepare-worker/Cargo.toml +++ b/polkadot/node/core/pvf/prepare-worker/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/core/runtime-api/Cargo.toml b/polkadot/node/core/runtime-api/Cargo.toml index 834e4b300b9e..15cbf4665d06 100644 --- a/polkadot/node/core/runtime-api/Cargo.toml +++ b/polkadot/node/core/runtime-api/Cargo.toml @@ -5,6 +5,8 @@ description = "Wrapper around the parachain-related runtime APIs" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/gum/Cargo.toml b/polkadot/node/gum/Cargo.toml index 9b2df435a06a..84875ea121b6 100644 --- a/polkadot/node/gum/Cargo.toml +++ b/polkadot/node/gum/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Stick logs together with the TraceID as provided by tempo" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/gum/proc-macro/Cargo.toml b/polkadot/node/gum/proc-macro/Cargo.toml index da6364977cae..b4a3401b15e4 100644 --- a/polkadot/node/gum/proc-macro/Cargo.toml +++ b/polkadot/node/gum/proc-macro/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Generate an overseer including builder pattern and message wrapper from a single annotated struct definition." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/metrics/Cargo.toml b/polkadot/node/metrics/Cargo.toml index 41b08b66e9b4..05344993a75e 100644 --- a/polkadot/node/metrics/Cargo.toml +++ b/polkadot/node/metrics/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/approval-distribution/Cargo.toml b/polkadot/node/network/approval-distribution/Cargo.toml index 8d674a733470..abf345552f89 100644 --- a/polkadot/node/network/approval-distribution/Cargo.toml +++ b/polkadot/node/network/approval-distribution/Cargo.toml @@ -5,6 +5,8 @@ description = "Polkadot Approval Distribution subsystem for the distribution of authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/availability-distribution/Cargo.toml b/polkadot/node/network/availability-distribution/Cargo.toml index 8c5574f244e4..e87103d99f72 100644 --- a/polkadot/node/network/availability-distribution/Cargo.toml +++ b/polkadot/node/network/availability-distribution/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/availability-recovery/Cargo.toml b/polkadot/node/network/availability-recovery/Cargo.toml index 41f09b1f7044..be4323e74f02 100644 --- a/polkadot/node/network/availability-recovery/Cargo.toml +++ b/polkadot/node/network/availability-recovery/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/bitfield-distribution/Cargo.toml b/polkadot/node/network/bitfield-distribution/Cargo.toml index 6d007255c574..2ff30489b6c1 100644 --- a/polkadot/node/network/bitfield-distribution/Cargo.toml +++ b/polkadot/node/network/bitfield-distribution/Cargo.toml @@ -5,6 +5,8 @@ description = "Polkadot Bitfiled Distribution subsystem, which gossips signed av authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/bridge/Cargo.toml b/polkadot/node/network/bridge/Cargo.toml index b4b5743853cd..c4b46c1dc001 100644 --- a/polkadot/node/network/bridge/Cargo.toml +++ b/polkadot/node/network/bridge/Cargo.toml @@ -5,6 +5,8 @@ description = "The Network Bridge Subsystem — protocol multiplexer for Polkado authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/collator-protocol/Cargo.toml b/polkadot/node/network/collator-protocol/Cargo.toml index 304cb23bb6aa..a51d24c70807 100644 --- a/polkadot/node/network/collator-protocol/Cargo.toml +++ b/polkadot/node/network/collator-protocol/Cargo.toml @@ -5,6 +5,8 @@ description = "Polkadot Collator Protocol subsystem. Allows collators and valida authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/dispute-distribution/Cargo.toml b/polkadot/node/network/dispute-distribution/Cargo.toml index b4dcafe09eb6..4f2f9ccadf8b 100644 --- a/polkadot/node/network/dispute-distribution/Cargo.toml +++ b/polkadot/node/network/dispute-distribution/Cargo.toml @@ -5,6 +5,8 @@ description = "Polkadot Dispute Distribution subsystem, which ensures all concer authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/gossip-support/Cargo.toml b/polkadot/node/network/gossip-support/Cargo.toml index c8c19e5de070..7d17ea45eab9 100644 --- a/polkadot/node/network/gossip-support/Cargo.toml +++ b/polkadot/node/network/gossip-support/Cargo.toml @@ -5,6 +5,8 @@ description = "Polkadot Gossip Support subsystem. Responsible for keeping track authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/protocol/Cargo.toml b/polkadot/node/network/protocol/Cargo.toml index 3d51d3c0a565..0bcf224332bc 100644 --- a/polkadot/node/network/protocol/Cargo.toml +++ b/polkadot/node/network/protocol/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Primitives types for the Node-side" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/network/statement-distribution/Cargo.toml b/polkadot/node/network/statement-distribution/Cargo.toml index de07937ffb0a..d737c7bf8968 100644 --- a/polkadot/node/network/statement-distribution/Cargo.toml +++ b/polkadot/node/network/statement-distribution/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/overseer/Cargo.toml b/polkadot/node/overseer/Cargo.toml index 2253a5ae0c66..62634c1da090 100644 --- a/polkadot/node/overseer/Cargo.toml +++ b/polkadot/node/overseer/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "System overseer of the Polkadot node" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/primitives/Cargo.toml b/polkadot/node/primitives/Cargo.toml index 7185205f905b..50ee3a80ddb8 100644 --- a/polkadot/node/primitives/Cargo.toml +++ b/polkadot/node/primitives/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/service/Cargo.toml b/polkadot/node/service/Cargo.toml index 6e8eade21a43..7f58a56d5d16 100644 --- a/polkadot/node/service/Cargo.toml +++ b/polkadot/node/service/Cargo.toml @@ -6,6 +6,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Utils to tie different Polkadot components together and allow instantiation of a node." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/subsystem-types/Cargo.toml b/polkadot/node/subsystem-types/Cargo.toml index b5686ec96be1..44bb7036d63d 100644 --- a/polkadot/node/subsystem-types/Cargo.toml +++ b/polkadot/node/subsystem-types/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/subsystem-util/Cargo.toml b/polkadot/node/subsystem-util/Cargo.toml index d12daa572055..9c21fede1c47 100644 --- a/polkadot/node/subsystem-util/Cargo.toml +++ b/polkadot/node/subsystem-util/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/subsystem/Cargo.toml b/polkadot/node/subsystem/Cargo.toml index ce4bceec7336..4f30d3ce9c09 100644 --- a/polkadot/node/subsystem/Cargo.toml +++ b/polkadot/node/subsystem/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/node/tracking-allocator/Cargo.toml b/polkadot/node/tracking-allocator/Cargo.toml index d98377e53759..0fbf526ccb8b 100644 --- a/polkadot/node/tracking-allocator/Cargo.toml +++ b/polkadot/node/tracking-allocator/Cargo.toml @@ -5,6 +5,8 @@ version = "2.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/parachain/Cargo.toml b/polkadot/parachain/Cargo.toml index 9d0518fd46ad..ea6c4423dc19 100644 --- a/polkadot/parachain/Cargo.toml +++ b/polkadot/parachain/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true version = "6.0.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/primitives/Cargo.toml b/polkadot/primitives/Cargo.toml index dd269caa2d60..150aaf153fa7 100644 --- a/polkadot/primitives/Cargo.toml +++ b/polkadot/primitives/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Shared primitives used by Polkadot runtime" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/rpc/Cargo.toml b/polkadot/rpc/Cargo.toml index d01528d4dee0..48980dde4bbc 100644 --- a/polkadot/rpc/Cargo.toml +++ b/polkadot/rpc/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Polkadot specific RPC functionality." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/runtime/common/Cargo.toml b/polkadot/runtime/common/Cargo.toml index 01b56b31cf20..1646db54455a 100644 --- a/polkadot/runtime/common/Cargo.toml +++ b/polkadot/runtime/common/Cargo.toml @@ -5,6 +5,8 @@ description = "Pallets and constants used in Relay Chain networks." authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/runtime/common/slot_range_helper/Cargo.toml b/polkadot/runtime/common/slot_range_helper/Cargo.toml index 02810b75283f..3f110bdd76c6 100644 --- a/polkadot/runtime/common/slot_range_helper/Cargo.toml +++ b/polkadot/runtime/common/slot_range_helper/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Helper crate for generating slot ranges for the Polkadot runtime." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/runtime/metrics/Cargo.toml b/polkadot/runtime/metrics/Cargo.toml index 3709e1eb697e..0415e4754009 100644 --- a/polkadot/runtime/metrics/Cargo.toml +++ b/polkadot/runtime/metrics/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Runtime metric interface for the Polkadot node" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/runtime/parachains/Cargo.toml b/polkadot/runtime/parachains/Cargo.toml index a3eec3f9d961..b01778eeb424 100644 --- a/polkadot/runtime/parachains/Cargo.toml +++ b/polkadot/runtime/parachains/Cargo.toml @@ -5,6 +5,8 @@ description = "Relay Chain runtime code responsible for Parachains." authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/runtime/rococo/Cargo.toml b/polkadot/runtime/rococo/Cargo.toml index 3b11c977edf3..764c53abbfcb 100644 --- a/polkadot/runtime/rococo/Cargo.toml +++ b/polkadot/runtime/rococo/Cargo.toml @@ -6,6 +6,8 @@ description = "Rococo testnet Relay Chain runtime." authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/runtime/rococo/constants/Cargo.toml b/polkadot/runtime/rococo/constants/Cargo.toml index 1d0adac44af4..921bc8f5fe92 100644 --- a/polkadot/runtime/rococo/constants/Cargo.toml +++ b/polkadot/runtime/rococo/constants/Cargo.toml @@ -5,6 +5,8 @@ description = "Constants used throughout the Rococo network." authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [package.metadata.polkadot-sdk] exclude-from-umbrella = true diff --git a/polkadot/runtime/westend/Cargo.toml b/polkadot/runtime/westend/Cargo.toml index f94301baab09..584f5855b7a4 100644 --- a/polkadot/runtime/westend/Cargo.toml +++ b/polkadot/runtime/westend/Cargo.toml @@ -6,6 +6,8 @@ description = "Westend testnet Relay Chain runtime." authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/runtime/westend/constants/Cargo.toml b/polkadot/runtime/westend/constants/Cargo.toml index 27d5b19b8e77..a50e2f9cc639 100644 --- a/polkadot/runtime/westend/constants/Cargo.toml +++ b/polkadot/runtime/westend/constants/Cargo.toml @@ -5,6 +5,8 @@ description = "Constants used throughout the Westend network." authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [package.metadata.polkadot-sdk] exclude-from-umbrella = true diff --git a/polkadot/statement-table/Cargo.toml b/polkadot/statement-table/Cargo.toml index 53ea0b74463b..d9519dafe12d 100644 --- a/polkadot/statement-table/Cargo.toml +++ b/polkadot/statement-table/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Stores messages other authorities issue about candidates in Polkadot." +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/utils/generate-bags/Cargo.toml b/polkadot/utils/generate-bags/Cargo.toml index 16205b0f51f5..3006d8325ef9 100644 --- a/polkadot/utils/generate-bags/Cargo.toml +++ b/polkadot/utils/generate-bags/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "CLI to generate voter bags for Polkadot runtimes" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/xcm/Cargo.toml b/polkadot/xcm/Cargo.toml index 86c7067ad6fa..113e72c27ae1 100644 --- a/polkadot/xcm/Cargo.toml +++ b/polkadot/xcm/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/xcm/pallet-xcm-benchmarks/Cargo.toml b/polkadot/xcm/pallet-xcm-benchmarks/Cargo.toml index b07bdfdca3d1..fe2b78163223 100644 --- a/polkadot/xcm/pallet-xcm-benchmarks/Cargo.toml +++ b/polkadot/xcm/pallet-xcm-benchmarks/Cargo.toml @@ -5,6 +5,8 @@ edition.workspace = true license.workspace = true version = "7.0.0" description = "Benchmarks for the XCM pallet" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/xcm/pallet-xcm/Cargo.toml b/polkadot/xcm/pallet-xcm/Cargo.toml index 4d44d75e34dd..e8cdd3b4931b 100644 --- a/polkadot/xcm/pallet-xcm/Cargo.toml +++ b/polkadot/xcm/pallet-xcm/Cargo.toml @@ -5,6 +5,8 @@ description = "A pallet for handling XCM programs." authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/xcm/procedural/Cargo.toml b/polkadot/xcm/procedural/Cargo.toml index 83b35d19cf7e..3167766158ff 100644 --- a/polkadot/xcm/procedural/Cargo.toml +++ b/polkadot/xcm/procedural/Cargo.toml @@ -6,6 +6,8 @@ edition.workspace = true license.workspace = true version = "7.0.0" publish = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/xcm/xcm-builder/Cargo.toml b/polkadot/xcm/xcm-builder/Cargo.toml index eaa115740f3e..2819a0b0a555 100644 --- a/polkadot/xcm/xcm-builder/Cargo.toml +++ b/polkadot/xcm/xcm-builder/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true version = "7.0.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/xcm/xcm-executor/Cargo.toml b/polkadot/xcm/xcm-executor/Cargo.toml index cc966f91fe4d..20ca40de5faa 100644 --- a/polkadot/xcm/xcm-executor/Cargo.toml +++ b/polkadot/xcm/xcm-executor/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true version = "7.0.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/xcm/xcm-simulator/Cargo.toml b/polkadot/xcm/xcm-simulator/Cargo.toml index c7caa49393ed..47900e226d48 100644 --- a/polkadot/xcm/xcm-simulator/Cargo.toml +++ b/polkadot/xcm/xcm-simulator/Cargo.toml @@ -5,6 +5,8 @@ version = "7.0.0" authors.workspace = true edition.workspace = true license.workspace = true +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/polkadot/xcm/xcm-simulator/example/Cargo.toml b/polkadot/xcm/xcm-simulator/example/Cargo.toml index e0aff9b7782a..6fbe9243944a 100644 --- a/polkadot/xcm/xcm-simulator/example/Cargo.toml +++ b/polkadot/xcm/xcm-simulator/example/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true version = "7.0.0" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/prdoc/pr_6549.prdoc b/prdoc/pr_6549.prdoc new file mode 100644 index 000000000000..61a64c724185 --- /dev/null +++ b/prdoc/pr_6549.prdoc @@ -0,0 +1,247 @@ +doc: [] + +crates: + - name: polkadot-sdk + bump: none + - name: asset-test-utils + bump: none + - name: cumulus-pallet-parachain-system + bump: none + - name: cumulus-pallet-parachain-system-proc-macro + bump: none + - name: cumulus-primitives-core + bump: none + - name: polkadot-core-primitives + bump: none + - name: polkadot-parachain-primitives + bump: none + - name: polkadot-primitives + bump: none + - name: staging-xcm + bump: none + - name: xcm-procedural + bump: none + - name: cumulus-primitives-parachain-inherent + bump: none + - name: cumulus-primitives-proof-size-hostfunction + bump: none + - name: polkadot-runtime-common + bump: none + - name: polkadot-runtime-parachains + bump: none + - name: polkadot-runtime-metrics + bump: none + - name: staging-xcm-executor + bump: none + - name: slot-range-helper + bump: none + - name: staging-xcm-builder + bump: none + - name: pallet-xcm + bump: none + - name: cumulus-primitives-storage-weight-reclaim + bump: none + - name: cumulus-pallet-aura-ext + bump: none + - name: cumulus-primitives-aura + bump: none + - name: staging-parachain-info + bump: none + - name: cumulus-test-relay-sproof-builder + bump: none + - name: cumulus-client-cli + bump: none + - name: cumulus-client-collator + bump: none + - name: cumulus-client-consensus-common + bump: none + - name: cumulus-client-pov-recovery + bump: none + - name: cumulus-relay-chain-interface + bump: none + - name: polkadot-overseer + bump: none + - name: tracing-gum + bump: none + - name: tracing-gum-proc-macro + bump: none + - name: polkadot-node-metrics + bump: none + - name: polkadot-node-primitives + bump: none + - name: polkadot-erasure-coding + bump: none + - name: polkadot-node-subsystem + bump: none + - name: polkadot-node-subsystem-types + bump: none + - name: polkadot-node-network-protocol + bump: none + - name: polkadot-statement-table + bump: none + - name: polkadot-rpc + bump: none + - name: polkadot-service + bump: none + - name: cumulus-client-parachain-inherent + bump: none + - name: westend-runtime + bump: none + - name: pallet-xcm-benchmarks + bump: none + - name: westend-runtime-constants + bump: none + - name: polkadot-approval-distribution + bump: none + - name: polkadot-node-subsystem-util + bump: none + - name: polkadot-availability-bitfield-distribution + bump: none + - name: polkadot-availability-distribution + bump: none + - name: polkadot-availability-recovery + bump: none + - name: polkadot-node-core-approval-voting + bump: none + - name: polkadot-node-core-approval-voting-parallel + bump: none + - name: polkadot-node-core-av-store + bump: none + - name: polkadot-node-core-chain-api + bump: none + - name: polkadot-statement-distribution + bump: none + - name: polkadot-collator-protocol + bump: none + - name: polkadot-dispute-distribution + bump: none + - name: polkadot-gossip-support + bump: none + - name: polkadot-network-bridge + bump: none + - name: polkadot-node-collation-generation + bump: none + - name: polkadot-node-core-backing + bump: none + - name: polkadot-node-core-bitfield-signing + bump: none + - name: polkadot-node-core-candidate-validation + bump: none + - name: polkadot-node-core-pvf + bump: none + - name: polkadot-node-core-pvf-common + bump: none + - name: polkadot-node-core-pvf-execute-worker + bump: none + - name: polkadot-node-core-pvf-prepare-worker + bump: none + - name: staging-tracking-allocator + bump: none + - name: rococo-runtime + bump: none + - name: rococo-runtime-constants + bump: none + - name: polkadot-node-core-chain-selection + bump: none + - name: polkadot-node-core-dispute-coordinator + bump: none + - name: polkadot-node-core-parachains-inherent + bump: none + - name: polkadot-node-core-prospective-parachains + bump: none + - name: polkadot-node-core-provisioner + bump: none + - name: polkadot-node-core-pvf-checker + bump: none + - name: polkadot-node-core-runtime-api + bump: none + - name: cumulus-client-network + bump: none + - name: cumulus-relay-chain-inprocess-interface + bump: none + - name: polkadot-cli + bump: none + - name: cumulus-client-consensus-aura + bump: none + - name: cumulus-client-consensus-proposer + bump: none + - name: cumulus-client-consensus-relay-chain + bump: none + - name: cumulus-client-service + bump: none + - name: cumulus-relay-chain-minimal-node + bump: none + - name: cumulus-relay-chain-rpc-interface + bump: none + - name: parachains-common + bump: none + - name: cumulus-primitives-utility + bump: none + - name: cumulus-pallet-xcmp-queue + bump: none + - name: parachains-runtimes-test-utils + bump: none + - name: assets-common + bump: none + - name: bridge-hub-common + bump: none + - name: bridge-hub-test-utils + bump: none + - name: cumulus-pallet-solo-to-para + bump: none + - name: cumulus-pallet-xcm + bump: none + - name: cumulus-ping + bump: none + - name: cumulus-primitives-timestamp + bump: none + - name: emulated-integration-tests-common + bump: none + - name: xcm-emulator + bump: none + - name: pallet-collective-content + bump: none + - name: xcm-simulator + bump: none + - name: pallet-revive-fixtures + bump: none + - name: polkadot-omni-node-lib + bump: none + - name: snowbridge-runtime-test-common + bump: none + - name: testnet-parachains-constants + bump: none + - name: asset-hub-rococo-runtime + bump: none + - name: asset-hub-westend-runtime + bump: none + - name: bridge-hub-rococo-runtime + bump: none + - name: bridge-hub-westend-runtime + bump: none + - name: collectives-westend-runtime + bump: none + - name: coretime-rococo-runtime + bump: none + - name: coretime-westend-runtime + bump: none + - name: people-rococo-runtime + bump: none + - name: people-westend-runtime + bump: none + - name: contracts-rococo-runtime + bump: none + - name: glutton-westend-runtime + bump: none + - name: rococo-parachain-runtime + bump: none + - name: polkadot-omni-node + bump: none + - name: polkadot-parachain-bin + bump: none + - name: polkadot + bump: none + - name: polkadot-voter-bags + bump: none + - name: xcm-simulator-example + bump: none diff --git a/scripts/generate-umbrella.py b/scripts/generate-umbrella.py index 8326909c3449..ae3873180553 100644 --- a/scripts/generate-umbrella.py +++ b/scripts/generate-umbrella.py @@ -120,6 +120,8 @@ def main(path, version): "edition": { "workspace": True }, "authors": { "workspace": True }, "description": "Polkadot SDK umbrella crate.", + "homepage": { "workspace": True }, + "repository": { "workspace": True }, "license": "Apache-2.0", "metadata": { "docs": { "rs": { "features": ["runtime-full", "node"], diff --git a/substrate/frame/revive/fixtures/Cargo.toml b/substrate/frame/revive/fixtures/Cargo.toml index 798ed8c75a5a..9fd434db6179 100644 --- a/substrate/frame/revive/fixtures/Cargo.toml +++ b/substrate/frame/revive/fixtures/Cargo.toml @@ -5,6 +5,8 @@ authors.workspace = true edition.workspace = true license.workspace = true description = "Fixtures for testing and benchmarking" +homepage.workspace = true +repository.workspace = true [lints] workspace = true diff --git a/umbrella/Cargo.toml b/umbrella/Cargo.toml index 7f50658c4e16..9affcffd2ade 100644 --- a/umbrella/Cargo.toml +++ b/umbrella/Cargo.toml @@ -617,6 +617,12 @@ workspace = true [package.authors] workspace = true +[package.homepage] +workspace = true + +[package.repository] +workspace = true + [dependencies.assets-common] path = "../cumulus/parachains/runtimes/assets/common" default-features = false From c56a98b991e2cdce7419813886a74d5280b66d2a Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Alexander=20Thei=C3=9Fen?= Date: Tue, 3 Dec 2024 13:44:52 +0100 Subject: [PATCH 61/64] pallet-revive-fixtures: Try not to re-create fixture dir (#6735) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit On some systems trying to re-create the output directory will lead to an error. Fixes https://github.com/paritytech/subxt/issues/1876 --------- Co-authored-by: Bastian Köcher --- substrate/frame/revive/fixtures/build.rs | 9 +++++++-- 1 file changed, 7 insertions(+), 2 deletions(-) diff --git a/substrate/frame/revive/fixtures/build.rs b/substrate/frame/revive/fixtures/build.rs index 46cd5760ca4e..eca547bc6ddd 100644 --- a/substrate/frame/revive/fixtures/build.rs +++ b/substrate/frame/revive/fixtures/build.rs @@ -204,10 +204,15 @@ fn create_out_dir() -> Result { .join("pallet-revive-fixtures"); // clean up some leftover symlink from previous versions of this script - if out_dir.exists() && !out_dir.is_dir() { + let mut out_exists = out_dir.exists(); + if out_exists && !out_dir.is_dir() { fs::remove_file(&out_dir)?; + out_exists = false; + } + + if !out_exists { + fs::create_dir(&out_dir).context("Failed to create output directory")?; } - fs::create_dir_all(&out_dir).context("Failed to create output directory")?; // write the location of the out dir so it can be found later let mut file = fs::File::create(temp_dir.join("fixture_location.rs")) From d1d92ab76004ce349a97fc5d325eaf9a4a7101b7 Mon Sep 17 00:00:00 2001 From: PG Herveou Date: Tue, 3 Dec 2024 13:45:35 +0100 Subject: [PATCH 62/64] Bump Westend AH (#6583) Bump Asset-Hub westend spec version --------- Co-authored-by: GitHub Action --- .../runtimes/assets/asset-hub-westend/src/lib.rs | 2 +- prdoc/pr_6583.prdoc | 7 +++++++ 2 files changed, 8 insertions(+), 1 deletion(-) create mode 100644 prdoc/pr_6583.prdoc diff --git a/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs b/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs index 98d647d868db..21368e9c2b4b 100644 --- a/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs +++ b/cumulus/parachains/runtimes/assets/asset-hub-westend/src/lib.rs @@ -124,7 +124,7 @@ pub const VERSION: RuntimeVersion = RuntimeVersion { spec_name: alloc::borrow::Cow::Borrowed("westmint"), impl_name: alloc::borrow::Cow::Borrowed("westmint"), authoring_version: 1, - spec_version: 1_016_008, + spec_version: 1_017_002, impl_version: 0, apis: RUNTIME_API_VERSIONS, transaction_version: 16, diff --git a/prdoc/pr_6583.prdoc b/prdoc/pr_6583.prdoc new file mode 100644 index 000000000000..0e67ed33e27c --- /dev/null +++ b/prdoc/pr_6583.prdoc @@ -0,0 +1,7 @@ +title: Bump Westend AH +doc: +- audience: Runtime Dev + description: Bump Asset-Hub westend spec version +crates: +- name: asset-hub-westend-runtime + bump: minor From 896c81440c1dd169bd2f5e65aba46eca228609f8 Mon Sep 17 00:00:00 2001 From: Lulu Date: Tue, 3 Dec 2024 14:18:05 +0100 Subject: [PATCH 63/64] Add publish-check-compile workflow (#6556) Add publish-check-compile workflow This Applies staged prdocs then configures crate deps to pull from crates.io for our already published crates and local paths for things to be published. Then runs cargo check on the result. This results in a build state consitent with that of publish time and should catch compile errors that we would of otherwise ran into mid pubish. This acts as a supplement to the check-semver job. check-semver works on a high level and judges what changes are incorrect and why. This job just runs the change, sees if it compiles, and if not spits out a compile error. --- .github/workflows/publish-check-compile.yml | 48 +++++++++++++++++++++ 1 file changed, 48 insertions(+) create mode 100644 .github/workflows/publish-check-compile.yml diff --git a/.github/workflows/publish-check-compile.yml b/.github/workflows/publish-check-compile.yml new file mode 100644 index 000000000000..83cd3ff8fa90 --- /dev/null +++ b/.github/workflows/publish-check-compile.yml @@ -0,0 +1,48 @@ +name: Check publish build + +on: + push: + branches: + - master + pull_request: + types: [opened, synchronize, reopened, ready_for_review] + merge_group: + +concurrency: + group: ${{ github.workflow }}-${{ github.event.pull_request.number || github.ref }} + cancel-in-progress: true + +jobs: + preflight: + uses: ./.github/workflows/reusable-preflight.yml + + check-publish: + timeout-minutes: 90 + needs: [preflight] + runs-on: ${{ needs.preflight.outputs.RUNNER }} + container: + image: ${{ needs.preflight.outputs.IMAGE }} + steps: + - uses: actions/checkout@6d193bf28034eafb982f37bd894289fe649468fc # v4.1.7 + + - name: Rust Cache + uses: Swatinem/rust-cache@82a92a6e8fbeee089604da2575dc567ae9ddeaab # v2.7.5 + with: + cache-on-failure: true + + - name: install parity-publish + run: cargo install parity-publish@0.10.2 --locked -q + + - name: parity-publish update plan + run: parity-publish --color always plan --skip-check --prdoc prdoc/ + + - name: parity-publish apply plan + run: parity-publish --color always apply --registry + + - name: parity-publish check compile + run: | + packages="$(parity-publish apply --print)" + + if [ -n "$packages" ]; then + cargo --color always check $(printf -- '-p %s ' $packages) + fi From 41a5d8ec5f3d3d0ff82899be66113b223395ade5 Mon Sep 17 00:00:00 2001 From: Michal Kucharczyk <1728078+michalkucharczyk@users.noreply.github.com> Date: Tue, 3 Dec 2024 18:02:03 +0100 Subject: [PATCH 64/64] `fatxpool`: handling limits and priorities improvements (#6405) This PR provides a number of improvements around handling limits and priorities in the fork-aware transaction pool. #### Notes to reviewers. #### Following are the notable changes: 1. #### [Better support](https://github.com/paritytech/polkadot-sdk/pull/6405/commits/414ec3ccad154c9a2aab0586bfa2d2c884fd140f) for `Usurped` transactions When any view reports an `Usurped` transaction (replaced by other with higher priority) it is removed from all the views (also inactive). Removal is implemented by simply submitting usurper transaction to all the views. It is also ensured that usurped tx will not sneak into the `view_store` in newly created view (this is why `ViewStore::pending_txs_replacements` was added). 1. #### [`TimedTransactionSource`](https://github.com/paritytech/polkadot-sdk/pull/6405/commits/f10590f3bde69b31250761a5b10802fb139ab2b2) introduced: Every view now has an information when the transaction entered the pool. Enforce limits (now only for future txs) uses this timestamp to find worst transactions. Having common timestamp ensures coherent assessment of the transaction's importance across different views. This also could later be used to select which ready transaction shall be dropped. 1. #### `DroppedWatcher`: [improved logic](https://github.com/paritytech/polkadot-sdk/pull/6405/commits/560db28c987dd1e634119788ebc8318967df206b) for future transactions For future transaction - if the last referencing view is removed, the transaction will be dropped from the pool. This prevents future unincluded and un-promoted transactions from staying in the pool for long time. #### And some minor changes: 1. [simplified](https://github.com/paritytech/polkadot-sdk/pull/6405/commits/2d0bbf83e2df2b4c641ef84c1188907c4bfad3c6) the flow in `update_view_with_mempool` (code duplication + minor bug fix). 2. `graph::BasePool`: [handling priorities](https://github.com/paritytech/polkadot-sdk/pull/6405/commits/c9f2d39355853d034fdbc6ea31e4e0e5bf34cb6a) for future transaction improved (previously transaction with lower prio was reported as failed), 3. `graph::listener`: dedicated `limit_enforced`/`usurped`/`dropped` [calls added](https://github.com/paritytech/polkadot-sdk/pull/6405/commits/7b58a68cccfcf372321ea41826fbe9d4222829cf), 4. flaky test [fixed](https://github.com/paritytech/polkadot-sdk/pull/6405/commits/e0a7bc6c048245943796839b166505e2aecdbd7d) 5. new tests added, related to: #5809 --------- Co-authored-by: GitHub Action Co-authored-by: Iulian Barbu <14218860+iulianbarbu@users.noreply.github.com> --- prdoc/pr_6405.prdoc | 9 + .../client/transaction-pool/benches/basics.rs | 4 +- .../src/fork_aware_txpool/dropped_watcher.rs | 291 +++++++++++++----- .../fork_aware_txpool/fork_aware_txpool.rs | 199 +++++++----- .../import_notification_sink.rs | 19 +- .../fork_aware_txpool/multi_view_listener.rs | 38 ++- .../fork_aware_txpool/revalidation_worker.rs | 9 +- .../src/fork_aware_txpool/tx_mem_pool.rs | 88 ++++-- .../src/fork_aware_txpool/view.rs | 31 +- .../src/fork_aware_txpool/view_store.rs | 262 ++++++++++++++-- .../transaction-pool/src/graph/base_pool.rs | 159 +++++++++- .../transaction-pool/src/graph/listener.rs | 47 ++- .../client/transaction-pool/src/graph/pool.rs | 30 +- .../transaction-pool/src/graph/ready.rs | 5 +- .../transaction-pool/src/graph/rotator.rs | 5 +- .../src/graph/validated_pool.rs | 27 +- .../transaction-pool/src/graph/watcher.rs | 6 + substrate/client/transaction-pool/src/lib.rs | 5 +- .../src/single_state_txpool/revalidation.rs | 25 +- .../single_state_txpool.rs | 46 ++- .../client/transaction-pool/tests/fatp.rs | 14 +- .../transaction-pool/tests/fatp_common/mod.rs | 14 + .../transaction-pool/tests/fatp_limits.rs | 189 ++++++++++++ .../transaction-pool/tests/fatp_prios.rs | 249 +++++++++++++++ .../client/transaction-pool/tests/pool.rs | 28 +- 25 files changed, 1420 insertions(+), 379 deletions(-) create mode 100644 prdoc/pr_6405.prdoc create mode 100644 substrate/client/transaction-pool/tests/fatp_prios.rs diff --git a/prdoc/pr_6405.prdoc b/prdoc/pr_6405.prdoc new file mode 100644 index 000000000000..9e4e0b3c6c20 --- /dev/null +++ b/prdoc/pr_6405.prdoc @@ -0,0 +1,9 @@ +title: '`fatxpool`: handling limits and priorities improvements' +doc: +- audience: Node Dev + description: |- + This PR provides a number of improvements and fixes around handling limits and priorities in the fork-aware transaction pool. + +crates: +- name: sc-transaction-pool + bump: major diff --git a/substrate/client/transaction-pool/benches/basics.rs b/substrate/client/transaction-pool/benches/basics.rs index 0d8c1cbba9b4..5e40b0fb72d6 100644 --- a/substrate/client/transaction-pool/benches/basics.rs +++ b/substrate/client/transaction-pool/benches/basics.rs @@ -152,7 +152,7 @@ fn uxt(transfer: TransferData) -> Extrinsic { } fn bench_configured(pool: Pool, number: u64, api: Arc) { - let source = TransactionSource::External; + let source = TimedTransactionSource::new_external(false); let mut futures = Vec::new(); let mut tags = Vec::new(); let at = HashAndNumber { @@ -171,7 +171,7 @@ fn bench_configured(pool: Pool, number: u64, api: Arc) { tags.push(to_tag(nonce, AccountId::from_h256(H256::from_low_u64_be(1)))); - futures.push(pool.submit_one(&at, source, xt)); + futures.push(pool.submit_one(&at, source.clone(), xt)); } let res = block_on(futures::future::join_all(futures.into_iter())); diff --git a/substrate/client/transaction-pool/src/fork_aware_txpool/dropped_watcher.rs b/substrate/client/transaction-pool/src/fork_aware_txpool/dropped_watcher.rs index ecae21395c91..7679e3b169d2 100644 --- a/substrate/client/transaction-pool/src/fork_aware_txpool/dropped_watcher.rs +++ b/substrate/client/transaction-pool/src/fork_aware_txpool/dropped_watcher.rs @@ -24,7 +24,7 @@ use crate::{ common::log_xt::log_xt_trace, fork_aware_txpool::stream_map_util::next_event, - graph::{BlockHash, ChainApi, ExtrinsicHash}, + graph::{self, BlockHash, ExtrinsicHash}, LOG_TARGET, }; use futures::stream::StreamExt; @@ -33,12 +33,44 @@ use sc_transaction_pool_api::TransactionStatus; use sc_utils::mpsc; use sp_runtime::traits::Block as BlockT; use std::{ - collections::{hash_map::Entry, HashMap, HashSet}, + collections::{ + hash_map::{Entry, OccupiedEntry}, + HashMap, HashSet, + }, fmt::{self, Debug, Formatter}, pin::Pin, }; use tokio_stream::StreamMap; +/// Represents a transaction that was removed from the transaction pool, including the reason of its +/// removal. +#[derive(Debug, PartialEq)] +pub struct DroppedTransaction { + /// Hash of the dropped extrinsic. + pub tx_hash: Hash, + /// Reason of the transaction being dropped. + pub reason: DroppedReason, +} + +impl DroppedTransaction { + fn new_usurped(tx_hash: Hash, by: Hash) -> Self { + Self { reason: DroppedReason::Usurped(by), tx_hash } + } + + fn new_enforced_by_limts(tx_hash: Hash) -> Self { + Self { reason: DroppedReason::LimitsEnforced, tx_hash } + } +} + +/// Provides reason of why transactions was dropped. +#[derive(Debug, PartialEq)] +pub enum DroppedReason { + /// Transaction was replaced by other transaction (e.g. because of higher priority). + Usurped(Hash), + /// Transaction was dropped because of internal pool limits being enforced. + LimitsEnforced, +} + /// Dropped-logic related event from the single view. pub type ViewStreamEvent = crate::graph::DroppedByLimitsEvent, BlockHash>; @@ -47,7 +79,8 @@ type ViewStream = Pin> + Se /// Stream of extrinsic hashes that were dropped by the views and have no references by existing /// views. -pub(crate) type StreamOfDropped = Pin> + Send>>; +pub(crate) type StreamOfDropped = + Pin>> + Send>>; /// A type alias for a sender used as the controller of the [`MultiViewDropWatcherContext`]. /// Used to send control commands from the [`MultiViewDroppedWatcherController`] to @@ -59,24 +92,24 @@ type Controller = mpsc::TracingUnboundedSender; type CommandReceiver = mpsc::TracingUnboundedReceiver; /// Commands to control the instance of dropped transactions stream [`StreamOfDropped`]. -enum Command +enum Command where - C: ChainApi, + ChainApi: graph::ChainApi, { /// Adds a new stream of dropped-related events originating in a view with a specific block /// hash - AddView(BlockHash, ViewStream), + AddView(BlockHash, ViewStream), /// Removes an existing view's stream associated with a specific block hash. - RemoveView(BlockHash), - /// Removes internal states for given extrinsic hashes. + RemoveView(BlockHash), + /// Removes referencing views for given extrinsic hashes. /// /// Intended to ba called on finalization. - RemoveFinalizedTxs(Vec>), + RemoveFinalizedTxs(Vec>), } -impl Debug for Command +impl Debug for Command where - C: ChainApi, + ChainApi: graph::ChainApi, { fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result { match self { @@ -92,30 +125,114 @@ where /// /// This struct maintains a mapping of active views and their corresponding streams, as well as the /// state of each transaction with respect to these views. -struct MultiViewDropWatcherContext +struct MultiViewDropWatcherContext where - C: ChainApi, + ChainApi: graph::ChainApi, { /// A map that associates the views identified by corresponding block hashes with their streams /// of dropped-related events. This map is used to keep track of active views and their event /// streams. - stream_map: StreamMap, ViewStream>, + stream_map: StreamMap, ViewStream>, /// A receiver for commands to control the state of the stream, allowing the addition and /// removal of views. This is used to dynamically update which views are being tracked. - command_receiver: CommandReceiver>, - + command_receiver: CommandReceiver>, /// For each transaction hash we keep the set of hashes representing the views that see this - /// transaction as ready or future. + /// transaction as ready or in_block. + /// + /// Even if all views referencing a ready transactions are removed, we still want to keep + /// transaction, there can be a fork which sees the transaction as ready. /// /// Once transaction is dropped, dropping view is removed from the set. - transaction_states: HashMap, HashSet>>, + ready_transaction_views: HashMap, HashSet>>, + /// For each transaction hash we keep the set of hashes representing the views that see this + /// transaction as future. + /// + /// Once all views referencing a future transactions are removed, the future can be dropped. + /// + /// Once transaction is dropped, dropping view is removed from the set. + future_transaction_views: HashMap, HashSet>>, + + /// Transactions that need to be notified as dropped. + pending_dropped_transactions: Vec>, } impl MultiViewDropWatcherContext where - C: ChainApi + 'static, - <::Block as BlockT>::Hash: Unpin, + C: graph::ChainApi + 'static, + <::Block as BlockT>::Hash: Unpin, { + /// Provides the ready or future `HashSet` containing views referencing given transaction. + fn transaction_views( + &mut self, + tx_hash: ExtrinsicHash, + ) -> Option, HashSet>>> { + if let Entry::Occupied(views_keeping_tx_valid) = self.ready_transaction_views.entry(tx_hash) + { + return Some(views_keeping_tx_valid) + } + if let Entry::Occupied(views_keeping_tx_valid) = + self.future_transaction_views.entry(tx_hash) + { + return Some(views_keeping_tx_valid) + } + None + } + + /// Processes the command and updates internal state accordingly. + fn handle_command(&mut self, cmd: Command) { + match cmd { + Command::AddView(key, stream) => { + trace!( + target: LOG_TARGET, + "dropped_watcher: Command::AddView {key:?} views:{:?}", + self.stream_map.keys().collect::>() + ); + self.stream_map.insert(key, stream); + }, + Command::RemoveView(key) => { + trace!( + target: LOG_TARGET, + "dropped_watcher: Command::RemoveView {key:?} views:{:?}", + self.stream_map.keys().collect::>() + ); + self.stream_map.remove(&key); + self.ready_transaction_views.iter_mut().for_each(|(tx_hash, views)| { + trace!( + target: LOG_TARGET, + "[{:?}] dropped_watcher: Command::RemoveView ready views: {:?}", + tx_hash, + views + ); + views.remove(&key); + }); + + self.future_transaction_views.iter_mut().for_each(|(tx_hash, views)| { + trace!( + target: LOG_TARGET, + "[{:?}] dropped_watcher: Command::RemoveView future views: {:?}", + tx_hash, + views + ); + views.remove(&key); + if views.is_empty() { + self.pending_dropped_transactions.push(*tx_hash); + } + }); + }, + Command::RemoveFinalizedTxs(xts) => { + log_xt_trace!( + target: LOG_TARGET, + xts.clone(), + "[{:?}] dropped_watcher: finalized xt removed" + ); + xts.iter().for_each(|xt| { + self.ready_transaction_views.remove(xt); + self.future_transaction_views.remove(xt); + }); + }, + } + } + /// Processes a `ViewStreamEvent` from a specific view and updates the internal state /// accordingly. /// @@ -125,41 +242,69 @@ where &mut self, block_hash: BlockHash, event: ViewStreamEvent, - ) -> Option> { + ) -> Option>> { trace!( target: LOG_TARGET, - "dropped_watcher: handle_event: event:{:?} views:{:?}, ", - event, + "dropped_watcher: handle_event: event:{event:?} from:{block_hash:?} future_views:{:?} ready_views:{:?} stream_map views:{:?}, ", + self.future_transaction_views.get(&event.0), + self.ready_transaction_views.get(&event.0), self.stream_map.keys().collect::>(), ); let (tx_hash, status) = event; match status { - TransactionStatus::Ready | TransactionStatus::Future => { - self.transaction_states.entry(tx_hash).or_default().insert(block_hash); + TransactionStatus::Future => { + self.future_transaction_views.entry(tx_hash).or_default().insert(block_hash); + }, + TransactionStatus::Ready | TransactionStatus::InBlock(..) => { + // note: if future transaction was once seens as the ready we may want to treat it + // as ready transactions. Unreferenced future transactions are more likely to be + // removed when the last referencing view is removed then ready transactions. + // Transcaction seen as ready is likely quite close to be included in some + // future fork. + if let Some(mut views) = self.future_transaction_views.remove(&tx_hash) { + views.insert(block_hash); + self.ready_transaction_views.insert(tx_hash, views); + } else { + self.ready_transaction_views.entry(tx_hash).or_default().insert(block_hash); + } }, - TransactionStatus::Dropped | TransactionStatus::Usurped(_) => { - if let Entry::Occupied(mut views_keeping_tx_valid) = - self.transaction_states.entry(tx_hash) - { + TransactionStatus::Dropped => { + if let Some(mut views_keeping_tx_valid) = self.transaction_views(tx_hash) { views_keeping_tx_valid.get_mut().remove(&block_hash); - if views_keeping_tx_valid.get().is_empty() || - views_keeping_tx_valid - .get() - .iter() - .all(|h| !self.stream_map.contains_key(h)) - { - return Some(tx_hash) + if views_keeping_tx_valid.get().is_empty() { + return Some(DroppedTransaction::new_enforced_by_limts(tx_hash)) } } else { debug!("[{:?}] dropped_watcher: removing (non-tracked) tx", tx_hash); - return Some(tx_hash) + return Some(DroppedTransaction::new_enforced_by_limts(tx_hash)) } }, + TransactionStatus::Usurped(by) => + return Some(DroppedTransaction::new_usurped(tx_hash, by)), _ => {}, }; None } + /// Gets pending dropped transactions if any. + fn get_pending_dropped_transaction(&mut self) -> Option>> { + while let Some(tx_hash) = self.pending_dropped_transactions.pop() { + // never drop transaction that was seen as ready. It may not have a referencing + // view now, but such fork can appear. + if self.ready_transaction_views.get(&tx_hash).is_some() { + continue + } + + if let Some(views) = self.future_transaction_views.get(&tx_hash) { + if views.is_empty() { + self.future_transaction_views.remove(&tx_hash); + return Some(DroppedTransaction::new_enforced_by_limts(tx_hash)) + } + } + } + None + } + /// Creates a new `StreamOfDropped` and its associated event stream controller. /// /// This method initializes the internal structures and unfolds the stream of dropped @@ -176,42 +321,29 @@ where let ctx = Self { stream_map: StreamMap::new(), command_receiver, - transaction_states: Default::default(), + ready_transaction_views: Default::default(), + future_transaction_views: Default::default(), + pending_dropped_transactions: Default::default(), }; let stream_map = futures::stream::unfold(ctx, |mut ctx| async move { loop { + if let Some(dropped) = ctx.get_pending_dropped_transaction() { + debug!("dropped_watcher: sending out (pending): {dropped:?}"); + return Some((dropped, ctx)); + } tokio::select! { biased; - cmd = ctx.command_receiver.next() => { - match cmd? { - Command::AddView(key,stream) => { - trace!(target: LOG_TARGET,"dropped_watcher: Command::AddView {key:?} views:{:?}",ctx.stream_map.keys().collect::>()); - ctx.stream_map.insert(key,stream); - }, - Command::RemoveView(key) => { - trace!(target: LOG_TARGET,"dropped_watcher: Command::RemoveView {key:?} views:{:?}",ctx.stream_map.keys().collect::>()); - ctx.stream_map.remove(&key); - ctx.transaction_states.iter_mut().for_each(|(_,state)| { - state.remove(&key); - }); - }, - Command::RemoveFinalizedTxs(xts) => { - log_xt_trace!(target: LOG_TARGET, xts.clone(), "[{:?}] dropped_watcher: finalized xt removed"); - xts.iter().for_each(|xt| { - ctx.transaction_states.remove(xt); - }); - - }, - } - }, - Some(event) = next_event(&mut ctx.stream_map) => { if let Some(dropped) = ctx.handle_event(event.0, event.1) { debug!("dropped_watcher: sending out: {dropped:?}"); return Some((dropped, ctx)); } + }, + cmd = ctx.command_receiver.next() => { + ctx.handle_command(cmd?); } + } } }) @@ -225,30 +357,30 @@ where /// /// This struct provides methods to add and remove streams associated with views to and from the /// stream. -pub struct MultiViewDroppedWatcherController { +pub struct MultiViewDroppedWatcherController { /// A controller allowing to update the state of the associated [`StreamOfDropped`]. - controller: Controller>, + controller: Controller>, } -impl Clone for MultiViewDroppedWatcherController { +impl Clone for MultiViewDroppedWatcherController { fn clone(&self) -> Self { Self { controller: self.controller.clone() } } } -impl MultiViewDroppedWatcherController +impl MultiViewDroppedWatcherController where - C: ChainApi + 'static, - <::Block as BlockT>::Hash: Unpin, + ChainApi: graph::ChainApi + 'static, + <::Block as BlockT>::Hash: Unpin, { /// Creates new [`StreamOfDropped`] and its controller. - pub fn new() -> (MultiViewDroppedWatcherController, StreamOfDropped) { - let (stream_map, ctrl) = MultiViewDropWatcherContext::::event_stream(); + pub fn new() -> (MultiViewDroppedWatcherController, StreamOfDropped) { + let (stream_map, ctrl) = MultiViewDropWatcherContext::::event_stream(); (Self { controller: ctrl }, stream_map.boxed()) } /// Notifies the [`StreamOfDropped`] that new view was created. - pub fn add_view(&self, key: BlockHash, view: ViewStream) { + pub fn add_view(&self, key: BlockHash, view: ViewStream) { let _ = self.controller.unbounded_send(Command::AddView(key, view)).map_err(|e| { trace!(target: LOG_TARGET, "dropped_watcher: add_view {key:?} send message failed: {e}"); }); @@ -256,14 +388,17 @@ where /// Notifies the [`StreamOfDropped`] that the view was destroyed and shall be removed the /// stream map. - pub fn remove_view(&self, key: BlockHash) { + pub fn remove_view(&self, key: BlockHash) { let _ = self.controller.unbounded_send(Command::RemoveView(key)).map_err(|e| { trace!(target: LOG_TARGET, "dropped_watcher: remove_view {key:?} send message failed: {e}"); }); } /// Removes status info for finalized transactions. - pub fn remove_finalized_txs(&self, xts: impl IntoIterator> + Clone) { + pub fn remove_finalized_txs( + &self, + xts: impl IntoIterator> + Clone, + ) { let _ = self .controller .unbounded_send(Command::RemoveFinalizedTxs(xts.into_iter().collect())) @@ -298,7 +433,7 @@ mod dropped_watcher_tests { watcher.add_view(block_hash, view_stream); let handle = tokio::spawn(async move { output_stream.take(1).collect::>().await }); - assert_eq!(handle.await.unwrap(), vec![tx_hash]); + assert_eq!(handle.await.unwrap(), vec![DroppedTransaction::new_enforced_by_limts(tx_hash)]); } #[tokio::test] @@ -348,7 +483,10 @@ mod dropped_watcher_tests { watcher.add_view(block_hash0, view_stream0); watcher.add_view(block_hash1, view_stream1); let handle = tokio::spawn(async move { output_stream.take(1).collect::>().await }); - assert_eq!(handle.await.unwrap(), vec![tx_hash1]); + assert_eq!( + handle.await.unwrap(), + vec![DroppedTransaction::new_enforced_by_limts(tx_hash1)] + ); } #[tokio::test] @@ -373,10 +511,11 @@ mod dropped_watcher_tests { watcher.add_view(block_hash0, view_stream0); assert!(output_stream.next().now_or_never().is_none()); + watcher.remove_view(block_hash0); watcher.add_view(block_hash1, view_stream1); let handle = tokio::spawn(async move { output_stream.take(1).collect::>().await }); - assert_eq!(handle.await.unwrap(), vec![tx_hash]); + assert_eq!(handle.await.unwrap(), vec![DroppedTransaction::new_enforced_by_limts(tx_hash)]); } #[tokio::test] @@ -419,6 +558,6 @@ mod dropped_watcher_tests { let block_hash2 = H256::repeat_byte(0x03); watcher.add_view(block_hash2, view_stream2); let handle = tokio::spawn(async move { output_stream.take(1).collect::>().await }); - assert_eq!(handle.await.unwrap(), vec![tx_hash]); + assert_eq!(handle.await.unwrap(), vec![DroppedTransaction::new_enforced_by_limts(tx_hash)]); } } diff --git a/substrate/client/transaction-pool/src/fork_aware_txpool/fork_aware_txpool.rs b/substrate/client/transaction-pool/src/fork_aware_txpool/fork_aware_txpool.rs index 065d0cb3a274..4ec87f1fefa4 100644 --- a/substrate/client/transaction-pool/src/fork_aware_txpool/fork_aware_txpool.rs +++ b/substrate/client/transaction-pool/src/fork_aware_txpool/fork_aware_txpool.rs @@ -23,7 +23,7 @@ use super::{ import_notification_sink::MultiViewImportNotificationSink, metrics::MetricsLink as PrometheusMetrics, multi_view_listener::MultiViewListener, - tx_mem_pool::{TxInMemPool, TxMemPool, TXMEMPOOL_TRANSACTION_LIMIT_MULTIPLIER}, + tx_mem_pool::{InsertionInfo, TxInMemPool, TxMemPool, TXMEMPOOL_TRANSACTION_LIMIT_MULTIPLIER}, view::View, view_store::ViewStore, }; @@ -31,8 +31,12 @@ use crate::{ api::FullChainApi, common::log_xt::log_xt_trace, enactment_state::{EnactmentAction, EnactmentState}, - fork_aware_txpool::revalidation_worker, - graph::{self, base_pool::Transaction, ExtrinsicFor, ExtrinsicHash, IsValidator, Options}, + fork_aware_txpool::{dropped_watcher::DroppedReason, revalidation_worker}, + graph::{ + self, + base_pool::{TimedTransactionSource, Transaction}, + ExtrinsicFor, ExtrinsicHash, IsValidator, Options, + }, ReadyIteratorFor, LOG_TARGET, }; use async_trait::async_trait; @@ -197,9 +201,14 @@ where let (dropped_stream_controller, dropped_stream) = MultiViewDroppedWatcherController::::new(); + + let view_store = + Arc::new(ViewStore::new(pool_api.clone(), listener, dropped_stream_controller)); + let dropped_monitor_task = Self::dropped_monitor_task( dropped_stream, mempool.clone(), + view_store.clone(), import_notification_sink.clone(), ); @@ -216,8 +225,8 @@ where ( Self { mempool, - api: pool_api.clone(), - view_store: Arc::new(ViewStore::new(pool_api, listener, dropped_stream_controller)), + api: pool_api, + view_store, ready_poll: Arc::from(Mutex::from(ReadyPoll::new())), enactment_state: Arc::new(Mutex::new(EnactmentState::new( best_block_hash, @@ -233,14 +242,17 @@ where ) } - /// Monitors the stream of dropped transactions and removes them from the mempool. + /// Monitors the stream of dropped transactions and removes them from the mempool and + /// view_store. /// /// This asynchronous task continuously listens for dropped transaction notifications provided /// within `dropped_stream` and ensures that these transactions are removed from the `mempool` - /// and `import_notification_sink` instances. + /// and `import_notification_sink` instances. For Usurped events, the transaction is also + /// removed from the view_store. async fn dropped_monitor_task( mut dropped_stream: StreamOfDropped, mempool: Arc>, + view_store: Arc>, import_notification_sink: MultiViewImportNotificationSink< Block::Hash, ExtrinsicHash, @@ -251,9 +263,33 @@ where log::debug!(target: LOG_TARGET, "fatp::dropped_monitor_task: terminated..."); break; }; - log::trace!(target: LOG_TARGET, "[{:?}] fatp::dropped notification, removing", dropped); - mempool.remove_dropped_transactions(&[dropped]).await; - import_notification_sink.clean_notified_items(&[dropped]); + let dropped_tx_hash = dropped.tx_hash; + log::trace!(target: LOG_TARGET, "[{:?}] fatp::dropped notification {:?}, removing", dropped_tx_hash,dropped.reason); + match dropped.reason { + DroppedReason::Usurped(new_tx_hash) => { + if let Some(new_tx) = mempool.get_by_hash(new_tx_hash) { + view_store + .replace_transaction( + new_tx.source(), + new_tx.tx(), + dropped_tx_hash, + new_tx.is_watched(), + ) + .await; + } else { + log::trace!( + target:LOG_TARGET, + "error: dropped_monitor_task: no entry in mempool for new transaction {:?}", + new_tx_hash, + ); + } + }, + DroppedReason::LimitsEnforced => {}, + }; + + mempool.remove_dropped_transaction(&dropped_tx_hash).await; + view_store.listener.transaction_dropped(dropped); + import_notification_sink.clean_notified_items(&[dropped_tx_hash]); } } @@ -288,9 +324,13 @@ where let (dropped_stream_controller, dropped_stream) = MultiViewDroppedWatcherController::::new(); + + let view_store = + Arc::new(ViewStore::new(pool_api.clone(), listener, dropped_stream_controller)); let dropped_monitor_task = Self::dropped_monitor_task( dropped_stream, mempool.clone(), + view_store.clone(), import_notification_sink.clone(), ); @@ -306,8 +346,8 @@ where Self { mempool, - api: pool_api.clone(), - view_store: Arc::new(ViewStore::new(pool_api, listener, dropped_stream_controller)), + api: pool_api, + view_store, ready_poll: Arc::from(Mutex::from(ReadyPoll::new())), enactment_state: Arc::new(Mutex::new(EnactmentState::new( best_block_hash, @@ -366,6 +406,16 @@ where self.mempool.unwatched_and_watched_count() } + /// Returns a set of future transactions for given block hash. + /// + /// Intended for logging / tests. + pub fn futures_at( + &self, + at: Block::Hash, + ) -> Option, ExtrinsicFor>>> { + self.view_store.futures_at(at) + } + /// Returns a best-effort set of ready transactions for a given block, without executing full /// maintain process. /// @@ -600,31 +650,33 @@ where let mempool_results = self.mempool.extend_unwatched(source, &xts); if view_store.is_empty() { - return Ok(mempool_results) + return Ok(mempool_results.into_iter().map(|r| r.map(|r| r.hash)).collect::>()) } let to_be_submitted = mempool_results .iter() .zip(xts) - .filter_map(|(result, xt)| result.as_ref().ok().map(|_| xt)) + .filter_map(|(result, xt)| { + result.as_ref().ok().map(|insertion| (insertion.source.clone(), xt)) + }) .collect::>(); self.metrics .report(|metrics| metrics.submitted_transactions.inc_by(to_be_submitted.len() as _)); let mempool = self.mempool.clone(); - let results_map = view_store.submit(source, to_be_submitted.into_iter()).await; + let results_map = view_store.submit(to_be_submitted.into_iter()).await; let mut submission_results = reduce_multiview_result(results_map).into_iter(); Ok(mempool_results .into_iter() .map(|result| { - result.and_then(|xt_hash| { + result.and_then(|insertion| { submission_results .next() .expect("The number of Ok results in mempool is exactly the same as the size of to-views-submission result. qed.") .inspect_err(|_| - mempool.remove(xt_hash) + mempool.remove(insertion.hash) ) }) }) @@ -660,19 +712,18 @@ where ) -> Result>>, Self::Error> { log::trace!(target: LOG_TARGET, "[{:?}] fatp::submit_and_watch views:{}", self.tx_hash(&xt), self.active_views_count()); let xt = Arc::from(xt); - let xt_hash = match self.mempool.push_watched(source, xt.clone()) { - Ok(xt_hash) => xt_hash, - Err(e) => return Err(e), - }; + let InsertionInfo { hash: xt_hash, source: timed_source } = + match self.mempool.push_watched(source, xt.clone()) { + Ok(result) => result, + Err(e) => return Err(e), + }; self.metrics.report(|metrics| metrics.submitted_transactions.inc()); - let view_store = self.view_store.clone(); - let mempool = self.mempool.clone(); - view_store - .submit_and_watch(at, source, xt) + self.view_store + .submit_and_watch(at, timed_source, xt) .await - .inspect_err(|_| mempool.remove(xt_hash)) + .inspect_err(|_| self.mempool.remove(xt_hash)) } /// Intended to remove transactions identified by the given hashes, and any dependent @@ -801,12 +852,12 @@ where ) -> Result { log::debug!(target: LOG_TARGET, "fatp::submit_local views:{}", self.active_views_count()); let xt = Arc::from(xt); - let result = self + let InsertionInfo { hash: xt_hash, .. } = self .mempool .extend_unwatched(TransactionSource::Local, &[xt.clone()]) .remove(0)?; - self.view_store.submit_local(xt).or_else(|_| Ok(result)) + self.view_store.submit_local(xt).or_else(|_| Ok(xt_hash)) } } @@ -914,6 +965,9 @@ where let start = Instant::now(); let watched_xts = self.register_listeners(&mut view).await; let duration = start.elapsed(); + // sync the transactions statuses and referencing views in all the listeners with newly + // cloned view. + view.pool.validated_pool().retrigger_notifications(); log::debug!(target: LOG_TARGET, "register_listeners: at {at:?} took {duration:?}"); // 2. Handle transactions from the tree route. Pruning transactions from the view first @@ -1041,58 +1095,35 @@ where self.active_views_count() ); let included_xts = self.extrinsics_included_since_finalized(view.at.hash).await; - let xts = self.mempool.clone_unwatched(); - - let mut all_submitted_count = 0; - if !xts.is_empty() { - let unwatched_count = xts.len(); - let mut buckets = HashMap::>>::default(); - xts.into_iter() - .filter(|(hash, _)| !view.pool.validated_pool().pool.read().is_imported(hash)) - .filter(|(hash, _)| !included_xts.contains(&hash)) - .map(|(_, tx)| (tx.source(), tx.tx())) - .for_each(|(source, tx)| buckets.entry(source).or_default().push(tx)); - - for (source, xts) in buckets { - all_submitted_count += xts.len(); - let _ = view.submit_many(source, xts).await; - } - log::debug!(target: LOG_TARGET, "update_view_with_mempool: at {:?} unwatched {}/{}", view.at.hash, all_submitted_count, unwatched_count); - } - - let watched_submitted_count = watched_xts.len(); - let mut buckets = HashMap::< - TransactionSource, - Vec<(ExtrinsicHash, ExtrinsicFor)>, - >::default(); - watched_xts + let (hashes, xts_filtered): (Vec<_>, Vec<_>) = watched_xts .into_iter() + .chain(self.mempool.clone_unwatched().into_iter()) + .filter(|(hash, _)| !view.is_imported(hash)) .filter(|(hash, _)| !included_xts.contains(&hash)) - .map(|(tx_hash, tx)| (tx.source(), tx_hash, tx.tx())) - .for_each(|(source, tx_hash, tx)| { - buckets.entry(source).or_default().push((tx_hash, tx)) - }); + .map(|(tx_hash, tx)| (tx_hash, (tx.source(), tx.tx()))) + .unzip(); - let mut watched_results = Vec::default(); - for (source, watched_xts) in buckets { - let hashes = watched_xts.iter().map(|i| i.0).collect::>(); - let results = view - .submit_many(source, watched_xts.into_iter().map(|i| i.1)) - .await - .into_iter() - .zip(hashes) - .map(|(result, tx_hash)| result.or_else(|_| Err(tx_hash))) - .collect::>(); - watched_results.extend(results); - } + let watched_results = view + .submit_many(xts_filtered) + .await + .into_iter() + .zip(hashes) + .map(|(result, tx_hash)| result.or_else(|_| Err(tx_hash))) + .collect::>(); + + let submitted_count = watched_results.len(); - log::debug!(target: LOG_TARGET, "update_view_with_mempool: at {:?} watched {}/{}", view.at.hash, watched_submitted_count, self.mempool_len().1); + log::debug!( + target: LOG_TARGET, + "update_view_with_mempool: at {:?} submitted {}/{}", + view.at.hash, + submitted_count, + self.mempool.len() + ); - all_submitted_count += watched_submitted_count; - let _ = all_submitted_count - .try_into() - .map(|v| self.metrics.report(|metrics| metrics.submitted_from_mempool_txs.inc_by(v))); + self.metrics + .report(|metrics| metrics.submitted_from_mempool_txs.inc_by(submitted_count as _)); // if there are no views yet, and a single newly created view is reporting error, just send // out the invalid event, and remove transaction. @@ -1176,7 +1207,14 @@ where }) .map(|(tx_hash, tx)| { //find arc if tx is known - self.mempool.get_by_hash(tx_hash).unwrap_or_else(|| Arc::from(tx)) + self.mempool + .get_by_hash(tx_hash) + .map(|tx| (tx.source(), tx.tx())) + .unwrap_or_else(|| { + // These transactions are coming from retracted blocks, we + // should simply consider them external. + (TimedTransactionSource::new_external(true), Arc::from(tx)) + }) }), ); @@ -1185,16 +1223,7 @@ where }); } - let _ = view - .pool - .resubmit_at( - &hash_and_number, - // These transactions are coming from retracted blocks, we should - // simply consider them external. - TransactionSource::External, - resubmit_transactions, - ) - .await; + let _ = view.pool.resubmit_at(&hash_and_number, resubmit_transactions).await; } } diff --git a/substrate/client/transaction-pool/src/fork_aware_txpool/import_notification_sink.rs b/substrate/client/transaction-pool/src/fork_aware_txpool/import_notification_sink.rs index 7fbdcade63b8..f9a41673bb8f 100644 --- a/substrate/client/transaction-pool/src/fork_aware_txpool/import_notification_sink.rs +++ b/substrate/client/transaction-pool/src/fork_aware_txpool/import_notification_sink.rs @@ -326,6 +326,7 @@ mod tests { let j0 = tokio::spawn(runnable); let stream = ctrl.event_stream(); + let stream2 = ctrl.event_stream(); let mut v1 = View::new(vec![(10, 1), (10, 2), (10, 3)]); let mut v2 = View::new(vec![(20, 1), (20, 2), (20, 6)]); @@ -342,20 +343,16 @@ mod tests { ctrl.add_view(1000, o1); ctrl.add_view(2000, o2); - let j4 = { - let ctrl = ctrl.clone(); - tokio::spawn(async move { - tokio::time::sleep(Duration::from_millis(70)).await; - ctrl.clean_notified_items(&vec![1, 3]); - ctrl.add_view(3000, o3.boxed()); - }) - }; + let out = stream.take(4).collect::>().await; + assert_eq!(out, vec![1, 2, 3, 6]); - let out = stream.take(6).collect::>().await; + ctrl.clean_notified_items(&vec![1, 3]); + ctrl.add_view(3000, o3.boxed()); + let out = stream2.take(6).collect::>().await; assert_eq!(out, vec![1, 2, 3, 6, 1, 3]); - drop(ctrl); - futures::future::join_all(vec![j0, j1, j2, j3, j4]).await; + drop(ctrl); + futures::future::join_all(vec![j0, j1, j2, j3]).await; } #[tokio::test] diff --git a/substrate/client/transaction-pool/src/fork_aware_txpool/multi_view_listener.rs b/substrate/client/transaction-pool/src/fork_aware_txpool/multi_view_listener.rs index 8d0e69db2e9a..a00234a99808 100644 --- a/substrate/client/transaction-pool/src/fork_aware_txpool/multi_view_listener.rs +++ b/substrate/client/transaction-pool/src/fork_aware_txpool/multi_view_listener.rs @@ -36,6 +36,8 @@ use std::{ }; use tokio_stream::StreamMap; +use super::dropped_watcher::{DroppedReason, DroppedTransaction}; + /// A side channel allowing to control the external stream instance (one per transaction) with /// [`ControllerCommand`]. /// @@ -79,7 +81,7 @@ enum ControllerCommand { /// Notifies that a transaction was dropped from the pool. /// /// If all preconditions are met, an external dropped event will be sent out. - TransactionDropped, + TransactionDropped(DroppedReason>), } impl std::fmt::Debug for ControllerCommand @@ -99,8 +101,8 @@ where ControllerCommand::TransactionBroadcasted(_) => { write!(f, "ListenerAction::TransactionBroadcasted(...)") }, - ControllerCommand::TransactionDropped => { - write!(f, "ListenerAction::TransactionDropped") + ControllerCommand::TransactionDropped(r) => { + write!(f, "ListenerAction::TransactionDropped {r:?}") }, } } @@ -268,6 +270,7 @@ where /// stream map. fn remove_view(&mut self, block_hash: BlockHash) { self.status_stream_map.remove(&block_hash); + self.views_keeping_tx_valid.remove(&block_hash); trace!(target: LOG_TARGET, "[{:?}] RemoveView view: {:?} views:{:?}", self.tx_hash, block_hash, self.status_stream_map.keys().collect::>()); } } @@ -282,6 +285,11 @@ where Self { controllers: Default::default() } } + /// Returns `true` if the listener contains a stream controller for the specified hash. + pub fn contains_tx(&self, tx_hash: &ExtrinsicHash) -> bool { + self.controllers.read().contains_key(tx_hash) + } + /// Creates an external aggregated stream of events for given transaction. /// /// This method initializes an `ExternalWatcherContext` for the provided transaction hash, sets @@ -346,11 +354,16 @@ where log::trace!(target: LOG_TARGET, "[{:?}] mvl sending out: Broadcasted", ctx.tx_hash); return Some((TransactionStatus::Broadcast(peers), ctx)) }, - ControllerCommand::TransactionDropped => { + ControllerCommand::TransactionDropped(DroppedReason::LimitsEnforced) => { log::trace!(target: LOG_TARGET, "[{:?}] mvl sending out: Dropped", ctx.tx_hash); ctx.terminate = true; return Some((TransactionStatus::Dropped, ctx)) }, + ControllerCommand::TransactionDropped(DroppedReason::Usurped(by)) => { + log::trace!(target: LOG_TARGET, "[{:?}] mvl sending out: Usurped({:?})", ctx.tx_hash, by); + ctx.terminate = true; + return Some((TransactionStatus::Usurped(by), ctx)) + }, } }, }; @@ -445,16 +458,15 @@ where /// /// This method sends a `TransactionDropped` command to the controller of each requested /// transaction prompting and external `Broadcasted` event. - pub(crate) fn transactions_dropped(&self, dropped: &[ExtrinsicHash]) { + pub(crate) fn transaction_dropped(&self, dropped: DroppedTransaction>) { let mut controllers = self.controllers.write(); - debug!(target: LOG_TARGET, "mvl::transactions_dropped: {:?}", dropped); - for tx_hash in dropped { - if let Some(tx) = controllers.remove(&tx_hash) { - debug!(target: LOG_TARGET, "[{:?}] transaction_dropped", tx_hash); - if let Err(e) = tx.unbounded_send(ControllerCommand::TransactionDropped) { - trace!(target: LOG_TARGET, "[{:?}] transactions_dropped: send message failed: {:?}", tx_hash, e); - }; - } + debug!(target: LOG_TARGET, "mvl::transaction_dropped: {:?}", dropped); + if let Some(tx) = controllers.remove(&dropped.tx_hash) { + let DroppedTransaction { tx_hash, reason } = dropped; + debug!(target: LOG_TARGET, "[{:?}] transaction_dropped", tx_hash); + if let Err(e) = tx.unbounded_send(ControllerCommand::TransactionDropped(reason)) { + trace!(target: LOG_TARGET, "[{:?}] transaction_dropped: send message failed: {:?}", tx_hash, e); + }; } } diff --git a/substrate/client/transaction-pool/src/fork_aware_txpool/revalidation_worker.rs b/substrate/client/transaction-pool/src/fork_aware_txpool/revalidation_worker.rs index 9464ab3f5766..eb898c35a134 100644 --- a/substrate/client/transaction-pool/src/fork_aware_txpool/revalidation_worker.rs +++ b/substrate/client/transaction-pool/src/fork_aware_txpool/revalidation_worker.rs @@ -186,9 +186,9 @@ mod tests { use crate::{ common::tests::{uxt, TestApi}, fork_aware_txpool::view::FinishRevalidationLocalChannels, + TimedTransactionSource, }; use futures::executor::block_on; - use sc_transaction_pool_api::TransactionSource; use substrate_test_runtime::{AccountId, Transfer, H256}; use substrate_test_runtime_client::AccountKeyring::Alice; #[test] @@ -212,9 +212,10 @@ mod tests { nonce: 0, }); - let _ = block_on( - view.submit_many(TransactionSource::External, std::iter::once(uxt.clone().into())), - ); + let _ = block_on(view.submit_many(std::iter::once(( + TimedTransactionSource::new_external(false), + uxt.clone().into(), + )))); assert_eq!(api.validation_requests().len(), 1); let (finish_revalidation_request_tx, finish_revalidation_request_rx) = diff --git a/substrate/client/transaction-pool/src/fork_aware_txpool/tx_mem_pool.rs b/substrate/client/transaction-pool/src/fork_aware_txpool/tx_mem_pool.rs index 86c07008c3f3..7b824d4653c2 100644 --- a/substrate/client/transaction-pool/src/fork_aware_txpool/tx_mem_pool.rs +++ b/substrate/client/transaction-pool/src/fork_aware_txpool/tx_mem_pool.rs @@ -30,7 +30,7 @@ use super::{metrics::MetricsLink as PrometheusMetrics, multi_view_listener::Mult use crate::{ common::log_xt::log_xt_trace, graph, - graph::{tracked_map::Size, ExtrinsicFor, ExtrinsicHash}, + graph::{base_pool::TimedTransactionSource, tracked_map::Size, ExtrinsicFor, ExtrinsicHash}, LOG_TARGET, }; use futures::FutureExt; @@ -74,7 +74,7 @@ where /// Size of the extrinsics actual body. bytes: usize, /// Transaction source. - source: TransactionSource, + source: TimedTransactionSource, /// When the transaction was revalidated, used to periodically revalidate the mem pool buffer. validated_at: AtomicU64, //todo: we need to add future / ready status at finalized block. @@ -95,18 +95,30 @@ where /// Shall the progress of transaction be watched. /// /// Was transaction sent with `submit_and_watch`. - fn is_watched(&self) -> bool { + pub(crate) fn is_watched(&self) -> bool { self.watched } /// Creates a new instance of wrapper for unwatched transaction. fn new_unwatched(source: TransactionSource, tx: ExtrinsicFor, bytes: usize) -> Self { - Self { watched: false, tx, source, validated_at: AtomicU64::new(0), bytes } + Self { + watched: false, + tx, + source: TimedTransactionSource::from_transaction_source(source, true), + validated_at: AtomicU64::new(0), + bytes, + } } /// Creates a new instance of wrapper for watched transaction. fn new_watched(source: TransactionSource, tx: ExtrinsicFor, bytes: usize) -> Self { - Self { watched: true, tx, source, validated_at: AtomicU64::new(0), bytes } + Self { + watched: true, + tx, + source: TimedTransactionSource::from_transaction_source(source, true), + validated_at: AtomicU64::new(0), + bytes, + } } /// Provides a clone of actual transaction body. @@ -117,8 +129,8 @@ where } /// Returns the source of the transaction. - pub(crate) fn source(&self) -> TransactionSource { - self.source + pub(crate) fn source(&self) -> TimedTransactionSource { + self.source.clone() } } @@ -174,6 +186,19 @@ where max_transactions_total_bytes: usize, } +/// Helper structure to encapsulate a result of [`TxMemPool::try_insert`]. +#[derive(Debug)] +pub(super) struct InsertionInfo { + pub(super) hash: Hash, + pub(super) source: TimedTransactionSource, +} + +impl InsertionInfo { + fn new(hash: Hash, source: TimedTransactionSource) -> Self { + Self { hash, source } + } +} + impl TxMemPool where Block: BlockT, @@ -220,8 +245,8 @@ where pub(super) fn get_by_hash( &self, hash: ExtrinsicHash, - ) -> Option> { - self.transactions.read().get(&hash).map(|t| t.tx()) + ) -> Option>> { + self.transactions.read().get(&hash).map(Clone::clone) } /// Returns a tuple with the count of unwatched and watched transactions in the memory pool. @@ -231,6 +256,11 @@ where (transactions.len() - watched_count, watched_count) } + /// Returns a total number of transactions kept within mempool. + pub fn len(&self) -> usize { + self.transactions.read().len() + } + /// Returns the number of bytes used by all extrinsics in the the pool. #[cfg(test)] pub fn bytes(&self) -> usize { @@ -249,7 +279,7 @@ where &self, hash: ExtrinsicHash, tx: TxInMemPool, - ) -> Result, ChainApi::Error> { + ) -> Result>, ChainApi::Error> { let bytes = self.transactions.bytes(); let mut transactions = self.transactions.write(); let result = match ( @@ -257,14 +287,15 @@ where transactions.contains_key(&hash), ) { (true, false) => { + let source = tx.source(); transactions.insert(hash, Arc::from(tx)); - Ok(hash) + Ok(InsertionInfo::new(hash, source)) }, (_, true) => Err(sc_transaction_pool_api::error::Error::AlreadyImported(Box::new(hash)).into()), (false, _) => Err(sc_transaction_pool_api::error::Error::ImmediatelyDropped.into()), }; - log::trace!(target: LOG_TARGET, "[{:?}] mempool::try_insert: {:?}", hash, result); + log::trace!(target: LOG_TARGET, "[{:?}] mempool::try_insert: {:?}", hash, result.as_ref().map(|r| r.hash)); result } @@ -277,7 +308,7 @@ where &self, source: TransactionSource, xts: &[ExtrinsicFor], - ) -> Vec, ChainApi::Error>> { + ) -> Vec>, ChainApi::Error>> { let result = xts .iter() .map(|xt| { @@ -294,25 +325,18 @@ where &self, source: TransactionSource, xt: ExtrinsicFor, - ) -> Result, ChainApi::Error> { + ) -> Result>, ChainApi::Error> { let (hash, length) = self.api.hash_and_length(&xt); self.try_insert(hash, TxInMemPool::new_watched(source, xt.clone(), length)) } - /// Removes transactions from the memory pool which are specified by the given list of hashes - /// and send the `Dropped` event to the listeners of these transactions. - pub(super) async fn remove_dropped_transactions( + /// Removes transaction from the memory pool which are specified by the given list of hashes. + pub(super) async fn remove_dropped_transaction( &self, - to_be_removed: &[ExtrinsicHash], - ) { - log::debug!(target: LOG_TARGET, "remove_dropped_transactions count:{:?}", to_be_removed.len()); - log_xt_trace!(target: LOG_TARGET, to_be_removed, "[{:?}] mempool::remove_dropped_transactions"); - let mut transactions = self.transactions.write(); - to_be_removed.iter().for_each(|t| { - transactions.remove(t); - }); - - self.listener.transactions_dropped(to_be_removed); + dropped: &ExtrinsicHash, + ) -> Option>> { + log::debug!(target: LOG_TARGET, "[{:?}] mempool::remove_dropped_transaction", dropped); + self.transactions.write().remove(dropped) } /// Clones and returns a `HashMap` of references to all unwatched transactions in the memory @@ -369,13 +393,13 @@ where }; let validations_futures = input.into_iter().map(|(xt_hash, xt)| { - self.api.validate_transaction(finalized_block.hash, xt.source, xt.tx()).map( - move |validation_result| { + self.api + .validate_transaction(finalized_block.hash, xt.source.clone().into(), xt.tx()) + .map(move |validation_result| { xt.validated_at .store(finalized_block.number.into().as_u64(), atomic::Ordering::Relaxed); (xt_hash, validation_result) - }, - ) + }) }); let validation_results = futures::future::join_all(validations_futures).await; let input_len = validation_results.len(); @@ -403,7 +427,7 @@ where log::debug!( target: LOG_TARGET, - "mempool::revalidate: at {finalized_block:?} count:{input_len}/{count} purged:{} took {duration:?}", invalid_hashes.len(), + "mempool::revalidate: at {finalized_block:?} count:{input_len}/{count} invalid_hashes:{} took {duration:?}", invalid_hashes.len(), ); invalid_hashes diff --git a/substrate/client/transaction-pool/src/fork_aware_txpool/view.rs b/substrate/client/transaction-pool/src/fork_aware_txpool/view.rs index 99095d88cb0a..3cbb8fa4871d 100644 --- a/substrate/client/transaction-pool/src/fork_aware_txpool/view.rs +++ b/substrate/client/transaction-pool/src/fork_aware_txpool/view.rs @@ -27,13 +27,13 @@ use super::metrics::MetricsLink as PrometheusMetrics; use crate::{ common::log_xt::log_xt_trace, graph::{ - self, watcher::Watcher, ExtrinsicFor, ExtrinsicHash, IsValidator, ValidatedTransaction, - ValidatedTransactionFor, + self, base_pool::TimedTransactionSource, watcher::Watcher, ExtrinsicFor, ExtrinsicHash, + IsValidator, ValidatedTransaction, ValidatedTransactionFor, }, LOG_TARGET, }; use parking_lot::Mutex; -use sc_transaction_pool_api::{error::Error as TxPoolError, PoolStatus, TransactionSource}; +use sc_transaction_pool_api::{error::Error as TxPoolError, PoolStatus}; use sp_blockchain::HashAndNumber; use sp_runtime::{ generic::BlockId, traits::Block as BlockT, transaction_validity::TransactionValidityError, @@ -157,22 +157,21 @@ where /// Imports many unvalidated extrinsics into the view. pub(super) async fn submit_many( &self, - source: TransactionSource, - xts: impl IntoIterator>, + xts: impl IntoIterator)>, ) -> Vec, ChainApi::Error>> { if log::log_enabled!(target: LOG_TARGET, log::Level::Trace) { let xts = xts.into_iter().collect::>(); - log_xt_trace!(target: LOG_TARGET, xts.iter().map(|xt| self.pool.validated_pool().api().hash_and_length(xt).0), "[{:?}] view::submit_many at:{}", self.at.hash); - self.pool.submit_at(&self.at, source, xts).await + log_xt_trace!(target: LOG_TARGET, xts.iter().map(|(_,xt)| self.pool.validated_pool().api().hash_and_length(xt).0), "[{:?}] view::submit_many at:{}", self.at.hash); + self.pool.submit_at(&self.at, xts).await } else { - self.pool.submit_at(&self.at, source, xts).await + self.pool.submit_at(&self.at, xts).await } } /// Import a single extrinsic and starts to watch its progress in the view. pub(super) async fn submit_and_watch( &self, - source: TransactionSource, + source: TimedTransactionSource, xt: ExtrinsicFor, ) -> Result, ExtrinsicHash>, ChainApi::Error> { log::trace!(target: LOG_TARGET, "[{:?}] view::submit_and_watch at:{}", self.pool.validated_pool().api().hash_and_length(&xt).0, self.at.hash); @@ -193,7 +192,7 @@ where .api() .validate_transaction_blocking( self.at.hash, - TransactionSource::Local, + sc_transaction_pool_api::TransactionSource::Local, Arc::from(xt.clone()), )? .map_err(|e| { @@ -214,7 +213,7 @@ where let validated = ValidatedTransaction::valid_at( block_number.saturated_into::(), hash, - TransactionSource::Local, + TimedTransactionSource::new_local(true), Arc::from(xt), length, validity, @@ -285,7 +284,7 @@ where } _ = async { if let Some(tx) = batch_iter.next() { - let validation_result = (api.validate_transaction(self.at.hash, tx.source, tx.data.clone()).await, tx.hash, tx); + let validation_result = (api.validate_transaction(self.at.hash, tx.source.clone().into(), tx.data.clone()).await, tx.hash, tx); validation_results.push(validation_result); } else { self.revalidation_worker_channels.lock().as_mut().map(|ch| ch.remove_sender()); @@ -324,7 +323,7 @@ where ValidatedTransaction::valid_at( self.at.number.saturated_into::(), tx_hash, - tx.source, + tx.source.clone(), tx.data.clone(), api.hash_and_length(&tx.data).1, validity, @@ -455,4 +454,10 @@ where ); } } + + /// Returns true if the transaction with given hash is already imported into the view. + pub(super) fn is_imported(&self, tx_hash: &ExtrinsicHash) -> bool { + const IGNORE_BANNED: bool = false; + self.pool.validated_pool().check_is_known(tx_hash, IGNORE_BANNED).is_err() + } } diff --git a/substrate/client/transaction-pool/src/fork_aware_txpool/view_store.rs b/substrate/client/transaction-pool/src/fork_aware_txpool/view_store.rs index f23dcedd5bfd..a06c051f0a7e 100644 --- a/substrate/client/transaction-pool/src/fork_aware_txpool/view_store.rs +++ b/substrate/client/transaction-pool/src/fork_aware_txpool/view_store.rs @@ -24,17 +24,51 @@ use super::{ }; use crate::{ fork_aware_txpool::dropped_watcher::MultiViewDroppedWatcherController, - graph, - graph::{base_pool::Transaction, ExtrinsicFor, ExtrinsicHash, TransactionFor}, + graph::{ + self, + base_pool::{TimedTransactionSource, Transaction}, + ExtrinsicFor, ExtrinsicHash, TransactionFor, + }, ReadyIteratorFor, LOG_TARGET, }; use futures::prelude::*; use itertools::Itertools; use parking_lot::RwLock; -use sc_transaction_pool_api::{error::Error as PoolError, PoolStatus, TransactionSource}; +use sc_transaction_pool_api::{error::Error as PoolError, PoolStatus}; use sp_blockchain::TreeRoute; use sp_runtime::{generic::BlockId, traits::Block as BlockT}; -use std::{collections::HashMap, sync::Arc, time::Instant}; +use std::{ + collections::{hash_map::Entry, HashMap}, + sync::Arc, + time::Instant, +}; + +/// Helper struct to keep the context for transaction replacements. +#[derive(Clone)] +struct PendingTxReplacement +where + ChainApi: graph::ChainApi, +{ + /// Indicates if the new transaction was already submitted to all the views in the view_store. + /// If true, it can be removed after inserting any new view. + processed: bool, + /// New transaction replacing the old one. + xt: ExtrinsicFor, + /// Source of the transaction. + source: TimedTransactionSource, + /// Inidicates if transaction is watched. + watched: bool, +} + +impl PendingTxReplacement +where + ChainApi: graph::ChainApi, +{ + /// Creates new unprocessed instance of pending transaction replacement. + fn new(xt: ExtrinsicFor, source: TimedTransactionSource, watched: bool) -> Self { + Self { processed: false, xt, source, watched } + } +} /// The helper structure encapsulates all the views. pub(super) struct ViewStore @@ -62,6 +96,13 @@ where pub(super) most_recent_view: RwLock>, /// The controller of multi view dropped stream. pub(super) dropped_stream_controller: MultiViewDroppedWatcherController, + /// The map used to synchronize replacement of transactions between maintain and dropped + /// notifcication threads. It is meant to assure that replaced transaction is also removed from + /// newly built views in maintain process. + /// + /// The map's key is hash of replaced extrinsic. + pending_txs_replacements: + RwLock, PendingTxReplacement>>, } impl ViewStore @@ -83,14 +124,14 @@ where listener, most_recent_view: RwLock::from(None), dropped_stream_controller, + pending_txs_replacements: Default::default(), } } /// Imports a bunch of unverified extrinsics to every active view. pub(super) async fn submit( &self, - source: TransactionSource, - xts: impl IntoIterator> + Clone, + xts: impl IntoIterator)> + Clone, ) -> HashMap, ChainApi::Error>>> { let submit_futures = { let active_views = self.active_views.read(); @@ -99,7 +140,7 @@ where .map(|(_, view)| { let view = view.clone(); let xts = xts.clone(); - async move { (view.at.hash, view.submit_many(source, xts).await) } + async move { (view.at.hash, view.submit_many(xts).await) } }) .collect::>() }; @@ -145,7 +186,7 @@ where pub(super) async fn submit_and_watch( &self, _at: Block::Hash, - source: TransactionSource, + source: TimedTransactionSource, xt: ExtrinsicFor, ) -> Result, ChainApi::Error> { let tx_hash = self.api.hash_and_length(&xt).0; @@ -159,6 +200,7 @@ where .map(|(_, view)| { let view = view.clone(); let xt = xt.clone(); + let source = source.clone(); async move { match view.submit_and_watch(source, xt).await { Ok(watcher) => { @@ -261,12 +303,20 @@ where ) -> Vec, ExtrinsicFor>> { self.most_recent_view .read() - .map(|at| self.get_view_at(at, true)) + .map(|at| self.futures_at(at)) .flatten() - .map(|(v, _)| v.pool.validated_pool().pool.read().futures().cloned().collect()) .unwrap_or_default() } + /// Returns a list of future transactions in the view at given block hash. + pub(super) fn futures_at( + &self, + at: Block::Hash, + ) -> Option, ExtrinsicFor>>> { + self.get_view_at(at, true) + .map(|(v, _)| v.pool.validated_pool().pool.read().futures().cloned().collect()) + } + /// Collects all the transactions included in the blocks on the provided `tree_route` and /// triggers finalization event for them. /// @@ -329,12 +379,16 @@ where /// - moved to the inactive views set (`inactive_views`), /// - removed from the multi view listeners. /// - /// The `most_recent_view` is update with the reference to the newly inserted view. + /// The `most_recent_view` is updated with the reference to the newly inserted view. + /// + /// If there are any pending tx replacments, they are applied to the new view. pub(super) async fn insert_new_view( &self, view: Arc>, tree_route: &TreeRoute, ) { + self.apply_pending_tx_replacements(view.clone()).await; + //note: most_recent_view must be synced with changes in in/active_views. { let mut most_recent_view_lock = self.most_recent_view.write(); @@ -386,8 +440,10 @@ where let mut removed_views = vec![]; { - self.active_views - .read() + let active_views = self.active_views.read(); + let inactive_views = self.inactive_views.read(); + + active_views .iter() .filter(|(hash, v)| !match finalized_number { Err(_) | Ok(None) => **hash == finalized_hash, @@ -396,11 +452,8 @@ where }) .map(|(_, v)| removed_views.push(v.at.hash)) .for_each(drop); - } - { - self.inactive_views - .read() + inactive_views .iter() .filter(|(_, v)| !match finalized_number { Err(_) | Ok(None) => false, @@ -438,30 +491,48 @@ where let finalized_xts = self.finalize_route(finalized_hash, tree_route).await; let finalized_number = self.api.block_id_to_number(&BlockId::Hash(finalized_hash)); + let mut dropped_views = vec![]; //clean up older then finalized { let mut active_views = self.active_views.write(); - active_views.retain(|hash, v| match finalized_number { - Err(_) | Ok(None) => *hash == finalized_hash, - Ok(Some(n)) if v.at.number == n => *hash == finalized_hash, - Ok(Some(n)) => v.at.number > n, + let mut inactive_views = self.inactive_views.write(); + active_views.retain(|hash, v| { + let retain = match finalized_number { + Err(_) | Ok(None) => *hash == finalized_hash, + Ok(Some(n)) if v.at.number == n => *hash == finalized_hash, + Ok(Some(n)) => v.at.number > n, + }; + if !retain { + dropped_views.push(*hash); + } + retain }); - } - { - let mut inactive_views = self.inactive_views.write(); - inactive_views.retain(|_, v| match finalized_number { - Err(_) | Ok(None) => false, - Ok(Some(n)) => v.at.number >= n, + inactive_views.retain(|hash, v| { + let retain = match finalized_number { + Err(_) | Ok(None) => false, + Ok(Some(n)) => v.at.number >= n, + }; + if !retain { + dropped_views.push(*hash); + } + retain }); log::trace!(target:LOG_TARGET,"handle_finalized: inactive_views: {:?}", inactive_views.keys()); } - self.listener.remove_view(finalized_hash); + log::trace!(target:LOG_TARGET,"handle_finalized: dropped_views: {:?}", dropped_views); + self.listener.remove_stale_controllers(); self.dropped_stream_controller.remove_finalized_txs(finalized_xts.clone()); + self.listener.remove_view(finalized_hash); + for view in dropped_views { + self.listener.remove_view(view); + self.dropped_stream_controller.remove_view(view); + } + finalized_xts } @@ -484,4 +555,139 @@ where futures::future::join_all(finish_revalidation_futures).await; log::trace!(target:LOG_TARGET,"finish_background_revalidations took {:?}", start.elapsed()); } + + /// Replaces an existing transaction in the view_store with a new one. + /// + /// Attempts to replace a transaction identified by `replaced` with a new transaction `xt`. + /// + /// Before submitting a transaction to the views, the new *unprocessed* transaction replacement + /// record will be inserted into a pending replacement map. Once the submission to all the views + /// is accomplished, the record is marked as *processed*. + /// + /// This map is later applied in `insert_new_view` method executed from different thread. + /// + /// If the transaction is already being replaced, it will simply return without making + /// changes. + pub(super) async fn replace_transaction( + &self, + source: TimedTransactionSource, + xt: ExtrinsicFor, + replaced: ExtrinsicHash, + watched: bool, + ) { + if let Entry::Vacant(entry) = self.pending_txs_replacements.write().entry(replaced) { + entry.insert(PendingTxReplacement::new(xt.clone(), source.clone(), watched)); + } else { + return + }; + + let xt_hash = self.api.hash_and_length(&xt).0; + log::trace!(target:LOG_TARGET,"[{replaced:?}] replace_transaction wtih {xt_hash:?}, w:{watched}"); + + self.replace_transaction_in_views(source, xt, xt_hash, replaced, watched).await; + + if let Some(replacement) = self.pending_txs_replacements.write().get_mut(&replaced) { + replacement.processed = true; + } + } + + /// Applies pending transaction replacements to the specified view. + /// + /// After application, all already processed replacements are removed. + async fn apply_pending_tx_replacements(&self, view: Arc>) { + let mut futures = vec![]; + for replacement in self.pending_txs_replacements.read().values() { + let xt_hash = self.api.hash_and_length(&replacement.xt).0; + futures.push(self.replace_transaction_in_view( + view.clone(), + replacement.source.clone(), + replacement.xt.clone(), + xt_hash, + replacement.watched, + )); + } + let _results = futures::future::join_all(futures).await; + self.pending_txs_replacements.write().retain(|_, r| r.processed); + } + + /// Submits `xt` to the given view. + /// + /// For watched transaction stream is added to the listener. + async fn replace_transaction_in_view( + &self, + view: Arc>, + source: TimedTransactionSource, + xt: ExtrinsicFor, + xt_hash: ExtrinsicHash, + watched: bool, + ) { + if watched { + match view.submit_and_watch(source, xt).await { + Ok(watcher) => { + self.listener.add_view_watcher_for_tx( + xt_hash, + view.at.hash, + watcher.into_stream().boxed(), + ); + }, + Err(e) => { + log::trace!( + target:LOG_TARGET, + "[{:?}] replace_transaction: submit_and_watch to {} failed {}", + xt_hash, view.at.hash, e + ); + }, + } + } else { + if let Some(Err(e)) = view.submit_many(std::iter::once((source, xt))).await.pop() { + log::trace!( + target:LOG_TARGET, + "[{:?}] replace_transaction: submit to {} failed {}", + xt_hash, view.at.hash, e + ); + } + } + } + + /// Sends `xt` to every view (both active and inactive) containing `replaced` extrinsics. + /// + /// It is assumed that transaction is already known by the pool. Intended to ba called when `xt` + /// is replacing `replaced` extrinsic. + async fn replace_transaction_in_views( + &self, + source: TimedTransactionSource, + xt: ExtrinsicFor, + xt_hash: ExtrinsicHash, + replaced: ExtrinsicHash, + watched: bool, + ) { + if watched && !self.listener.contains_tx(&xt_hash) { + log::trace!( + target:LOG_TARGET, + "error: replace_transaction_in_views: no listener for watched transaction {:?}", + xt_hash, + ); + return; + } + + let submit_futures = { + let active_views = self.active_views.read(); + let inactive_views = self.inactive_views.read(); + active_views + .iter() + .chain(inactive_views.iter()) + .filter(|(_, view)| view.is_imported(&replaced)) + .map(|(_, view)| { + self.replace_transaction_in_view( + view.clone(), + source.clone(), + xt.clone(), + xt_hash, + watched, + ) + }) + .collect::>() + }; + let _results = futures::future::join_all(submit_futures).await; + } } diff --git a/substrate/client/transaction-pool/src/graph/base_pool.rs b/substrate/client/transaction-pool/src/graph/base_pool.rs index e4c3a6c425a9..04eaa998f42e 100644 --- a/substrate/client/transaction-pool/src/graph/base_pool.rs +++ b/substrate/client/transaction-pool/src/graph/base_pool.rs @@ -20,7 +20,7 @@ //! //! For a more full-featured pool, have a look at the `pool` module. -use std::{cmp::Ordering, collections::HashSet, fmt, hash, sync::Arc}; +use std::{cmp::Ordering, collections::HashSet, fmt, hash, sync::Arc, time::Instant}; use crate::LOG_TARGET; use log::{trace, warn}; @@ -30,8 +30,8 @@ use sp_core::hexdisplay::HexDisplay; use sp_runtime::{ traits::Member, transaction_validity::{ - TransactionLongevity as Longevity, TransactionPriority as Priority, - TransactionSource as Source, TransactionTag as Tag, + TransactionLongevity as Longevity, TransactionPriority as Priority, TransactionSource, + TransactionTag as Tag, }, }; @@ -83,6 +83,44 @@ pub struct PruneStatus { pub pruned: Vec>>, } +/// A transaction source that includes a timestamp indicating when the transaction was submitted. +#[derive(Debug, Clone, PartialEq, Eq)] +pub struct TimedTransactionSource { + /// The original source of the transaction. + pub source: TransactionSource, + + /// The time at which the transaction was submitted. + pub timestamp: Option, +} + +impl From for TransactionSource { + fn from(value: TimedTransactionSource) -> Self { + value.source + } +} + +impl TimedTransactionSource { + /// Creates a new instance with an internal `TransactionSource::InBlock` source and an optional + /// timestamp. + pub fn new_in_block(with_timestamp: bool) -> Self { + Self { source: TransactionSource::InBlock, timestamp: with_timestamp.then(Instant::now) } + } + /// Creates a new instance with an internal `TransactionSource::External` source and an optional + /// timestamp. + pub fn new_external(with_timestamp: bool) -> Self { + Self { source: TransactionSource::External, timestamp: with_timestamp.then(Instant::now) } + } + /// Creates a new instance with an internal `TransactionSource::Local` source and an optional + /// timestamp. + pub fn new_local(with_timestamp: bool) -> Self { + Self { source: TransactionSource::Local, timestamp: with_timestamp.then(Instant::now) } + } + /// Creates a new instance with an given source and an optional timestamp. + pub fn from_transaction_source(source: TransactionSource, with_timestamp: bool) -> Self { + Self { source, timestamp: with_timestamp.then(Instant::now) } + } +} + /// Immutable transaction #[derive(PartialEq, Eq, Clone)] pub struct Transaction { @@ -102,8 +140,8 @@ pub struct Transaction { pub provides: Vec, /// Should that transaction be propagated. pub propagate: bool, - /// Source of that transaction. - pub source: Source, + /// Timed source of that transaction. + pub source: TimedTransactionSource, } impl AsRef for Transaction { @@ -157,7 +195,7 @@ impl Transaction { bytes: self.bytes, hash: self.hash.clone(), priority: self.priority, - source: self.source, + source: self.source.clone(), valid_till: self.valid_till, requires: self.requires.clone(), provides: self.provides.clone(), @@ -322,22 +360,36 @@ impl BasePool { if !first { - promoted.push(current_hash); + promoted.push(current_hash.clone()); } + // If there were conflicting future transactions promoted, removed them from + // promoted set. + promoted.retain(|hash| replaced.iter().all(|tx| *hash != tx.hash)); // The transactions were removed from the ready pool. We might attempt to // re-import them. removed.append(&mut replaced); }, + Err(e @ error::Error::TooLowPriority { .. }) => + if first { + trace!(target: LOG_TARGET, "[{:?}] Error importing {first}: {:?}", current_tx.hash, e); + return Err(e) + } else { + trace!(target: LOG_TARGET, "[{:?}] Error importing {first}: {:?}", current_tx.hash, e); + removed.push(current_tx); + promoted.retain(|hash| *hash != current_hash); + }, // transaction failed to be imported. Err(e) => if first { - trace!(target: LOG_TARGET, "[{:?}] Error importing: {:?}", current_hash, e); + trace!(target: LOG_TARGET, "[{:?}] Error importing {first}: {:?}", current_tx.hash, e); return Err(e) } else { - failed.push(current_hash); + trace!(target: LOG_TARGET, "[{:?}] Error importing {first}: {:?}", current_tx.hash, e); + failed.push(current_tx.hash.clone()); }, } first = false; @@ -434,8 +486,24 @@ impl BasePool Some(current.clone()), - Some(ref tx) if tx.imported_at > current.imported_at => Some(current.clone()), - other => other, + Some(worst) => Some( + match (worst.transaction.source.timestamp, current.transaction.source.timestamp) + { + (Some(worst_timestamp), Some(current_timestamp)) => { + if worst_timestamp > current_timestamp { + current.clone() + } else { + worst + } + }, + _ => + if worst.imported_at > current.imported_at { + current.clone() + } else { + worst + }, + }, + ), }); if let Some(worst) = worst { @@ -562,7 +630,7 @@ mod tests { requires: vec![], provides: vec![], propagate: true, - source: Source::External, + source: TimedTransactionSource::new_external(false), } } @@ -760,6 +828,58 @@ mod tests { ); } + #[test] + fn should_remove_conflicting_future() { + let mut pool = pool(); + pool.import(Transaction { + data: vec![3u8].into(), + hash: 3, + requires: vec![vec![1]], + priority: 50u64, + provides: vec![vec![3]], + ..default_tx().clone() + }) + .unwrap(); + assert_eq!(pool.ready().count(), 0); + assert_eq!(pool.ready.len(), 0); + + let tx2 = Transaction { + data: vec![2u8].into(), + hash: 2, + requires: vec![vec![1]], + provides: vec![vec![3]], + ..default_tx().clone() + }; + pool.import(tx2.clone()).unwrap(); + assert_eq!(pool.future.len(), 2); + + let res = pool + .import(Transaction { + data: vec![1u8].into(), + hash: 1, + provides: vec![vec![1]], + ..default_tx().clone() + }) + .unwrap(); + + assert_eq!( + res, + Imported::Ready { + hash: 1, + promoted: vec![3], + failed: vec![], + removed: vec![tx2.into()] + } + ); + + let mut it = pool.ready().into_iter().map(|tx| tx.data[0]); + assert_eq!(it.next(), Some(1)); + assert_eq!(it.next(), Some(3)); + assert_eq!(it.next(), None); + + assert_eq!(pool.future.len(), 0); + } + #[test] fn should_handle_a_cycle() { // given @@ -783,14 +903,14 @@ mod tests { assert_eq!(pool.ready.len(), 0); // when - pool.import(Transaction { + let tx2 = Transaction { data: vec![2u8].into(), hash: 2, requires: vec![vec![2]], provides: vec![vec![0]], ..default_tx().clone() - }) - .unwrap(); + }; + pool.import(tx2.clone()).unwrap(); // then { @@ -817,7 +937,12 @@ mod tests { assert_eq!(it.next(), None); assert_eq!( res, - Imported::Ready { hash: 4, promoted: vec![1, 3], failed: vec![2], removed: vec![] } + Imported::Ready { + hash: 4, + promoted: vec![1, 3], + failed: vec![], + removed: vec![tx2.into()] + } ); assert_eq!(pool.future.len(), 0); } @@ -1024,7 +1149,7 @@ mod tests { ), "Transaction { \ hash: 4, priority: 1000, valid_till: 64, bytes: 1, propagate: true, \ -source: TransactionSource::External, requires: [03, 02], provides: [04], data: [4]}" +source: TimedTransactionSource { source: TransactionSource::External, timestamp: None }, requires: [03, 02], provides: [04], data: [4]}" .to_owned() ); } diff --git a/substrate/client/transaction-pool/src/graph/listener.rs b/substrate/client/transaction-pool/src/graph/listener.rs index a5593920eec4..41daf5491f70 100644 --- a/substrate/client/transaction-pool/src/graph/listener.rs +++ b/substrate/client/transaction-pool/src/graph/listener.rs @@ -36,6 +36,7 @@ pub type DroppedByLimitsStream = TracingUnboundedReceiver { + /// Map containing per-transaction sinks for emitting transaction status events. watchers: HashMap>>, finality_watchers: LinkedHashMap, Vec>, @@ -119,32 +120,44 @@ impl Listener, limits_enforced: bool) { + /// Transaction was dropped from the pool because of enforcing the limit. + pub fn limit_enforced(&mut self, tx: &H) { + trace!(target: LOG_TARGET, "[{:?}] Dropped (limit enforced)", tx); + self.fire(tx, |watcher| watcher.limit_enforced()); + + if let Some(ref sink) = self.dropped_by_limits_sink { + if let Err(e) = sink.unbounded_send((tx.clone(), TransactionStatus::Dropped)) { + trace!(target: LOG_TARGET, "[{:?}] dropped_sink: send message failed: {:?}", tx, e); + } + } + } + + /// Transaction was replaced with other extrinsic. + pub fn usurped(&mut self, tx: &H, by: &H) { trace!(target: LOG_TARGET, "[{:?}] Dropped (replaced with {:?})", tx, by); - self.fire(tx, |watcher| match by { - Some(t) => watcher.usurped(t.clone()), - None => watcher.dropped(), - }); - - //note: LimitEnforced could be introduced as new status to get rid of this flag. - if limits_enforced { - if let Some(ref sink) = self.dropped_by_limits_sink { - if let Err(e) = sink.unbounded_send((tx.clone(), TransactionStatus::Dropped)) { - trace!(target: LOG_TARGET, "[{:?}] dropped_sink/future: send message failed: {:?}", tx, e); - } + self.fire(tx, |watcher| watcher.usurped(by.clone())); + + if let Some(ref sink) = self.dropped_by_limits_sink { + if let Err(e) = + sink.unbounded_send((tx.clone(), TransactionStatus::Usurped(by.clone()))) + { + trace!(target: LOG_TARGET, "[{:?}] dropped_sink: send message failed: {:?}", tx, e); } } } + /// Transaction was dropped from the pool because of the failure during the resubmission of + /// revalidate transactions or failure during pruning tags. + pub fn dropped(&mut self, tx: &H) { + trace!(target: LOG_TARGET, "[{:?}] Dropped", tx); + self.fire(tx, |watcher| watcher.dropped()); + } + /// Transaction was removed as invalid. pub fn invalid(&mut self, tx: &H) { trace!(target: LOG_TARGET, "[{:?}] Extrinsic invalid", tx); diff --git a/substrate/client/transaction-pool/src/graph/pool.rs b/substrate/client/transaction-pool/src/graph/pool.rs index 2dd8de352c6b..23b71ce437b3 100644 --- a/substrate/client/transaction-pool/src/graph/pool.rs +++ b/substrate/client/transaction-pool/src/graph/pool.rs @@ -181,10 +181,8 @@ impl Pool { pub async fn submit_at( &self, at: &HashAndNumber, - source: TransactionSource, - xts: impl IntoIterator>, + xts: impl IntoIterator)>, ) -> Vec, B::Error>> { - let xts = xts.into_iter().map(|xt| (source, xt)); let validated_transactions = self.verify(at, xts, CheckBannedBeforeVerify::Yes).await; self.validated_pool.submit(validated_transactions.into_values()) } @@ -195,10 +193,8 @@ impl Pool { pub async fn resubmit_at( &self, at: &HashAndNumber, - source: TransactionSource, - xts: impl IntoIterator>, + xts: impl IntoIterator)>, ) -> Vec, B::Error>> { - let xts = xts.into_iter().map(|xt| (source, xt)); let validated_transactions = self.verify(at, xts, CheckBannedBeforeVerify::No).await; self.validated_pool.submit(validated_transactions.into_values()) } @@ -207,10 +203,10 @@ impl Pool { pub async fn submit_one( &self, at: &HashAndNumber, - source: TransactionSource, + source: base::TimedTransactionSource, xt: ExtrinsicFor, ) -> Result, B::Error> { - let res = self.submit_at(at, source, std::iter::once(xt)).await.pop(); + let res = self.submit_at(at, std::iter::once((source, xt))).await.pop(); res.expect("One extrinsic passed; one result returned; qed") } @@ -218,7 +214,7 @@ impl Pool { pub async fn submit_and_watch( &self, at: &HashAndNumber, - source: TransactionSource, + source: base::TimedTransactionSource, xt: ExtrinsicFor, ) -> Result, ExtrinsicHash>, B::Error> { let (_, tx) = self @@ -368,7 +364,7 @@ impl Pool { // Try to re-validate pruned transactions since some of them might be still valid. // note that `known_imported_hashes` will be rejected here due to temporary ban. let pruned_transactions = - prune_status.pruned.into_iter().map(|tx| (tx.source, tx.data.clone())); + prune_status.pruned.into_iter().map(|tx| (tx.source.clone(), tx.data.clone())); let reverified_transactions = self.verify(at, pruned_transactions, CheckBannedBeforeVerify::Yes).await; @@ -396,7 +392,7 @@ impl Pool { async fn verify( &self, at: &HashAndNumber, - xts: impl IntoIterator)>, + xts: impl IntoIterator)>, check: CheckBannedBeforeVerify, ) -> IndexMap, ValidatedTransactionFor> { let HashAndNumber { number, hash } = *at; @@ -417,7 +413,7 @@ impl Pool { &self, block_hash: ::Hash, block_number: NumberFor, - source: TransactionSource, + source: base::TimedTransactionSource, xt: ExtrinsicFor, check: CheckBannedBeforeVerify, ) -> (ExtrinsicHash, ValidatedTransactionFor) { @@ -431,7 +427,7 @@ impl Pool { let validation_result = self .validated_pool .api() - .validate_transaction(block_hash, source, xt.clone()) + .validate_transaction(block_hash, source.clone().into(), xt.clone()) .await; let status = match validation_result { @@ -488,6 +484,7 @@ mod tests { use super::{super::base_pool::Limit, *}; use crate::common::tests::{pool, uxt, TestApi, INVALID_NONCE}; use assert_matches::assert_matches; + use base::TimedTransactionSource; use codec::Encode; use futures::executor::block_on; use parking_lot::Mutex; @@ -497,7 +494,8 @@ mod tests { use substrate_test_runtime::{AccountId, ExtrinsicBuilder, Transfer, H256}; use substrate_test_runtime_client::AccountKeyring::{Alice, Bob}; - const SOURCE: TransactionSource = TransactionSource::External; + const SOURCE: TimedTransactionSource = + TimedTransactionSource { source: TransactionSource::External, timestamp: None }; #[test] fn should_validate_and_import_transaction() { @@ -545,8 +543,8 @@ mod tests { let initial_hashes = txs.iter().map(|t| api.hash_and_length(t).0).collect::>(); // when - let txs = txs.into_iter().map(|x| Arc::from(x)).collect::>(); - let hashes = block_on(pool.submit_at(&api.expect_hash_and_number(0), SOURCE, txs)); + let txs = txs.into_iter().map(|x| (SOURCE, Arc::from(x))).collect::>(); + let hashes = block_on(pool.submit_at(&api.expect_hash_and_number(0), txs)); log::debug!("--> {hashes:#?}"); // then diff --git a/substrate/client/transaction-pool/src/graph/ready.rs b/substrate/client/transaction-pool/src/graph/ready.rs index 860bcff0bace..9061d0e25581 100644 --- a/substrate/client/transaction-pool/src/graph/ready.rs +++ b/substrate/client/transaction-pool/src/graph/ready.rs @@ -589,7 +589,6 @@ fn remove_item(vec: &mut Vec, item: &T) { #[cfg(test)] mod tests { use super::*; - use sp_runtime::transaction_validity::TransactionSource as Source; fn tx(id: u8) -> Transaction> { Transaction { @@ -601,7 +600,7 @@ mod tests { requires: vec![vec![1], vec![2]], provides: vec![vec![3], vec![4]], propagate: true, - source: Source::External, + source: crate::TimedTransactionSource::new_external(false), } } @@ -711,7 +710,7 @@ mod tests { requires: vec![tx1.provides[0].clone()], provides: vec![], propagate: true, - source: Source::External, + source: crate::TimedTransactionSource::new_external(false), }; // when diff --git a/substrate/client/transaction-pool/src/graph/rotator.rs b/substrate/client/transaction-pool/src/graph/rotator.rs index 61a26fb4138c..9a2e269b5eed 100644 --- a/substrate/client/transaction-pool/src/graph/rotator.rs +++ b/substrate/client/transaction-pool/src/graph/rotator.rs @@ -106,7 +106,6 @@ impl PoolRotator { #[cfg(test)] mod tests { use super::*; - use sp_runtime::transaction_validity::TransactionSource; type Hash = u64; type Ex = (); @@ -126,7 +125,7 @@ mod tests { requires: vec![], provides: vec![], propagate: true, - source: TransactionSource::External, + source: crate::TimedTransactionSource::new_external(false), }; (hash, tx) @@ -192,7 +191,7 @@ mod tests { requires: vec![], provides: vec![], propagate: true, - source: TransactionSource::External, + source: crate::TimedTransactionSource::new_external(false), } } diff --git a/substrate/client/transaction-pool/src/graph/validated_pool.rs b/substrate/client/transaction-pool/src/graph/validated_pool.rs index d7f55198a40a..14df63d9673e 100644 --- a/substrate/client/transaction-pool/src/graph/validated_pool.rs +++ b/substrate/client/transaction-pool/src/graph/validated_pool.rs @@ -30,7 +30,7 @@ use serde::Serialize; use sp_blockchain::HashAndNumber; use sp_runtime::{ traits::{self, SaturatedConversion}, - transaction_validity::{TransactionSource, TransactionTag as Tag, ValidTransaction}, + transaction_validity::{TransactionTag as Tag, ValidTransaction}, }; use std::time::Instant; @@ -62,7 +62,7 @@ impl ValidatedTransaction { pub fn valid_at( at: u64, hash: Hash, - source: TransactionSource, + source: base::TimedTransactionSource, data: Ex, bytes: usize, validity: ValidTransaction, @@ -280,7 +280,7 @@ impl ValidatedPool { // run notifications let mut listener = self.listener.write(); for h in &removed { - listener.dropped(h, None, true); + listener.limit_enforced(h); } removed @@ -453,7 +453,7 @@ impl ValidatedPool { match final_status { Status::Future => listener.future(&hash), Status::Ready => listener.ready(&hash, None), - Status::Dropped => listener.dropped(&hash, None, false), + Status::Dropped => listener.dropped(&hash), Status::Failed => listener.invalid(&hash), } } @@ -492,7 +492,7 @@ impl ValidatedPool { fire_events(&mut *listener, promoted); } for f in &status.failed { - listener.dropped(f, None, false); + listener.dropped(f); } } @@ -671,6 +671,21 @@ impl ValidatedPool { ) -> super::listener::DroppedByLimitsStream, BlockHash> { self.listener.write().create_dropped_by_limits_stream() } + + /// Resends ready and future events for all the ready and future transactions that are already + /// in the pool. + /// + /// Intended to be called after cloning the instance of `ValidatedPool`. + pub fn retrigger_notifications(&self) { + let pool = self.pool.read(); + let mut listener = self.listener.write(); + pool.ready().for_each(|r| { + listener.ready(&r.hash, None); + }); + pool.futures().for_each(|f| { + listener.future(&f.hash); + }); + } } fn fire_events(listener: &mut Listener, imported: &base::Imported) @@ -682,7 +697,7 @@ where base::Imported::Ready { ref promoted, ref failed, ref removed, ref hash } => { listener.ready(hash, None); failed.iter().for_each(|f| listener.invalid(f)); - removed.iter().for_each(|r| listener.dropped(&r.hash, Some(hash), false)); + removed.iter().for_each(|r| listener.usurped(&r.hash, hash)); promoted.iter().for_each(|p| listener.ready(p, None)); }, base::Imported::Future { ref hash } => listener.future(hash), diff --git a/substrate/client/transaction-pool/src/graph/watcher.rs b/substrate/client/transaction-pool/src/graph/watcher.rs index fb7cf99d4dc6..2fd31e772fd8 100644 --- a/substrate/client/transaction-pool/src/graph/watcher.rs +++ b/substrate/client/transaction-pool/src/graph/watcher.rs @@ -113,6 +113,12 @@ impl Sender { } /// Transaction has been dropped from the pool because of the limit. + pub fn limit_enforced(&mut self) { + self.send(TransactionStatus::Dropped); + self.is_finalized = true; + } + + /// Transaction has been dropped from the pool. pub fn dropped(&mut self) { self.send(TransactionStatus::Dropped); self.is_finalized = true; diff --git a/substrate/client/transaction-pool/src/lib.rs b/substrate/client/transaction-pool/src/lib.rs index 3d3d596c291f..366d91a973d2 100644 --- a/substrate/client/transaction-pool/src/lib.rs +++ b/substrate/client/transaction-pool/src/lib.rs @@ -36,7 +36,10 @@ pub use api::FullChainApi; pub use builder::{Builder, TransactionPoolHandle, TransactionPoolOptions, TransactionPoolType}; pub use common::notification_future; pub use fork_aware_txpool::{ForkAwareTxPool, ForkAwareTxPoolTask}; -pub use graph::{base_pool::Limit as PoolLimit, ChainApi, Options, Pool}; +pub use graph::{ + base_pool::{Limit as PoolLimit, TimedTransactionSource}, + ChainApi, Options, Pool, +}; use single_state_txpool::prune_known_txs_for_block; pub use single_state_txpool::{BasicPool, RevalidationType}; pub use transaction_pool_wrapper::TransactionPoolWrapper; diff --git a/substrate/client/transaction-pool/src/single_state_txpool/revalidation.rs b/substrate/client/transaction-pool/src/single_state_txpool/revalidation.rs index 5ef726c9f7d3..74031b1e1c72 100644 --- a/substrate/client/transaction-pool/src/single_state_txpool/revalidation.rs +++ b/substrate/client/transaction-pool/src/single_state_txpool/revalidation.rs @@ -88,7 +88,7 @@ async fn batch_revalidate( let validation_results = futures::future::join_all(batch.into_iter().filter_map(|ext_hash| { pool.validated_pool().ready_by_hash(&ext_hash).map(|ext| { - api.validate_transaction(at, ext.source, ext.data.clone()) + api.validate_transaction(at, ext.source.clone().into(), ext.data.clone()) .map(move |validation_result| (validation_result, ext_hash, ext)) }) })) @@ -121,7 +121,7 @@ async fn batch_revalidate( ValidatedTransaction::valid_at( block_number.saturated_into::(), ext_hash, - ext.source, + ext.source.clone(), ext.data.clone(), api.hash_and_length(&ext.data).1, validity, @@ -375,9 +375,9 @@ mod tests { use crate::{ common::tests::{uxt, TestApi}, graph::Pool, + TimedTransactionSource, }; use futures::executor::block_on; - use sc_transaction_pool_api::TransactionSource; use substrate_test_runtime::{AccountId, Transfer, H256}; use substrate_test_runtime_client::AccountKeyring::{Alice, Bob}; @@ -398,7 +398,7 @@ mod tests { let uxt_hash = block_on(pool.submit_one( &han_of_block0, - TransactionSource::External, + TimedTransactionSource::new_external(false), uxt.clone().into(), )) .expect("Should be valid"); @@ -433,14 +433,15 @@ mod tests { let han_of_block0 = api.expect_hash_and_number(0); let unknown_block = H256::repeat_byte(0x13); - let uxt_hashes = block_on(pool.submit_at( - &han_of_block0, - TransactionSource::External, - vec![uxt0.into(), uxt1.into()], - )) - .into_iter() - .map(|r| r.expect("Should be valid")) - .collect::>(); + let source = TimedTransactionSource::new_external(false); + let uxt_hashes = + block_on(pool.submit_at( + &han_of_block0, + vec![(source.clone(), uxt0.into()), (source, uxt1.into())], + )) + .into_iter() + .map(|r| r.expect("Should be valid")) + .collect::>(); assert_eq!(api.validation_requests().len(), 2); assert_eq!(pool.validated_pool().status().ready, 2); diff --git a/substrate/client/transaction-pool/src/single_state_txpool/single_state_txpool.rs b/substrate/client/transaction-pool/src/single_state_txpool/single_state_txpool.rs index b29630b563bb..e7504012ca67 100644 --- a/substrate/client/transaction-pool/src/single_state_txpool/single_state_txpool.rs +++ b/substrate/client/transaction-pool/src/single_state_txpool/single_state_txpool.rs @@ -29,7 +29,7 @@ use crate::{ error, log_xt::log_xt_trace, }, - graph::{self, ExtrinsicHash, IsValidator}, + graph::{self, base_pool::TimedTransactionSource, ExtrinsicHash, IsValidator}, ReadyIteratorFor, LOG_TARGET, }; use async_trait::async_trait; @@ -254,14 +254,19 @@ where xts: Vec>, ) -> Result, Self::Error>>, Self::Error> { let pool = self.pool.clone(); - let xts = xts.into_iter().map(Arc::from).collect::>(); + let xts = xts + .into_iter() + .map(|xt| { + (TimedTransactionSource::from_transaction_source(source, false), Arc::from(xt)) + }) + .collect::>(); self.metrics .report(|metrics| metrics.submitted_transactions.inc_by(xts.len() as u64)); let number = self.api.resolve_block_number(at); let at = HashAndNumber { hash: at, number: number? }; - Ok(pool.submit_at(&at, source, xts).await) + Ok(pool.submit_at(&at, xts).await) } async fn submit_one( @@ -277,7 +282,8 @@ where let number = self.api.resolve_block_number(at); let at = HashAndNumber { hash: at, number: number? }; - pool.submit_one(&at, source, xt).await + pool.submit_one(&at, TimedTransactionSource::from_transaction_source(source, false), xt) + .await } async fn submit_and_watch( @@ -294,7 +300,13 @@ where let number = self.api.resolve_block_number(at); let at = HashAndNumber { hash: at, number: number? }; - let watcher = pool.submit_and_watch(&at, source, xt).await?; + let watcher = pool + .submit_and_watch( + &at, + TimedTransactionSource::from_transaction_source(source, false), + xt, + ) + .await?; Ok(watcher.into_stream().boxed()) } @@ -458,7 +470,7 @@ where let validated = ValidatedTransaction::valid_at( block_number.saturated_into::(), hash, - TransactionSource::Local, + TimedTransactionSource::new_local(false), Arc::from(xt), bytes, validity, @@ -662,8 +674,8 @@ where resubmit_transactions.extend( //todo: arctx - we need to get ref from somewhere - block_transactions.into_iter().map(Arc::from).filter(|tx| { - let tx_hash = pool.hash_of(tx); + block_transactions.into_iter().map(Arc::from).filter_map(|tx| { + let tx_hash = pool.hash_of(&tx); let contains = pruned_log.contains(&tx_hash); // need to count all transactions, not just filtered, here @@ -676,8 +688,15 @@ where tx_hash, hash, ); + Some(( + // These transactions are coming from retracted blocks, we should + // simply consider them external. + TimedTransactionSource::new_external(false), + tx, + )) + } else { + None } - !contains }), ); @@ -686,14 +705,7 @@ where }); } - pool.resubmit_at( - &hash_and_number, - // These transactions are coming from retracted blocks, we should - // simply consider them external. - TransactionSource::External, - resubmit_transactions, - ) - .await; + pool.resubmit_at(&hash_and_number, resubmit_transactions).await; } let extra_pool = pool.clone(); diff --git a/substrate/client/transaction-pool/tests/fatp.rs b/substrate/client/transaction-pool/tests/fatp.rs index 9f343a9bd029..c51ca6e17663 100644 --- a/substrate/client/transaction-pool/tests/fatp.rs +++ b/substrate/client/transaction-pool/tests/fatp.rs @@ -2267,19 +2267,13 @@ fn fatp_avoid_stuck_transaction() { assert_pool_status!(header06.hash(), &pool, 0, 0); - // Import enough blocks to make xt4i revalidated - let mut prev_header = header03; - // wait 10 blocks for revalidation - for n in 7..=11 { - let header = api.push_block(n, vec![], true); - let event = finalized_block_event(&pool, prev_header.hash(), header.hash()); - block_on(pool.maintain(event)); - prev_header = header; - } + let header07 = api.push_block(7, vec![], true); + let event = finalized_block_event(&pool, header03.hash(), header07.hash()); + block_on(pool.maintain(event)); let xt4i_events = futures::executor::block_on_stream(xt4i_watcher).collect::>(); log::debug!("xt4i_events: {:#?}", xt4i_events); - assert_eq!(xt4i_events, vec![TransactionStatus::Future, TransactionStatus::Invalid]); + assert_eq!(xt4i_events, vec![TransactionStatus::Future, TransactionStatus::Dropped]); assert_eq!(pool.mempool_len(), (0, 0)); } diff --git a/substrate/client/transaction-pool/tests/fatp_common/mod.rs b/substrate/client/transaction-pool/tests/fatp_common/mod.rs index 15f2b7f79c14..aecd83360f1e 100644 --- a/substrate/client/transaction-pool/tests/fatp_common/mod.rs +++ b/substrate/client/transaction-pool/tests/fatp_common/mod.rs @@ -201,6 +201,20 @@ macro_rules! assert_ready_iterator { }}; } +#[macro_export] +macro_rules! assert_future_iterator { + ($hash:expr, $pool:expr, [$( $xt:expr ),*]) => {{ + let futures = $pool.futures_at($hash).unwrap(); + let expected = vec![ $($pool.api().hash_and_length(&$xt).0),*]; + log::debug!(target:LOG_TARGET, "expected: {:#?}", futures); + log::debug!(target:LOG_TARGET, "output: {:#?}", expected); + assert_eq!(expected.len(), futures.len()); + let hsf = futures.iter().map(|a| a.hash).collect::>(); + let hse = expected.into_iter().collect::>(); + assert_eq!(hse,hsf); + }}; +} + pub const SOURCE: TransactionSource = TransactionSource::External; #[cfg(test)] diff --git a/substrate/client/transaction-pool/tests/fatp_limits.rs b/substrate/client/transaction-pool/tests/fatp_limits.rs index 03792fd89dfa..afd8183957a8 100644 --- a/substrate/client/transaction-pool/tests/fatp_limits.rs +++ b/substrate/client/transaction-pool/tests/fatp_limits.rs @@ -641,3 +641,192 @@ fn fatp_limits_future_size_works() { assert_pool_status!(header01.hash(), &pool, 0, 3); assert_eq!(pool.mempool_len().0, 3); } + +#[test] +fn fatp_limits_watcher_ready_transactions_are_not_droped_when_view_is_dropped() { + sp_tracing::try_init_simple(); + + let builder = TestPoolBuilder::new(); + let (pool, api, _) = builder.with_mempool_count_limit(6).with_ready_count(2).build(); + api.set_nonce(api.genesis_hash(), Bob.into(), 300); + api.set_nonce(api.genesis_hash(), Charlie.into(), 400); + api.set_nonce(api.genesis_hash(), Dave.into(), 500); + api.set_nonce(api.genesis_hash(), Eve.into(), 600); + api.set_nonce(api.genesis_hash(), Ferdie.into(), 700); + + let header01 = api.push_block(1, vec![], true); + let event = new_best_block_event(&pool, None, header01.hash()); + block_on(pool.maintain(event)); + + let xt0 = uxt(Alice, 200); + let xt1 = uxt(Bob, 300); + let xt2 = uxt(Charlie, 400); + + let xt3 = uxt(Dave, 500); + let xt4 = uxt(Eve, 600); + let xt5 = uxt(Ferdie, 700); + + let _xt0_watcher = + block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt0.clone())).unwrap(); + let _xt1_watcher = + block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt1.clone())).unwrap(); + + assert_pool_status!(header01.hash(), &pool, 2, 0); + assert_eq!(pool.mempool_len().1, 2); + + let header02 = api.push_block_with_parent(header01.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header01.hash()), header02.hash()))); + + let _xt2_watcher = + block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt2.clone())).unwrap(); + let _xt3_watcher = + block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt3.clone())).unwrap(); + + assert_pool_status!(header02.hash(), &pool, 2, 0); + assert_eq!(pool.mempool_len().1, 4); + + let header03 = api.push_block_with_parent(header02.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header02.hash()), header03.hash()))); + + let _xt4_watcher = + block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt4.clone())).unwrap(); + let _xt5_watcher = + block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt5.clone())).unwrap(); + + assert_pool_status!(header03.hash(), &pool, 2, 0); + assert_eq!(pool.mempool_len().1, 6); + + let header04 = + api.push_block_with_parent(header03.hash(), vec![xt4.clone(), xt5.clone()], true); + api.set_nonce(header04.hash(), Alice.into(), 201); + api.set_nonce(header04.hash(), Bob.into(), 301); + api.set_nonce(header04.hash(), Charlie.into(), 401); + api.set_nonce(header04.hash(), Dave.into(), 501); + api.set_nonce(header04.hash(), Eve.into(), 601); + api.set_nonce(header04.hash(), Ferdie.into(), 701); + block_on(pool.maintain(new_best_block_event(&pool, Some(header03.hash()), header04.hash()))); + + assert_ready_iterator!(header01.hash(), pool, [xt0, xt1]); + assert_ready_iterator!(header02.hash(), pool, [xt2, xt3]); + assert_ready_iterator!(header03.hash(), pool, [xt4, xt5]); + assert_ready_iterator!(header04.hash(), pool, []); + + block_on(pool.maintain(finalized_block_event(&pool, api.genesis_hash(), header01.hash()))); + assert!(!pool.status_all().contains_key(&header01.hash())); + + block_on(pool.maintain(finalized_block_event(&pool, header01.hash(), header02.hash()))); + assert!(!pool.status_all().contains_key(&header02.hash())); + + //view 01 was dropped + assert!(pool.ready_at(header01.hash()).now_or_never().is_none()); + assert_eq!(pool.mempool_len().1, 6); + + block_on(pool.maintain(finalized_block_event(&pool, header02.hash(), header03.hash()))); + + //no revalidation has happened yet, all txs are kept + assert_eq!(pool.mempool_len().1, 6); + + //view 03 is still there + assert!(!pool.status_all().contains_key(&header03.hash())); + + //view 02 was dropped + assert!(pool.ready_at(header02.hash()).now_or_never().is_none()); + + let mut prev_header = header03; + for n in 5..=11 { + let header = api.push_block(n, vec![], true); + let event = finalized_block_event(&pool, prev_header.hash(), header.hash()); + block_on(pool.maintain(event)); + prev_header = header; + } + + //now revalidation has happened, all txs are dropped + assert_eq!(pool.mempool_len().1, 0); +} + +#[test] +fn fatp_limits_watcher_future_transactions_are_droped_when_view_is_dropped() { + sp_tracing::try_init_simple(); + + let builder = TestPoolBuilder::new(); + let (pool, api, _) = builder.with_mempool_count_limit(6).with_future_count(2).build(); + api.set_nonce(api.genesis_hash(), Bob.into(), 300); + api.set_nonce(api.genesis_hash(), Charlie.into(), 400); + api.set_nonce(api.genesis_hash(), Dave.into(), 500); + api.set_nonce(api.genesis_hash(), Eve.into(), 600); + api.set_nonce(api.genesis_hash(), Ferdie.into(), 700); + + let header01 = api.push_block(1, vec![], true); + let event = new_best_block_event(&pool, None, header01.hash()); + block_on(pool.maintain(event)); + + let xt0 = uxt(Alice, 201); + let xt1 = uxt(Bob, 301); + let xt2 = uxt(Charlie, 401); + + let xt3 = uxt(Dave, 501); + let xt4 = uxt(Eve, 601); + let xt5 = uxt(Ferdie, 701); + + let xt0_watcher = block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt0.clone())).unwrap(); + let xt1_watcher = block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt1.clone())).unwrap(); + + assert_pool_status!(header01.hash(), &pool, 0, 2); + assert_eq!(pool.mempool_len().1, 2); + assert_future_iterator!(header01.hash(), pool, [xt0, xt1]); + + let header02 = api.push_block_with_parent(header01.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header01.hash()), header02.hash()))); + + let xt2_watcher = block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt2.clone())).unwrap(); + let xt3_watcher = block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt3.clone())).unwrap(); + + assert_pool_status!(header02.hash(), &pool, 0, 2); + assert_eq!(pool.mempool_len().1, 4); + assert_future_iterator!(header02.hash(), pool, [xt2, xt3]); + + let header03 = api.push_block_with_parent(header02.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header02.hash()), header03.hash()))); + + let xt4_watcher = block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt4.clone())).unwrap(); + let xt5_watcher = block_on(pool.submit_and_watch(invalid_hash(), SOURCE, xt5.clone())).unwrap(); + + assert_pool_status!(header03.hash(), &pool, 0, 2); + assert_eq!(pool.mempool_len().1, 6); + assert_future_iterator!(header03.hash(), pool, [xt4, xt5]); + + let header04 = api.push_block_with_parent(header03.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header03.hash()), header04.hash()))); + + assert_pool_status!(header04.hash(), &pool, 0, 2); + assert_eq!(pool.futures().len(), 2); + assert_future_iterator!(header04.hash(), pool, [xt4, xt5]); + + block_on(pool.maintain(finalized_block_event(&pool, api.genesis_hash(), header04.hash()))); + assert_eq!(pool.active_views_count(), 1); + assert_eq!(pool.inactive_views_count(), 0); + //todo: can we do better? We don't have API to check if event was processed internally. + let mut counter = 0; + while pool.mempool_len().1 != 2 { + sleep(std::time::Duration::from_millis(1)); + counter = counter + 1; + if counter > 20 { + assert!(false, "timeout {}", pool.mempool_len().1); + } + } + assert_eq!(pool.mempool_len().1, 2); + assert_pool_status!(header04.hash(), &pool, 0, 2); + assert_eq!(pool.futures().len(), 2); + + let to_be_checked = vec![xt0_watcher, xt1_watcher, xt2_watcher, xt3_watcher]; + for x in to_be_checked { + let x_status = futures::executor::block_on_stream(x).take(2).collect::>(); + assert_eq!(x_status, vec![TransactionStatus::Future, TransactionStatus::Dropped]); + } + + let to_be_checked = vec![xt4_watcher, xt5_watcher]; + for x in to_be_checked { + let x_status = futures::executor::block_on_stream(x).take(1).collect::>(); + assert_eq!(x_status, vec![TransactionStatus::Future]); + } +} diff --git a/substrate/client/transaction-pool/tests/fatp_prios.rs b/substrate/client/transaction-pool/tests/fatp_prios.rs new file mode 100644 index 000000000000..41bc374b38f4 --- /dev/null +++ b/substrate/client/transaction-pool/tests/fatp_prios.rs @@ -0,0 +1,249 @@ +// This file is part of Substrate. + +// Copyright (C) Parity Technologies (UK) Ltd. +// SPDX-License-Identifier: GPL-3.0-or-later WITH Classpath-exception-2.0 + +// This program is free software: you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation, either version 3 of the License, or +// (at your option) any later version. + +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. + +// You should have received a copy of the GNU General Public License +// along with this program. If not, see . + +//! Tests of priorities for fork-aware transaction pool. + +pub mod fatp_common; + +use fatp_common::{new_best_block_event, TestPoolBuilder, LOG_TARGET, SOURCE}; +use futures::{executor::block_on, FutureExt}; +use sc_transaction_pool::ChainApi; +use sc_transaction_pool_api::{MaintainedTransactionPool, TransactionPool, TransactionStatus}; +use substrate_test_runtime_client::AccountKeyring::*; +use substrate_test_runtime_transaction_pool::uxt; + +#[test] +fn fatp_prio_ready_higher_evicts_lower() { + sp_tracing::try_init_simple(); + + let builder = TestPoolBuilder::new(); + let (pool, api, _) = builder.with_mempool_count_limit(3).with_ready_count(2).build(); + + let header01 = api.push_block(1, vec![], true); + + let event = new_best_block_event(&pool, None, header01.hash()); + block_on(pool.maintain(event)); + + let xt0 = uxt(Alice, 200); + let xt1 = uxt(Alice, 200); + + api.set_priority(&xt0, 2); + api.set_priority(&xt1, 3); + + let result0 = block_on(pool.submit_one(header01.hash(), SOURCE, xt0.clone())); + let result1 = block_on(pool.submit_one(header01.hash(), SOURCE, xt1.clone())); + + log::info!("r0 => {:?}", result0); + log::info!("r1 => {:?}", result1); + log::info!("len: {:?}", pool.mempool_len()); + log::info!("len: {:?}", pool.status_all()[&header01.hash()]); + assert_ready_iterator!(header01.hash(), pool, [xt1]); + assert_pool_status!(header01.hash(), &pool, 1, 0); +} + +#[test] +fn fatp_prio_watcher_ready_higher_evicts_lower() { + sp_tracing::try_init_simple(); + + let builder = TestPoolBuilder::new(); + let (pool, api, _) = builder.with_mempool_count_limit(3).with_ready_count(2).build(); + + let header01 = api.push_block(1, vec![], true); + + let event = new_best_block_event(&pool, None, header01.hash()); + block_on(pool.maintain(event)); + + let xt0 = uxt(Alice, 200); + let xt1 = uxt(Alice, 200); + + api.set_priority(&xt0, 2); + api.set_priority(&xt1, 3); + + let xt0_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt0.clone())).unwrap(); + let xt1_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt1.clone())).unwrap(); + + let xt0_status = futures::executor::block_on_stream(xt0_watcher).take(2).collect::>(); + assert_eq!( + xt0_status, + vec![TransactionStatus::Ready, TransactionStatus::Usurped(api.hash_and_length(&xt1).0)] + ); + let xt1_status = futures::executor::block_on_stream(xt1_watcher).take(1).collect::>(); + assert_eq!(xt1_status, vec![TransactionStatus::Ready]); + + log::info!("len: {:?}", pool.mempool_len()); + log::info!("len: {:?}", pool.status_all()[&header01.hash()]); + assert_ready_iterator!(header01.hash(), pool, [xt1]); + assert_pool_status!(header01.hash(), &pool, 1, 0); +} + +#[test] +fn fatp_prio_watcher_future_higher_evicts_lower() { + sp_tracing::try_init_simple(); + + let builder = TestPoolBuilder::new(); + let (pool, api, _) = builder.with_mempool_count_limit(3).with_ready_count(3).build(); + + let header01 = api.push_block(1, vec![], true); + + let event = new_best_block_event(&pool, None, header01.hash()); + block_on(pool.maintain(event)); + + let xt0 = uxt(Alice, 201); + let xt1 = uxt(Alice, 201); + let xt2 = uxt(Alice, 200); + + api.set_priority(&xt0, 2); + api.set_priority(&xt1, 3); + + let xt0_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt0.clone())).unwrap(); + let xt1_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt1.clone())).unwrap(); + let xt2_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt2.clone())).unwrap(); + + let xt0_status = futures::executor::block_on_stream(xt0_watcher).take(2).collect::>(); + + assert_eq!( + xt0_status, + vec![TransactionStatus::Future, TransactionStatus::Usurped(api.hash_and_length(&xt2).0)] + ); + let xt1_status = futures::executor::block_on_stream(xt1_watcher).take(2).collect::>(); + assert_eq!(xt1_status, vec![TransactionStatus::Future, TransactionStatus::Ready]); + let xt2_status = futures::executor::block_on_stream(xt2_watcher).take(1).collect::>(); + assert_eq!(xt2_status, vec![TransactionStatus::Ready]); + + assert_eq!(pool.mempool_len().1, 2); + assert_ready_iterator!(header01.hash(), pool, [xt2, xt1]); + assert_pool_status!(header01.hash(), &pool, 2, 0); +} + +#[test] +fn fatp_prio_watcher_ready_lower_prio_gets_dropped_from_all_views() { + sp_tracing::try_init_simple(); + + let builder = TestPoolBuilder::new(); + let (pool, api, _) = builder.with_mempool_count_limit(3).with_ready_count(2).build(); + + let header01 = api.push_block(1, vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, None, header01.hash()))); + + let xt0 = uxt(Alice, 200); + let xt1 = uxt(Alice, 200); + + api.set_priority(&xt0, 2); + api.set_priority(&xt1, 3); + + let xt0_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt0.clone())).unwrap(); + + let header02 = api.push_block_with_parent(header01.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header01.hash()), header02.hash()))); + + let header03a = api.push_block_with_parent(header02.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header01.hash()), header03a.hash()))); + + let header03b = api.push_block_with_parent(header02.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header03a.hash()), header03b.hash()))); + + assert_pool_status!(header03a.hash(), &pool, 1, 0); + assert_ready_iterator!(header03a.hash(), pool, [xt0]); + assert_pool_status!(header03b.hash(), &pool, 1, 0); + assert_ready_iterator!(header03b.hash(), pool, [xt0]); + assert_ready_iterator!(header01.hash(), pool, [xt0]); + assert_ready_iterator!(header02.hash(), pool, [xt0]); + + let xt1_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt1.clone())).unwrap(); + + let xt1_status = futures::executor::block_on_stream(xt1_watcher).take(1).collect::>(); + assert_eq!(xt1_status, vec![TransactionStatus::Ready]); + let xt0_status = futures::executor::block_on_stream(xt0_watcher).take(2).collect::>(); + assert_eq!( + xt0_status, + vec![TransactionStatus::Ready, TransactionStatus::Usurped(api.hash_and_length(&xt1).0)] + ); + assert_ready_iterator!(header03a.hash(), pool, [xt1]); + assert_ready_iterator!(header03b.hash(), pool, [xt1]); + assert_ready_iterator!(header01.hash(), pool, [xt1]); + assert_ready_iterator!(header02.hash(), pool, [xt1]); +} + +#[test] +fn fatp_prio_watcher_future_lower_prio_gets_dropped_from_all_views() { + sp_tracing::try_init_simple(); + + let builder = TestPoolBuilder::new(); + let (pool, api, _) = builder.with_mempool_count_limit(3).with_ready_count(2).build(); + + let header01 = api.push_block(1, vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, None, header01.hash()))); + + let xt0 = uxt(Alice, 201); + let xt1 = uxt(Alice, 201); + let xt2 = uxt(Alice, 200); + + api.set_priority(&xt0, 2); + api.set_priority(&xt1, 3); + + let xt0_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt0.clone())).unwrap(); + + let xt1_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt1.clone())).unwrap(); + + let header02 = api.push_block_with_parent(header01.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header01.hash()), header02.hash()))); + + let header03a = api.push_block_with_parent(header02.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header01.hash()), header03a.hash()))); + + let header03b = api.push_block_with_parent(header02.hash(), vec![], true); + block_on(pool.maintain(new_best_block_event(&pool, Some(header03a.hash()), header03b.hash()))); + + assert_pool_status!(header03a.hash(), &pool, 0, 2); + assert_future_iterator!(header03a.hash(), pool, [xt0, xt1]); + assert_pool_status!(header03b.hash(), &pool, 0, 2); + assert_future_iterator!(header03b.hash(), pool, [xt0, xt1]); + assert_future_iterator!(header01.hash(), pool, [xt0, xt1]); + assert_future_iterator!(header02.hash(), pool, [xt0, xt1]); + + let xt2_watcher = + block_on(pool.submit_and_watch(header01.hash(), SOURCE, xt2.clone())).unwrap(); + + let xt2_status = futures::executor::block_on_stream(xt2_watcher).take(1).collect::>(); + assert_eq!(xt2_status, vec![TransactionStatus::Ready]); + let xt1_status = futures::executor::block_on_stream(xt1_watcher).take(1).collect::>(); + assert_eq!(xt1_status, vec![TransactionStatus::Future]); + let xt0_status = futures::executor::block_on_stream(xt0_watcher).take(2).collect::>(); + assert_eq!( + xt0_status, + vec![TransactionStatus::Future, TransactionStatus::Usurped(api.hash_and_length(&xt2).0)] + ); + assert_future_iterator!(header03a.hash(), pool, []); + assert_future_iterator!(header03b.hash(), pool, []); + assert_future_iterator!(header01.hash(), pool, []); + assert_future_iterator!(header02.hash(), pool, []); + + assert_ready_iterator!(header03a.hash(), pool, [xt2, xt1]); + assert_ready_iterator!(header03b.hash(), pool, [xt2, xt1]); + assert_ready_iterator!(header01.hash(), pool, [xt2, xt1]); + assert_ready_iterator!(header02.hash(), pool, [xt2, xt1]); +} diff --git a/substrate/client/transaction-pool/tests/pool.rs b/substrate/client/transaction-pool/tests/pool.rs index ed0fd7d4e655..e556ba9875f1 100644 --- a/substrate/client/transaction-pool/tests/pool.rs +++ b/substrate/client/transaction-pool/tests/pool.rs @@ -80,12 +80,14 @@ fn create_basic_pool(test_api: TestApi) -> BasicPool { create_basic_pool_with_genesis(Arc::from(test_api)).0 } +const TSOURCE: TimedTransactionSource = + TimedTransactionSource { source: TransactionSource::External, timestamp: None }; const SOURCE: TransactionSource = TransactionSource::External; #[test] fn submission_should_work() { let (pool, api) = pool(); - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt(Alice, 209).into())) + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt(Alice, 209).into())) .unwrap(); let pending: Vec<_> = pool @@ -99,9 +101,9 @@ fn submission_should_work() { #[test] fn multiple_submission_should_work() { let (pool, api) = pool(); - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt(Alice, 209).into())) + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt(Alice, 209).into())) .unwrap(); - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt(Alice, 210).into())) + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt(Alice, 210).into())) .unwrap(); let pending: Vec<_> = pool @@ -116,7 +118,7 @@ fn multiple_submission_should_work() { fn early_nonce_should_be_culled() { sp_tracing::try_init_simple(); let (pool, api) = pool(); - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt(Alice, 208).into())) + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt(Alice, 208).into())) .unwrap(); log::debug!("-> {:?}", pool.validated_pool().status()); @@ -132,7 +134,7 @@ fn early_nonce_should_be_culled() { fn late_nonce_should_be_queued() { let (pool, api) = pool(); - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt(Alice, 210).into())) + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt(Alice, 210).into())) .unwrap(); let pending: Vec<_> = pool .validated_pool() @@ -141,7 +143,7 @@ fn late_nonce_should_be_queued() { .collect(); assert_eq!(pending, Vec::::new()); - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt(Alice, 209).into())) + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt(Alice, 209).into())) .unwrap(); let pending: Vec<_> = pool .validated_pool() @@ -155,9 +157,9 @@ fn late_nonce_should_be_queued() { fn prune_tags_should_work() { let (pool, api) = pool(); let hash209 = - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt(Alice, 209).into())) + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt(Alice, 209).into())) .unwrap(); - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt(Alice, 210).into())) + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt(Alice, 210).into())) .unwrap(); let pending: Vec<_> = pool @@ -183,9 +185,9 @@ fn should_ban_invalid_transactions() { let (pool, api) = pool(); let uxt = Arc::from(uxt(Alice, 209)); let hash = - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt.clone())).unwrap(); + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt.clone())).unwrap(); pool.validated_pool().remove_invalid(&[hash]); - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt.clone())).unwrap_err(); + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt.clone())).unwrap_err(); // when let pending: Vec<_> = pool @@ -196,7 +198,7 @@ fn should_ban_invalid_transactions() { assert_eq!(pending, Vec::::new()); // then - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, uxt.clone())).unwrap_err(); + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, uxt.clone())).unwrap_err(); } #[test] @@ -224,7 +226,7 @@ fn should_correctly_prune_transactions_providing_more_than_one_tag() { })); let pool = Pool::new(Default::default(), true.into(), api.clone()); let xt0 = Arc::from(uxt(Alice, 209)); - block_on(pool.submit_one(&api.expect_hash_and_number(0), SOURCE, xt0.clone())) + block_on(pool.submit_one(&api.expect_hash_and_number(0), TSOURCE, xt0.clone())) .expect("1. Imported"); assert_eq!(pool.validated_pool().status().ready, 1); assert_eq!(api.validation_requests().len(), 1); @@ -242,7 +244,7 @@ fn should_correctly_prune_transactions_providing_more_than_one_tag() { api.increment_nonce(Alice.into()); api.push_block(2, Vec::new(), true); let xt1 = uxt(Alice, 211); - block_on(pool.submit_one(&api.expect_hash_and_number(2), SOURCE, xt1.clone().into())) + block_on(pool.submit_one(&api.expect_hash_and_number(2), TSOURCE, xt1.clone().into())) .expect("2. Imported"); assert_eq!(api.validation_requests().len(), 3); assert_eq!(pool.validated_pool().status().ready, 1);
Release notes

Sourced from lycheeverse/lychee-action's releases.

Version 2.1.0

What's Changed

New Contributors

Full Changelog: https://github.com/lycheeverse/lychee-action/compare/v2...v2.1.0