From 2f32d8fdea55b745bdd9ccc0ca3d6f0dad670aba Mon Sep 17 00:00:00 2001 From: mythreyiramesh Date: Wed, 6 Nov 2024 15:49:17 -0600 Subject: [PATCH] Update documentation --- .buildinfo | 4 + .nojekyll | 0 ...e058315b519fb9d19a8c2ebcea9dfedcc5d077.png | Bin 0 -> 173939 bytes _sources/bp-guide-gh/ch1-model-formulation.md | 282 + .../ch2-numerical-implementation.md | 400 + .../ch3-data-generation-and-curation.md | 500 + .../bp-guide-gh/ch4-software-development.md | 97 + _sources/bp-guide-gh/ch5-problem-setup.md | 157 + .../bp-guide-gh/ch6-result-dissemination.md | 79 + _sources/defaults/markdown-notebooks.md | 53 + _sources/defaults/markdown.md | 53 + _sources/defaults/notebooks.ipynb | 122 + _sources/intro.md | 15 + ...e.4045f2051d55cab465a707391d5b2007.min.css | 1 + _sphinx_design_static/design-tabs.js | 27 + .../_sphinx_javascript_frameworks_compat.js | 134 + _static/basic.css | 928 ++ _static/check-solid.svg | 4 + _static/clipboard.min.js | 7 + _static/copy-button.svg | 5 + _static/copybutton.css | 94 + _static/copybutton.js | 248 + _static/copybutton_funcs.js | 73 + ...e.4045f2051d55cab465a707391d5b2007.min.css | 1 + _static/design-tabs.js | 27 + _static/doctools.js | 264 + _static/documentation_options.js | 14 + _static/file.png | Bin 0 -> 286 bytes _static/images/logo_binder.svg | 19 + _static/images/logo_colab.png | Bin 0 -> 7601 bytes _static/images/logo_deepnote.svg | 1 + _static/images/logo_jupyterhub.svg | 1 + _static/jquery-3.6.0.js | 10881 ++++++++++++++++ _static/jquery.js | 2 + _static/language_data.js | 199 + _static/locales/ar/LC_MESSAGES/booktheme.mo | Bin 0 -> 1541 bytes _static/locales/ar/LC_MESSAGES/booktheme.po | 75 + _static/locales/bg/LC_MESSAGES/booktheme.mo | Bin 0 -> 1708 bytes _static/locales/bg/LC_MESSAGES/booktheme.po | 75 + _static/locales/bn/LC_MESSAGES/booktheme.mo | Bin 0 -> 1646 bytes _static/locales/bn/LC_MESSAGES/booktheme.po | 63 + _static/locales/ca/LC_MESSAGES/booktheme.mo | Bin 0 -> 1246 bytes _static/locales/ca/LC_MESSAGES/booktheme.po | 66 + _static/locales/cs/LC_MESSAGES/booktheme.mo | Bin 0 -> 1405 bytes _static/locales/cs/LC_MESSAGES/booktheme.po | 75 + _static/locales/da/LC_MESSAGES/booktheme.mo | Bin 0 -> 1304 bytes _static/locales/da/LC_MESSAGES/booktheme.po | 75 + _static/locales/de/LC_MESSAGES/booktheme.mo | Bin 0 -> 1388 bytes _static/locales/de/LC_MESSAGES/booktheme.po | 75 + _static/locales/el/LC_MESSAGES/booktheme.mo | Bin 0 -> 1722 bytes _static/locales/el/LC_MESSAGES/booktheme.po | 75 + _static/locales/eo/LC_MESSAGES/booktheme.mo | Bin 0 -> 1337 bytes _static/locales/eo/LC_MESSAGES/booktheme.po | 75 + _static/locales/es/LC_MESSAGES/booktheme.mo | Bin 0 -> 1396 bytes _static/locales/es/LC_MESSAGES/booktheme.po | 75 + _static/locales/et/LC_MESSAGES/booktheme.mo | Bin 0 -> 1341 bytes _static/locales/et/LC_MESSAGES/booktheme.po | 75 + _static/locales/fi/LC_MESSAGES/booktheme.mo | Bin 0 -> 1368 bytes _static/locales/fi/LC_MESSAGES/booktheme.po | 75 + _static/locales/fr/LC_MESSAGES/booktheme.mo | Bin 0 -> 1412 bytes _static/locales/fr/LC_MESSAGES/booktheme.po | 75 + _static/locales/hr/LC_MESSAGES/booktheme.mo | Bin 0 -> 1402 bytes _static/locales/hr/LC_MESSAGES/booktheme.po | 75 + _static/locales/id/LC_MESSAGES/booktheme.mo | Bin 0 -> 1323 bytes _static/locales/id/LC_MESSAGES/booktheme.po | 75 + _static/locales/it/LC_MESSAGES/booktheme.mo | Bin 0 -> 1403 bytes _static/locales/it/LC_MESSAGES/booktheme.po | 75 + _static/locales/iw/LC_MESSAGES/booktheme.mo | Bin 0 -> 1445 bytes _static/locales/iw/LC_MESSAGES/booktheme.po | 75 + _static/locales/ja/LC_MESSAGES/booktheme.mo | Bin 0 -> 1471 bytes _static/locales/ja/LC_MESSAGES/booktheme.po | 75 + _static/locales/ko/LC_MESSAGES/booktheme.mo | Bin 0 -> 1375 bytes _static/locales/ko/LC_MESSAGES/booktheme.po | 75 + _static/locales/lt/LC_MESSAGES/booktheme.mo | Bin 0 -> 1413 bytes _static/locales/lt/LC_MESSAGES/booktheme.po | 75 + _static/locales/lv/LC_MESSAGES/booktheme.mo | Bin 0 -> 1404 bytes _static/locales/lv/LC_MESSAGES/booktheme.po | 75 + _static/locales/ml/LC_MESSAGES/booktheme.mo | Bin 0 -> 1883 bytes _static/locales/ml/LC_MESSAGES/booktheme.po | 66 + _static/locales/mr/LC_MESSAGES/booktheme.mo | Bin 0 -> 1674 bytes _static/locales/mr/LC_MESSAGES/booktheme.po | 66 + _static/locales/ms/LC_MESSAGES/booktheme.mo | Bin 0 -> 1213 bytes _static/locales/ms/LC_MESSAGES/booktheme.po | 66 + _static/locales/nl/LC_MESSAGES/booktheme.mo | Bin 0 -> 1356 bytes _static/locales/nl/LC_MESSAGES/booktheme.po | 75 + _static/locales/no/LC_MESSAGES/booktheme.mo | Bin 0 -> 1317 bytes _static/locales/no/LC_MESSAGES/booktheme.po | 75 + _static/locales/pl/LC_MESSAGES/booktheme.mo | Bin 0 -> 1371 bytes _static/locales/pl/LC_MESSAGES/booktheme.po | 75 + _static/locales/pt/LC_MESSAGES/booktheme.mo | Bin 0 -> 1364 bytes _static/locales/pt/LC_MESSAGES/booktheme.po | 75 + _static/locales/ro/LC_MESSAGES/booktheme.mo | Bin 0 -> 1390 bytes _static/locales/ro/LC_MESSAGES/booktheme.po | 75 + _static/locales/ru/LC_MESSAGES/booktheme.mo | Bin 0 -> 1722 bytes _static/locales/ru/LC_MESSAGES/booktheme.po | 75 + _static/locales/sk/LC_MESSAGES/booktheme.mo | Bin 0 -> 1393 bytes _static/locales/sk/LC_MESSAGES/booktheme.po | 75 + _static/locales/sl/LC_MESSAGES/booktheme.mo | Bin 0 -> 1374 bytes _static/locales/sl/LC_MESSAGES/booktheme.po | 75 + _static/locales/sr/LC_MESSAGES/booktheme.mo | Bin 0 -> 1679 bytes _static/locales/sr/LC_MESSAGES/booktheme.po | 75 + _static/locales/sv/LC_MESSAGES/booktheme.mo | Bin 0 -> 1349 bytes _static/locales/sv/LC_MESSAGES/booktheme.po | 75 + _static/locales/ta/LC_MESSAGES/booktheme.mo | Bin 0 -> 1928 bytes _static/locales/ta/LC_MESSAGES/booktheme.po | 66 + _static/locales/te/LC_MESSAGES/booktheme.mo | Bin 0 -> 1806 bytes _static/locales/te/LC_MESSAGES/booktheme.po | 66 + _static/locales/tg/LC_MESSAGES/booktheme.mo | Bin 0 -> 1628 bytes _static/locales/tg/LC_MESSAGES/booktheme.po | 75 + _static/locales/th/LC_MESSAGES/booktheme.mo | Bin 0 -> 1766 bytes _static/locales/th/LC_MESSAGES/booktheme.po | 75 + _static/locales/tl/LC_MESSAGES/booktheme.mo | Bin 0 -> 1273 bytes _static/locales/tl/LC_MESSAGES/booktheme.po | 66 + _static/locales/tr/LC_MESSAGES/booktheme.mo | Bin 0 -> 1373 bytes _static/locales/tr/LC_MESSAGES/booktheme.po | 75 + _static/locales/uk/LC_MESSAGES/booktheme.mo | Bin 0 -> 1681 bytes _static/locales/uk/LC_MESSAGES/booktheme.po | 75 + _static/locales/ur/LC_MESSAGES/booktheme.mo | Bin 0 -> 1462 bytes _static/locales/ur/LC_MESSAGES/booktheme.po | 66 + _static/locales/vi/LC_MESSAGES/booktheme.mo | Bin 0 -> 1431 bytes _static/locales/vi/LC_MESSAGES/booktheme.po | 75 + .../locales/zh_CN/LC_MESSAGES/booktheme.mo | Bin 0 -> 1310 bytes .../locales/zh_CN/LC_MESSAGES/booktheme.po | 75 + .../locales/zh_TW/LC_MESSAGES/booktheme.mo | Bin 0 -> 1341 bytes .../locales/zh_TW/LC_MESSAGES/booktheme.po | 75 + _static/minus.png | Bin 0 -> 90 bytes ...69c37c29e427902b24a333a5f9fcb2f0b3ac41.css | 2342 ++++ _static/pfhub-logo.jpg | Bin 0 -> 63998 bytes _static/plus.png | Bin 0 -> 90 bytes _static/pygments.css | 152 + _static/sbt-webpack-macros.html | 11 + _static/scripts/bootstrap.js | 3 + _static/scripts/bootstrap.js.LICENSE.txt | 5 + _static/scripts/bootstrap.js.map | 1 + _static/scripts/pydata-sphinx-theme.js | 2 + _static/scripts/pydata-sphinx-theme.js.map | 1 + _static/scripts/sphinx-book-theme.js | 2 + _static/scripts/sphinx-book-theme.js.map | 1 + _static/searchtools.js | 531 + _static/sphinx-thebe.css | 129 + _static/sphinx-thebe.js | 126 + _static/styles/bootstrap.css | 6 + _static/styles/pydata-sphinx-theme.css | 1 + _static/styles/sphinx-book-theme.css | 8 + _static/styles/theme.css | 2 + _static/togglebutton.css | 160 + _static/togglebutton.js | 187 + _static/underscore-1.13.1.js | 2042 +++ _static/underscore.js | 6 + _static/vendor/fontawesome/6.1.2/LICENSE.txt | 165 + .../vendor/fontawesome/6.1.2/css/all.min.css | 5 + .../6.1.2/webfonts/fa-brands-400.ttf | Bin 0 -> 181264 bytes .../6.1.2/webfonts/fa-brands-400.woff2 | Bin 0 -> 105112 bytes .../6.1.2/webfonts/fa-regular-400.ttf | Bin 0 -> 60236 bytes .../6.1.2/webfonts/fa-regular-400.woff2 | Bin 0 -> 24028 bytes .../6.1.2/webfonts/fa-solid-900.ttf | Bin 0 -> 389948 bytes .../6.1.2/webfonts/fa-solid-900.woff2 | Bin 0 -> 154840 bytes .../6.1.2/webfonts/fa-v4compatibility.ttf | Bin 0 -> 10084 bytes .../6.1.2/webfonts/fa-v4compatibility.woff2 | Bin 0 -> 4776 bytes _static/webpack-macros.html | 30 + bp-guide-gh/ch1-model-formulation.html | 839 ++ bp-guide-gh/ch2-numerical-implementation.html | 1031 ++ .../ch3-data-generation-and-curation.html | 1086 ++ bp-guide-gh/ch4-software-development.html | 636 + bp-guide-gh/ch5-problem-setup.html | 649 + bp-guide-gh/ch6-result-dissemination.html | 602 + defaults/markdown-notebooks.html | 550 + defaults/markdown.html | 553 + defaults/notebooks.html | 575 + genindex.html | 394 + index.html | 1 + intro.html | 494 + objects.inv | 8 + search.html | 406 + searchindex.js | 1 + 175 files changed, 31726 insertions(+) create mode 100644 .buildinfo create mode 100644 .nojekyll create mode 100644 _images/165f042da09af3f7a5e742dd4ae058315b519fb9d19a8c2ebcea9dfedcc5d077.png create mode 100644 _sources/bp-guide-gh/ch1-model-formulation.md create mode 100644 _sources/bp-guide-gh/ch2-numerical-implementation.md create mode 100644 _sources/bp-guide-gh/ch3-data-generation-and-curation.md create mode 100644 _sources/bp-guide-gh/ch4-software-development.md create mode 100644 _sources/bp-guide-gh/ch5-problem-setup.md create mode 100644 _sources/bp-guide-gh/ch6-result-dissemination.md create mode 100644 _sources/defaults/markdown-notebooks.md create mode 100644 _sources/defaults/markdown.md create mode 100644 _sources/defaults/notebooks.ipynb create mode 100644 _sources/intro.md create mode 100644 _sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css create mode 100644 _sphinx_design_static/design-tabs.js create mode 100644 _static/_sphinx_javascript_frameworks_compat.js create mode 100644 _static/basic.css create mode 100644 _static/check-solid.svg create mode 100644 _static/clipboard.min.js create mode 100644 _static/copy-button.svg create mode 100644 _static/copybutton.css create mode 100644 _static/copybutton.js create mode 100644 _static/copybutton_funcs.js create mode 100644 _static/design-style.4045f2051d55cab465a707391d5b2007.min.css create mode 100644 _static/design-tabs.js create mode 100644 _static/doctools.js create mode 100644 _static/documentation_options.js create mode 100644 _static/file.png create mode 100644 _static/images/logo_binder.svg create mode 100644 _static/images/logo_colab.png create mode 100644 _static/images/logo_deepnote.svg create mode 100644 _static/images/logo_jupyterhub.svg create mode 100644 _static/jquery-3.6.0.js create mode 100644 _static/jquery.js create mode 100644 _static/language_data.js create mode 100644 _static/locales/ar/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ar/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/bg/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/bg/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/bn/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/bn/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/ca/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ca/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/cs/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/cs/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/da/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/da/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/de/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/de/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/el/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/el/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/eo/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/eo/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/es/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/es/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/et/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/et/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/fi/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/fi/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/fr/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/fr/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/hr/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/hr/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/id/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/id/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/it/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/it/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/iw/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/iw/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/ja/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ja/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/ko/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ko/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/lt/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/lt/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/lv/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/lv/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/ml/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ml/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/mr/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/mr/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/ms/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ms/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/nl/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/nl/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/no/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/no/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/pl/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/pl/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/pt/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/pt/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/ro/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ro/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/ru/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ru/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/sk/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/sk/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/sl/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/sl/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/sr/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/sr/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/sv/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/sv/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/ta/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ta/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/te/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/te/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/tg/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/tg/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/th/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/th/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/tl/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/tl/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/tr/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/tr/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/uk/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/uk/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/ur/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/ur/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/vi/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/vi/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/zh_CN/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/zh_CN/LC_MESSAGES/booktheme.po create mode 100644 _static/locales/zh_TW/LC_MESSAGES/booktheme.mo create mode 100644 _static/locales/zh_TW/LC_MESSAGES/booktheme.po create mode 100644 _static/minus.png create mode 100644 _static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css create mode 100644 _static/pfhub-logo.jpg create mode 100644 _static/plus.png create mode 100644 _static/pygments.css create mode 100644 _static/sbt-webpack-macros.html create mode 100644 _static/scripts/bootstrap.js create mode 100644 _static/scripts/bootstrap.js.LICENSE.txt create mode 100644 _static/scripts/bootstrap.js.map create mode 100644 _static/scripts/pydata-sphinx-theme.js create mode 100644 _static/scripts/pydata-sphinx-theme.js.map create mode 100644 _static/scripts/sphinx-book-theme.js create mode 100644 _static/scripts/sphinx-book-theme.js.map create mode 100644 _static/searchtools.js create mode 100644 _static/sphinx-thebe.css create mode 100644 _static/sphinx-thebe.js create mode 100644 _static/styles/bootstrap.css create mode 100644 _static/styles/pydata-sphinx-theme.css create mode 100644 _static/styles/sphinx-book-theme.css create mode 100644 _static/styles/theme.css create mode 100644 _static/togglebutton.css create mode 100644 _static/togglebutton.js create mode 100644 _static/underscore-1.13.1.js create mode 100644 _static/underscore.js create mode 100644 _static/vendor/fontawesome/6.1.2/LICENSE.txt create mode 100644 _static/vendor/fontawesome/6.1.2/css/all.min.css create mode 100644 _static/vendor/fontawesome/6.1.2/webfonts/fa-brands-400.ttf create mode 100644 _static/vendor/fontawesome/6.1.2/webfonts/fa-brands-400.woff2 create mode 100644 _static/vendor/fontawesome/6.1.2/webfonts/fa-regular-400.ttf create mode 100644 _static/vendor/fontawesome/6.1.2/webfonts/fa-regular-400.woff2 create mode 100644 _static/vendor/fontawesome/6.1.2/webfonts/fa-solid-900.ttf create mode 100644 _static/vendor/fontawesome/6.1.2/webfonts/fa-solid-900.woff2 create mode 100644 _static/vendor/fontawesome/6.1.2/webfonts/fa-v4compatibility.ttf create mode 100644 _static/vendor/fontawesome/6.1.2/webfonts/fa-v4compatibility.woff2 create mode 100644 _static/webpack-macros.html create mode 100644 bp-guide-gh/ch1-model-formulation.html create mode 100644 bp-guide-gh/ch2-numerical-implementation.html create mode 100644 bp-guide-gh/ch3-data-generation-and-curation.html create mode 100644 bp-guide-gh/ch4-software-development.html create mode 100644 bp-guide-gh/ch5-problem-setup.html create mode 100644 bp-guide-gh/ch6-result-dissemination.html create mode 100644 defaults/markdown-notebooks.html create mode 100644 defaults/markdown.html create mode 100644 defaults/notebooks.html create mode 100644 genindex.html create mode 100644 index.html create mode 100644 intro.html create mode 100644 objects.inv create mode 100644 search.html create mode 100644 searchindex.js diff --git a/.buildinfo b/.buildinfo new file mode 100644 index 0000000..1b3f1c9 --- /dev/null +++ b/.buildinfo @@ -0,0 +1,4 @@ +# Sphinx build info version 1 +# This file hashes the configuration used when building these files. When it is not found, a full rebuild will be done. +config: d54a620b835e21c0a25c8324d24e68d5 +tags: 645f666f9bcd5a90fca523b33c5a78b7 diff --git a/.nojekyll b/.nojekyll new file mode 100644 index 0000000..e69de29 diff --git a/_images/165f042da09af3f7a5e742dd4ae058315b519fb9d19a8c2ebcea9dfedcc5d077.png b/_images/165f042da09af3f7a5e742dd4ae058315b519fb9d19a8c2ebcea9dfedcc5d077.png new file mode 100644 index 0000000000000000000000000000000000000000..608a1e0b4388b0b195dfa2d7d20cc4c73f5050d3 GIT binary patch literal 173939 zcmaI7byQUC_dYy`0tyJINH>Z|!_X-W(%qd>(%l^cB1jA!f=G9RAPqweozfzmBQfwh ze4a<2?|T1u*J2j4&YZZIB7Ot{fv{zy#Z^EcR4xz*r33>FID*5( zE)V?Ub&=3=QFX9zaW{4{2gw_|ytj35v9&g#bTfBywsx@RVCG_GXQZ@pae42|$HHRw z_XK7KCrg%BKM75Mn>>6kt?dll()jL!@Z7FP*q_DgX-t6UnW*oKdo3KltZGT9uX50t5Hz@IS0>l;30|b#Khzz9>)EN%?mm1A2OT@>>3$*#1aWb|$4@I|BOa*RQ-*QVEo6KVgudpdfH*Q4RR-{fuQ( z(Pub014VwkDi>!XKi|rGm;GlCq@w6w*xIUH&Q?M$ef}PV($oL9OQF;R|DQceqwkq+ zJLin$-*0g2)pMOx*Yn!`EM+G6M@Ze30Z+K3Qp(Dh%bNH3Hit8!r*}RV6-B;fZVc%q z_ujQ)k^i%iDOGax&0AwWTXg)h^}=3i)2!|qA8s4$$MSpXYHHqJZWpR5D|fiJU+HU< z>B;bAZ03ZMuO?(&)AGCRdO$Rb|CRl3O{z)mfQtJ|P5uxrdR3j7-FXW0o#DPQgP#1x zO{mQ%7(!s^6K}-&lhm-zmWbl!FdW6o&TgY=r);gVmt1VxmAU0m)bBVUOUcmC@Vx>Y zd~v-cJOblhjxi?mS*M|RgW)K?|402CZB0I_2>2fJSFjTe&mLifExXqwpF;Cg#$s_% zQBehc{|NR0ZZ-6jlM5doAA_plbo?z5A>ofmy38N(Qsl-5ORai-7aI~=$POI8Z@@!_ z9Q;m5GW{;C(a_KuuJ)S^2X+6L4C$IUq7Khtk8*ZQ?B|A^lsB(b2t8S4s_gD;H9FP( zXaW{yzRfWy3UhdYJeZpsJ~46s+kqc~KZ!}V=PgTX7nIYcr)5)0_!7_XdX>PlmwyT6 z8;jo&Cb`$ooaxP%f3{pT=;yHS@JLQFm$K{Jue=5*O>ooZ>8HTI2W~sbIH<51i(p8>4J!9X?p!b5A}NA{gVTME`>#(6h0SNH%)@<; z5?pEcpMUxKbu|c+`A4BJlK%GQ;8v($*uu&x;`7_&@wqu!UEQ>&wX=10BsoeEFWx4_ zq*k}Ir1$hlX8PZFE**w(gFf_|X|?+a7HhWOe24t|N>QCyTlu-&=eu;AtRaP8SAR17 z#CWe%WThx@bU*8QozC;-V#{+qUaHTGy=7b8ftr}CQtxKpy?qeEz0@bqz1Riphq#y+ z>Qb|`mxqXjVbgwq;eO%VKNgNgy7P||f|94+w zi9&E=E5=&ML83eLq_7ucc#mag?)3A{Y8iFwV$_Q@90!@|N9X1SF3)yQE?(aJloDPY zG`wL?)^{TsOlH}to42QV9(@!pe4X@Gf$HA*=fQ<2@&`g?~_>&R%^}nPv&13*^!!Kr)DFWf{a=f z0kAagYM%?I^S$}r7SEHr#q?76w{Yy+Ie3!*X1CxrZ)dvsdv3a|XS)67jICEJ2iM%( z+_U#d-E=-_@*`0r+|VqkC(^Ih;5X%zz$H)zCXlOx@+hltUzjWhu8cL8iL+MS)94ClOyRf2Zu zSI?YoYHMrBetrC7XHov1Vbwh-9ih&z46C06jJ{1XM944T%;N9O*_7YeumJKDZaNHc zJ0u>N9NaluJ@dkG{V$?Xqc?}k_vbbyQnWvVu}Zrk;(10x+l!7~mG9TCeW2!=)^{iK zzr9-ayguqpWit(PZpq0(F_LpBC@i#;d-lhFb=Qm301sYTIcdIZ4%OFS&m`eU$4&${i0iSz^r z0v_>`?YSMmbCcVG79 z)~&N$`C42?jf-*EhG;$DY()8sBBydc_2e+NqmLJuY`|c@C=l_lBj{_GjiRW92&9;4F z0KU)9=-#de^$I|_(4w!OtQF<>vP5q5-neI0l%;{pexaDel8Cu zBqqN1V@lWIb8hbHmok}urRQiyv_uam}1t=jNEAx-rB zRw?PAh*LB%hBOi&$Ei(thFh#zZn50vyWl#lujkl}54!sT=HvwII^yed(ZkjQ-?+OF zJ0ZiB_O7;hime2$0`gwcn;Olr;p|l(!}UHeC(? z9Y?r4x8s-u0a<7BALrpwDqZ7l+OulKOc3aKfdfNUTmC33qg)ggU;jj=mR@uGs`R+l zR94DXrRZ6|+3}Yfel6p(930;WUHiuF3*=^+!{&F2oA*m83r>Sf*8mo<+?guX z^GBZPd2W0X074z8rnc5`);#%Wle;|?Lc)FQaC`1>z2$$iRqQVoIB(w!fkKJz9QGXq z5;}@hJS=l>jRuSdf=$BpzT*MG;SHiaON-G>tL*P?3e3b>1$xT=w0B?Pm50B~h_x_h z#~AdodwxO8{y7w;wvIgT7giKTf|;0@c9+|;EHgdB7|L75c_|>0jYmBsjTf6~jX#1g zQ~2GP?|iGKf#-|%>kSr^Sw*Y;g~n^Z8qLOXCGK`Fyi~|?@~b-Vf`-N&K@WV6q7Aza z5UQ%G-zPNX81w%;c2-n~mdnXj{>iI;v4gvhN{=1;PY zfP+G<@V#=o(}>jw^69QBI0c;}cw1GDhNEo@T zcrvU#Td|BpERURS!%v1iTMdkyASzOMJC`ZbpW)kVYYPuLlNx(%+05lT4)gzg-<{Nz zdxEx3MSYLbehyoV=V0s~kGGtNV$|s&T!9BdPZTWYHVE45FolNXtc}->JYvtEJhsLr zF!0DxO>+h|c|Ak7$%WpaJb7wLW0-HJB&gi5$;CSJA?Vx5h_LWJr;UvbfLY!yRRS6m zi^u*4XwXDUcgq}jpqO5Y#{9Al7f{UEOmFnq`Fb>xsnGH{V>FCuB0VAN2!7P-z3siL z?UI$e!R^b$!f*AO70?s2#lBchtnWrw=X=8=jfqJ~$BiStu{-7MN;6AuCW`5_K)5!XM^g@15lU0_jM⋙@pZX=QorY-v#Deq15~8iw!T(BELGVoN z&Z*bg&aURy|3w&&Ef9Vs!>u1;$f_#(#lvK3+);7$)Ohf*%_d$hjSmA6?j%Isi?yq6 zUEHV?~d-8!NDEGD>g*FHvHX5pjB;w9WNb%^M7|bgeSC3} zf|!jXJ?4vj3FS!)f=qvS&m-sQ$(y5OHPj;(Ho3rN6*o-E+g2 zV(XhBdGE4T$Lv+6q&t~Uk;oOr&2SHnU*=a1h4qPEe?u3&TUC~$>qgDhw6Sj_Y32;^ zftFJz3$q8PKY*VVCyD6D=O8U;F@@NYdDL8gvnge2!Dj_)OO~Jr_s4i%`=hyBu{1jI zm&9quYso=n2|S|`xz*?l85VVNNDi?Nyt}Ujk)dUYemL~9gz7q9emhK z?Zbohs6WYf>Gu&S$lJSGVG^&~?^IRoUv==`|4`;zlKo$b>-Y>esr$yTucq=Br^*MH zn?1)as+!67P-kXx!@I~FUpGSL?-#JRoLDNAzH(7&o&^hjm*!G-zqhIvco+?UwaJj|xjT7SEZVYob3x%!5_oP!R&VaWd z1pW6X8D782(jBOAPv^8~8)_>x)2Rzi<&EIyyZk>C1L+&~c;m+lZUmreAs>1WwEaG8 zuV8;j;#kIq@OtR^|~)621Y<`eC23i4c$NaZ0dAC(i{A}dTOYAy{I z@fkpzT1Q__yw_9x`Gn~ZThZkF$e}MbqR!qpt7Wl5|M$iiRQH*LlM7I)g&bd)eFRyN zQ|M&J9CyPH<;%NCW5-Uu&B?&Dzl1{~aJC?9{JJ1%1mekZ+bnP9LYASF>0GBpPfP#u z1X~b5CPWmMHAMmWlgrRit<7|a zP%M0Y?0t|0WjB7V0P>MA%qh^QUoZ0Ma56C=^&}ieq(3*EI4wN_JBAQLJX0Stp!h3V zfSHZ6!7}N88~La^q~`k69W?a&n|Z^aEUvb(X<;r3IGyHd==5go;dqX8ho|jsPkP(- zS%d7`^ffmKWQp}DAscRlzzGjX-NBn1Iv*_kQX1icVuT%D5$1)0Jzawr4_1Fqw)dcg zn9FyU0WdzHuQspr>jFNtUvCK=*Yq?rH*t9XcB2G5+;~f#YVgx`qHW0n<^2bkjxYC;s z*Lgn~N%+~^!x9F2l;)e5>GLub)roof)CUlE%6O;6SI1>vgtCgtNB1GH{MHtULrXk& z+Y!X)tl02@(Mo5i?R*{N!1uuWZt-gB>c)gGRXI(qd*0 z{a!q#X&w;_aWyFV&p;JDxJANJ{ihXzER^is7-y8j;g7E1exy@uk)9#y*PhJ?r(xc$ z3dgmc7XLfEn{hH<@33_WR~+$%Z5L(@?=Lo=-2dnNsZkdQ_nA$99tn z$1RZgy-~V*JG)o2a89T(*NN|# z^7sWc74-UbKde|*D$0zv$3Net*`B?bzUSJ{ne`%!2|+-5f#3Qs>BbW_bA>ca__a;f zV8m4|3x3V1K-KGuv-K1U*=8A(Fjq-eJU{k@YuaK3$EDt z-c8cB+HsEwRcqSN3K}YS)9uZA@BNQj0btE7a`_gvk!(2ZJR;b8M_Ge7*{$uc+M7bJXPmmtS+{_wz|r*G*!yOrLn{gXT;RUG)Cg%=kz!WI#36 zbhuDB5y8u=F*4it*0%S#c#pU{k;mY19$RLr^XH1$<^&O?UQQa}W~sNwl-dB@tl~NB5&<}{XZk~&^Iw>w{6_t z0pA{4pk*z-uSs?us@`e8Az;YNKCYRZXy0oIGF2gC*B`1kV*AOrUG{jqRo_Tg&@zwn z1B)%_PW3@zEVi_>W5LQ#vRA4wwa(IRS6a?3dH4E-$2?{qcuqeB@RggYf}uK*hP%y@ z)&XN`Y|{QVnp&46+e7=-v#Fq7z?bc|@Il>M*2sXrgI9bb^o8l2K(^)7ko<4LhVt$3 zyftMk<;3|8xozN+HHR3^b_6ajVt@O1aI=-7V@)D8Go*XJNx@``D>u!cz-88iH#@r` zk}|}o=aU0XjUQ&yv=~x%IOkVM0$Yn|o@isl%zL*ol@jsv71xo09nIwUZ2)xGkYMDS zKCC$=J{^zhZ%64R{4d6mh8fJQUz5(ZZM`a6pRv61_ag|&KGG*p_B{TYy9USzAI4Go zkVZ=uSb<3zw^G%6F4os3YYZszsDmM9STwi-KaZmqh|_?_QGJwIs6A^47Ajdnjc|Dc zW9p7)vAIZ(EMzT!(erJoiG0regZW8CS?t{W$d}p>cTX)qtQ7wAJ|zOzr*$u1?>3n3 zML;Zdo(6sz|HWJ9N<+;|V+!p(h?#WJk0OyAAA9_K9$y|O>51p2BS?0HhoCk89wTOT zGmL2GYpIlTqX-70;VhN@f!3S+%Xq#O4WHz5w^P8JN zhjM9w4olQ7{vaD3(W+93#{-cw-=z7Vu3tJ|l2lfPNV>qiM7TD<1u(R4yH?~x=`t(F z%^OEGuF})|8cKgFRVV>Oiny~?gBOBhOY(frc%vBjxOflen$cjQU#lHXex$ca(``*35PJYWkx!}P9=*AsqP8NM0v4dt?Hoh&s7f_Wu*oSFM8|acXzvmz4@xk8rcu@ zymq2N`38O;XY|{}yYlkqKDSm`&Pg}vyqD0Jsc|Nr-FFc*7Mq&MB5wIdko2w<(3Q9pgj}f=kK~ROHRN)jACNe;c3Dwlp zMia0T9^4Det@DbaiNg)jVw6-=!~w`%!Z3i2{fDAkr6km$gP;yfm(Wh~i!A4j;40&# z3GnSVPy~b;wla^n%|1FaJ#!B%2p$ZbZHitIzW%VTg!bW#lWV_+sNt(k|0&|*?*4a8 z@tKqiyOdIPJ2~+%+$2up?`n9_MlazZI%fKcle){H#b0%XZ5mjKEllbTzVBK|vXpl2 zF2phXcp(2BE1WePEh5ajpLQ(~Jlw$_x|>y)Sb<_?Wd(ZQ1zDZR%gyb)NdE^x$dTEu z0Su%ju7fqYTGz|uiEp^yb=^^wyvMXXx7cCxpw#^hendvs&AE;Em$jnok3&&^BkJM>^RRg4!sl$faONqou$Ef|}bk=EBI+jhAG3ao68 z>gP+TIsb>#G@JjaAvc9MmXegF8AMg}#NKIzt$i z!!`OZh76BX;=*PE0(9orN3uzMJ&+^ho>^F4gKUtLvuE%9;1TJa^{;S+K7QtLdUiYZ zstsr}7HH8hXe-^FWrzb4&+lg6)K$Ml%lo4KAKkvOd0^K32l3))h(GgFXZn-Z;% zF5%lp0S3C^n`eCS_zVI{E_N0!DZ^Pn6!@m8FZsTIJZSAygx)LkTCbFuD2Kyh=sW-0 zN3&*AMDhra0zIbYCx2OnFoTbHX;GXE8K!O%lArSeQ>FQoOTWT3wlb=BZ1kLy)+15o zf6el{Qw6&FK4H>|DKQ~xPbipa&kE|0xM{xXR?O!fYVxPM!MJ%P`q2a+pvT5 zL6K=kl7NDEqMtO44uuIpo4ngTdK~#*h9EN$_c~urj!BN#38Q9jE>d*uAMG%5L;K7waew6# zWqRLOyQ&&_p9g6(Rno_AUzpns#WCtx4fhXJ1%AR3VhDwlt8B(eaJONI6nOH3${H`a zFEs=tEwXVyifdSsc^AG7Td-bk8!k|Pnf<8iH9;E=?0rt-!Vm1ejwUoHngtpjiQ8s` zoo}ew3HhnfL&&s`P+HT=kvL6LAfLIZ_anTO&@`Edi(o#G+in1)W&9s|!t=aO+*F|L zP$1KP?Fz4ecYh|w)f9pX5~x*gC}t4B2y^FZ*LW+qNwn0Kd}@RNv-?r{K{*vr&Hg08 z6tZJqM_4}rms?HGtMaZ_^pxx>55f9{yVq~m%j0>LxLdIE?8Wa}2eMy?QAcU0JPyDo zmXRXy+a?0ZD)K(nROjpj<3(DX*LH_u2NN+ucfLz*ZK@3zBW9^jh@tT#tOrOqg&T6hm zIum(V_V-De?Fox${Zv2uxiRTkE(7^mP6Uze$4Id}_lX&I3b8hMaJ)5Iy_&C-0jXdN zn-;_r>5nWNG(EBfOTkC419K5~7PF6{!m<#JkImZ)f$FegNxxu2zwGsX8!Pjd)AJzv zsC(FsXub`{&Hd4^LUzR(Zc5k@VEX(+v?(R)!@;eaX1|f8;$;cj!9n!esr4J*-R6DN zkgV6t-yYKy1yXsD`*g~5q+v9(6}Iua?`3@xt)8?WBOgi8A7CAfJR$U z?hVEzoIt#mcOxM9BegzBoi8gb(Kkman}kJ-E?)B%>Km@Hyn#nKoJce%Mp05#cC9gI!qC>;k=&OyKyUY zyZ)w>v*w%%NFGC`gq)Ph)37?LB5dcyc3}Q1pNiYN=I{xQq>=qCF8xxT=hz449@AYU zzfqdo3g+ImlG0#gKl1GTP#IkHO3^eT5)%_-S@sMSRl8 zMQ4wK7-pG}_S71P8j8>LG(RV`)oyr1!|L}rkM<)z^-_-x z=-dyX`Jfk{<8ei535QNodorM%prefW$L~rj$#kWq;I#9)bmRguA-J|}n`q=^!l`tc z`a_#>zM-h~OENCu3l$_N!qf@Iw=6fT`vQ^Y_Nz=)1}}MvV?R#Pt=Xps7B``VP~t0^ z%BAsdx)z-~Qgdz7e!yq7r+7h^5xaT*fv+N~Ybj&6LeDtQ(t9@IkWv&Q%y6h6r<8Y* z$f29gO&qntDHLWz(3yz#)PgTk8K~YkwMYHs8e>sxsj5z|3`IGxF3Ej+iaz(hQ0wCP z)}tU1y>HzuR}f{u(&k%z;{5B|jm-2MmczWn$==B5aU3eC$9weD?`nBZ{X9uZ+na)i zln7~lD0Uz%~ z&DTkjLAc~L3f|Yu;9+-Ao0|E#CT=Uv9)|I@o@>FNLaro`88oE!ByTu&MlRjUqa^1) zGmbemiZHWe0o4+;1zIN?VtrdW*pjjv690Jkl8EZnOWPKRYs0|Xj;e^*ggX5BB*XG2 z%bb1_J+hx?PK4Wk6eTdzOufL|&f8*jc0oXj3}q26fvIm!JRH@h zAsJvB(rnM`;hbY<=KGY_yE-M}=PmQ7B9_t9tDi2gTX0xZGoewb1zSciR7!QOnT*B zj3NC}EzoIo3pMzlJ60?rf9m-jl@B8He;d}B;JG>orDdW|RUP!CY2PG}SY7=(J9XH< zZ&o7-ugN|6#F#qr!#|&)>g`Bl=e_o7@dnNk_mAQgGK6&PiJD%ZRq?TvHV6gnF+j zrw~Yibz+t?m9PIbc1|xv{&hO$`jH5c$rtpGY&Ax_+cyR(=sItvAC?L6Iv5P%alHsF zw@HoF4p4^E!so%*c-Y30;Xr=szMdgS0b7%xEznTaz_0v=Q)BzgmOvk3PPS)GstVXO zwup7C?@7yuA@;Yx<)!Y!O{SE1+(>fm1mz*X9Xywgr|#@2D?b{}+~Ns)alY3nI|xk| z*JNpKKjWBUZtuh6#HaY(2brLt#xb;-~j!v#O4ooilB-UFb zpm0bY`HA8i#{FIl?!_I`%dIxKZAPNSnUgb;-XXa6K``YvfD-lY|2%voS1nhK$(*q5 z{hh>c$a_&-W5kSxtFaR;dl%c`{&&hsZ~p$e=Zy;f_AF_#AA?m|?kANI!+*owBp5VI zO|jjAQ_{hFAQv$x#2?2sLuA+*d1$+<+aF}{zOnVbE2ijIH_NX z7K62h{Bv)43nF5oWkI?JMZ)EUY6g!09qWjk3-YX*R!;asvV3%uW?g~?ip-iu8}qba&FQ1(GTHkQM19J}lC zg}di%G?aB<00lP{D-~JAT(mBy?VK=EOEbbqHA$t~ECBC4FcwpQU_OeC; ziow%rYeH31_4-M$N=#A-uib9TELujl-dH-g2KrL!C(*16IKH$RNbG{PomB&i8sGif zLX*8Vf@36U>avJ@KSmtsFR`0g`SJ6~N$k9GS}Z>W4ViobxdN(^-|9Lw*O)$&*7j-2 zNu6VW|F-OqR{F{toYFYAiWOAD0-!{Iw++TGBpq?A_l@H)Xo((BjYF6G_5M0KX(g5I zDag4ZZqogl1t{5IIV=x`A^eCL5>iiFEyHNA>=N;ctu3x!lCAPDE`EFQvkjTMpH`wI~lTwuX(Q5(u>Ni>d)q((1-7hM!I}?ZTN&%IZ0o$j6 zbQIrZ3rB5?24XMDbEUBP>Ub&sn+4F@=JJ}!upDV`z_ult4 zrr&e_AyTWn|TFgffbpllrov@(X)O1a7!PBKlm}&LWx4>pYT721@Mr^3islu?w3bTU$ zFGV^3W!)S7M_^={lOeJrw`@t5(w9R)ASOh>gb z0-1s|1_K`!G_2WJXC*q8#x|%};hVa8FemBDrhU(vkB>&d(sVL4mQ4A@#qZVCw^|jt zOexJ|3pOcqO-;KyfkFTnyVdKm51FhPJRfag!K%WBRsT2fkV*t3lS5$O=!at`&`|K9 zTyxij&B2suf8e;q8Cu4{vh(5jL44ZIx6^@#TN7Z&xa~ww*>Yv&j!n#Es_n(ZEzQ%Y zA6c`~uz}Z`tD3%L2ZaP`I{J`jT#J=!M z(_OAXf$F}#`!zN|>O42~psSb3I_hv=DP!!GOWD0WVv*UMmq%pX1hGDl9F^Lx3LU=Q zZmlBtU=!Oy*Ie-Ge87v{j-RLvF@5YKPuApK@*V|u+gADJiyHWY=wRKa$AUMM&=sd# zuF6G#=$wo}4v|WM4UOas$@*l(img6yjh~-^7xDNcO$hZR{yaiqwN6e<)d;g=d7Lbj`Ai;}M=Jhu_*?Fu` z##KaXLy1ddPKi5T7pcZ0fmmbrsypprG5&r1dz0xNWt;Qcj*H#3wnj`m<5{^0e4yp0 zq?oX;iSjm`DE}&)=djtkN8fZ=(Er6)*8S|2(ycgtH*mGkB{}#zTkUv^HQ-rm`IOJmsQJ=pp_PRGwW?^s!S?v3IQSeG&AJvKP?$#trmD%2RxN zu=?7BCepT=hU?@}rlM<&GFRa<_ehfDOu_OaI`hO29+F&EO``$%cDqvZL$Gc zeUn83GbxUjMUPpoo&cMYfxVFWPq8D#38=b}%uxXiuMQiu1(MYDQM<@tPDq?Kii zmL@4|&!YdbpMx}B8P3E^e}Bo1 zU8+Q*!SSirvLeqPyIE!MRL9SU;mZHU zyUyVD_9bZ=Q7oV0d9p+!ctxeaaEyWZF03P$=kGHPE?Ar zsfX|j!nELD^TkZ+gZXKqr{;8AyM~3Q&ygr1rL%}MWpH5|qWSQA@8*-(k(Ns*&^huj ziOr^ZoIZ^F3cZp!HB;Svh2%~cYOO1@vPn!LDeSM+{5qYm%44W!$B6T+QJ^dz5PX`R z4>G+j40Py;kWLqi&$H2@?CqO6NjRtfI8U9V_O$NpgDJA7af{N$IuXJBvHhyPmZ%ZEw!6j|bZ}JJ{ zwx^ke3-A91*a^_#g!)<$^RC+_I4+$F)g7`xTX@xk84Htuy8^wp+`nww*Nn&G!TSR$ zoBrF-mLtiE`y*IH`Vj{MadWg)TqBu8)uXTw-v?m*@9NrA)3ZxS2ybs-X%=;XUX)ql*6O#~Tq3Rb4#$)}?p1YC7yI8b`mq){;fRpA^Y>7t{V1|W7 z;HAED%0pE7kP=L$;&=h2kNE2po^@7{8mpf4lvMEA(}Pwt4Gi(pIxMH2&hx7{m>~A( z!jfk% zrlTX2Zdykgj_nkPwKs_9?iop-RW|7WT`w(_FuCqS$~J4);e)bccJYRCBf$^S{jSeB z9`|+6gGrWyx`z(}wc%q}sj?QKCwWF1@ez>4MAdR=m_@@Q10d^q1J6-A@2R|;r_-CS z{6Fu$l3X9ZPtmDPoWE+O-KAgmE>Zx&w_|Q9Wm99TI=B>`Mecqr9&4q+C($G|_0EGB zXa|m04s*F(50URz;dL;ZCwKEX;@7gqG_-qIE#xQBaa31PNdxA(=#-p75OO>pEJ!kE zhuOGvp&1RIQJ`g?l;b>c_*6?7xhY8N=0G>c^gwLy!PCN=$dxyRsh?*TKe`XA>vTHS zFZW%u7_Q~ln4g<@pUGtflQWWVWO2@f7B)Q*q@3O_V?^f&CS=CFcwds)t0+-TFDwPc zAT&1za=y>S#HKLRUA3AqPOeQJu94vsm#NQ8Bx9AAk91uqcK$F!t0|IN&r_%LBk~t; z&n@yeCoQvfT`F1l6&|JaowsTgP2_Jb{LZ;GI^pCdtv;^oK(hMs+!VleZot->CGxUaZtR+y7LtilPl!@A#@@HpOCJZla6q@Q50 zxV|uAmVOMl6rCA?i}eIOr~VgmXB+fn~t#~7Og zp6CanSn|^yc5g1ctDO;Pfirg_TC(CzNFl%JHAf);<)rfA;&ppWJc`UY*t*v3NOB#2 z*Kk!^|B^A^1L6LV@S_pvaLes)LdkE6Rn2jI1sM{Crn+qNf|in|g*lCdFd+G&!)Fqd zF*cP7`l#PZdB4LNg_zmAq0|L~N!rc%omf60%Mj1hep|x-SX8OXE*KK<7xDsR}P-p21H}wzbJUXp^IOR1~ZJYI{(45Qk zP|cTUoWxDc^z}uHFcb~&XV#Msb`C@l=Cu&R3?FqmT`tMJ00b+Zr>s$`(+%{XsJRS< z5*SEZS{9xh1fr9Bs7I^)BhjdFtn+wnFKtLc zRX^w1a8tzjbPm2N@(SY!wI5|qIp+fys~IK5uUnVR#{lU2BnnuP!Ys^7t>me+NEKCU zs;QW)UK5{sm9^AtQ_acc+bVJOeSI~H165GBJ$GBF`7815>V`zG4V0^3_+^_ZEjFYi zn^lYo*w*;jW>j}=dMjcL#wcDe*Qet1Adb7fIAE5e&Eb|XUiKr#&a88Svsg7X(B9V< zvHa7eMvvXQJ^=TpE63vHaQE_JHPE`_V}m^+2V#|c|44-(1dU94Q5(2b5jH`=a;7EHft`?>(Oce zOxC3PtE;P*zl;B;z*Hba=HEiV7~Q&jv612o&l ze4@ug=a8;y$q^};;YK4BkYlPeL(Au#?gb^%GU7;^PEOd=sLW3PXdcZf+XF>gU)6mDA0stRu$$S|t-)eo zuoYJ;$kRqHQZnkj=x90H%-!a57CNH>J-*(46Y?U$t#4ZKCAK`qpd-==mXtg6i##pX zB7vwE8{2H|d4PsS@a9KRneq>{Z>h=O(3)Pbya&9CrfEWSCewcXUV)vlDSz(9)HKGR zQ&%KgY(=Gt%FIuD7HC0^re!GX85q|?{+;bqnf_a#G>u8Xy#A}W92jEq@Zd<5d-6E^ zE&8ajZy;=LHgSo4TYZ*(dwGMo!0Ud?Y#yzX11_?H#N?#t* ztn=pv$~il!%i@7&U1~ma`$hIdE9AeEd2sVNl>4fY2kl;SJqi9deEpyXPYCm8O>;&k(N}vF``&)n!)O27Xk2aw{ zXssO>wo^4Q*uS=U_qy!WKNFjB@@QEw0vv!`r#WzMzM-CFuM_HtoaxE~$kM$F%NU|$ zl1d_$(ys?uBZ20;%8qizZHp8a^V2rM}g_%8Y zvKqJ3dU!jPOGSGBt02$d7Qk96)lvrRk3VEg)td3J9DZ|hQMt-SJyO;k)jNtr5pb<# z_llQ&^Uf^Gs@tT2p$hHZgY+>FR#vigaz9^EhkjM>TdFimV{KDvHaB00hEC|_dA4Qr zFU-$*=Fs{;>s-xAV>N<(6jSU0HJR2bp@Rk{7uyw7cAc&_Q#0$ZRLIPS$TiH07~j+?0m72?0nQsa5rVh+_?Va<|xj; z!e*Lzzy0(FV#9Uetb8f{FKK;x$$7-r9`+P(K;ngRet57OKwF|D{)UM1kyl>h`XXB-oPEF$R#KQ42=fF zTwBdGoN*2}VWZyOqvu1vxv>QKU_R%^dt%(L-=v{KPP{;J zdRpt~)tGL({Arx93*$%QE|1DL(S3+T7rv4rp!ra~yUXCtr!ygMR26nsf~ zVkFR8d-D2i>=6qyGkqo6)ibT$?j0wWLNxHcoDvc)2)?rE{syo5;lH#c zENgVb$R7WS%w5`<3ZU7TFU)uZU%#Ua5i#So6KghaQkivpdo}O_tUs$t6mxvL2SN-5YjQi%o!yOyj z>sdY${@S4|UBiSVSM~kS-aO68eqxfig$BCnVXMj;X74IH9!Mdg#D%^=lnd79Bxlq+Nn? zjOZEX_F@_#Fqo|sd_mpc?xB5i5S>I*1>r4?i0LDORKJHMxDBAqZl(q!X}#tm-S#XS zs?FC8bkcwp6s6i4v^=o%B#FX6wdZinK6R@rtv(ANZyZsKUOX6mm%F!Q`Zs`aOGWZi zC5SQUyZn4)|}5uE8|5+e#I|8Xtm&jt`NJo z#jAl28rBN#p)=Wrg@?~JIMR@C+uzS_Y`mKi1ZK|%4i8zgt`@dD_8YhEx?lI^YVUyR z#Kgqmd3_vm?H>^3=rV&q8V2H;g>|l-OYo9nwf%lXozTJEN)GT*VBa5mKgqcPFiNCT zpQ>ircBN9_pZ{Tj?J;gp&Z3jpyXIh&eD4hlJ+pDz^WE%S9wH))_Nu%eI=j+RXWDee zzkL%V$9vtMeZkiS$pS3d)RP`;Vj7SB$t`r`uhY0w%>-HiX3IWdOCJ> z2+#LI2hwPM3zWtNhQT5pYxSj8khnW%u=&c@SKsHA8kBr$XrLUHdmU$0m5Z?Jw>Z%?S%p;5%T05CkTj(nv{22`CNH(%lG1BOqOqQlzCrx*O^4o^;3lTx;$B$OEp+2@J*<-}}V< zrg_ZIFLk$vVBCO~Trc?716;ZnFEjLu)c>28v{o#skBV-+@3`?f?$XBIyJ&2AG%>6@ zmNKR5NFWpc{;RB5Xk8kj+@YZ%(;>`(lzs8^xG_0BWBQqIrlvgH1t%ebVXWDXRrS3n zca0lEKkjnP?5-IBEB-%)`qQ#A6Wr#{FAak+PU#)0bSr8G{3 zGgh5GbWU&QZr$Fp{*k`(iXv6V*>k$-3g20KmHE(BNbf^*Iq5JN>Nk!Q?FGD-))XrM z!=kUkI@j6W{f05anR|I5#A91pB;xPOvbfnSzo&+g7`G${@9|J(jCnpyf+Rx%4U%3t zMRPSmo)ME?IVL-XTX;1@rRI09wZ*u~ufby!7MnLJ0?4W^jG=zgFBr1?(D3%8*jSj4 zFJllsy4DzXeaWzlB4Qu;YD)6E3Q90@45tMNex*F_W%jMY(kCj#F;_)za|Tp#epNYo z&eY*7?aii49GT_KyYL06P?NuW%lfi_{=q*~P1tFn{=hQIyl%AeOxX+!Br9ns(wAKGrW%hs7vKI3E$6t!31+o=UIeV|2{};pWP32q!3LsAL zv;zv1LQl6VP(zdH=?%S;;oBWAxShInU*o&fv+iwKY#TWUhSHeVCTu!KmxtRf zE6w)HWLq%^d&*yKI47fWkC7m%HY4>i#n3GN?vF`U%WPAaoONDeLCz_gQyjXn_{ca> z{dCBPBE-hxH;;Nem>wk0NZJJBBpBvR1qo2mt49KVQsnVb8ymU0mYz(fPu_F{B&cvu z%Aec!)vS%(-4QZeCSzP>1B|nC2uUGoTG2m$Fv0Y<{!mHCHkUkdl=Qw`y7_aup8iBg zoAQIHlJSjfUL?C^YP5A`Boe6@X=3l8nMwYHDax(FQR38U+h68wgN_41iBF5`aM!~= z%(5Lk2MD*#bqo5_SMB6O*`+n6NmQf+C<7x;~lFdSY+1^0%0L&R{`aJ$R*B* zef{mp(RG3rKaY5msE<{Tdk4p!Qg;f7|ccUygA!;x@623S;=0g>Dw#g*e#3D}l>nWVLLfr~v z1h;vwN<_kh(lY%-;3aO_^;8<3rrDqR{EU$9&&5yZ$jh4X3Vz9=wH-HX_hMqHym~K| z;dg_o#j3m;A)~TUjJs*AwZh8DC`w{%nGwl~DXayeJ50@P7%9Uw9 z)Gba7NZ2e=1<;^Y()GYf|b%vWbdm$M+M?~rm3G=}? zB2`N_^{|R`2Do2}{JE`VY8IZF4O$aXF%2a6pX*9=d5 z#3d^|gDVadTos#j_~B=I>F5=*!WMIZOxlc!SG{n!iu(sP7*#%gVWj~A#Y!h)Z+p1^ z=W(2HN}3DwKW05p`Fmuwl7WY5TSyf=iKo>BbgP$;k1nG?I8ErCb5lmB>)alfYD?jV z6D{Y~7*oG*(th!OKI^uoS>M>mbe!Aox4lWLQxrkkll??+fEG-JhOfi2Z)ZHuzYQ)$ z%nT3|XK%^K=Ot(=tx!`eBaQzx8F3NpLr|B`m8yj>R3@o~;;nS1qmt|UMbs5mD1>e6llh3BrFOwC>d;XP)}*u@Ot zQI$+xJhrlJJArKT157*tJbJl;V2ot6De1+X`iNsmwluMf=|9`RQ|1>50*TUf)Nv~G zYigsA$lJIV@#b|7L%I=cX%XgFSajT<5i?1#3Fg@~P!vH@g>aAgCbAmmD&vOlJRa}F z95RehMjaPsgk{>wgB%>Sb&{veE1z5=jrj{oVX_s-wJyOoSG{izyfumF00}qn>dTp) zk*FDF0{^>f--sc`H=0|V-qif~H{irW#2SRB`<~#HDMxk>Olrc^Q%~+g0SsV zb3yK(pgY}3``eiNE;&3JFOIOm0jSC(_LakGV=C8i$l;3&wQx@GIuL}hh78`vh~Ld! zUk<5sGEGa+G+2mNh~9y#@nfXVZyaX-sS}(8jZ%ZVclRfJvYtD(b;Fgaso^Yc8n+RP zx23i|NE&+C2Orm%ugxsw*P0&R3q z15dd|Y()%a??lC)&v&5A2sP)yuV7gkkTvCo>b-|M9?nd5;{b~KUYf&@A%a~QgkZ;t zS`^FJ9hY5$3>D5(nSSnt9LLo?;f@_~YEBUDD|TcH?|CL^p^%>i*s2pYf?2qo)OQ%B z>Le4}tA=qO-12r&N@ux$k3>lSA*OH=C2#iSo63%)t543*ug*46YPnt$VwLZS$06SxmseEgdZ{h=?Sx@MUv{^b{S%XI)L|<#pc2r^C{G4x28~b z3Plq=4K`lo|No>zE+4l_eY(>kMZgfP?IT~ihRba@at}nGUE@b64ko?+DT^z}Tw{ zF)o=2E3e4ID4jz=P&5^l@t)@EuVk?w%NSBYD!4LAseI=#_i4e5UYXLC>5Uu@fr3T! zO0`6rGe_)L_U=E?ZX{F;g}SA6rA{9-SF)nT7r&U3uwS1tGgIK;e&@|t$rVJKFnt;^ zdtPeV=UtLxxOR0BZec!f2!QJd zf!(|1S(((!jQTe?}#~tFMqyafaq-XdIc04Sr4< zF3ql(Q`P^Hc=vQWX>J4&s9E&a&?&gD%oGda71Yy^)2b*+A zaYLUw4xu>)4(4qxnwd6NRV)XQQ%{{3m0Cq2VYTfVnlo_h4@-V4rR?;CZzeA9Pm2u{RSF0$iQ!nN7w&;yA$-9t=cKxcVcBVLg$MHYojnF^SfsA3& zC$|-SlhXoMYZ!r?FX&YZB4eB8G$G!vt0i8+-U^W-4|HiZUivfe>rO(qe z++h6?qK9i=J{wW)oevmhEBn?3FvZfMT1+SU$v7I}{7dP8Z2puQk)W09C4$^z+93QQ zi;c2g&+oy)vsQY?yY$Q8+u&1zB&YjAmAs?tU6Q|8u|D{mmE;g`Dh5xW0iNs=KG-ssyxXWpi1y?OWW<3e?ij49xnH?0CqPlYc%eESC@myyL{ zPRe5*8U}~ohS}SWy}}P?M@ISTD>6@7Fa$PX{HtZyfvYHG)Gui?dJi%wcMTi6W$ic) zovUXqhrUrVXOy>-*YaE+cn(@(+DqB0k#AQ19T*k0Q}+q#ysU|?zskHbv;P*KLI_8) zNhkw*_VMnf4=r3VOS{d({=5+_@jvIpMNnwoJAi8EAhYfI_uA45w8(R zAs=G@m{H5&M4rDJBij-f6UcM6A*1sDsb$wRlmlN<;&N<>|1u;B@c;rbnWN|_RxB%e z&Gr*vVDPdw4h^`nRIzacJcv}(o_~v!TSe_3F!dj8IMZq#pl*FTsvkF>=}7r>9$h~( z76>+cr@B%Zv&p+a5ml~qo^5ljTXcjy#VpUu~<> zEio}Vz+Czz9ws*|+R#i;P^OGBa5!*x&kGee88T4FZopG5r|4ME^PV!+55NyL!=GzK z6s7DKQT*A?mh$P_P9u|}6EdM2uqGT6y^O-y&*@4CHROlNcH3)6-h zY`PV#W9un+JG-k2D$(pha^8NzAodS(N&N{M*W;TQ&p6Vf5|#e3IJn9j_pFCs0PsNU z(Vm3cE~M$g2DH|F3o>RUCWMFmm8M?*fGUaQTnqdQZqvb*37>jX{C#L6y$iE#>b>h;esWgW^azu^-kq_N#w}_ca@|@sE$J&-6#pX+u%R-av~6C}!Rt z=O}xAb&hu86n>VcRdA4EJFj5x{(VE-{@+J%|C%os+Puq7{2R$u@VR2&X65hnG#mrH z6vM=BlMuN9@ycno_SUrcZs^yDl&_Ac0}?uusg#-?8Y(|hPgwKhdhq{y<~PQS8xjsb zvN7MuS9X5fqy~J?p6B&M?NaLkmXvImVy$rjg@%$&jVWg^YIcEw_R=bkin_N|dAvXo zGD0%-0U%9?K2shac)73rq67)4QOpjm7bH=yl+_nAz%Mjw#Bl-U`==k~{q19Oma{#M zu?`}2f`V$6MOiV4omKbf5@<8v$<4R3Bej1=q0fF#jwD&_tQ_TYkXq5=6wC5D| z@20@WaDK}a2)i{kbpAo2}Y+Y$5M}d z--Mk2d`8OQNZjnpC!%wOf}Gbi_R)vsm#iVmOr*@8KjI|yWKmZ*){laCK_rS*=xf~x zNqkQ@$^g!VH{9vAT0i~^XmS@Nm=zj-?G3x~<;{=S_+U*ZxOiaVbt#KAxReIs(Q3NhtLrn~$PDxCwotv| z0h!B8tBI7y%-WSKHvX-Y7CUK8bn^L1oihuKv9%7<11dg7vmM_QW9Tl*V;A=xU2Zer z-IPejgTy~zW{Se91NR-4zN8DK>3deT7hL96m9Ne2^dNzXpv>|uj)<8ZcgM3DpRF`F zkQ=AQn{6UcRb~XS*CDAN_P9w3Yi;6h-z7*~kxZsLQe?{X5K^S=#j5CXfSb>UTFbO( zrS89H6rSxZU7Gizs5GRgF*tcG&#c`?4QY(Cu|~^LJj*MSI$cdvtOeL`F$8kqO>N%8 zQZOhjAaHKs)CQ&iDnNTZY@PmMNjglvwIu3CLN5D6lPJvFb033-J#yEH>&M<0Cb8_I z(t@ID&t2%iN&2O$K8DISUf$V}fuc0QVrxWD=S)(5@5S2YJW@ug}%tytQKwwQ}&^?`C73Q*Ngj#@Ks`>Ja5zyho3&xElj!EIzZJLZ%%! zYv>}p>sRCz#ds=txi$DP$YJsP_D z?OPl)o|waF-JhlzJghYQ&S@2>+)z{CyA^$Rt+8dzfXTk4K>sYu|8sL zVm64pN@qJxzc~Wb;6GtOsat93B;--Jf%11^gQf^W4pl5QvB96VP~bTjPDKH9Nc3cFyR^v4h@gl{ zi0?{s^x1sr)9nY`zyh4+gwWbd{#`*EX;y`U%nu+{BGV9?afe+}z_cc1AOnCg-`cxt zHGN${d`|zbx+!7wOz((aHN75FpxHi>?ah1o)i$PV52t!yj+1sqi;MEK z+Wads(F=ZjHl5JMhHk;5Oi^-`);i0eAxSh^Q(K%BaH@k~{cQcJv(J$$irRay9D;Tc zH2uY^&5>ZZu)aCrjURcG^%S~3#`H?6L7jLsuJOW-dr57ErYSBY%E1AiWtEALf{T&l zcsQF)Z^q|UEsKR&O7b}A*@-s)8q3f2&8&3!EcE}18WCL5HT^^V^Mf&Mal8XTe=}k(~ZD<@Yn!sELjOT(iOq<)LR$BtY0kAG9^z z#cA0|S9Nh2y-HsGm;E4EY|7aYp`&7S-5!Brq|7U>98%L8aERluC3Lf|n42@=s~~mz zjq85aSYC|ag-p@V@arYH8PHPv+y?QoUMSamzDymL6Rnmr8l0#OZ4B>Vn^)!YW-a%y z4Gh2JGEj&oLoZZ*M%xPtLPrv~FofA4fYXym_n=K8Xm4^# zc%uBbgvS-3`9#yFl7jld>v319b?q12!NX$(>2Irtp${{UA+Yj8r)AHfGPA;*L@+#e zr6x+$RBUqT1(~M7YoB?G zY?r-q&!FPk6}u6wzKhwAvGK%^vw?K{seP*_>h)%WuSY{e;U;y>V8h9gED0QAlpwNC z;#r8jJU7Jj?5`m&r~SSMH2SJ~ z_n0@>-C~WIMxV#}LfPUh0GzzKiLdnzm%5hs9Vgp&z@qK{Di{ z>q$uQZ+on*|n_xFdecxL^Xp`0F9TLcASY*?n<;d1j238eG?ES+-*72^W1Q z=-Y8GVQ8Gh6y%Qv4c4JNF7*!Wc#G;%m06rZr+nyb_(ctYVELCEpZ8;5HiFW={|qcr zQ~7Xd!f9R7BWe#{N~#q+s_yg*Oxt`U(1^RpjiO$iPp=4gE~e4yDiT21!usrT^Af=9wN6-`AqaS zpsgasg9$Q+09GKU}hK8ex2c0_xOvvg723iY%+#cFvxekHb?UW(s3ok^>a|xS3`|NXDNZ1dgg{0i@VtXY(I6nx`VL z2pZRWbbK-_+qe;6E!cUEM13}|Ta=mb%pl-Ms+4fqbtH58h@PJ}YvrHvC{_r=lAwG4 zVcjYueDXg5d_-@o0aau`tI&f8vhO+mg@j6_s_zR3j@~yWXZSRjK zHBF!d?sxO@r4RJQ%GMPqLd^G#wfolRm7nShNV)f*S8gU0Gl)syhReZf{3Z(?HshpU z-$Gn;9=!nF1(Qf1j&{M0PpAG6DZIXMu?cdw+% zYp|P*u)7!DX=*AEL@hZyHk^)+zWLA?Hu-NM!oPG&FMXv9I>@D9z`f8FiMg%q)ARQc zzaCP1ug!&0Wu*?TV0?y&HDbx+>a4#6FzNr|gXB|X;^z(`A(VX^0L`OQBCt341%yp1 z5H_`{VPdQu?vCs-I}ur*9{A7W_UMD+avt~Z!q4A=^f>4esPLGvZjeV*@Vwl=c}Ua{ z{fP*r)UF;Ywv3$^G4C-463n072_Dk^m=A$R7qLgw#>+8w@Y#i+F_-r!gM}x$_*}L3b z>=3$CpjphGopuXH30A4mu)R0Q+m^QZ2>tk>bIo0)0V)33tH@kQx{TkGu4a@YkYw_a zh^piC3o880sP7zQ)gO))6!-E`{(Xr7^!Q4eu*UG~Fjylyt~ zc<&lRXXmLLJKJ;c_YZ02epAEwxzICWRXKP(xDT*Cn^ekkzSULV% zRlFxB?(-CyekF7U#O3ae4$Pkp7kV|!+>N~Af2uGiSYlu(w>J@2a`ggFw+bOZdhAcK~Xz2>v>6+-X7Xofkf66+A9 zPP6e(3eLm5ES0xvw+r19Vf<^1m@emC0G>94#Lv@Rc?q-!(29G$#v@g#i} zAE^D5g(%p2#GfBsAX6J}$l8=BrFOoh){2V6|CAK| z3bVRIAT7+fn~ox(*g412Qym~Ma09`cHCOcX0b^2yS!Y@E7zT;sR!Boo<}Z42GOk0A zEvnz`ppO3S(INiVOR4Ist|IjQ7xQnQs|&jDJ+b~Dl}6U6kaHG~JeGXvN0o}CDL3Q^ z_Djyn%!Jg|64zI-^{1x|Fg&=o2rs;6T;>Ro zL_;}hOgOHx&M>J7_%n(@o?&vi)dH;U?#1VQ<{88St#=kG9pX-UV<#ZtSZH+n-NUxR zxPaR-AU>{zg^H7eL#a_VFSqie)9azl_Ew3h+0Gj3dkd4oJa|A8C>A=CE_o}ydobZc zzfYB9HS6*AH&wu957!yFcBPBK73EYw7Q#s-G%4f`66ykM-2!n`OV1Qj7YEr9Ap*AunCK7cpM(Vomsezzr< z8^!Twn(fnQzxAI=`CkdPbd2`J6U3{Y97xX($v`Ef4o#1xPZDEKG&E^;REb28xSat@1{EzM? zh(-%Qulh!auV81~pC)ei#i@CeSq_0gF1?i$6FoC?fxI>9e-`}omQ+D%U^gnB5DUzE z<=iRSyng?*Dep~Le1qn)PgH4m>;CQSOy|AexAv&*{B(~Rc3?hJ+V!lt35$)9Un=2O zasZwigk&CO4gtlT(2BJl6&aocs~!P3sQdUmk+Smm&u8QU+lQ8$e?J!VRUf?I8=}qe@|pbbUw#%?(_}SPnn4UCV z4b5Jcw_){jD*F~08rlF^afKCy!rkYg_t+dbbdz8HE+)D8%qMaz0^p9I0F5$%v#4rh zl(JMpv2_jooTYx1*<`n?37a_uO`ZxE&jeXq>t{r@ZBXmJ7f-zZ{VjTL9S*C?hj=$C zhED0`$}&VQ{Q`;X1fF#Df>RK_68OVhoFlJNaRe5n_eH7!h2ucCtixY`fev5+)Rz&?ETham08ZR zqiwO?SRycJ9v_vM08UW}xz3NOjHTr#ve@4o#lr^^>&R7(+DRsi@xlCuo&BaH-iESW zKbUY?Y3RjTcGYbnwPWa~W20su(Z8z7`KPs54?&pAG60|1Sfi+=ySr5rz2W-uCF+Bw z=rk2rr%@HY=ti#PN1Vh$4`2F&Y~gJ4E_K%FI?p8_pN&NvW(ll;GlHe4rZU`vV?QXRUgNur2DXEi6P1j?GbufE2FTAN(BIqjm^7B&qka8Y` zO*_$ESfwjxH#pu;>jYX}dYZxWOQH!?=BrNp*zf}52w}cq(jcpatJJg5Qj;A7qwd)` z5qYny=M7Kj|MwvM9A*>u8?Q~qX;kz^RgqWOWQkY|U1C7FwIi}C=KA(?AEsPJ3wM>+ zrQs+9-!_B63pJg~m27w?3kUg5&+KQCKo6uN`yMHU%K3#0pE>(58}$ucn%J#bNw7Em zg3CyUM=^u|&%^a4qF-YW;__|028K}@IIU*HG_s3l0MxC4_#G7;@9D;Dsnpm%2+1KK zU7D*gc8^11vU-Dvc%U|#^0e;bL>bRIVlvl*PjaL%-y)-UOgmm$NqOJ*6|9X9^lt-G zDnpb{!lLY#Bmsq%M`YvqXiWFPKEp%}Di`bAmUT%UU>F~dq`dY}AaQ!acJL@?ujhjF zvpEbUx3e_ceLAI_|K0}~%lT$P0vG!koEOvOqv&nc)YLOjEgM%o!JQA6 zDm&yQ7Hm%9aTWv3v;7khNrGGlj_Saas|T4^OOl_h7^AOJH?DGHK|H0j06DwQwr~rl zKTI1wy*oXiU70?rq@1g&*yLm*j6~s^a*xxR%&es*XE8AV876>2V0DChYvi|UYqGxY zfeu67p{XhoJ9Z#6{qjX<#yH_|eGx|j%*!3Yh@SncrM)ns7k^(-Y=N4P569z=wPk}e zdG;u{COgWqo@{Z1KFm6-BFewiniG&8{Y~sPtc4Z=5_6LZX@NSDzWh&w;Ewy}$aBfy zO2+O{r@Lpby;Eby8Y)<&Bwoql2?DGG+u8*WhGf3b9G5h_f^d6TL?HGM=nIhhAIp-~ z18uUwt8<5D(PIaX+$dG$wYME$UqbUJO*4j$qnkyX<{JMoJ0+%duYddXyfb`LS#_12 znll$i7N<1&*!)DdxIB;z;xlVAmP3D*pOlP8u+Jr8|FDw2Q`mYw6GMV#<6KhBrYhJBUv++6^z$iD0UK90>u(sG9 zSeVF!hCQyz0#_ltccex7pGf3+!&34(1>OA=v30dt+?TMzLNt3-6t);m0(mpQMP{L> z5oFrV5+?M+G-<=j%x2lj3yTLMu*Q zN&4>7jWX-9_w4r@gR10Q^~S7XaQG0uFariJix(JtW#QG!ESH_OkO?Swq1>TNpl zewCMxHTg2XF@X%Sl8MT1>xdG2f2b_B)Y6-(?Q~La!)F12MyioMd-xBycv!S3W_!A_ zZboL~I~@Eir>Swzxs~aoar`wQn#ZYpfMRGC-s4D29-UtiA&oRqffjUEgS#&XC%J;1 zq{i#V*b*`4SY`s+Z;56TqjRX6E@W)4r!iXne9NNE-L0?^)$lP_9CwkLy7!l`hW^9# z=VJU9cs`NuU~yi)n;A3gx0bbhAgZ~)!nCt;v=+qw{1iBt)^h5Bw2vFJy4IxP-toO?yBSNrqg^mUaE=s8=T@w~5o?_4N{Nk?8U`$^qbw66X5 zR%{E}#WjDc2ubM@U96mD$5KV)sv~l*HVjz}PW3U+=k4F8K(w?(qFtr`d3{iBq9k5A zR-204WX(0voA{<3H4$2{W2hjT}V*aEv zfn-lkUL`iOaaB{@#cm{yVRv-df;=!hSFz?JhzeV$Kyoxu7xic5dh$5fE&=w(fW=NE zT=)Xdf%LeE(Id@qP$Un|dxJU)v$4eON(D0jd@^=BAdc|XWlDji(90Mz3QUeQeE1GLi02NYukNyZl`X^=o>M@`GnA#(LB{@H6Lt{>WA;sWsz zTG@gY9N?fpT6cEUX{akVa6z5)n+a>;1fnG6eAKnc^`iCOq>kJo)@n(`{7Gf-(kBd@ z{%ssvyt<0rRRq3lwAfU5>xP`w*KL0$Sd>%6-h;~j#~CN|uEj6* zlfBs!u~>kbM$oZ`&xndHfwF)-=M60qF?dOJZQZIS#!)nsJTk zuJPa#5p&KvCi)vagT^Dp9+!oZq!a^n_|!s^nZUu+e5lK=+yhYtTB0_K#-WXo$qt#q zs#~djN=o4Lu(H${Fpu@f9C%0+@WS&m!sLaBfcG=+Sa|ks62HV=(v4ETlOd%>-i#fh zoQf2@j;kD4`r4=Ky6hL*#LWE5?(?b}?f<-j90w=t|6a8F} ziFzgjvK9Rp(CTI~b-`%ME-@VXMh}R|jh(BcWvtH|*pE`uE1}0OwxYUYb>n$M+C>kz zIF*D?)_q^!Vm;l<4LE;FWQ72C7C1*9FN& zSguBsk+3@CY*G$yi)O6p!H`bsTTy@=8#1HeX6oP+dkNzqp>Z5}idwjeym6my8mnIp zrx;7Owwfd13DXA=4(&Jyq}~wGnUejhbj@&CC(Ib6ZBw|<9=myKiLd&rNatz^@zw6% zVeQPe@(YLj%9&I3Dx(2?9INpPw59QiUFUi$OFlDjP>#+|LD2zA6aG+@D3O5-hUpxI z$oc}z9f+}vzWkx3V{w3t&52qY_r%X5z<%67yOP*rU6qX4LmNkQz3@afM)seXQwbh> z;gNrPyEn-IZ9sD3!-tgWp(n4jv#P@u7ijpAZPy!yu?H~(Cv-QY+F~ImEYT~`;gyMf znzU5cx>sN587_|)D!fonnuQe(mZAw0$usxd^c60I%S_#S#JHu5BK?<(Jy^s!=4(yu z*>-cvO^9$s?68WX5p_;T%q>T)Lfv0Iuk@?|OHTmNccq zzdYBxpnj;X669z7IU2;MGiEfNfqFcgiXpM7&?6|>c;87#(o)fEY>2fxymrA$(^c}o zY$r?Sv3-CReRM`tjW`T=8+&5cj)H||@kfWWf2Wi-j^6hMcXXoCeU}O{y}e7X<{Mh? z615jR@)$VV;_i?F+yBsv`nGaIF{ab=O5m>$^R(jO+#||2cb|$BB#eI zBG4*Bvwa^!h`uVxJTa}<& z@+S5T13bUkYn%#c6vbZoFNZoP+|BF>VSxq0$aj)x__`AT>aA%J_&9yB)U}CBq7+p0 zHnN2|vomU`I&@Oq)$-@nM)?|`>700$6m$MT2nooY*-f%uQ(GQ$MUd*%x)oxa@7D{* z_QYi0Zh4#RqE7v3o(Cxf}c^_ajgM_H6Aw&gTsSnL!rp1N*a3;AqJEJIrQQ z2Jp{&_5EnWj%L1)s(!p?PX6jMGi6km^D;v`$Du?_YO5bdr1`P@+0aZ<)cL|KkNV*+ z6IJu&w3+CanmqBLS}o?to;AG-2D;IH!E;X%hjH;k3 zH>bR8yWkHic#5#>_srRoFS_Jgzug;TnJDFs`DN)I%Bu;Ns}A1|k5^jMU! z1nw_*V+ks(*zwf>hgSboI1zg@E%f`CjkYJOtzN{cA)v4Y&r=Ug3w6v~mAUFyA^@W9 zE|ospcNrX&2U+ypXC+H~B83JKUTys)<+H&8XYn1z#cBNoIrYg|-0_!M28w#7$G0vE z0qU$<>|G!~)cp85m_O|4;3_r}6Q79Xew9i;PK>+JupRws-Ov?fjzK-={3B_=fLN&4 zIv=-}YeICdWs3c-<2UaejUAcve(6b9>7N1{UPO``(l!woGfgqeRJT@6DWDE~N8lm9IP<{##O6(bhWdh5e^es-Eg6}A&&#qjrIcXQ zFR!Y!hVv)3npo9LbOYtRp)E{F&oTSUL?>jedMV}W zQrG`Z&wQh7MWSC}7A5(NH1^YM#oq6;bX21eS-wTO;^LQ5qb+_vrHN^KB$|3ZPSBVX z$Y!;s__z)Rrlq10Nlr@%^6Afx1G|nrLAX$ik$7*lUC8F3 z9^-qd&x^8&O*qM%XsIeqB~;UE8WI!b4VQ6q$H&lRHsy&Ej@}q8wCxF`nLG|UF7%lj4!)MW9JAc$d1-1=MJfhC(dJnhy#a7w~ z{dFgwn~vz6Dk&!|Z0VMDYs{ES3Miav-m`w+hjc<&S!20XYiB%+V_$HR@F9Cm*}jY4 zo_0z1Ok%nslpd7ENCq2x-(?Ev&GcT`TQ0JhqHKiDOb8&VYRynY1V}KXk&%2C$I!M~ z9Ws!qNmjP`KwjJuz_oqly>CH-v^ijb@3G>lC+5XFG~JRloaGZUN)Qt}Ok{~z7YM({ z;f)Aq;705wH-LF=gpK82x;~(Hl6n$+cEz=Smc?97clT&Xc9C^W(cpIwItB_(^(YAW z13)Yg#BzJrMRMXUQ2r|uLogRUZ1q*B98)6rZgIDI&3OsP5MsAA!h;&@%wa@U+Xolx zx{eVOD?E$B6*RzsXrQHG!yjDYgTzc*iKPf)9$5mgHyB*?RDOl0yb&1UKP*VENvtqr zfps`|nQBT-;Qr=0De>UhK`}1Jz#AqGTVE~htEC@4G~)R;H)-QlRFFqEcn3VA|5Fp- zPs?40iRGpR2j^jDvHN}DZ{z*z!e!MX68lSD(BU`0V+eW9QM?*gqznRWY2*HB+}5~@ zN}xgXhRmF*(|{Nx8Gi{Q*{Y9Je!86LRdlPlEMU2d6RnpST`&WVL>yA52I>{uN7nx^ z!3501sdsXp9B=#p`1VTcjduS~$9|v0zm92GqLP~L8an8e9!@$08w!%Oce_fb)#1@g z{7pHvI{m{_W;oO7X7k!~9PGiMd_Sx29D_RITyGR+vmo!Rjp09`G+r>shpWS!MHk$ZF7 zK&gXSO!4E%Y2Xd!S5D~jhBrL+St>=N0isKwhReP9_7*1wmo(iy@a>HEPWW%b3WbZX}t!~T0 zHp{J5$cTQNWqdxrtHz>>#bZ03mgW0m8@F>Zxsk4p6nA`)b~JQMFiMDk>%1T3Tpw-^uc{=$eEPaI4QuEW=Jy&= z69oe;jn?C_WK*bTBw-uoJ4}}t8gbwhDXB(2fqx!?{17*tyz`&107aGa{RxZ)>77No z{Kreo{z|;G<9)Etr0@BiAFZw5w)Y+@MA->_CC0h4TZtk3Fo}G=51JbQ!G$An-^&kD zc}5mxD@>tN-(VRP=vKf!c=S~0{E1aph+6fX%o0hDM0PzTo5^Y>6FmZbu_b*wU`~0p zoGF5$ir>QT*(@1dc)4nQR+Z|BvD1*DBb(}iOXb3~6WyIQ{H>>36?5;Kc};^`subCR zU1;OnGf{6&M8DP`kQa?QawJ&%+wKsj*&1kN>1r~}%U0R^F>umvL#TgPq->|*Fbu${ zCU$8NR;-J0_PvRI&YeN(p>p}F z-9~;SVFzE7LpUb5-sEC#Ibq6LGe~Ex7MI@_^e8$;9W7+u*@>r}jE@H6N;m3_`qvTB zloCIRQDgRf+nv#(CUL-14qQeYNb7!d<4PgIG=Dw}`K6(aJ%+UKa3DWfz|7wJ zJ@6>@qheau+%KZ5CI)x!w3V#)$U~xK)QoA%UItgCL_?3AMKP94PLk9 zXH$H2zTXv#U-Y>)hm2lh-vlp3qf7I_1{GU9evvL!;25RW{bW7nQz~V11u-BHI_(=a zH1@)Heou`wrhLlc;vjQU%`6znm?faRZKqBSEkr?bDJo3S5Spxc;$c9_1KZXyq1i9=TKW7d69hLv?gXpi!iq z?_(!ANB?!=>U7`>DN;HbXRD^zrKnr^0lloU(CH6+rJ#;AS|O(HpCkW8v7%AYxAf<>WnHA?7}-s$8NAiSfvZ*1IwoSR;?(@PsSp3< zRlDdulBylCjs2IUFlQwTWEPNc9Mw8gv) zYLEdWkO*FGWQ&#JWNeS9lpOe3ZRrU#cHz<;0hm&~W8}fNH2cPG3kV<$e0~vbk@_40 zd@e`~@nGaxXX{~-F#K$*#lFSkhqj`G6nX9@jX5e+l8Qd`G_V{vz24O#W0Y*k5nfN) zE)#K}I|7>?7rJ(@IJ!VJE@}X<29`|+;CFUJ@!o=7DWOx0w68B_rgw=MmEOiwJZ)A2 zWSLfF(O!FAF&U32BzG8h!~4_g=o5afvXQglmO`xjs6T=tWD2Zs!OS9VHb;?dj&#=bIYb-i?}3tO0$hlUhn6uT*VBu!GEGn?OSM2ek{bKhLGcjBet$yG}c z@SU_#l{n)sZgzhVZQ;p?Iy^3*Keq6y-f0MB-iId3r$8&0X*-B}t?N>_UUF}R0sp4W zpI9T=DkJCtalIfXW%v1*-OVzc>R*V`kTOG(@87X~u=dE7W=j@s;%B#>$o#)(Bq9B_ zbw7l|kbe0~va8ld<#2-W+>y=@GXilhG}k=DLLMXkx+ z`t{YTM7I`L(W4+}h*16ln=!!Cp%d*o<;Ff)xQDkR+d0G=!Cnp>8`($~WC+XLFH5e* z0RePU?Wn)B4E7I~s28CR-eE4lsBZVBdXha5SLx zQr4+a;Q|ZaUQhyvvH;OQ1J*|$tKm071tmY~8oe&K^G4F@b?Vs9%m;a;?0S8$NA+`O zqH^VL(zrLdsDZwO?#%QTBk7AFuVwJl<>b zs-fsF&qp(j0R6w8r_JQ7xMzDK@GwCF$~eB*vW6hly6sJ5f1G8op2b51#YVE1YZOSn|-R03Qx%#SZ z;AptPp6|$xfk7gWVF#yH_*?*6;C$u(@pM&TRdrjGPC>f6C8WDWO1itdyGsy|P66qX zI&@1OrMtTu$wSv6?*3oyE55+z+H;LH=7=qn;6Jc~)RJ((&%?uiuR5oAWw>SJ*+FVR zhxdaTTI-^-qO*-1dnm2>i?M{undir#y!6BCz&+@cQ=iKV_4L~#f6?X(;STtjq#|H{ zj40@mWG=?uugWn??$8+^vgUVb*Jh|EWl^e74eBdC1R8-T*kek+VG-Hsy;L`ktmW{| zd}Athl~luHp6o(#S^X4NX%oV>PcjWU6giKBW-&x#S8O4Yu8h>k@v(9wx85?fE$RhN z4Ad9;ed~9!r7)7#u)#rE*S_Yeuh4U{tq)a}w}q!>CN-GSM4ZK;QH8?pT*j`UH}gvsTU8Y=A~l1l zY4OX|b>But@WFvVy9>I! zqcW<&a2iHyl^juX=&8)usmKY!9P$LVh~|+Ng-b+Gz$~`>P0$sKg-`wpIHYg4{G0(L zBle~HJx<#F11&{%KL2a&K!Ll16uYd=iFq0fA=W>$~D_M0Dj9Jf_g9>C4g zCNss&{@N-K4JuD&{cFKsn8LXpnI03D6s-({hF`6qs->kZliHXGsUzKsZVm66Z$R2i~YsAX{o#S-R3P83^}FmXxyeS?8C4h9tw&= zq>}7;P~4z$Fn#g8XadPaTJOt2}9o6^48;_G0 zz&^V!TFJI|?OMG-&kh&0)=)LYHaufxWK0vOnVCOsR*UZ`;OOxY0;_w`vRHSz3&iag zL|E!je($~%M;vrV_Lwk}^4MCM_IK%=*K*Jfe4>;;U4xTwT_4axRsZ*ER#Hulazn-2 zG5o+G$Ghp1u>Ns@23b-@ZGEGta`fN8Ew-6BZ#t~>h$v~Sbm@af+31(k&EfMv0<3?P z$_&0|0UR3Yk5i-ys|n#6vks~Gr$Zdtj$vbUjuSHudz;NaxKa|w&=bR~ikjJ_Tk#VE zf6T^ND@(&vEHKT-*C;7?MUBe=Iu8+V;Vd^(;U2Ex^VLt!t((-ZCoW0rU3z)4qcok2 zCQ)xQCn()O)6*uDo_XU95)OFn;WCU8^=CO)Dndm_^|dV2(t4YV={=aMi&w_V$elit zDbZ$GS;{92gKf&|yQnmH2vh8Ed-FJ5tgg}6bM*Ks-j!BsD@`u`n&FOxzuHFEqEemW zoEj!rni_MAtjK%$45br%x6t~Vu7QiLR$K_ZzMl23ric`?1wk{=JYgGM^?jwTXGSl_ zFP)yKesnb}R(D>cy~kl<`r?>F0Mv_-ko2-xSJ7tu6G9In%DtxqNv!Seu zf6kI3w=;D7gVE!_8FG6bFP!{{VH>nQx_%n{4g6h?FL(0=5hk7;oOBV>&m9cGq*-rp zPzHNj+kX8^8JPRx;*V%h6Y_qt`#IM#a;;?Oxr#}+Ykt%YV=G~EK(ph?M}yl5 zz&xCoH>Oh&Yc)D(eHPQN1*5SMncjv3l6{5ee_jguSnv!CILvzDwtF|Mu=K^wxEL=M z_de_Nci3`TBYqS+lcGx3EbKDVJf$tCG;U0Ur#|@E`)$|mq|?eQbbK_~GAIrUgI?Lw zk;wJxvc_Z7I2yVd*bUHoGqNSr<#+m{G+}^5e=E%;^2wW3>LV*}$%7#3ti%$!yGphQ zyM<-c&2DSTGMjuIu5-RZJ$5EurjyE$gUJ3)5#T*ZkGEst%i25y@t7iCD%n%% zkQL0~nLH}9W5G=6r;j}HrP9^}o!V~m747dkgk$|&zRAfqicS^_w zIbK}Hp^5~2$wz_9U!iv6op+i8mM-^n$WKM5$8mMnuHiL*iFT)XB0p@R?`ovr(Kk{k z8&{3BqjC`-_9E0`^3o%$Jbj7q=~CQ%zGY^+(^wNnN_1>}xD;i0^XnKEoy?4rMr<#2 zJ!g&>f%(;NG30!ik`wa(>4n#z!Rd3kepjk9@etI%V&yIyVEf}{XiPFHVXvEeYddFJ6uryq;%1}P9iAQGkroG=8{#;%Fvo=@%xyss>n6V(Y zC=7>)T?;A4OnQ{$tXue&_2ENbD<@#Y3%pr<3$(!%_)UVktw5Q~!=2I+{>wy}jkRg)uaI9bXZG^=g=y9yRA`d2a zGQf!>>S~6Ev5-rVnJ=c5iJioAAC3X-)Y}lE(#EDu{QjmW+9K^#6BobiL&RnG10;0Q z-#=_8IBqNRIe4Kw7+g8?^<8~s^Oa#$vh&;u!(0{;htg-BFdUR!(HE{B$TMpw%SJfg z;Dt=aoTZa`qc1~6==0wk`lxsZX@%biQkRITC;I_gx)prRwED*L9)acAmq7+Uk2k(& zvKbGVTF=li?%5cWS2R88qea9hB`gULla{3fv}0ggMa9>8<_!|2Lm~=Ne$6;w2{xrJ znPy~HR2VlTxLy~9NfwDE#^~r^Z|N_Q#i^7m&jLALoN8K#(xGu?oP24e9#jJ@-*ADm zX!?`klY~RAvR85@@1v`uZT$S$)APJGQ%OoE6>lTvPX1;7^5yuWK=D7Prmy)I%*!x*T@rtO5?MUh zyh$I*Zv5T*=JU;tix=f6`W;B+aBnjt-)r-QO#hFGD_9y5Knq%w+RJ2%6Mqc+3rU!Z zJov+g#i{ghu7f#$O_30As_XBoIl zgq>&e=MX$;v$Iw)4A96QHXrW0A#S>kCk}>UCW=Jp{ZI7mwAg8uJ?FOK1-koFn9-iu zxv(;`^94pm8=%_=gB!c7pJGAKH+yXP7v?!4^#u=Kv5q!8)}{}U1y>Bog@XAz%X=4k zzd;r1?7t+Z43~qH9k37P0$FgdW|s2nFDwlP`3Mr#75$Bli2f%?b=) z#_%{a`PS`8{yJ)+@?ezT8*-OczTL+EZp_h|q2dycnz!P&(m%YpbVb&lzECG%tl5ZY2maRSj+9FC9rbm-GSdsw9O%>h z^(jRqPb4c0#QgBtjWo*+l`C=$??cHFjBjrW)?>9meT@-Og+L4l+xe)#|59J1g$9_I zYKHRz^~HMW1p!Plhoc1`!-WuvI6jvf;{W%BSw*+M$7eXQJ(uzo zCv|cZs$HcQdCbNxUQo{Lcn1%I_?YFsr|Vc<6^~}p znSOaazp;>Qd~$KSa0b9uY6H{_ZQ(uvKA4!rm-9yy_y$(_44h)!0Bi2>n)KqI*P z^8qAf{W_=0%-K%b#Ysv{t7>>UY*h$e-7BB47?PBY!6J|+Cfs3rbkAB1M@S$&~zrQbp5O$3-`3$DEwD(3mGL!?@qZvxua-VH~~a zY*C5kXXk=a51h7WK*|ZxBdfx*MT}n>}K(sk5B#WSw7Pfy*t_9WowwFkGREqad?UB zE)@32FTyt5yoqqIqZ~x-*OGi)$6X@7PigK#E(3m@)&=Y>S0kpEfC>DA-O-Oiv7gcP zZ3AAk8aGm|o7ppN!o>1c|#|Z+Qvy|A*fl+1lx?};}$B6ga6%{n?7L)<6x1SuEIjq*7{~tx%#5x`1(Q6t4w~38K>QVmvL20vx?UrUU2zs1kXOtd5{I15AL?;AXg!%7&Ma{Zs88jwwuWtq8X3_9^5K+-G< zDI`=n*M_12FTOPrRQJzJSqTfQ^RkU0;>F2$y|^W8F^y*av{_hTbH7DeC5*V|$sJHy zJqyZ7WVj~!{*w27_m9FDo}@6ba#Gv3_$biJD=PL#rnjsZN`t39!}N7Zggb9gQ$OWt zd5$EB6z}g7KsEmaNmrITnrNG*t#7bB^fq#@_LB88q;W3Kipq026*-`dt}xqHzfWHq zo6(H;D^F<=O;zpX@t!H-8FWZX%lBwouKxSUGyZ+|r`?=pv|#o)#h%#?)|MYSMfd#Q zfEyY@rp-5cv7QLS6}1*}eJb_z-;K>beV;81Q!e_(1Bb4lLZ3g$3M{k89*z@zZ6Esq z?k=byeyriYf989=BIPmhAcpDU-{7nDID6VwB72>f9BuLVdGrn$e7E^E$BrulZi}Z_ zX?fiCC{G#2-sDAwAn=v+{QPYzf3L3hA`IYpzgU<5j)7HAw)_2Th!xiR_Ti*70_*(R z_g4&t#F^mr%6nBt_Bjdv$li(+FBEdpZ|sh6AkYk3egmpM8>q^Dy6Y(w+fXsReF@- z?kyY2Q3@Po2v4^9yJ`$Cv8mJwc(i?{-uAGfw|^<9u7M8IsVV}3*_^~qCjNvxo~UW! zcR8W{t=z-}Mb_UVs=r_3+HDp#VbS;A)ZPI@RX($Z>95NDdwO5A)UlPYFTW&wy}T{y z|9Y0sDHD0Y(~PxIrzR%e#f^NXkDKzDsXbDEF~+4LN8!g3J@@ClCmCXZsoPce=3${| z=B7f^w>Yx5o2Qg$WDDv)wWZ+;#cySERqC&7&s~cb>2x|s)=u+B^pzNRqj+| zy^Pd}&-;~%b47)ZA(kjCzQkeDMrwwdF_>~GpY&0XwAM+A`zDij-a||DkaliLW;~^t zyULwdsxCxzBIqcesWY*r0^#g5!3wnpHdhP1a&4eVohW`}SwxH+q|oZn5k-%9`J?lB z;Bk;ffrd==x9hio@5U9E4XIjL0MAS>tCC}^NXEz)a!3>s$Sq?z@^TO86w$ejRxE zH&*=0dt%d#-)7@YVWkEfg9!0uqmtKZgTz-<2P|ENve%thn3xSQ5O@^c+khG8`NP50 z(cS^cLZmr${yV1p%N0b+)OMt(Rk{Wea5+U0$MNdquFg7W3Sw8@eq!R_v@zfCu?wQi zX;f7_9WOzgJtVL6&A4_9bfE=2%<5agJv1C%! zJCFkOWMrz#BSo`KKHciZ6RxA*BB8J4IzHL+fy&PYr_9&r+^>H;dX^v9gN!62YPx-S zLs>T8#eDLHYW$+?DBj{E?;ju{ANZ2C(N9=`P$B#J`D!9RG+El9DQ4=HQs&YZ29|=XPYx=rB(IO6W*Uq{4g`0oNh&j4L5Ga}V#3?oam3^thnH-2UlBTyv4N%cw zd5Y1HZ0+5Z)}$P&;I(&xk6ARi;ls4fwz7!#v?%?RD_2{SeHj2VKC!G@+;#0PgF+pJ zLFO%W6xyD??2@lUYwn%=*RYRaGA3QcJndNKhbeuGl`3(@f2NZ)oK02Kj5U z$&&FTW`H7C$_?w*oS3c`c_!qyzEImO@*+PAft>nB8TpjmB=j@=o(N@+fY6TSo?A10v+!Z?9)>S9;`wvC$i(E*96#ki%_Wb_=L@aGs`#9p&R21LpH! zqTKrgEW?(l7Jfs~6DKJJ!Xl(+-C<2hL}yNc%-nuTKVd>2(Sa<|*NBS|L#)p2l*Y?u zz7+CAAYA?+tk@go^m!ew3Oo*`_tj3j3dJ@fDq4fNVWy`#!I3vYI;bUeVI(jLd#C zX8m#mhf-^Njk{Y!_AL{V)}kKtOa;EcR)3k>F@`#$HWNy6U0BX+wwge&`iuuNUfceo z*(CUV>_>;L^V?umjNtV<=%%eVC4HvZ;@)K*zJ=Avr*)qq;H}3RyRdJat@@E< zPZ3m0*E=aLcTEz!v-32?5aw%|5yWK7-%Tnzy%?L6_4tK6%D|`WVdz*FTmNFP1~MyY zhZPay;EIxa%&$MH;N+T)TGK7BqHa9;IJP|#lZl_aCyAqhkc7HP5lGO6>Qf zg&Q2Si_XLh_awp(sgDp^~{{xRO`n4S~`1#3_3-Bhd>X2(7}VJ;2dR_>;mJpp-389v+(zX^=kk;BrR z`ef=RteZ}Hm7kE8zd5oI@`9vc;9dWi6+*W_*xTXC>3@65&8iOHd-^ig3L}U$*IEFN zhv;D*cd9DBAa|ZM8{ic2t0WhM>mTjAZgaOBqJzU$hqCUp$78ZPW4U0P1mBU+hTDQ^py~$Hl?M#omc5W zxr=BMadE7@;HpL(chirnH$C`SSv_$xLU1Yq2o(?{H6yV!_KjOo>Hhq5DNLRFx!Qr@ z0(jeiw@7>>_HM`nXQzm|52@pZ5H?yOSRckP{xz##P67GR=aO{0y51jq1v<$&d68Ps zDz)d~@j4Io!B$@lDpS3+u(NxXuIJ)TJn^$jy+1R=^KynywKt;k%Jm)u19wlmW0fYw2ms5For zAy5dETUgJPVrrerDPdZaT<>|`LRD>cbh;LA+i1o`O*9$6T=XGkqAF7*$cvdaYKgPF zluO(`k|DvU`v8IgOyo_@qSgD9(^IKiXgPR~b!GF;{u2vfDsk>lP9vzmYw-41i|*y) zdv%WmdEKLT-@(@&6#8zc0b(yoT)W9{>$nKsAv;J_is?_WlSP-H*pc=`2ifeBGncJ{ z4glyvG@q+W2;t7&Ao?(o5WgRq(QTZV?QhUl-AvZ`G8fC;coX=&KjZSk=MqBVVb&M?KO?k zBrpH%RVA+9Me0mFt+0&#zSG_ZzifcGY3D` zp57hwab)IB;y{-(B(N%`&`q8Lp{W6c4?W7(HNdIityuveYGcT>0G09*F7(~mun}p9Bi2HKMyAiuQGYy zAp;&Kg%nO9iou3jNtC~?>Wt^LQn2=An7gEFN>9@UL(YB@dEbi)_`HD~XO!%aNI==D z_94Y;u9=4PNS?gLmuf+6*Ey1WS!u1b9CHgDF`Her$2WZ}ynZcP7n8MD0>5Q^)Lr=%RR^=e@K6 zj1433e3n1i_Ek6`Lu`h2m+thgG9kp5+eR!9w`~1ZTr;;5lRIy#fE)yQTQ_=hI1~U_ z%XhEa#;RHifiJ065Klo2<3@axn>TG^omHvM4WBhWS4S-HPPa|peRG% z0L7djC!0;`ztjD;#aCM3K6;$b@YuK$*JxHhAE10)HW9d(r^FXMd^LC-OC07EZ-f${nKPu+v^QUn*GknoB(>)D zCwQ}NmGi#RvrL6uyM(BB8Gm9NI^?-q(?FqBXxHc_xFVhI+Y@-rg7IH1@;k$WPITkE z(br0ubRzXr!p(ke+?(*RUnJNOhjLYb*TR32$f9cPfFGK}H=pD?9h5(;Fdbr%(qZLgPWI+^gCaeX*cc40rN_&Xy=t|Hm=IO~IP$&>i8*pRr`; zu_i;F%1|oMqJinj2t$!B->}-rO35vYnBX@AMOlCQwOmt^=@x`WjRmjDaRpW86Y6XR z=$eToHyMXWG7VSe=jaixNOwHauW`)y*>zb|&WQoheO#9BVr@%+yhD}qGPgj+U*=qt z%?}8HhuxTvXu!(z!VDmC8sgMF2IfgYFg9BylkW1nn9|)!);vieZP#mFZyeX>RD4HkrW22t2#6IAp37(Zv7~tXdz6A-%((>w#Zyvv5iC-`;|`JIZ$Nx9 zaMu45bLg0yzE&NjWvB)XME{JYgMtM*f(}Z;hf19s+Yh<`{_52we`FJnteK(H|3lvK z7d+|0?FJ7)XvL<-RrO|>`8rx$1<~r}J@E`J`$p0iJT{04S|zqz#d~mkucO8<@+l>M zGT@(RW9heJbrs5g1OYm*;h~&Cd1b-j`OJ>ow)uG#h1(>#p z^>Fl_?ML4L>W=`GHmrWiKE)yFvess!0}JIL?608IMYT3F{0)NTfgg{RxTMRP+UL(% z=B_K#fSQD6-HRxByeN|8g6Gf}eWHqJuwCmTp7h_2ZPu{G&g=_l_veSRd?QwBebRSKma`LmuZ=~uPd|tzE_j4>4tjVqX12V&>en`};;Z|nxcV_hH*Ssjas7zA)Zbj0EBm|2Bz(Zm?gMGEBjNI`1U!$sUW}ms3(@1GY zKl8+k<4R%^_`V=cjyuYs$(OS<3uvG|zLG=>K$1(`OEHpew3Chf8M?1)2OD?rGI&6t zXq{z75$bB_nRJ;pke)0eX4}sSDqlXG)YhpFT|gk(C#j0*0kO4B~8vT%ffFZGf(|C%P;6+heknzvWomToVV&3aHR>OVFPZ+Jse z&`?>;*5A+BG{1UCrg<{!|p5`7jFjsGL#PbleY_O>vk`CCS}_^wY6$4~zq>aows zKQ=c7X(k2ZvLnm3-X5KnZGK!Uj3H#Tui5-mr|=Y_m{U%$WF zN$kwkczci%(TezX7f9}nZfJ?4Iz`ATYj^&KYj3B2mGva3@)QpCE8^X)zy2PC3qGW) zR6;(X6-G9_)(uPOl1EjGOEgze^aDKfwS)!TJ4gESfyf+)c9Ts953#vDZ%Z(xF1rHn zZ)-?8@O?x<=3-Sv8V@&eBAoXkaxG;er%p&qUaGXa8Oq)tBTVTNgo3EeQ-6x8`)T#w z@jiqx`6ql9^ycY5@$mTgMHRThxFR>Y;kqoy{h?o)(&kJo*r%DOs^#rpkQ%u`jKo$faRH zH-l9FOY`TkL$B{-AU!S%`>yK=;%62@eEOOg_OHOVrv}RYGnBL(=ws|*l%{a{Yz2~& zg>M!3qve>R-NYlqh1v6I+OzYOCT3iX09k;qN&2<`gf=hv$S*+B&ybR2DX&r3ZGOJm z`+Uut*p;+(NtmFn?T@-GQ2!_#VIfs17DU@!+GEtY;-Or42|~v%JwkFf83A&2{ru6X zYF8Brf-@D@t{IWQ_gVwa-StCVZ{65_+8-M#RoJ`h)HTzz-d@#U+JmXsG}s9mQq}H) z&sSlp9>&CXs`Eu9#K^k`ggWEBs1WLnkkNt}!wcS8QH#XB&@L(8}nW2<`r@az)h zZZSYYTg4fV7V62P$fLryA${Ky9^f4sa=bF*|?RYrM^NPaJn`A`-)|kTjLMd)ON8_JUk^?A_3xJF4pr&xTzBujP$M7n-b=#@D1bBBC7J2ii z;`KKJc)umOEB}>2%10#X_}cvn0#+$7I=4Qw&r>nK{Jt?VU=m0!y?6uwIgu$hv2U#} zi2b`}y@}v4fIcdr(%Jh{Uqn32^Tmk!3spGE@M6;Oec=kX2=iG^{PBHTEuw7wFa>>m z=J-_x`M>@gBB@JXU>)Sqmsl9Vf>M?8m@^FBb65eh^6SXz5~MrXsaGDBE#U=qsuESp zq{N;|xGYnmu7q6}o2Q?HJoWB;Or)m*{H6WIJi#4VJ=^_{jq^v4q7x-(r`4^&gs-YphIus zl4;u)#Kv@cb@{16t+dqoBLjE6ygK%yp=J}CBwexYx2u)g{Uyd@l&umm>gBBv;JtI~ z-M$6Bw8bcy-%W-sZ#8A}YJZ_WI3H)|DsH4?;s5DzzDs#Je6hRA@OVkd5Y71J^3GOV z+3{7G)APHdltZxeCDk2>{ROw2`CG{E4AgAAPR-!6y3s=-g_B{A+!PrdN7 zX&V6#1YPjS`{>|9i_alf(mVVi8GGwsn%h1j%NEgSH(&nCLpshoc9U<%Y+#NeA~NAD z3%7TBhYsf0cI)cA{E8t>Obc;*gmKBi1Nljrwa23-+bfW{FKsC7rAsijPALU3x_I=e zur1_js07X?0VE|PTYCc~QUVLe@5+mkm=%_eOZfWo{FV^Pf@HS+`EXSey4pnpVbX>Ot zkfD|mq6k=_0H{8k;-h$zkKZYBtoTKG(S0>AU&$dM zv@o>naWnUWj4+widJp|BJ9hTTvy0$|%OWWl1?tY8JS58D-^*||Og4bw&BzNVK@24n=7=+qM*`&?^W zOCBsEb9CH&wW47d6)vqZ0)L*(YhK`aSjLEBW7`ZC6C;JNr@tc435*>{gVocb=l=dC30EC@3?@z$M zJQrm5yH*fC9X;TtSxEEEX3I?GMR!Eri=E@6R9!9G;$n8GGAsWU&Hpr7(*+$ z-{oMw6qmNmjnvC!qV9iu=kA?4y*bZrx z_~R^d9nL(>i>Q>=DsQ92?@$avqX-Iy;8KS>NO{bW9O|ZdD_+W-+UoV1_nrS-ny1Ht z^Ta5{xp)rUnGD6E;qL`~E*YQ*b29KP4M%P*j|F$sqyodF@Cm z;vVpM2YhkK)c&tZd@^a@Oe;k>+?Zo`E={c(-z`IQ7)^Hncp&s0==Lb~Wp?h$XeK_} zqc$U?%JTg7p8 zKf}}5Zl4bX5ix7yNo-C;Aw^w}v9+07zEzrqQhA>{^If>TB_el$A}yc46L~e|E6-nE z!J_g9s}gp+m1#p#eW&Z3<$^!~kgB(@oPN_pJJM!bZExJje3`c18DG%{P$VeeVj0~Z zP}9i~D{6Xj7*lIuOm;J_6=unI;4B;HeLJ``_dJK8R&_8?t&ClyQ~5j_r(H{@#+F|e z4o>*I!tB7!mF7@Uy4X^T_&MyUPF><1o;0;BZtk;WZn~Z6uT*Xd1vO0(78Tn0ZluB^ zAh`}ULXKxV?_3`9R+gAZfs4mjw}FF@p~%kLTV`nXAO^@TuNjuj@Hv9e400O@#&3uibwkm!&zfrmSqx=>3 z*<~&PvBklrFAWm0RGz{*>$5h>Hi-8;s4T%?I$@VS#@xxaAIsLo+b6#j3~6LvemX?W zUiuG#qJA_8PgCUdEHiwdzd!r<+i4^Z@iGKfkaQ)o!5MsoPKl&t^)KYoVwerS8p&>Rn{;dTYy zzaEA+POqkK>3MN=&wiwKy>vk7J~sMy2u3o~X9C3tZAbxrf`J&kR`ayj3p*QlEZydo zt;2<1#Yd zRpN3KTpTr6=h$y8RQ~}X=aZFo~|HR>D>^^E+Ov3z$kj(t2< zShOt?9-`H}p6v;{X+bb8;P)i)U{~MuUgP=qO+tdUVo2*Zzi1=uEH$57_7adOv^S;9 zfaz%AdC$Or2}DkZ{G98H(#%swT@22+)2#1sNRfi))X{>K*DM7iD=AEIGsl1gl?@CS z9NfyqM?$;H6|AYi*wwDZ%C>^$#mFp%J3B0rjtA(n)pnJLiNu)o2eswObY9N>+Ofrqw$*AQ3rZM#w>&$vj*%dh|+q}yX-LUEHC}H`n1%i zg=zq^j0r~W<{Lf~eDw_+^D;VOy&gAg*oS1gT(%+Gzk>e@S=RTp{XM}RnlT#3EODvv z5~{>FG2_gWkf7pZeR0X%>Nr~qp?J{48&-X0spWV?4DYCI$aN)vQEE-zDm%p@tm;ql z-{1iSdO&YgjJY66tsVnuu?(Z!`{9UU?vBz&t&F0_k%oE+N=kSwojR9cc0J`-cxdSpJE4wfPG%9m!pQ0enF-9BO z@IN_Omd7pmIGe2*OL9MkYp9XBudO0OUQOcOE?X7F0@*LwvgLiqX_=Km#IU|Yl zGfmv6!cG4%zC{z~_5gmeTjDZ8CrS@Fo%)=3z{F=h`M?PkE{TZC)NWEA+IMvCm`zu3 z9GP5{_-L`4S@MvqwuL%U=(SOVL z>?x7LFL4uRrkPAy80F1ucv3W0Nt~>jh#=-?U;T`t)x~VN$u7D0!hIONO4og?fndW&*|nWjElU#mfJ*7>OlwibBaJ{>*aRL^A9sIrC{fNx`CTcFf#f4uI)^O}Ob zU;gz*PMn%zeWuHNqZwNJ{)S{IKn7?~VSQ-yyqzW|U?=;rc>bA}-*eB=BMaoZA=Jhb zV&5vwtnna%vGSO;>}Z=#|Ik&vVCXFq)n9!jDtH+ZzC;#;G2u3bezeW$9sCdr!vj9% zV%DZy?{O9ypj^#a9T&CO&1qfirB;4@x%YjJ)8W3H18PvpYU|EB@`XzeZx;LJ($|6I zCD2qEra(9YtnLIa_9;06CoL>#HR$f;%{Bba=@mCZ7CE&X8BCTU%G$%Wb`S?oe-5I_ zi2VKGGzrQq5ik|{PXm1Oc7QoR>6bnY%`e!V@kluG!&twhnm!AdX8FYWb|X%9dkKi^ zr>>;??kWBwJ2qCBk({CEFiuu2h5HuA(ciI_-|;efC3X6|?*jjhKdoDa z>RM-t>Dg&DlDvkBYv1rqJg0fu`1LUe&m{s)y>a`zT*YHwAUJMfZ#RR?RdMGmc|xb1tuo)f^3r3hhlZiN3dP>jg3BbA%f& ze&yu*RN5N*XQWvgB7XbtrH@}6F-vB>tt?Fhxda6JbcgRG!!7HtDn(u8mZ|k=iQDnh z{=VFQB7BT?M7U2VV`ddS6|&_^L>9#;y{;#v*ZA3S)l2_2*4{C>NMkHN;8j$hq}zT{ z+uIQ)!fh+lve6TiSsJ15hQFN9?KKG5>Vhv4`fs9+mo@-S~@wOKzHa{Zhs zcW>%$J_mDjX||wG7V-IjSfstQ{ZIsZoP%N<3vF+x=EZH~0&fot8YsTf?}g1pjHf24 ze7Q;J%Z#%jPWVNXSh_Cp;_05k(J8U{4c%f!wmJ2PHU!RopAdWyX(N?k*sc&IAaoweZA`7rtQOc> zCja0c`3_Djf@Ko*dd*p0HSs^(QyW$>_+&m@=$0)1r(f;iIpHJ>$ zWk1R>{dIF=`=dUHy@MnPU4=#K;rF!`18cA8;$ZjKZkbVUF{APL+=8fV5cwcU>f{+< z59e`bPg1;alj1JQ~HNJEzka?cv zFqk4&G0bBB0}>-k^0}Dif&;rS&(~UgX523DGwsokER z()lSQyeD{O>!iR}(o$vpW(!{PM4fBi!q6&$!aYV4E?# zstgR36pW_md10FG1P@oISrs_USV(c*>Q3{~sfqGa4s{JaKn}0%S)D2^^$ZZj5|2|z zYGtKo(K2c@hy&!xRR6^yuICdn@ht=FmKWyX7x)-#)qL5%F4rw>?tDhQVHM$I7kcy& z{Kw4JE32AX+hMm?B>BrMhGA$PlXaX*f2-e*-1np%hNB>B*)#9+QtCJYUkO}U^*hs@ z3PS6#UI7vm>a|DS>x$oqw(VDNz{sauzK?)3>{5yWC~IFczoGk|6Erx0QF!A`4dzZY{ky>$>clgK0g?@vL)OE}^ z1+dQW|7Q(+T>uBKTeUHj9kk)4zm5g~ODs0UuDaAv14!X*Gq+E4d<9C736yM)7rP>q zYGVP>ca>nv$w1EaOy*g^WA^m>+cO6s{VI$IV}0Es(@XO!aDVxN8m5Uu`q-a)oJNp2z%n6wO<0R{$J3l7RCo9jEBhgR{8vB+U=o}HGAfx*-)gJi zV1Zwgby##&4PJ6Z>=AF#sR-g~WQjmc7NhyT>P({p>!ler>t2OG!`&;oRnV{xS;d(P4)!JieyaGnD^)g8a8#>Dhlua zR*AFX22DI)h=Yh)Egm371RYe>Z~8tb-NVv!aB(AO+_m-Glcd<0qR>QC-EPJ_edUu1 z*^;9RCe1A;myPX9yN~wqviF~>3q%^dUc*eiF91!sjQdkD%sZ!^^JDi_--YT``RQ3q z!vbEO&nB!)0wxS%oM&+D)hnj%*8A6{Fd3Eprjx#xIdfsDd_hh$=d*=*Bl53}PCJal zG&skEQqsUq?pXO3R|3;!Had()Y!zYwP2JFoq30`e^BL z8*8e}yw#9DgPi(dzqn&eieG^O!0fx=rkm%IDd5+&a7A}i-%a;(*;1Z81*YP=#RP3O z3Q{L;YnFKb9un~02bNFY&MZ$p?qPY~2R_Gw+IyoRuY9>C^w;&iB@62w)*}_`_C`EF zPu;l5Ku_nS)N?t?6WI90Y}{}+bqpl@-f83jjjqUuBKi8BTZ9L^3WA*(yjct~q={|| z@#cP*JLV++38ZA7Y@rsDRJqRk4hl+_mE^qJ5Z7|gJCNC3`2`&IqAmTKokNKZH0jUG zl2eF`xP2Z;*=02wC+^(=9IJxh2WgMt2WG_Q&CGv)lUW4pFZwDg?<--^K?imQNjo*H z(xN5*4ZYb>{I)2?AqbB=B(N-GuVG_Q#cy`dQ9(_`QdayldCfX+_VkYp2|z@~g(*d9 zmsDJ!=tIQgHs;T8Sw(MVaz5eLWxQXjM$j8NrZ@77gNb8hk}Y| z|EPKXU7xbW%g0`J{`gB+Pk+Fq>_=D;EvBj%2v{+#Ygs72rBOweVLp~&bJ%eif7yUH zmz+o>$OxdwQpNwJ1x;pn`o`iVZyLgV*`Tc!D+iKvp7xNZSoYTBtzyRG}Kx%wFNFW?+ekGt}zd5vT*`2kOzYQNf z*c9L=%pm-L4E7q}BCS1!BZj%*{yc|*HBFqs@-2jdlK)LarD9Sw9iX&S2sklm1#3Cx z^dp*3G}FBGJqx14c3!uF7CaB3fkR}7;Tu~*Ofb;ZV8O2#BpyrWFq0OI!6<`-T<5eFUx*`A>8jzDnw(gCo_dB z5+pu>QTz^0OjO9&0a{8W30GGoPsbd!QA*c>KX)nldT&hAwx4OR{r*a~_&ys}`uxqF zud?aq+&K2W?;QhlNZ|ldJJe$W$`siZ>MRE9!|AgYxxcP^to|->orN6?0P8 z372L5^ec&f6h?p-WTznozX0pdXhyqaV?L zxpQHqw;-pUN+m}P%449OdOA5;XF zd`UyYRw*n4tPs+>GO1v<(%gCXEfOiar7WGQD>PKX@Zm#HFI`eE`G)&FdJ)qk4?6&n z*UMtbWiov8)1R1M>uH$4j}+7kptX9DnQ@fl_dZp`A0F9OC6F4L;sAOAw$@&v(k5aB z$YPfWc{`vqbUN{KG`fD{{;~2Q04Hj+$d|SCK*rbmPqn+X)o5i#zi-JVBGq?EO;H4A^1k}#&XT-m z(aicY-3UeiZ-Vn{kFe#7^p-@cH?CS3pvVK%c(Yy?;~cuOglD1%(DT&{6R}FHH-8eV zHR3m`OlF(~Qg?&5TYHb3!LnDzCDQ|<^uWqd{#xF?692G{!RnR7YI_aCMUcm@v| z`CH-*>-F)9(s-zENJ=D&ar(s3?S*R$pJm`ickJ-Ov1pkmw)m31Yg<)#80(E$Kl|%1 zO2Zq5A^+_;pb$}AKOnc;KK@L;p-Es2Nj)Q?6l4u9vR2Dg6SzMo?S0@C(W$7ht3&&W z5~1~2`2_j>n&6XT-~ZI11L2a99&0nC-VY6{JYRmZ)zOt^vYa0U+sqcb=gr$U?#|H> z;>A24?<6}>{tL5%G{RwTsIKADtru)_d7dv+qSCIlHARCC0P9lGdX8USxIIgkFM=_9 zm8%9>zj**6e-~uAd#04D&yFK{bJ#<%q2GVR4!?XutL!?N#;bqweo5L^B zw>P$KZ&*qtMQ_%k0LRofwwFLC23P^KnuA6?{C?d34q9;9nkeh+c7vx(dbhL@HmXc9B7-SI@Qz5q z1@Tg1WxoJ=pp329BU(_H`Wy#0vZ7#QRCIWl!#GwQDuf_aE{ckz&bh$U*HMoN-T5p& zxjb=3>mOXuSyjqtS=Pls7?4G&3n+>+@OzY^`M7wP-&$i0j$x_q4CNRsTAF0b6BwMR z+!t13^%TOSQ(9TFzW5B&FL<}-o^DuE=nA78bz;rqN4utMtG-8iw&sbpxd_Oa74Ra} zx%_w;HV|cLy;JcpZ5u zSJoM@I!#`(Tu1jFr4KOPs}Sg~kLdWKi+;Mdd?N7v$GeaW6}JP}6}ed)2ZL8u*pDwV zkBH-Irjms>htitGI*k^1H184`x5OWhb1N?c0Yh?@R=zJ`IZqq;6@5F1(~V@^#w=V@ z2N9-*cvXsh_TskQBO{z^{Il_su9T4iJXDurSx}#YnA348R#+AtIVz)fg^9))oKb`9HKHkePAtW*X zGjKMcH{@g=D8uzs)ajRwAkL-D#C>GeepNC1YTpD_2sW?^#t_X+kWX6x2rD;uD8QAC zC*5dm^Pe48+{pMmXRgpxl0!;5p1vUOG#x}1LCd3zDXD{+tpg9k)~og1-pXEHg%hc^ z2)zeXuEm4RVV}4$-XQfVuhT2=*jkE0QgC&iKZHv%@_S9`Tv{lk@yRPTgkNM4PVc4+ zZ>gy`sMiSZb&t#0>Kem?=*CHpVa+!NvPRD-FlpJW48)j{#>NrDR0qS4L>jRO(1^sf(rm?l<71C6t4X%{5H-^YbHv+P+SN$t zVZ&0I6jWI~)S8n}kaTE+n&>xLun2kz&b*G!g%Uxsbk1SfQ4?=w7%CE=xG=F;c+Jxc z+kMkP4cn?AgFoc?((#K-yz)UJj7Y>YVw%v=5W9g9@NX@}bZ{&7L8lW=CXl(fmB8Vj z?bIGdl1?^@a9xY?@G$-uI?>bGR<)PN-j!W(8oN84d&)LTZtx_fSOKeVse?5&CBYCc zrPjO(A}Uq@bYQXC|6Y|Bagh+a25(`{2MPCfxSyp_*FZ*68EX{Kr)bBg219XsJR^C_ zbsDQKLXQKYWwcjmfO1{;AsxBpdJ;-CqIa0rs&=}R<>-4N;$M38 z&x$vUX*dvH;P1N=H#9rg8ar}h0_3GnFT96KR~ULtfdFp}keFwB2@3<~lW(w(m})C! z{3w|31}G5~0xIakH)Gsg!Z=cC3i)~|3foK`J8G}M_l=+O?7Gd@xy!qbnVUuGw|Xd- zRL=R7b4qXOLWKM}o-^$9OLHv!d6#?=uRB7&Ti*T6Z^8`_Y05XLwVi0$UEB7i5r6|1GzIVs zypK&*=d?E*kUer>#Ic*bf{m)t>&ZV=s(xmH;5D z&R8?(v~lP24tSucQOg1taDe^JPU-!STg5duXnR|H?rVVIqZ27GRZp#ta@^FrzEV3L zz-zA*d{Qg;u>!;|^m8hQ6eek-TNd)R-l6U%2*sQ|G#r>-F@BQYk}}2==KGOYqKcXv zFX72aoV&3|BRy-s&Ru1-BQfozz~nf?c&oe3uODD$&nAu0m7~oB8K_3!*FhQ2=*aEp z%x6s*YB5A7r8l3_Jgg9DQTR!V*p*<-tUH^f<$Y@?qaMHXzl;QNhMJq)%R$t!i~~|f z=M#H-mgl!~qJ?;ks>jtH(3IGXr}e*;;~P%S#O~weABx4TOd~$G(04*}&IMd8d)f@! zhLvLu!bQgvmXg_qqtuq-)!8@xD%pHy_RWa{7h7CUjg#tj|EYR2|G}b8(9+V|=+`B! z`YgPh#4PXV3-f!i@EEQ~OHs$I(l9kiXVnJ*<}fA6hHsVKv5IbaShX1@ra!&~2L@-# zCdNt2ew{cT)npQ;Dc^GmSe8zP2{)aA$8NXa#miG0WwgeNDR%*Jj?HS|eJ36gQre28 zF?18`t>W{@Q)DyQPXR0NYzWm8;yV+kgYxZ^XBNw2bW@sf!WG+M6bsbU+#JhgAv7;r zpvGo${}`TF9UlbaeO}PC_zzk_=Ch?#xzuzD9JLZ5f{5yn6wN*5oE%B6v5DV0^ywH8 z@-}ob4(%${wOU2CmaZlQ(?WXm@zCi+{aQ!y&SR=iMzZFC>fipDvhnA{Qf^{X-Cb$m ze}|&r?0Q~vL2t>7>nf^~#Z{nlVK{7)(VXU~tk$aSu@SF#pi^TcrlD~*a{ zMNEg|p|k=4;*vfJ?zu9|rXi(K3;*aKm$&b3TC6?;qgYj6g44lU?hLz24)<5zQq zh1FFKWZ-Xc3u`|(u9nu^)PFH6d%iKT4%&8*aDhuoZcGgF32HBb`C5T4h)TY}DBLbr zDf&Y8xvQll8%n1%AAX>T(dY9jFTsh zho~$69iRXC{9G+44s2iy_rGVVks$nP$}!-^ktz(Uy0HN1xY(mG6M%(Je@1;4~F0n=z+u>Z)6FTmn z?=h-5AWpx5rr@WZfK$1&e+Qta)(a6^eMDjwa=an@OznWby1zt+vbPndq=ghm@Q#iD z(@TD%_xy-4@RKNfe-Wvz8R)vv16xSgW~OF7WFzZ-wb}2YS|m&{c|)zJ3z17 zN~ib}aF-p=R^ZDSUAlZHnafn?u;(d74Yp&CPgF|VWUZu))+IGseHf80UJ)@43dC!z zu7PwutT`e6V@>s?GB%3JYt#?3-k7z*_Z)#=<$J5 z?OPJ9LIePVwr6oE7wobS4e{-YSD5GxhT;}xIrFf2IZio+{KUhtG;qw?%F09Q zo~eZ7_+AzWr-k!)PuWO`+Rl^{ehWgo=UQ^-4@oi)@App^FC})2)rOiONw{ONV-_1Y zC5vBv_y1n`)&^a1M9+I?cDvhG@Z!4Uzpn~L__6dA=w)R-^a2ab`FY*2YVNUzrn=Je zX~2$s4Fw>P`4894J2#Yj?y?rH?U6-fvZLFQ(tqYgYd}JtOU|$L^Z9OR5w$Jk1>@@q zlFe`Yc{$@}*$$(6K{wt3$-8W@OQU-aZj+I+>o%66*CtIF2w5e2K73$UKqHaw4aJ#T z=HX|xbS#eqHUAfX#Uy#<&feJ7!C&Bsqfu5EOTz zwh>LvEUV45B+q#Jr$t3hD#DkBhAFD3-BaB*FP>}!$>3kJx-EeDzCcB^j&NUG;D2Y1Jd@(*LmTZU zY!+lN>#ke%qZ9_<+8-Myf9SdLWhR+qM4GcQ@#-}dg#uD7Q)ve5TO6?hxDFX)Sb@uP zadj*)K)u-X>?GJ3Eu9`P<;$N1usM-fAi~UNqWMG2zdJude;@rLV^K;q-SUM*14c3^ zrEq4oP6PfW&I*8POCwFx`{kj81KRLR5a;;n5ISBZChy7?UDWWaB)t!;U6LxwfVGR0 z6t%+M#Kyle3&9&I(qu{iA@UABBe4$D2F@mcT z{sNGuB?ZKZ_!KbIXFREb!34VePlPANFQY??Sj46D_M$_4YY|B90cLu|I`UK8Rt|E zy=D4}fTXy3|B?Xq>mQ1C3lS)o>PnL%fUd@DZ&nxF%Ku6_rix1pE(zs5@1DAn_SKGG zrx60Y9j&(ZJ=Y|C#g&9UtNy!1wI{xObxi3FA|9tIp1}FsaI;;=yGQ2mC|v|k+VJQ~ zyZU9t+dJ(pJ!=!L{^9!fFk_>~Rn={rSxQjp&L1JmJfDpJm~j?2M3?vb9wu=pg`xB} zhPP`JO`~8L`uuDtj^YY&Nt^%vz>6@Vl{D-BG5qu|DK-rdf zeCac~@QR*x2@uT)*Uc8##siV_ArC?%kob}%nTC|uC8eOWnpaM*nW>t!3Gj%|gaM?1 z4cmu^!+i+33VbfDirW(Vm}ZW1MJ;LzK3Nb*mY!YAq$GV}R$uG)NBGOIRIMXZLp#xz z4U3jtGR?*T8l1S1syreH)cbQQgFYXE0Jk3b=cvHn16PyUFJ)>o1GPq(B_C{qKX*t%8pB|7N(AGE8pI`xPq5Gkr8G*d2IHb zQd-NzDS0bs5ND*nV!&$H)pDm>?R(D3bkM~~!#c8S34k5uD$iF|?$h-UTLwinGfRqRk6-*lg=4Mc0-}@JZ5H7<{N}$vB3@G6JDxM+A zuQUUahFyoMik2aMeP8Whe5oL`>G-RkPd=}`riAI`j=;*_2=uE5H3V{OT?ao#TtJ{k zFFQawFQ(+FiRtUEs>OEk*<>eHt%V!DA~O)1;|!F>#$Buhdo>7fb%}Fv2D&tN%wj)Q z8qE#HTv7dwoTU73D8SC@0|-)&_0;a&m#ltEEaj@*>6;1uKSJ_`FnxI0e5xc?4IBQx(B?^>hKXRchMK)M1P$&j8~;jusLU4 zB%Yr=7p55@`bK6d!B`coissv24c*Xf6d}p+C?5KmhW$UV*!lCB8vO9|eKwt;Kh2kq zAx`f?c^5(&xh+4N!@F4jKGv`9YVt$bgZAgFUqItr9OrqIz12^C=@5 z!o5zqGT&O9Bgt7(yV;D$ty-xJ02o$b*A^AIeHj>aS4+U*NVceY5*g??`0P1KoudP9 z$Fr~4-V|xHt5>bu0~=rcIjD$mqrQYbU7hpj!`0mxjoL&u9b~LSc$TmrO#eCCie;d4 z9)mJA9dV~M(ZaTWg)Xc0?218FV3So^yHM-P+_U2m|5tBWjXcH}K2%x8!i^7KWEt~} z!3>$oeq2wEE><#3-VWV5c|uFdBI!q{rGU5Dj|o!=RKfAK`lw6E-MEwv@k zn_x#%n6pYM_Z*C~%}kTV2o)EgRU^vk&~Q;pSJjvjR^Dz9JQ&1xNXOjPIg!hs|d@3RLX_ z*6dCJ0{j)XPJ#o6y~LII@GJjNGfR@ZH5(uR;H+ZSi4WKSjb3c%FP7@*0D#G=B8!b= zT$d3%w>KQKek2gS=$oz70AG;4AHLBqCp2%SxlT|$qhGauAm zca5+pN3}W9u}wVP@ht8r`QWAfFEv4>(Y=Geg2T;fJJu9nz?VYH{QgpxtN)M@AKlC> zQVl@xNvK}`6sy(f4h%kZ69?*({9{j3`8h=!TJRQ7f@HtjRhRuBZheR&ECyJ(#+4Lq z?@Jwlz8d#FDD!5#CUj1;^Nth{zuJ(VAhWndDIP0e0i3&JU3ZLaCfVZhN~}f0Za=C; z;o)n26iDR&lj@wr-+7eR#{1FiAF})0DY<%fG`2w3}+3Ov4hGLa5Gt9w3!y3(GIb(f>%$YZs=G=1*-w7 zq&W;>XCgz7QrGH4XP14h(wEs>a;h)>r=R|Q8E4R%I!%h{d9yeAhu>wAO~q|=9@xz7)Fwd@}KTYmR&IW{#+^vtP+-Qo2QW`p|IbXZ)MIdHZmb4)PfBul679_s`aRa~SIGBA8=05D(b zDnE0M4u;#%Wo}b37*4 zwmdb__bD`B9wX!acymwXm{+*L6Uy?_ZXR(^^LtzyIhIz}e5>8T(JWz3;~S2ZBXz@1 zAS%7_?Xb?hav+Cvf>BJ_@s^Mne{q8x@dADwwJb3_RGwN}2PP)1;TaulXq)E6_;1c2=iWMawy%B+#3w(aaF&{~t1=L-GT;o^E>6+(5(7*3~WtD#@I z{0~p0_TN?1$~%*(w)l^R<$u4=6Uh1=y$m99J!V{lax7Y8AiSlF*_mUI)D){k7DcTX z7aGYzzt>t3)e>v0QJORJXIaBPdK_bBcPQ(cYYMH4^X10QbXbnhBno;BTUaUdmSvr{ znx4UU|8IkW_)Nm0{Q%Rjvzh&}TZ+2w5($JXRc%YVB??4}+l}Vu7*46$Z5vBn`4D1; zNw(2{uOVejJ^(-ULt!+GYwy7NTu3$2mdN*-M#`&7<+6%n$8?B8n!n}KPUrXD#wdvx zlW~2R=HA3@{&$-@8k^0!k}o_3294*r-hZw@#OXL5saprv8hUEO4J+RzNFz z9IdSGHfm;tsSmJ!4X<|wW~I;693a=|L;%*{*f`9C{+bg&XkiFO!L9^&&f>6Q_6*yi z(@=aNBy;`X-IN-^ZC$|@i-W360Dw6L??N)(S$dq+hsZ>SQ0b09!U#Pee&s-6$ZAk% zU!0oxvNHL#!=2OA7c)^Qq^xU<2VX(c77SBe+>rclwGz=o%^1&5$i&DZz^Y?qZni;~S;oEKo{SA}6DlUaQj{;eKf zqi82Euqur3Pu&g5E=IHE6Lr-L@OD<<+icEb!Gd|>!`H^^n3q;>RQ!esIKqJin&_y( z{%^&mRyq~ESPeSMw)=!0cj*FH zw7xrBJ&pTLx$+!yWd=%g3M{0s-G*Bdi{h1tH&A0V{A=*_tJf>|zT&T2YnQ9Nh{!77 zkRdIXtVbFKcbZl2m!#C;8O6_927H|9n5TwzsE3h5J4Ljnm+A zJZtLK%R-N-PxDhphZ>!~op7FQlsF00lGUsvb~j`82e~nGt%-m`<%7TLJYs=w9*{vo z;gGCP>}2LKOVCH*!|kWOL>6%UGjM(++}a? zcAOvHSKC6fHL;5L`BKQs0C+b$AZcUJB>&q9Q`(ZP3R#JLz!N7`?Q0amhnc-DetnUa zvI9Uf>c@u2{m=UC;0@P;%NPb-ITu=?eunSFq%LBR?UUgZVOO0>2D;Rew;$P2|88xy zZuSN|19UO|1APN}P8s*Z@tI#=d#8Tp?q@O?no{pM_|t#ltJlxXsA8&W+FYz%ROaT2 zoJzHr%>}BFV1;!)%y?n9-vU{|=ctK3hv#KC_E#+U5E_2|5DbTVOO3_m?)KD=`z$}a zJ`(ZT+rQDhIy^Iuj-%!sY3O{u+*L^W-f~+^=Q?z=SE(2E<~o1JwB?tQQw&G=M54@03uA@sA?ygB!vk?bh`la#2oK9Xh#s)E}UWY?vRt&Q;6GUNE1cr9PKSS6Wk z4yU2fXe;m%22vu@@r!Zzl|@z2t3f&ETiZW~rnP8HH^ijIm~dDE$!*X%WTdSg`!fM}vhgG~wQ;t_YZKTe%!8_0H%Iekjn~sbW1A+0t`? zXmTB~N6A1VKz_pVDIz43W~np1a2_w06=^I@S}#1Za=QFnZY_S;cJ%=wA(6Ay|MHd> zXlf<_T-@JDIO{(DpEso1=r1{N1%QT{M4M3w##iTW5ugASE$M=F%h?*QWy^H<8G|8o zw3x{hbrXeng?HUY$9bQ>qU$oacYt*|jGdnNBHcOLD+E*blMv{BFg zyuxAb@Hz`#=D6t(DH%P)`B7iyN}+5rhG3-ask5%%6&A886PesBi>zRhsUbUJvGbHv zqt09xgmXEn%76n~StoA3$}8>Iixw*ReD7kJ%aH6S4LN?9=8_f*$uV@Y@3AHJdJPWP z?AL^DsP5T4elo2`A89km>buX~IfPU9;W3$}f0C@_3fk1*{U13w6|Ejmk5+LgcXjVk>NwVbLC-pC~iHe`)~a7=Y2KhGbhq zV%zYeU#Af+d^4wvMHt$C0N(nXU9la!4p(BKS1AFu+EMsO#ESqH8IR4iQXwoGr;rxD zcal$SGXw}O#Icrv)YiY)^!(!aFY<(E)S<(gyN5>vPSm#~L1vlQqo6e8-8kvA<`7+w zA-mDBdgn{%Q8%)rN`;kS^wEPU9^RhVPTxJ>dpZ&SQ!tIA_y8G5vO2FEExWP1bk@}b z^4B+<0=^4#FCQw!R*t9zUsT#}q^#!09!c5>+2xs5VXjVK;9y{~5~6DHFDvte!wUv! zTsWG9giSy}3&L);w|q33ZF?n+hjelE=vyUcW_8g=`k^H^sL>T?X8L}cd?>E<|ShGt4@83 z7;`cKeAlC_`!OwO#;uv3-~*e@(Zpp0OY^#v#V^XXzQ=v^DiqcCZGHR5@bkg2<8jSa zyWN3^d&`p|N+LMhq4P8&=Q<{Cr!x+W^2tsbx75&Rgp`p%+HRIb$qrzO9w~IlFmPM` zemY+Vm`9;$9ze+P>K$LX^UjfNTD^Nf+47$bI^VRhw0vLEy?fB9=`g(NNg`? zh=%e)0B{>o9G9Qag;+!-ui>X&1t<)*g%$7-|w>LkJckCMyT03pD02_s%ymR zQ$LP;n^Fu3l`n1Cy8g*ZxI$2=g*}D3Y>?#wn$E_%?RTR-x=oQIVtHUcIvd}Y)YXH+^J@+;Sa$4cP)MNCa9tTMmp>Myd zqBz=!W>jqNMZPP=R6wf#uGFLD-Uj6TuKFB0oAbIfLc^Dl&w7*%&Ld_PQ9SH42!bnVT3@PAcGLZ@Lc_4k!S)>!{JA zMSFL8)@^r;;>jG%>~$ul7`XM)#XV%9%NAg6pj|v+V0w6eT+A_N;h7X{TwDq~kn~u@ zn-0d>zw{sh!*yK~Cm*yf@|R2BrM>c}%ni@J2}Km$joY6i`FU-)gy{+Ucl0${1*l)A z!rMlgf2QR6&X{Dc&_=VD6Dh*&(t{2UYzw~207SGbg2Nc&2j>^+a;Ig|MuP9}kzh!M zDO!v2k2BTf^ltqbJf)!i4PHRykt_V86g+0@ExaiLd=_?sd>F>ry~V6v&$ZIs=#Mt5 z_K@FmHbDiTY~k9kVmsP?@Vzc(UAbIB z%^x0o@3o3K_viJyUwl~YJJt+IhH;6F_VU&(Hw@s|&beN(vFL$u$->-*^y3cl>Pd4M zWT0Kyb8MJ|Wj!OSGS->BiD?|te|rqcS7NjVDs!s~dkPFZVgAe{Gb+;vsy92utyR>0*^@P{+RdWV2d#>V%D z%<*NBI3sw?mzNF`Z}HG9cr4xkMc{ohDN8oX;Wd{mSmKn&nhXcH0jm27glm^+U|=P8 zFudZ0CXhec{#xBN79NT}L04F%XHNVXX1yuQD}siT4u+8If@-AGAY=v2x4MuECRJ3iocv)5RW+FKDJ?aW6fM~=$z22kaNYi+S%Sc|el!Yiwa zMY>>SPe`0je`VvbS+R>&R7Zs{z}q0nG_}V2ieN(LRR=fFrsT!UBCNij)y(;EW0RX; zQ0%nnMQ>TJqV=aj8837V-l{76(OYYw=I7GSBmC>NJHs@tDenuD21d4!6%nPd2^Q3o zOZgvit8o^^)bl^Xq$5V`4-*e`(pNGN<76VnTuqvN0#aN@O-$tK=(0ZQF|r3lJ1Exw zsQt`d|MTbI!-22&Hnkqes6PB~90)ee#^J@sy@85?)Q_A5p^M9U2RLJF3ipJGZ@<#{ z2!9f}|NEVe_c2vWb#?VeU^&l)y{h~kfu#@6p1J!gZLe(2$=arm)Vl&nxZh}B)Pz<^hu54A1N4{3&3kP@Xx}h<^VFN4B=(*+qRIj ziN{Tt5|EuK5|4N^)c9-0TpUt27ceq4q5-s|RUm>lRaq_gTwb?eQt}z|Wh8&28N-ww zLd0s796R9Tv!mU597i=-gi~x-ei$F# ztoz5I;j#R*FRLdowSyYjr)sdEo_DXY0y46uJrP|Bl7W$HA|O+Mo1*+Fa+yXG9>YSI zD_Xo*y?&!HUMuGE6DJ@-&vRP6A8nnITX?V>)3E;th$hrjjB{k(;ADd>4K|_PQ`qGW?>t+H2~)fW4IZ%x}zdyP!XOR9ex;?N;{ zL}r_KARztsTf!FE(1SW)Qk8XEXSL;;3 zqKyz83=q`Rhat=X;gQUU3VqeQ{2$ir(-h97hXEE zX>83qH-$`EVZBEeyy{$%zxCOT+^+_CTA-WP>y!*Vh@)Aa-mO55jp1(%Nh9rzxyN#~ zbz?q*VQ`AlQ)SnZFsw;z?23-6|_mnX2+K&>B!(c#6I7;GTr%&J+MATWI#AK%jzWd3WSl3p~rtqks-MB&8ex} zdrEO=rni(SFQX5IAV!o=1htec)H_+0A@v&()3~c;R2iLy`Sn+$Hb6&2Er>aTvxk3o zQTSb*cL$t@XWA4mZ~ivJ-bDPpt3w(x<^P*?^+W&xB*^dy>lc z`8{>EtNxeQdMTe{xAOiT#=%o;m>4CQ?3LZz=5?qnJ5vm#4uK2hpo%f_y%|7LfJ{KT z3x9Iht0nP`ue4gC5|Cf-@r+KP!3^OjaUr*1XFZ?=-M034hiwE3ZD5uAh!FD=s=>h; zdJ~xjq;lkaSfGog_=fo1Cg+MklN=#t(+3slm z<|8z7nGlc)`T1c;_%TPY>blsqa(C*8-6{;|qn(t!_V58~4A9Sb{+QKvTz@g_gD~@R z=9L@wO%xzq_Y|o8YqdMbf(K-OTD5LuDoFlzXwa>-{_$5#3ftB<<4DsW7&!HbNE5_q z8YnOAd(#j7$)VOwGWqueIP@_-H^24Wz;^vCt-VKvu}YHtk&Tc8b5>&7N$&Xh%sQ%Rmn&Cf1j z(NKQ@OtQ2cU`8utzY5>da4tGTO=g=X6SdV^#kl~@Zu_r4HeY$bJ`e!E(m{Ih*;5y| z6>zpcLCxNaj!RWAik0Wuv9egf^)bv)tp(>bm9lOA;)cerW09>U&~rXZE2~g`Y!hoL zVJ87neC+UPd_@^2%dGk@t*>`at=qB}eLKu?xcTU!sa93TkKg9bM8xPKJx$quUZ*8o z45Bie{=$MKXjN73u;n7lw6zL=4$3Z#_oZ?R1&zs=;%SrTcF8Io=*%Ydd;@QCWf?fy zJ2NR*a#)D@nwUFM2Uozt3+{G!D#7QG+(bg7ye;;y$K@%WdIHLvS;>Y>~1#p4#|SZNU))$C*VKL8Cu^1k1{y#q-;cf)S>9G1kr z+TG6rw4A@oAO%3wJ&`{^4uEvXL!PY(Uz5i0Qp}{dGHqFiQgJ8NkGdw&zL&b66 z^ZBT(tStE7-wHf6mFN{A{H=|6t33GY{WQGnJX&9WHH+T&M%v!+3IGm%^+#-a)qBZC za$2V_O~xLT3$?ln&M10(2b#}I)ya}D%$BoB_6{=i$NK?T^uA+X8UTfZIg25*#wIo+ z6YdA1qNr#Masg%z_n}vWIdAJ-ocrAEX#Vo+Q^O0Z0f_e}T#}NH$mZ=J1c60u_*)7W zk>=E-Tm4(=+^55rH_s-Xm#;Zi2%jpIhuE_@JDM`MpA+7F3L8IgHg&Im3&GdC&$aXc zsKGEwAOr}kyhTYdjNg6>m?pt>CsK9#87z9w>+#mr(D?t}2f)-L_mVo8vrm?DjXp_pKt>Q+{R=8;3~k}?`ru70M1=JKFH{%ID&WjiWwkmDTei_`)<(hTxPj!|zm(@R zi(2ErX-Au0{9uj^$^gBh;#pVvGt@}g3viqG94p1fni!IG#{LkVQ?9^w(VOs|as~S0 z4XBm%N0h_!tUO)5Hvpxg)}0SC9r_~Mj@DJ&{_H9?RduAJ5lnv=qgwv0{o_4&10fKC zSpQ+71D%+eG{%VBG*m0=OTHg8uMeL+7iTurMhHQ2Y>O7NXcK zf?oT*Dn_x!Ezw&QZpC#p2ob4O(=xw@y>YON)-pxg>%`DzrJGQG@}_zCFai80EGO~I%Zn9 zvtXtpnGqZwQ2=FD#leA7uRJ`J%d_P2HM8H}DHa$jvp}HKV9sLLvL``0Z4n4)JiT8O zC2~RtSFt(NFMq$GL!sdaX4!Z&rQo?=(K7on9AY!wPNu2~%NI)0^23|@NF+^GEDhuL zschOZ!E-z1ldy7*!JPTfb%n~1e18s)+pTA|6-`kTR@rv6y@#cm^HQ{-!7(N_ix)4Z zxw)D9?z_+ZStgU=kw+fkth45}m;9}v>FSHQeEfMX?s|-6Z#;zs7qqbUi|^*dUwoZ) z|M^)q-uN{({^IMXejg+EJjxSiy_V>1xpCF2>v?xi9P=K=7Re< zHnf^kSK$r&(3%&z*P;7$P!!C_I7XzeCw{54_)VYg~tl~%Skgr*5 zY>0_J--Z>7;%RM{jehflQ)%vmvmw`x=Clo`d%Mam4iJ_}`e~`w_)fVH#plO&-Yf8| zI|I$<0acMI(4e$)IzyLbSTy5uxT5Fh7=_;15ap2g|qDhUa3Z4J>^g2HMkyU6Oos6lX0LvE4Z!^Fd(m65Z z5Stteb8{PTeh%e%N9Tu25i}~h3@Wd6h+~~AO0|3{_>ak z!yo>@jvYIA>s#MSFc{#ydlM}9+KVJq?dojiH=YZ<)# ze%FRpd+sSk=Ppc#o3nX(Cb1Dhu1#qw$6t5*5}Yfnn1HWc49Ej&>!!k_vg2A_}f2Y-xt2i(4VAQRcrvI zJHKY-+$7S0qYNarK8KY|poS~TRto^q&p$$T_vVtn_q8p=)7p+Ovc$J+BK6Q85Xl&7 zT?^jRE-86G)o%8gEoU=v$1MmWOJLP{ch*uq8eabn6rZ2e{yjt=e~{$v?TBm^y}ohQ zMXQsuNp&8;w6h=pY5R2%wyRynrW2c6B(Z5cO%fxmwZm=8BQlDo#h(9CM70r?>Du-D z^_65EyTuJT&jnwdy?9EQsG$m!${H-wWa7_uw&qpyS8E{Oik55P(rTMfn--$mhH$Ca zNabTLVw2tT9M;4Lia&(+#B%|Am-&*{;aRZ}Pe6XTB(^+*F+L_+?KB;|u6PZR$fQa9 z=_iO}9JR5Xz-6y5svzVF1nepGz5r^qJf>A-o{dXv+Ge+*S=ltPpMROueZP|fHZv)d zKnTyOlL=h$Cc^LiBEf6lgHp!4AhoLQ|FierVUlHcefQ_wRJp5jnAnqNC++NP&b!*6 zoHGbSwvlDhiv`B^`x*?kv9SSTY=bSp2$Vnxp|p}#tIc`RPL4e@J)OI&x^mrc-apR0 zx2n6Vs;g&a7X%P* z85&wpffzo2

&hKGe^6j>D0E{u^BQKgu3>?He}Hv%7uE+Lcu0;(27Htn?>MgwWpn z9I>7b$}{uip8Y<3Kl)D)x*j^Cxs#V#YO0#m{F9FYu>D_ul+4rnDV{z>;--5rht^?d z=5exl?Cd;RB*L1HF0~pDG&!+tJD2>eSw+@wQnsajT76>ozP1O!?(`Uy$JF3imP_Ga zb#bL`zLVLne2(1rzCkKh0U?OJ@xv`=e`|R#w!*u2Umwqek-lOJV4aZ1VN!T#tGF#S1z6p zLlPrvni~g5&!zH=Lf5RD?nl%KkcFlZd-IQAKJzU0xe*HA`zm@`t<&ruXm~wJ=~4RT zU*b()M#NLZ-}#dWvoRfEu`?QgHn0XSGle^G31fKS1V-4{ETgZfzVIlrQ~+H^A6iS~ z&bKQaQUe6CoiaD=qB402=ky`0UAJPN+z*v9BHe?&zBxMWIaQ?V00Jw~q4ZC#gIg_O zM3>J)X;#v)k-jyu)^%+gn|4ZAQS`y}xR=l2TsXNPzo*_fz%I-K5dh(sY0#n`+L z=hTZh$DYNy#QRp`IS%>DXBUY4Q>!(* zoS9}Uw;oXYFjrXW+|~2$4`Ym+pqkGt)z>UC4k%WXpj`;H99fO?ciUzf2BUhIAUSNP~U=NO{f$iEJ=t;HzE+6a^j7&?$v$geiCztB3 z7nh+6(s4<)s8E~Li(K8Mlw6vIQppsW+N1pkA)SV4 z(Ai-Ui`L#T+x;vXDb#2GXsBrS-FF{S$|e8&*`NIxpf2El`)~g(V`F2K%Voa*{qM7D z*Oi5z{e7yqkJwa3&V(*k^%d#w;nr{d3F|+m@;9oJ>gBVXzNY^7@y%-1cg}bIa*HKi z{=h$1O^pz2de;ty-?$Yy-#9?+YAejI*}T1}P}iHE!%8L45((V-tO|U@M;SC7Dy49? zyWMh&g>c5c`{6g!|F$>Ku`WsH)=oD6>ObYW|M&@Z|IgoG-=}|%y?^@KOH32od@i(Y zZWZddxU^^#t8PFVUxB{HylW(*D2P`s(pIwWW*ViUNb#dq#T;0N{#;20DK=q{SVjobJ?0R26dOC$SdLnG{uB1ZS=aCc0Y6bhCx+bjMx3_GT0<=bt zL=l=6(uJ;;j^<@2)krCtK*X-?fLltrB)GCs=}l~(YsLXRAq~x{%aYMI>_&7BfNNtP z{yw@DA?Y{EBA!N=%MXCeWI7b$&tE*n+!=+^2u&k7G)#KSa=C`sXqvz@ zG%Q&GDG|ES*7B~V%y^2fjk`$nuK^*j3-fFhudv=4Mc^^lMBfqEhcBk01^SvqWTC#M zv(5o5ph~^!I-5Fc=0er|Wb^aPE3bwMhYDlP$vNTzkd= zK`jpIlv0IXe(NQd-~WospMA&WsiTquXH_F6rR3l_$^J9yvxDa(j~(*(lSf?s%a>d} z^<9UFc^%WzxN~oe8?TEpJ5}bwMYY4voRZ8HB(5i!_Rn3h1h;M%B%)W2)~uw?U9K4i z=yk>cjw|`M|M?j6IR{;;@6_8qpS++xOUGPhW~=<#e>g&=+TQcGJEfkdhG~TQnxHz< zCaZ>G=zd(rK=(fqD%wBRGSZ!49!KfOp@!elOp{%||8Lmy$G?SUnZ!4)CAE8N+v}+1 z+3cq}o8h@P{Wud}eH1NXvFAVjQ&!!s22V1uqP@n|EWf6{WNsFr36eM50@UbeLO0NQ z)gWrQWb?(9f8lAQUBz0pmdNntkOo&id2E?qswy5k1k%G=wHC7pb*EX?Q_m89nteOv zUOo?i@aZJwZ+#m3%qvU27umQKJrPH`9=59!x#P{tE;~eQ=BEAG=(_dJXUTl~YXEe= z`-fW2glVQl-;ey0+6THGHt5Yt2tjmM(aG#$8Lf8+W9=3kzp;sJ+7fD<=6pKZ<-bG%U!C*fp_eI~ zJ&$x;^jL)C6{0m#df`2`I1o~cr?9r}R*k>wg6pEi;>{^zu1n=PAFa9h0Yn2gI)La# zKd7?e-~?G-(-+DA$!}7A^b0uWj;TzSlLx5!p_kDIKZxPmgEy<7v2kXn@qE2RptD)r z*htR}t=?PF744%hAj?J24Xj%q2HnJ)8^b>My(^}GX}v>;bPu==l^4FNEW0%wb7yNu z$)K?b&>6!Ye7fbUY;62Vg=>x0NGX}WaFUr5FH>5^(mlwtaW9-wSv{`D=yc7sPD^)( zj$@I!23!aYbN9WVo5;)r?zzLrtl|{~IY!Hs5Q4a`wXqBHAU(`P2VI-?5bGXj8<95? zDTJo0=a{X|RiFupm>LmTb3?nDP~>(?Xd3ap)pT#(Lq+dE6Os*)%iI({O0lr?nvtFt z-ZzV_o`bxYz?H0~uc>{fW+3n?JEQr{l_mrgS0`@OEVY|eM*}LF=SdD;P}{n7h?WEV zufO2&yI*pdtaCw&m?A{I0(#eS#sNVE1_GDo;F~YH{N7ho_~r8_73yUfDk$?N9|_^3W0Na-jQSdwfBkbCNhJ-A zp2+b#e|WMjEmwfp=%%qiUlY{E4QfmiF(lE*4`z$-gSpjzM-|MD7mqX-_yer{@%M56 z=|{QqnZI69c1EDHnf%&gJagX(q?eC^(HT~D0;{3n*1v2L+ zC{4{#y|^&@W$qhaLRQK|Hf$lWx3QyAeI@qYO5C?aj%~RPJ-$3WCqP%6Vi~=6722v{ zoU(ekTdUU6bGKUW%o8t=J93KrkyB`vNzV?YzX`H0uNH|VUKKZ7$p ziLfGA9kpv*7P8Aeq@5Av%og`EdGaqlP4;nhEhPrKpm=3rzp{`6&jq0&l1q&!tQ|Ln zIvY^=HO&TP_R;5&*%?GUg>`*%8|xsX(<@hSOf@pnV-aL_hU$SQD1PaW$o-FBqx21B zpkdv3AJ)!WmfaUUl}3vx6?0%n5LiCT+}uL3{?sJWwh^X@+1J>*T1t<~bE>h@2UlTi z+>5pEA<%TZsSDUgp1dNVv=9Q*cSox}ugqtR&AZVOtu> zRPIZ!77eXgX=a22#jPAIZNw7>3BAN-agyC0lqyb$*rZ|$5u5Im zpiq_^zvPjQt9v2yDkC=Ogh^j#lz1WmZRl&DMnx;zU^{9%&rB!_=!mIwBF#!l$%#wK zT;TYnh4=enqk*;&8~@cbSCG7LN|GMib2rD%R56624nBWIZGWK*cka-L zn6GYwJ)g7r)6bmeGhe#M0pC`6pi2v%n=c%g<5Pd7w40y!_*QP(sSZql*qrqLJ=CkS zZDWGp_>~=K8hqo?3I6J<%a6UfI%-t3f&QfzN^hTkBD`x8bo+NvuQxU;s2~uqkjN_2B$PP^y7kTD}f zcilj2#~!3zW$G{f4^W#4Zk1}jWWBR96n%Y6$DK;MrN)nAhL0f;KOo!a4EW6*V`;Cf@|Z|E;xW`8=ZNwSwt;Wo*u61su0M%|0f$jQ)EOv|b3(>2uf zWTiSAJ`40!ThRK~gY=O8vs-Huu>p0zcWvB7&-Q)9y8EvfQ3>d1F|QCJ3lJbSL1T0E zj%X{X$$2PM1#_~8?#;W%x+x6dksm!xetZP!>n?-qNRLDp?EiFDP4uJ_CYGt=dXhQ+ zan+MlXvSYX;W6vat>j89ab3HXC4^vYe*(u-*Tix(Gyu~OMEzbZS5^*jNBkyb*Ba3> z^f6mhLVth@lZzUgI*a5)gti-nbX+w|x+d5(B>3Px8o%^zop;@?vu%wQ()&V3v?f;1 znkJadRJlA_ATyce7v81wfx9*K3@bFpFm*aQ;~XE6xNdFRJy&wmmRBD&{L3#~@yNl@@_8jxwA?d~f%J%O+p!=JEieICj*e!}OsV`Dp%L4$G_-TM(xOoY ze&XZm+_qWn*m?C^pK>KMo!DDHioSLW*cFOj{9m{;<5ZsdIx;&$WM~z7ssk^dqjYR( z2qA!1E-~@He-D7T5QsW=QKb@&mnVjh(rh0?&a<7BkTQ!&>vJ;Yt~_I-c9VG50d=p ze@o&=K0)+NKTP}`Kfa{#a4(+%yMnu@v4Lg=0!wu^HLK^w#sN}FDn1QP>+Zo=U%Q_4 z{`HtUm43(_If8rk;IjL>xb#&U{0t`*`m3+q-17UL>(ppMix3;PTE1dhoXk$E=dBe* z#G5;pt)%Q?j@+1P=;M8>>D+Lg(y%x-^A}Gw-Bx{_qRP4#PO2OjDKUx}0IL2#JJLjB zC4|7-c_)MvDuGC~k4l3-nQ?`N5J6eVG!lV{O-!rJ0$ajH$3-Hp%IM)r>ikqq9B*0? zM)hr6sHpc(X=a?v`D3_t6~{+x>h(3QCz+jB*IjRC&3GUP=8RjC^Ao-pJqL!S!W#3h z!8ox{QR_{%sS&AnMmu^*V!Ntg*w8v_nDM#V;Q7+D40CHhAvA{ncbwYDIzGN>@ariG326ECZV^o~6-k}-{KYc$?@yUs7YTj!zcVLn@?TJ^Xvu57+N zDY;>T*0PzqR`u*lYGPvd&TceaITqUGDy6c=xeG;dd54Yb6a4&7tM_FrqOpERb)Y9k zsv&Z-tuC1Jy>DAh#L_61TrOU24G(s8sQX#db-KHkHa0Hmy6C{ zN{=UqZc=DQJE+Y{OXxZ~fA8P0?x#M;9glsQ*jk?-?^~dnTlNAV3-e)+-?gfmzGi#V z?}XVN{);rSZUgCu-U_I^6y;(ikcD}?78Hy6nt$qh0Ce2>h6SGoI-BJXo4~vvx@jwV z;8hrt|>5KFa7DpyMt-sPjq@o7}?dyivujuW3KzxkFT*{T9xpGs>nJ zkd8y;IYp_8-16YE6hwf?x>~b@5Ey-R0f9oG_pQR(adSiQx94jpcRpj;Fe z8VD@a*(~RX=3YF7H#rJIU~b)mSTq>bS8u`CrjCnq`X!tT?P=t~ebh9}?TR*O-Ei-+ z2tlBu(F`lJ8`cafyf*?G(Ml_{dF~p#Cb|!|S|NMkBuI(X(M7yZA!6xuTM?R$Q_8DM zm-xhB~^Qp(VlyBT7WFM7OuTrKGCeG9*2=z`mJ7!1U# zoIN>1+9+cHaZOn~zuGlDTj9+40z$xh-Z>1w*5L@>{leXR=8taXcYk9y|LPaF@q7Pn z50OZ1@@ngPb)6kLRbj+89H5Lx|U8!>X zRD0vNzi;(=W3$2v>1aOvsafS;ey%MV)#6(7BkyAO|NITiE`M<6c{u0Pa?D+~DXNZ? z$ikKB2bxuY*u=Ir&w&Zk*z0Dpd*A<~Xvq}Si|3ht;yX2pOB<+7W%L4-bEiSqN!_+E zL^0}bN9EjUysDa^a4wys^7NPSO0}CU(AUJTKwopE6;Pn`MZ#@iMTx)rpP=;&`dTE3 zdEHHz8+MSqS>_nKWQW-fLQpb!~1b1u%X;c zk|4__Fb#-p--T9D=d>aW$`$oeYGokco>%%B!?yzNdeghG)@@+mCq9m`Ml}fT#HE(h zzh)IQ@M4j1Kz&8`)o4;$ewxbD-=O&UKOpyq|B}Mz|A5lh{~VdmAd+d!I;-AR6=<6P zjGjJ~0n$cE*FoldZGh`6Ic_1vZS+F;StDn(z!9z9IG|dX50l}8MosJL!q~7hI|;xT z-i5w#F96Q5r&o+FNA7+*@elt3W(z%1P>c07vXlqu)li!&q@&e0HdkBHbD6(*66reV z(KsEeH--0yZbj+vsb=N5NlLSmOMb8Q4kF@7aH>RRFJYB30JzZUQup4fs`FP7u>~{!t;%-1tKQB)ES`+k^dDV; zaJ}3`=f+*=kvP(I!fUMF>Ulb&o=?5$8a=H(m~(WxwtblbbwQo4u7LnR!JlAHwrMaI zpdOcI72-712?L$W5AetRoaNwAKeC99wr_*r_AP?p6?pj^y&#z{sO3y#;pKC3$+<37 z!Ex1kn`PrXbEt&l!n#2tL^>AN8}CRUCA@Sv&s+8h-hQjTtl7e~s2BFD1Gjy1iiue@ z4%o2TBw}f-T@~l%8@hS(8wTm_TKMb_(3xismsDtKTBEmfp%wGC&FW%4ak_OgQYyPR z71bOW*1}~-DH)#$8XKEquQxXTII6y}Y4(7f``Q<{{Gb0nF8$`OTs39Q9Xqe`A|f&L z)f*Mpo@;9$AYGU8Sw&%K>4?_A0#{F_=>5P)0hs>$pCkS7H+O3J#wIWgNL+stdP>oc z%HR7U`9J+F^kfP>-Gy{)D(4hc!#VXLGB<;JNo}i?GDOZ+V)J}8C0)0Uay7iwIyUUEOrO;{&AM@J14E`7p+|8xV;Oa2?!BXOtZ?5V`fCwr9yhDjHx7wx3lc z=chwm3iwp2x{CWW%hJ(ZuBfpxropW(rdRap%7ZBPGvs~UWMUEhN2ntS#&e^>6>WU;Expj?qWzW-G|F?IFa%c`-t`G&60 z>Ul$hV9v$0)o*NqdAfQUT2R|IDc;|S)2$JkiK#McV4~&3lw95|G%{*BhIE zG!@-)9m0y>X6C3~TKdw?eD@nn{l)(VK-xCbfA!~AwZ4FcW(;44&~-H5VMhAs$+f7; zg|o;?MFk|buz3xdsl^nX^aF3kTDJkOkSBLi&BnVEts5IDWsQawP=}^2Q{DeK-rN-K z$cY7XG;j7Y_;~`}tQxFVFOA@4=MYw;WkYr?%bOZiBJM~Gt-CQ1Sxcr#{K&r`@gx5N zEzk^DR%nqOAQb@9pZ~wu6Jr?Nz4U$Lr^C-hM>puEnt@-GJpO8zH+?yDF)JQ=883_&|F)%$ zm1n58ax;xh;D)BJ8g7_uFNB6ZsB|w^qO(~{xolQ_AN~mje)<=&uD^@;TR%$jXMUZ; zkN+Cc2S0$Z{YK2)w=0yj%`$oi(0tdrKo`^2_WCrm+V(GOY^>F5m4lv?%zgcffI=6w zZhsPD>>N&h9yjY}qWBt{YEgwh0=Ng&HLImNF*fXMNgWbGpbhxPe|lxs?<=XWv56&c z&MT{RS;}FI940zFf}2}eo)#!Odt4g~Ye_ikN~<_EN@ac)gdn|kYg0$DSnnz&u$Pkg zi>L4wnF$1RwAl1HqGkV{@FzGj_SI#-rhK@8VjQLTmymnmX?0z!2s}bw1pSr!c$H-1+ohap%*2g=QE06nZ1H60Wb1jy82U z)Y;5@;V%Jo%?0$7s_*jT1r)4u0qHDtjB?KV`kM94^O05TUo9+$@9$ZJ*8l_7NM`M;KgFjZzjjIsjd7e;)wz-~TpFHUrdbpR3P( zgW|V8qdx2Eso6vONRH{c=svYn@9m=!NiHkQ*Lu}Cmzjx%=kRJvN)N|(&C@*xIX4an z^tH+=-Yn-Z&%B6pX8)2bs8&^@p$%M>XudK(OL0m)1Cv9;m@RCpg%G4xZ$ghm@f@4% zrPB+Jud&`oB{QQ~SwFNlo}fyE>4HbK4YZ?KpQb?v#pf&r|GvS8qQBv{N_wSw8$4SHllXEWnPrUjf`IBezWae$+F`e$71XWuSwFE=G z?Y$%FH8oosG&aNQ5?H>0z@@R~DAf354Y8S>U-;~p@M&mk224ytFrRa{JpO~{j`n(E za|IRV+0+>bt&|#X2uoeW>_H-uLfdM z@}0+;<=4QX(82~YneiQaNZxjjnsvM|ftQ&=wxEK{`!uxVEq9_>5!~4coD&Dazq?bT zq28x_;wbL8ZxQTkjJ&yt&^X|=qM<>}5p6Lt(M~1y-i$Cz?D0`5XHPNyzy6E5UhaLU zVJ1x&)ahHqz7{2`W#s%UW;_CQO>Sh}1`OY&%AL4?tX4>F-$Y{5x*A$DxDH_~eMkqE z&)(E%s3Qq7lj6H}E6SK=;F&RE-GiVRcz#p3SW6~77w4j)A_n@JMx_s38Db;LMet{m zTT#(ot?Ibt79v9fBz8B}ur#WGI%Ox+goDh@ENMJq*X<#)aSPI}l6mB-0BD0g<*b;m z(a?rghrhA?V{iCI4IN>6fWK^+nvNi>(*v*R|5u6nyPctb2f1*D@AUD2JjBpQ`2* zb7U`^#Pb_6t)m+!(T$K2-FLl{u@tVQW@snou592Tr6gZejm=~P{j zwk>*CJ5>&Bs(pvKYCcOf?~j6glyk z&(2qn5~7w)B3gUS1x-dz5-!gw{O6h1)O3wK@7RQArj>{$68R~0R z5H%!(;NjhZH(f8CI*eGgGbZd*oW|`1JfW9C8DTEcl&Xp+7<#4AO4``%glY3SHEmfH2l8q8whx>A!6fBE9WdN)rmP+8{}GRhtbkK3a#@z+|gQaXfrc~ zph6q)snO6tAgK5nwU16TiDpGf46H>nt&onkSZCvoUw}#(5sjk_G^b4lh>bTpshX8G zD@1FeiH7cDuVzWtAri3}c;h{2HT~$<}QUULbvMASk`!Lq+Kr>9-YMIQrqhv3fBy;{ab7u}S zb8*QiEU@9d-0w~QV#p& zN3c&kzhpU5N(z&gC`?|$wW|vdn=38Xu7otJcz?IFnbdVY&uu8u)^ACDZ_OuE7{rO39Q@ zL+k5Ym}wIrHa#i9B_9!5-7DzymzT*y=T$nR%@q_yP7|tuvR(N8v4ym>d|CZ>JK>!5 zrD>v}t#Y#p5SyVc^_zA5>fa+%SJv1ZzoeSMRXxy|T!^CWT`yRx;?H>cqzsQ=x|B+Rv6VN=E2+RZ;FcS@Iq&OhhF7=mQh3vjC^u}2 z@ZJYfO`D;u8x<;g@=Wt)WFZx8QDfs%(FS@9uG^}X^?GCTkEE8(-w| zfBAK!W0Sn)P6q$UFX8zCjYh;GKB!(kQ=k6iiY=N$ea*&NUW5o5n`?yFIN1#L zY+l~#xmjo-sJxW!x2wTZ?&2hN-Qc&r3I|@q%jeKLyNU0-9xpSEeM~ie(T6__LPM4c zh-#V0MkSoBOirT>Z9?l&6rIwsgUE6TE!nXkQ)H#(jGm?VH-8c~k*&(hWfW2-L^yC> zX$9_R&a8R^4*b;5HO&nQ5F2;qwQFp=pt0#4S`a*`^(s9^fZ8}0Php>W5$Ehd+{@}b zH*IXX`jlSCu447nax|>f>(E>^ig05cBnQ_aGz}vf$1@x2Y#iSWO<%XQC2dlRClP72 zu6pOM<*Me0_S&O0-o!bu)!@mSX-}JC`z9Tp86`2W4%fG(^%fZjfI>&j{z1I_JoDdw zB%}!9I0S4lBcfv;d=%TCI597t2G2tz5@;Q1BI|e1wRsN_|JYV@bJ&F}PPwSGA$3;M zjz4I1r!QS|o_63?WmXCbVT;7kdR3z)gusZ#apIk@_W|_v$~?h6e;99mpnzmgYK17Ktqd1jc}k8ix_NM+drU(3yhAPQTdyK& zQz$wdKCYe%x9scU+-Up80YSwg8o&6FZXUR$dFIphz!|ND!}o8)nVqV zUn29!SDE|z7n%La=a~8HzhLS!f5OZcmA<0mj{6XrPUVH~Dx22z+cDN`s%c9mM~Q7x z{PODL4Em}~q1#gVjGCp5@4WtsG7zL)rTqP`Q2g8<;G8~0`P-jgw($&uIeS+%bQo%< zk~iK4K6gKL*BjLTHz}>hr=rbHyk-Kv0I|_~S7EHKn{D>(#{-8ZXXH5U*@M`}p2eH3 zSv@x@q3LLSN(^u468ynl;`$q*oJS%M-9uqQxe-k?M{IoK0Asj$6CRX4=vx}EKxb16 z=WK5E{AyKw?u#sBm3{GYzX{NgL?@AS51tt`HcPF8g|5^2miGWK_q8t}?Gi-PakgjG z{cUumamUZ&Jn<#W7ru+;Tg~ge{pf=VLDh7Fjy0P}uis8$U>&K|8|hfLmCg-2>E3cZ zJ=<@jbK@@DNCJs~N)egAcGOv@Lu@h%VbND_S@0YPEuS3+bNj7mgX-FJPA)`kDp_AQ zsA=eBb-W!jN`CwTZuQD|_n|f^(HPlYu8e4cu8q4e6CFs;qj32&Mpq}n6F{04R`&p! zrZLd1_H!yz#$BNuG59rD=jYwhFra;YmkqsfOs_$ufse zs{?S)4J&gFebXIk!OtElk;z>f`sLz!`A`Pem8=re(9p1pI zU-~y_riHAQ@n+QE(Asw|nxT^%R+OHZ&;NOtl)dbFMvjB$ss!#jj&|VGBMb9al+giD zofu={lYhXupZhW9zo(MKJMMm<%I znfbzBF!wi~SJ^eFfxVZT!#<)08(dP5>%18MH(vA`(L+yC`2)1Gj+M zwUTl!pQrE_zeDw3aM7i0#}<|BwFDmfzJn`;^Yb zt{_*K2XduVkJuPN0=*T%F;qgb;Wswk)ELrrktOw}*1G#c2e?L6%d?pvzWWA*X%Y4B z3pbJ=xoTthvRc^K)EanME-ES-t@SnGIZcls!r->_<3 z-H1d2ea+Sd%d(Pb;=MyeJNt;Fx-jEObSsLc8KR!29kAL8jC#+I8vXm~T1!{aKYq~asr9c#A|_2bgrNP_a*B(tXuk{dm{;-Jr}kJwyk zV*_f?pI*O>n2*|a7)3naeptp+VS~__w1`+bt|ytwuB;IYjRRth`1%@KR(BAK=y(!l z=C7>D3(y+N)X+77nMj3*zZp+qnR=Lo(#$|WN=dbCES1PXw9kY(v)QX8IKoEdOUN?Lr{?fHxM6#Qp$7VsR<&uZ#pbmpjtk#?{?$oQ4Q!ro+1JJ8DTk^J(THH6r!o8G zN^5v+9Mcfw3vNTvzioR=%~bGQmmvNsprg&syV#CuQhU-m>sH5!#dOLQkCBV7z6R-9 z*6WSU3d$Wji+e^1);k`27a|hD>hGcdUGG5i?I7Lpi%Qg*>LhZ@LtvQ15;{g_H_q&I z=z_IeIcJo8sj+d_g3m=fp#=1-JfyR7@jPRH_@6lcOFv2WJ6}UOHqmW6SoMkDpv$L_ zHLIE<+VT{g)ctQEv8sniI!S!TE>d^iPshCvlYa26biV0bbiLyP41WAqh;GqQ;Jfu5`B$yY|2l3mEz}qA8&3Fk?0`y zuAj!b;a;_l!_Tz*eW)cF8g6@?jjHd%Kf&66{U5{Zo@OO1 za3ZA)8ymfM2xI*)ky~#k{-(DgfNCL&mg@AkNg|5{yrMsIzN$4HFg&M|qpbS*f5q^B z{Xb})dRU5{)nUjYfDx-v(PSZu^yy9Z*`pvOTKB-R4K^%vMr(I4QFBClZ4n#iqH3z0 zSQ^I{S-X=LTK$AdZWhhYY%vFh0nmMIh%96pB9K}%O6S9G2Vm~o-+*Wow_+RB;8E8e#nCz@(&UxMy(DjIq^JFdf0_|r0XDb10$XSKjbvJ?mE9Ik(4u2WX>IJn?~$b zD|r5WX2u&+OxrCXG?GKZ*s0Y>K>FdwGLgdanJlKUlX(RaGxUny=5gkl@p+;{??3+RE0`zM6!zP{J_p7S{x z3dQxd{(J^M@-sNvH1V)BQB#FeD_nhrrfcJwkF0UyCKhdU1Gnk&5idvj#6gpvbMYql zSBen-1Q>tPRGTt~Tg*+;p~n#5!~J{4EXBwy>3j|jjQLrYaaXvu?bLO6**yK-=b9$= zoaEx)7G*4*alFsn6WQMJ;$%l`7bBd~^EGEzA zshsI6Aa~XByVqdX=Q&7Mh7w&ZLpFy^qp?O<;PTm*$G6SG1fPzr6xGxdVF>m##m3g2 zNXM;V7cEeL&MFBu)B>eVZ~?-{S2NZ7uc7Vju^pF3dl_M!7hzmKTlnI>OlN8Bm70}J zFy!S2b_cY-ouhfPFZAu-_Ad+{VgP+Bwo7}K? z8|&SG1qz!eJ}VtCO15pk?67w@wW1iVthxM{6Kn(A8C56|SY)+fWJ4QG4X~Fe*IF2& zs0%YhFrBKilN%9{KkanB7AAad724ArmOtr?7_%oU95|Hw+L(5~6JwHlQ>7Y)ZoUuZ z!|Hq!4!0)htjIZzjQx`-7|JKQ9vAwFlz6$hgQpsJ11cy&$$B!fda_8JB7GN2%cuP^ z#xzZaH(a=C`Cgpo&qw=&>I`8hXWEeBQm3)~4waEN#oEvpANZ-tSZ^9LE;%(lLxk!I z5o5;lzUUuDxxdGXFtr-97P+Ns`?|wZO_+iWq0Tidy!yNBETi%pVYqv8H}}2vRp4ie2h28dN;gg{A3PFLHU* zg^_?o+FnM0+!qOC@?uwRZoU$7``LmAlg~`OQrLrH*{Oh&FEqLJLzAEHvc1E)1TQ^T zij-ST-~@rOJNA(lmJG> z&g9S#v9qiy0WtXBofEl=&I z^es=`CbRYle0%Tt_@)>eacFKnDk5*IEw=SjG-`FkSq!o{7fpH0@Pv;=0Io|tinaA+ zc$dF^V@sO`7OOIDnE=_fbcUOmMbjg!8BUcQazYR^qOhFaiOLq~wLHFQnObDYxb;FWxx|ix+>~TdE>r5Um(=5k|2H^BMgrpn2Ea*mI1YWk?yC zWZOC~g55+=6%Z0WIbPy((<{pcH$bba;nt|7q`pxnZBf6Wg3H9&pibua`!5~`!o4w) ziPx;;{JU%C^w8oc><^?I7A&p{d~BX71@e|1Ji%0qO%5uq&u%d|R#!sK_Y$&0 z5%PUw41!CdWf>h&mR^TjYEhFC*NH~ooll`XB}Di9+ojUque1Vx&%|DEBh z@bs7H4|nCeWQt82DaSij41Nbda6?K+{-zhh%&~g)$kqsQ2yOaf{8|3?qF(CUXFS28 z1qZ(ugmtN90RPucTYs7&Q^ajBJX%mtd{0lBuR*m#>F<^YPf=6|cf*uOu+7e@tr*tn zNdY&P3=N;GhQdui<4RbL`2O`sc{&88`rfkWz8a1)ZcxY(aN`%@NU1k9de^xt%QIXS z%WzDS4T|_-Gg^opm0=P+u1$X7+n8VKLhYA=8ieqM!JrnA3Z!3P?Ig0gP6#YNq<6`q7(W$U9YXNs@1^GTKTGDZG^d=X2zwH$L< zg=ZbH55r`X9=5?NO`FcPNrz_{;lelKu0Yar1$V;}`{hc0=4K|^xd_*!^ZirbSMHJ@ zTpWR|Z4aQ~j8+ochi{IE2Lqs=f@g+T!X<`MYzH%j#Fg~=Z*4T&vz2lLpZ=`k0#orX zDgxsBKbbyc2MdZ?kI7gvg$2XYy|D3TXc-J#*;I40k~Z#{3XauPL&c;-Yel1QtAWwE zm!@7W$rY?kcr zj4WeHqBYRMo4Ka3co16H-`(q|5j}$XOEp~bXJv=gr+y0RbRNg+okBbut{)ce>fAPe z(~Bi;Hsn_?30+}+_ED}8o7cigWmt$J&|l;bZMSqFcjF!{(lgXh=z8)2il>Hzs!@Z4 z1w`+6SeHH+X6Z;TBVcUe9dK<=Tvl13YqySqE*XjA-_Z=bi>-v_wjgmgMs@aIvgD&EkJ4Vu3h>$&dpmt7Z42Zjvgw zY~-Lea-n0X1DD%v!V2bDQghL93>9c^Exj(Z(Fj8TN7nZ{_1|L$& z!?Jah(M;_(6>kFW^LVU-fz+gCn=>{rOhjzF4$%yEW`{P-r9mqgI;X@;TlIxBX^Uh5 z4JSw}a<6S=*!WZ3`BrGR2lR#qCfg|)SN>jYN{Pw{sr{$qr^U-e+?=&ysIC4l>G$&* zhw~Gk2Q`sqfW73{1%sA&a`&~@N&j?ko;z~DQa2Iwv7Mdw)YkJ%KUt*3n1^?lT9F7k zNJC0j=+UL4#eL-U86Q``K-oR<&?E>~RsG~p`WxLZwk!(HhOh5!HAj^SbRp^5%eiBp z82ASYXgN~?6<|HwKY(6hLZQmrzDU=x!V(X21OtoL16Mg{?z6I_OXmXwUt-x=g25I) zzHw#eC!C0nN2z!E5P@#-%41|}za^^ZqgLzQchouIXTkrMU>n@EHj+G)M741ezKsG?Nx%e0Js;ChHpDHNbY!~dy5 z3ci+(u#ooWTn$uSbg!Mba|3MGW61zg;gy&vH$*#wn|Ck0i?-CQ?;E40rHG029iIqW z({2bNJPlpn%X&tRpwaS|MdA`Z(w(DS8V#KgpV9ZRnyLbI!Mq<4L63<~yIrC~>BhIh zl<$s$ZH1DiWSm`SojD9%Nr7k1<_s^lm|dXvpYX6<38%nNWwf4bw7_#REkf>Hkn8(D zb1JJb-^Q%EF~Drkoi@li;Qk^TX<4WOYxgrXz7Nq_+Z_?hbmH?Re!UPxP59n%3u~`r zD~lGdllRAu?@m$IMY7jXDgq?@nik9ZL%-5@$9|P@pwXw$ygj^4U0h!`5MxU?e$hzg{e=%!CPs)OXddvnR;<|DAnF#@ zg6@|Z{-=6!%fGs!LklL)PJs3=mZFI4=l|Ky_rvP!vU9sF0Br^U2WfyN3X}UbEHd1Cg_0ifI@0jT!TJ zWs4#IjbuvhtFkvqfCsQgE=0dK9l3VcfSGT%C~-%Qk=`8_hwK$FE^d${UFT)s(Ql^O z$GLZZGkN~rM@ZZY?9aV7?Z4k1Mk*Y9dS~V-=z5Jl;joOg`ki>GdR=E@K`bjkjCjiW z>tWSbDt!VsFLO!?wXJRmU25o|cul#gO z87G1UQ^JmD!e&U561QHD!luQ@U0N9tIe^f~r)n)`ECzN2|I`A^WRa6?aR?{r^xC!r zW|3mGOvQQ>tj5y*FCcj=E%TcQ8P$RB9NEM5#xXvzXd($uh1jn-9e%u6PIVNM zM7`l*SY-Fi9*dJ-78VGE?Q)gT%xQ#1@$%F#XQGkn@TFN1W+Z2JRo=*YoLT!qNcfE` zwNu+t&@)>(aRSOJ^A`rGf9N!~zyaBJUN_#fz;6qFLPpKSov^Qwvg1OKU%|z_VcSW6 zcFB)BES1s3gvwo-$xj|8OEMz&-u9ooWQItvIePt`TScn3iSlgw&mrD1CFsmTtxc!3 zZ`Rp)lXj&7f#4v-x9M0noahd3$#Wo$KoCli>Oqk4#hL=hG{L{9x6KC(S#p?x9MI5S z|3BhNw;o{ZM(1d=m3Ly~4yI1^A+Sj}IZ}}b*+42VEvsNTc~50N&5xL6SFbxEQT`fc z+nut)ibuYLI_2Mo`K2#*|9h{~eLnf6?DJfr6668ZbFXL$4>o6Oa)SLX?Crf_*nqM} zoc_@2i9!XQK7mQ?WGyDq|3j%y?qV9R`&OkL&yez`WMc+bs3e-zdN3}DXx7MMwDsk? zIt|+EXf{~WD!nkWX!=KmpkDFY--$`xPrAqLd|R@>Xxf%LnlZj#NRfE7_0WMIhn*GmYb0tN)EUV-@HtdkH4oc#d58RC7~h_0o}D zx&>OZe6Sc(zt2R^K$9rqJ)8Iu^~&xzhg3X~D>e0N>0cik8x@rTl$rEK z;b@SDSRM~d`x0uKW^^~mrf(lZBx7eV$TkQgCv|0N4B_f_2sS!97W%aAA%kjd4Sk|q zq(wXZ=LOE*b_QkgZKwHYXU}46XNw_!b}R2Y{Hq~&2`b?AyN2A7y&kU5-?$$?KVyJh zhHp89FkTN)^~lP``@PP@QmPjvf2NF@#!hwrv*wFfsSrGAQi_g-E`)fvs%Ii2d163?1D@tGW{P!Z-bbn^6Q7iS}tUPt{*uBhHi z2-LH6DgoEbO$;}@=q;#b&6L?qs$F6;060!a+p%6RS^kArE2+8qGEl;S()qS`G{P81 zWnn)nwLV_eOXmrs0sIu0OJP0+j}`?iJ;Toh2ErHb_Re2Y+>1j88s*xZN(@y)*&5yJD1&V%=WN?p*+sq>&VeL55vqegf93zPiffHo z!`sz5wh&`Qn>*fG^+NhXL&h&8NMpAIKhDi?_iF{UeI(i{*{-A(7&irA{NKRT>MT-C2g1)5%a>Fow za#mr>5ub`?8m`FZ`2xP-!&0We&O#Pr+oM-nI!RDWlXoMp!n#Bc#zjM#z+IPgyVGbw09zacbBef(J z(wE5HGXIQ2VMI=@{A+1&W@o_NAblv23%1b_2hFIM&tvg%xCQKvr4X`-o3El&!4hOt zoZ1y@8MvE5It)V|)8(MI@3gp8%MEe-N127(M-1|7%4$@$Nm<&hzZWKT_zVrr2njK) zH2PX3x@>lxUKkovevXcL86*tpI3)Vu)>qW_oF20NMbiEcR!EoJ`&J8*0S8%E`A+wY zxfxo{1e`7-SEdHbxA%*`_x2r_jWn8e{uL$j@tP~&@Q7C(;Uee7tUqs~3&Ny2~T z&!4)!+tHPE!(g9raPH>?cM4sdP~8lwf8?GHGH{pScQegwez}@EhkNi6xqa`9Av{FCl^lBX0sr@& zY&VQQc%C?X<2t5^xT{AB=F_6CZIB<`%<@f*o^w}qq5Uwmep-Rk9sT2xRT-IQ(lP3G zE|45z@OuL#bzdJOkw1Mf&f2Wn+ARoFcH`ybdS4A6iqICowi5w5Rx!0E;N zHFVOhu%;H0)E7}4Ub9;FS76aw`z}^}N_|S{YwDF}wIYom@v)s$o2vT!@l0$&0VVbE z;6C?A?0ains#W=WK@k{#{stlzBD5nNaVnqs@|A>ZP4@T@AL5cB0uuCln!U0E`I(h= z>KYjADk~m+S!DvY{Pz>W3K&4XuKMJTP6p6Z%8slfZ}cLWr0mO!5YXgl1cQi`{}g$P zDP+!%^>q{OsqowqWgDRdiR0^bb`>wyq7u!(^diqBS~g-20Gfw~0@|4V?Ccr`z`Wy3 zDSLSv=*S(G4KC(7-HgoZvP^SW4(_>{{rN+)Jtl{rH7)y|be728E-ZHCBa`FGCwLNK zgrl;Ta}_<*xNLVu%r2`R(eb#$$s|`;VNe~^d`n@of-X&ZFA@Q5bgT>|aT`*&1xtQ` zwL!g*q@w(p&ESBiq}V0HW}TT-$JZD^=Y03BI?!=z?c2m6C2usN?R!K4AT1%`U@V}% zcg2kSX??vgFL{g%pKhVE&SJA-c|~mU@u3V}+I4UZd^;!$0$x>apSa1|R{yYdJIC8k z?U=kgQ44kZ#gO}gkj^1uS(PAIP5d>0^P;5|<= z;nG76u2;fLG~hjy>6&bWH=WeIa1#CQMCo%xaePhm)$0yEI?#icUkV+Kk4Y9BTS1y1 zyZ_0qpt;f1X%t><=(?~n>Xuiy{7BHCIvAR5n>&OLvKH?2Y<&;7Mini^H*2{}r9V>b zY5_9;K+{r0E;wkV$;f*1hwJWSxw*R6!xKswOl1Z+h3oygu1})=_cNFt-@R6Lm|Ok1 znet>t=ul1`+xLW#1)Git(AW|mUqJ&?HCi&&*53S%6I@pG`T*hNEwLa_H2-+vm^ps@ zHVHjP4&s0X?vUBG$DV4loRw}D)Pz6>)P-Vl^p^%|mU3dMLzB&gUO~xZgkg zKABwgwN6degidF;!hvH#v48cebsFMOKw7>0xOmVFF9yV{S*^39J(04jm)P)+m~}KL zNhh7u@KXiB?`x7OcrI!JsMFobJ$H|@Qy@^HsVloq1$c9hRo5Hb2t;I zwsNI0LxS`EOkvQe=ZLM|EIllwKbxj|{`)fX%=(D>tX>dsJ#itK-2wp z#P54BeLz5}3qKk)tx|quug`~f0LdB)eI073Ir19C>TYebv%3CjSbga7n1AkQ^L}Vp z@mLpQqb1@>kO__^UX(u5q`g@t7g%#2K*Sc%y{aNiBDTe z>9?KOCG+;V}9Qm;F(WDJ6XB z!LmQ*oSj_nmGv+)sF946nf11fR=!W98{Mo3e-!!7lp)xy z8=4O_KMM3F?oWGGe2MqZzH{6QM}eX1+7bf4Rg6CP6|n3^?LQ!*=-)GDq8{|r_BPC5 z&mt%nV8Ve?W7nAT3tGXwnQ9=Z`3Ze<^CAHbpMg*<4DWMHZ(UJ+ftgWed;1OBkdqOY z!UMB`1h>l7s1$`KL5o0h&Bq}V7;Hdr`Dt*^`mYl!a`z#8)(rMRVeCu60CeiX{A)dt zwvKP@#K&^MWWtIKK-91W|3l)_#PG&>NlK zvG_%bao?wIQLr@|v=n?+al;$*d(Aok&vNnVZeGF~V5`jhS{)?GHmBy!lG{#4*oWWY zuv5Dws+R$fV71@oHz=noDDA|Tloszwd29Laz9|RIJDTG}(jO-!#f`EEb0Bob*C|yM zwd?sWeJIRZK6kM~6(ALPvEyHm;m>bWEvSD!x0X0PZ+BeQn?L<}sF1W>$*-_HJ6j&} zw{<=tMh<~eYqyC6ty=v(W#5PNR%xOu4Q z&$weh#**%CKLO|aA>kWsjsDrKGN((9KzYpk(qev5|LTq=W1Nd}ckc_|unP&sBu0j? za}xw7;K<9_@K@A6GImef>pmi!h60(_=-}ca7sNGx#XZ+vOmh8^v4AIc%Flnz=b#lX zBw?7`k0U6_`QVmgPCe{gsCo9j>ciVJF1L&3xCwPz17kB?aZFHHjRU?fqC?2Y6u@4O;F zg~~`VCWlBmawxn~H(J^!RiaBumhF&s1sB-g;j5il0gA(#yC$`w7vr=a+On)1UOKW+ zP-Tjp<5#q}mgE%PGPf^j3j&tj)%{<(aUhG9H(ia^Suckb3lxTyB@(u}om^`Pryk`z zvYhL^A{U=vhK?J@IGd+v(0YKCyEW0-KV-+O{ZCT%kAXv$l(=XM@S+52>oQqP=`~yx zPWD2>0Gr@*wt0bUe&Mo%X42>FTU7zFA}2rewCQ~CEwJt1RJ@xEr@c^W%&wSSJ+$Mc zGL!$-8vea3G+2JQSL7k^F~=3wX-E{Yh7)%Zu>Yfu{n5Lt?zjKbL+eIOav}?fZ@w`M z*3`c5ET-1j+?nv)Ab-XkM-PpS3%9j_g($3PhoIMe%qtBgir=e8Jx*L*x3v%MIn~0! zlHphF8>eEDw&?so(EmMst6sqgME=t^(QJ?%(%|0837DU?eA@CBXG3PVqb8py(t)*M z*st`k8H83Q$D;6ce>|J!coUpVI!SyfB^Du*$wTXam)hcprXwwh1$uKXv_tFGo_(*h z=k(erfo@5ozyNfxF>M{E8&XDEO#?}i4rvG#%9@=$9DG2_9%XQT&}O41T8GuOfUFEr z4b!P$@7@nyw#-X6|d)-8o|Gcwl869a)ub*3BQJNx=C(t zc`6`~$Es z$%tc4K3ZvNciYc3G=ea-8a+C;qcKSIb%DPy80qZHe0T}ncURZl`G7@OtAeci@!WW) zCEQS(e1O;o5Ikuv%FYUR3)vt8E4N`SnAUPrDB9W^1lf7oT3q1F4BRwpI)i zu_IJMR$#n!%_H}7D?1qtXZXEf08npuNw~<3_=GTDK274-(QpoI>Z(nHR01Gx@XVkA zJfG3M?FTRnHt`acJY8ShRC09!$0Lm%v3LD>6AvFVTfs0Pxk>}U%~2y(%DaY z!`&!y6Hv##wjGg1Ke}wm6ubEteX5XJ7kn7^te8^E+miy*DGdN7sX`g&nJ(U_LA-&W z50Gm#l9ZN#v-i%iD9Z9@;j)t~*9Sm~yRiDUsc7Y*Laxy;-uz78XUKT5NUbg;DI6>; z+ES|r?9DBQUa>xdJ$X0TB>5)If)ha_Vw z3W}n_V?JK-mE!P$h>dI5N(e@yVT|R^9T&Z*H93ZLl>HAkJhkBgm{j(x>9e!PHr7mD z#o&i%<-C*NN%bcBvK3B4-Esu9Dly;$GzIcvBt! z>+v-i7k_NL&Fy_>KhKXZ{wtM7SR|slI|C1lq3D;TxnEMGlyC2q#6zQ%YZWA|I8_y7 zp1sP^UZP{y=VgTpgQJ6}KEOL@RWtFsDP$Euo28G=c~|ObBt&$jaT0vqtHf3{)Y?E; zcd^8CFvd(O=U0VZfBYS#?&28m%s$EV_9Nl1?|`)IDohz_ET5);bxT|vnm0@p~6n*ILhxu7N)cv$by5XY9ms~zf=evt*ERwks@^Z}YGTyZ; zQ{URsy_l z-M8U|`Y#PfUsseWUPr=tT6*6q!eL8gTh-EfUkLi!!#7@h zC!pK@hgwfHHLH00+3!XqT(_$#U-7%Udg#TW#vyz))(Vg5lhzIsykYAM!W%9jxoT5k zWe56JY>$r){sWLp_1o3o$rdn+se->nWaY!+X|LyX~!#I~JeCnx9=FN*qz~gqjtHqCxiEd!>Bz$``P?D|yKH>*F zeAv1YcfZ?8+l@CTKCNC4J1ckv7bhBblWvNh10)8jkA2I@JkIb3<^KEonF57|_l(k+pz=|U=IxlR?z}saA9;JzU-21omvBiSg5y|{ z7k`y1oKeA^nkwWfclBa!On|;77e&6%GX1DDyeQVlRZTA!g9<{x3jLwdIMSdO(S>-7 znGr4<_J)FH4N5Q8tle?SHahIV5C3O{YHN~^GP%YI=5Y65Mq4nHM+jFQIFD8_Nf9bC zj;K5jaTLuNy8V>;!k@a>NhM`>*2*!3=KG~!R}-xs;nxT836p&(9h<-@Rrwg>gbqM- zT@MTVu9(0gS00(3^N|0yhyQkUvt56itAuUs<9LFU(l4)Q0hwM?ND(dEDKD>@qyum> z(ZzTIr!C!iZ0hgmR7wjtRe)D^nss}{kf6S7%~n+Bw$mN{oNptu=SJ6KTbaY%Dds}f zuiE;^$;&woTw!M}JihR6(qw(qfvbX3*P-w8SM9z)oF_k3_Qb=NR<)J6C=O)WD5B8%jv)nhmXi|<4LEt|& zEPMcRBSwL$*Fn4EsXxuwQR$6CY*6iF_tbZqNgAer2K#=73dXLP6AM!$&|(AtRSr+#!ztZS|3ir*Rax>z<|gk0b5Pt^XDVIL`Ze`jg%;VjZtES@4&aA+&kac`d+ zViQ0Z(B(@^wHU#S4_s1L4%swRDN@%+jnSpnTbcUJH}#U`zFkq6R8kH<4$ya#B9S+9 zLH%HY*|q-d3=-J+ciS4eCf#Vzq3;G{Tr5TZ$m$F~#18&R$R^(J^-QF0p;nA$zv0Qi zn*CgtG)yWS1Uja1CY5T#aImJ<&)IHCr#)MJQS|MeV^lG*-2dxqsd{Gh`iDV*%NzyE zh4h1{;oRB=Q59^rO%!bpXm*@mAgoz(3%}drZr2Me5EU-omlMI3l(ok7Nw=OAL#MHLEIG)B!R5>OCdVeZ)JZW4Yb*|ts7zuyVId*az3xgoGk8)U z!M9#d6L@y;`(%qGuiL=NQvc<2!9u=z;jxpp=-bBm9x%lpyYZ@$-g=(I3B(F6dn&0U z$>mU2rr4e=C+6lG--t3s|xUFC9Tn$`)RdxoXX4FNM>a&kTe7q4q zDRAGyX0f09S0cN2QS84-e+o3Dg~Et^!3x%HZwX9uu5zU1{J?sXRUC}@;W^R7?3%7y z%pMvO#|kWgZHIjS;yRaqrptE9QWJHF2gXrEipQR(nP);5(C{RH*RK0nay7BMaCZY( z@4*XAt07W z{l<7VRdNZ1aN3#qDw~Sm>)KDl>ltL)h{UjUKLMqsyN#9|j5RfYub@J(P?n6^viL*d z;Q2dS*iLS#j^0Uj*4-nIEJH zL*!ZkGo>4b3;AeO4KUmN9b`@fp;l$VU&9==CUMzrQ|p%I%~i>*l;U&MPfY02Cy^?M z*lzs@r7be_uY@IN!$W^Y1)hA7#2IB?quX649Gn0ONm0Ni@4bZzd)jTPIWPdXtbQ!I zD*R@6iY^HV(*aXrRs|a)0-Cn2W{jG&CUt}v46avZDM412{9qfA4@*&e&Rlj{KU9jB zX49Pep)_VkHzi=Qt&+3T|E{ISAH(x>MXt1wJ!r&A+<7xNYTWHiHi%H@U-~2;cFOYA z%BzfUiP`@0^&*OHOK|M(@z}EOhuIJpZ$YrTQ$(&!T-rS`aSm3;nrO9z7$?dLDf>)DryVVQ?y3Y!is&7-6n! zBxJzT7BO}mz-}~)L^mK0ll6JlG8(FlWOlOJH3fb35e{m~?e)r!u zgG(53n$*Wzo;*?T#g>fEOXp+MwKgrgYN^!vg=b&ML-thQG0cnv24Izq zrwDSzEK^;Q+Pe2pW&7K{*Rzdc<*qQL?bu4D`{|GjcCV5Mca~vq08LH;*7==W)qP7m z3XEGC(y+N^5wz^E+CA^6szyTdJSe5@Zl;zS@Go_jZrM8%Unh*8Y#RCnYHfB@7dZC_ zFR*6a-z`{z4nu)Giu-<|2>LrF2dSq+C6CM1SAgVMFqx{_>5so7g{IL*TGrn>sbN#Z z+NLUTvA4TKvud9=tc!J!)g>KhaYlKXB!fb}quIkkt*uCf5-pDH8S7nAwm@(a0O>R*_ywJ;ut4Hxykk-gwYg`i%7x`MllN}kmbx$AEYxwJ zSX&H3PVet(JUw7~00>t53ARdwT6qPt1A)DDm{f)N+N2n4WoM$3Wv0{9j36YFSQ}G0T3`Q|~ou{T6ZQ0pCeeEfXkiwFsBu|Nwj(tRp3f@3Wtplr3APS<%p#GD@;%)&J zD7&Gc0ctw|(B7DyQ~YFoQUWTD*A-2eqNX&EOXz9_$l}hXnOAabVCFoZa(e61chYD z1B@jtQq#Hbq9#%l+P^S+-kJu=PB1MT9orNauO=0+$g+^ccPnCE!k|40Z?1_b6*%5Z zi5mOGq42nTjh6AwUG3jM^xWk-+8&}2q zYanKTKj74~Z6Oh^m`QKmE)aN?QZgUcM_m_D&JeO`OG-Q zw2NHd-_n*S+hNhFx;2e-$F&(*@jjPq)+_E#kp`y5Rs`HeFG~X*cIE|Z)jGh&!vd|= z3pWb>b>G1JUG*Uw*~mqG&I&m%%{+#YXw-yLW=huTGjTiia_4 zKLImj_cv3Evle+9ei9_M3~8uI*p2j`KK6dSQym&%zQSQ67Bl$V`v3W-zjs>Ve{B(_UIIG0qkU(Vng356TAeW4_Zrj@7+fG&{{^G>oH8qE~_QIIAl z1}e8ki-{H7*`|K!XA*Fi;Rfo!csMaH>NLwA@PQn|=}*CPouE5cvZv%>{7feEO&#f= z`ic=(LJ(BBaqnNgE9BNPd?0?1835|&HdOt_kb^YPFA4k4+#>j)+IL7E8xR-SPvX+d zlj_!o>bGG~0(%i41Vc%scA->QW-WO)u~*F9kbG!Ym^AUoHT^=0`4h|%w)WRYifU^$ z`l9R`pcezokhMkGgGVT4TYx4jyT>EuV40%abbt8Jf64cQi@V}8mo%SbpHWKBbY+XN zO!Dd7hXdmpySkbr09?S_Xo^DSr#$hdnA90icNUo$bnD`R24Xl$( znGFis1P-S~ut2Sg{J5pLUsY||1P^&n@X=KkYNKpKI0d10glIs7nE%i_iI>Kg_wFA& z>b{%f6NhU2sB40o4>FU^N-aGKLDmtgauW_8e3wq^Ofo77^cXGM5Qq#iI?HO}HRH3i$e%$C(+%4I%zPLVL@R}wiI`6jgk_-(J(XR(*NxNco(qqlH zKvbhPd=LV@0nf*5{!-xg8@RTQUJhsD$MHmP&uzq}?>+ZXsp6APaiRl#rj<^uJ$ShH~K0nCb8bg zPE=XO)QWe#1pdC2#EzHR**}DGwo;0L!=Q6nyWCWOLfo~cYLk-HSvMISk4(fKLEkFw=CiZZ|cC!5#9J(|cFrh@1b$3!@loMKv;c$h8-MB4Itv)&_ z&aLvdzgz4C?HtW2`LxgHv$I3<-;EYdx*28HOG;)*RIldf%-J4~er%$;BuTtFN;B#M zD+bZ4RrY&1lTJjt^Ub8X@-${k%M@0o)d=vxcMc~X^Qy1ugwltRGg&jAP0OhD(X_Qz z=>oQL*}dfT1cno=yY4Jq)Joh)I|%nCiZGb>Xqy>CxMNpW58`w+*2R!*V@j*9Z^fI-{lK<(Ze3zvPO0#4t%b{8f}2aicG6OS@60yh zmuL1jH-+ebNNwgHFle!Q46Db|W=X2)@N>g-6(ms=fCdnmcLARmBc+6L5Q&wW3bjKI zY}Bh2`~lYrtD{k_rT@~q{6}j1#ZIF8*!!|eURvGYm{SxtL*Ccm~! zpG-+@vkV!Mr5=iuXsyftQ|M5$zV5owV{{{PvY9-mfG@8J$~5ggF)=AVR!<}Hd%J9*czzU{AIb=8qW#|x=T@6@fnL0$@y3cy$yIt#$qN*7a*@Th~g z%5Yjh(mjBxA zv{gk#`)}-%ry538pJ&+po(1`S*?jJuFiehpJBH2nG0uu}f;a`D7SIT2Ad-9Er(2{v z-d6c3xr(eue>-i25nDwggZ_+;Y9gse@ECgPsz^Ra|!J zL%XKZY0k-qhrN>z;&WgdOCc!_sWuP!geGLQj0pgWJb;}`?62jA4+mM)xoKR6MO7z0 zS{Xx7R){*~Gvft(_C=XQC;E6=Oj;O1SX1B3)5rDCB(hw@WY2lhs%Bn>hBA!S8a~ru zl%7|v=f@QbkjhmgEGiHPlw*|TidLDRwREP9e-7~yYR^9@co9#=iikhdRTlpWkVfD? zR_P&FN3YkDl^y*I#oO25mb4H48X9EcbR5X}?!v0=lzJK-4suI$Q%xq-M!sAU=#@-m z43CnG3D@a?w$v3?d*&s;eOoXX>+r(`BLzdNhrC)%~sN3<%?Dx|XJ z2TSW`YJQ*I-3W6szo)uym6b7?11zTAwx)*!RarMb(57(wEsl3S$#$uPn*e0sXNzIdPZfq+E17OY2~F75^YSjjR>h=aJ(!Esiytt`+Ek>#7d9zdiO1s!j@p znj8d76{{n7XYq{xgk#nPmIk$;uF31Aq3Fp+%0w2Z5@*2aRrudDa~_5CUAe9|jd+vS zO?j2ratCsKpxxFc&@KP&B{gQz+FBf30uJ@o{&{i~R3+iV zzXZkvx1Ad+4!7#I14k{TY$VG`+RY89umGAk))KmrxVa(Dq-~;@$q!1Bj|5_aCAk48 zk)XhZe^W(<6VACS$hBB-JKcpv4nWZcWhL@Z=%$D*S2SN0;`t)H>Yqs!3T)DWGe6aN z2$(HP>*%JRF}nTnPl4yFnDS4Z@8Qva7K}Ab)S7Bb3*DTZ8Wa3**nM-Z3q)2Fpj9{%r~!wEgD#zF>)2J2 zaDjSfW`p8xrPmfo`?v{25n*!9YVHIRt1`aPH8_WN!8Rcqn@7LzdB(@0ETqodU|HbD-Isd4m@I_BF}2~sh^TL017 z3bm0^xoqVs3kQTuGSJaXmsvx|cAJjtms$u|y2&P=Ff zJas}c=R1YvN>C`Pa}#V=B5EKdyy&9|YkR=)4^g&7gV3m?lx;n)M`*RL@FaZafXAPI*X8R^7x={QPw~kwXPKFoXu1YS`a9d- zhF6Yf`FH>IIGL=?#EjDW=-SdoYv(3kXH#eUTz{@!tzgd4u@cYkpF;?E$D3;Cc_MD` zpZ?7*-u}iRJP-c+C(kl5RiUrP;=ONOnK{wlhuX3+N&PE#uz~5pPrWd%h7}bippP{`S)584r=*^SdL*udry)J0L1PnI zK2J7$C~GO7R^!;Ac0pLNC8&*aUeV|xw>+qjo(3g7ujUlB?>@B7K4q~R=w;eQY<$zxy+D;wrbO&^{4@-^l4MpqCiq1 zL`~?N&n#$Co0T^?0W@$3qkX<_&j%W6JDE|OBl1LXqc zr@jJC6)oKxhIKlASf{L%z}J!mA+*AZhNcqkxkGIkf&>&rGtsfcJV92=A@Uj+L#(7k zx)*${kw|tS3^N=oTc)-^)EhCC_CQJ~M>^GS{J+_n$@H-o)jua*X6EGnw)HhoLu`To z!x|N>`Jgc{4yYG+n{|!-mD;F}P8ac{Y8JXv3kN=lsKM5?X)IHt>>d?4*Z|KF^yz^b~i$<8khJ*At9QtNY*=f9(bCedqUi!+Rd*lRkoSHT9KmstM&= zZs=n5;KFCMVQ75fpKalvesn|l*^hl_J&`sunf^XiEUL49O)YX^XkaOVw|85VH{Y53 zJJ$nU%X+=BX`_tc?U*}m1|;Qge|CXeQegG04=E~B=(5y+5)}-D&19NH-zxB2gzv%? z3<~Q@q`E=V!KpU1x)s4d#I_e`7mVTEpy|l$6z;?b?q!7-=QS`wL zShu}#;TKF(=|oyku%zdOsE)WoN3?Qgn%wAFq+6r^gmknzolQVPGuCZG#1d%9PSxB1 z_OWN1YHegG7Y@_|8d|s>pN^*IGazNCBdISV8YkgzPkw9!*KYl=4`^uG&}ORs?0P+7 zR;W|>CBtQDA zSU29Mmhs9Hc>eE$#-?T*(Awc;L9ncU9e8s!s^)UPZ&qeJh4j%Q*GB}siE~gXBFzY8 zG(ga?W(!>#cG9(JH?f{Ugc+gKy#|Rulj@$;x7~`lWv|-TQwJ2yE})@Bi0LTkKfKWsJCtq{l+mJph6B2cfdsR_~-ez)e1R`3jn)Yj)l z;vhX`^5NK_CAASxE~~GRQZna{=eqm>ZroBY!)Az$?ReoJy-{NW%R8zyszTXec3wS; z*7n64zLcYu&bGB_Vi8@XmtW2`z1J4k$uT98*EP6zhv3GI8k+_L5yQomP|<70v@Bvc zUM-Yzah2-O7hTtQ`JCii2PKC_R8toqHpPmA=g9?*Xd^S~I9<0&ghKhQgrGO29I{R~ zL2b_Y;fU*cYbFAkPz_(u7@ZoEWbz(gc*^7RPkK!H%}S78)2QloHp^A6Bzf|<#}mg@ z<6;?b;|9S)y9IY`Q^B7V8y-I}M?*62+uL2SlmCG$l% zKOy=Z62*K4*YzkBs}0ebpmuDC z;5q7iUYcr*&*_Qvy_T9x~?&} zx`VrJ?_u?j8uVAn4xjp3Hq2*fRYy+Db9O|XpqCD28q&~$+P=X;2pF4ona#R<{X63n ziarf9q1Ih3S8!|(*Mq7p`OFtDQY>DXV({=m-f8c8b7K@n2*F3*w~pWacYFB7 zf4Z5sJ=DG?^6y&(1_H2@iuMn+UTE}31500q;qQZo>dT30S2HPpsF^f)*+ zBA%>KnHrSq&wlHxwjeYebNfCte}EsOUUz4GA4J{d9iq3wdVIrhUM98KCy;$!m zjHpjZ^AWp-`%@|6O{;CzS8c8dr40>DtG&Ql($W0c{eZ?Kgh0;Es%Akq5gmQlJ_?vO zx{!eGRk6!UEh}499~|qjlDh zisaUt=-zTYU7PpNwP`n<8+X#VVF#V-wlBN>LPc2tYXZ{#<0?dKn#^|uZeLML$Ixr% zUx?a3z18*KsHBu!@@LGuQ&zaIjmk7Mwyx>GGBs?+34(56eO?s1Khpq1<7b_ zpqcT5C$)HI_*vdl&yifA@nlL(Ut>^pBo}<7px*#zPl|dw>YS4?w~HyP|v4d8}87;4H}4f}98hjwrXjd{yC4x!*VVacbxk;4?HW09S;v#A z(F*8yodIIggwoZh>H}pDpRa{{F0P{&B#sM}ii3{JeK*FJd`Hs+KlSc3`?g0Iy)e(& z6EobhBhpfM9kB$x{&5>^(%4+|8__i_<^!daymWAmLW@EDg>i?uc@N7JY#(mj*Z|yr zb3Bw;rsD91T^{%BR64Gcqww4b|5$l0W795=JiB~H`8VIJy}M7GDTFyR`x-PhiI~QQ z)$0B|a;C!b`_+Z}>z}xeANqirc)aK44!-<2Lr_hH?pHf6N04>sj)$! zHi1pDzGib%s8N>kp&mzHvrR2i(}>*hCbbQ{t3oYGXeQ8TIbkqo_Z7jKPAMOvVWpYz zPy`=XKD$$wm1XYCINr<{Xga1Jx(G^eZ(gTF#xOL9-7lpzgGTeT3a0W~Y``2!ZS z+I#>cgdpW-+*EUO4aNEZ?${YXB0Brg66sJ+5TG^7Iisn458T==hV(8k&}DTGDFM8# zniw;g#?jP+D?8V`0d2TXnudA({a{#V<-AIUH%w%uq#9P1M{J<(dd({OWIzklR_KPd zWcz#vGcPxbmz`D)cnIu77gn;9SkKa?OK2Kqs++OYHu8g8DR!@AcD{lzEsPC20I*LT zRE;8pp|=b7r!SSh%N$nl59ckXtJ|r8$IhN z7$a9~yxdv?s&i>pH4r`%m6Ky|_+qUQ&6n&Dt#LdJiD1X-rL*{}yHq%3J*6zDi_>Zy z>9`6})pd={YdRS0Rvn9Jh;Y9y`;Uo)?=m*jMayS*Pg0>+6{luDy|~UzN)C=F>*AqK zl{ItydTohrCu*tY#xhjHyt-cy3`sOiXErY|bVUISwy85fY?kj&!-)ke$hZbx79)blg^ z{J%cLFa5uVn&ucCJfYqNJ2zQvxrlXl=zQX%-F)o*o&3%(^z-1Y3GUsa^Aiv2^w!Ny z-gUjY(ZBq?Jegc`GnHK4;k!@xcK1<@XexmOhF6*Nq#HkDc5YP5e&I-w@yQB?A-Ln_ z9xhC%_3YUarMEjmZ+C>ZJgA=YU;ECL2Pg-o0dIeJZ~-Fs54E<|AvX2lod1yP^~Poe zWo*3xW8+TnT*}}6Y>nbISR1s7L|Sp-JvS8615|t)-bkto%^yT)Wi?W83@a4yF0Pt^ zz#<8zQ=JV59f1SF_^M!#Vo& zf`(D%W|8@f$~b5I!yVruIqp#j_RXplBUmws_2Xw~$OQPa5rc?&T0oSUr@jS`sbj{v5(5fw0 z9SMtWpOQ5)QD}N^zj9GIgGEfZapS_Qk#g0gYI_I)9mxnC>$VXY*u<=@Mu54J-EhEJ zD%TL35r1ZW`zpb{VYTd&V~{PW{m7S`u(7E)8i|NXrC(e^2sRJYC}s8g6VT9x`<7;< z1hsikeO`9JG9l?dMjP2Y*O#V=&_tk-&Sq>*^3vI0AK|X;8mSic#HpB~r6DEBxS;B( z>o!wT|K77s5RcS;epozAozV>WZ*S{;p5^LjPMKa?{_*S=QY+gK&0pQ4q9N&1fvHRzKKfh-0 z*7j%SuiFsewmmV7y2f*;TkunF)VXtqV9y4@TW^c7X^ly_D*5cUn(GZ8`Thizs>g

xiGqd?$)of zBLxl}ombY}5C7oO%T`ibHzu(x4bu<|y-r1Yy%v`cg6IS92P=X*HbUja?*TO$TJW73 z9Y;NUq?DBXL4TyvrUVTQ|m1y@%L7Fm{zF~w=HP0}`Ln-r2Z*tmfvUxN)fjsuOI*iIZf zCRws2S(aqsm9BJ|4>N4WMf3YH=Ui)T-sgf$XFQJ{N$2dd_gZT&c*lIl7;ikzerM!h zn(fCF3rIa9(8GN8$+?$2(!KWlF+%o4i&jS(7;(%J?3Zj+S17Il*S#5Kn}4#Xg1OkcU{5yK&)2O;IeoHEJjd z*;o7E5dIped!*^ClZ~L!BztF@C4wODtg8w^Fa{;j5XoVVL!nT=kfjBOd3WhMQ^O}-w3#| z&z0A~dY0nF3zV(U_W=7x+9T0j5rRUIk+apj59zWW>jgi0A}qAQ3&&$qd&_MIk-XL! z1|Ggi!f-e9_WaYcmNU;sL_FtnI&ME0Ks4N%FcZ@FyQ#+30rq~fEaB+6O5LXD)^tTt zLE@@$>b$%7`H}xOfo!hwT+8GwOw2Jda9s<3O*>E(g8QzM@$Oq?D2jw1etQ&z052RX z;@os?i>` z7NJX2PHYNUEw@_r0WG z1j@GS+3U}}0&0{&sqGLOxsD7C02|6F$$%JY*dkp`<#T1sI*D11-2~y&_?je(d^U;J8!fANGR?hHhu&&8KGzl6a)$^q&M>P=dcX}Ud+E&)PuSAAcjiP7HNuyPH zA#chQ3_N{`VzTkv;Fh4&jkoRaC~pWM4drM;nicR>`fCK7j*ZnGvC$2ekPP+&+b${v z6j{Ph4_oqIOcb5Y2*7+PuUujU=GI+9Iwceh_gH%&K0}rW=96rH zdt+_^yRDDl&=vySl3>{cHU$zH?&FbUj5Z-BnnIjz&V@y`?UQ_h{9qjLwU8q1Jhh&Hx^GA(H$e%-8jSJ7q+Jz4( zq#YTWZrHdu!FHs(Q$s3k)TDzQKVJr=z-YgM&gj)o@Y*`8;hsZmG2s(mPS8#j#2Of$JMX65Lh7jV$KJ$4t)YO?ANtXGLPQc>D zS#fRAF_T-fytodBf%FQ>Pk$2SXFd(%=o2t69)-O!1H*rwqG2#APYWo&ni49yF9 z`~Z^$>P5D%i6uth6wT>?ctLI3=@|Eo>BXm6A8hgtZ_@6q5i7xs6Y< z90Dh&W}r~L<%+e`Jp>Q}noqft=XpYwA*5)MADSvbl4Veh9hX9zvCm#urVbDZ<^F9> zM-XVgV*_{-{#Z*vx(Wro9EgBQ?rM|OJ&Ztib18vsQ)l&C(%6GjhKXF!glVL8Jz?Ori?&mgZS5nt zX{&^iDb8=6Xx7tu_~i~xP8L%@rr-t>jQ6%C6#p=2w|a5NOY5Qz$bZ65s|8gaZU0 zyi0~60~Z%5{^4m0C7r-DZR{D5uGs{3A)}jEuqsG_Gnlgpu{nP!2g9U@M^*gte`d;x ze|dBsm!{mst2cxUZP&Gv8-3t`C_({(nI#inKT`PxeDSMn5%S(UdJv7MI5Wu(d_JAS zYsZ_PSe+4e45A$&?A#i526OJHGnn&^o4XK=C|F(BapaBmy`)b*yMjW|!tg)gCLu}%`j`6veTCHnD_s+8cz*dZH3sNWs!VS-s$JC!&m;j|V%sKAy z7~&lYqXd9}gyN6}wn5o-Gt`?NhVQ-~VqpVS&~s^|rq3dA;TRI<-+;vAWGG?|$;=s; z7mu=I(KlXK7NzIYfNeukRH&Sc(DW*3x$)Ce@dp7Sfm#*|hTyO!j{|xU@P`}{rSqsf})P5vI}D%nSfT^*J3Adx=ZKx(3;2+7@gO$UZmn)+f4xrS{`(1;lVp5{N+E z$NV-V6bA{kHpn{L>xnLxItS{?{w@cUC;w4NL1_2QEsMT<$pod$?5psEx1hp`=tNeB zvSpvMFaR``q6sKl4l?;#HUXQ<;fe`%9sA=wb!BFvTO)P!gQ%^G@se&~EnR9k+eH}C z{dE%21Vn&s9wifH?8YFI=D~o2>ZnkGK3&tY-<5X)mz> zmXfW{4?>93wV6v$Ja?9&PzFLi;LhFkk6$z7_$^VAfCHlh?>~fOeA6 zM7JgyM8$RubP~MtX7)YK@LZm3x`emief7IF0(~9q^GusyVxC4V`$)?cK0!;154~k0ehybM&pZ^Mz zp}qUzfem+iH}Rc?O=8movg(7sqX%jz23hk%jBvG01E!*&eD}Lh+_JaA^bYXp*@qut zvs{ca0xOrG8YL*aIHZ(%B6Rz>Ha`H^HcH9b^fNa=fc?%|o?<`m8;2B*v(GH%0Z9Up z6_}+03d?g&xPf};KB(8-2kn-3!uP>n0TDGE4ycfM@Ig>z#ZV$s z2J!h>^fSPsvs;iiqWKxQ0ZT|TOL-^sBj7zhJ+Lh6b>E)j(W=Zn6FGrlX0DO}50gc_0od6h4VX9WN%@Bfh=dXLD&8 zNEHB|0^Gf))|b={GW?v32Dn0@#kR-7?a#6iiD(_++V|W)F5&h)?$3L|7Pbyu-3j+z z2nnaE$<7eXl@wrFjEs6y$f|MboFF#rMgQ@~x51}Lc;jRmU-;Sze(&Q66w4HmpoFbM z&F4{V1S@N0oV!>lwZ89g5TpGH@GIIS)8B9 zK~o7HxxYPG^(MY^u}N&2Kn+F^8QhBa_-=IWxDMTW4x?+=jfijEhv@KjXk5CIp1a`4 zzXXUDfOhy1*r7NGrSL6Zg3Wyww3uZp`a}YWb~BxNC-2%MmTGPQY}h3MN_p6Y4D3}N z9oswZMAVW}0g5k(a6c=cikFVF`89zsY%t#2)WmI-OUTS#Kx*P7E7#BuKE4Nwq($ z698u^?W>UOoL){vHB?FRR6p+=r>2sG0-=15c-uNK2UG16RbDl&liFX@SVu27= zBp1pilpRctCdIqj>H^54`v5HfTFjz+=?(Ut;aFXwMNQouZrVhSM=8Z}vWQCySx2I> zk}NfhbhT}FfMYW$8X*KhKl{DVxL-E05y1g<3d8^((&_csh%~gIPljB_Ujw+|0j5P^ zx9Ct&N>MgkU(uDKx5JNsPljbv#C!#qCdJoYv++U z&;U58U>!l$F#=esSvwFN8-R78?%Z8D?`I>(6u1njb#gZV&n%lZlF=N0O@mw5;T=Fa zQNY@A4)3_L%?-Fr2y&&U5{_SB-Hcg}46WJy=kz)DeA%~?bxZnt{rI5|j3Uw*!)Kp0 zae6|BrV{+%8}VQN=W+b_e>sXTJig%kOp*wG_#Ny7c;>Yte)_kU@#w1r;|I1w z>Kwv<_?;E};oq}`!b5xf&@>5a2_4gO^>03ztbubEvMA=*@4xg6`_i@zs}1MJ?A#W? z_AMb8CdCuawl)ub{xL3-yR#Ru=+z^BoA~y`Cb8K72q8?W6bQo?>q2yRJJe7Vux+Gg z&Q-{f0H&1A$A@49V<4a~PCN^9@`TepAki*|X!zsZAhH76(4Fpq^SO!&!hJZ_#2d`Z z;tzqux*aJRDHovlgYd<=p@w3R#Ng23Z7mBn+t86+m_*{@ag@2F%@^xJ=k|jL4~#(z zMWOgZP(2300t$G7*yVI=92r_TRzVr9Hm@PQS{79e zm4A< zDG>1)&?E!7BCwnSCYLErO;fybp5hxPY&`KgGi7V4)R0tlg#lAU6?0;vo3^6&HFc& z6xa+)D;I_6;{;de@kS2U|p9`!$05ZwcYxUbf95uDTkp9Z$iwfgry} zt)SjTa(Bpp_i$!bA>Fa`N+@hrc%>p1;@ey^;NPjX)#`(UBcUO`U;NDj+?5 z4)HB}ouaUuNdSbv9M}oJS%fux66X0=SjrhH4cSDJ5a{SdVQm4$^(CisARxthU}Y1q z=DBaCcZ?A&F;uWrfZ_|V;gN$|kbUO!006tIvFV#qisJeb@~d+ImqKab7(#s`Q2ezO zj7Ua9DFOdCG# zuTcUaXO@xW??A>XBWkCRou7c>^VdE003eU=hk4;B;9h)3GfUE78rHdpqLC%yo_l`7^!$%IW=@$A=Rm=@a~+tkq+(U8jNNM>~mbqC?U z-QH#-%qP=|%X8Nyisf4OfO%8&&}Tre$MdA?tLOhI)eNjr*~hDq(K5fR$ts z-7#Mc883QdXss443|?$AVndP2xBso!HpQ1-v7st}P1&%-aGgeJb$EboSWYx@xCyZ# zgg})g=%&rCk0vu|92uJ0dY{{cUz4$#)zBN&G1isGbz?z*Xeg8k3S}T)qBu55(H-Gw zXrad59zqB@BPyr~SeA{lVL9Czo5}zPM!SLMjWAUBOH;jdHOQSF@x$afW@aEE8B3#c%!LS@?W1?zxR^><_;^hJW?8 zD1P_PFW}2xTf~F+^x{|k%WmiI31Quxo387?t8b+6>air=|IXR~l~-P8&))+(d^ok} z{(R?H^Jmao@9D#z|Lp|MUCiO)WDeW6)Smo{%O(8WhfhG)Z5+P71N(P3(fe)Uy9S#b zn=6DQD~OHmf~0D&^b*oD=Rs}uKr5x0@5C4Hfx7z^C_4|cKjMb;>PhbY&OQJHMj;Ec zT&b}q-lQqG$z4QvY)S>lJS9w$WJoFY*(F7TWz??xnxz6#lc$hho&jtdN+5*T_#VW@ zb~h}niRxqV(_pdB0Pm^<+2`7-54pwZmd0lI(zZMtbJF(>1AvGO`E$`+g8otlN=3novMxwPxjB97`W9A(^ccBi;Z)iYBSw z+3k8Eg$f50_FZxxnQiFK91_E{9a6CoP)bpbvg=VxEx|bPtm85BzQ$T>?5`>57S7G2 zkt>>zB!X>&5oaz-z~_S`5tI!Z^XobiIg0fx#cGBkk)!Uw$2L~=b0vurJPK8^kt(3= z>+|9w#qmjsi#$!OvrcdT+Ya{cvcbsOI$M(p8k937ns&m`?>z zG!#e#$m9#K%p7(M+PHPMg!`|Tv1=IUjqx}`ePr`dwzd*42YhwtlyWdpzV ze@^4&qi#@9xoqL7XIUrb-ESL!EEDG+A&I+*#|$4mo~j8ip_Jmt>+JpRIvhiHoLwt~ z0NX~IUjy-&iaQRo1;lz?n{>v&fBUuLSWoKMHXg#S|Bw2LjZJ*_VUyTg1<0y~*yt`0 zNrqX>Av1RgmR@oU<-QoZ_>?UNq3*w%FJ;Iz5xTOfK@G8`B_m&H*b~WU007nRk|O?k zQesjx0I-&40Lui`{Gh=watl+=4UgJ3@+)&lPMm~U%!5cW!UJ0n-?9%{sP$@wGpN&( z!bZ82%+dnTvq==!+aH`IWN1nt)KLDUhN3K5nNk$j7V5sH83f@>O`Wat&lx5mB&3E| z$=oAjFHOKW{k%h1YqrnlgO*`8cV+vHAXR<~%ch{zO+?dzmBa>wK#z<-)_kxH9hun+ zb!P>6VR{C02I|Z*ku^Vvtb%}|l+Cm)N4pwQv~LGE!2!ImuGk;jL`TGxqiqz$^(7d- zFw9T~Kq>6SOVD5Z0`ynD!iK0)3YuO8^b(+`HP?BzVBp+L8fAkGn%p%Kb&BRwa} z3=IG@1&%jlezk}^Cu>^%y^4}qo<40aLh z9%jeq>ErDWDZLt4=Q1?E=7vA?cd~71Cm9U@zWj=XKl!4G-WX*KYnHx?!BW2rb+QjzjX?4 zoJ;`#o_KZz#gdKDp#ZMiSHI1-V@nv(h=M}V!r2Rzp3k|(B9>OlP!xh24s>82mjjOW zD+u^nm#0FG_O)-Uz%blvs9d)23%_|1GxJ6CcKh(VzjgqT@TNfNdj*@s<|;w)2N50J z>6qzLQ*7$G8j3plegKe%c0jxJ-7GattJT9QB4w*sIb4y1;*JSk?j3a`QohVqnJZ-;v@>I^8lsLB5`zVKZrnQZ`&&w?x0Q&vEi%LYBy^$ z=a*+;6l#Z7)`Litt0zNqK9dlHgx4myQnv%u4Efc0=-DKUe7ep*8UFb(NL9fKQb(WD zWwU0_LVxvfP`x&-N=+<4vMtzJ0P@J5n%^7TU!#B(I*Mngq^k15&L)VC>;#b{7=x%#(P!HS#?bdfg8rTL90z0_~}OVk8GD2f1bu*CF|eLtmE>q|sIBy}c8N{71+h7|NHMtzoStj%yIf9DOs!C;3IGsv z$Nbnk9!D&sf&y4d6me!c1x;f6vy@U$XmQ(-C4wOTk_simk)o9?8Dl*Jm-zAAHsIcC z-*Qj_A*_2O=9#=15CpJ0>UQAl|Q`DQ=_9|VIkn?r}@{u&tG>GK(9cFnuqHqfw!kY$1!`P`UlpN){A9o!p3z%S$O8-vhP;I13nW4X5+>O@zE zhE&GD3$L=8#Ih*<*YBUji8C35LkfQH!w1mYeeEK!H}UOMY*i5(LLhaso0sf~EH(j9UO0))iI`ubj_pRUoB2_43lm69oPt#@ zg2)OY!`l%Z*;zrl+JV!t$-2bG<}+-xzH#miqR7l$gl#sL`B2-2k>~!J20jG=H56rj z7D`(d{S}{KSxz8AsCNXBp>4JQ3~xtdaBJPaSGF94dc%W&tb!(&P=4`?mHVDcf~-sf z0Lt+JClcHXy@9_5aE;KqVMFl;5$a>IrNY`m!wwOp)FHlQ;%`{sYGKwH^3x(x+16yx zmB5jv>3QGoD3;j(JV_!I$3~Df+t3jTD9{uMwoQ?)8mia~g|$Ucn|)VWv=dUS8`{CQ zz<1XNA&(yb6b-bHhRss~<*GC^+jf((whV+TB!rYwC$jh6eKLCD>|wm6r;JB#kZ|X2 z0*Tm=_zFfVDOyRVC>ubL7eqdp`)t|>5I8=`x{Sl!fS=a{r)L`fT~M>p7iNV}SJcWsvaM4D@IS@NRN5VlzEgK)ztX@0T#W#LlPdcGg~7Km7g?1pE@F z=L$G}dSgkL^>FfRnqB{c0d#ioL`hY`Z~Veu96A_Bp=jY}f8{vNUCcpM2;O#Y^9bde zu48hvSE~kU9^u61FqfXm`FJQm32j zVU>%Ze)dGLvnf#1bmrH{Bij+|9)#=*fbwtvk#^>fwHI$&4Yy;HWGnpT0*kH&ffVgR zcyNm&smjh@YWk2fidj(GW--qVd_B(R65=fP&AkX;9#*Jc&!CWn^-VE_V({|!{tD&0|xze>; zoz8jE(7gL0NW5j}AcUZU7vJs5(JVtpF~MY(!QPR|1iwHS>aLsNyXX6%?7jsg5CI89 z9G{ke@Lec!ZK7FG2TYrB(4G zOv`p8NAQ&S!j!#i2G62Go*@RDs5Q2_~4|~Vs=#Ft;7A08AD41Gq zhu9Dl4fkGRSQ2_-k~6O)5~wxi-*Z5MECJIi6cbCAcU_#DqcBY1jS1Qou@J!lT^?f7 z69p6*&`luGqTzmSmi_(BJ0<+vhh+?Rv%h=nRU03F%5vVn6@>jymKaHD7w!0L+^FZu zd)c{Z9TRf~R0VkOmTMdFTn$0UqEQt-K0tS*>0nOwMQq>R1>K;Cg(Zyi*Dg8*g9`4u zixv1^{@P;A?>7oTjt=gvJXw7{8NdB2`>}s_6vZOD7u|Dv58|=r(q%zhPM*u4!2ixP zZM=3o#eRQ7N25P&2_Z*&>D6`o+22gyU%s*cLV#cWZ+me4{`h6T?q+)Y;0GJyr~r=RdXaWX7y|wMXiaAHOobSduwPe#r!pVevQ=G=OnlJV%><2?m~2U z`;|rc2BUx^GY?N8>zJlVI0hmskYokX;T=qpmrF6(TLb7>Hw~?wLRyQ&K@=6XY19lw zZG>Wq4K+<#AuJ`@H_=x^3U@%eUuP@xM1tMNI(5SP;)QP5b^SE} zi~a;yVMi$iktBqAnWV3I=Rm#oi{3`#W#YGa4Lat z-JlDAMN%tc`{BF$gYez`!J6T>ViJAOS4$og!hK?4C7Gexb zlh|A%_@bR{neppEbZx4AHr1e%!YUO&IkB;`DaT(Uk8F2tfQm1G=FBFsV-6hJ|W zZb))e_wzL$)EggSLmC0t%ToXVdHew67~3u}sIziAN>E^eqS9Xj0IJ8dDpsw1v2Mtk zAJj7I1~It70e;95X=;2G1-PFU8qP%#xEjF$tEmz$&1YGWOM$7S9BiAVc|CQK;^-uW zXymM1xniOQmHwJ4&y?y)(EuReQyi&UGTZ#zu=Em2Nk)=GeIu9M(Go;2=&vQCg4lS6 zE%tS=W$Z+z4BfO5)Yv&90s)#qNY3Ix;>3N2H62BrbN-3rn4SepYEPnYK)BL;?v!plrRaVo+x_Xqo+tXu%494ZuzQRdO_M#C36fu_pf68ywJTmWhzQ z`RpQ6Io*+I)x(uUJyS|Cx0=W73j3ZrBN`N$prl)PV47iVSDghFDR(nkeZO zESo|iwdBDoMH3KSkXEEGzd8?qLJdVPd%*$#3S5d-Z?e3T4&@;>p@51|Kmi4?nk+&g ztjN!l+6xWO75X8o|S)8>Omw1Q7once^xLQns&r)%RUN-aDTv%X+_kad;@->D~3p9!(WRMb;RQ

0X#DqQc|gOiq1t_khX{V)EfNlJ-%u-QU3JuRS-0`2$20hEf3S*Q z{qr?^{u?>WE}M`fVDDB9*YEPdwt?r4vK?;EW8-e;SDt4l^i6yH=<9m(eT4BUSzM`L z;N+$H7frEbVPZNDSyhnCvGZqN6JkRM!8>@@=F4AeKbf=|=PzZU>o($16(d89jZdm7 zp})6%{h)|_7Csw6Y;L|`V{-j^cQJhQe2wP z;QVakiSVLGHjBBYt$dTu!y$ZC-cGMo_-n2e9G{Js*hFhX5<-2Wtgx;#pT&uJ4u&Bq z?LS~-&F>WJr6ygQ<@Ew+o;{uY@gAor%3sFZlDgY5xC0COegNxx-VLIt?x4;(B%Omp z-T(K;Z?YS}I0#${VuwrwtJd3jk|wQSqAZ7gG1-}mSD`y1}-p7%M=^LReb2Ay%$ z_u|vaO?&)d%NAM!*(i6>|D#hwximNw>{iJm_TeKeaWBSyBqPJHbFnriH~=0g;*1!X zX~qm=WAdnEs!}?HR_G6BDBY7dZ-2go8L+XgptYUx1+Dwc^QjayF%#9DHEFT9ChjD= zK(MtMF!BPl#U9#DyE#lWAz2eYvVfYS$d1{u0+rykD62E(Mo3Z)N-J%HUG#eIy_wV z;A~BhTCU1tzarS>f00O|)XNE%b;BwoY^`niCU|ixHi{Q?w0OA8hhDXTP35 z*_}6p`IKu!4f2v(eP0TB!FDAStvTvV(I5Y-jq0&j=;GycVvhtBgEl0$cm0iciej)}F*RBhz5um;cOX#3LV~a?le9EqM2b4z8ROy8tWHra1YRzF zTq0^OaWN2QUnwXSFh4-%@rZW|4S7G1#Y7!?2sRK3&v_j_(^z|5?(-0YM2u%d>rRXF zIgn{^R;N^S)(u7fgKeUio#kOG^Q{Z*|}v6cZP>#zX=XHOqZEdW0jc(ESht* z2^0e&4(c(ib-PN*a7WSc76@uk_-uHaHiT>_>d4r5_%A!a5@lqGnrbQ&0*Ek`mJ>xE z3|*dbL!2d9t1};jC@!C%Fb1X8>h}#iBGkZh@6iSFPO@BAH39D51bESaX-_C_J1A&E zr-M9G2~RTE3UpL0!W6g*HYM_WF~2 zW4Q!hro{JA5f%J__mwS>Y%%3?iQ@OjQ1u5+0^rw)$T5=9v@yO^bP?TATTeaW`6(UB z_3K=gy8tZZW!Z(cN>yf#L>G`duF=a@!%Ch zKc8m3!d8&G|l5bxdN07oyqsbmj&2=^mQ0IzDy8n|$ zIxJkO-y|~0%B)cl!t-&C5anLxp`W8j+s7)#odykNI}-AV zUHdpsxAfCHU;3zQiGUBay(F8%P6^Q3wGCe;q!ox)7goWfuE}i6Sj+>+ZYs6A*w6k; zMM2A+lgeg10KousKMGnl)4+%5oT7 z0^VOxJT3`^G68AY5Wo;7NDY~PF(BJOqmY@%9T-jHG{89Y+BRA#Lj-Nb|7yl9+P+$Z z?HP}V(dQZ!LmABM{!I}g;^~PxjDb0`K;=$;8%2Nmti9!;UZOH-k~lUSmKA8c+_#*@ ziEM^aBVJ{~6FKn*Bedq^8}Kwm)TlHYVwS&rt%K$K>ZqoUr_`X3^V)D4PK&C$IV^l zje7c&r7IK!a7ZwNPd0fLkskk4laxHzV_n72hUIy=0GG%+ICk6zx{97(|B4Jn4@8KQ zK`F4~b%-ek>f{9mo!Eo6h}Bw-TfUUD4x=70=|HcFui%JESGgW$+v{a*`E^#xUA?Auf(Ls)12{ljv9 z_uA8$E62jT?(9~~ZBz@hgR!8s!Ou|4F}e4~Ic@n|_3JbA`gR7AG%q{N#lj@r(1M?tTLBbi7|rfsoF%#? zbVR(C$bm*GjI`Doyrl(}X%zixv~<~@)mmlCGawU_=9)?M3`UEVW8^q;x+M8TV4ZJB z0|-k_GNvQa`ZvPF0nMrM^23dw;N})CE0q?6hR8^|$MYA`rCEiCeQxkI1<1i6dNuP;H-xnW1 zPIL-}S<9iX2_d_jZ5hy~p_(t!c`aO&7t#I0EM?Zby-ocCTN~ zoYU3uh@pk7`RohhU+d(|h``aDUp$%%7ei5FaF>nr@ApURT{LC+fW_%uZH5Q-62$FA z_{`OoGt@A3^I#?Z7t&ZoHM-Og!gp8BUPF8oD`|Y|U}S6=V*h{BQ4?F@P~;LP7mobY z<31333c~KgoP(Px*T~v7n^{ZcB0IIr43`LnPduwLAxoxSgEXfI+1_cdlQ4}T+RS6a zHG8g^rV;~EZ@gbb>`Q`SI{bbIBq*}2m2Mekz;0{jar87;HGMbSgfuV}9S=<_W{q~? z|Ld(n4Dt&q7dvyCacHT4@%=2g2k^XJPIh9e5Do)jKAWB*8I2_M1;^DAQwt63o3;oA z&K{cTX8AHIIabC<)2~t;UAVIZp1O$#Wj9Jv4t*m@F_#k>lZ2 z8}LpiF10U*g+^XJ^f1*-r{E2Z=MHMZm2H75WpLaQO_mo2OH*8pF*a?`QBLwRI#+G? zwk-d1V*>AELn2>Bd?XwLC~)YQ%+o-bjxyMP%#2wFs40ex;o|d?7F=!d63R*wn3^N> zpj|$do#0#!FL4o;YAWO$tf$DM1Ly@Jf_l*|Yi(w*(Ms$`rfnq5OT1_sA~Fc08`=@- zO>99K51-9wVd}x;9aB3fS@V`@nePC*Yg#6@PwsW*Npwvonw59IM+p(QsHt){%#M*W*R<+f zLFvn{s}wzOd;r=gyzTLZ2W&NcUARs~7|*-eu%yL@R4w+rq3E?g>=@`%3}Wn&eErDJ z)~q8i1i^v_231x}&E6(K1y{Fyni}FS`VSnxqJPKh#8&^0gSU1;k&PG={!x`@L#sA%8{2dIcg(pf`A%Hz{=Drsk#72 zuVn?x!N2$qq%7tTau~Yn=)Rt~+O5SZbeyxw%30*dP!RyIc^|dj;)(&Kut47c(d`;) z_jz|@V8MK?@O7r6xENsrh6F(~{f8#??`w2|+~S5t=I9Oa-^D>h3_VGo{{q9yA-N=? zQwya0pcxT7LZhfu;AqXT|Dv$$h+$mRxH zAp8H)cbjJ-I`{Xypn$LZ%f}o&ah}`&RUWo>kT6r?U&$@(46`3>9@A=jzg=2py*{3x zXvBSzrC;FH8pdB%mI8e^LZ-+aW@U;@+s~vNymYs1lia#kbP}{*zbM6FwnLG*rbQkHYV=)K zeBSM#HQE8T(dH|#eu=VJ%R#6Fg0`h0DJdfl^Fju_D1(tpD^j_`5PyaJX6E0qdPY1O zgreatx^4d{1~=pU%P*LfsO9UT9&JDDELsJLK(W&ufH^IIjCQ`y+%JCphSp*&%AB|V zjTo)Qlxvz=ONQ-QBStih@4nPR-;7pC34y<1kfq81_)KrS3UCj`ZpV_(ER<1HGu=cy z!Rlh#Xc@C}f|?GMF*|6WQ1ru(_JUiXn|7Z-wnRM6B_WhWa?;Ku{}EduGOg z>dsS*^oR?%v4BTPjwLBxG8|*IJS2B|PuOF4n~F`MP9OcR8VjBISWP{PTG zIk?~!nwhC~?vE$phwav^LlUqk)t@#oQ*aGq?8=M?6sEt4UgLnqfPB=#nPPDuYhCzi zO`{nkb#{}2CwGT~CxY|Z3iZCq?#i7=qA_d;IlK?CQRBF7NG8@yjdrHFvDZNDH?1>h zKk+!qjQjjc0^$IC51HX&l(^Py27S$IgROS;h^?kQ{x94R+j5SviJbYm=PIxmZsWfi zTo>|Mlp**#G@QQIXv8FWI7qUg8qe?XZ!vZNZSl#xKgksZEFV-tU*D+LXfpex}J77 zwS*SaD+^9$fhn~cGaLcaeN{c}Z1fHv4<#VZdG^M8G=2?@HtJBS{nBUd6nZvy>H~#G zYI!^|wX_)m(-%=)acHM?xJvv_<>TRv?%V8lKC;m+*`A*3mWT}=evil&B2nP)WsWc_ zC*rilpWIXR%?o|-jusOFKJWDg0qcGDG{CeCFGAmsd{Kq!3inaWz7$y4U%HC>#61SL zapZRw$yV9ke}+ROALEIA5+tJK3BcELey0NoulsG)+}Zq!+wl#c3Knk_sk_stji920 zbRZC~VtgHQ%}e6LX50Sphn)L{KofF9os}(X)cmJA2o?_S+AGqOJ|J#?WUX%v8>(`$ zQ0q8-DI2VWfz$uoiJON*I!9A$WE#PPm3zBq zDO}*R9;a2mVm}D)=nIh~|BnIgZ^v>eg<}>gl^53;XO;Pp%F~&$uQGN5cT|X`5YIaG zMJGhwkwS$IDxt6L97*2?!5106WqFg4`uaoo9@fH$=IDy1JSa?y*WkBa&bT%_q9r6q zFoh6O-vi;(`K`IXXPbFw(^PA_^b^u5Ym^ESX06vwi=_#VIo*6eS9H=x`I2+d0YqAe+?T9aYDHVuU}LAW*L!2!YN+&YIw5_vy2c?_cfnB67$r-* zBNb65_#?`uK_vQ%$UAkJ#)ruiFsm!4f>@#gtE$h>ocEX!j^V-lK1V0E{?(GMzG_}T zKi=f!55ic->v`oyFw#6F_%`U~x8_Y2(EAL16z%uT6@jimx^OK@d}zAu##S+Bk^&P6 zn(V{*mnnkPhlb8w5j={^B{ezL@`b~b6>kC*IcjO_D*yZa$z$tKDUzeX-JA{>jLpT( zr~ZtkJ~P9_C0oqlGW6cMydhX(EYc@_n2E{Jm;*yiNP-V;6aTpkH$@*kx<*1l`gVLQ zLHop%6xPSwho#MDdtbyn(kI?Otr&X4=k;hi7$U8^?NjLOZoB?+*0%>{ygaI?8H z22h{0Zfbd%lSC&i*p`Sx#6JwnncounkFy(ulAb&7%io;Pq&$|TZ*M5;@s0=>{Kc^D zLVQQ2`7HMI#P<>ot0nSL-R)l}il(NFkrPu4F%0$Thnmd%k~H3ps9RLG7OuZ-(YK5u z)$(k^D6MZinfa?}X1x(>rwpMJM4k}>&w34p!rW!)Hf4I?k+FM2%`Ru{m$K^40akih zAEFgn$m!-u^NQ!bcQ+KSKatsHH7ZUEfHJ2Oi@|P#oJ_y3V;wwRipF)shKC_I#F5LD zeR8+YZXwP<^R}&_)`(0QuC*J+r#JtppgeM3++4Hwanx#K_$X@8-XPU~vYDNq*}!u+ z$cWu*y}Wg8u|;K)NT+)lGg(Z#T>AZ~7997f+U7^xz+zV;w*UKN zt>+;|XSmSYk_0g5LBlE<7#BwuTJ4^OG6rGYjV=E{RoDVTA25HEXv!UVKGxIVXz<47 z7@;_=4)h|zRi0hWI3A6Y#=^`b;K==Z>DjHj~!7uz@NnSb7#a?wyj)GBJ_kllGbQaFM?7f#K@wk7=zj z!WuNWE;pkp^%Jg>pSdJ~zKSE0!rkGF@9Umv;5j_~Y1Zw(4#@RRmOCvha29l^V8 zI7BS=_88Q*DiCPjHjI@|r^kJafBMR>dUTRd?Y}zEfx2BijJGX)1LDSF!V_N&d*((- zk+@oBsXco0f7%i7J5-u5If+C50+pae6lH@)Q+NZgb3xUgC?V+#+j-BaK(xGpj_s9o zCFEof*S^iCxIElRRE9TAsY2b=5|KmhM%N4D;Q}L1CO(=wgT<>Ia%FoQSyO{ zv0a^Qd;@}J5vsSbWqsZF>G}(MoplHdgL{lPP{R5;u6UmKpyewLQOM*d$zYexGvGl< zT#(j65(?eeg)s}UVx2Cx%e=5s0xu5*9_I5W)4$5*ahg*JK)SbfyUi4H@xa4Kc2h z@`!BsDs4*dZF2e&Pv!1Iqp{>eo`bA7_QABs#Kh1%jrb&h1{xg^TkFmD#y$S`A0k3c z+hHHukz^u1J;+)B1nKn4$uL86%qogs=#RL)d{b%YGHVUBPZ- zdk8>;4)7GhmksAvg!zhk3j>srGf)0av}031-K7;R?>BCfXW8&VM~zPRh}^&NH1UZ+tls3tGIN+(ZBN>9QTnxkmSRJZ+z ztDKR;#i)L7q^Ep1q}43QnMhAHFdOWfVk**s0rmPK^W|fsCJuuD2sDTy?U$w^+fK8I zrHObRE&K!5f{0d$H6fz02_YUy6LsBo#1*+v;(&^F+DhtP6cWYp<0?`mv79keUhhRB znM{{PwrFQ2-j`^rGz4PZQE_no5P&ScSwPi$K%toizb|MWVk8JgfZ? zF<+Q_*hdr(Q9%FLza1qr?u_OAMXh}#jt_{bAmcwY&dZ(ED;a>j|1)BUr0_~S#-Rq$ z%+o-NmrkLVP1T!qv?mW|dOiIfOboxk5%VKdSfvQ@QGN)U^4n)N_cto9Y0eG3v||ZV zxSpxHx{0E4DLt`AJp`XBTQaKJ6XiR*Hp;(eOQw;+G!8+kBp;P&MY(#5`lMjGa4K~G zC(_kG!9rix?Q&D)yu$JC1g^yGho-}*6&m$rNr!0R1jLltGG)}~K>twB1$j>2)m7t%6*Aor+u6H-DI$+e> z5?p`EgVv9o%Ay9DzF#{~+Xis<2fTF+j9UNvTUIBj#P!P|PuiI{;r7eI68(6cecdH{k*OzwHK?@gZD}~KipqZ!m(PJlRdrY2;@HGbgLz0Ja z8E9c7=7(GtEq_9Tad7dNXc!)f6)+Xp#v8Ns`!)W`!NqDPhLQ^UaP`;C7Xmt2z?@_0 zX|vp~uC|TDpH%yeVw-W8h#jk2Q=Mrqc5-A)gEmq>^!Pht{zM`t7c~@&+@dhc z(kCp}%r4^${nX54Cby4oPr+IzY%VlGY3k*L5i|_M5q6k!r*!?s2if_Ext<Ti3xvrxr0{u-N0LiXz!>lOP{(Kyvukw#JY|1DfQQIiC;=a~$&FFJNfZCCtdM8ov8;*6K-{jV!0OCt9QJ@@z80SB_IF*lJpLE!Qb+j=vqEI0EJiYCr zyu=>sAG%oHJ@H#gP`A=$FLMOv0s%R5CNoe;@SJ_;4ZXovf>_#geJfy{e+i$9OT#f3 zhED~?NpZ45wa75WT?+8unk{?Yf3ByGL9gaD2rI#Kbz%3~>lv7tBD5QI#jTdvUw*&X zETI55wWUx)S;1fH>HRRo>=Nza?x5#A3q?t6=5 zcsx>GU;h1$ojt4s%#z(eDhmTPpO*^B)0Q_{cB<;G5HHZi9De@ z3}AdkpriUt1*vjTybvptCd7LV!3=qg*|!96?jw<*DQ3oqpmt~6)+qlXtnz4|;a35+ zKRAFVxtyY@pOtg{kCH7jbM?GhXAeVb0=bDbuIC+U|IZ()ZER+gX%2d*HUh@0TYX_? zMHqgezRbyB=_*$6xJZqQrd)E|-e1SkN3xWe+j|r0@irw$0T1iJn-7q7bL^l)TUq%c zXxR4C4UMnK-=b>PamR|th{^63_dv&>XW#cXbTT}nO&6&@4JRPaJxd>&sT9E-RI4#? zAQOz=pQJ%_rDvOi2%xg>8KWmg@yaure#+mFKy|c0JlgGJ)!EAW4*y$k$P!s%!3wlC ze` zub+G=lT-yrN2xr)yfQ+DX6#__*ALCC|#NwLaPH^(5JUV!iK*W~nG7Ef}FW>=a2x6GpK-r6#m1YfO(uCB_t0Sc-tWSXyDr^WV z-oCME`OMGW0#&}h?M4~XO5xf=W^f=r4-V4d!w~7kFA)CF5UdILW~e=0z`AX?3ktLb zGRsWEloI3`Sm5_% zcaHJ7(GE%v%flalX#9v3fvXgvvO9~21D@SgT@`eJ;DZ@+ zQFfGJtXiZcQA+u|jfK0UGC6B(;~%RyH>#_{!#aI?dUAZG`wk829RCFc&Z_;5RE#+q zf$l=SU;HN?NWzTEAs-+9^&3W&Ew@jPocRKKxi3SF_(x+pK2l@cHWkMJVFAQFRQHc9 zzi5ofQ}zlo7?W~KOX$G&ofVd^qBgmSTVZyvJ{q6Gf&J{+omJ)%EE0SR?&2<>=(6b&8oD27ATG}ZolxpLvd97n_Mi41jQYKH9g zMsIh@-rq1izqT9uJBhbj{Fzh(BmS){i`p@M2qmBip~4GO?TGsV*RUX;RcK(i7|FmG zJxVEod>d3C#3yRoL%-Nv{E?#z*G-Sy*(@T;%co`Rj>{O^(2xp}Cw@@!W>KGR z4sERCFjv76#OD!7i)~|G?%TE7Ms(~r2TMhB&QJEs`l6pYZ{q-UtyD;yU~dNdcrr` z4!r_PNI|ORkg+w}YKlC=CKX!=F7^xg0zpdd6HKhvk_}C{w$)kcCVJ7MUdht=Cr>lOoULL~trQ%kI$z^m9qm-OhWem=}2#nopG3ir`4y(Xuqe zV?)|;P%+4eS&Fw4@neQPqmmjlIi?JJy?iRQr1l@Pz?CvGolj3yUlB#5=HgeZB15(} z;?zzfc??-Xj5;XQ72Z;RhpKvL7UJU>prJpl?-C)ERM|o+B^uBb-8Ylme>- z4V}L24dG*m5UaM$?=s7{owM;Xw7ti7N9D9EcU%$a;`|TNuPzspF zi+oMJ5%Q05nCK1n;l7)%Sf}eHd1Y!ZS49cHij;M3e`L7NapFy%bRaAkaWE*C?9#@b zPxBTM>xiT&r38lg)qaU&Y{$vN>NqV@w06(o@sglisVpd`)lPFF8eK{6gD27#zVKwFq_9PfxdfbCzc*V1Ll{ap)N9}Axcb^E3dMlWuo zTcV=#0m!wnZpa8`FyVPe*EInQ#Sds{)ZKdD3CPZCPilUVNcLBi)68ay6*?jas zEDW|HVLSGE!6P+c#OLQ4si*!h=b9p8fwJxfdS+*&`H8@lWquImz9e$Qah1RZos3GJ zn!DFLN3@1m3bh4uG&cd0T5jrARA4Lo(z8wEv$hPyhf}I1yP^;=o#jbpMlKre5NTzx zXc5GmnEqBSGVB!g)6d?!$PE}$)!!Jy0JGx|cDG?BE%le--`CWuS9PZ(CF_ml3VW8K z)`fJiE%XiXpb$NTIr}oJ8oS8cfrih7rj44REFD~ZQr-r88gKT599ZVBt`LC69K5^%d@$3=%^m zznn)yH+)BbT${IbVy^tnjZM}S``xqCGt0P% z^B!&NyD7Ph4oxeyGYIa4aj)+*i?wy)sTB~X1MQW^DywjUF@xTCiur~9KF)$IEa<7A zKdwwPRAW^)uMt4>ZMWC^7nxTc{FSt&@l!c3HwEY@e^;HIUD*5A>j7ChPcTld;#7hxs+cZ!uCN6kJq!O*q;Lywg_=kl(LBFrKP2OxUpW>G z(sX+;9hGJ|sbk>NxIDc1KePM&6Y7XmEq0B#6%edZ00|D0av(ORp z1cefL^s2M-vVpOGFiLhRblt^$h$8o6oL=Q2mHeNC^>bqWUM=dz%x9)?ZDkzNWeY8K zAhi>?_V(whJAT5fdr81f_U-*9MHvpRs$0>P z^CVH%j;fN*RWNj_?oe)7EkiTyLGSva#8vQp$x#%JeC4I*k@_$>g`UwtJm6g87>c4+ z72*-jEK2g z46;|2XZqkdd4|2=R2#C9`t3ZsO?|+|Vg#s>pYLldW*7Atw?-!qh}z3*neY$nUOHI{ z^BfaM(e#%&)Zt)IbP5ZIDODCH`-1}9J<9$d|Le~7nmQBD^oz;B z&(mm9_7284o3TyDeFwdyZ&e&x`Y*Gan-9is?qMEe77kJNF#+O;Pkd{NvZYf2*04V8 z>S*(gxg4(<5dJ$8j;QO(6+~Te~ZiXRZ~n zt)+Ppx;3LVX@^bd+tZc#fwxgdcd$Sw`%>i5uc$up(0+u&1e!aQ_Q}U@t*$hcc4;Ep7 zdaT^0$`&woXpTDOBuLfJ38)xjT52QeCiKA z8~x@gH=xS^E0aJjCv1@$a#KrRRw!FVFVSHs%55i&Ez&kp_wPD_B3n>(nGo&fMp8vH z{j1w$5WcA3A~E@d53YpK{W^BebE33bW>(qztD5Xp3=UrQHtg|6Ft+_V6E8MLFNeWM zl>28$lIqJ%qL$D3NjRXp%e;l;Tdk0j2{9Pv=CpLC zt;8HN_+bTt6`BqmM}>+^-{(6cC#UJh!@dZd#T}ChUUn}SVAIKn<=VgU)7NeA1rY)4 zDqe>+T8c;>emxO)i61VKWnK)b9V!tjux16Q#Jwo^Q#5xy>}=7SCC+lq2q1=kR<5~4 z@2B_Bo?8*(I^;uOA#0}!!v!AAY_=%vmnI(qLJ-w;eMjsci~V*2-5j)MAFNH3E}4Do z{#Mq&#o$5^TyVK}RGI{ISao%5%z=z#Ej=)|HTd&C1?uMQ#lvzL4BJT9n~r11+yIVY zWP+`1OZqpKAO0ON zMa}lxSJnE%96L3ztj}F6IneTSZmvjWCZC4huACS_hV@C62*_q&!KdW>18iV;~RMxd)=vFOLD z=Q-8$iD;zzW1%O|wwsET`@>PcHM=Ezc^QE4oT#9sA7 zevSF0_b}>XoC{>EoSYYHAg3B|VIj#rbUZIb+)vq&)4psubfylJ7Jb6-rg7N57m62; zFM`={Q-d`L4q8&*;1Im_NPOtCFu(jsnq%AKs}E=b6$%U&?zVgxRQbtnM4b;AMXX#p z!b(5Ggx=pPzBA%v3S@K_6zlE^!8+cF;sI)aZDnldI zdQqYO09@FEBWd9ZsfL2PXnI~j-@Zy90`Mz9i@?*xG5$q|{Pg^s!LhD zWvR!u8PW;Xr*~;4qVC+5ecMLb(L_6b8zrJ(rrQ)r;QZ;<%m@{4=;X%~*F-}oY9w!^v-onD2ztbh5YT_j_ zGZ)aAFVHbFR@pIUz@{5?$IG4SrcfK!p?vr!uUI*-R|0fUE%?uhh;ovYRU*yJEBL5J z?+fUstJsyF5>KO9vDy3gE&Y}Q7?#nebCX05wVEZwDpKpAs%#{|8z%$}PeKbP?zRcd zPsHD?fjPj_tW3d6sX|R^z z(}l((ri|#+BGjH-^xB6n&+*Kl!f`}pPT}e%Yl_JWi7=~QV-X5@h)E-0wWxCoW!bAa zHloQK^NYtVG;I4#HLsWm%y?^K$``JhJ?v#k&$H;~!P?P!{qBGtJR}$w4NT?Lb{7{d z*W#b1t0UYbSeM2R&~eeAwc?EkX|PXj`KdsTPVC>o23bf~{pp~ewInv8ws#Kq01jw0 z-={sYejz{6(|LJ5|4bUKK9=qE4uiGkLI;u!{NY0r!6H~6EA)6G*TkdN^ZnhJ_^{CR z1Mn?(ceRW~m|3l+KY?U>1rB%X^CbKsuZ`KtGE3YuZB`i^XrTAI!I;=tD&`awA?Uo{ zhFPlRh-|et%1UDKtM^)zbhWYPozoIg75tZN1nOGM(doV}`L+Q>?RRwF|J{DJ7K15a z{vsHo{IB!O)vIJz;Z+Pn}~{;#X~+eFiM&=ZRC;p4}?6egX^JPcn%92^`p z10Cj{@x!JJZ;$RG0z17OOimV_2N|K3%5damN9ItleH{Pd*H7E~{u7i-jZ+~9i^x1| zX+1C29ot<}UCD2-Tw7sGry`E_fy2fCxj{bzWoXWO;mUbz#H%H~T=n<@w*bNFS1vT{ zVznzXXF$03iWrxC~aoSd@=zo(>JMw}9mqomJlZiMQLXpe0F=@AE!BKx&*bxD)Vw((*cc5||VxiR7 zNf>Ag)Bv0c{Bl=7*e`YVks2qLGKEn(&OtmgB-J^NR(2c+CrkVrWGL8;x)bW7=RygNUnSRnBPNgPI)hb)iwe6WLw_`@kO&tk-pBXpUk|M?#s zWhIs-2T{a8X*>Uu80;WHyq(MbpPx*I79Z?7KJ^q1{B(^JxF>3Nr}*n?%SUnQGAVyF zVIg$Y5`#ZkwJ7KsK0H}69lqpgW(m|%pB)a4hv9d3FlqTLIgj_k>u&S@ooX$B22f{- zCIoa$j9x4u{_6uN6GbxoDq@N5CV><5+Z>^~PEE6sw`Eq?kKg9@azc+v;~rFm2v&fFrckUshL`& z-+jHW=}gngBQf69*I{W-5zfXSQ#3=(6x`Hj+H$uQ;IJjc%n*9cko#{RM~B?~{#M|- z1ewS#?V-JyFZ!7ghA8k%F?!$eyl@_wa{(wTF$lYWbDP7!6~SHbW``k?ny42B>f_SQ z88@Z5C0T&dYrm1tHRbnJ3N=l7yi4}+;b4uIIDS#eSHiE*Nez^<+OkC2Dt=2hX$GJ&p zHAE*U-Ic?@VsGCRsfZ>aRe$6QDi+xBS3(+ZJNJkH@?fEzg`bSl+68KUruG z$x`2c`*5`KAiQAh?2<0zBEg;x_;$7{Tgvl3t@#+YQ?#lUH^WM#lkRrV=#d1ZWx^1i z{ANQ+Kj~arQTlk(v1l=in_LxVc=)KAf9m?|oewsO$@(rQgR4i52j|nv)9q$r%P&4? z&Knx}aQf(Ge#fkxEXD@~8RMX;CQf)g3v~g~(P&qlC0*@CVvFSC+_k=fFbCBr$R?CV z3|JBxKs@GWfWz8IC~*cVno43-Kp}xQvc{s^c*;clCw0(U1sS^iNmoU@Wq)-OkBy<# zI@4R*I=CzO7d?CT^Fbaf`fkdmkQYS8(QyJG;M;-C0=|o%=8)QV_UC6Z|s6kS2CHrIsLRk+$giPh;=D7 zto2(P94BtJ$3_v)Hr_kzNi>Tptz;oxL$w)tWY|3^tmqf9S;h>}1r>K*pGY>t0{-?%awn}Nk=x%h+0Q15N1_lHN`mtFiNw9B7< z?)d0>huN3hdYggWenP-3Z18UWiWykEEC3`90Xc4~7>nL!;)@4z20G%|qvs^wBF|=5 z&o5dTZwE46ntp6N^-_AgkD%T?mOZ6w*nC^kAD4t2ECnMyj7f^ z_+R1sWBqkqd9-kMzq59j@t^`2eo%I-LOC$6_O+M@y7s>;ap3hXbR&vF!GX)79L@R8 z;xGb3rYLX1=T8Qa5Ce>h5!e6oK*P5N1Gf{%Nfv~m{#(kS-h%)aw?(1L`KN19S397e z8gtQ_>M(+i0F~@b+%Fv|7{t}YvVPKcQ(CVcm@Q7H{sm0yqwNqS$*pc z=L-vlg)DW@&J>^_Ab{*Gq*82Q!7xswpS1aY38LQDk^Eak)cLmTfdVQzq?=$-m9BxN z9{Nz&kJCA#F5ypfRSNUMHCrki;8EMqID|kR0$iqwf&hauV}?TdMRXSd=ilUCZc^Kr z8LGo9Q9RJ>pSY{y?qAX*qANx$(Us4}uX!qA+GI@jN*@M3ixN+l( z`vu94sc#7)!Dp~cUK;C#ccJII@p-hB>(^^pSGM*a#%#E1`XhO5;3eC3b~yD6ENd+^ zU(w_v)qdVi+vabmO%ze1J|(c=cemFboE^0L$U7-`c=nxot?t)VJ?_CE{xje=9;xu#BIsx?@4C+a;9lKt_CvSj3*_vB67bIG^=KGx2%StbJWl5L>-AMY+ zIB6ID+?0rC*hJHL z;KhcLuD_nh0=H|(Z+n$2P$0kK!G^7JhvKAA8SHNUO<*H#;OUchekd^d-I)YP(c)2m ze%F>HpaQ_c^M&v)+B{f<7%K)huLUkb z6Y()Mlb#UdGlKhIBhU@C69}0aZs9sXueN$4$v2_=`u&#(Zq3+1LYd3X+-%sXCO8=` z@pC~Ukfbp)mzbvo>DNv%_Kw;4_pv`-4wB7lw_BWedXEkDL}?4NV}xtsTR-UbYiW8i z(mz0EhDPJhZY|bS@d_(X7Yf#MCQERoteR`12qEsce;8B@9eIWU@hc_tn>8my2@Bwka60qZLg(L*? z^aF)57|AL-wlT$6BI^j?Rl(9B!yRoie;8>u97h!rwNzP&iN@Zk9m4oYBV#YD!W7hbrUZ-1>0CT`;Kb4Fs&?S#$dPwSa_nI(Q) z;nBj}Azc<)4SXCoS`QR?%{i&DNM6_LpxNfK^Y41bTupt#t2+Wo2QbM=mLbS9?Egsu z`Ga+OApQXAtWN`mLAM2L;`$TBvL!Kt^KBE)!W`Y$yb5a&9#>KV8}NE=`Y^;q)xmpz z=s_U={^H$e8!7VdPzsV7BlJoeJya{pT)tEDCpCL1+7nv3AosS@%1A%RPBj`0;i``u zph`j|al$b(H#A4|0RaLgO{CkSpPm7gd)Hl<6|my*8lrex@H#0IC-cZBuT``^*2gFK zXd?le3!va~S5Le`X(M=lo#u72#r1VO}&_%Bd zmA@Kto(70gw6ffk>!5O6F1Y$ryitIKx_gH{h_aIoUn>FrY;xZ!NiSNLp<@eSBe_uB~<);lTo?mxp+RAJCi)$;J*x8 zjB&hVqRKDpAJ^Y>{>N9y?%EW$quSZ0w-kCh5OWAGmxsb}_GEHicQ8 zWE5JZtV&ZcN);ks>h$Te#PESMDvT)ebgsTSVD7~3ZqYff+P+~4cBaX2Yx`h;MX_Zi z`~h@`bP`X~6xEWhfrY`9I*I03K#@2DUQOwedU9jwg#k5sGV^n{&UaQ->cz*G!$UU` zCa`{pec{~uN-|r$f3=LbQ$bw5rEVUFt0XDhlo8F{B+lLhHZuW0d>VnG@ETjGXRvPP zcIUL%?sv{ezd59Sghl)4aiQKtR>trUP24FWwco)b>HR}Q#c|&uJh5~Q)pnDUof&QK zqrKU!ZY+{WM0AaQp5YmWoJ;4JcM?{L3|}W~I@%z>|ARyg z$}GFF$ci@_@2-7beGL17A*K%12b+phfxsKN2t5%#hHYRzRQaqDCwuI zDNdIAjr~Hz#MJBB)OLndZqMExjiK+8Mf>~fg$!L%Pu$yKoZ(sAzekR;f4XMrKS4H5A!_-)VJBP2ecBnP7o}D%g|5PXbWb z5?H{xUNLItRBmeLTtA6^n?5TfN+y=shs>Ig{$Bp=|@Xg)FiD(w?VJ;&lmf)um)lj zdbnx7qL=6b-S27aO-o&R4Fo8Hx3=hew6uO~{m!7EH(9k(53IEIO6(TT&_azP`N4V1 z_JQUwmZPuzP%>OBOt1r=7Dkz*iUvwT2$nB*QHxuVhQngRgj#mr+?neLHv$ATQ==o# zF;ZXzw=<*5@S%a_k>-Azug*s#soL_F6Kv_|#@BJDM8um+B%_SWRMq29qvSjJ|7cCS z#)iTAC~_A3DhcCIErISnC$`F0a7XUx#`Reml0`gyPE~b0T{od1nh0a>cpo11To9Cl z5U$`GsT`I2CMk9+wg0G9Eh2VDcN@uwkXllw;W8wmSjDD`-0u%E!w! zbzr&W2~!Vkc5Q7C@EfH!7kG zkZd-}xqeDkp!0kt)XU8+yIa=J9F@?*ldX+*6dTI%LL%cEk6m}kh5&8eh3e>JdrSF& z;?8x{ef2EntI#zZ4*8QFKK5KGb|-{7wMxYYt?5VqzP?cMGA~X6aM=L&rr((Kq*_ z-)U^z+^!8G$C+k)QdfsqC{>2d{2_m(DQV0zptDqVqx!K(SKxceCrg+)8Er~~W%K#? zD1wcP1rAYBC-$xpOIvR+>4{U5I=Niv^AQ>0R;6d=O5A%IkTo|RI^CRkD| z&9h7U z9a*eW{`iV4j%c?g&Nd6DDqn3`T^S>WcRQfxhY`Xtu<5tnTPw4{r8<-~gGfb+X1vZe zQ}V@paR5gDeIAg$NKw)sW79+UM4Cn?XRtABtnmj}pkcMIvS>D+xET)^_La;5TwtZZ^tQ7T z5Jzwbv8V0~_Yek{H9hv^0tC8nh=4joH&RB(=y&YI4su)^Yn?4W&johYy*kfK5BO5e1oU7#^HIh6xJ(Kia24To#g+{)d{V7V2B_bq4 z-3ro=l>$&+Waj&AGI_?e<@s^Ezl26TX6L4=dTRrO1gHqf%nwoyBinsB{t{jhizTjk zA*e3b)G$YWjbk@;0(f2ve!4*t2)l%*57b80m-9|clT#t675r!wWE(e^6yAcA|I0T- z)hA7Ci%uz{rVii(75j;{FjlH1z&xS-T$uuXNY{LQhhp2Gpf_it{ zgXU;nKeBHk#)`m{Q2Uq-E}ZWhVqTwo>Z@N}tkP#$Omw#1mSpEwuEGvjYz&P2RDoY} zJNSaxHih ze~(Z)Ia9uLdU-136ZHAz-}TS?!=I0t7(1_Y7mEPD=%>Ksy$v|O(QFr!I0(+2q{V!< zhKC-oabHmF!DubnGM7UE5LaoMeF+-b%fSfqfrA8N5(516AD`+nB}&ZAOgmkcBt>Bn z`vstz&+I=k0~;5rx)96&7V6XftPG}n)p~~=DgksJWYfOCu1+lB6W6UH_&naQHJ1w> z^`9!(#Bt)6eWQj{Tg=7(M$xO+-GwWmcT%LSplMBZ0871YLsuu8{kjNP0GRkNbY*q{ zWXl-Da9;eeym=f?(_Vp0z3nwdLbk##F2b0hK2DmG?6@0ezZyC-e@7m!B+sjIs~Ge``_d3^~P${=CMSj-71a@$isJ$HYQadW<98eh-{P}OCipq#uXk*jHWn#4oI|X>ATS#o-W;V zs^jAkq<{qgaRN-^g)d~jj*X4OHzgddF@xDlJmRgQ35+1VzIBYb z+ArMAl^e-=u9~F@!)@Q}42d#DWgsyaoz>H=qGii)Uz2*eD0Sfew^Ppa_sJ0?OIxL%;-NtCo-RfZnh49Rd5 zNj*Xg>>S)IOq&mW>BiXnxXaSMTaSe?ZO!Vi(>&zK^jY9tyuXeqR5M4e zVz})zW--2gG$8$8w>vXjVB_>m7Wn?=OSJ2Qjh`CH>p%x1?*DvVnhajAf#S;qww_oH zO`5~gc7m8ym(^T-tK^4a1(^S>2ty)Ba{W9=8`1s?f%Vp@xcu+k!TR2J2C4ZSBN_W& zb$-Rm>Mufi`OuS#<;v-8cCAM(6BXJoNZjGrO^SgQ9x{(6g$yIwC|RA1_S3kU*V@GS z;sRA;JPC_IckEj}Sl>{Lg`ds<3l1s|6`9*jCcZYYgqQQ%O2{FkKd7?Zx?X;;J;)6n z+4J@2CZ_tBL4!xF+RF#-Djr_R0=rF`H0wKQ^JT!T8NK@G2+@s$tP4dW&T!{k>vs8bkJwxwQ~E~;CdRUFxShIhMtofDdPXm;J&+NC)Io< zUJnLhFXw*eJ)%v~=8J=y-ol!0U4Z>vTR{i$F`Rk^8k8r^2I)iWrny*=%|)jJq4ozn z-(#)SeHH%^?Q%o~6-e$K6`YHCLOAA2Zs)V=LhoRj#5zVH*}JmFSh*=*ZH401H<#4l zRR7^;cU`UkKTPwTs?~tKGOKxpv2%DuFtC@%feE{BHn69Z(v#Dk7JBIUoq`RN9_fw3 zf41L1m{JStMkR-1eR#jOrnJkSehsb9y2|FS$jejj@jB{i)}!^#5Gp|-y}xO(eYD|Uy8<%*Gk1xEjUYZaDb z{ZMBoYF{;AGKqUG&-IKY4I;+qpIO&=8bCC?nJtS*eGp_Hlcp+;|BYno)Qt9Df70(W zXsXui0J8ZG`vo_ByiV*U=zz7?4|ktJ*wb1ZmwYw2{jFj?0M& zpX&Ye$Ka&`mbhURk!j?*Rliy|&=>e};kln{JpY={Fv3~Z-aeNUPGbN@i79JTuOUW+ zwBudMVJiWAuzrp?I^iK|KGShf5xgkFmb%S>riNL(TUS4G7G<3I z7qxW|lsv;Y2NPzLD<-$gpLrhW-}7jh;jNNqYb5{O{7L&}B152utokB|yC);AI^p}J zWoKq%y!E>|)*a(x?Ie~bNhpxp{nDO)rA!mHx7XN}-4I}n6`2*fhJza-K?*QxftIDcsT zMn!_s3)>d&NK15d#~kZ>0}Y(iNKKs_w0=Abd;ddi`*wE=kA*r+e`#mM1^BNWKFMV1 zn?FQKc&+0w;iqCE)mARPAnU~gDMVJjPlUd2emVUQ?|V${hZ0k}b#Zkj(I++@Btp6U zHbaSzeQ}1}&u@!Blcu@lC5;pJnZc2?!#7`$z%9$w^a~uI)=|?_-8163)cz`$dc^&^MJ2GTz%_)j@EFs=D7y{~UBe!H? zG02(5fD2JJ9%X%#GbY3tKX_P0rU4|PZ5YmltfC6vffh(am`Bfdn7({qn z9`k}1Ay5hp1XkG+m3By9S{B`UVoJ4Ae5z&UGl7Nf#U;O5va5>cU!>*+O%r@wub8~r{NOu?pkxr@BJ%!pYH#>+igui{mIui^1ubo?A3(Eqp3(>rL~Oimo@Z; z2AvofND8w}hFXP33^=utvSo@eFB(=`G>?!XxFDp7r;*loq#Ze8Lkf3d)U=O?q2fB{ zcL`ngB2HcXT^M}6$OPYxGkl$Me-pg!WYz^;D)`LxZhc)==mK~9?ZjE=Wnv-DDU zzHcWp!nCJ*{tBu56OHQhGM75H`S1~~YSzxv*F|=np+ zQYkk&_B@w~rUbL1)IDTE7dL79F3NnynK*jh)+@~NvbK}*vIchKkvi6eUxpE6h&z=N zkTzV&qXgfsan2R96x8|tTNP-^uG@td$Tr_$>Sb8d$`D_eJ;cK7p1VB{j^HXL6?83y zZ3o<|qeCrw9>K=xxP3uTV4`(@ZVwy)BhrNW-}id47S~7wE*cF}7M7R$3aG?x zB^iYSq8c5Qx-bK)aX%eSWyyebBFh_@R@1l85%WIp0WZG3#NXV|loG^8rc!04va$8( zKyLOg9)e-#Uds$fiO#>)xrR_^6e@dY4+Y`Z3!v%HF^os1a7EA(Zs z<|f524U9=5%HU#Ip+T@?80}iOIZ8K?Oh zlS9#ln}c}uWZSosb}}%)JjA?AKwi%KT1#K%of`8K5TXqbh$jDWZJ^?|vRY>Ja0{-$ zeg=%S`jZPfut?VZNBEFrpNl?&n1dnN#4HL;l~`$pfzKBZ=1*yCU8V*7a}aM|xLVlY zAXp*Nan|d%=f1~@_vs+*XoH}u(wobltKyI@gCIK)fRq_cFz9fsgV8#)VvOp5rKlLFU-eS<85xF&AV z2^L(3efrG%cv!AfQRZXi#PY3vCcda>f@1L z2OgB)&0dvTd&SsRG5<4_WYhklL{50<$qxWxmSr8kWwlYUl?!w3+I~Dd&Cm0a zolFzxCOm)f@-EcmV$|Sa3RD_hB@6IL#tHYpw1_eW#~V|MC5(1G?MX{wA4Jk2Ti_50 z+gAvz@Rk%|F=z3Y4V)={h=WBe5Y+kZ0OR<1t|0w@G^NJwAz=FN^1iz^6qH`Vr$&Yx zmFwM2EGjZTrB{Sl;L@)FT*O_>En_HJxeQG1jlGT}v5b5ut6D2!upGVjm^9Wb0*{ym#awa_Qd5Z0Iww4I{x_tUM?5GnD{ z8ww2pS;toF?oHG(Wq##tLhD3*<%$ty2t!ut2e{@rl&%~4nUVt z4!R(5o9|T}k1=`YJ#8C6OgN@hsL~yUgdEjl(?tw5b|PDy`3|Q_HOh_-8Jy1&+FjT{ z>|I^K=Y+U-^lM31B}XCI&vH@ke{moUG+@%FT)Pa+Ul^kKNh|J?&w= z^5eDF?q%0#Baqemh5Kc8>b#ef$Bpl*3#2gdVLLb1(g1*ZpBztb&1uUH+4B(Z9n<8D zwCib!fv=}O&=hz$Oyf{g&q&2_64VZxD*@?K8;&w3d@R&KV)|XI@T>5h*L&FXzum8i z_NzSdV*#j4ssw2~ZKL0f0LQ#IGhmkBCOGEA*Zx#L;$1zj?L=_x6}pX7uPO{tMrRebs! z>86(Yz8BRR`##YyF#{5!4E>uxC1)_;tTg=GBe8k;hyo5`_>ESWE7erg1*3ET^`sGK z*crG97AbXbjO@7o>xBEH=HH`M`PDwF z0|AneB8S;L8FUAG^0VTClW)Q)&N@$%CY0;tD#9J+W=~yauh?>Lq`WYg3zd&&FxDw@|pKcNn5vZ*}y_Gh-G;l687d1hh z(1FQd3Ke5J)oGCOZ|eLLxvMQkklI$r*CmI(Pa+#`BCCfgf|)&KO8g~L?cI_4h#yOi zphXByo2v7s^jfUXZkiUxt-&hTWN3|-@jW%a| zR|qdw1pn<}D`$@wJNyn7?WV21!$d1XhqC!ds$^{25j~Otjc8K$?Gpm216tQpl-HG$ zNC%A9YIx)Z;KsQ+14OZN&<0q62pHALU?z-zA1;is zGQ=vYW!r7TI9gbr{qc?HwPy%vw3nDlkjsz3xZY}G z0Dwfw9x&s&2w%W9u+IXi=CH64S+?wXGX84EgyTvmwisD>RjWMmnAX@Zua=_j>WdtT z%1v0n6|pSk3#fl*PH3;TmYAc#jl!Q)X_Yde5oPN? zslT~#36BYj9>K;$YNP@vR(IhOH1CF7y^~EW5{%NGzeB4C><>g2-cL{5p02hkPHA4B ztEz*1?87ifX9gV$ulR4kx+W$mwoN5wp>CoYc&JSlRe&W5M=B@8@d3SYLP2@n$*YeL z# z1HAI)7eIK;|jAMpiWac8>F5#~Q+B;JtGv_N)SKn$mo7pB& z+BAq~8D}aY;Qd?f_BlRZ@%xXo`(E2}+{a+6B7484$N0IgRK|b!JEn*(gGlXDmHVmZ z`t!GUzIb!V6mly5+Yf{!}G9I>jEUzco-I=$_WMB zgu?)HG9Ik;16y7T$JjX*6GLQ)1@RwCaCVMEhw{RR`yItE>j)CYPM)eRx)A~C=f>}` zA3uH-?>pC*cLrzDy!*WC6)JC|g51`p*Sv*e7 z6x{ppYGJcU6GkY~%eDv&V<0+ci|>=fYL`G{E_x%ziT6ywf9a&Lxh9)_!Z~FEmmFJ3 z({nwYH%rQYRhgF&Va)-}0Mq?%{^J&``wPI({!bsjNXM_nh1P9_3>4CU#{>ND51_D8; zjjXGv>9G&&S``6n2(T!)(DyzmOTECfE)D+4%hsd_C7&=3qmrHP4#+kBC_^55%eaN# z83&R+(i^slI(UcfWE~vhO(0%U?YV`?x=Q;1fy1>uvPzZxf@CwGBtHY~@6upM*D4D# zR4#IVp3w~;cb&XUIqpnng8LR6;|wN2QW{R#o<~8)48MMuOo1pSU$hzY3j9dT9|bo& zvy#`@n*`wD^>)n=nfCAEeUgX@hR|}%g|h2Df@k^ebHhB$Pt~h%NfPyZ)>yJk6TA{u zD7g#F>XN~%kQQLJ%vQKI9_bcRkH4^o{ykTbA>@L;hzXSC z2;bX)jwtu1XQYYX<&-!^I~Ej@5fh7_Buvj?qRgpdKRG%)+o`Jp671i$jF`P|*-`Qy zTVtk#e(VCl4dpcSfaKK{py7jn^S}uG?{hxn>c``PN%eQSW$E+PeIOjm`Fc>MgGO|< zNY){d^oMx)=M+E$h#96reHbm*Y~psKZ~Mor4lwr(Xf`^=E2ZVr!wNJlZX~%>_{PJN|r8V}VaJwF^XcCFs@OFsU-S!&of`v@bM14%_GCzCBq!z@N zsDMGn>29{Md1hUk4J@bGK^xoIXU1UOaC=!XohAo|+D;?uZz=0RAJ9V9IEL+bd#cG( z(Z)aFIyi7#3{Pi1*}(P-X7O-~f(<={kmLhwcPVe3ZO0E7ELT9Hf~Adr{fLNAO`YjM zV+HO{);5J7f6wEP0B?`~N{9=fKcH>3R$yOC8GjF;A~O$JJmn{DrN3Pj4#BI!Heu?l zNK9FQqwFWjUtZk~Gf@+COQljb_s#IS$F|DfAE2E#NMR+m+xuokTsB~cdIRmo9#O>6 zt{-8VIhC`@v({>l(@&=de(UtNImdWfqpH#w8m!`oLxiK|3C7g#QtDM{SCTf$CVCZl zjgF}zZK!76Uy=*}Zw!_ox#n-UU@$dWu3Vyr7nF<}{o4SdI%3C$@xh8LHN9oJZ@|{6 zlcZ~fY&jY(01?AU+nPF14>O?R6}IWzGVOWn;50ONwUNQFZ8&_nNdoX0k&dDpmgi+{ zYTJu){^w~y>we)9=RSG_msW1-N9<4$e+}fcT0`B(Auw1r{o1c214GDu6j>|TxK0fV zQ192=2>{ZlH0M(YcIebsCOP0dbKfT(nQZTSK8N^rg5g?F zr7-BZ(tF`Y6<|6d4XkNmk{CeI5Y;wEJ;k}ogt<<@*eK192p$`pSM({MOq?kqXm+;y z!<3`9LQ#`I6A068K4pzo@EWO5tiuf0gPXAPzK@xrIxiqGyT6L`3?vv`&)+zVLB#{WImWA(HEL zF@CDNnrKci`Eau>;krLL-r;sWo_&+O`IPe;`jZ}`slo5?&$O~ zM^lQ1r_D1~A)oTbf`S+AjE3j0?2DgG*{PQ{k`E!^vL%IG2&nGG1VM)?#%no5=li<%uAM6*L3>;fC zPW14QVw7^;ljwl`j}0q4yuCzc#?&xo{yyD7m3A2WDK|sp#Yj2(9_uYs=TE{>a%PYSYW44Veg(h%)z_BYZ}i#XvRMsxN0SQc~-PySPd(K6l+dx ziG|L{$|cs9T71T4rkb@a4G=voorsqh++tJVZ?{v?Cd!Otlv-)5`zU#xW{u}?fmR}` zy!FYh%exWd-MfQWj;Mq_N6%m8jX&Ir`~)>a_x&D0qWKKr>~Z5q+tsZf{N;urf-vuJ z7YY9O-i3uv5;gco%1TwCZ``EThtXHx&`IGp;eIA5n0&bP1XS3S!gK_X;LNNX2o{S! zh|DFXkN1m6W2BO4AUadB4tv#)^YE4qX3kSpY+{$eacxXkD5H)F604kq(32|W@Mni( zuFIav-1rAhl2YQ8UU_0vPh_!{ z)(+=l!!#$sTqd-}%?uEY7S19QXkt#2+{h|iLeeg!aat{tA*Kg)pMUUO?Zu`%X7o`i zMDTO}2I}(h1^oc$^`8nsf2Z12zrGl$%}Whr-R6P|RCf8R$z_Y2JU%p~-~i9_OK zN<{x5QtkSyXLEO-?g&fPjepYtn;mTVXfJ{X(URd*Y^Rrnf83m%Qgmw)dfr9!*wGJ< zANnp3P(3NQ7~b+U8ccB}ua|}Q`l==5QmJkshc3{_wF{*&SmdYYA#*GeKO${OFvsBz zF1Is?H;=+IK9f`t&z4e_)~#ymXn*VL+pLt-3f@H?YUdk~Rh%~IK9AyqXe9mo;)f>Y z&HS_9GJ2eKUu$4uJ)ECFDyLZ}1CLl||5bn#Mo`UDc<9=3)vDoDdCrjLe>NJ>efWJM z595MZX_Z^#FmY)-#m{K?xT!@H22a~8qgpidXTr^bsJ0!bnlT)Wnj^(_$iuDkWW;qk zvw_HUa{U=7DWx%UB8=0vL_yS<@&URvN0GwL>M2Zk^mVKt<7HGVekAKNv|EOfTQv6h z`s-Evq4=M#&pH06CqJstV@n)&uWI9S!`%rphWk&#@uL#dKBpugv74bj6F;_$sKB)* z_aq9Z;bfFxzxd|2a!;Bln$fV0g?9ORk-I@Sj{`D2xoVKgkIV3~Dg$Qn<_s<1r-!$* zlf-JMd?JU4l$5~w=!Qp`#8MpQpXGIN+<6()I}eZD?(3ZTZ!9+l6i~<|7&IQ;a)!C2RC~+6exH|`1SGHc=QB;Uxqmo?yJpyzfQ#$xkgw^rQpJfJb^4C7tzv` zZ)(j2NE+b4FG*9&PteF}-j~l7gi8G2HH4RQ7ZKD5tv!O(>I&&NnY@SHhaZnuFV7qs z8?3uVdKNGHTq5X;V{9jQ&jvxo6~CZGzjR`QT-?RA>Vyo7?vP`C%ZV_Bd_B?Mm=3*8 zD2`Bam@daHlbhb31&d&N8k~Rew2`k1Ddy;1vBW^1Z>Egwj(ie)dR~u$fw+CXXO1pJ zBU^jEQT9HoQ6{N~6Tu?Pf%Lyl7YEaD59UY4)TWX%nteWOv^b*Nhus-Z*n(DkwGV$z0YEos!&i9>?cU!T__mrE$j7zikvr+UgQ!puo zaUNtjOoYhEUnj+|`h+6%48RGtpe-m~);l%y+RkK*+OCuky8 zbkRv`7Me@u#mr!P`A*29dSV?^?n`iQLU0XY@3-w5x-3sQ>LVOGck=INZ7ST)&e(Kq zKnSJqTUW!fDqQ)$rmtXH^45qLrpkM-i)=UVaL=6qqBaaht z!kW{{perKJwJ?vK!F^8|sGuZJk(H!mlNmTbQL-#GgUt-2pit3)C1#K*`(V`okEm!D zmkgON^`RnapY0}8nKYdMK|x2vtP}C|Xn48R+CuBdGA$ey-TZMP?&%PdWH~#^L*3gqml%5|4+w*PQ&8`R2=N=qG~7)^K-aCRf|<8iyi{ z4ab5N`FSd|#$Uh0y&qF{L2}ETX>LzmSY&Q(Hgz(*ll6V0mvayAX1w`Kox5D$IFuQt z%M)M#^^M~}x&Pe~xj^6E7P-&=p&B}c@p85K%3kqDQw;}Z6)CVHRu%>n; zl)uy{5CcgHUGA{>6^RqvgHgUW`3m zRmFbm5bileP5e2q+9!?KFM}cv9_)$Mhr*}6FjCFRkfA~j+y^pLkX{$=4Av%wEdx^Z zCB<=JG_wjTP<{E>?l$n}Kd;UHo%6&8ZOIy(;vINv#x4@e;+`sp4zk}b!WQO!Oe3(5 zv7UBoCR%xZ>QWe_mw<7{rb0&LfKjfGt(0x)P%PU&q}a6%LZ}_Le_|Bs^v(#r!H?9| z9h_eL?B6&j?EQ+2Wz;4frnh)6j7Ra3htDCR!yl4KsTZPcepCYl?;rdWA9c zwx5nLlnUia?a8KQ*g`4CdIs|&G@oP{BJ9O#>nkbYs(#7WvULaPE(~wk-_Y1d+wHx6 z1K*flVDZ30H9IRoOMdCD$Wt5)%ox>Au=1SYHQkT%(H@+7TMY99*Gr@Za2{mDo8!$a zo(=hJ5=UOj1CNHS;Hj~xtiJ6bl&l>uedgO#8f{LL_;fw~W8np^Q&E^E4W8owofhZ~ zUn8Vqb8=Kqs4#R_FntkKjTB>b+q zx>5ePRu{?9yqi9TGVc<~gRW}vMeDb&{jUw2x+yy9h_U=N;e5R(r4lugMn`p11${xo z&?VQWt6A4Bx}-U|fEG&XGHw_7A4<|xRo_3m4*VbiT`t(~1-q*+SSVvG#MfRc1L_Gq?j<}KV3;prxq{@v7f>w`ursGwzz7(3yqwv~PhO-*c z{iIr|;`?(}X7>0>?0XA&QY6el-1{weIo7>OeywQ59Kksk zWubLPNdFe09p8)wb>$?3LSPvZhi)13gg;LW403Dnw7{b zhH2lU`{~Y;I#6KcDEVhec!B?qbuN^sgVinPe-0N9=-*ytePGCJFArwnk|CJ=LwG<} z8d;7F%kJ>Nr(o0 zQFjzgW*$k^lmZXPU8hH;i-$MN?iQWV*k0b0L|hlxNXo4snmD{}+rS99ikD`Nboq}^ zH)Y`3orxQ$_OBQslh+v$5O2xuXBnc{`s)^6-;9sn>l|Udiy@u4?5xgQYKgED$6T}d z%7uph2_Dmh%^Ddo(ER@bDl{W+hmiG~BW04ZT=}=|hsE%+n$c-txoVCY!t&Uv=(weH zwx`q$Tm5@cMN z5U|?S?#lR`ie2PKpMFNd*hr0SPCNu)Gp&X>0VDByLX1*6hw zxqmaYL2mdVoZcr3H8F56Ai^@AK4{x7uRI`scd0j0O0M~B4o+5qJzwR?Kc?O%mze|j ziGAPPYIT6Gq)rL;tZiWs#2zn8__wYZ*ELl3N0^4GB1-u@C7CLWTGU}*qS~oHEl~qI zoO#1TD&(1ARes;#?K+DP(+uK+7OZ}m+(%2A7ZIDVD?Fa!!4=~B!itI7MPe>|F#OFn z1uX`GKNG&i2qx=G*mZT!etA7Rz3V$Lvu`%Ht)c#Cdy1D;j*7!E7jrqLZ~13-X2j^@ zM`=?S*u;_Gc^bq5P??UX?lmN-9A)yaV|~u^Kk1QILNlC9BhC!MTPk1Ycl~5My_va# zo+UEDaIrRmw);C6(5OPWtP)YqDGuz_l|Rs|3eYE31ax~G6M{&{a^3g-TptHBJGE%kmmKwIEO<;;&~TSV#hpGB^1^8AGHwOJ zK?~Pth!%X2Rw^V21Tkj`@Tb#jkmMEUEOXaCZ`ogKE@4}gwy$(0C4!hUEhM!{gH1m6 z6&Wa>35^hi;ZA@NQSHFTmJox#y$793q3fEJm;zggh!JR@^7M(RFvdUGIjj_v@>Nqz zdZFEf)#i=t{Ul-o-|-zTVoHV;Q>K>>hN7~(F*2f}*MKi2qgMBZF!eIFpE?U#Qzul7Z> zcIVRem8{>D=;Tgph=4bzFgIe?5&~2^^6KK*TxrY*64iLo)ob?m8*nMKV}0Y~qbJzk zKfs?h!H)s|@8Qsbky^Y>&zep|yv0_9n?%mghfLDLL&v^+g6iT~?)`&YFm^e=;J+Ew`gN zN5ML>4tC8UBKVf(?a_9@yI~H$h+K{fjec}%2%A|V>LJYQ8S3LPF^T=E!7#Vi)xWHq z$BUEoONase2yVRj{#3&a8%DVm{)hO?&z=qHXrqO9=%4F7wlyqO5TUD08$n6@tApKT z1_b4MJwvG-FM@w)q3HS^wWe-@z4d27y2a?PMe0@ z_o{6d1S-^#1FJo{)NZda! zp`^l)FkBBk!3ZV8L#jUQXPdw;O0XLcl1zwq{_r%u)=I&ON}fE>c^;1>ZsLto?DM~? zDh#Ho|F=vj2bL+&#i`9g_m?7DiS*WJ!@DVk3vLXbj292_5@d0U*xz8cURl1Q04H7Z zW^L)qPwe_Uc2;kSpRK4;i3NNH9Qmlk}VS3_I^I#EmSRLxSV2P`QlH=j<$ zvX%C>RkE{hLm@OsnF9^Wi1qbe6o}o~v%?dA1BA1%@UoJ&!iy3U`w><~Ii_(f^DCG+ z=Nm8kr%qz0c(*jv%ZU(!eZPGr-@Pc)tpJ~2Di8CDN|8Ey91c^MXMD>m*^?w?-iOFZ z8ip#D1;PZBF1u^HY0)|JLvb}o6x$+_yoa?trClAJRw2oJOTZIp_50*J%4QN|*!{w{ zOH3jUOiM8GU^@Q~*0+*G^F+)t#7xvmFoTh+W0zGGsAux5GI|(&Hy2}<&lz+jjKhl( ziLl9g$0pM#gpO?Wt^=v}dkAoQ+nzS}qz~IAOE1=EP>S$d$8}QKoJOtJKyh0*-#ytEWQQqAbb0aS_M?GPkj|PpLsEH~Er&ig4abnV~_D|GaZv%EL`_>o8AJlV= zFmq*E{3(?l7`LyY*a3BuieWRnT#WLtV%cQ$H5s7e+Z$^MY#4ax0MVhN)NSX1)JbP_ zP@mm~nOZz|qYtqwyWndhxeF;O`p0+^xX{pm!U@!OPb29ZZ0BN;K>nQkyJd|bN|`Y^ zD4HsiZ}3aS-zR$biC8a;?L9o~T~6SzE%!nUzXwtnuS37V)K{fql+K^lgazp$7?pY1743S7n6HbDgq+NA_ixklRaw`=j-T&R5DZu47qKV54dPIv{d2v)aP6>~ zOMCu4!(q9G7_qtO+93t)-TqE#S3K`itQh$K^^<`6>Y)9;;8$_XbO@iP_mMm?EEJ@D zEa2fj_T4+Q@9cgz!DtBt`m`Az^^1lKZ22pC;}5Gr8pGiH(`jV+=m%LPMKjD(N3QP-IIdjMR|BtD+jEnO5!-bay>5@(fr8}gh zTa=b=kOt`n$(07B85%U3_8ETv^LfsB%Nus@y=Uh7UNy+50?t21tSH&L z#Q3pR=T%*whzKu=(TQ=ijw2bh$3JAb+T^{bI%QLd1UhP|FqpSXn8O=xTXi5`)DX%q zbreg~x*uQhPdSbl{ShTgkPz3L>xTE%h^{}$z`B0GxWhW}d_S8aL$H}enYN{!-o}8> z{^*I+>Z01SvqTs~t-_r+qZGg+O-U&qi3}~D@$kj?>sw8B^-zsILM*wjQY6B#gQ`Oj zE&Ug#D~tbjY^e|7?;b3v(k(N*WaK%xJfZ4&=$yR>BHYX0X!q1GHq8yID*Uuw3lvIk zGe*D18ef_~N97XeSFv+R9K;zEy_ZVPvKaZ#xDbba69F`6-Bx-rOYX4cBI$}}G{xOq z6_)kgWi!f&e@;k`>ym0MVmReY(jQu8f$Q$ehXfGd+OX(PX@k!*jd_G^H;Syt2P+#E z(vgS-Ilku)#ZqM)ve@RDl)8yaMXO2%A}647-8UUTj~b*| z$EkBZx(7+nK|zMIK!`PudLS3VLc$ANQ#QCi-x2jW`a!ub^cz2Y2~KQjz6(LPP8R|4 zg*7nyNL(XvNK~ac*Xnu$8-d>n%ErFV9xl z|5-`7l;H3DKwj`OMf*jNwtCJHF$^_f#v8t`IX*|vFlN>no2f2Cr_dKJTKrjH`e!YQ z3(4p44O-vswfA#-KV=S^&)-Y37?pS3V-M&Q#sb<+|kf-fRW zYo(FeS5yoB6oztqO)M(BEhQU6_24FGlTbB*U&%)qg;ACl!^qnrDPB$Zb4OS{E#Y1A zi`89TT30;kD6e$_x{qSxkhf}h95~_h1=ephxxMdNbU8HV+19d-24YE6ZRS4g&(yjI z*uX{_(WOw~RqM^@qxaP4xNm;64^kb!x+s{1*HrKJr*zY5T)u#Nf^-%!Sg%iO&aXQO zg}(vC63Th*K7TUQmU^55^A8sjn}&qFsO5T3TmX}yP|*2SHi4IBEUlcFOubyqElqqO zu84g+&PPeE7)x^(*!JjtkH=I8>$RO)8@jR3#`6eBNC^5S5kAQJ@v{4B>02abNh!y6 z;G6|JrFS7V_G2N6zn3RORE(o!CLnTEoO*GFTrT{Qijw$Z!L-K&&nbgzzISb-Cds~) zMetBOa$fGt_lV?MI!%hci2eP6r-9(j?g6()p_J;(IZ%qMnx zRI?7HEwiXz$l*V&A+?*`^F=L1Tc^-w8vU9JiRl=vC&|`5qL`SDBl}~q? zrIJMzOGmxPSH%=zLH$-Fo1X7PTcjji5Ek;0U7_>KSC!_r?rb8bLz^YXtKLE^pX^y- zRS^7KgMSi^3;yRaPJXxUz_n9!Mp^tETr zV=Q{V60*Ih>UcbR(zq=y5&K5OH{Ol_?C7Xe5j*QlN@Niu_kODgPFP`q2+jN zW0%X(@8iJ$oh?akbZo@eUiSj7w5PT)=X7xBNwcpezvM9gS@gxAcxc{rolRN&ritFb z%x$eX#4qi$P~B+ptpnlff;ybottQg%$TDKm%e5=mpEd5Rzk!y9HbL`USBho!KkS{E zM8za)#!cU+mxO(iYEFrV(0xF%)&4DJZ_}x(_EMr^ZMvhpcue{FB>Qz<3X9he6A!g= z#^2?bMaECry_gl)V2*vOW6{n_#IRE3&E<4r!wf}+yC^f*7wi4ov}}Xf&g?dKrjFUo zlO7&s?xL*C*M}$pd3q^wSvbh+rO>$1Z>nN0^bX72a#}3UZ@ji1*udVML@2La6NDYR z`_3zc>s@EXD0}8`4YErvlD}6yr7yyXU_QlbuJBz`H{x@6zL#fG2J?SJZJN4%yY~*! zN-D`0zC>o}xQJ+OPLIbCTFH1x@(PcI;gK{5Qfg@2(PgO8XH-Ek?Q6~GcDP0uK&bfL zK3k7`9m+6>AsbT?fhiVqqZ5dfQ>wlg!mL`n;bIzvFB@}~l(9dwP1tAzcxoi((z(%v zh}_>}OMVsj!(}RR@d5Pcwh5;Th!QxA_)o}`8Wm1ZmjD57lJeXmit3^)5W@719o;p`#-z5l@rcw*P!}mkZFkO(x0X9FH}-rQObU- zYvdP}x7%5W@bK3Sjx4L#oN#fh_pRXj{DY+v`Fj3ps3WuMOLMx>#n;S=ixzt@L8JWT z&UflEyiIk!dLs5`wMpy;JWi#L{Q*{8wcWvK$JUml;Dp_~eroZWKv+85&z+9+&UW98 zMq0koRkW^uE%q^1F=Su%36L4Mw_R!R63%g4g)4XVqeWgiZy7&Qo|*+6X}t>yDPdbi z8!52-V9bf8t!_+i&P>iC4QNamowaBb37q2|*vxTFg{6t-#`aZN&HR_I1|KIakiMAx z;PSVcUb)6kYmwEz?)iIn+%0x1v)EuxR>4wKG7aH*rTdeTEPx$LTN$1%1Cf1V&E3B& z=A&4qZ=BXgHUUQTX+1RvWTv&m{ZDLv7vrDD)axLFn(j6St}{Hg5 z?7mbSK8_o14U&{E)pD6?nqury{Y{J!O;Cs7K*)M&KmX?zCN2P_DqzQ;wvnbAXCb3D zn$Vl?4bHvc_K2Ms-NY2~2l8!`4T-CGs|jg4aTof$ned6BSf<~6%+}wpCv$8hN0cTr zzUeD+_*A6)+^X$$9}9|V)JW%=9R-`^#srN=PZVG!LN|Uxns!;H#Hir3$|qp<`t0iA z<3qguT@%ep)7C(&DbUgv9G=^#HMHgNR=AG6EO6CBc7AZ#1yM(^)0EDaYk`ge>3+=* z28;`oBmhYUa%S@w#+1ICXkVlxInZYl2qQ0gxd9jT@|nQVzLM}+H`jvumJ%xb@nbY) zZLN^8;<{!%R6apj8fO99wkW)&>IxzEmp~3-yWO{j4i2o zIg`%$I3kjGonLxZ8VVNHB-wm{!A6CMMS!_Yf-KcqzIru@f4+9|QLeUD@Z=ChIO5l7 zwNK)69nKPAI8iEelEm#Z?gJMc5=#@8{g+fc<~(Pxx=D_ka;FvTw$4a){S@dlKi^7k z#eQeG?*qp+(!%L1t?=1ifp()U)c)o7ZzlACKR!BJoqe=OrnhQ|Mv{n7zC^tHsLmuS z(48^T4IYJ@@BBGSM$1l-iQ#;%~9~Fe!mcVKj#d2bm|rwH+DV3?3p-3(6Y< zP2?a^2d}o@@$HT>pN!8=Hp3YVjgu;0jn`+tJ9{BBR zc|nO0Y(Btm?X_Sxbr8Q*%Pd0rCW7F{fxP|6XWWNw^Hqehn*kRwg5TqxlcKBw|JHH% z-T?0B-?MAOQT~vP3?t(($qJ3_e;(|LwZfHz-;?{phhYlK9F>R)@=s3)>N?*2aNuz~ z#^m$QzvQGVi=v~eO*m4PQY~tIj{G>RYG*9wMhm_S`Ar z3L)9^X%?~)jW-g>;j9klFGT(ZNC(s1`DWLc-44sxlk{Aeh)G_w$q zR?hauIGQp{#p4YI;vfH#a_eO3NlnKdnI032vR#%69^(lW1n}*y+olh$PbW`MaK8X= zQ)0J_or}CGVk#VYsgtRu+BNc-zQS^wYqa$cn}UtMvOzQnI&)*XRW%b|M?Y5=)jxw6 z0FO~2{V?9V#z_*5%X-&(w7Ow~{Zi+Zg$-jBKb)h3Pd1^1khk;eV@x!~7ge6UHz;QT5ZM6Df``wr1(QL7k3#KqEeELA5 z$*vmHx6H3MAnj8bfE_slyUwdFGoM2P^MzTmf8IM@QkdvCmHb`zIUp>)(^EbUvC z9!_LOhOY*3D{XtbQ`HZ!bX>l?({G&`A)<*Cw-b_lPt*nN-1g-=$gm&MefKPH7IIaI z-^8z#(;8TjTXJZ$>w4(9A!Amc;P{hx=`WRUZ+|>V&{RyVUsX7CeWq{s^Hh>V6RF8_pOQM7{hgDxMm(`DnwDpyqSj(+1%jTHdLZd>nI;v$m4ew`DowEhTT; z**|L1TIjWO%JPky87-bJJ8!V8QBWD#zJUr`M7NBdciOKQB6j0O4>{~78YneNaTcEZ zL^(qdmuKHgyrf}Usxd8G*U2le-gAiX0O@4pOZhQ|F#CrN4Saqh$TOyAG&`R>R#oea zy@L%rYcPR4J5I}-%!WZ%TW{7frT1@c{@{9I5aIeb7Cjd=y@tij;AKbd%V*l|$S}>N+jd-yc;K7T^Dhs9l@kKfcBRwo{%Tm+}_xZ*GxVJ2lPxkGqi}@B?>=!)$`Pt6RA!VqvKe!Kf z5;-tQ8K%H!4Sqlil|p62N%Qd-9g-SC*%eA zc7PMqh+XYmFHS!Sz4KS*aMv@JRQZM2pe5c>3V)7ydou0M7h=11HgG-7%nAu8VS`a! z%mTXTi1HZNvl)T^1vsOIUVWiB7k!A4;XqFRWI=j54sUoSqK~^z*4HmIfBmepXUlSJ zcM#q2;QKSDhosLxcXnxg4(CjKR&McpcH^6^X@sIebnD;(@}(%8Yb1%_?0?dc{B7kG zDLm&lK$IB0wN>4iILkb$>;K@A;jEupvxAP2Z!Fj?)E$0}xXr_+H;9u##4cq>auJNif8)5Da@{txh zJvwx!#_1;sR^17ezN#TMQ({hLpUQEh^82vYF#6+rOI9u*@Qp6)MD5gDDB`?L#y5nY zo?Ppl__y4#s&DvG)})#QIRQ7G*orPj<~_4v3tN9wCL+>@tU|^pj%~Pxu$;W<7-Z?G zuU|U~+?if!8ms$bLjL^0{D_QJ?4z;~>4G0;ggZLE6GfU>;?ay@7x^mqHLOtJy|@A% z_92O+c8T32ukC<Rp*&-grogG_o9?5mhq4vDnO#2qr?gNC{?1j(?S{ zQ^?aL{G#E_4zzysj>GyQDVx7w;zXj%c zsl*r!0|wFW?<8C2T3tf}Qk(>WdnBo=(2^#!q41g`D-}-p8X*SQ7#IUqdss=Z=0@4j ztcc1h>=(lvP@N5*y2tGZ8sKd>5b?QN-n1yu`NPoPSM5iMu6qCDIoJ$;N7Ct4@}bY( z=>1Me>ow$l{^bSyxg3j5Y*4K_0x%ow&&+@4#p18`92=z+RfBfNr3Oe&MYpsZ-@p?l zAx4EKpujnlQvigQn>52X%}+bJqNDX~*SR8vMp z{YTc%XV1?)kLysdbHT)z>x1rh)fQD%IsUv_*$J-VQTm`pEqd=5jX%A7jF9=eVsEtM zJ$b2)NuUI~)q|P_quxvo2A!S|SJe*o`AoMYxGB+LAu)0t5m%-LZRd02^#;{X+j!2< zt;E1|ExmM|!$ z4yC*;@45Qqny)1I-Hlij#SJdyGcP?!U;V~TKN18+LB@mv^moTY_=9hqA`N1wQCIVj z>G=`@m}Jo{sgF0^TC4R^yMm+4$gl;{Z01INf+~u!JTR`Wu#jW0<#^yeTVquCyfp1c z%V&h!>e<0~j(t(4Kusw_jGz+74xWwltAsceO)Hub~NlulSft;aTRFtxQ^=KPC zXgJc8iIn9|0i5=P!sEQV&0rF(Y?}Lg_;{im>i*MgUu5+SXp$7Vyfj`*Rskd49xgf`$l!zFv?218{ z%rO_8RNFIBcGY?va5W8Sex005w;Gv*_b!R_8OLFrYR;R2G(F@Dw294R6mq& z|2XISSFOcAA&yJrk8njFU5$(!eab(GW5@b%EZbN z*?VIyNFgG(O_Q>RzbrOjFWZ3=h8TlZw2FptofFD=|L{p@N&Pw8ue8^d4(=sW34~w3 z?9bOa0SEcHQ~U-ZF5MbHPcN!|R4o1BJM-oz!l>a$jDz$TN8rHK7DW*6QBvSR4WceY z07?TqNTK|?^_g)ALDAIgK>IoYWLP5}$m`k9yZVfyV_c{bMsFn_;+2dHSshD1OArLA zmM1bO1Hq+VSDIe$b4NCQrHsxA5mc`*e`MIv8==M?dF~g-D0fIRIkysn{D;|v55oyR zJ8c(V&dT^DXY#9a8=Z|*?cF!sJzO8+FJ907y*(av@CH$QHi8k>o`r&f8L$2r%fFRf z%u%rqT>HLbTcHr~_srO&+!J3o(o8Da4YQSk{lRnLN+LWC<)b2%)fVY{Q#NCkf0A!9 zADtO{#~k@(RDMC%!>rDh?h8dE1}pU92>M1e#m`7?>NXQ%WJy?|&Qi?LvmwBbHz`2f zQz&Z!@4uL67VL&eUP@^=xe1silYc94+N^kf=k0oQ^dYJQ8lG<@0i4G{EVHR;vZ*CM zSX{iXvSdg5xsn7XvoaIvN(*zZe%^iOLEW}@7P~XIGS6x*eqQzRgu@5Z4@5Hln~br1 zoJ55DJWglHr$fP0>Lt$fo`~kJKY{fRf2F4p3B(RrtgYkTKSMd2_UG+nN3dj*pVVun zQ)~a#gN%VG0DN$qR#a&P9vs1L>~2R#C>*-QS8925a*=%AGVc;u0m2Ud0spj4HLFNy zq`mhf4LXWgxQ+VC*<9UE1Ad!9s^j5i*(KeYvcpi~>Do7pJwAm&`7e(ly9+m9XJAmB zUYt2ZF!e!}rR%HwTmU~F4-vzUjkl2bL{UNB+@ji>jUXov!8$5Nft01VX$l$+3omsi z{0u5Rme{$mJS7};cN46Om^vAq-0F&X91R{36~kktg?c?|XBeP_X@#*iWq2I;QlesE zW8}1Qx~=9TZzFLQ^D=QO;Jwwf{XE?_y3~6Y5zX&eyZhczRSnc&iI$x_{$jqdxxLiS z@#O1Y_YzCxA$<~&$v6Ank)9gamvzw9<-gy75aYg5E-Q4htLgW!-)Yqzl#`MED!`t7DfI$7I|Aw7_*yZjB%{Y}DNF z{rzq=5iCi|FeV+Z&OOrlhqT)Rdc7rzkP&#;iz4-j$6`eLd z{9IJ9AN*nZvU0uGmI?qhi(w*{O{7S>09w6G`|ZjCqIgAg+k4&uat za|`OW5END&9R@&Chlct7bo+u;acHt#!>#AGIa8WJ^{)%fb^$N8IKP0HqlN{JTLGV= zgaxkVH~tG!6sVbIX288`cH;+euR_8!EDi|#^RMVQ!on|q%W>Ou@mVIFP>&wq)5yh@ z5XI9OEjlwlHpVI1C6DlRkkivx9i6Q7{r~>azrW}){XGhw2fI-LdFJQN?*$w|LQ{;R z)*g=aO*juv`Sl!UW!4phbE_xeTJ^EufuRG6Ef(oaAIYR&laU;-P4`ro6 zTToCc?JTj&n^`#0oeUarVJ*h8pE6JksL+|E$%*5Q-TQG6sl|qHG^k^#DL$UJZzR{* z40r0t5TCD=Aj&A9ZZZ4v$wp&$Y@Buxgf&`z?l(RBGKK zWo%(nN-_aq=f?^@k4E(6ZN2e+v9s~49ycJfuC7iV#JnTS|6Jmo!H=41O79lIGHu9X zjnihdHi^oA_a5GrjGBI}wDDw8cs3+g87@~FKKJi^f;62D!WO&8WcWtZyOWMXgXY#B z2w83AbnAjBVa+p*4cHYei&#dkbu#oq6Cska$bI@%RoFL`E>u*So+H0wWKDp)E}_K! zvWkQe>^mNwgRz(H#y_xR60ooz%dwF=zRQ=5h)qOpWr;n5R5F}U>*63LKBsRtnanFn z7xJViuI_3a3T4)e_LbI7CJ|LnPj{|X0%pXV@37#5CNIf+6>tj%B90Ia5hC2)bA{`{ z4}NsBN{*g4K8YYJF>@-4jo}i^UAdgHyYCs= zHQhmHuv(~1zy01RcnNkTvh-!_L$Urg3li$*^2zT86J5u$Je(7v3UqV${bZ6*UPDzU#i_(e02X4>1qFs9Lo zy$EYv+@a76XEi5ZOsU{?a>v(e>YmSWEZaZnZkxILLffu@O;Ogc@i`5P7shXp~nDYfR#Qk4~ zuWQ3wnrr+qY@H$vU)SQ#YU-9-9Kxw2g%hgLxe?b35u6PHH0Y>zs-HB z@0WrfXx{H2Nr;R5^@H(CcF}Y${Z)B$8T*{ zWAj8VreE*RO=Bmhb$4N_%kZG1$_kHILHH5nx%K?7;O;l*MYAj}-f-vR%AaHg zKU7|wZSA40iR37Z_1ci*VAaTzzJG@RDS^q!25G#J{Ypkw?n!0%%Yo|g+!g_gYC~Qb z5S&^D$zeynrYhZA{h8SWc4t#DUopOb_|-SRw>=Ec9NMNoYyGw9D{-iM!8jO#xmR7e zvS7PzmQvfj8DCSX%{L8IzI*U!i(FaY#^-2j4+0^b(;C;ApD9|z$?Stc^Nj6lNJ=u< zWrpqhH^Op6V!x|(Q(MIL*n3&^vGJKU6aqRDUB_QxaGBk&x zfr_xi<8Eey8I*-%PbdUxWv9i&_oC3z(oAP;4<2+_^cA>^ZA)nNQIB$lpQc!U(@zQR zs-xT&*zb()VoTiE8=KtfTdsr#u}~Z~2@=X{qB*q8M?8d~81aN(j}I5%W*OFPmqnRS zkIo*1_Pvn&j^8W1;tfWD`y+hb?OpOWD!G{AKAJEPtWbu}Ph}<8_z;_B_vT|0deha_ zN+~zO1AUUYjP2sy`t&SPUY2T&7uFgGnB6WE{v=!Xi=@jbD^?>jRxd@vSV!3}acCk(oPLBZGBb!V{2zAg{VPd|}V z#>l11Z8U~-MXH{I1c=bp1&ts#QVR=VntQZc6ccML?LcpE2Syr>`;khavXpT=zCK0Q z9KqG|0uyd$j;ygESg?!0uY|92C=f_r%!QGCD~ee23kpkiK1oJ6#?%&K@?^Edye@tR zdC7QeE(u3h@QW>@gHiHI;$_qGa!m{BbcXkXbQp-0^ZWE7qE!v0%_PK!~W#Y zP`#+regDl;CMb#V1@QZAjPpR+>oaodVM!avsPJFYFXm-3(n=DqY zVpw~b{q-Zj!oy+{6k{yUM}{~j_Jm(L4OP$9*8l_{sn$y0jhq4&B6T5N;*6BBj6D2d zlM91^pBGZ=UEMPl9iw1sNMD-g+a0%`$LB5=j^1X&B&;*1Hy(=|z?ToiOuE8jjaxH% zs<%mY^9_IUN?cHL`?Vsyk$d@?#}6*^$|>XqhXV#*EUU6(FJG}^h0MHCj1Sn?d%UG3 zo5zSMaJj}hDtDGhPT5>e`if7g)cD{--&7-Vijgv6-!SFl)6>%k3HU3jAC@Qu*WfoE zn&m5kua%w_P^UQj^Qe%APWO7_roo^0iQY+9!Y{uu^XuM1fqz#!AUl00zjD;Bgwp+d?pBxtGW=LF9lGrJWy+hS zC6hWXF1X?>OB1}+0Y$Bqt{cMh+ z+JYp*LP&&=3{t7>`g6P4R((j0+~p0HxMDy$8wo>j>7~?5P*YDa-+F6ZsqRq3su$@1k%lne(Y}GNjT89Xnlmge`mud;S!EFGvl zI8!~}a*qntuY3dY6yRV06C>cW@Y&vc*T+7VU|?-S#U3&`CK~b>c-*nMmp0cyTv^FQ zV)&>>^6YeId+%zM9mWfR#N*TH`Ki#_--KYIDZHBi8^K>gTV%+Blj19A?{=Vhq%t-L zV?*IChF7%C>qz)+);@R|R8u2azd}C0YH}+2C05>t2#D00%5h|%47pdJ@YdxFv^Sp~ zgUYogAK-)Pp`&IMyp;9mV4*D4N+vPpjrsSYf)qvSwFB7emi9r^01!6oCwTy+P>W0k zgtdx#>mj^>qg=KuJTr})w0!?T47vj6XP_(t*XCvQT$4@lbKi?K6fvP7!-q!!zLvh= z%bF3niOtz`D=fV(pc*RV3fS{E{s@p@r_~3&7NW?4sa-1*L-JGQwEx@vK0OsXfQZV< z@d@4f+#q+H$wXfHSfJ41JUXs0WS3<9%alXQAVOhXNzK^sq{YiYtp2g*$&SPR4sAsA zg2F~rQRH^2b?9X7CkOAL_6sh)&kmbj5dzNx5N3R?2JC@{ikY>`UfSgSwAgP{8q(MD z?YYk~30j)MP~tSBLe}#G=)TuQVLzHxQ~704^{GJ1=YZF9cV2j`$x5H^+zZ#Ru?_=r z4AauB&Gw{gdt5{F5at3WWe@L;9uA`2YhOCS)Xja~k;pG9c#cb?nM$oyg14hm0aQ(z zRVgH?GsKv*$*k)m2J37Wjd@V7&yh$xZchrdYiKDzcF-NgkVJH9yEm{H4jhY7AZBPzWHwqKKc75|>$}CM1epjX-Zn1Q0#8FlinoL6h z@H_CnS|k*e-Ii;ohH`(+@7yx=xW{Ic5wU;;iZ<7jk>#Q;T-;Ruq~`!(e`3NkG$oa` zw@$L&{<5k{g6di^C@l{@bH1J@R_MEggPm8iiCbhwT&R^oX2VM)sM;b#h$JXK_55sS zr;r-FYwuMm@EuovBj(eqvT!)qMjy~Mh&##58}erB_k~4cENlI~^X>yc9)eM6vrR@^8cU>EDL&l3A6cCF-%fD5zTJ#=2nU(*)ZU zDJ<$W&?;?F6f-LlI>{GL=Lt{Z3^Y!X@h3}B?hGVDMO>j8PV9P$+-EEEnMb;?w#R0V z+x_X4aO{T~E(D5)`>LBA;g|hN&w1o^8>``WN!{My1!lsvJ(rWtE$@lSdMLv-pyCkb z2r2KyV$uIryqJ~BvhoNkFkW<~ytkVjMtGOep5cZ?bNZ%lCkW1gLmH<&8Ldpfr)uW#PplN+?s5Sbg}1<6?@ z!!Uu#p+Q#0o5(+_mn+?c4ov(1qsWfyY0V=;m?W8BRfkgOHJZHgKPrxy9plF-n%QxM zxA@BBT$>s|ZkIn<)5pBFbVSvSfUULCpgR5K?pyAP>&@8g@D+{jlVXF5+!E00$DXR2 z0d~q|A+hqHzc9yE(JHq18porU66? zv5~?380a9a)7cBXFOIZalH3|(?c*%EhsF^(LSxslAe*04Ec0IH z5?btm&H=Ie8{B=7euV3Pt&@~o_?FdgGuGqrKdHgeB-l+ZmF&4&k47PsUbUq9B9sK1 zDJNwWL+Q1I|2**0lKF^kZ(Bz9LeyH6nF^#e?^jXK-yr7~JJ+s(Q0=sJy;r6Za1*8z zreV8Xb*{z5rP*~t$FGTqz}t?x>M9NzTmbtO&3BxiS8eMWBVM&?qM;s-5iB94Q$>ir zNtag;rsxc81H#&%UJ5!(FC30(Newc{Mb_ubac$@Ahp}qFXsc|AVv3&@82lIyXw!iD!14;CE-9{Pv* ztlt$F+5aj=tv3?^7|mm)t&EuXd=)r+5g_(0_25aHDvJM!RQCQ(h9z5cmq40Lw64QI zZdPHKh9-~q)^~_<(%^NxlQ>7Q&|E#m%AKtZsfgn*a}10dP7XRroB%MS`kj5%Epw-z zEbId^4*%bX#Vc-29@$y}3?lU(vj9FnIV3pJr0$O&8!NRLRDWyewf|jTDi{W z65Xr$wt?_^I4^3Ho34Eg0pm6G3#E?|I`T%@>qE4ZZz;+zj3!2mh0k^&lsAglt+x{@ zK9BydkHy;dB#r{0K=Uzd5=HX9a@kuiP&o6Xdscn%^Dx(}R4*L^Y)=4GlpUCojr045 zqCp2n$u2m)AxswgH9=`m00icaRGM2JF_pkFtZ40FCM7Bx#3Cc7XV^aeyr&3(_}{mA z-S0Q_8B?9+l+HvBvJFv8_`!=i#~YLwO@7fHn}$DkB1J(=FyUSvq8Fy|w0nPT7DR?} z?1KBl1mW241!ShGL90X;PF%AX>!}Ed%Q1f>Z{U&ZJ$>`34B6u&ygT%6O3PwpPW2@8 zn#j#sbZ+X*rOc5=50Wqp11K4YKnA`(8w~bvX+j8#_O5Mb8e=k9VR_N&^qw?y z-zUCBh0&-(?}Of*1E^(kY;l14@_A7#ldo$;L_fAW6>-&q);i$MtNDF>Mx}vFUGM&@ z@=ja~xE+ocO2c9PC!Vw4)KUX-jK!9`zGCyX?4fV0)gwl)L#GJ3sy#~eYNM$pfPrus zn>(?(aX2E!mZ=WQhlKw1mFmSgc_AY3{YWIe34-}2L_rXD)j5O%5;m**r zYA~BWtw98h92ln>d@o!Tey3+m0u9q&maJAf?5zrtJDd@Z(RC|aCEDJ!nSA;vITf6h zuYoOq)w;XE$WH9u`S&R$$rudIYz@%Ij_pFCNnSTF8;`%k_@<%4#RE13lU?oy{~xL} zyV>2pxlCv7q}9ZWPw)P6_XjT&+G~V9e-s3NNx?hj;}dcm+eI`hkpCvu6^^c@>vYB# zf6`uNeSOhTeZ1#jv68v>E-snHI+%^wlKwN#TAzt=!KyBAZ+BtSG=eu(g|PbcUG3yj zZ@qXM3S@|7jZqw^+R6w3%2|IIT!{sB7yda)cisoZt}L0BWB{q=3Fdv_z_GH)m~kA5 zE7eO51%b<7-Xe3}cuE(Xnajg3tKNK%x_3&TlPGz#rCNzDymX-`b@~`>b%*U5%(;Au zDfshn0tph3kJyqd)qHF-h#13?7%=IwAHva5-1XI-t%s0kYc={qFMkL(CC}j2<``Fd zD_o3bMjF46wGxaOHHbm>ZW-bqeQx$@zq8x*g;}yPhTxn8eMcrgV}zL%09f6%pa4LC zg#7fQ#Kr;#sI)64FO${baM+1nFwDy(MNKcF>iiBB8$DF(#t!T)HC$77)0j4a8EDklpMG6`o^*i>#6sO&LR}2XksZ znp7E;V`}-*Vgq({!BbIZ=pZi#JS6R52lY_5-U((rY_FE^v+3jF;g7~jh_yGo+$Jc~ zPrG9Vki=XRFk+>$f&Ii+){|qG+}U{YlxM+r9vYi{78%v(>M&Sue}3L0hX0Bb%E?N@ zG8Ds3(|mghzu#~d=@~7lO&Bb~EJQTX!*QXeO&RccDV)n z7ufb_IBAZnUgyf4S`3G?Zs@eWB#cMp;SqA2Zn%2!N+Ko%kpd6jRgQ;jOpL{3W&nSq zlUxLZ3NBy%SQ@I9QrDzg8I6;8GI4=p%c`?)8stAGcEaf3J!cc#mlzbP;+v=V!{lvq zXN3ELb*oO8TMow-f*@5ON z-)Uo_X3@}kdyU9mgpPGOk!r%Ng1&!m(IFs=EHiV%%7|ZQGBLRp=qvYwt?m>ez`cli zMt2A+tp);u&dLcFaLRvoYl6Xe=8vpEfE8#lEQUiRe1Oz5J-gFipkBUV_%nrAETEKp z(vLuh8?%x?bW%J#SkcfyRCr`r%JVWpQlQ9DI zV)DqPQFQUW4Q(D6U-{V9M^e7dOc1owR|>YW$7^f}9a2~$OFA>JlLo}J4nNBB@=*1SdlAO(CZkAGc&a8LG%@h$<2-d{s zUWS4M1x~kmkYCkmcG-N)k_5?Xv~L;&jcv%Na%0F8;`*{a5z0Xt-!%kn){5q!4Q(>! z5(Sv;Gq<+t-rK7__?wBRzP{Gn*p%qi=QO^Q#eopW`c|rHTB3PAxw0Jtdw)hcxIz&4 zc!TKRpDd|T;u(hACBig^y)IGGVM&AIjvazJ*MI0ef$xLX=f=g{W4mNSH%r4);(UD$ zB*bvE68Mx4388O zw7xoSL`%+5UY}zg#7^IeQIAmuO#V1aTEykc|9+00ryX2?ylc~w&RQZWok8TND&jMf zY}BNsOSTOJP>&YBoEGAXf#G8+D;qg*4200Em9IQ?7+5mxFm}XV_G5j@NY%)M$ggwz zvI$@P85~tth=lJ_4IF6jq8tc4yRK?&jeymvG4l~R3FP*4S+Xm2x{GEN(kGAgkMJ08 zaEYFu^`L?Gw3nl6Q$0^d6ouXa|DZxG<%hZ@eiy6?poAFxXpt7{!+*#+uRKmeu|o6<88xyk3EG zmiS?T;w9sTrixQtCSx=MOgXs%m8tr%guhZVfXyI=vZ(vT-;D1Ujp>Jz;a6L`lG|KVuu8^DmX}I%XEP9Q_xBv6(ykHOo%oq4hgqEBUfsql`bjUlJKB&JKRHou;?2_?RmZc`0;KH zpaiwskEhiLN$_BO7((|RXBp8>BC^2R{a+yDRecpKSa7yTgio3E zDU}VHcfo7WWt;p~lgo*}!rWz;^KQ5B#aQ~-|5*=OPrnG0WZHY1@FqB6R;$2P>edt1 z{z2X@Bb*iB`pJ8gyG0f*`msTnQLwgOp{9nPW?JVaK;Bw3Urd;`kWIoc$gC_Uk5^@t z%xUp=Y^T#Cxz;bpy}`x3@}8VK-$`JgXHYs)C{vCZldE2XBd?nr7fKTXBdeurHYE=JlV1;$2u06=&3xuT; z5xdYr&9~1~oC7F@Cy*gb7Mb7<5pdd{O*?unxck5Rd?r>yn00d>_VdUeYh^%edKGwc z1e_PJvQ)9|t_xqi1{$-t$=WyYTw`9_(7TxR6#nYPYRmdyp2dbn54b!DDA6v)mp7lv zP^vM^zRSxse6fq}`7LM)BN^mH2n4Rz_d+3-nGW5XW%{w^hdlLe8ol4Lgvil18P@8Q zDL6C6Y9p0L26mJMQ;H(K{QiMD%C4RE`TL_THb`|Y(Gg7wFDos_h-2R>Ry!yHFyHmc# zNdN7CR$WOnR_8&SF%MLw7u?*DpqiXyB9Bc~6#o`yqPr1!2jsKHK_fzB zlJEP1RPI4MV?JM3WSdNkS{=R&aPe1achS36Pr8l&$U2%Q@ki}5S`?Ggn$0gt>;eUo ziMhj0ElL4M0HfAc=}3E>7J-q)?E3H2QZ~7lF1%tuu~_7A06`jD)E3G*)K9GIu^7&FY3?)Y{IAjZqaL98 zu1z+~CH2913clz6p~1|@gkR_RC=i=6VmS*)X+X-zDRYV^lVDM(c_+&KmIV)5NesNY z!SCq@pfM}q7fDDuc45g$H*QfGp zyv;bg_iKenNO;-;@|?t42JpvYQ#)^LBH=ESu`n?2jQAp6W+9f?g4r)fU=ozJ_FOOV zZ)OAI_}<8G@yLU9ExBZtO5=$sw)+c1U~)_?X>G^K;H(nKDB!ldww)yn=;E;UTa z7l9K@ZBd)El~$RUpm2x04zug~r+yn@;7S4yKQ(w>7$`urLJ5o@e8V=Bk(7TiH=H7` zIs1fy&dqk&y8M(3AWP#`=8!N6<(U69^eTa{s(gp=n!KP4MdZ?(xLx zs|7|b!Z^AoJ5y{r&qaw|aZf!{1)WI(w~5@Agt;H4{0(5Z!grq0^HI5g7Tc%BovDl@ zxU86!4%y;k5NnxxU_F?a77*XSCv!gDQ9K1X1ay_Fava78k^*5*eQo*4RF45l&iwZ- zQhAX?Puj4uAaF9^s|p9k$K!odVqnp!Mm%b{S{m?rWfBCwCeR*df3Dx#f~zyTvZ#8_ z{#nC8YU@k>zut~4s;ML!#1TX`!3Bs71VxlZj3|g~+EEtK(6~G7VHGj#1SBE|1_Ic$ z(gwr<8<|N2lr0hY1(hTamLL#tD%jmWbNZ{#nVgq%-l=-^?!8ra zt9n)UnuQR{x0!(5K(tUJhw!8$Vm9mLdo!@1-q|8&i~@BAFwa0E?ifFz#q)x0U{0vU zzRq2rHSIRguZ$DcO@=M|tIG?pnsP6OHkWb(T21E)*zewXx7}ua z0xBFUB)8O#6V3@JnTN-JrmX18qxgPAO;|dX&`IOcWPS>VND-tznh&a`(Vz(oovT-` z!fFEj{R`>zTYX{`JITQZ+1b@!6%?K|#T$lo8f*cX@XU1aeLtO5)j0(i{ZsL9JFTcg zDKP*dbt8HoXYVCyTbic8cf{b@Y8nN9JS$^aPwG^ zBa*N=pJ!dnaWvC4@(u1b2GM_X(}K?2WaSkUC_6o{zZiJT%F5wlIHWP?aC6YVb$W}_ zP2xUxAB4%HuzrDg6<@=CVc<4_bD#k7Bd46Fnu?pGtOB(_E7si_XWzS07xBT5u}exL zGUAYI#_2w5IGDx_Wvu$uueVXY!&5G1 z-~fx{3jg&pYoesI?0Xj%m4>gY(?u^{C_Q}mFm~bfW!DQAq7HdVr{5ZKb*E9jK+cVv zj&{aNA*re(yfZ6%>FQ02%F23{mYTA%vW}O zsK(ZSc!!0}9G>3%2RxGc5rZEhQ-aRavDoMuS%`vy0&=e4PyDx6a0QM?ihQZPvZDBKhSrcc^f~SFZ9qOs!Ao4VB&^ju}=C01dPpgn6|zuazIdg zGDizjwZBKB5BwTn)?en4!Awhx`$D&y$F@MtLyr6Ug5ErWO0V$m*fAX5`W;A0t5Oj@ZVxbc4s;un$$Vp;Wj!me9nXhb zuYDOGtcx_LB9p_{mL{3#nkQ@<1EPWzM#wtvVsm$CZZdTk2}t{~p~3d~KdTjP(zVO! zVy%*rk{QO=6-LES$Q$!0f$Huhj!VLw5y^x_tVGo6>fv$EK|5|^mhJMsgoRSCYu{*` znK`(__)21{&TVVHlsL@DEelVq=#=#epFBv7Hp1a>VI2LO#_7c;dCA@*A$qO9s0?gw@{Bas2%xlrT) zTJ8Ks8m}wh*W4y^^l)4M^Q%lDb?N|H!^7gFpO7|fOS!r5Ic>4G8j&(SmSGxDGaTXE zcH^>p_&;diISpSR38ONNQuGAVv1Qq7YYD`GsUdQ=ZRw5P-+pU8>FQU`SXRKkJ0q+BUVA(fmi&!9sM{`k#_1n2Gph`Gr6&<$7`;N$^;G%R&#y~G zVs7a8V5Ki4adlAX5Wqn!2kQZjkVhL`xQU=}Iy+DK`+wL^BSewjUnFYs zcwjMowXMBfq0Yw0XbZrDbgewCSkYH;aX3=tQn}~7_V&||p0bBw1Fi@JbN`3~>hlbr z+>PokumRjL`D_J<9xQ^^8ojFb-zD?(;t zBLs|>t`o>IVVCfQsWX;$y-eo#h~-HvD>DCOO%2ogpsv2Yf1f$YFo6hsc#wrh(y0NB zhMs^l=40OCW#yE;0cAzPqNy}_VsY_iAW=KtV&~50o*|}jUqvG_PZHL9$!_^o76g*9 z!=!nXnJRjp?J|agqI)PspsyzCCJUHm-PXwrU|@2sFbBi}?z*r5`KlGMq16IF(U=eD zv*LOJ*vN{TpO12UaM+N>=ks?xELLOXFeLuI`Z%-Mxw&dCnM{^REZeP@0vv@R zGFjc3V4Q>`B_l~ppfhGVyw=o?J_D9v;A> zMjwrx(FNp_R%@a@opX;DR1emK>Hr1wi3)433VvPUN|sH8e7p!?a?5J*f z;b_4gr#zk+U`lH+YEn<&Cf(NWF@<8j>sZvsJ`ZOS>#4WaEMSsDbkFX!nN+)qk`luh z;Pjc5zHa|KHRZBcw)K39X@V%j*wXS5eXh&u`HL54SGq^Tg1C||t#$z%4u=oW_m)%9 z_8V}IRO;Yxe1LC53h%}j+gBKAtxMogrLSD?rzn1^odi}|Tc z*cwN4y~v)Blhe93_vC8@m3mCvyv4KvjHdWrC>FuRl|k>oh5dDyX-^9HZ%VWg5Bi2o zzokDfEKGv$7>SNp5!8?+60Er2Ews`mUR(jRYL3a3io_*s!}$nBFjpHLV5}W6GBiYO zN=`EItiM7Q>C3Zgx1(ymuFaF|u5sI{e$~d#oFL@qcV^n}wgS3rs3}>_Wdx~y{=t2` z(z;m3eb|2K>QxS?FMamR+r?(#LffiTYijP=$paHYAg5a)<7lL%`4J6!K)*_uhB@3jmli4*&oF literal 0 HcmV?d00001 diff --git a/_sources/bp-guide-gh/ch1-model-formulation.md b/_sources/bp-guide-gh/ch1-model-formulation.md new file mode 100644 index 0000000..cf1f674 --- /dev/null +++ b/_sources/bp-guide-gh/ch1-model-formulation.md @@ -0,0 +1,282 @@ +# Model Formulation + +Nana Ofori-Opuku, Jim Warren, Pierre-Clement Simon + +* Review the literature + * Start with a careful lit review and see what others have done. + * Take the time to understand the derivations from the literature. + * Consider good examples from the literature (Can we list these on PFHub?) + +## General Considerations on the formulation of phase field models +Phase field models are, quite generally, extensions of classical non-equilibrium thermodynamics. There are quite a few treatments of this in the literature. Here we will follow formulations similar to those developed by Sekerka and Bi in "Interfaces for the Twenty-First Century." {cite}`bi_phase-field_1998` In that spirit, we will start with a very general formulation, including hydrodynamics, and then simplify the problem. For those interested in starting with a simple model, you can skip over much of the initial formulation and jump to the section on the further reduction of the problem. + +In thermodynamics one usually starts from consideration of the internal energy $E$, where $E=E(S,V,M_i)$, and $S$ is the entropy, $V$ is the volume and $M_i$ is the mass of species $i$. If we decide we don't want to consider elasticity we can divide through by the volume and compute the bulk energy density $e=e(s,\rho_i)$, with $\rho_i=M_i/V$, and similarly $s=S/V$. It is then usually postulated that in addition to the thermodynamic variables there are any number of _phase fields_ $\phi_j$ and the internal energy density is written + +$$e=e(s,\rho_i,\phi_j).$$ + +Here we are going to consider a single phase field $\phi$ that distinguishes between two phases (could be liquid-solid, could be solid-gas, etc.) and postulate that the total entropy of a system of volume $V$ can be written as + +$$S = \int s^{NC} dV,$$ + +where + +$$s^{NC}=s-\frac{\epsilon^2}{2}|\nabla\phi|^2-\sum_i \frac{\alpha_i^2}{2}|\nabla\rho_i|^2.$$ + +Here the superscript $NC$ is meant to indicate that this is a non-classical definition of the entropy density $s$. We have chosen the simplest possible forms of the non-classical extensions (that is, simple square-gradient penalties). The entropy density is itself a function, of course, + +$$s=s(e,\rho_i,\phi).$$ + +To close the deal we now need to work our way through the various continuum-versions of the laws of nature. + +### Evolution equations +In order to write down evolution equations we need to resort to the known laws of physics. For continuum theories, we really have only a few ideas to fall back on +* Conservation of mass +* Conservation of energy (First Law of Thermodynamics) +* Conservation of momentum and maybe angular momentum if absolutely necessary +* The second law of thermodynamics (entropy increases, free energy decreases...) + +A complete discussion of how to use the above rules in this context is outside the scope of this best-practice guide, but we offer a highly abbreviated discussion of the ''flavor,'' following the ideas of irreversible thermodynamics (we largely are following works like deGroot and Mazur {cite}`groot_non-equilibrium_2013`, although the continuum mechanics community may be more comfortable with Noll, Coleman, and Truesdale {cite}`malvern_introduction_1969`), as well as the aforementioned work by Sekerka and Bi {cite}`bi_phase-field_1998`. + +### Mass +The first idea is that we need to specify a flux of particles + +$${\bf J}_i=\rho_i \left({\bf v}_i-{\bf v}\right),$$ + +where ${\bf v}_i$ is the velocity of the particles of species $i$. In general we want to work in a center-of-mass frame + +$${\bf v}=\frac{\sum_i \rho_i {\bf v}_i}{\sum_i \rho_i}.$$ + +Notice that this implies (by construction) that $\sum_i {\bf J}_i=0$. + +The law of conservation of mass can be simply written as + +$$\frac{\partial \rho_i}{\partial t}+\nabla\cdot(\rho_i {\bf v}_i)=0.$$ + +Then we use the definition of ${\bf J}_i$ to rewrite that as + +$$\frac{\partial \rho_i}{\partial t}+ \nabla\cdot\left({\bf J}_i+\rho_i{\bf v}\right)=0.$$ + +Note that if we sum this equation over $i$, we get the continuity equation + +$$\frac{\partial \rho}{\partial t}+ \nabla\cdot\left(\rho{\bf v}\right)=0.$$ + +At this point is is common to introduce the notation + +$$\frac{D}{Dt}=\frac{\partial}{\partial t}+{\bf v}\cdot\nabla,$$ + +the "Lagrangian derivative" or "material derivative". The we can write the mass conservation equation as + +$$\frac{D \rho_i}{Dt}+ \nabla\cdot{\bf J}_i+\rho_i\nabla\cdot{\bf v}=0.$$ + +If the system in incompressible (a common assumption, although we'd have to abandon that if we want to consider gasses), then $\nabla\cdot{\bf v}=0$ and we can write + +$$\frac{D \rho_i}{Dt}+ \nabla\cdot{\bf J}_i=0.$$ + +### Momentum +The law of conservation of momentum (Newton's second Law) for a system without body forces (like gravity) can be written + +$$\frac{\partial\rho {\bf v}}{\partial t}+\nabla\cdot\left( \rho {\bf v}\otimes{\bf v}-\sigma\right)=0,$$ + +where $\sigma$ is the stress tensor. Using continuity and incompressibility as assumptions we get + +$$\rho\frac{D{\bf v}}{Dt}=\nabla\cdot\sigma.$$ + +### Energy +Our final conservation expression is for energy. Just like the equation for momentum and mass, we start with a continuity form, and assume a flux of internal energy ${\bf J}_e$, and distinguish between the total energy density $e_T$, the internal energy density $e$ and the kinetic energy density $e_k=e_T-e= \frac{1}{2}\rho v^2$ and write + +$$\frac{\partial e_T}{\partial t}+\nabla\cdot\left(e_T{\bf v}+{\bf J}_e\right)=0.$$ + +We can then use the momentum equation as well as the mass continuity equation (along with incompressibility) to arrive at + +$$\frac{D e}{D t}+\nabla\cdot{\bf J}_e=\nabla{\bf v}:\sigma.$$ + +### First Law of Thermodynamics +We now write down the laws of thermodynamics for the densities. + +$$e=Ts-p+\sum_i\rho_i\mu_i,$$ + +where $p$ is the hydrostatic pressure, + +$$p=-\frac{1}{3}{\mathrm{Tr}}\sigma,$$ + +and $\mu_i$ and $T$ are defined as derivatives of $e$ through the expression + +$$de=Tds+\sum_i\mu_i d\rho_i+\frac{\partial e}{\partial\phi}d\phi.$$ + +Of course, given where we're headed, let's rewrite this as + +$$ds=\frac{1}{T}de-\sum_i\frac{\mu_i}{T}d\rho_i+\frac{\partial s}{\partial \phi}d\phi.$$ + +### Second Law + +We have chosen the entropy to "extend" non-classically, as it is the star actor in the second law of thermodynamics, so we can write the entropy production (which must be positive) as + +$$S^{\mathrm{prod}}=\frac{dS}{dt}+\int {\bf J}_s\cdot d{\bf A}\ge0,$$ + +where ${\bf J}_s$ is the flux of entropy. We can compute (for an incompressible system) + +$$S^{\mathrm{prod}}=\int \left[\sum_i -\left(\frac{\mu_i}{T}\right)^{NC}\frac{D\rho_i}{Dt}+S_\phi\frac{D\phi}{Dt}+\frac{1}{T}\frac{De}{Dt}\right]dV+\int \left[{\bf J}_s-\sum_i \alpha_i^2\nabla\rho_i\frac{D\rho_i}{Dt}-\epsilon^2\nabla\phi\frac{D\phi}{Dt}\right]\cdot d{\bf A},$$ + +where we have introduced + +$$-\left(\frac{\mu_i}{T}\right)^{NC}=\frac{\partial s}{\partial \rho_i}+\alpha_i\nabla^2\rho_i,$$ + +and + +$$S_\phi=\frac{\partial s}{\partial\phi}+\epsilon^2\nabla^2\phi.$$ + +At this point we can insert the equations of motion we got from our conservation laws and do _a lot_ of algebra, which we leave as an amusing exercise for the reader. We eventually find that + +$$S^{\mathrm{prod}}=\int \left[-\sum_i\nabla\left(\frac{\mu_i}{T}\right)^{NC}\cdot{\bf J_i}+S_\phi\frac{D\phi}{Dt}+\nabla \frac{1}{T}\cdot{\bf J}_e+\frac{1}{T} {\bf Y}:\nabla {\bf v}\right]dV,$$ + +and + +$${\bf J}_s=s^{NC}{\bf v} + \frac{1}{T}{\bf J}_e-\sum_i \left(\frac{\mu_i}{T}\right)^{NC}{\bf J}_i+\sum_i \alpha_i^2\frac{D\rho_i}{Dt}\nabla\rho_i+\epsilon^2\frac{D\phi}{Dt}\nabla\phi.$$ + +It is worth noting that this form for ${\bf J}_s$ eliminates the explicit surface terms from the entropy production. We have also introduced the tensor ${\bf Y}$ which is rather a complicated beast (it came from all those integrations by parts which we have skipped in this presentation), and has the form + +$$\frac{{\bf Y}}{T}=\frac{\sigma}{T}+\sum \alpha_i^2\nabla\rho_i\otimes\nabla\rho_i+\epsilon^2\nabla\phi\otimes\nabla\phi+\left(\frac{p}{T}-\sum_i \alpha_i^2\rho_i\nabla^2\rho_i-\sum_i\frac{\alpha_i^2}{2}|\nabla\rho_i|^2-\frac{\epsilon^2}{2}|\nabla\phi|^2\right){\bf I},$$ + +where $\bf I$ is the identity tensor. + +### Constitutive Equations and Evolution Equations +After all this work we can now find constitutive equations. Inspection of the final expression for $S^{\mathrm{prod}}$, suggests a that we can guarantee it be positive definite (which is required from the second law) by assuming + +$${\bf J}_i= -M_i\nabla\left(\frac{\mu_i}{T}\right)^{NC},$$ + +$${\bf J}_e=M_T\nabla\frac{1}{T},$$ + +$${\bf Y} = \eta \left(\nabla{\bf v}+(\nabla{\bf v})^T\right),$$ + +$$\frac{D\phi}{Dt}=M_\phi S_\phi,$$ + +where we have introduced mobilities and the viscosity $\eta$. It should be emphasized that we could have assumed all sorts of "cross-couplings" between the various fluxes here, but instead we have made the simplest assumptions. Inserting these into our equations of motion, we (at last!) arrive at general evolution equations + +$$\frac{D e}{D t}=-M_T\nabla^2\frac{1}{T}+\nabla{\bf v}:\sigma,$$ + +$$\frac{D \rho_i}{D t}=\nabla\cdot M_i\nabla\left(-\frac{\partial s}{\partial \rho_i}-\alpha_i^2 \nabla^2\rho_i\right)$$ + +$$\frac{D\phi}{Dt}=M_\phi\left(\frac{\partial s}{\partial\phi}+\epsilon^2\nabla^2\phi\right).$$ + +$$\frac{\sigma}{T}=\frac{\eta}{T}\left(\nabla{\bf v}+(\nabla{\bf v})^T\right)-\sum_i \alpha_i^2\nabla\rho_i\otimes\nabla\rho_i+\epsilon^2\nabla\phi\otimes\nabla\phi-\left(\frac{p}{T}-\sum \alpha_i^2\rho_i\nabla^2\rho_i-\sum\frac{\alpha_i^2}{2}|\nabla\rho_i|^2-\frac{\epsilon^2}{2}|\nabla\phi|^2\right){\bf I},$$ + +with + +$$\rho\frac{D{\bf v}}{Dt}=\nabla\cdot\sigma.$$ + + +### Further reduction of the problem +We have presented the derivation of equations of evolution for an incompressible, two-phase, multicomponent system. Most phase field treatments ignore the velocity terms, but for pedagogical purposes we have retained all of the terms that arise from flow (for an incompressible system). These terms should not just be tossed away without careful consideration of the system of interest! Nonetheless, now that we have taken care to show how these terms arise, and also, for careful readers, how to extend this approach to multiple phases and additional gradient corrections, we will proceed with some more simplifications for a less complex system. For those who are interested in solid state systems that can creep, the work of Mishin, Warren, Sekerka, and Boettinger (2013) {cite}`mishin_irreversible_2013` extends this framework. Here we eliminate the ${\bf v}$ equations by fiat, assuming that only diffusion controls the evolution of the system, which is often reasonable in microgravity situations. We can also go further, and consider an isothermal system. Then we have + +$$\frac{\partial \rho_i}{\partial t}=\nabla\cdot M_i\nabla\left(-\frac{\partial s}{\partial \rho_i}-\alpha^2_i\nabla^2\rho_i\right),$$ + +$$\frac{\partial\phi}{\partial t}=M_\phi\left(\frac{\partial s}{\partial\phi}+\epsilon^2\nabla^2\phi\right).$$ + +This system of equations should be adequate to describe a diffusion-controlled multicomponent, isothermal, two-phase system. One could, of course, retain thermal diffusion, add more phases, retain the velocity terms and more! + + +## Clearly define the equations, parameters, initial conditions, and boundary conditions +Now that we have specified that we wish to consider, a diffusion-controlled multicomponent, isothermal, two-phase system. We still need to decide on the specifics of the system, and, in particular, the thermodynamic state functions that detail how the energy or entropy vary. All of the variables need to be clearly defined, and ideally should be either parameters that can be traced to thermodynamic variables or other physical constraints. As noted, we wish to consider an isothermal system, and so we can use a Legendre transformation to replace $s$ in the above expressions with the Helmholtz free energy $f=e-Ts$. + +$$\frac{\partial \rho_i}{\partial t}=\nabla\cdot M_i\nabla\left(\frac{1}{T}\frac{\partial f}{\partial \rho_i}-\alpha^2_i\nabla^2\rho_i\right)$$ + +$$\frac{\partial\phi}{\partial t}=M_\phi\left(-\frac{1}{T}\frac{\partial f}{\partial\phi}+\epsilon^2\nabla^2\phi\right).$$ + +Additionally, we will now only consider only a two component systems, so we only have species $\rho_1$ and $\rho_2$. Note that the total density $\rho=\rho_1+\rho_2$ is a constant (for an incompressible system). We could formulate the problem in terms of these variables or we can move to a concentration $c_1=\rho_1/(\rho_1+\rho_2)$. Clearly $c_1+c_2=1$, so we only have one independent variable. In this case we can pick $c_1$ or $c_2$ as the independent variable and label it $c$. As the reader can see, these types of exercises are highly non-trivial, require substantial care, and need to be done with rigor to understand the host of approximations and assumptions that can be made (at a minimum here we have ignored elasticity, different molar volumes for the species, and other issues are external fields, and there will be more to come!). We move to a concentration picture and _redefine_ the mobilities, $\alpha$, and $\epsilon$ in such a way that the following expressions hold: + +$$\frac{\partial c}{\partial t}=\nabla\cdot M_i\nabla\left(\frac{\partial f}{\partial c}-\alpha^2\nabla^2c\right)$$ + +$$\frac{\partial\phi}{\partial t}=M_\phi\left(\epsilon^2\nabla^2\phi-\frac{\partial f}{\partial\phi}\right).$$ + +### State function +We now need to specify $f(c,T,\phi)$. Note that we have retained the $T$ dependence here, even though we are considering an isothermal system. Isothermal does not mean temperature independent! Additionally, in the expressions just above we "absorbed" $T$ into some of the coefficients. These parameters can depend on $T$, but often the dependencies are unknown or should only be included if the phenomena under consideration demand such an inclusion. In the interest of pedagogy, we recapitulate one approach to modeling a liquid-solid binary alloy, although the details are less important that understanding that a specific choice of state function has to come from _somewhere_. Following the treatment in the Annual Reviews of Materials Research (2001) by Boettinger, Warren, Beckerman and Karma {cite}`boettinger_phase-field_2002` we note that the free energy can be determined through a multi-step process where the two components are called $A$ and $B$ respectively: +#### Step 1 +Start with the ordinary free energy of the pure components as liquid and solid phases, $f_L^A(T)$, $f_L^B(T)$, $f_S^A(T)$, $f_S^B(T)$. They are functions of temperature only. +#### Step 2 +Form a function that represents both liquid and solid for pure A + +$$f^A(\phi,T)=(1-p(\phi))f^A_S+p(\phi)f^A_L+W^Ag(\phi).$$ + +This function combines the free energies of the liquid and solid with the interpolating function $p(\phi)$ and adds an energy hump, $W^Ag(\phi)$, between them. A similar expression can be obtained for component B. Note that $g(\phi)$ has minima at $\phi=0$ and $\phi=1$ with a maximum at $\phi=0.5$ while $p(0)=0$, $p(1)=1$ and $p'=0$ when $\phi=0$ or $\phi=1$. A popular choice for these functions is $p(\phi)=\phi^3(10-15\phi+6\phi^2)$ and $g(\phi)=\\phi^2(1-\phi)^2$. Note also the $\partial p/\partial\phi=30g(\phi)$ by construction. +#### Step 3 +Form the function, $f(\phi,c,T)$, that represents (for example) a regular solution of A and B, + +$$f(\phi,c,T)=(1-c)f^A(\phi)+cf^B(\phi) +RT((1-c)\ln(1-c)+c\ln c)+c(1-c)\left[\Omega_S(1-p(\phi))+\Omega_L p(\phi)\right],$$ + +where $\Omega_L$ and $\Omega_S$ are the regular solution parameters of the liquid and solid that again are combined with the interpolating function $p(\phi)$. The gas constant R needs to be chosen with the correct normalization so that RT has units of energy per unit volume. + + +With this specific choice of a regular solution free energy we at last have fully specified a system and its evolution! + + +## Clearly define and pose your physical problem before solving +Regardless of the explicit functional choices for the state function, the most important point made above is that the phase field method requires an explicit choice for this function. Once we have selected it, the equations derived above detail the evolution of the phase, composition, temperature, etc. Here we chose only to consider phase and composition, with temperature as a parameter. Having fully specified the state function, the next question is really about practical issues around a specific simulation. What are the boundary conditions? What are the relevant length scales. Here is a list of issues: + +### Complete dimensional analysis and understanding relevant scales; state the reference frame +There are any number of dimensionless parameters that can be found in these models. Understanding their relative role is beyond the scope of this best practice guide, but constructing these numbers is straightforward and essential. Usually before attempting to solve the equations, it is useful to "scale" the equations, thereby reducing the total number of parameter in the problem. In general we can always rescale space and time to eliminate two parameters. For example, a natural unit for length $\ell$ might be defined in terms of a scale of the free energy density $\bar f$ + +$$\ell^2=\frac{\epsilon^2}{\bar f}.$$ + +Using this definition of $\ell$ we can then get a time scale $\tau$ as + +$$\tau=\frac{1}{M_\phi\bar f}.$$ + +Using these units will eliminate two parameters that need to explored when seeking solutions. + +### Plot your state functions before implementing them in code +While we derived a specific choice of the free energy above, regardless of where you got the free energy (or other state function) it is wise to plot the function, as this will give you a quick check that your state function is well posed, has minima where you expect them to be. + +### Consider the impact of interpolation functions, barrier functions, etc. +We chose specific forms for our interpolation function $p$ and the barrier function $g$. These were not arbitrary choices, but nonetheless, they are hardly the only choices we could have made, just relatively popular. All such choices can result in simulation regions where "surprises" can occur, often due to insufficient spatiotemporal resolution. + +### Consider every boundary term and make sure you aren’t eliminating important terms. Check the fluxes +When implementing the boundary conditions, extreme care must be taken. One cannot just "zero-out" boundary terms, as this may break some requirement about mass conservation or other physical constraint. + +* (Show examples on PFHub, possibly benchmark problems?) +* Be mindful of your assumptions and approximations + +Having clearly defined the mathematical framework underlying the problem, it becomes important, prior to progressing further, to contemplate and thoroughly grasp the various assumptions and approximations inherent within the formulation. Often, the exacting mathematical underpinnings from which the model has arisen may have presented challenges of being intractable in their complexity, or alternatively, they might have been of an impractical nature or even lacking contact with empirical observations. + +The considerations surrounding assumptions and approximations are distributed throughout various places throughout the model's formulation. Foremost, are the descriptors of thermodynamic energy density, which provide the basis for our understanding of energy relationships, as well as the delineations of boundary conditions and the specifications of initial conditions. Notably, the latter two warrant attention since, in the absence of these conditions, the partial differential equations that determine the temporal evolution of our problem could only hypothetically yield an infinite set of solutions. + + * If possible, run a small test problem with and without approximations and to quantify their impact + * Consider how approximations change in different dimensions and symmetries + * If possible, avoid assuming symmetry to reduce the complexity of your problem + +## Carefully consider your length and time scales + +a) **Identify the Smallest Feature Size of Interest in Your Problem:** The smallest feature size refers to the smallest spatial scale that needs to be accurately resolved in your simulation. This could be, for example, the width of an interface between two distinct materials or the size of a fine structure. Properly resolving the smallest features is essential for capturing detailed interactions and behaviors in your system. + +**Additional Item 1: Generally the smallest feature is the interface width between the features that need to be resolved.** The interface width often represents the smallest detail that demands attention. Neglecting this width may lead to inaccurate results and incomplete understanding of the system's behavior. + +b) **Identify the Smallest Time Scale of Interest in Your Problem:** The smallest time scale corresponds to the fastest processes occurring in your system. It's important to accurately capture these time scales to ensure that rapid events are not overlooked or misrepresented. + +**Additional Item 2: The time steps you consider shall be small enough to allow capturing the kinetics of the process you want to model.** Choosing appropriate time steps is crucial to accurately capture dynamic processes. Smaller time steps are necessary to capture fast kinetics and prevent underestimation or distortion of time-dependent phenomena. + +c) **Identify the Smallest Length Scales of Interest for All Physics and Consider How They Interact:** This involves analyzing the smallest spatial scales relevant to each physical process in your simulation. Understanding how these different length scales interact is essential for capturing multi-scale effects accurately. + +**Additional Item 3: Depending on the numerical method used for solving the equations, you may need 5-10 mesh elements to resolve the interface.** The mesh resolution, i.e., the number of mesh elements used to discretize the domain, plays a crucial role in capturing interfaces accurately. Higher mesh resolution is required to resolve fine interfaces properly. + +1. **The Sample Size You Consider Will Be Relevant to Your Feature Size:** The size of the simulation domain should be appropriately chosen based on the scale of the features you are interested in. Having a domain that is much larger than necessary can lead to unnecessary computational costs, while having a domain that is too small might exclude important interactions. + +2. **It Is Recommended to Formulate Your Problem in a Non-Dimensional Form If Possible:** Non-dimensionalization involves scaling variables in your equations to remove physical units. This can help simplify the equations, reduce the number of parameters, and make the problem more amenable to analysis and comparison. + +3. **If You Consider an Initial Condition Far from the Expected Steady State Solution, You May Need to Select a Significantly Smaller Time Step:** When the initial condition differs significantly from the expected steady state, smaller time steps may be necessary to accurately capture the transient behavior and prevent numerical instability. + +4. **Be Mindful of Initial Conditions You Select:** Poorly chosen initial conditions, especially for interfaces or abrupt changes, can lead to numerical artifacts, excessive computational demands, and inaccurate results. It's important to select physically meaningful initial conditions that smoothly transition into the desired system state. + + **Additional Item 4: They may also result in numerical artifacts that lead to artificial stabilization of unstable phases.** Inaccurate initial conditions can stabilize phases that would otherwise be unstable, leading to unrealistic outcomes in your simulation. + +5. **Using Automatic Time Stepping Integrator Algorithms Can Benefit PF Simulations:** Automatic time stepping algorithms adjust the time step size during simulation based on the system's dynamics. This can improve simulation efficiency by using larger time steps during stable periods and smaller steps during dynamic events. + + +In summary, these considerations highlight the importance of careful parameter selection, proper resolution of length and time scales, and accurate initial conditions when performing numerical simulations. Addressing these aspects helps ensure the reliability and validity of your simulation results in various scientific and engineering applications. +* Non-dimensionalization + * It gets MUCH harder with coupled physics, so be careful + +## References + +```{bibliography} +``` + + diff --git a/_sources/bp-guide-gh/ch2-numerical-implementation.md b/_sources/bp-guide-gh/ch2-numerical-implementation.md new file mode 100644 index 0000000..d9b568f --- /dev/null +++ b/_sources/bp-guide-gh/ch2-numerical-implementation.md @@ -0,0 +1,400 @@ +# Numerical Implementation + +When writing your own phase-field simulation code or when choosing among existing codes, the numerical implementation of the model is an important consideration. This section of Phase-Field Recommended Practices Guide is split into two subsections -- one focused on choosing appropriate numerical methods and one focused on choosing whether to code your own solvers or use existing libraries (and how to choose between existing libraries). Although these subsections are presented sequentially, these choices are more iterative than sequential. For example, you may start out deciding that a certain set of numerical methods are promising, but then switch to others after considering the availability of libraries. + +## Choosing an appropriate collection of numerical methods +There is no consensus on what the "best" numerical methods for phase-field modeling are. In fact, given the diversity of the models and settings under the phase field umbrella, it is unlikely that any single collection of methods would be optimal for all phase-field modeling. Instead, a wide variety of numerical methods are used in the literature. For most problems of interest there are multiple numerical methods that can be used to obtain a solution to the model equations (and perhaps some methods that _cannot_ obtain a solution). Several factors to consider when choosing between numerical methods are: +- General computational performance +- Appropriateness for the planned computing hardware (e.g., GPUs) +- Scalability, ease of implementation +- Availability of libraries + +Each researcher may have their own unique balance of these factors that leads them to choose a numerical approach. + +These choices can be very important. The performance of different methods for a given problem can vary by orders of magnitude. Likewise the complexity to implement the methods can vary by orders of magnitude -- some solvers can be written in a few tens of lines of code; some may take tens of thousands of lines. The path-dependency of the choices are also variable. Transitioning from a spectral code to a finite element code might necessitate an entire rewrite. Transitioning from one implicit time integration method to another may take a few hours. + +A phase-field code involves a few different types of numerical methods. Different choices for each type are possible, but not all combinations are possible or advisable. In the end, to determine the numerical implementation for your phase-field model you will need to decide on a collection of numerical methods and approaches that are suitable for your problem and work well together. + +Before deciding on a strategy for a numerical implementation, we strongly recommend that you put thought into your problem(s) of interest. Understanding the governing equations, boundary conditions, initial conditions, coupled physics, expected symmetries and other factors discussed in the [Model Formulation section](https://github.com/usnistgov/pfhub/wiki/Model-Formulation) will aid you in deciding on how to implement your model numerically. + +### Start simple, then selectively move to more complex methods +In general, we recommend that you start with a simple method and then add complexity selectively where justified. There are a few benefits to this approach. +1. Simpler methods are usually easier to implement, decreasing the time from starting to running your first test simulation. This gives you an earlier opportunity to identify unexpected issues in your model formulation that you didn't catch before implementing it. Part of what makes a simpler method easier to implement is that a simpler method is often easier to debug and/or there are fewer ways for it to fail. +2. The simpler implementation can be a backup option if the development of a more complex option takes longer than expected. Even following the [recommended practices for software development](https://github.com/usnistgov/pfhub/wiki/Software-Development), code development times can be unpredictable. A suboptimal backup implementation might get you through your first milestones while you're debugging a more advanced method. +3. You may learn that the simpler option fulfills your needs. Complex methods aren't always better; the problem of interest might not need or justify investment in more complex methods. +4. Even if the simpler method doesn't fulfill your needs, it may illuminate where added complexity is worth investigating ("these small explicit time steps are bogging me down, I should try an implicit time integrator", "I'm wasting so many resources in this area where nothing happens, I should try adaptive meshing"). +5. Solutions obtained with the simpler method can be used as reference solutions as part of your [code verification strategy](https://github.com/usnistgov/pfhub/wiki/Software-Development). Obtaining the same solution with two methods is no guarantee that both are correct, but it is an encouraging sign. And certainly, if two methods yield different solutions, the implementations require attention. + +This all said, there may be some compelling reasons to start with more complex methods. One such reason is if the method is already implemented in an off-the-shelf package. Other numerical considerations could come into play: an unpreconditioned Krylov solver is _simpler_ than a preconditioned one, but the preconditioner stabilizes the solution and may be more forgiving for non-optimized simulation parameters in an initial exploratory phase for a project and may be _simpler to use_. + +Additionally, we also recommend initially implementing a simpler form of your model and the building up to the full model, particularly if you are new to the toolchain that you're using. There are classes of issues that with your numerical implementation that show up in even very simple calculations (MPI communication issues, stencil issues, scaling issues, etc.), and it's best to deal with those as soon as possible. Note: this approach works best when the simplified model is a simplified version of the _PDE_, not simply a simplified version of the _physics_. Sometimes models at different levels of complexity have a very different structure. A few examples of simpler starting models are: +| Target Model | Simplified Variant | +| :---: | :---: | +| BM1 (Cahn-Hilliard) | Diffusion equation, then add the higher order term | +| BM2 (Coupled Cahn-Hilliard-Allen-Cahn) | Cahn-Hilliard by itself, add one Allen-Cahn equation, then two, then all of them| +| BM4 (Elastic Precipitate) | Cahn-Hilliard by itself, then add elasticity| + +### Choosing a spatial discretization +Four main types of spatial discretizations are used for phase-field modeling: finite difference, finite volume, finite element, and Fourier pseudospectral. Each of these methods has been used for simulation results uploaded to PFHub. Examples for each method are: finite difference - [Memphis](https://github.com/memphis-snl/memphis), [HiPerC](https://github.com/usnistgov/HiPerC), finite volume - [FiPy](https://github.com/usnistgov/fipy), finite element - [MOOSE](https://github.com/idaholab/moose), [PRISMS-PF](https://github.com/prisms-center/phaseField), [Fenics](https://github.com/FEniCS), Fourier pseudospectral - [MEUMAPPS](https://code.ornl.gov/meumapps/meumapps)). + +Here we give a brief overview of the strengths and weaknesses of each of these spatial discretization approaches. Aiming for brevity over completeness, this discussion skips over the considerable nuance in the capabilities of these methods. + +#### Finite difference +Finite difference discretizations are one of the most common spatial discretizations for phase-field codes. The field data is stored on the vertices of the mesh and derivatives are approximated using variable values at the point of interest and/or neighboring points. See the [Wikipedia page](https://en.wikipedia.org/wiki/Finite_difference_method) for a general introduction. While many flavors of finite difference methods exist, most finite difference phase-field codes use structured, uniform grids. + +#### Finite volume +With finite volume methods, the field data is stored for each element in the mesh (i.e., the "finite volume"), and changes to the field data are calculated by summing the fluxes through the faces of the element. Therefore, finite-volume methods are inherently conservative. Because the flux calculations are done on the faces, finite volume methods can be used on unstructured meshes. Also, as a result of the emphasis on fluxes, finite volume methods solve the weak form of a PDE. See the [Wikipedia page](https://en.wikipedia.org/wiki/Finite_volume_method) for a general introduction. + +#### Finite element +Finite element methods are the most complex of the common spatial discretization methods for phase-field codes. In a finite element method, field values are stored on pre-defined places of each element (the "nodes"). The field variables in the element are continuously represented by a function of pre-defined type (e.g., bilinear) that passes through the field values at each node (the "shape function"). Derivatives are calculated through derivatives of the shape function. The field variables are evolved using volumetric integrals over the element, where the integrals are calculated using [quadrature](https://en.wikipedia.org/wiki/Gaussian_quadrature). Therefore, although field variables are stored at the nodes for the element, the evolution expressions are calculated on "quadrature points", which often are not in the same locations as the nodes. Due to the expressions being integral expressions, finite element methods operate on the weak form of a PDE. See the [Wikipedia page](https://en.wikipedia.org/wiki/Finite_element_method) for a general introduction. + +#### Fourier pseudospectral +Along with finite difference methods, Fourier pseudospectral methods are historically a common spatial discretization for phase-field codes. Although Fourier pseudospectral methods have similar theoretical underpinnings as finite element methods, in practice, implementing a Fourier pseudospectral code is very different from the other methods listed here. In comparison to the other methods with a local representation of the fields, the Fourier pseudospectral method has a global representation of the fields using sines and cosines. As a result, derivatives of fields can be calculated using fast Fourier transforms (FFTs); in the reciprocal space, a spatial derivative becomes a multiplication with a wavenumber. This FFT-centric approach avoids the need for linear solvers that the other spatial discretization may need, leading to a popular semi-implicit time integration scheme (see below for more details). Fourier pseudospectral methods have the fastest spatial convergence of any scheme here, exponential convergence (as compared to polynomial convergence for the other methods). To balance these advantages, Fourier pseudospectral methods have restrictions that the other methods do not. The reliance on FFTs means that periodic boundary conditions are the only type of boundary conditions possible. The FFTs also require a uniform, structured mesh, so no adaptive meshing is possible in most situations (e.g., unless a coordinate tranformation is possible to project onto a uniform, structured mesh). + +#### Spatial Discretization Summary Table +| | Strengths | Weaknesses | +| --- | :---: | :---: | +| __Finite difference__ | Simple to code
Minimal computational overhead
Adaptive meshing is possible | Conservation is not guaranteed depending on the stencil
Difficult to use on complex geometries (more complicated on non-uniform grids and much more complicated (impossible?) on unstructured grids)
Adaptive meshing is constrained by need for a structured mesh | +| __Finite volume__ | Naturally conservative
Adaptive meshing is possible
Can be used for arbitrary geometries (via unstructured meshes)
Simpler to implement than finite element methods | More complicated to implement than finite difference or Fourier-pseudospectral
Orders of accuracy higher than two substantially increase complexity | +| __Finite element__ | Adaptive meshing is possible
Can be used for arbitrary geometries (via unstructured meshes)
Fairly straightforward extension to higher orders of accuracy
Popularity in other domains may aid multiphysics coupling | Most complicated to code
Most computational overhead | +| __Fourier pseudospectral__ | Simple to code
Highest spatial error convergence rate
"Free" implicit handling of linear terms | Limited to periodic boundary conditions
Limited to uniform, structured meshes | + +#### Adaptive Mesh Refinement +Adaptive mesh refinement (AMR) is the process of changing the mesh for a calculation so that the mesh is finer in regions where the spatial error is expected to be high (e.g., where fields are changing rapidly) and coarser where the spatial error is expected to be low (e.g., where fields are changing slowly). An example of adaptive mesh refinement for the PFHub Benchmark 3 problem is shown below: + +(Insert BM3 AMR example) + +Note that in this example, the mesh is the finest near the solid-liquid interface and coarsest far from the interface in the liquid. PFHub Benchmark 3 is an example of a problem where adaptive meshing is particularly useful -- at any given time, the area of the interfacial region is a small fraction of the total area. The interfacial region needs a fine mesh to resolve the transition of the order parameter, but a coarse mesh can be used far into the liquid where only thermal diffusion is active. The [uploaded results](https://pages.nist.gov/pfhub/simulations/3a.1/) with by far the fastest run times for this simulations, using MOOSE and PRISMS-PF, both take advantage of adaptive meshing. + +In other cases, the benefits of adaptive mesh refinement may not be worth the computation overhead and increase in complexity. The early stages of evolution for PFHub Benchmark 1 are an example of this case. The composition field is rapidly varying almost everywhere in the domain, and coarsening the mesh in any location would likely introduce substantial error. + +Three main adaptive meshing schemes are: +- Adaptive unstructured meshes (full freedom of mesh shape, but high overhead) +- Block-structured meshes (a mesh made of rectangular regions at different levels of refinement) +- Quadtree/octree meshes (hierarchical mesh where refinement occurs by bisecting parent elements) + +#### Methods for Applying Boundary Conditions on Internal Boundaries +Although many phase-field problems of interest can be solved in a rectangular domain with boundary conditions applied on the boundaries of the computational domain, in some cases, you may want to apply boundary conditions along an _internal_ boundary. There are two typical circumstances where this occurs. One circumstance is where the domain of interest has some complex (perhaps dynamic) shape but you do not want to have a body-fitting mesh (e.g., due to code or method limitations). The second circumstance is that you are using a Fourier pseudospectral method and want to impose non-periodic boundary conditions. + +Two methods have been developed to handle this issue -- to impose boundary conditions internally in a computational domain that decouple the solution domain from the computational domain. The [immersed interface method](https://epubs.siam.org/doi/book/10.1137/1.9780898717464) is a sharp-interface method for imposing internal boundary conditions. The [smoothed boundary method](https://doi.org/10.1088/0965-0393/20/7/075008) is a diffuse interface method for imposing internal boundary conditions. In some circumstances, these methods may provide a performant way to side-step the restrictions on the meshes for Fourier pseudospectral or finite difference phase-field codes. + +To date, none of the PFHub uploads have used these methods, but Benchmark 6b is an example of where it may be appropriate. + +### Choosing a Time Integration Method + +If your model is time dependent, you will need to choose a scheme for integrating in time (or time stepping). +A time integrator is typically described in terms of its order of accuracy and whether it is explicit or implicit. +Classic examples include: + +- Forward Euler (FE) method, a first-order explicit method +- Backward Euler (BE) method, a first-order implicit method +- Crank-Nicolson (CN) method, a second-order semi-implicit method + +These methods often serve as prototypes for other families of general-purpose time integrators that have successfully been employed in phase-field codes. +**Many of the community codes that participate in PFHub already offer selections of time integrators; the documentation of those packages will often include suggestions on what to choose for your model.** + +If you are using a code that does not provide its own time integrators or you are writing your own code, there are many factors to consider when picking a scheme. +**The "best" time integrator for your model will depend upon your governing equations, the spatial discretization, any required linear and nonlinear solvers, and even the computational hardware you have available. +You may need to experiment with different schemes to find the right balance of performance and accuracy for your needs.** +This last step can require significant amounts of time and coding. + +If you need to implement your own time integrator, we provide a brief overview of integration schemes and their strengths and weaknesses, but this discussion serves as a relatively high-level overview. +Time integration is an active area of research across the phase-field, applied math, and computational science communities, and it is impossible to cover every consideration. + + +#### Explicit vs. Implicit Methods + +In explicit methods, the solution at a future time step is only a function of previous time steps. +By comparison, for implicit methods, the solution at a future time step is a function of the future and previous time steps. +Forward Euler, for example, has the form $(u^{n+1} - u^n) / \Delta t = f(u^n)$, and Backward Euler has the form $(u^{n+1} - u^n) / \Delta t = f(u^{n+1})$. +Broadly, we can summarize the strengths (+) and weaknesses (-) as follows: + +| | Explicit | Implicit | +| --- | :---: | :---: | +| Code complexity | + | - | +| Time step cost | + | - | +| Time step size | - | + | +| Memory usage | + | - | + +However, there are notable exceptions for each row. +Additionally, choices that influence each row of the above table also affect the overall consistency of a scheme. + +**Complexity:** +In general, explicit solvers do not require nonlinear solvers for the time-dependent portions of the model, and linear solvers are either not required (finite difference methods, many finite volume methods) or only require the inversion of the mass matrix (finite element methods). +This reduction in necessary solver components can reduce overall development time (less code, less debugging), which may allow you to start running simulations sooner. +Additionally, from a working FE code, it is straightforward to implement either explicit/embedded Runge-Kutta methods, Adams-Bashforth methods, or Predictor-Corrector (e.g., Milne) methods. + +By comparison, fully implicit methods will usually require the implementation of nonlinear and linear solvers. +Some methods might allow for one of these eliminated: for example, the linearly implicit Rosenbrock Methods do not require a nonlinear solver. +However, most codes will adopt a modified Newton method where a linear solver is required at each nonlinear iteration. +The BE method can be a prototype for various flavors of implicit Runge-Kutta methods (IRK, DIRK, SDIRK, ESDIRK, etc.), Adams-Moulton methods, or Backward Differentiation Formula (BDF) methods, but there are fewer similarities between these methods than there is between the explicit methods. + +**Time step cost and size:** +Due to the need to solve a (non-)linear system of equations, one time step of an implicit method can be orders of magnitude more expensive than one time step of an explicit method. +If iterative solvers are employed, the cost of each step will also vary with the overall conditioning of the system from one time step to the next. + +However, it is well-known that explicit solvers often have strict requirements for the stable time step size (e.g., $\Delta t \propto \Delta x^2$ for FE discretization of heat equation). +By comparison, most implicit methods are either unconditionally stable or have much wider stability regions +For a given time interval and similar order of accuracy, an explicit method will usually take many more time steps than an implicit method, which can increase the accumulated roundoff error (this will depend on the particular schemes). +Also, if the increase in stable step size is large enough, the implicit method may end up requiring less walltime to solve the entire model. + +**Memory usage:** +Explicit and implicit schemes can have different requirements on the amount of RAM that is needed for the same overall problem size. +If we consider the FE and BE methods, both can be implemented with two vectors: one for $u^n$ and one for $u^{n+1}$. +For the explicit method, this places no restrictions on the resulting solver algorithm: you can solve for $u^{n+1}$ and then either copy it to $u^n$ or swap the associated pointers in the code. +However, economizing memory in the implicit scheme limits your method to classical iterative methods like Newton-Gauss-Seidel, which may not offer satisfactory performance in your overall code. +More powerful solvers like Newton-Krylov methods will require more memory, but will allow the implicit method to converge quickly. + +While not universally true, this leads to a rule of thumb that for equal numbers of stages or steps, an explicit scheme will require less memory than an implicit scheme. +However, low-order implicit schemes may be able to take significantly larger time steps than even high-order explicit schemes, which can equalize the overall cost. + +#### Coupling and Consistency + +Comment about how hard it can be to solve multiple equations simultaneously. +Do you solve multiple small systems or one large system? + +#### Semi-Implicit and ImEx Methods + +In semi-implicit and implicit-explicit (ImEx) methods, different terms in the governing equations are approximated by different implicit or explicit schemes. +These methods have a long history in the phase-field community and, as suggested by their name, behave "in between" explicit and implicit schemes. +For example, convex splitting methods for the Cahn-Hilliard equation naturally result in implicit and explicit terms. +Semi-implicit methods are also the default choice in Fourier pseudospectral methods. +In more general models, physics with "fast" time scales may be solved implicitly, while physics with "slow" time scales may be solved explicitly. + +The resulting schemes are usually much cheaper than fully implicit methods. +The largest stable or accurate time step size will typically be reduced compared to an implicit scheme, but is usually much larger than an explicit scheme. + +#### Time Step Adaptivity + +When choosing the time step size of an integrator, there is a need to balance computational cost (i.e., larger step size, fewer time steps, lower cost) and the numerical accuracy (smaller step size, better approximation of time derivatives, lower error, and improved solvability). +Just as we can adaptively refine and coarsen the mesh of a spatial discretization to improve accuracy or reduce the computational cost, we can also employ adaptive methods when choosing a time step. +In many Runge-Kutta and Rosenbrock methods, the scheme provides an embedded estimate of the error in the solution. +A weighted norm of this error can be compared to a specified tolerance, which decides if the time step is accepted or rejected, and then the step size can be adjusted by a PID controller or some other filter. +In multistep methods, we can derive estimates of the leading truncation error, which then allows us to check the accuracy of a step. +However, different methods will have different rules about how to change step size: Runge-Kutta methods can usually change the step size by large amounts every time step, but multistep methods often have to change by smaller amounts or only every few time steps. + +When properly implemented, adaptive time stepping improves confidence in solution quality, minimizes the chance of your solution "exploding" from too large of a time step, and can save time with expensive schemes by reducing step size in fast-changing regions of time and increasing it when the dynamics are slower. + +#### General Guidelines + +1. For initial development, it is best to start with simpler schemes like Forward Euler. This will allow you to gain an understanding of your model's behavior, check for bugs in the basic mechanics of the code, and start estimating the cost of simulations. If the model is inexpensive or you don't plan to use the code more than a few times, a basic integrator may be all you need. +1. If you are forced to use small time steps on the scale of time you want to simulate, you might consider an implicit integrator (again, start with simpler schemes like BE or CN). +1. If your model contains varying time scales (e.g. from coupled physics, concentration-dependent mobility) and you have difficulty maintaining a stable time step or find that the convergence is unpredictable, adaptive time stepping will likely be helpful. If you are using explicit schemes, consider trying an embedded Runge-Kutta method. For implicit schemes, you might try a higher-order BDF method if your right-hand-side function is expensive to compute or a diagonally implicit Runge-Kutta method. +1. If you need to solve an elliptic governing equation simultaneously ([as in Benchmark 6](https://pages.nist.gov/pfhub/benchmarks/benchmark6-hackathon.ipynb/)), the resulting system of differential-algebraic equations (DAEs) is likely to be very stiff. Even if the time-dependent portion is not expensive to evaluate, the cost of constantly performing the elliptic solve can be significant with explicit methods. Consider BDF methods, diagonally implicit or additive Runge-Kutta methods, or Rosenbrock methods. +1. For coupled physics, carefully examine how each equation is related. Some time-dependent terms may be less strongly coupled than others or be more costly to evaluate in a fully implicit scheme, so you might consider a semi-implicit or ImEx scheme such as an additive Runge-Kutta method. + +Many families of time integrators have variants that can choose the time step size adaptively. +Additionally, the Adams and BDF methods have implementations with variable order of accuracy. +**If your code does not already provide time integration, many packages exist for various flavors of time steppers**, including but not limited to [SUNDIALS](https://github.com/LLNL/sundials), [PETSc TS](https://petsc.org/release/docs/manualpages/TS/index.html), [Tempus](https://trilinos.github.io/tempus.html), and [DifferentialEquations.jl](https://github.com/SciML/DifferentialEquations.jl). + +### Choosing Linear and Nonlinear Solvers (If Needed) + +Depending on your spatial/temporal discretizations and whether you need to solve any elliptic governing equations, you may need to implement or choose a set of appropriate linear and nonlinear solvers. +**Many codes will already provide solvers that work well for their packages.** +For example, if you were implementing a model in FEniCS, the developers have already exposed options from PETSC's nonlinear and linear solver interfaces and you can easily switch between different dense, sparse, and iterative methods. +Even if you are implementing your own code, **solvers may already be available from the libraries you link to and you may not need to write your own.** +For example, SUNDIALS provides a set of linear and nonlinear solvers that are already optimized for its time-stepping routines. + +If you need to write your own solvers, we provide some general guidelines below. + +#### When You Might Need Linear or Nonlinear Solvers + +The need for (non)linear solvers in a given code will depend on the equations you are solving and your choices of spatiotemporal discretizations. +As a simple example, we can consider incremental changes to a 1D Allen-Cahn-type model for a driven phase transformation (i.e., a simplified form of BM3). +For a spatial discretization with centered finite differences and time integration by Forward Euler, the equation at each point of the mesh will be of the form + +$$ +\phi_i^{n+1} = \phi_i^n + \Delta t ( \phi_{i+1}^n - 2 \phi_i^n + \phi_{i-1}^n - g'(\phi_i^n) - Q p'(\phi_i^n) ) +$$ + +where $n$ corresponds to the time step of the solution, $i$ corresponds to the grid points, $\Delta t$ is the time step, $Q$ is the driving force, and $g'$ and $p'$ are the derivatives of the double-well and interpolation function, respectively. +Note that we assume values of 1 for mobility, $\kappa / \Delta x^2$, and the well height. +All of the quantities on the right-hand side are known: we can evaluate each $\phi_i^{n+1}$ directly without needing to perform any linear or nonlinear solvers. +This is sometimes referred to as "linearization through explicit time stepping." + +A common approach to improve time step stability of a PFM is to employ a convex split of the governing equations where we decompose the nonlinear terms as $g(\phi) = g_+ (\phi) + g_- (\phi)$ and $p(\phi) = p_+ (\phi) + p_- (\phi)$, where $+$ indicates the purely convex portion of the function and $-$ is the remaining (presumably concave) portion. +Typically, we solve this convex-split approach by ImEx methods such as Forward-Backward Euler: + +$$ +\phi_i^{n+1} - \Delta t ( \phi_{i+1}^{n+1} - 2\phi_i^{n+1} + \phi_{i-1}^{n+1} - g_+'(\phi_i^{n+1}) - Qp_+'(\phi_i^{n+1}) ) = \phi_i^n - \Delta t ( g_-'(\phi_i^n) + Qp_-'(\phi_i^n) ) +$$ + +This system of equations is now semi-implicit in nature, but we can form the convex split such that the left-hand side is fully linear, e.g., $g_+(\phi) = a \phi^2$ for $g(\phi) = \phi^2 (1-\phi)^2$. +As a result, we need a linear solver for this scheme (such as a tridiagonal LU decomposition) to obtain $\{\phi^{n+1}\}$, but no nonlinear solver. +We can use larger time step sizes than with Forward Euler, but we can easily "break" the system so that we don't observe a monotonic decrease in free energy. + +Lastly, we may choose to discretize this system by the Backward Euler method: + +$$ +\phi_i^{n+1} - \Delta t (\phi_{i+1}^{n+1} - 2\phi_i^{n+1} + \phi_{i-1}^{n+1} - g'(\phi_i^{n+1}) - Qp'(\phi_i^{n+1}) = \phi_i^n +$$ + +The left-hand side is now fully implicit and nonlinear. +We will need to perform a nonlinear solve at each time step, and this may or may not require the solution of additional linear systems. + +#### Types of Nonlinear Solvers + +Two of the most common types of nonlinear methods you will encounter are **fixed-point methods**, which solve problems of the form $G(u) = u$, and **root finding methods**, which solve problems of the form $F(u) = 0$. +We can usually convert fixed-point problems to root-finding problems by letting $F(u) = G(u) - u$, but the reverse conversion may not be as well-behaved and will be problem dependent. +These methods have some similarities in underlying concepts, but the resulting algorithms and implementation can vastly differ. + +While not discussed here, another important class of nonlinear methods is Full Approximation Scheme (FAS) multigrid solvers. +In FAS, we obtain solutions of the system $A(u) = f$ by relaxing the residual and its error on progressively coarsened grids, after which we interpolate a set of corrections onto the finer grid levels. +Depending on the forms of $A(u)$ and $f$, this method can look like a fixed-point or root-finding method that can be applied to a wide range of systems, although the implementation can be quite complex. + +**Fixed-Point Methods:** A basic fixed-point method will often adopt the following approach: + +1. For the current guess of $u$, compute the nonlinear function, $G(u)$ +1. Calculate a new guess by $\tilde{u} = G(u)$ +1. Converged if $||u - \tilde{u}|| < tol$ +1. Assign $u = \tilde{u}$ +1. If not converged, go to (1) + +This is often referred to as functional iteration or Picard iteration. +**While simple to implement, this basic scheme may converge slowly or fail to converge at all.** +There are schemes to accelerate the convergence of the series (e.g., Anderson Mixing, Aitken's Delta-Squared Method), or we can linearize the nonlinear function about $\tilde{u}$ as $G(\tilde{u}) \approx G(u) + \mathbf{J} (\tilde{u} - u)$, where $\mathbf{J} = \nabla G(u)$ is the Jacobian matrix of the nonlinear system. +The resulting **linearized fixed-point method** is then of the form: + +1. For the current guess of $u$, compute the nonlinear function, $G(u)$ +1. Solve the linear system $(\mathbf{I} - \mathbf{J})\tilde{u} = G(u) - \mathbf{J}u$ +1. Converged if $||u - \tilde{u}|| < tol$ +1. Assign $u = \tilde{u}$ +1. If not converged, go to (1) + +As a note, we may not need to explicitly assemble $\mathbf{J}$, or the associated linear solver in step (2) might arise "naturally" in the governing equations. +For example, a pointwise Jacobi-type fixed-point iteration for the fully-implicit 1D Allen-Cahn example can be written as + +$$ +\tilde{\phi_i}^{n+1} = \frac{\phi_i^n + \Delta t (\phi_{i+1}^{n+1} + \phi_{i-1}^{n+1} - g'(\phi_i^{n+1}) + g''(\phi_i^{n+1})\phi_i^{n+1} - Q p'(\phi_i^{n+1}) + Q p''(\phi_i^{n+1}) \phi_i^{n+1} )}{1 + 2 \Delta t + \Delta t ( g''(\phi_i^{n+1}) + Q p''(\phi_i^{n+1}) )} +$$ + +where $g''$ and $p''$ are second derivatives of the respective functions. +This combines steps (1) and (2) into a single process as we sweep over the entire mesh to evaluate $\{\tilde{\phi}^{n+1}\}$. + +**Root-Finding Methods:** In many cases, a root-finding method will often adopt some sort of Newton-type method where we linearize the function through a Taylor expansion, obtain a correction to the solution, and then iterate until convergence. +For example, the classic **Newton-Raphson method** can be written as: + +1. For the current guess of $u$, calculate $F(u)$ and its Jacobian matrix $\mathbf{J}$ +1. Correct the solution by solving the linear system $\delta u = - \mathbf{J}^{-1} F(u)$ +1. Converged if $||\delta u|| < tol$ +1. Assemble the next guess as $\tilde{u} = u + \delta u$ +1. Assign $u = \tilde{u}$ +1. If not converged, go to (1) + +Immediately, we can recognize a similarity between the Newton-Raphson approach and the linearized fixed-point iteration: both perform a linearization about the current value of the function for a guess of $u$ and solve a linear system to obtain the next guess. +(Note: this is part of why we say that fixed-point solutions can be obtained through an equivalent root-finding method.) + +Assembling $\mathbf{J}$ and solving the linear system for $\delta u$ can be exceptionally expensive. +However, if *iterative linear solvers* are employed, a few iterations of the linear method can significantly reduce the residual of the nonlinear system. +This leads to the formation of an **inexact Newton method**: + +1. For the current guess of $u$, calculate $F(u)$ and its Jacobian matrix $\mathbf{J}$ +1. Perform $k$ iterations of an iterative linear solver to approximately solve $\mathbf{J} \delta u = - F(u)$ +1. Converged if $||\delta u|| < tol$ +1. Assemble the next guess as $\tilde{u} = u + \delta u$ +1. Assign $u = \tilde{u}$ +1. If not converged, go to (1) + +We may make further modifications to this algorithm to potentially improve performance, such as only evaluating $\mathbf{J}$ every few iterations. +If we employ Krylov methods for step (2), we do not necessarily need to form the Jacobian and instead only need to evaluate matrix-vector products $\mathbf{J} \delta u$. +This leads to the popular and powerful **Jacobian-Free Newton-Krylov (JFNK) method**, which is employed by many community codes and software libraries. +Also common are **Newton-Multigrid methods**, where a few multigrid iterations are performed in step (2). +We may further try to "globalize" the solution by combining the inexact Newton method with a line-search method to find an optimal decrease in the residual, usually under the condition $||F(u + \alpha \delta u)|| < ||F(u)||$ with $\alpha$ between 0 and 1. + +If we examine the pointwise Jacobi scheme for the fully-implicit Allen-Cahn, we see that this is essentially an inexact Newton method that does one inner iteration of Jacobi relaxation at each outer Newton iteration. +Thus, we can see that there are some general similarities between these broad classes of nonlinear methods. +**However, it is rare that the resulting algorithms are exactly equivalent to each other, and it can be nontrivial to switch from a fixed-point to a root-finding solver.** + +#### Types of Linear Solvers + +In the above discussion, we've observed that linear solvers are necessary as a result of the discretization of the governing equations or because we need to solve a nonlinear system of equations. +**The choice of solver will depend on the size of your simulation and whether you can easily evaluate a Jacobian matrix of your system.** +Up to a few thousand unknowns, direct linear solvers (e.g. LAPACK, UMFPACK, cuSolver, SuperLU) that offer dense or sparse variants of typical methods like LU decomposition and QR factorization will often be efficient, provided it is easy to evaluate the entries of the Jacobian matrix. +However, it is important to remember that dense direct solvers typically scale O(n^2) for required memory and O(n^3) for the number of operations and quickly become unsolvable. +The scalability of sparse direct solvers will depend on the particular method and the implementing library. +For millions or billions of unknowns across large numbers of CPUs or GPUs, iterative solvers are often necessary. +Here, a wide range of options exists; in particular, relaxation, multigrid, and Krylov methods all parallelize well and have been employed in a variety of community codes and numerical libraries. + +Some of the simplest iterative methods are stationary relaxation methods such as the Jacobi, Gauss-Seidel, and (Symmetric) Successive Over-Relaxation methods. +Classically, these are derived by splitting the Jacobian matrix as $J = D - E - F$, where $D$ is the diagonal, $-E$ is the purely lower triangular portion, and $-F$ is the purely upper triangular portion. +Depending on how we manipulate $D$, $E$, and $F$, we obtain the above methods or their symmetric variants; however, **we may not need to directly form the Jacobian or its submatrices**, as we observed in the above Allen-Cahn example. +**The simplicity and low memory requirements of relaxation methods make them attractive methods, but they often converge slowly.** +The convergence can be improved by employing multigrid methods: **Geometric Multigrid methods converge rapidly by applying relaxation methods** on multiple levels of structured grids and are popular solvers for a wide range of problems. + +Krylov methods (e.g. Conjugate Gradient, GMRES, BiCGSTAB, TFQMR) are a powerful family of linear solvers that form a subspace from a linear operator (such as the Jacobian) and the residual vectors of the system (this is a very simplified explanation). +While these methods can be formulated to directly use the Jacobian, **most only require the evaluation of Jacobian-vector products**, which is what leads to the "Jacobian-free" nature of JFNK methods. +This Jacobian-vector product is typically evaluated in either a functional form if the Jacobian can be easily obtained (e.g., the kernel of a linear heat equation), but for methods such as JFNK, **the Jacobian-vector product is readily approximated by the Gateaux derivative**. +These methods can, therefore, be **straightforward to implement, even with intricate linear functions**. +However, **convergence is strongly dependent on the condition number of the operator matrix.** + +The performance of Krylov methods can be improved through **preconditioning**. +Here, we form an approximation to the overall Jacobian matrix, $\mathbf{M} \approx \mathbf{J}$. +Depending on the exact method, we will then find solutions to some linear system of the residual, e.g., $\mathbf{M} z = r$, at certain points of the algorithm. +If done correctly, the computational time and the number of iterations to reach the desired tolerance will decrease. +The preconditioner, therefore, needs to (1) be easy to form and assemble, (2) be easy to solve and apply, and (3) should capture the essential physics of the system. +**Designing preconditioners is problem-dependent and can have a huge impact on the overall model performance**. +Many possible options have been applied by the phase-field community, including relaxation methods (e.g., Jacobi, Gauss-Seidel), multigrid methods (both geometric and algebraic), incomplete LU and Cholesky factorizations, sparse approximate inverses, and multiplicative or additive Schwarz methods. +**You will likely need to experiment with the best preconditioner for your model,** which can require a significant amount of time if your libraries don't already provide them. + +In summary: when choosing linear solvers, **it is not trivial to switch from a relaxation or multigrid method to a Krylov method (or vice versa)**, although the former methods can be used as preconditioners for the latter. +Changing from one Krylov method to another can be relatively straightforward, but **some Krylov methods only apply to symmetric positive definite matrices**. +Modifying the preconditioner can have varying difficulties: switching from a Jacobi to a Gauss-Seidel preconditioner is trivial, but switching to an ILU preconditioner might require much more effort. + +### Choosing an appropriate parallelism approach +(Discuss distributed vs shared, CPU vs GPU) +#### Distributed memory +(pretty much just MPI, also mention UPC or Legion or Charm++?) +#### Shared memory +CPU/GPU, performance portability layers + +## Choosing appropriate numerical libraries and/or what to write yourself +The phase-field and broader scientific computing community have developed many libraries that you may choose to use as you implement your phase-field model. As you decide which methods you want to use, an important consideration is whether you intend to write code for certain functionality yourself or whether you want to use an existing library/framework for that functionality. + +### Investigate existing solutions before writing your own +Before coding your own functionality, it is always a good idea to explore what solutions already exist. Researchers have devoted their careers to developing some scientific computing libraries and frameworks, and they may be better for your application than something you write yourself. Even in the cases where you _could_ write code for some functionality yourself that is an improvement over existing solutions, it may not be worth your time to actually do so. Finally, even if you decide that your best course is to write your own functionality, learning about other solutions may inform your approach and/or help you frame to potential users what distinguishes your implementation. + +#### Existing phase-field codes and frameworks +PFHub maintains a [list of open source phase-field codes and frameworks](https://pages.nist.gov/pfhub/codes/), one or more of which may fit your needs. + +#### Consider how existing libraries interact +Some libraries are packages in a larger collection where interfaces for interoperability have already been developed. Such large collections include [Trilinos](https://trilinos.github.io/), [PETSc](https://petsc.org/release/), and [hypre](https://github.com/hypre-space/hypre)/[SAMRAI](https://github.com/LLNL/SAMRAI)/[SUNDIALS](https://sundials.readthedocs.io/en/latest/). Staying within an ecosystem may reduce your time to solution and will keep you on a well-traveled path if you reach out to developers or a user community for help. + +#### Consider local expertise +An important consideration for choosing a library or framework is who else uses it. If many other researchers in your organization use a particular library/framework, you may want to as well -- when you run into issues, they might be able to help you (and vice versa). + +### Consider licensing +Another consideration for choosing a library or framework is what the license terms are. For commercial software, license terms may dictate that a new license must be bought for each CPU core being used. With paid software, you may also want to consider the future of your work, even if you have access to that software now, that may not be true if you move institutions, your institution changes what they buy, etc. Other people who would be interested in using code that you develop would also have to pay for the underlying software. + +For open-source libraries and frameworks, a wide variety of open-source licenses exist. While a discussion of the differences between these licenses is out of the scope of this document, the details of the license may constrain how you can use the library/framework and how you can distribute derivative works. One reference for open-source licenses is the [Open Source Initiative](https://opensource.org/licenses). The terms of these licenses can be confusing and disputed. The legal department at your institution may be able to offer advice. + + +## Further reading + +### Solver Methods: + +1. Y. Saad. *Iterative Methods for Sparse Linear Systems, Second Edition.* Society for Industrial and Applied Mechanics, 2003. +1. W.L. Briggs, V. Emden Henson, S.F. McCormick. *A Multigrid Tutorial, Second Edition.* Society for Industrial and Applied Mechanics, 2000. +1. D.A. Knoll, D.E. Keyes. "Jacobian-free Newton-Krylov methods: a survey of approaches and applications." *J. Comput. Phys.* 193 (2004) 357-397. + +*** + +Topics we want to move to other sections: +- Conservation laws and symmetries (Model Formulation) +- Have an expectation going in (Model Formulation) +- Add pieces of the model one part at a time during debugging (Software Development) +- Ensure physical expectations are respected (Software Development) + +*** + +OLD TEXT + + +Contributors: Stephen DeWitt, Alex Chadwick + +Alex Chadwick, Steve Dewitt +* Carefully consider your spatial discretization scheme (FFT, FD, FV, FEM) +* Consider your temporal discretization scheme and use temporal error estimation when possible (implicit, explicit, etc.) +* Identify relevant conservation laws and symmetries for your model and carefully ensure they are respected even after long times +* Start small and add complexity. Add pieces to the model one part at a time during debugging. Check to see if it is working, then add more, then test again. +* Have an expectation going in (back of the envelope, consider basic physics), and if it doesn’t do that, figure out why. + diff --git a/_sources/bp-guide-gh/ch3-data-generation-and-curation.md b/_sources/bp-guide-gh/ch3-data-generation-and-curation.md new file mode 100644 index 0000000..eb1761d --- /dev/null +++ b/_sources/bp-guide-gh/ch3-data-generation-and-curation.md @@ -0,0 +1,500 @@ +# Data Generation and Curation + +- *[Trevor Keller](https://www.nist.gov/people/trevor-keller), NIST*, [@tkphd] +- *[Daniel Wheeler](https://www.nist.gov/people/daniel-wheeler), NIST*, [@wd15] +- *[Damien Pinto](https://ca.linkedin.com/in/damien-pinto-4748387b), McGill*, [@DamienPinto] + + +## Overview + + - Look at lit on data and see how this is implemented + - Generation and dissemination + +## Ideas + + - Data formats + - FAIR + - Metadata (hierarchical data standards (look for current versions)) + - What standards exist + - One or two examples of phase field data stored currently + - Use an existing + - Create our own example + - Practical choices for storing data (figshare, zenodo, dryad, MDF) + - Deciding what data to keep + - What data to store when publishing + - What is supplementary material versus store versus leave on hard drive + - Lit review, good citations + - minting DOIs for the data + - might include simulatioin execution and logging + - how frequently to store data + - how to store + +## How do we want to structure the sections? + + 1. Intro (Daniel) + - What is data? + - What is metadata? + - Why do we need curate data? + - What is the motivation for this document? + - What should the reader get out of this document + - Why is this useful + - Create a distinction between software, data, and post-processed results + + 2. Data Generation (Trevor) + - HPC + - file systems + - data formats + - formats not to use (e.g., don't use serialization that depends on the version of the code that reads and writes because code changes) + - don't use pickles + - restarts + - data frequency + - post-processing -> refer to other document for this + - precision + - importance of folder structure + + 3. Data Curation (Trevor) + - Why is curating data important? + - Why do we need to store our data + - What formats can we use + - Is my data too large, data sizes + - What is useful for third party / subsequent users + - How might the data be used for AI or something else + - Could a reviewer make use of your curated data + - Storing post-processed data and raw data and which to store or keep + - Minting DOIs for your software when publishing a paper + - FAIR + + 4. Metadata standards (Daniel) + - Why do we need to keep some metadata beyond the data + - Zoo of things like data dictionaries, ontologies + - however, these are not well developed for our use case + - For example, you curate on Zenodo + - what extra data should you include + - how to describe the data files + - how to maintain some minimalist info about the simulation that generated the run + - When, why and how I ran this simulation + - What software + - Give example of a yaml file with 10 flat fields + - The future should be better in this regard. People actively working to improve this issue. + + 5. Examples + - Practical examples (Trevor) + - Using Zenodo for a PFHub record to store data and metadata + - Relatively rich metadata scheme + + - Simulation from scratch (Damien) + - data generation + - folder structure + - HPC issues with data + - capture process / descriptive parameters for the data that + are useful for subsequent ML practitioners that use the data + - ML / store data + - Narrative of what gets stored to disk + - Decisions of what to keep and how frequently to save data + - Auxiliary metadata decisions + + + 6. Summary (Daniel) + 7. Biblio (Daniel) + +--- + +## Old version + +- Save the data from your published work as much as possible, with meta data +- Save the inputs used to produce the results from all your published work + +### FAIR Data + +We discussed the [FAIR Principles] at [CHiMaD Phase-Field XIII][fair-phase-field]: + +#### Findable + +- [ ] (Meta)data are assigned a globally unique and persistent identifier +- [ ] Data are described with rich metadata (defined by R1 below) +- [ ] Metadata clearly and explicitly include the identifier of the data they describe +- [ ] (Meta)data are registered or indexed in a searchable resource + +#### Accessible + +- [ ] (Meta)data are retrievable by their identifier using a standardized + communications protocol + - [ ] The protocol is open, free, and universally implementable + - [ ] The protocol allows for an authentication and authorisation procedure, + where necessary +- [ ] Metadata are accessible, even when the data are no longer available + +#### Interoperable + +- [ ] (Meta)data use a formal, accessible, shared, and broadly applicable language + for knowledge representation. +- [ ] (Meta)data use vocabularies that follow FAIR principles +- [ ] (Meta)data include qualified references to other (meta)data + +#### Reusable + +- [ ] (Meta)data are richly described with a plurality of accurate and relevant attributes + - [ ] (Meta)data are released with a clear and accessible data usage license + - [ ] (Meta)data are associated with detailed provenance + - [ ] (Meta)data meet domain-relevant community standards + +### Zenodo + +Historically, [PFHub] has accepted datasets linked from any host on the Web. +At this time, we recommend using [Zenodo] to host your benchmark data. Why? *It's not "just" a shared folder.* + +* Guided prompts to describe what you're uploading +* DOI is automatically assigned to your dataset +* Basic metadata exported in multiple formats +* Browser-based viewers for CSV, Markdown, PDF, images, videos + +#### Metadata Examples + +Zenodo gives you the option to import a repository directly from GitHub. The original [FAIR Phase-field talk](https://doi.org/10.5281/zenodo.6540105) was "uploaded" this way, producing the following record. While basic authorship information was captured, this tells an interested person or machine nothing meaningful about the dataset. + +```json +{ + "@context": "https://schema.org/", + "@id": "https://doi.org/10.5281/zenodo.6540105", + "@type": "SoftwareSourceCode", + "name": "tkphd/fair-phase-field-data: CHiMaD Phase-field XIII", + "description": "FAIR Principles for Phase-Field Practitioners", + "version": "v0.1.0", + "license": "", + "identifier": "https://doi.org/10.5281/zenodo.6540105", + "url": "https://zenodo.org/record/6540105", + "datePublished": "2022-05-11", + "creator": [{ + "@type": "Person", + "givenName": "Trevor", + "familyName": "Keller", + "affiliation": "NIST"}], + "codeRepository": "https://github.com/tkphd/fair-phase-field-data/tree/v0.1.0" +} +``` + +The *strongly* preferred method is to upload files directly. The following record represents an upload for [Benchmark 1b using HiPerC](https://doi.org/10.5281/zenodo.1124941). I would consider this metadata ***rich!*** + +```json +{ + "@context": "https://schema.org/", + "@id": "https://doi.org/10.5281/zenodo.1124941", + "@type": "Dataset", + "name": "hiperc-gpu-cuda-spinodal" + "description": "Solution to the CHiMaD Phase Field benchmark problem on spinodal decomposition using CUDA, with a 9-point discrete Laplacian stencil", + "identifier": "https://doi.org/10.5281/zenodo.1124941", + "license": "https://creativecommons.org/licenses/by/4.0/legalcode", + "url": "https://zenodo.org/record/1124941", + "datePublished": "2017-12-21", + "creator": [{ + "@type": "Person", + "@id": "https://orcid.org/0000-0002-2920-8302", + "givenName": "Trevor", + "familyName": "Keller", + "affiliation": "NIST"}], + "keywords": ["phase-field", "pfhub", "chimad"], + "sameAs": ["https://doi.org/10.6084/m9.figshare.5715103.v2"], + "distribution": [ + { + "@type": "DataDownload", + "contentUrl": "https://zenodo.org/api/files/ce1ca4a3-b6bc-4e2c-9b70-8fe45fc243fd/free-energy-9pt.csv", + "encodingFormat": "csv" + }, { + "@type": "DataDownload", + "contentUrl": "https://zenodo.org/api/files/ce1ca4a3-b6bc-4e2c-9b70-8fe45fc243fd/spinodal.0000000.png", + "encodingFormat": "png" + }, { + "@type": "DataDownload", + "contentUrl": "https://zenodo.org/api/files/ce1ca4a3-b6bc-4e2c-9b70-8fe45fc243fd/spinodal.0100000.png", + "encodingFormat": "png" + }, { + "@type": "DataDownload", + "contentUrl": "https://zenodo.org/api/files/ce1ca4a3-b6bc-4e2c-9b70-8fe45fc243fd/spinodal.0200000.png", + "encodingFormat": "png" + }] +} +``` + +#### Metadata Files + +After uploading the HiPerC simulation data, I also registered it with PFHub using `meta.yaml`. This file tells the website-generating machinery what to do with the dataset, and provides additional information about the resources required to perform the simulation. + +```yaml +--- +benchmark: + id: 1b + version: '1' +data: +- name: run_time + values: + - sim_time: '200000' + wall_time: '7464' +- name: memory_usage + values: + - unit: KB + value: '308224' +- description: free energy data + url: https://zenodo.org/api/files/ce1ca4a3-b6bc-4e2c-9b70-8fe45fc243fd/free-energy-9pt.csv +- description: microstructure at t=0 + type: image + url: https://zenodo.org/api/files/ce1ca4a3-b6bc-4e2c-9b70-8fe45fc243fd/spinodal-000000.png +- description: microstructure at t=100,000 + type: image + url: https://zenodo.org/api/files/ce1ca4a3-b6bc-4e2c-9b70-8fe45fc243fd/spinodal-100000.png +- description: microstructure at t=200,000 + type: image + url: https://zenodo.org/api/files/ce1ca4a3-b6bc-4e2c-9b70-8fe45fc243fd/spinodal-200000.png +metadata: + author: + email: trevor.keller@nist.gov + first: Trevor + github_id: tkphd + last: Keller + hardware: + acc_architecture: gpu + clock_rate: '1.48' + cores: '1792' + cpu_architecture: x86_64 + nodes: 1 + parallel_model: threaded + implementation: + repo: + url: https://github.com/usnistgov/hiperc + version: b25b14acda7c5aef565cdbcfc88f2df3412dcc46 + simulation_name: hiperc_cuda + summary: HiPerC spinodal decomposition result using CUDA on a Tesla P100 + timestamp: 18 December, 2017 +``` + +This file is not part of my dataset: it resides in the [PFHub repository on GitHub]. Furthermore, since the structure of this file specifically suits PFHub, it is of no use at all to other software, websites, or researchers. + +### Structured Data Schemas + +In the Zenodo metadata above, note the `@context` fields: [Schema.org] is a [structured data schema] *and controlled vocabulary* for describing things on the Internet. How is this useful? + +Consider the [CodeMeta] project. It creates metadata files for software projects using [Schema.org] building blocks. There's even a handy [CodeMeta Generator]! If you maintain a phase-field software framework, you can (and should!) use it to document your code in a standards-compliant, machine-readable format. This improves interoperability and reusability! + +```json +{ + "@context": "https://doi.org/10.5063/schema/codemeta-2.0", + "@type": "SoftwareSourceCode", + "license": "https://spdx.org/licenses/CC-PDDC", + "codeRepository": "git+https://github.com/usnistgov/hiperc", + "dateCreated": "2017-08-07", + "dateModified": "2019-03-04", + "downloadUrl": "https://github.com/usnistgov/hiperc/releases/tag/v1.0", + "issueTracker": "https://github.com/usnistgov/hiperc/issues", + "name": "HiPerC", + "version": "1.0.0", + "description": "High-Performance Computing in C and CUDA", + "applicationCategory": "phase-field", + "developmentStatus": "inactive", + "programmingLanguage": ["C", "CUDA", "OpenCL", "OpenMP", "TBB"], + "author": [ + { + "@type": "Person", + "@id": "https://orcid.org/my-orcid?orcid=0000-0002-2920-8302", + "givenName": "Trevor", + "familyName": "Keller", + "email": "trevor.keller@nist.gov", + "affiliation": { + "@type": "Organization", + "name": "NIST" + } + } + ] +} +``` + +That's nice! But what about our datasets? Shouldn't the [PFHub] metadata "describing" a dataset live alongside that data? + +#### Towards a Phase-Field Schema + +We are working to build a phase-field schema (or schemas) using [Schema.org] and the [schemaorg] Python library. The work-alike port of `meta.yaml` looks like the following. + +> *N.B.:* We're going to deploy a generator similar to CodeMeta's so you won't have to write this! + +```json +{ + "@context": "https://www.schema.org", + "@type": "DataCatalog", + "author": [ + { + "@type": "Person", + "affiliation": { + "@type": "GovernmentOrganization", + "name": "Materials Science and Engineering Division", + "parentOrganization": { + "@type": "GovernmentOrganization", + "name": "Material Measurement Laboratory", + "parentOrganization": { + "@type": "GovernmentOrganization", + "address": { + "@type": "PostalAddress", + "addressCountry": "US", + "addressLocality": "Gaithersburg", + "addressRegion": "Maryland", + "postalCode": "20899", + "streetAddress": "100 Bureau Drive" + }, + "identifier": "NIST", + "name": "National Institute of Standards and Technology", + "parentOrganization": "U.S. Department of Commerce", + "url": "https://www.nist.gov" + } + } + }, + "email": "trevor.keller@nist.gov", + "familyName": "Keller", + "givenName": "Trevor", + "identifier": "tkphd", + "sameAs": "https://orcid.org/0000-0002-2920-8302" + }, { + "@type": "Person", + "affiliation": { + "@type": "GovernmentOrganization", + "name": "Materials Science and Engineering Division", + "parentOrganization": { + "@type": "GovernmentOrganization", + "name": "Material Measurement Laboratory", + "parentOrganization": { + "@type": "GovernmentOrganization", + "address": { + "@type": "PostalAddress", + "addressCountry": "US", + "addressLocality": "Gaithersburg", + "addressRegion": "Maryland", + "postalCode": "20899", + "streetAddress": "100 Bureau Drive" + }, + "identifier": "NIST", + "name": "National Institute of Standards and Technology", + "parentOrganization": "U.S. Department of Commerce", + "url": "https://www.nist.gov" + } + } + }, + "email": "daniel.wheeler@nist.gov", + "familyName": "Wheeler", + "givenName": "Daniel", + "identifier": "wd15", + "sameAs": "https://orcid.org/0000-0002-2653-7418" + } + ], + "dataset": [ + { + "@type": "Dataset", + "distribution": [ + { + "@type": "PropertyValue", + "name": "parallel_nodes", + "value": 1 + }, { + "@type": "PropertyValue", + "name": "cpu_architecture", + "value": "amd64" + }, { + "@type": "PropertyValue", + "name": "parallel_cores", + "value": 12 + }, { + "@type": "PropertyValue", + "name": "parallel_gpus", + "value": 1 + }, { + "@type": "PropertyValue", + "name": "gpu_architecture", + "value": "nvidia" + }, { + "@type": "PropertyValue", + "name": "gpu_cores", + "value": 6144 + }, { + "@type": "PropertyValue", + "name": "wall_time", + "unitCode": "SEC", + "unitText": "s", + "value": 384 + }, { + "@type": "PropertyValue", + "name": "memory_usage", + "unitCode": "E63", + "unitText": "mebibyte", + "value": 1835 + } + ], + "name": "irl" + }, { + "@type": "Dataset", + "distribution": [ + { + "@type": "DataDownload", + "contentUrl": "8a/free_energy_1.csv", + "name": "free energy" + }, { + "@type": "DataDownload", + "contentUrl": "8a/solid_fraction_1.csv", + "name": "solid fraction" + }, { + "@type": "DataDownload", + "contentUrl": "8a/free_energy_2.csv", + "name": "free energy" + }, { + "@type": "DataDownload", + "contentUrl": "8a/solid_fraction_2.csv", + "name": "solid fraction" + }, { + "@type": "DataDownload", + "contentUrl": "8a/free_energy_3.csv", + "name": "free energy" + }, { + "@type": "DataDownload", + "contentUrl": "8a/solid_fraction_3.csv", + "name": "solid fraction" + } + ], + "name": "output" + } + ], + "dateCreated": "2022-10-25T19:25:02+00:00", + "description": "A fake dataset for Benchmark 8a unprepared using FiPy by @tkphd & @wd15", + "isBasedOn": { + "@type": "SoftwareSourceCode", + "codeRepository": "https://github.com/tkphd/fake-pfhub-bm8a", + "description": "Fake benchmark 8a upload with FiPy", + "runtimePlatform": "fipy", + "targetProduct": "amd64", + "version": "9df6603e" + }, + "isPartOf": { + "@type": "Series", + "identifier": "8a", + "name": "Homogeneous Nucleation", + "url": "https://pages.nist.gov/pfhub/benchmarks/benchmark8.ipynb" + }, + "keywords": [ + "phase-field", + "benchmarks", + "pfhub", + "fipy", + "homogeneous-nucleation" + ], + "license": "https://www.nist.gov/open/license#software" +} +``` + + + +[@tkphd]: https://github.com/tkphd +[@wd15]: https://github.com/wd15 +[@DamienPinto]: https://github.com/DamienPinto +[CodeMeta]: https://codemeta.github.io +[CodeMeta Generator]: https://codemeta.github.io/codemeta-generator/ +[FAIR Principles]: https://www.go-fair.org/fair-principles/ +[PFHub]: https://pages.nist.gov/pfhub +[PFHub repository on GitHub]: https://github.com/usnistgov/pfhub +[Schema.org]: https://www.schema.org +[Zenodo]: https://zenodo.org +[fair-phase-field]: https://doi.org/10.5281/zenodo.7254581 +[schemaorg]: https://github.com/openschemas/schemaorg +[structured data schema]: https://en.wikipedia.org/wiki/Data_model diff --git a/_sources/bp-guide-gh/ch4-software-development.md b/_sources/bp-guide-gh/ch4-software-development.md new file mode 100644 index 0000000..557b9a0 --- /dev/null +++ b/_sources/bp-guide-gh/ch4-software-development.md @@ -0,0 +1,97 @@ +# Software Development + +Daniel Schwen ([@dschwen](https://github.com/dschwen)), Jon Guyer ([@guyer](https://github.com/guyer)), Trevor Keller ([@tkphd](https://github.com/tkphd)) + +People don't usually arrive at phase-field methods from a software development background. +This page recommends some approaches to reduce errors and wasted time before reaching a usable state -- including the installation process. + +* Start small and ensure quality before getting bigger +* Consider whether to invoke an existing library or implementation to save time, or write it yourself to gain a deeper understanding or implement non-standard features + +## Follow good coding practices + +The choice of the programming language requires a multitude of considerations + +* Ease of development, familiarity of the language by the development team +* Target architecture and operating systems, portability +* Use of parallel computing infrastructures, MPI, GPU support +* Performance of the resulting code, compiled, interpreted, hybrid approaches + +### Commenting code and design + +Comment code generously. Whether it is for other developers working on the code or for yourself a couple of years (months?) in the future. + +> "Code is more often read than written." + +Documentation can be roughly split into API documentation and inline code documentation. + +* API documentation facilitates reuse of the code. + - [Doxygen](https://doxygen.nl/) is the _de facto_ standard for C++ API documentation, but supports many other languages, such as C, C#, Java, and Python. + - [Sphinx](https://www.sphinx-doc.org/) is the _de facto_ standard for Python API documentation. + - [ReadTheDocs](https://readthedocs.org/) is a widely used hosting site for software documentation. +* Inline code comments improve the readability and should capture the intent of the documented code (which can be very valuable for debugging purposes). + - Choose variable names that reflect their function, and don't be afraid of long names. + - Use longer comments and [docstrings](https://peps.python.org/pep-0257/) to provide context for larger blocks of code. + +API documentation should be augmented by _design documents_ that offer a high level overview over a code, library, or framework. Design +documentation describes the way different pars of the code fit together and their roles in the overall project. + +### End-user documentation + +Key to successful software projects with broad adoption is good end-user documentation. To ease the learning curve for new users, this documentation should contain + +* Installation + - Hardware requirements and software dependencies + - How to build + - How to install + - HPC considerations + - "Run the docker image" is not a (complete) installation instruction +* Introductory tutorials +* Examples +* Theory docs +* Reference documentation + +### Version control and metadata + +To facilitate contributions to a code, version control is indispensable. Version control keeps track of all changes to the code and keeps every team member working on the right version. Version control systems enable the use of code review workflows (such as the _pull request_ workflow on [GitHub](https://github.com). Code review in turn allows for input from multiple developers and for productive feedback and improvement cycles leading to a higher code quality. Open version control platforms also invite outside contributions and user engagement, leading to project growth. + +On open platforms, it is important to add and maintain metadata, such as the code license. Authorship is tracked through the version control system. + +#### License considerations + +> [Largely not unique to phase field, or even to scientific computing, so not a lot to say here, but should reference good guidance] + +* If you do not spell out your license, potential users must assume you are granting _no rights_ to copy or reuse it. +* If your institution stipulates a license, use it. +* If choosing your own, understand the implications of the license you apply: + - Some licenses may be incompatible with institutional requirements + - Some licenses, e.g., GPL, may be an obstacle to commercial adoption +* Don't try to write your own! +* http://choosealicense.org +* https://tldrlegal.com + + +### Continuous integration and testing + +Strive for a large test coverage of your code. Ideally, tests should be added to your project that exercise every single line of written code. The utility of a thorough test coverage is twofold: + +1. It protects against regressions, i.e., unintended changes in code behavior. This in turn liberates developers to refactor code as needed to improve on code design and code quality. +2. Tests can be used by the end-users to verify that they have built a fully working version of the code. + +Tests can come in the form of small problems (e.g. mini phase field problems) or unit tests. Unit tests do not build a complete simulation, but allow targeted and fast testing of select components of a code. In practice, a mix of execution of the full code and unit tests will be required to achieve comprehensive coverage. + +Use a continuous integration (CI) infrastructure. CI systems can connect to version control systems and trigger automatic builds and execution of test suites in your development workflow. For example, testing should occur for every pull request that is made to a code, to ensure that the software is never put into a broken state by incorporating new changes. + +The optimal CI infrastructure builds and tests the project with all explicitly supported compilers on all explicitly supported operating systems. In practice, the resulting matrix can be very large in particular when it comes to multiple versions of supported compilers/toolchains, which can be mitigated by declaring and testing a minimal version for each compiler in addition to a current version. + +### Code verification + +While regression tests only guarantee to maintain the _status quo_, they do not guarantee the correctness of the simulation results. _Code verification_ is required to ensure the code does what it is designed to do. Several verification approaches exist. + +1. Comparison to analytic solutions. This is often only achievable for the simplest problems (after all most simulation software is developed precisely to _numerically_ solve problems that have no analytical solutions). +2. [Method of manufactured solutions](https://www.osti.gov/servlets/purl/759450-wLI4Ux/native/) (also known as _forced solutions_). Here, a user defined solution to an equation system is forced by applying boundary conditions and source terms derived from inserting the user defined solution into the equation system. +3. Scaling laws. Known scaling laws, such as coarsening rate over time or convergence rate as a function of domain discretization, can be tested to discover implementation errors. + +## TODO + +- Am I disseminating this software? diff --git a/_sources/bp-guide-gh/ch5-problem-setup.md b/_sources/bp-guide-gh/ch5-problem-setup.md new file mode 100644 index 0000000..1287853 --- /dev/null +++ b/_sources/bp-guide-gh/ch5-problem-setup.md @@ -0,0 +1,157 @@ +# Problem Set-Up + +Larry Aagesen ([@laagesen](https://github.com/laagesen)), David Montiel, Sourabh Kadambi ([@sourabhkadambi](https://github.com/sourabhkadambi)), Sudipta Biswas ([@SudiptaBiswas](https://github.com/SudiptaBiswas)) + +After the phase-field model formulation is developed, implemented in code, and verified, it can be set up to solve the scientific/engineering problem of interest. The purpose of this page is to give guidance on some of the important considerations when setting up your code to solve your specific problem, organized in the following sections: + +[Spatial dimension (1D vs. 2D vs. 3D)](#spatial-dimension) + +[Initial conditions](#initial-conditions) + +[Boundary conditions](#boundary-conditions) + +[Interface width](#interface-width) + +[Convergence](#convergence-studies) + +[Impact of orientation](#impact-of-orientation) + +[Kinetics and how long to run](#kinetics-and-how-long-to-run) + + +## Spatial Dimension + +In setting up a phase-field simulation, it is important to understand the role of spatial dimensions in the physics governing the problem, and how that might impact the simulation results and its interpretation. This is particularly important if simulations are being performed in reduced dimensions compared to the actual dimension of the problem, which is a common practice employed to reduce the computational costs. + +It is likely that the physical behavior of a certain phenomenon might scale differently in 1D, 2D and 3D. This could be related to the physical processes in the bulk regions of the system or at the interfacial regions or both. +For instance, the amount of interfacial region relative to the bulk phase region differs in 1D, 2D and 3D, and also governs many physical aspects of material behavior. + +Therefore, it is important to determine how reduced dimensionality might affect predictions or comparison of simulation results with reality. In certain situations, on the other hand, it might be appropriate to setup the problem in reduced dimensions of 1D or 2D due to the inherent symmetry or directionality in the problem. Moreover, for simple microstructure geometries, it might be possible to setup the model in cylindrical or spherical coordinates, which can allow the simplicity of 1D computations while also capturing 2D and 3D behavior of the model accurately. + +### Example + +To demonstrate a case where simulation outcomes can significantly differ in different dimensions, we consider the [single seed case](https://pages.nist.gov/pfhub/benchmarks/benchmark8.ipynb/#Part-%28a%29) of the [homogeneous nucleation](https://www.sciencedirect.com/science/article/abs/pii/S0927025621000963?via%3Dihub) benchmark problem. A simple phase-field model with a single non-conserved order parameter describes an isothermal pure substance with one liquid phase (order parameter = $0$) and one solid phase (order parameter = $1$). The nucleation driving force for the solid phase is $\Delta f=\sqrt2/30$. The free energy of the diffuse interface is $\gamma = 1/3\sqrt2$. + +We consider a seed nucleus of $7.5$ unit radius in 2D and 3D. The 2D simulation domain is of size $100\times100$, and the 3D simulation domain is of size $40 \times 40 \times 40$. The nucleus is centered at $x=y=z=0$. Uniform mesh of element size $\Delta x = 0.09765$ is used. Neumann boundary conditions, given by the zero normal-derivative of the order parameter, are applied on all domain boundaries. The figure below shows the starting geometry of the nucleus in 2D (left) and 3D (right). + +2D_7-5radius +3D_7-5radius + +The time evolution of the order parameter, given by the Allen-Cahn equation, was solved using the MOOSE framework. Details of the numerical method can be found in [Wu et al. (2021)](https://www.sciencedirect.com/science/article/abs/pii/S0927025621000963?via%3Dihub). +The simulations results of nucleus evolution are shown in the figures below: (left) order parameter profile measured radially from the center of domain at different evolution times; (right) radius as a function of evolution time. We see that the seed of same starting radius $r_\circ = 7.5$ units evolves starkly differently in 2D and 3D. While the nucleus grows in 2D, it shrinks and dissolves in 3D. + +nucleusOP_evol_2D_vs_3D +radius_evol_2D_vs_3D +

+ +The role of dimensionality in homogeneous nucleation can be understood from the classical nucleation theory where the solid-liquid interface is modeled as a mathematically sharp interface. The interface is a 1D line in a 2D system and a 2D plane in a 3D system. The free energy of the nucleus particle $\Delta G(r)$ is a balance between the energy cost in forming the interface, and the energy released due to the driving force in forming the bulk particle. For a 2D system, $\Delta G(r) = 2\pi r\gamma - \pi r^2 \Delta f$. For a 3D system, $\Delta G(r) = 4 \pi r^2 \gamma - (4 \pi /3) r^3 \Delta f$. When the rate of change of free energy with respect to particle size is negative, the particle is favored to grow; otherwise it will shrink and dissolve. By setting $d \Delta G / d r = 0$, we obtain the critical radius as $r_c = \gamma/ \Delta f$ in 2D and $r_c = 2\gamma/ \Delta f$ in 3D. + +We can now apply the above sharp-interface analysis to our diffuse interface approximation in the phase-field model. For the given model parameters, we obtain $r_c = 5$ units in 2D and $r_c = 10$ units in 3D. In our simulation setup of $r_\circ = 7.5$ units, $r_\circ$ $>$ $r_c$ in 2D, but $r_\circ < r_c$ in 3D. Therefore, the nucleus is favored to grow in 2D but shrinks in 3D as observed in the simulations. + + +radius_2D +radius_3D + +The dependence on dimensionality is further illustrated by considering cases where the initial radius is close to the critical radius: $r_\circ = 0.99 r_c$, $r_\circ = r_c$ and $r_\circ = 1.01 r_c$. The simulation results of radius evolution are shown above for 2D (left) and 3D (right). As expected from the the classical homogeneous nucleation theory, the sub-critical nucleus with $r_\circ = 0.99 r_c$ shrinks and the super-critical nucleus with $r_\circ = 1.01 r_c$ grows. + +Since the nucleus in the phase-field model is a diffuse-interface approximation of the classical sharp interface nucleus, $r_\circ = r_c$ is fairly close to an unstable equilibrium. Ideally, the radius would remain constant with time. However, since the system is unstable, small numerical errors accumulate with time, eventually leading to growth or shrinkage of the nucleus. During initial time steps, the interface profile is expected to undergo some changes from the starting profile due to equilibration. While the $tanh$ function is a common choice for the initial condition of the interface, it is an exact solution only for a planar interface, representative of a 1D scenario. + +## Initial conditions + +For simulations of the evolution of two or more phases, it is important to anticipate the expected equilibrium state of the system given the initial conditions. To do this, one needs the phase diagram as determined by the bulk contribution of the free energy density. + +For example, in simulating phase separation following spinodal decomposition, it is common to define the initial state of the order parameter as a spatially uniform field with an added small 'noisy' perturbation with small amplitude. However, this order parameter must be within the spinodal region of the phase diagram, i.e., the region where spontaneous decomposition leads to a decrease in the free energy. Below we show two instances that demonstrate that choosing different values for the baseline order parameter, $c_{0,base}$, and the same initial perturbation term, $\xi(\vec{r})$, for the initial conditions of leads to different dynamics. + +![c0_0p15](https://github.com/usnistgov/pfhub/assets/16142451/e2d2ddca-9aa9-4c78-a0b1-2148ef2ed577) +![c0_0p45](https://github.com/usnistgov/pfhub/assets/16142451/8580071f-e29b-4b2a-8aa4-b0902e1610cf) + +## Boundary conditions + +Boundary conditions (BC) are required to solve for the governing equations in all phase field simulations. In general, every field must have a defined BC at every boundary of the system. The three most common types of boundary conditions (BC) for phase field simulation are: + +- Dirichlet BC: The value of a field is specified at the boundary. This type of boundary condition is useful whenever we want to impose a value to an order parameter or field at one or more boundaries. Some common examples include setting a constant value for temperature to simulate a heat reservoir, or setting a constant value for a solid/liquid order parameter to indicate a fixed phase beyond the confines of the system. +- Neumann BC: The value of the spatial derivative of a field is specified at the boundary. This type of boundary conditions is useful to specify fluxes of fields at the boundary. For example, setting natural BC (a special case of Neumann BC) for a field at the boundary enforces that the normal component of gradient of that field is zero along that boundary. Therefore, if a flux for that field is proportional to this gradient, natural BC is equivalent to imposing zero flux at the boundary. This BC is convenient to ensure that the field is conserved. In addition, natural BCs are useful to exploit known symmetries in the morphology of domains: for example a spherical domain can be simulated using a quarter (in 2D) or eighth of a system (in 3D) by placing centering the sphere in a corner of the system and imposing natural BCs along the boundaries that define the corner. +- Periodic BCs: The value of the field in a boundary with periodic BC matches the value from the opposite boundary. These type of BCs are useful to simulate periodic domains, but also to minimize boundary effects. since the system does not interact with borders. + +### Try different boundary conditions and check their impact + +We used the results from Benchmark [Problem 1a](https://pages.nist.gov/pfhub/benchmarks/benchmark1.ipynb/#(a)-Square-periodic) and [Problem 1b](https://pages.nist.gov/pfhub/benchmarks/benchmark1.ipynb/#(b)-Square-no-flux) to analyze the effect of boundary conditions. In addition, we solved for Cahn-Hilliard dynamics under the same initial condition and simulation parameters as problem 1 but using mixed boundary conditions, i.e., different boundary conditions for each boundary. We compare the results for each case at simulation time _t_ = 1000. The simulations were carried out in the PRISMS-PF framework using a uniform square mesh with $N_x = N_y = 128$ linear elements and a time step, $\Delta t$ = 0.005. The results are shown in the figure below. + +![BCs_white](https://user-images.githubusercontent.com/16142451/197867529-25d4ab7e-1a69-45f8-8fee-5b2ff3284db4.png) + +As can be seen in the figure above, for periodic boundary boundaries the $\alpha$ - $\beta$ domains are **continuous** on opposite sides of the system. For No-flux boundaries, the $\alpha$ - $\beta$ interfaces are **normal** to the boundary. For Dirichlet boundaries (bottom boundary of the right panel), the value of _c_ is **fixed** along the boundary. + +## Interface width + +Phase-field modeling is a diffuse interface approach, meaning that interfaces are represented by a smooth variation of one or more order parameters across the interface. The width of the interface is a function of the model parameters and the interface width is determined by model parameter choices. In some cases, an analytical expression is available that relates interface width to phase-field model parameters (such as free energy barrier height and gradient energy coefficient, which also impact the interfacial energy). In other cases, no analytical solution is available and the interface width must be approximated or determined numerically based on parameter choices. Such details are specific to the formulation being used. + +Once the relationship between model parameters and interface width is understood, an appropriate selection of interface width needs to be made (while maintaining the correct interfacial energy for the system being studied). In some cases, the interface width in the phase-field model can be chosen to match the actual physical width of the interface being studied (such typically sub-nanometer). However, resolving a physically realistic interface width requires a sub-nanometer grid/mesh (grid/mesh convergence is described further in the next section). Using a physically realistic interface width often makes it computationally unfeasible to simulate systems large enough to be statistically representative. Therefore, in many cases an interfacial width that is much larger than the the physical width of an interface is used. In these cases, a careful balance between computational efficiency and model accuracy is needed; the interface width should be chosen to be small enough that the physics of the system are accurately represented, while maintaining adequate computational performance. A useful rule of thumb as a starting point is that the interface width should be at least an order of magnitude smaller than the smallest microstructural feature size of interest. Starting from this guideline, simulations of microstructural evolution with varying interface widths can be run to ensure that the choice of interface width does not affect the simulation results. A small test problem may be useful for testing convergence with respect to interface width; for example a shrinking circular grain embedded in another grain may be used for testing convergence of a grain growth model with respect to interface width, rather starting with large, costly simulations of hundreds of grains. + +## Convergence studies + +### Carry out grid/mesh convergence study AFTER you have finalized your interfacial width. + +As an example of a mesh convergence study, we can consider [Benchmark Problem 1](https://pages.nist.gov/pfhub/benchmarks/benchmark1.ipynb/) from the Phase-Field Community Hub. In this problem, which models spinodal decomposition using the Cahn-Hilliard equation, the width of the diffuse interface is 4.47, as defined by the Cahn-Hilliard equation and physical parameters in the problem statement. Given this interface width, we need to ensure there are a sufficient number of grid points (for finite difference schemes) or mesh elements (for finite element or finite volume schemes) through the diffuse interface to adequately resolve the variation of the composition order parameter. + +In [Problem 1b](https://pages.nist.gov/pfhub/benchmarks/benchmark1.ipynb/#(b)-Square-no-flux), a square domain with dimensions $200 \times 200$ and no-flux boundary conditions is considered. An example of a mesh convergence study for this problem using the MOOSE framework phase-field module (a finite element code) is described. The $200 \times 200$ domain is discretized using increasing numbers of elements $N_x$ in the $x$ direction and $N_y$ in the $y$ direction, maintaining $N_x = N_y$ for square elements (using linear Lagrange shape functions). The simulations with varying numbers of elements are run until a significant amount of microstructural evolution has occurred. We need to increase the number of elements until the microstructure at a fixed time no longer changes with further increases in the number of elements; at this point the simulation is converged with respect to the mesh resolution. + +The simulation initial conditions and the microstructures at $t = 10,000$ are shown in the figure below. + +Screen Shot 2022-10-25 at 3 25 26 PM + + +As the number of elements in each direction is increased from 40 to 80 to 160, changes in the microstructure are observed. However, once the number of elements increases to 320, no further changes are observed in the microstructure. Therefore, the problem is converged with respect to mesh resolution at $N_x = N_y = 160$. For this number of elements, each element has size $\Delta x = \Delta y$ = 200 / 160 = 1.25. Therefore, the number of elements through the diffuse interface width is 4.47 / 1.25 = 3.6. Practical experience in the phase-field community has shown that somewhere between 3 to 5 elements through the interface are usually required to obtain mesh convergence; however, the appropriate resolution is problem-specific, and convergence should be tested for the specific physics and parameters at hand. + +### Carry out time step convergence studies. Try higher-order schemes, adaptive time stepping, etc. For explicit time integration, know your stability limit. + +For codes that use explicit time integration, there is a maximum value of the time step beyond which the solution becomes numerically unstable. This stability limit can be determined by the Courant–Friedrichs–Lewy (CFL) condition and, in general, it strongly depends on the order of the spatial derivatives. Below we show the simulation results of [Benchmark Problem 1b](https://pages.nist.gov/pfhub/benchmarks/benchmark1.ipynb/#(b)-Square-no-flux) using time step values slightly below and slightly above the stability limit. We employed a forward Euler time-integration scheme and spatially discretized the system using $128 \times 128$ first order elements. The simulations were performed in the PRISMS-PF framework. The left panel of the figure below shows a snapshot of the concentration at time $t=33$, which was obtained using a stable time step of $\Delta t=0.015$. If the time step is increased to $\Delta t=0.016$, the time step goes above the stability limit. The right panel shows the concentration at time $t \simeq 32.39$ for $\Delta t=0.016$ and features a numerical instability that appears near the bottom boundary. After only four time steps the amplification of this instability caused the simulation to fail. + +stability_limit + +Codes that use implicit time stepping schemes may have fewer restrictions with respect to stability as time step size is increased, depending on the problem. However, discretization error still occurs in implicit schemes and increases with the size of the time step taken. Therefore, a convergence study should be carried out to ensure that the size of the time step does not affect the simulation results. As an example, we can again consider [Benchmark Problem 1](https://pages.nist.gov/pfhub/benchmarks/benchmark1.ipynb/) from the Phase-Field Community Hub. [Problem 1b](https://pages.nist.gov/pfhub/benchmarks/benchmark1.ipynb/#(b)-Square-no-flux) was solved with the phase-field module from the MOOSE framework using $N_x = N_y = 160$. The results are shown below. The microstructure at $t = 1000$ remains the same for $\Delta t = 0.1$, $\Delta t = 0.25$, and $\Delta t = 0.5$. Some differences in the microstructure are observed at $\Delta t = 1$, and further differences become apparent at $\Delta t = 4$. In practice, it is recommended to start with a given time step and gradually decrease it until no changes are apparent with further decreases in time step size. + +![Screen Shot 2022-10-24 at 9 43 26 PM](https://user-images.githubusercontent.com/3810555/197662555-124119a2-0bad-4bd4-a4c9-e5f684adad26.png) + +Adaptive time stepping can be useful to increase the time step size during time periods in the simulation where there are fewer microstructural changes, particularly for codes that use implicit time stepping schemes. However, convergence must still be checked for the parameters of the time stepping scheme being used. An example is the IterationAdaptiveDt time stepping scheme used in the MOOSE framework. This scheme attempts to increase or decrease the time step to keep the solver using a certain number of nonlinear iterations (controlled by the parameter `optimal_iterations`), within a window or plus or minus the parameter `iteration_window`. Higher values of `optimal_iterations` parameter result in higher time steps, and with that comes the risk of discretization error changing simulation results. As shown in the following, for [Problem 1b](https://pages.nist.gov/pfhub/benchmarks/benchmark1.ipynb/#(b)-Square-no-flux), `optimal_iterations` values of 6 or 8 gave results consistent with the converged time step of 0.5, but when `optimal_iterations` was significantly increased to 15, changes in the microstructure resulted. + +![Screen Shot 2022-10-24 at 10 17 37 PM](https://user-images.githubusercontent.com/3810555/197666881-21d25d59-1781-4a52-9505-d02735d4a5b4.png) + + +## Impact of Orientation + +Oftentimes, the results of the phase field simulations are sensitive to the orientation and alignment of the key microstructural features with the mesh/grid points. To demonstrate this we pick a simple solidification problem with dendritic structure formation. In this case, we utilize the solidification [example](https://github.com/idaholab/moose/blob/next/modules/phase_field/examples/anisotropic_interfaces/snow.i) from the MOOSE-based phase field module. This example problem can quickly demonstrate dendritic structure formation including the formation of secondary dendritic arms in a computationally cost-effective manner. Here, we use 4-fold symmetry of the structure and vary the reference angles to misorient the dendritic arms with respect to the mesh. Dendritic structures corresponding to 0 and 45 degree reference angle is presented below: + +Screen Shot 2022-10-24 at 2 45 09 PM +Screen Shot 2022-10-24 at 2 45 28 PM + +It is noteworthy that the shape of the dendrite varies with orientation (as observed by the difference in the dendrite center). For better comparison, we rotate the $45^o$ dendrite to align the primary dendrite arms with the reference orientation dendrite: + +Screen Shot 2022-10-25 at 1 11 29 PM + +This highlights the slight differences between the dendrite shapes, especially the center and the secondary dendritic arms. Additionally, the growth rate of the solid also varies with orientation as observed by the change in solid area fraction over time: + +Screen Shot 2022-10-25 at 1 03 55 PM + +Thus, it is important to evaluate the effect of orientation on the results by misaligning the grids. Furthermore, these effects are influenced by the discretization of the mesh. Hence, it is important to ensure that the mesh is refined enough to properly resolve the interfaces (if necessary, run a mesh convergence study). For more information about strategies to simulate multiple dendrites with varying orientation, please refer to examples by Biswas et al. [[1]](#1), Warren et al. [[2]](#2), Dorr et al. [[3]](#3), Ofori-Opoku et al. [[4]](#4), and Pusztai et al. [[5]](#5), among others. + +## Kinetics and how long to run + +The amount of time the simulation should be run depends on the science or engineering question to be answered, and on the system being studied. For many classic phase-field problems such as grain growth and coarsening, a characteristic feature size of the system increases with time, and the progress of microstructural evolution slows as the characteristic feature size increases. For example, in grain growth, at long times the mean grain diameter $D$ increases with time as $D \propto t^{1/2}$. Another example is coarsening of spherical particles in a matrix; for sufficiently low volume fraction of particles in a matrix where solute is transported by diffusion, the mean particle radius $R$ increases with time as $R \propto t^{1/3}$. + +It is also useful to be aware that the system may reach a metastable or stable equilibrium state with respect to system energy, in which case no further microstructural evolution will occur for increasing simulation time. In the grain growth example, if the system evolves to a single grain, stable equilbrium has been reached. If the system evolves to a two-grain configuration with a flat grain boundary between the grains, it has reached a metastable equilibrium; the system could still lower it energy by removing the grain boundary, but in that configuration, there is no kinetic driving force to remove it from the metastable state. To monitor for such possibilities, it is useful for the simulation to periodically output the total free energy of the system; a stable or metastable equilibrium state is indicated by a constant free energy with respect to time. + +## References +[1] +Biswas et al., “Solidification and grain formation in alloys: a 2D application of the grand-potential-based phase-field approach”, Modelling and Simulation in Materials Science and Engineering, 30 (2022) 025013. https://doi.org/10.1088/1361-651X/ac46dc + +[2] +Warren et al., “Extending phase field models of solidification to polycrystalline materials”, Acta Materialia 51 (2003) 6035–6058. https://doi.org/10.1016/S1359-6454(03)00388-4 + +[3] +Dorr et al., “A numerical algorithm for the solution of a phase-field model of polycrystalline materials”, Journal of Computational Physics 229 (2010) 626–641. https://doi.org/10.1016/j.jcp.2009.09.041 + +[4] +Ofori-Opuku et al., “A quantitative multi-phase field model of polycrystalline alloy solidification”, Acta Materialia 58 (2010) 2155-2164. https://doi.org/10.1016/j.actamat.2009.12.001 + +[5] +Pusztai et al., “Phase-field approach to polycrystalline solidification including heterogeneous and homogeneous nucleation”, Journal of Physics: Condensed Matter 20 (2008) 404205. https://doi.org/10.1088/0953-8984/20/40/404205 diff --git a/_sources/bp-guide-gh/ch6-result-dissemination.md b/_sources/bp-guide-gh/ch6-result-dissemination.md new file mode 100644 index 0000000..dd03302 --- /dev/null +++ b/_sources/bp-guide-gh/ch6-result-dissemination.md @@ -0,0 +1,79 @@ +# Result Dissemination + +Mike Tonks, Damien Tourret, Katsuyo Thornton, Jon Guyer + +How you present and disseminate your results is also a critical aspect of applying the phase-field method. Here, we provide recommended practices on disseminating your results. + +## Recommended Practices for Postprocessing and Plotting: + +### Present dimensional results whenever possible + +The phase-field method is inherently dimensional, meaning that each of its model parameters have specific dimensions in terms of length, time, energy, etc. These values vary for different materials and systems, based on material properties such as free energies, diffusivities, interfacial energies, and so on. However, it is a common practice to nondimensionalize a model to simplify the numerical solution. Nondimensionalization has also been used to avoid the need to have accurate material properties for a specific material system. In those cases, results are qualitative at best and are not material specific. + +It is recommended to present material-specific results using dimensional properties. Therefore, if you nondimensionalize your model, **always** dimensionalize your results before plotting if at all possible. Quantitative, material specific results are always higher impact than qualitative results. + +Presenting a dimensionless model with dimensional properties should be used as a sanity check that the dimensions and parameters are consistent. For that matter, even dimensional models are usually coded in a way that does not actually incorporate units in a self-consistent way, so careful balancing of equations is important. If your simulation framework supports dimensional units, you should use them. + +### Make plots and figures that clearly illustrate your data + +Well-constructed figures can greatly enhance the presentation of your data. There many general guidelines and recommendations that should be followed. Rather that reproduce them all here, we link to several valuable resources that provide great recommendations: +* Video 7: Incorporating Illustrations from [Writing as an Engineer or Scientist]( https://sites.psu.edu/scientificwriting/tutorial-reports/). +* [Nature reference](https://www.nature.com/documents/natrev-artworkguide_PS.pdf) about making good figures with excellent suggestions. +* [A Brief Guide to Designing Effective Figures for the Scientific Paper](https://onlinelibrary.wiley.com/doi/full/10.1002/adma.201102518). + +Figures can be broadly divided into two main categories, visualization of the actual simulation results and plots of postprocessed data extracted from the results. +To create images of phase field simulation results, you need post-processing visualization software. There are a number of powerful tools for visualizing simulation results, including: +* [ParaView - open source]( https://www.paraview.org/) +* [PyVista - open source]( https://pyvista.org/) +* [VisIt - open source]( https://visit-dav.github.io/visit-website/index.html) +* [Origin – commercial]( https://www.originlab.com/origin) + +These tools read in common data formats, and so your code needs to be able to output results in a supported format. [VTK formats]( https://docs.vtk.org/en/latest/design_documents/VTKFileFormats.html) are supported by all of these tools. + +To create plots of postprocessed data, the data is typically outputted directly from your simulation tool or from visualization software in formats like “.csv”. You need tools that can read in these data and then generate various types of plots. We recommend tools that allow scripts (as we discuss more, below); such tools include: +* Python, using [matplotlib](https://matplotlib.org/) for plotting and [pandas](https://pandas.pydata.org/) for csv reading. [Seaborn](https://seaborn.pydata.org/) is a useful tool as well. +* [MATLAB](https://www.mathworks.com/help/matlab/creating_plots/types-of-matlab-plots.html) +* [GNUPlot](http://www.gnuplot.info/) + + +You should also carefully consider the color scheme used in your plots. For example, some color schemes work for color blind viewers while others do not. For more information about choosing a color scheme for your figure, see Fig. 6 from [The misuse of colour in science communication](https://www.nature.com/articles/s41467-020-19160-7). + +### Automate postprocessing and plot generation + +When preparing results for dissemination, whether for a presentation, report, or paper, you will often find things that need to be changed and therefore must regenerate figures and plots. This is a normal part of research. However, the work required to regenerate figures and plots can be significantly reduced using automated scripts or a well-defined and documented reproducible protocol. The goal is to reduce the amount of "manual" operations to a minimum. Consider a paper you wrote a year or more ago; how readily could you regenerate its figures? + +Creating an image that is clear and provides all of the information needed for a typical publication in vizualization tools can often be a time-consuming process. Luckily, they often have ways of saving a given configuration that can then be reloaded to quickly generate a similar image. In Paraview, this is done by saving and loading the state. + +For plots of postprocessed, data is often outputted from research codes and then plotted using software. Plots can be generated and then edited manually or scripts can be used that define all aspects of the plot. The use of scripts may make the time it takes to create the plot the first time slightly longer but will reduce the time to regenerate the plots to almost zero. Scripts also ensure that your plots have a consistent look when regenerated. + +## Recommended Practices for Papers + +### Provide all of the information needed for someone else to reproduce your results + +A critical aspect of scientific publication is the reproduction of results by other researchers. For papers using the phase-field method, that means you need to provide enough information that the reader could reproduce your results. It can be helpful to put yourself in the shoes of your readers; if you come back to this work in a few years, how readily could you perform these simulations again? This information does not have to be provided in the main body of the paper, but can be in appendices or supplemental information. The provided information should include: + +* The value used for every parameter in the model. Even if the values are given in one of your references, you should still provide the values in your paper. +* The domain dimension and size +* Initial conditions and boundary conditions +* Other conditions used for each simulation, including temperature and length of time. +* The discretization scheme, including types of spatial and temporal discretization and spatial discretization spacing and time step size. + +Even if using a proprietary simulation tool, the input files should be published as the ultimate source of how a simulation was performed. There are potentially multiple levels that may impact reproducibility: + +1. The parameter file(s), configuration file(s), or driver script(s) for the specific simulation. +2. The environment variables and batch script(s) used to initiate a series of simulations. +3. The HPC scheduler configuration file. + +GUI configuration is particularly challenging from a reproducibility standpoint, but even command-line arguments that affect the simulation are undesirable unless they are captured (and published) in the next highest level of configuration/script/driver. **[note: Some of this may better belong in, or cross-reference to, [Software-Development](ch4-software-development.md).]** + +### Clearly state all assumptions + +All models are generated by making assumptions and approximations. You should state every assumption and approximation made in the formulation of the model and why they were made. This includes any assumptions involved in equations you have taken from the literature. It is impossible for a reader to understand the strengths and weaknesses of your model without knowing the assumptions and approximations. + +### Include key verification results + +It is natural to present large simulation results that capture complex behaviors that occur in nature. However, it can often be difficult to assess how well a model is performing in such large simulation results because the behavior is so complex. Therefore, when presenting phase-field model/simulation results, it is important to validate/verify the accuracy of the model and its implementation by simulating simple problems that more clearly demonstrate the accuracy of the model/code. Such simple problems may have known analytical solutions, against which the simulated results can be compared for verification (see [Code Verification](ch4-software-development.md#code-verification)]). Key results from such studies should be shared along with the main simulation results in a repository or in a supplementary document of the associated publication. + +### Share your input file, output data, and/or codes + +The best practice is to share key output data and input files where it is findable and accessible in a manner that the data is interoperable and reusable (FAIR); see [Data-Generation-and-Curation](ch3-data-generation-and-curation.md). For projects funded by federal agencies, your data management plan may also require you to publish your data associated with your publication. There are several public repositories to which your data/files can be uploaded and shared, which are described in [Data-Generation-and-Curation](ch3-data-generation-and-curation.md). The data should be accompanied by key metadata, including information about the software used to generate the output and the associated publication. The publication should also be associated with the shared data via DOI. If the codes are not publicly available, it is also encouraged that they are shared as well. diff --git a/_sources/defaults/markdown-notebooks.md b/_sources/defaults/markdown-notebooks.md new file mode 100644 index 0000000..a057a32 --- /dev/null +++ b/_sources/defaults/markdown-notebooks.md @@ -0,0 +1,53 @@ +--- +jupytext: + formats: md:myst + text_representation: + extension: .md + format_name: myst + format_version: 0.13 + jupytext_version: 1.11.5 +kernelspec: + display_name: Python 3 + language: python + name: python3 +--- + +# Notebooks with MyST Markdown + +Jupyter Book also lets you write text-based notebooks using MyST Markdown. +See [the Notebooks with MyST Markdown documentation](https://jupyterbook.org/file-types/myst-notebooks.html) for more detailed instructions. +This page shows off a notebook written in MyST Markdown. + +## An example cell + +With MyST Markdown, you can define code cells with a directive like so: + +```{code-cell} +print(2 + 2) +``` + +When your book is built, the contents of any `{code-cell}` blocks will be +executed with your default Jupyter kernel, and their outputs will be displayed +in-line with the rest of your content. + +```{seealso} +Jupyter Book uses [Jupytext](https://jupytext.readthedocs.io/en/latest/) to convert text-based files to notebooks, and can support [many other text-based notebook files](https://jupyterbook.org/file-types/jupytext.html). +``` + +## Create a notebook with MyST Markdown + +MyST Markdown notebooks are defined by two things: + +1. YAML metadata that is needed to understand if / how it should convert text files to notebooks (including information about the kernel needed). + See the YAML at the top of this page for example. +2. The presence of `{code-cell}` directives, which will be executed with your book. + +That's all that is needed to get started! + +## Quickly add YAML metadata for MyST Notebooks + +If you have a markdown file and you'd like to quickly add YAML metadata to it, so that Jupyter Book will treat it as a MyST Markdown Notebook, run the following command: + +``` +jupyter-book myst init path/to/markdownfile.md +``` diff --git a/_sources/defaults/markdown.md b/_sources/defaults/markdown.md new file mode 100644 index 0000000..567652b --- /dev/null +++ b/_sources/defaults/markdown.md @@ -0,0 +1,53 @@ +# Markdown Files + +Whether you write your book's content in Jupyter Notebooks (`.ipynb`) or +in regular markdown files (`.md`), you'll write in the same flavor of markdown +called **MyST Markdown**. +This is a simple file to help you get started and show off some syntax. + +## What is MyST? + +MyST stands for "Markedly Structured Text". It +is a slight variation on a flavor of markdown called "CommonMark" markdown, +with small syntax extensions to allow you to write **roles** and **directives** +in the Sphinx ecosystem. + +For more about MyST, see [the MyST Markdown Overview](https://jupyterbook.org/content/myst.html). + +## Sample Roles and Directives + +Roles and directives are two of the most powerful tools in Jupyter Book. They +are kind of like functions, but written in a markup language. They both +serve a similar purpose, but **roles are written in one line**, whereas +**directives span many lines**. They both accept different kinds of inputs, +and what they do with those inputs depends on the specific role or directive +that is being called. + +Here is a "note" directive: + +```{note} +Here is a note +``` + +It will be rendered in a special box when you build your book. + +Here is an inline directive to refer to a document: {doc}`markdown-notebooks`. + + +## Citations + +You can also cite references that are stored in a `bibtex` file. For example, +the following syntax: `` {cite}`holdgraf_evidence_2014` `` will render like +this: + +Moreover, you can insert a bibliography into your page with this syntax: +The `{bibliography}` directive must be used for all the `{cite}` roles to +render properly. +For example, if the references for your book are stored in `references.bib`, +then the bibliography is inserted with: + + +## Learn more + +This is just a simple starter to get you started. +You can learn a lot more at [jupyterbook.org](https://jupyterbook.org). diff --git a/_sources/defaults/notebooks.ipynb b/_sources/defaults/notebooks.ipynb new file mode 100644 index 0000000..fdb7176 --- /dev/null +++ b/_sources/defaults/notebooks.ipynb @@ -0,0 +1,122 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Content with notebooks\n", + "\n", + "You can also create content with Jupyter Notebooks. This means that you can include\n", + "code blocks and their outputs in your book.\n", + "\n", + "## Markdown + notebooks\n", + "\n", + "As it is markdown, you can embed images, HTML, etc into your posts!\n", + "\n", + "![](https://myst-parser.readthedocs.io/en/latest/_static/logo-wide.svg)\n", + "\n", + "You can also $add_{math}$ and\n", + "\n", + "$$\n", + "math^{blocks}\n", + "$$\n", + "\n", + "or\n", + "\n", + "$$\n", + "\\begin{aligned}\n", + "\\mbox{mean} la_{tex} \\\\ \\\\\n", + "math blocks\n", + "\\end{aligned}\n", + "$$\n", + "\n", + "But make sure you \\$Escape \\$your \\$dollar signs \\$you want to keep!\n", + "\n", + "## MyST markdown\n", + "\n", + "MyST markdown works in Jupyter Notebooks as well. For more information about MyST markdown, check\n", + "out [the MyST guide in Jupyter Book](https://jupyterbook.org/content/myst.html),\n", + "or see [the MyST markdown documentation](https://myst-parser.readthedocs.io/en/latest/).\n", + "\n", + "## Code blocks and outputs\n", + "\n", + "Jupyter Book will also embed your code blocks and output in your book.\n", + "For example, here's some sample Matplotlib code:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "from matplotlib import rcParams, cycler\n", + "import matplotlib.pyplot as plt\n", + "import numpy as np\n", + "plt.ion()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Fixing random state for reproducibility\n", + "np.random.seed(19680801)\n", + "\n", + "N = 10\n", + "data = [np.logspace(0, 1, 100) + np.random.randn(100) + ii for ii in range(N)]\n", + "data = np.array(data).T\n", + "cmap = plt.cm.coolwarm\n", + "rcParams['axes.prop_cycle'] = cycler(color=cmap(np.linspace(0, 1, N)))\n", + "\n", + "\n", + "from matplotlib.lines import Line2D\n", + "custom_lines = [Line2D([0], [0], color=cmap(0.), lw=4),\n", + " Line2D([0], [0], color=cmap(.5), lw=4),\n", + " Line2D([0], [0], color=cmap(1.), lw=4)]\n", + "\n", + "fig, ax = plt.subplots(figsize=(10, 5))\n", + "lines = ax.plot(data)\n", + "ax.legend(custom_lines, ['Cold', 'Medium', 'Hot']);" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "There is a lot more that you can do with outputs (such as including interactive outputs)\n", + "with your book. For more information about this, see [the Jupyter Book documentation](https://jupyterbook.org)" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.8.0" + }, + "widgets": { + "application/vnd.jupyter.widget-state+json": { + "state": {}, + "version_major": 2, + "version_minor": 0 + } + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/intro.md b/_sources/intro.md new file mode 100644 index 0000000..132936d --- /dev/null +++ b/_sources/intro.md @@ -0,0 +1,15 @@ +# Phase Field Method Recommended Practices + +While the phase-field method is a powerful tool for modeling microstructure evolution, the value gained by its use depends on how it is used. The PFHub community has compiled a set of **Recommended Practices** that help to ensure the best outcomes from your use of the phase-field method. + +These recommended practices have been broken down into several categories in the first part of the website. + + +```{tableofcontents} +``` + +The second part of the website a small sample book to give you a feel for how book content is +structured. +It shows off a few of the major file types, as well as some sample content. +It does not go in-depth into any particular topic - check out [the Jupyter Book documentation](https://jupyterbook.org) for more information. + diff --git a/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css b/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css new file mode 100644 index 0000000..3225661 --- /dev/null +++ b/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative}details.sd-dropdown .sd-summary-title{font-weight:700;padding-right:3em !important;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;user-select:none}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary{list-style:none;padding:1em}details.sd-dropdown summary .sd-octicon.no-title{vertical-align:middle}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown summary::-webkit-details-marker{display:none}details.sd-dropdown summary:focus{outline:none}details.sd-dropdown .sd-summary-icon{margin-right:.5em}details.sd-dropdown .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary:hover .sd-summary-up svg,details.sd-dropdown summary:hover .sd-summary-down svg{opacity:1;transform:scale(1.1)}details.sd-dropdown .sd-summary-up svg,details.sd-dropdown .sd-summary-down svg{display:block;opacity:.6}details.sd-dropdown .sd-summary-up,details.sd-dropdown .sd-summary-down{pointer-events:none;position:absolute;right:1em;top:1em}details.sd-dropdown[open]>.sd-summary-title .sd-summary-down{visibility:hidden}details.sd-dropdown:not([open])>.sd-summary-title .sd-summary-up{visibility:hidden}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #007bff;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0069d9;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem} diff --git a/_sphinx_design_static/design-tabs.js b/_sphinx_design_static/design-tabs.js new file mode 100644 index 0000000..36b38cf --- /dev/null +++ b/_sphinx_design_static/design-tabs.js @@ -0,0 +1,27 @@ +var sd_labels_by_text = {}; + +function ready() { + const li = document.getElementsByClassName("sd-tab-label"); + for (const label of li) { + syncId = label.getAttribute("data-sync-id"); + if (syncId) { + label.onclick = onLabelClick; + if (!sd_labels_by_text[syncId]) { + sd_labels_by_text[syncId] = []; + } + sd_labels_by_text[syncId].push(label); + } + } +} + +function onLabelClick() { + // Activate other inputs with the same sync id. + syncId = this.getAttribute("data-sync-id"); + for (label of sd_labels_by_text[syncId]) { + if (label === this) continue; + label.previousElementSibling.checked = true; + } + window.localStorage.setItem("sphinx-design-last-tab", syncId); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_static/_sphinx_javascript_frameworks_compat.js b/_static/_sphinx_javascript_frameworks_compat.js new file mode 100644 index 0000000..8549469 --- /dev/null +++ b/_static/_sphinx_javascript_frameworks_compat.js @@ -0,0 +1,134 @@ +/* + * _sphinx_javascript_frameworks_compat.js + * ~~~~~~~~~~ + * + * Compatability shim for jQuery and underscores.js. + * + * WILL BE REMOVED IN Sphinx 6.0 + * xref RemovedInSphinx60Warning + * + */ + +/** + * select a different prefix for underscore + */ +$u = _.noConflict(); + + +/** + * small helper function to urldecode strings + * + * See https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/decodeURIComponent#Decoding_query_parameters_from_a_URL + */ +jQuery.urldecode = function(x) { + if (!x) { + return x + } + return decodeURIComponent(x.replace(/\+/g, ' ')); +}; + +/** + * small helper function to urlencode strings + */ +jQuery.urlencode = encodeURIComponent; + +/** + * This function returns the parsed url parameters of the + * current request. Multiple values per key are supported, + * it will always return arrays of strings for the value parts. + */ +jQuery.getQueryParameters = function(s) { + if (typeof s === 'undefined') + s = document.location.search; + var parts = s.substr(s.indexOf('?') + 1).split('&'); + var result = {}; + for (var i = 0; i < parts.length; i++) { + var tmp = parts[i].split('=', 2); + var key = jQuery.urldecode(tmp[0]); + var value = jQuery.urldecode(tmp[1]); + if (key in result) + result[key].push(value); + else + result[key] = [value]; + } + return result; +}; + +/** + * highlight a given string on a jquery object by wrapping it in + * span elements with the given class name. + */ +jQuery.fn.highlightText = function(text, className) { + function highlight(node, addItems) { + if (node.nodeType === 3) { + var val = node.nodeValue; + var pos = val.toLowerCase().indexOf(text); + if (pos >= 0 && + !jQuery(node.parentNode).hasClass(className) && + !jQuery(node.parentNode).hasClass("nohighlight")) { + var span; + var isInSVG = jQuery(node).closest("body, svg, foreignObject").is("svg"); + if (isInSVG) { + span = document.createElementNS("http://www.w3.org/2000/svg", "tspan"); + } else { + span = document.createElement("span"); + span.className = className; + } + span.appendChild(document.createTextNode(val.substr(pos, text.length))); + node.parentNode.insertBefore(span, node.parentNode.insertBefore( + document.createTextNode(val.substr(pos + text.length)), + node.nextSibling)); + node.nodeValue = val.substr(0, pos); + if (isInSVG) { + var rect = document.createElementNS("http://www.w3.org/2000/svg", "rect"); + var bbox = node.parentElement.getBBox(); + rect.x.baseVal.value = bbox.x; + rect.y.baseVal.value = bbox.y; + rect.width.baseVal.value = bbox.width; + rect.height.baseVal.value = bbox.height; + rect.setAttribute('class', className); + addItems.push({ + "parent": node.parentNode, + "target": rect}); + } + } + } + else if (!jQuery(node).is("button, select, textarea")) { + jQuery.each(node.childNodes, function() { + highlight(this, addItems); + }); + } + } + var addItems = []; + var result = this.each(function() { + highlight(this, addItems); + }); + for (var i = 0; i < addItems.length; ++i) { + jQuery(addItems[i].parent).before(addItems[i].target); + } + return result; +}; + +/* + * backward compatibility for jQuery.browser + * This will be supported until firefox bug is fixed. + */ +if (!jQuery.browser) { + jQuery.uaMatch = function(ua) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec(ua) || + /(webkit)[ \/]([\w.]+)/.exec(ua) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec(ua) || + /(msie) ([\w.]+)/.exec(ua) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(ua) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; + }; + jQuery.browser = {}; + jQuery.browser[jQuery.uaMatch(navigator.userAgent).browser] = true; +} diff --git a/_static/basic.css b/_static/basic.css new file mode 100644 index 0000000..5685b52 --- /dev/null +++ b/_static/basic.css @@ -0,0 +1,928 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2022 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +div.section::after { + display: block; + content: ''; + clear: left; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 270px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li p.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 360px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} +a.brackets:before, +span.brackets > a:before{ + content: "["; +} + +a.brackets:after, +span.brackets > a:after { + content: "]"; +} + + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, figure.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, figure.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, figure.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, figure.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar, +aside.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px; + background-color: #ffe; + width: 40%; + float: right; + clear: right; + overflow-x: auto; +} + +p.sidebar-title { + font-weight: bold; +} +div.admonition, div.topic, blockquote { + clear: left; +} + +/* -- topics ---------------------------------------------------------------- */ +div.topic { + border: 1px solid #ccc; + padding: 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- content of sidebars/topics/admonitions -------------------------------- */ + +div.sidebar > :last-child, +aside.sidebar > :last-child, +div.topic > :last-child, +div.admonition > :last-child { + margin-bottom: 0; +} + +div.sidebar::after, +aside.sidebar::after, +div.topic::after, +div.admonition::after, +blockquote::after { + display: block; + content: ''; + clear: both; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + margin-top: 10px; + margin-bottom: 10px; + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > :first-child, +td > :first-child { + margin-top: 0px; +} + +th > :last-child, +td > :last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure, figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption, figcaption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number, +figcaption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text, +figcaption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist { + margin: 1em 0; +} + +table.hlist td { + vertical-align: top; +} + +/* -- object description styles --------------------------------------------- */ + +.sig { + font-family: 'Consolas', 'Menlo', 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', monospace; +} + +.sig-name, code.descname { + background-color: transparent; + font-weight: bold; +} + +.sig-name { + font-size: 1.1em; +} + +code.descname { + font-size: 1.2em; +} + +.sig-prename, code.descclassname { + background-color: transparent; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.sig-param.n { + font-style: italic; +} + +/* C++ specific styling */ + +.sig-inline.c-texpr, +.sig-inline.cpp-texpr { + font-family: unset; +} + +.sig.c .k, .sig.c .kt, +.sig.cpp .k, .sig.cpp .kt { + color: #0033B3; +} + +.sig.c .m, +.sig.cpp .m { + color: #1750EB; +} + +.sig.c .s, .sig.c .sc, +.sig.cpp .s, .sig.cpp .sc { + color: #067D17; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +:not(li) > ol > li:first-child > :first-child, +:not(li) > ul > li:first-child > :first-child { + margin-top: 0px; +} + +:not(li) > ol > li:last-child > :last-child, +:not(li) > ul > li:last-child > :last-child { + margin-bottom: 0px; +} + +ol.simple ol p, +ol.simple ul p, +ul.simple ol p, +ul.simple ul p { + margin-top: 0; +} + +ol.simple > li:not(:first-child) > p, +ul.simple > li:not(:first-child) > p { + margin-top: 0; +} + +ol.simple p, +ul.simple p { + margin-bottom: 0; +} + +/* Docutils 0.17 and older (footnotes & citations) */ +dl.footnote > dt, +dl.citation > dt { + float: left; + margin-right: 0.5em; +} + +dl.footnote > dd, +dl.citation > dd { + margin-bottom: 0em; +} + +dl.footnote > dd:after, +dl.citation > dd:after { + content: ""; + clear: both; +} + +/* Docutils 0.18+ (footnotes & citations) */ +aside.footnote > span, +div.citation > span { + float: left; +} +aside.footnote > span:last-of-type, +div.citation > span:last-of-type { + padding-right: 0.5em; +} +aside.footnote > p { + margin-left: 2em; +} +div.citation > p { + margin-left: 4em; +} +aside.footnote > p:last-of-type, +div.citation > p:last-of-type { + margin-bottom: 0em; +} +aside.footnote > p:last-of-type:after, +div.citation > p:last-of-type:after { + content: ""; + clear: both; +} + +/* Footnotes & citations ends */ + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} + +dl.field-list > dt:after { + content: ":"; +} + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > :first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +dl > dd:last-child, +dl > dd:last-child > :last-child { + margin-bottom: 0; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0 0.5em; + content: ":"; + display: inline-block; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +pre, div[class*="highlight-"] { + clear: both; +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; + white-space: nowrap; +} + +div[class*="highlight-"] { + margin: 1em 0; +} + +td.linenos pre { + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + display: block; +} + +table.highlighttable tbody { + display: block; +} + +table.highlighttable tr { + display: flex; +} + +table.highlighttable td { + margin: 0; + padding: 0; +} + +table.highlighttable td.linenos { + padding-right: 0.5em; +} + +table.highlighttable td.code { + flex: 1; + overflow: hidden; +} + +.highlight .hll { + display: block; +} + +div.highlight pre, +table.highlighttable pre { + margin: 0; +} + +div.code-block-caption + div { + margin-top: 0; +} + +div.code-block-caption { + margin-top: 1em; + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +table.highlighttable td.linenos, +span.linenos, +div.highlight span.gp { /* gp: Generic.Prompt */ + user-select: none; + -webkit-user-select: text; /* Safari fallback only */ + -webkit-user-select: none; /* Chrome/Safari */ + -moz-user-select: none; /* Firefox */ + -ms-user-select: none; /* IE10+ */ +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + margin: 1em 0; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: absolute; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +} \ No newline at end of file diff --git a/_static/check-solid.svg b/_static/check-solid.svg new file mode 100644 index 0000000..92fad4b --- /dev/null +++ b/_static/check-solid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/_static/clipboard.min.js b/_static/clipboard.min.js new file mode 100644 index 0000000..54b3c46 --- /dev/null +++ b/_static/clipboard.min.js @@ -0,0 +1,7 @@ +/*! + * clipboard.js v2.0.8 + * https://clipboardjs.com/ + * + * Licensed MIT © Zeno Rocha + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return o}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),c=n.n(e);function a(t){try{return document.execCommand(t)}catch(t){return}}var f=function(t){t=c()(t);return a("cut"),t};var l=function(t){var e,n,o,r=1 + + + + diff --git a/_static/copybutton.css b/_static/copybutton.css new file mode 100644 index 0000000..f1916ec --- /dev/null +++ b/_static/copybutton.css @@ -0,0 +1,94 @@ +/* Copy buttons */ +button.copybtn { + position: absolute; + display: flex; + top: .3em; + right: .3em; + width: 1.7em; + height: 1.7em; + opacity: 0; + transition: opacity 0.3s, border .3s, background-color .3s; + user-select: none; + padding: 0; + border: none; + outline: none; + border-radius: 0.4em; + /* The colors that GitHub uses */ + border: #1b1f2426 1px solid; + background-color: #f6f8fa; + color: #57606a; +} + +button.copybtn.success { + border-color: #22863a; + color: #22863a; +} + +button.copybtn svg { + stroke: currentColor; + width: 1.5em; + height: 1.5em; + padding: 0.1em; +} + +div.highlight { + position: relative; +} + +/* Show the copybutton */ +.highlight:hover button.copybtn, button.copybtn.success { + opacity: 1; +} + +.highlight button.copybtn:hover { + background-color: rgb(235, 235, 235); +} + +.highlight button.copybtn:active { + background-color: rgb(187, 187, 187); +} + +/** + * A minimal CSS-only tooltip copied from: + * https://codepen.io/mildrenben/pen/rVBrpK + * + * To use, write HTML like the following: + * + *

Short

+ */ + .o-tooltip--left { + position: relative; + } + + .o-tooltip--left:after { + opacity: 0; + visibility: hidden; + position: absolute; + content: attr(data-tooltip); + padding: .2em; + font-size: .8em; + left: -.2em; + background: grey; + color: white; + white-space: nowrap; + z-index: 2; + border-radius: 2px; + transform: translateX(-102%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); +} + +.o-tooltip--left:hover:after { + display: block; + opacity: 1; + visibility: visible; + transform: translateX(-100%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); + transition-delay: .5s; +} + +/* By default the copy button shouldn't show up when printing a page */ +@media print { + button.copybtn { + display: none; + } +} diff --git a/_static/copybutton.js b/_static/copybutton.js new file mode 100644 index 0000000..2ea7ff3 --- /dev/null +++ b/_static/copybutton.js @@ -0,0 +1,248 @@ +// Localization support +const messages = { + 'en': { + 'copy': 'Copy', + 'copy_to_clipboard': 'Copy to clipboard', + 'copy_success': 'Copied!', + 'copy_failure': 'Failed to copy', + }, + 'es' : { + 'copy': 'Copiar', + 'copy_to_clipboard': 'Copiar al portapapeles', + 'copy_success': '¡Copiado!', + 'copy_failure': 'Error al copiar', + }, + 'de' : { + 'copy': 'Kopieren', + 'copy_to_clipboard': 'In die Zwischenablage kopieren', + 'copy_success': 'Kopiert!', + 'copy_failure': 'Fehler beim Kopieren', + }, + 'fr' : { + 'copy': 'Copier', + 'copy_to_clipboard': 'Copier dans le presse-papier', + 'copy_success': 'Copié !', + 'copy_failure': 'Échec de la copie', + }, + 'ru': { + 'copy': 'Скопировать', + 'copy_to_clipboard': 'Скопировать в буфер', + 'copy_success': 'Скопировано!', + 'copy_failure': 'Не удалось скопировать', + }, + 'zh-CN': { + 'copy': '复制', + 'copy_to_clipboard': '复制到剪贴板', + 'copy_success': '复制成功!', + 'copy_failure': '复制失败', + }, + 'it' : { + 'copy': 'Copiare', + 'copy_to_clipboard': 'Copiato negli appunti', + 'copy_success': 'Copiato!', + 'copy_failure': 'Errore durante la copia', + } +} + +let locale = 'en' +if( document.documentElement.lang !== undefined + && messages[document.documentElement.lang] !== undefined ) { + locale = document.documentElement.lang +} + +let doc_url_root = DOCUMENTATION_OPTIONS.URL_ROOT; +if (doc_url_root == '#') { + doc_url_root = ''; +} + +/** + * SVG files for our copy buttons + */ +let iconCheck = ` + ${messages[locale]['copy_success']} + + +` + +// If the user specified their own SVG use that, otherwise use the default +let iconCopy = ``; +if (!iconCopy) { + iconCopy = ` + ${messages[locale]['copy_to_clipboard']} + + + +` +} + +/** + * Set up copy/paste for code blocks + */ + +const runWhenDOMLoaded = cb => { + if (document.readyState != 'loading') { + cb() + } else if (document.addEventListener) { + document.addEventListener('DOMContentLoaded', cb) + } else { + document.attachEvent('onreadystatechange', function() { + if (document.readyState == 'complete') cb() + }) + } +} + +const codeCellId = index => `codecell${index}` + +// Clears selected text since ClipboardJS will select the text when copying +const clearSelection = () => { + if (window.getSelection) { + window.getSelection().removeAllRanges() + } else if (document.selection) { + document.selection.empty() + } +} + +// Changes tooltip text for a moment, then changes it back +// We want the timeout of our `success` class to be a bit shorter than the +// tooltip and icon change, so that we can hide the icon before changing back. +var timeoutIcon = 2000; +var timeoutSuccessClass = 1500; + +const temporarilyChangeTooltip = (el, oldText, newText) => { + el.setAttribute('data-tooltip', newText) + el.classList.add('success') + // Remove success a little bit sooner than we change the tooltip + // So that we can use CSS to hide the copybutton first + setTimeout(() => el.classList.remove('success'), timeoutSuccessClass) + setTimeout(() => el.setAttribute('data-tooltip', oldText), timeoutIcon) +} + +// Changes the copy button icon for two seconds, then changes it back +const temporarilyChangeIcon = (el) => { + el.innerHTML = iconCheck; + setTimeout(() => {el.innerHTML = iconCopy}, timeoutIcon) +} + +const addCopyButtonToCodeCells = () => { + // If ClipboardJS hasn't loaded, wait a bit and try again. This + // happens because we load ClipboardJS asynchronously. + if (window.ClipboardJS === undefined) { + setTimeout(addCopyButtonToCodeCells, 250) + return + } + + // Add copybuttons to all of our code cells + const COPYBUTTON_SELECTOR = 'div.highlight pre'; + const codeCells = document.querySelectorAll(COPYBUTTON_SELECTOR) + codeCells.forEach((codeCell, index) => { + const id = codeCellId(index) + codeCell.setAttribute('id', id) + + const clipboardButton = id => + `` + codeCell.insertAdjacentHTML('afterend', clipboardButton(id)) + }) + +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} + + +var copyTargetText = (trigger) => { + var target = document.querySelector(trigger.attributes['data-clipboard-target'].value); + + // get filtered text + let exclude = '.linenos'; + + let text = filterText(target, exclude); + return formatCopyText(text, '', false, true, true, true, '', '') +} + + // Initialize with a callback so we can modify the text before copy + const clipboard = new ClipboardJS('.copybtn', {text: copyTargetText}) + + // Update UI with error/success messages + clipboard.on('success', event => { + clearSelection() + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_success']) + temporarilyChangeIcon(event.trigger) + }) + + clipboard.on('error', event => { + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_failure']) + }) +} + +runWhenDOMLoaded(addCopyButtonToCodeCells) \ No newline at end of file diff --git a/_static/copybutton_funcs.js b/_static/copybutton_funcs.js new file mode 100644 index 0000000..dbe1aaa --- /dev/null +++ b/_static/copybutton_funcs.js @@ -0,0 +1,73 @@ +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +export function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +export function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} diff --git a/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css b/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css new file mode 100644 index 0000000..3225661 --- /dev/null +++ b/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative}details.sd-dropdown .sd-summary-title{font-weight:700;padding-right:3em !important;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;user-select:none}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary{list-style:none;padding:1em}details.sd-dropdown summary .sd-octicon.no-title{vertical-align:middle}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown summary::-webkit-details-marker{display:none}details.sd-dropdown summary:focus{outline:none}details.sd-dropdown .sd-summary-icon{margin-right:.5em}details.sd-dropdown .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary:hover .sd-summary-up svg,details.sd-dropdown summary:hover .sd-summary-down svg{opacity:1;transform:scale(1.1)}details.sd-dropdown .sd-summary-up svg,details.sd-dropdown .sd-summary-down svg{display:block;opacity:.6}details.sd-dropdown .sd-summary-up,details.sd-dropdown .sd-summary-down{pointer-events:none;position:absolute;right:1em;top:1em}details.sd-dropdown[open]>.sd-summary-title .sd-summary-down{visibility:hidden}details.sd-dropdown:not([open])>.sd-summary-title .sd-summary-up{visibility:hidden}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #007bff;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0069d9;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem} diff --git a/_static/design-tabs.js b/_static/design-tabs.js new file mode 100644 index 0000000..36b38cf --- /dev/null +++ b/_static/design-tabs.js @@ -0,0 +1,27 @@ +var sd_labels_by_text = {}; + +function ready() { + const li = document.getElementsByClassName("sd-tab-label"); + for (const label of li) { + syncId = label.getAttribute("data-sync-id"); + if (syncId) { + label.onclick = onLabelClick; + if (!sd_labels_by_text[syncId]) { + sd_labels_by_text[syncId] = []; + } + sd_labels_by_text[syncId].push(label); + } + } +} + +function onLabelClick() { + // Activate other inputs with the same sync id. + syncId = this.getAttribute("data-sync-id"); + for (label of sd_labels_by_text[syncId]) { + if (label === this) continue; + label.previousElementSibling.checked = true; + } + window.localStorage.setItem("sphinx-design-last-tab", syncId); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_static/doctools.js b/_static/doctools.js new file mode 100644 index 0000000..c3db08d --- /dev/null +++ b/_static/doctools.js @@ -0,0 +1,264 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Base JavaScript utilities for all Sphinx HTML documentation. + * + * :copyright: Copyright 2007-2022 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ +"use strict"; + +const _ready = (callback) => { + if (document.readyState !== "loading") { + callback(); + } else { + document.addEventListener("DOMContentLoaded", callback); + } +}; + +/** + * highlight a given string on a node by wrapping it in + * span elements with the given class name. + */ +const _highlight = (node, addItems, text, className) => { + if (node.nodeType === Node.TEXT_NODE) { + const val = node.nodeValue; + const parent = node.parentNode; + const pos = val.toLowerCase().indexOf(text); + if ( + pos >= 0 && + !parent.classList.contains(className) && + !parent.classList.contains("nohighlight") + ) { + let span; + + const closestNode = parent.closest("body, svg, foreignObject"); + const isInSVG = closestNode && closestNode.matches("svg"); + if (isInSVG) { + span = document.createElementNS("http://www.w3.org/2000/svg", "tspan"); + } else { + span = document.createElement("span"); + span.classList.add(className); + } + + span.appendChild(document.createTextNode(val.substr(pos, text.length))); + parent.insertBefore( + span, + parent.insertBefore( + document.createTextNode(val.substr(pos + text.length)), + node.nextSibling + ) + ); + node.nodeValue = val.substr(0, pos); + + if (isInSVG) { + const rect = document.createElementNS( + "http://www.w3.org/2000/svg", + "rect" + ); + const bbox = parent.getBBox(); + rect.x.baseVal.value = bbox.x; + rect.y.baseVal.value = bbox.y; + rect.width.baseVal.value = bbox.width; + rect.height.baseVal.value = bbox.height; + rect.setAttribute("class", className); + addItems.push({ parent: parent, target: rect }); + } + } + } else if (node.matches && !node.matches("button, select, textarea")) { + node.childNodes.forEach((el) => _highlight(el, addItems, text, className)); + } +}; +const _highlightText = (thisNode, text, className) => { + let addItems = []; + _highlight(thisNode, addItems, text, className); + addItems.forEach((obj) => + obj.parent.insertAdjacentElement("beforebegin", obj.target) + ); +}; + +/** + * Small JavaScript module for the documentation. + */ +const Documentation = { + init: () => { + Documentation.highlightSearchWords(); + Documentation.initDomainIndexTable(); + Documentation.initOnKeyListeners(); + }, + + /** + * i18n support + */ + TRANSLATIONS: {}, + PLURAL_EXPR: (n) => (n === 1 ? 0 : 1), + LOCALE: "unknown", + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext: (string) => { + const translated = Documentation.TRANSLATIONS[string]; + switch (typeof translated) { + case "undefined": + return string; // no translation + case "string": + return translated; // translation exists + default: + return translated[0]; // (singular, plural) translation tuple exists + } + }, + + ngettext: (singular, plural, n) => { + const translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated !== "undefined") + return translated[Documentation.PLURAL_EXPR(n)]; + return n === 1 ? singular : plural; + }, + + addTranslations: (catalog) => { + Object.assign(Documentation.TRANSLATIONS, catalog.messages); + Documentation.PLURAL_EXPR = new Function( + "n", + `return (${catalog.plural_expr})` + ); + Documentation.LOCALE = catalog.locale; + }, + + /** + * highlight the search words provided in the url in the text + */ + highlightSearchWords: () => { + const highlight = + new URLSearchParams(window.location.search).get("highlight") || ""; + const terms = highlight.toLowerCase().split(/\s+/).filter(x => x); + if (terms.length === 0) return; // nothing to do + + // There should never be more than one element matching "div.body" + const divBody = document.querySelectorAll("div.body"); + const body = divBody.length ? divBody[0] : document.querySelector("body"); + window.setTimeout(() => { + terms.forEach((term) => _highlightText(body, term, "highlighted")); + }, 10); + + const searchBox = document.getElementById("searchbox"); + if (searchBox === null) return; + searchBox.appendChild( + document + .createRange() + .createContextualFragment( + '

' + + '' + + Documentation.gettext("Hide Search Matches") + + "

" + ) + ); + }, + + /** + * helper function to hide the search marks again + */ + hideSearchWords: () => { + document + .querySelectorAll("#searchbox .highlight-link") + .forEach((el) => el.remove()); + document + .querySelectorAll("span.highlighted") + .forEach((el) => el.classList.remove("highlighted")); + const url = new URL(window.location); + url.searchParams.delete("highlight"); + window.history.replaceState({}, "", url); + }, + + /** + * helper function to focus on search bar + */ + focusSearchBar: () => { + document.querySelectorAll("input[name=q]")[0]?.focus(); + }, + + /** + * Initialise the domain index toggle buttons + */ + initDomainIndexTable: () => { + const toggler = (el) => { + const idNumber = el.id.substr(7); + const toggledRows = document.querySelectorAll(`tr.cg-${idNumber}`); + if (el.src.substr(-9) === "minus.png") { + el.src = `${el.src.substr(0, el.src.length - 9)}plus.png`; + toggledRows.forEach((el) => (el.style.display = "none")); + } else { + el.src = `${el.src.substr(0, el.src.length - 8)}minus.png`; + toggledRows.forEach((el) => (el.style.display = "")); + } + }; + + const togglerElements = document.querySelectorAll("img.toggler"); + togglerElements.forEach((el) => + el.addEventListener("click", (event) => toggler(event.currentTarget)) + ); + togglerElements.forEach((el) => (el.style.display = "")); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) togglerElements.forEach(toggler); + }, + + initOnKeyListeners: () => { + // only install a listener if it is really needed + if ( + !DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS && + !DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS + ) + return; + + const blacklistedElements = new Set([ + "TEXTAREA", + "INPUT", + "SELECT", + "BUTTON", + ]); + document.addEventListener("keydown", (event) => { + if (blacklistedElements.has(document.activeElement.tagName)) return; // bail for input elements + if (event.altKey || event.ctrlKey || event.metaKey) return; // bail with special keys + + if (!event.shiftKey) { + switch (event.key) { + case "ArrowLeft": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const prevLink = document.querySelector('link[rel="prev"]'); + if (prevLink && prevLink.href) { + window.location.href = prevLink.href; + event.preventDefault(); + } + break; + case "ArrowRight": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const nextLink = document.querySelector('link[rel="next"]'); + if (nextLink && nextLink.href) { + window.location.href = nextLink.href; + event.preventDefault(); + } + break; + case "Escape": + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) break; + Documentation.hideSearchWords(); + event.preventDefault(); + } + } + + // some keyboard layouts may need Shift to get / + switch (event.key) { + case "/": + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) break; + Documentation.focusSearchBar(); + event.preventDefault(); + } + }); + }, +}; + +// quick alias for translations +const _ = Documentation.gettext; + +_ready(Documentation.init); diff --git a/_static/documentation_options.js b/_static/documentation_options.js new file mode 100644 index 0000000..3063782 --- /dev/null +++ b/_static/documentation_options.js @@ -0,0 +1,14 @@ +var DOCUMENTATION_OPTIONS = { + URL_ROOT: document.getElementById("documentation_options").getAttribute('data-url_root'), + VERSION: '', + LANGUAGE: 'en', + COLLAPSE_INDEX: false, + BUILDER: 'html', + FILE_SUFFIX: '.html', + LINK_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '', + NAVIGATION_WITH_KEYS: true, + SHOW_SEARCH_SUMMARY: true, + ENABLE_SEARCH_SHORTCUTS: false, +}; \ No newline at end of file diff --git a/_static/file.png b/_static/file.png new file mode 100644 index 0000000000000000000000000000000000000000..a858a410e4faa62ce324d814e4b816fff83a6fb3 GIT binary patch literal 286 zcmV+(0pb3MP)s`hMrGg#P~ix$^RISR_I47Y|r1 z_CyJOe}D1){SET-^Amu_i71Lt6eYfZjRyw@I6OQAIXXHDfiX^GbOlHe=Ae4>0m)d(f|Me07*qoM6N<$f}vM^LjV8( literal 0 HcmV?d00001 diff --git a/_static/images/logo_binder.svg b/_static/images/logo_binder.svg new file mode 100644 index 0000000..45fecf7 --- /dev/null +++ b/_static/images/logo_binder.svg @@ -0,0 +1,19 @@ + + + + +logo + + + + + + + + diff --git a/_static/images/logo_colab.png b/_static/images/logo_colab.png new file mode 100644 index 0000000000000000000000000000000000000000..b7560ec216b2d1b6f77855525fe966c741833428 GIT binary patch literal 7601 zcmeI1^;ZuSFsz@@e&Hu|o~yU_Jn_7Cy4b4(M?f2S`owL6D#ysoM3Rsb4MX|l6hl52QIsX*kmQMmFZ6Xu|Wk1r15+E^+Er?@^MFpIE zq!=C|$Nn*F4aR@N|DPxS6E^f|7Z=H%T>vS)_|-RkkprWw zSGb9TlwheKfo{U5J)kX1$cHtEFe}Pa2Au|?^hCk%8gdI}l*ypIUsLXLMy9W|q-ZAw zJpZkmGRa|!=7CyrA#Bs2?5UdZ1^pDaji}+DimdE$JB@FrJvAIxy*3v#1-8OwO;OS$ zsv*P<%V4%?*Keca@o9}LMOs~ph)z!AU;${{23k&Gq7A@nDP{*I1HiTZ=Q*54?Bok) zp6L_4HhiE->YU6{m*{7O7j#SkBb9JPo!k8TD0H6{ zdSE-mmA!Js{}(?qh${0wB7Rx{*F=43D>?j3kU8MX&`sQJ+wHUD6eEr7j%*2x%5|a8 z*;AP<*tCQwj`Af5vvGHXF=9{cdzV2BMI@}VHgmol)^f>Ectcls5p3dW?40~ADd>ki za*q>v=nQQmGI5&BS!GU|iX9>qB9r=_Qm9t_Qwi+zWI zc%%oQ`P}{ZXk^}?+H!u2my^C#TD%=V|3pb$MXhJ07bx-^=oxj?ZSk!---?f2cs8_& z8?O{lvxMDZi7gsdvoZ2bmyLYs1!O1RMC)1Wv`9p-I(1pfww9siX;Lu>^>_Y=g+OHo zPm(N|h?h5Z>yze~wKtPBRv(mZx*A4R%bganw#OV=SE*=J^b#~(YfIcj(k=(i37PY7 zUiawSj8SKczPk-^=SwOOb%X+bRcFm+=N1r{{CA<=kbVq8cFGcLSGqM5FUxChbc&`o9$mUo4kZLh+%KP6m zDMd3SH~N5fH8J+8;bpxhi-9i}^PV(^u?zb49_c!Ow_!1w%w(RLEeXJoMU>Nnlc8sd z<;K$L<-WwC`NJ0PWzB59Pzbg|FZS-=xlaWDjM-PXIJ;r4qyFnFc_<-VDg5P=Zk0Pd z%f7GFg?FzC??rmjG^Ib<{cfE+dud-%)Ep=a8Q(Z-Fng}&CvD+JPdO)mL-$u4eH#LJ z7heze_GA*{rYAL;ejb#P;oTD_*Rgrw;)1(e;+zGN{)D)k?o$t&BGWEM!Hn}LQm1jd zf@B0+pEzI&qREI@Qr=#K;u~Fs)Saf>_1X|EQGz0D_a|>)d?IOck($^4a`v4Hc6sKV zgm7-VK|sz+(A$-L0BnhZ#qKk${svcv4#QmCcMCb>t9=e+^b49rrK@5C@-Qs{PN6H8Tb^nIy#)VA`)o~+c~m2m9bN}EcwI`-IP+fB&d^;19iX9{XvM6VYHE(fX{BIU zjMLmkl7p}TslG;@C!HvX=7hVy6cGIM{h7hxrM^q{j`Y4Ux1nI*k9MB?ToSK!Qpvy< zT~`Qofe|OBk8vza_r02Y;~+V6WKn(J{_?BR9@-`D&Q;nTEx7+j36Qk0(l3TahUki} z;O-FUuOnNVcc-Q3c?;A)ZpgKC-Sa8`{c}MNm$j))KPPdL#xR*0kxQz|V-;WZxI+?u zFB#~P=os0);b?+6$-z@yE%k*^!0x)K_!|4!L%ADpXqe`pG|8A+rht_!jZid=wb1j& zjPG_SeS*{ef!h*}~k!*;Aar3`tCeHO@>c{c>ak(x3f^w3+_zT>j)aP_hVoV4~^0L<5^eu_y z-@tf0YyH-(#5uTh`s3DIhpc^`UysO{L8JS|z=qnHFb)UqfMnC!Hu$=eiC+a;9t*X6R?Q8POFRq?_ak1&yP&YF6`@B=qySm8MJ)n*E zdS-&E$a$DMp!}+S%^(Q))m7O$Qece1ZtB+=H{**c0@XT53VGNeFhvnDVocubi6~ru z2X&(|kp)joFLfuG?i;d=&CZBQhez8i+lhV+c;_pEL6+Teo z1qclCF-EO~XWkH3u|unGI79@`+YLi}rF>PbBrn{PBKWF&S%K6N0u^DRx7qImnJ`+c z>Nu)TJyhpyJX_!XHh^82M+YgW&cxs(vQKEpL%}iK(hH=<@)j#E3_?a*JP@0=R z;O*(_2@>IjYLClnL+$PJ-5!vt6>UJ7$KHM3LlFFMxb19oFZ_fi@{fp};$@_n8driG z`=77&{Z^0#T>t%$hCqQi8M}0E4XipxikcsB$>o9M)rBJWQDY7UrgKAy|BP4kr`Nay z??T|Ajh_U=3lem-tL$_tEhB=Rqfi?bUj`u>$a-x5WxqHn6t4)Q-NQ^Bt-k!mcE0ES z4)*3-(5@V)=EloLT~ReorH252&Q&MWWc$oiSS{!xpO?VPpJFD-QN6c=<7HxnH1nH% zeiOM22U=%trq`HCXYNL#H!P!M1{?)QcIGYWO$;mCMHnpgd?*ZE&bmylPxndZ$B}ct zIfSCaCu!a^rBwLoo4gQJnU<%~!6cPP-qxJLZM#F&_gwU%?O$k?DIF6l%q_lvcs3})|Z?z(K3q9(BASQtZlw@+<5mv zrHuRbc}A4I9hLtxbS!@ju49VVt1XxpO?1&$LA;?ZANYo=SC^nMg{9BY`=cZcTaR{A@r{UB@;%H zPb6QWRuvU)J>>*0FB;9Uq|hH4C$u8T=T?sz{5%Ex)I%5W6wQmtel=rJ)Tbw#E7{Z;t3U zY9a$t=WkneF<9867^HBvLp>hs;A@H}9KEwn2t!?ITQ1vZ?fCFF(RfFYplQUymF`y4 z74MX)v7%4i_52G~fn=&qCfo}f%Gj8bd7dI^BDI?AlVN_!qWMJT#NBLs^p)e{tG?D4 z)|x9tIcLpO$-JtVj=#$1Y&GRE*-xUKd_{uxiZkqAudNRF!dph|+p41KtIf(8)c1p~ zv)f(_RGUK*j_{s!DNDET-@ekFNlnTXW_=+4t5>Qbq`aWl%F6e}e)<=0U{Lp}8twQ? z8cJ&^2hntuxcqQ~k;<29cTQz)@X@zbQN?f1q??MK&`gi2me&l@XLSxN|!? z;kRJcy-ahz{?{Aj;b0E9*MKf|Q@H!%2FhB8=t$dhTtR4^%hSctIRz;tXJPme_gd zLiJlhH^x9|I?_vaIKkgiAyrk&%Mv26OqK|av#t%u9aU2`wvZ61wo4$DW%z~d9P`5& zx2Zk{zL$Z1@bGicZ})KZzJKhZaZ+P!-p1uH9dgwUQ5u(q{HyTaprSe95WuIadBYv0 zPUJ~G+G2~n0DfE{7!{N*#1+?ql4nK8`Fr?o@j~3c(>T^^trK4t~7#7WQoVk)7KnFY{iPIQ?Qh8 z+Wy6Ol|m6pA8r4lQdt@$=Z{k}^_evzh~Vt_J$aBM!djok7rTfxt8f+KVv7GM1Awc>b%$6NDX zcl~`@-PYtGJSGIO(C^sr&BxXHz*cUJnB~X1`0$kX)@xH+qFRp1^Vpt^u3V$(w;_vf zHIi3Mb+A5@Nx^>r8g^tF%=j0o$Rhli22c4xiy2SEGE=Dk)m)mzF}VhHtiP43?%dTPKbDg+Gmq$pq6DlCZzY5@`})4DTSfgVh3B z6B#;izoI9B%{^V1qYVp<-KgZ=_(;UqyU^wT{IFPQ?YY4%;yq4cbgN`_dqp${t%ytU z!T>q+J?*26u4Ak4Jx#9uHgScR2!%5YX9%5Bu@HL^VaJ7%jj#ceYuaRZk7vMWX)jq| z-rX)3v33MqZ$qaWp!X$i1yJ*rOfjP-u6noa{n9pxzJw0P2+@UNLHS(-e>##A#9xc` zAr=;dh7~9d71L_&bj`DI@l$2 zSX@4j7tZbUYdo?rgctpAg3>Z@gv1{~grCRQUGVyTbzIJ-YZt2xF(cT)W0~l-76Lw* z<6YF%D4R$X>ZEj#!c)zMi018e@?^1%&N`zutD(OQ;X8am+pNW(YhRwy*%wrsnwb#T z>n{K;55wQE!cVF)X+X12fX<x`lE~DquFsMPRoBuzhuVdR8Gv zevya06i9>q3oJZyDGUHOP=iTbBg`AO7~BI0N8$lqEvK_=V)(Du!8=i|%_2^xqnCgh zYEho!c`8!%;N8>VD_@8NZxuyDHBlxl_=CBT5z4cft(NLsv9Wo81)VnjTne@sFAuLA zv^?3h>Rc?eDzkn@SvwCF^spU#ZJuQz6o4V90>Al2JL^>6N4y0wyg#4m?khQ$4$xa5 zlJZV5E$o~arUalDb_b7lXJs*(UA*P>jQ%3i`I8pyKN?*kY>iRE7J9GGiz^nA>aIV> zaJ}>Ecj_*#d8xFcjhy+6oRGfCr^qR6C2fGkhPUT-of7St?XBEaY>?_o$Y;IiV*<6d zlA;M(1^;P>tJxjiTQAB{T$TKPJ?7HfGON=ms6=%yai0?j-qHB-nhvKj_0=^YawDhO z&$wC;93X#RhmcNJTfn66z&E;UAFGeV6TsD61;r(%GZvUrDg2W3Y2hPsTqkinoI4PV zXDedcq+P^|`+Zqpt5*;9cKbAf6!xI4X{#P5OMaE4?*}B?BIY^Gyv0%UUq}lKO~C#Z zCRamrC=OeXKTKm|4p>}U!kLbE%NxPGuZ1-DR(wWFK@>24ca*qhEt5B*r|(Kty!Pj0 zZauh;NqoiV&&q9pT#S7@dl4JUVA|RmaH8kslFhypJ_)20*ebs^yXIQA(6mi|Wph<8 z=`?$6$QX%TaWE9DLjOgi>rciE+f(9`A4gn4&jZA)v29ug%2=CtvV-U|71pd@edT~> zTA~BLBxs`RYEh%@DuEBdVt=S~6x5VXGkg4=c(|;e@Uk2Mxd}~#h^+`jF}r@=C0+HS zJcg`@*AUj2Ymhzqb=;b}w_oSQ>VH<@k=B`!P>>u5;cpo7O#PB&IQ>AS{06fz5fsXyOt1R0^~JUdht$M7yYTxq$&$T&teFpg;y{BUxXR(00s6bHa2EU zQz~u3(zn7I;Ei{D%kc60jYvUAK^2vZcMr$(Mvo58z}?>{fBdZv&KdKaM(W*WeijQ+ z;}+j>_K=@gAG4KLl-oHs1uHl{4Iq_bV|(|n23Ml=$x+vE+w;rZ1-;Cgwa-{hvjGND zf$}y#wu81ZOPZ@Wj}WbIj4k%PEPTy)sLP0Kk0C=n2lpOrPl~et;FC1`zjD=4!5coL zUgdZMo&inr`+cr#<^beEmG){%LjzXvEJ;=`hMnEYG|VU#W^gR^?uh;u@MsY$78=09EY#xn`@9X5)nb~&t)6wi zB(Y#$oL!o_oI|#`LeD5m>ezV6;nKHq@ZYvUufb~M33Qw%6`GhEa}S@P!}T;dH@bLx zG_yiKDTq6zQz}25>oeWOXpL<9!kJrP)LQASx)Dh$MiaKmk}q7TZJjtiA`M6zv_)Sn zoW-S@(c2ebP+DQqvD-S;#gt=zlveyhax!aybe(eZtlKEO1+bZSM diff --git a/_static/images/logo_jupyterhub.svg b/_static/images/logo_jupyterhub.svg new file mode 100644 index 0000000..60cfe9f --- /dev/null +++ b/_static/images/logo_jupyterhub.svg @@ -0,0 +1 @@ +logo_jupyterhubHub diff --git a/_static/jquery-3.6.0.js b/_static/jquery-3.6.0.js new file mode 100644 index 0000000..fc6c299 --- /dev/null +++ b/_static/jquery-3.6.0.js @@ -0,0 +1,10881 @@ +/*! + * jQuery JavaScript Library v3.6.0 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2021-03-02T17:08Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var flat = arr.flat ? function( array ) { + return arr.flat.call( array ); +} : function( array ) { + return arr.concat.apply( [], array ); +}; + + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + // Support: QtWeb <=3.8.5, WebKit <=534.34, wkhtmltopdf tool <=0.12.5 + // Plus for old WebKit, typeof returns "function" for HTML collections + // (e.g., `typeof document.getElementsByTagName("div") === "function"`). (gh-4756) + return typeof obj === "function" && typeof obj.nodeType !== "number" && + typeof obj.item !== "function"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + +var document = window.document; + + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval( code, node, doc ) { + doc = doc || document; + + var i, val, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[ i ] || node.getAttribute && node.getAttribute( i ); + if ( val ) { + script.setAttribute( i, val ); + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var + version = "3.6.0", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + even: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return ( i + 1 ) % 2; + } ) ); + }, + + odd: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return i % 2; + } ) ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + copy = options[ name ]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if ( name === "__proto__" || target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + src = target[ name ]; + + // Ensure proper type for the source value + if ( copyIsArray && !Array.isArray( src ) ) { + clone = []; + } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a provided context; falls back to the global one + // if not specified. + globalEval: function( code, options, doc ) { + DOMEval( code, { nonce: options && options.nonce }, doc ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return flat( ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), + function( _i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); + } ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.3.6 + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://js.foundation/ + * + * Date: 2021-02-16 + */ +( function( window ) { +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ( {} ).hasOwnProperty, + arr = [], + pop = arr.pop, + pushNative = arr.push, + push = arr.push, + slice = arr.slice, + + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[ i ] === elem ) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|" + + "ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // https://www.w3.org/TR/css-syntax-3/#ident-token-diagram + identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + + // "Attribute values must be CSS identifiers [capture 5] + // or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + + whitespace + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + + "*" ), + rdescend = new RegExp( whitespace + "|>" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rhtml = /HTML$/i, + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\([^\\r\\n\\f])", "g" ), + funescape = function( escape, nonHex ) { + var high = "0x" + escape.slice( 1 ) - 0x10000; + + return nonHex ? + + // Strip the backslash prefix from a non-hex escape sequence + nonHex : + + // Replace a hexadecimal escape sequence with the encoded Unicode code point + // Support: IE <=11+ + // For values outside the Basic Multilingual Plane (BMP), manually construct a + // surrogate pair + high < 0 ? + String.fromCharCode( high + 0x10000 ) : + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function( elem ) { + return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset"; + }, + { dir: "parentNode", next: "legend" } + ); + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + ( arr = slice.call( preferredDoc.childNodes ) ), + preferredDoc.childNodes + ); + + // Support: Android<4.0 + // Detect silently failing push.apply + // eslint-disable-next-line no-unused-expressions + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + pushNative.apply( target, slice.call( els ) ); + } : + + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + + // Can't trust NodeList.length + while ( ( target[ j++ ] = els[ i++ ] ) ) {} + target.length = j - 1; + } + }; +} + +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + setDocument( context ); + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) { + + // ID selector + if ( ( m = match[ 1 ] ) ) { + + // Document context + if ( nodeType === 9 ) { + if ( ( elem = context.getElementById( m ) ) ) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && ( elem = newContext.getElementById( m ) ) && + contains( context, elem ) && + elem.id === m ) { + + results.push( elem ); + return results; + } + } + + // Type selector + } else if ( match[ 2 ] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( ( m = match[ 3 ] ) && support.getElementsByClassName && + context.getElementsByClassName ) { + + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( support.qsa && + !nonnativeSelectorCache[ selector + " " ] && + ( !rbuggyQSA || !rbuggyQSA.test( selector ) ) && + + // Support: IE 8 only + // Exclude object elements + ( nodeType !== 1 || context.nodeName.toLowerCase() !== "object" ) ) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // The technique has to be used as well when a leading combinator is used + // as such selectors are not recognized by querySelectorAll. + // Thanks to Andrew Dupont for this technique. + if ( nodeType === 1 && + ( rdescend.test( selector ) || rcombinators.test( selector ) ) ) { + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + + // We can use :scope instead of the ID hack if the browser + // supports it & if we're not changing the context. + if ( newContext !== context || !support.scope ) { + + // Capture the context ID, setting it first if necessary + if ( ( nid = context.getAttribute( "id" ) ) ) { + nid = nid.replace( rcssescape, fcssescape ); + } else { + context.setAttribute( "id", ( nid = expando ) ); + } + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " + + toSelector( groups[ i ] ); + } + newSelector = groups.join( "," ); + } + + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + nonnativeSelectorCache( selector, true ); + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return ( cache[ key + " " ] = value ); + } + return cache; +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement( "fieldset" ); + + try { + return !!fn( el ); + } catch ( e ) { + return false; + } finally { + + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + + // release memory in IE + el = null; + } +} + +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split( "|" ), + i = arr.length; + + while ( i-- ) { + Expr.attrHandle[ arr[ i ] ] = handler; + } +} + +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( ( cur = cur.nextSibling ) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return ( name === "input" || name === "button" ) && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + inDisabledFieldset( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction( function( argument ) { + argument = +argument; + return markFunction( function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ ( j = matchIndexes[ i ] ) ] ) { + seed[ j ] = !( matches[ j ] = seed[ j ] ); + } + } + } ); + } ); +} + +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +// Expose support vars for convenience +support = Sizzle.support = {}; + +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + var namespace = elem && elem.namespaceURI, + docElem = elem && ( elem.ownerDocument || elem ).documentElement; + + // Support: IE <=8 + // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes + // https://bugs.jquery.com/ticket/4833 + return !rhtml.test( namespace || docElem && docElem.nodeName || "HTML" ); +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); + + // Support: IE 9 - 11+, Edge 12 - 18+ + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( preferredDoc != document && + ( subWindow = document.defaultView ) && subWindow.top !== subWindow ) { + + // Support: IE 11, Edge + if ( subWindow.addEventListener ) { + subWindow.addEventListener( "unload", unloadHandler, false ); + + // Support: IE 9 - 10 only + } else if ( subWindow.attachEvent ) { + subWindow.attachEvent( "onunload", unloadHandler ); + } + } + + // Support: IE 8 - 11+, Edge 12 - 18+, Chrome <=16 - 25 only, Firefox <=3.6 - 31 only, + // Safari 4 - 5 only, Opera <=11.6 - 12.x only + // IE/Edge & older browsers don't support the :scope pseudo-class. + // Support: Safari 6.0 only + // Safari 6.0 supports :scope but it's an alias of :root there. + support.scope = assert( function( el ) { + docElem.appendChild( el ).appendChild( document.createElement( "div" ) ); + return typeof el.querySelectorAll !== "undefined" && + !el.querySelectorAll( ":scope fieldset div" ).length; + } ); + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert( function( el ) { + el.className = "i"; + return !el.getAttribute( "className" ); + } ); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert( function( el ) { + el.appendChild( document.createComment( "" ) ); + return !el.getElementsByTagName( "*" ).length; + } ); + + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert( function( el ) { + docElem.appendChild( el ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + } ); + + // ID filter and find + if ( support.getById ) { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute( "id" ) === attrId; + }; + }; + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode( "id" ); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( ( elem = elems[ i++ ] ) ) { + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find[ "TAG" ] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : + + function( tag, context ) { + var elem, + tmp = [], + i = 0, + + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find[ "CLASS" ] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ( ( support.qsa = rnative.test( document.querySelectorAll ) ) ) { + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert( function( el ) { + + var input; + + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild( el ).innerHTML = "" + + ""; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( el.querySelectorAll( "[msallowcapture^='']" ).length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !el.querySelectorAll( "[selected]" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push( "~=" ); + } + + // Support: IE 11+, Edge 15 - 18+ + // IE 11/Edge don't find elements on a `[name='']` query in some cases. + // Adding a temporary attribute to the document before the selection works + // around the issue. + // Interestingly, IE 10 & older don't seem to have the issue. + input = document.createElement( "input" ); + input.setAttribute( "name", "" ); + el.appendChild( input ); + if ( !el.querySelectorAll( "[name='']" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" + + whitespace + "*(?:''|\"\")" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !el.querySelectorAll( ":checked" ).length ) { + rbuggyQSA.push( ":checked" ); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push( ".#.+[+~]" ); + } + + // Support: Firefox <=3.6 - 5 only + // Old Firefox doesn't throw on a badly-escaped identifier. + el.querySelectorAll( "\\\f" ); + rbuggyQSA.push( "[\\r\\n\\f]" ); + } ); + + assert( function( el ) { + el.innerHTML = "" + + ""; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement( "input" ); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( el.querySelectorAll( "[name=d]" ).length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( el.querySelectorAll( ":enabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild( el ).disabled = true; + if ( el.querySelectorAll( ":disabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: Opera 10 - 11 only + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll( "*,:x" ); + rbuggyQSA.push( ",.*:" ); + } ); + } + + if ( ( support.matchesSelector = rnative.test( ( matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector ) ) ) ) { + + assert( function( el ) { + + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( el, "*" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( el, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + } ); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join( "|" ) ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + ) ); + } : + function( a, b ) { + if ( b ) { + while ( ( b = b.parentNode ) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + ( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) { + + // Choose the first element that is related to our preferred document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( a == document || a.ownerDocument == preferredDoc && + contains( preferredDoc, a ) ) { + return -1; + } + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( b == document || b.ownerDocument == preferredDoc && + contains( preferredDoc, b ) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + return a == document ? -1 : + b == document ? 1 : + /* eslint-enable eqeqeq */ + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( ( cur = cur.parentNode ) ) { + ap.unshift( cur ); + } + cur = b; + while ( ( cur = cur.parentNode ) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[ i ] === bp[ i ] ) { + i++; + } + + return i ? + + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[ i ], bp[ i ] ) : + + // Otherwise nodes in our document sort first + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + ap[ i ] == preferredDoc ? -1 : + bp[ i ] == preferredDoc ? 1 : + /* eslint-enable eqeqeq */ + 0; + }; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + setDocument( elem ); + + if ( support.matchesSelector && documentIsHTML && + !nonnativeSelectorCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch ( e ) { + nonnativeSelectorCache( expr, true ); + } + } + + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( context.ownerDocument || context ) != document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( elem.ownerDocument || elem ) != document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; +}; + +Sizzle.escape = function( sel ) { + return ( sel + "" ).replace( rcssescape, fcssescape ); +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); + + if ( hasDuplicate ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + + // If no nodeType, this is expected to be an array + while ( ( node = elem[ i++ ] ) ) { + + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[ 1 ] = match[ 1 ].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[ 3 ] = ( match[ 3 ] || match[ 4 ] || + match[ 5 ] || "" ).replace( runescape, funescape ); + + if ( match[ 2 ] === "~=" ) { + match[ 3 ] = " " + match[ 3 ] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[ 1 ] = match[ 1 ].toLowerCase(); + + if ( match[ 1 ].slice( 0, 3 ) === "nth" ) { + + // nth-* requires argument + if ( !match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[ 4 ] = +( match[ 4 ] ? + match[ 5 ] + ( match[ 6 ] || 1 ) : + 2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" ) ); + match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" ); + + // other types prohibit arguments + } else if ( match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[ 6 ] && match[ 2 ]; + + if ( matchExpr[ "CHILD" ].test( match[ 0 ] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[ 3 ] ) { + match[ 2 ] = match[ 4 ] || match[ 5 ] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + + // Get excess from tokenize (recursively) + ( excess = tokenize( unquoted, true ) ) && + + // advance to the next closing parenthesis + ( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) { + + // excess is a negative index + match[ 0 ] = match[ 0 ].slice( 0, excess ); + match[ 2 ] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { + return true; + } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + ( pattern = new RegExp( "(^|" + whitespace + + ")" + className + "(" + whitespace + "|$)" ) ) && classCache( + className, function( elem ) { + return pattern.test( + typeof elem.className === "string" && elem.className || + typeof elem.getAttribute !== "undefined" && + elem.getAttribute( "class" ) || + "" + ); + } ); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + /* eslint-disable max-len */ + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + /* eslint-enable max-len */ + + }; + }, + + "CHILD": function( type, what, _argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, _context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( ( node = node[ dir ] ) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( ( node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + + // Use previously-cached element index if available + if ( useCache ) { + + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + + // Use the same loop as above to seek `elem` from the start + while ( ( node = ++nodeIndex && node && node[ dir ] || + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || + ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + uniqueCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction( function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[ i ] ); + seed[ idx ] = !( matches[ idx ] = matched[ i ] ); + } + } ) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + + // Potentially complex pseudos + "not": markFunction( function( selector ) { + + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction( function( seed, matches, _context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( ( elem = unmatched[ i ] ) ) { + seed[ i ] = !( matches[ i ] = elem ); + } + } + } ) : + function( elem, _context, xml ) { + input[ 0 ] = elem; + matcher( input, null, xml, results ); + + // Don't keep the element (issue #299) + input[ 0 ] = null; + return !results.pop(); + }; + } ), + + "has": markFunction( function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + } ), + + "contains": markFunction( function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || getText( elem ) ).indexOf( text ) > -1; + }; + } ), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + + // lang value must be a valid identifier + if ( !ridentifier.test( lang || "" ) ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( ( elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( ( elem = elem.parentNode ) && elem.nodeType === 1 ); + return false; + }; + } ), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && + ( !document.hasFocus || document.hasFocus() ) && + !!( elem.type || elem.href || ~elem.tabIndex ); + }, + + // Boolean properties + "enabled": createDisabledPseudo( false ), + "disabled": createDisabledPseudo( true ), + + "checked": function( elem ) { + + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return ( nodeName === "input" && !!elem.checked ) || + ( nodeName === "option" && !!elem.selected ); + }, + + "selected": function( elem ) { + + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + // eslint-disable-next-line no-unused-expressions + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos[ "empty" ]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( ( attr = elem.getAttribute( "type" ) ) == null || + attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + "first": createPositionalPseudo( function() { + return [ 0 ]; + } ), + + "last": createPositionalPseudo( function( _matchIndexes, length ) { + return [ length - 1 ]; + } ), + + "eq": createPositionalPseudo( function( _matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + } ), + + "even": createPositionalPseudo( function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "odd": createPositionalPseudo( function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "lt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? + argument + length : + argument > length ? + length : + argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "gt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ) + } +}; + +Expr.pseudos[ "nth" ] = Expr.pseudos[ "eq" ]; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || ( match = rcomma.exec( soFar ) ) ) { + if ( match ) { + + // Don't consume trailing commas as valid + soFar = soFar.slice( match[ 0 ].length ) || soFar; + } + groups.push( ( tokens = [] ) ); + } + + matched = false; + + // Combinators + if ( ( match = rcombinators.exec( soFar ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + + // Cast descendant combinators to space + type: match[ 0 ].replace( rtrim, " " ) + } ); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] || + ( match = preFilters[ type ]( match ) ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + type: type, + matches: match + } ); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[ i ].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || ( elem[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || + ( outerCache[ elem.uniqueID ] = {} ); + + if ( skip && skip === elem.nodeName.toLowerCase() ) { + elem = elem[ dir ] || elem; + } else if ( ( oldCache = uniqueCache[ key ] ) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return ( newCache[ 2 ] = oldCache[ 2 ] ); + } else { + + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[ i ]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[ 0 ]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[ i ], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( ( elem = unmatched[ i ] ) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction( function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( + selector || "*", + context.nodeType ? [ context ] : context, + [] + ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( ( elem = temp[ i ] ) ) { + matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem ); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) ) { + + // Restore matcherIn since elem is not yet a final match + temp.push( ( matcherIn[ i ] = elem ) ); + } + } + postFinder( null, ( matcherOut = [] ), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) && + ( temp = postFinder ? indexOf( seed, elem ) : preMap[ i ] ) > -1 ) { + + seed[ temp ] = !( results[ temp ] = elem ); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + } ); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[ 0 ].type ], + implicitRelative = leadingRelative || Expr.relative[ " " ], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + ( checkContext = context ).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[ j ].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens + .slice( 0, i - 1 ) + .concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } ) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find[ "TAG" ]( "*", outermost ), + + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ), + len = elems.length; + + if ( outermost ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + outermostContext = context == document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: ) matching elements by id + for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( !context && elem.ownerDocument != document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( ( matcher = elementMatchers[ j++ ] ) ) { + if ( matcher( elem, context || document, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + + // They will have gone through all possible matchers + if ( ( elem = !matcher && elem ) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( ( matcher = setMatchers[ j++ ] ) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !( unmatched[ i ] || setMatched[ i ] ) ) { + setMatched[ i ] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[ i ] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( + selector, + matcherFromGroupMatchers( elementMatchers, setMatchers ) + ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; + +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( ( selector = compiled.selector || selector ) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[ 0 ] = match[ 0 ].slice( 0 ); + if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) { + + context = ( Expr.find[ "ID" ]( token.matches[ 0 ] + .replace( runescape, funescape ), context ) || [] )[ 0 ]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr[ "needsContext" ].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[ i ]; + + // Abort if we hit a combinator + if ( Expr.relative[ ( type = token.type ) ] ) { + break; + } + if ( ( find = Expr.find[ type ] ) ) { + + // Search, expanding context for leading sibling combinators + if ( ( seed = find( + token.matches[ 0 ].replace( runescape, funescape ), + rsibling.test( tokens[ 0 ].type ) && testContext( context.parentNode ) || + context + ) ) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; + +// One-time assignments + +// Sort stability +support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert( function( el ) { + + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1; +} ); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert( function( el ) { + el.innerHTML = ""; + return el.firstChild.getAttribute( "href" ) === "#"; +} ) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + } ); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert( function( el ) { + el.innerHTML = ""; + el.firstChild.setAttribute( "value", "" ); + return el.firstChild.getAttribute( "value" ) === ""; +} ) ) { + addHandle( "value", function( elem, _name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + } ); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert( function( el ) { + return el.getAttribute( "disabled" ) == null; +} ) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; + } + } ); +} + +return Sizzle; + +} )( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +jQuery.escapeSelector = Sizzle.escape; + + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +} +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, _i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, _i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, _i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( elem.contentDocument != null && + + // Support: IE 11+ + // elements with no `data` attribute has an object + // `contentDocument` with a `null` prototype. + getProto( elem.contentDocument ) ) { + + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( _i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.stackTrace ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getStackHook ) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the primary Deferred + primary = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + primary.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, primary.done( updateFunc( i ) ).resolve, primary.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( primary.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return primary.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), primary.reject ); + } + + return primary.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +jQuery.Deferred.exceptionHook = function( error, stack ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, _key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( _all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var documentElement = document.documentElement; + + + + var isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ); + }, + composed = { composed: true }; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if ( documentElement.getRootNode ) { + isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ) || + elem.getRootNode( composed ) === elem.ownerDocument; + }; + } +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached( elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; + + // Support: IE <=9 only + // IE <=9 replaces "; + support.option = !!div.lastChild; +} )(); + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [ 1, "", "
" ], + col: [ 2, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + + _default: [ 0, "", "" ] +}; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// Support: IE <=9 only +if ( !support.option ) { + wrapMap.optgroup = wrapMap.option = [ 1, "" ]; +} + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + attached = isAttached( elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( attached ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +var rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +// Support: IE <=9 - 11+ +// focus() and blur() are asynchronous, except when they are no-op. +// So expect focus to be synchronous when the element is already active, +// and blur to be synchronous when the element is not already active. +// (focus and blur are always synchronous in other supported browsers, +// this just defines when we can count on it). +function expectSync( elem, type ) { + return ( elem === safeActiveElement() ) === ( type === "focus" ); +} + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Only attach events to objects that accept data + if ( !acceptData( elem ) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = Object.create( null ); + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( nativeEvent ), + + handlers = ( + dataPriv.get( this, "events" ) || Object.create( null ) + )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if ( !event.rnamespace || handleObj.namespace === false || + event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + // dataPriv.set( el, "click", ... ) + leverageNative( el, "click", returnTrue ); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + leverageNative( el, "click" ); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function( event ) { + var target = event.target; + return rcheckableType.test( target.type ) && + target.click && nodeName( target, "input" ) && + dataPriv.get( target, "click" ) || + nodeName( target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. +function leverageNative( el, type, expectSync ) { + + // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add + if ( !expectSync ) { + if ( dataPriv.get( el, type ) === undefined ) { + jQuery.event.add( el, type, returnTrue ); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set( el, type, false ); + jQuery.event.add( el, type, { + namespace: false, + handler: function( event ) { + var notAsync, result, + saved = dataPriv.get( this, type ); + + if ( ( event.isTrigger & 1 ) && this[ type ] ) { + + // Interrupt processing of the outer synthetic .trigger()ed event + // Saved data should be false in such cases, but might be a leftover capture object + // from an async native handler (gh-4350) + if ( !saved.length ) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call( arguments ); + dataPriv.set( this, type, saved ); + + // Trigger the native event and capture its result + // Support: IE <=9 - 11+ + // focus() and blur() are asynchronous + notAsync = expectSync( this, type ); + this[ type ](); + result = dataPriv.get( this, type ); + if ( saved !== result || notAsync ) { + dataPriv.set( this, type, false ); + } else { + result = {}; + } + if ( saved !== result ) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + + // Support: Chrome 86+ + // In Chrome, if an element having a focusout handler is blurred by + // clicking outside of it, it invokes the handler synchronously. If + // that handler calls `.remove()` on the element, the data is cleared, + // leaving `result` undefined. We need to guard against this. + return result && result.value; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering the + // native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if ( saved.length ) { + + // ...and capture the result + dataPriv.set( this, type, { + value: jQuery.event.trigger( + + // Support: IE <=9 - 11+ + // Extend with the prototype to reset the above stopImmediatePropagation() + jQuery.extend( saved[ 0 ], jQuery.Event.prototype ), + saved.slice( 1 ), + this + ) + } ); + + // Abort handling of the native event + event.stopImmediatePropagation(); + } + } + } ); +} + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + which: true +}, jQuery.event.addProp ); + +jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) { + jQuery.event.special[ type ] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function() { + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative( this, type, expectSync ); + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function() { + + // Force setup before trigger + leverageNative( this, type ); + + // Return non-false to allow normal event-path propagation + return true; + }, + + // Suppress native focus or blur as it's already being fired + // in leverageNative. + _default: function() { + return true; + }, + + delegateType: delegateType + }; +} ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.get( src ); + events = pdataOld.events; + + if ( events ) { + dataPriv.remove( dest, "handle events" ); + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = flat( args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl && !node.noModule ) { + jQuery._evalUrl( node.src, { + nonce: node.nonce || node.getAttribute( "nonce" ) + }, doc ); + } + } else { + DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && isAttached( node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html; + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = isAttached( elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var swap = function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableTrDimensionsVal, reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + }, + + // Support: IE 9 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Behavior in IE 9 is more subtle than in newer versions & it passes + // some versions of this test; make sure not to make it pass there! + // + // Support: Firefox 70+ + // Only Firefox includes border widths + // in computed dimensions. (gh-4529) + reliableTrDimensions: function() { + var table, tr, trChild, trStyle; + if ( reliableTrDimensionsVal == null ) { + table = document.createElement( "table" ); + tr = document.createElement( "tr" ); + trChild = document.createElement( "div" ); + + table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate"; + tr.style.cssText = "border:1px solid"; + + // Support: Chrome 86+ + // Height set through cssText does not get applied. + // Computed height then comes back as 0. + tr.style.height = "1px"; + trChild.style.height = "9px"; + + // Support: Android 8 Chrome 86+ + // In our bodyBackground.html iframe, + // display for all div elements is set to "inline", + // which causes a problem only in Android 8 Chrome 86. + // Ensuring the div is display: block + // gets around this issue. + trChild.style.display = "block"; + + documentElement + .appendChild( table ) + .appendChild( tr ) + .appendChild( trChild ); + + trStyle = window.getComputedStyle( tr ); + reliableTrDimensionsVal = ( parseInt( trStyle.height, 10 ) + + parseInt( trStyle.borderTopWidth, 10 ) + + parseInt( trStyle.borderBottomWidth, 10 ) ) === tr.offsetHeight; + + documentElement.removeChild( table ); + } + return reliableTrDimensionsVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if ( computed ) { + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !isAttached( elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined +function vendorPropName( name ) { + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property +function finalPropName( name ) { + var final = jQuery.cssProps[ name ] || vendorProps[ name ]; + + if ( final ) { + return final; + } + if ( name in emptyStyle ) { + return name; + } + return vendorProps[ name ] = vendorPropName( name ) || name; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + +function setPositiveNumber( _elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + if ( box === "margin" ) { + delta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + ) ) || 0; + } + + return delta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS( elem, dimension, styles ), + offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + + // Support: IE 9 - 11 only + // Use offsetWidth/offsetHeight for when box sizing is unreliable. + // In those cases, the computed value can be trusted to be border-box. + if ( ( !support.boxSizingReliable() && isBorderBox || + + // Support: IE 10 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Interestingly, in some cases IE 9 doesn't suffer from this issue. + !support.reliableTrDimensions() && nodeName( elem, "tr" ) || + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + val === "auto" || + + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) && + + // Make sure the element is visible & connected + elem.getClientRects().length ) { + + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if ( valueIsBorderBox ) { + val = elem[ offsetProp ]; + } + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "gridArea": true, + "gridColumn": true, + "gridColumnEnd": true, + "gridColumnStart": true, + "gridRow": true, + "gridRowEnd": true, + "gridRowStart": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if ( type === "number" && !isCustomProp ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( _i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && scrollboxSizeBuggy ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && ( + jQuery.cssHooks[ tween.prop ] || + tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + return this.each( function() { + var className, i, self, classNames; + + if ( isValidValue ) { + + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = classesToArray( value ); + + while ( ( className = classNames[ i++ ] ) ) { + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion + + +support.focusin = "onfocusin" in window; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || Object.create( null ) )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + + // Handle: regular nodes (via `this.ownerDocument`), window + // (via `this.document`) & document (via `this`). + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); + } + dataPriv.access( doc, fix, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + dataPriv.remove( doc, fix ); + + } else { + dataPriv.access( doc, fix, attaches ); + } + } + }; + } ); +} +var location = window.location; + +var nonce = { guid: Date.now() }; + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml, parserErrorElem; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) {} + + parserErrorElem = xml && xml.getElementsByTagName( "parsererror" )[ 0 ]; + if ( !xml || parserErrorElem ) { + jQuery.error( "Invalid XML: " + ( + parserErrorElem ? + jQuery.map( parserErrorElem.childNodes, function( el ) { + return el.textContent; + } ).join( "\n" ) : + data + ) ); + } + return xml; +}; + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + if ( a == null ) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ).filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ).map( function( _i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + +originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() + " " ] = + ( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] ) + .concat( match[ 2 ] ); + } + } + match = responseHeaders[ key.toLowerCase() + " " ]; + } + return match == null ? null : match.join( ", " ); + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) + + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Use a noop converter for missing script but not if jsonp + if ( !isSuccess && + jQuery.inArray( "script", s.dataTypes ) > -1 && + jQuery.inArray( "json", s.dataTypes ) < 0 ) { + s.converters[ "text script" ] = function() {}; + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( _i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + +jQuery.ajaxPrefilter( function( s ) { + var i; + for ( i in s.headers ) { + if ( i.toLowerCase() === "content-type" ) { + s.contentType = s.headers[ i ] || ""; + } + } +} ); + + +jQuery._evalUrl = function( url, options, doc ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function() {} + }, + dataFilter: function( response ) { + jQuery.globalEval( response, options, doc ); + } + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain or forced-by-attrs requests + if ( s.crossDomain || s.scriptAttrs ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( " +{% endmacro %} diff --git a/_static/scripts/bootstrap.js b/_static/scripts/bootstrap.js new file mode 100644 index 0000000..766173a --- /dev/null +++ b/_static/scripts/bootstrap.js @@ -0,0 +1,3 @@ +/*! For license information please see bootstrap.js.LICENSE.txt */ +(()=>{"use strict";var t={d:(e,i)=>{for(var n in i)t.o(i,n)&&!t.o(e,n)&&Object.defineProperty(e,n,{enumerable:!0,get:i[n]})},o:(t,e)=>Object.prototype.hasOwnProperty.call(t,e),r:t=>{"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(t,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(t,"__esModule",{value:!0})}},e={};t.r(e),t.d(e,{afterMain:()=>w,afterRead:()=>b,afterWrite:()=>C,applyStyles:()=>$,arrow:()=>G,auto:()=>r,basePlacements:()=>a,beforeMain:()=>v,beforeRead:()=>m,beforeWrite:()=>A,bottom:()=>n,clippingParents:()=>h,computeStyles:()=>et,createPopper:()=>Dt,createPopperBase:()=>Lt,createPopperLite:()=>$t,detectOverflow:()=>mt,end:()=>c,eventListeners:()=>nt,flip:()=>_t,hide:()=>yt,left:()=>o,main:()=>y,modifierPhases:()=>T,offset:()=>wt,placements:()=>g,popper:()=>d,popperGenerator:()=>kt,popperOffsets:()=>At,preventOverflow:()=>Et,read:()=>_,reference:()=>f,right:()=>s,start:()=>l,top:()=>i,variationPlacements:()=>p,viewport:()=>u,write:()=>E});var i="top",n="bottom",s="right",o="left",r="auto",a=[i,n,s,o],l="start",c="end",h="clippingParents",u="viewport",d="popper",f="reference",p=a.reduce((function(t,e){return t.concat([e+"-"+l,e+"-"+c])}),[]),g=[].concat(a,[r]).reduce((function(t,e){return t.concat([e,e+"-"+l,e+"-"+c])}),[]),m="beforeRead",_="read",b="afterRead",v="beforeMain",y="main",w="afterMain",A="beforeWrite",E="write",C="afterWrite",T=[m,_,b,v,y,w,A,E,C];function O(t){return t?(t.nodeName||"").toLowerCase():null}function x(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function k(t){return t instanceof x(t).Element||t instanceof Element}function L(t){return t instanceof x(t).HTMLElement||t instanceof HTMLElement}function D(t){return"undefined"!=typeof ShadowRoot&&(t instanceof x(t).ShadowRoot||t instanceof ShadowRoot)}const $={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];L(s)&&O(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});L(n)&&O(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function S(t){return t.split("-")[0]}var I=Math.max,N=Math.min,P=Math.round;function j(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function M(){return!/^((?!chrome|android).)*safari/i.test(j())}function H(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&L(t)&&(s=t.offsetWidth>0&&P(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&P(n.height)/t.offsetHeight||1);var r=(k(t)?x(t):window).visualViewport,a=!M()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,u=n.height/o;return{width:h,height:u,top:c,right:l+h,bottom:c+u,left:l,x:l,y:c}}function W(t){var e=H(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function F(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&D(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function B(t){return x(t).getComputedStyle(t)}function z(t){return["table","td","th"].indexOf(O(t))>=0}function q(t){return((k(t)?t.ownerDocument:t.document)||window.document).documentElement}function R(t){return"html"===O(t)?t:t.assignedSlot||t.parentNode||(D(t)?t.host:null)||q(t)}function V(t){return L(t)&&"fixed"!==B(t).position?t.offsetParent:null}function K(t){for(var e=x(t),i=V(t);i&&z(i)&&"static"===B(i).position;)i=V(i);return i&&("html"===O(i)||"body"===O(i)&&"static"===B(i).position)?e:i||function(t){var e=/firefox/i.test(j());if(/Trident/i.test(j())&&L(t)&&"fixed"===B(t).position)return null;var i=R(t);for(D(i)&&(i=i.host);L(i)&&["html","body"].indexOf(O(i))<0;){var n=B(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Q(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function X(t,e,i){return I(t,N(e,i))}function Y(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function U(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const G={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,r=t.state,l=t.name,c=t.options,h=r.elements.arrow,u=r.modifiersData.popperOffsets,d=S(r.placement),f=Q(d),p=[o,s].indexOf(d)>=0?"height":"width";if(h&&u){var g=function(t,e){return Y("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:U(t,a))}(c.padding,r),m=W(h),_="y"===f?i:o,b="y"===f?n:s,v=r.rects.reference[p]+r.rects.reference[f]-u[f]-r.rects.popper[p],y=u[f]-r.rects.reference[f],w=K(h),A=w?"y"===f?w.clientHeight||0:w.clientWidth||0:0,E=v/2-y/2,C=g[_],T=A-m[p]-g[b],O=A/2-m[p]/2+E,x=X(C,O,T),k=f;r.modifiersData[l]=((e={})[k]=x,e.centerOffset=x-O,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&F(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function J(t){return t.split("-")[1]}var Z={top:"auto",right:"auto",bottom:"auto",left:"auto"};function tt(t){var e,r=t.popper,a=t.popperRect,l=t.placement,h=t.variation,u=t.offsets,d=t.position,f=t.gpuAcceleration,p=t.adaptive,g=t.roundOffsets,m=t.isFixed,_=u.x,b=void 0===_?0:_,v=u.y,y=void 0===v?0:v,w="function"==typeof g?g({x:b,y}):{x:b,y};b=w.x,y=w.y;var A=u.hasOwnProperty("x"),E=u.hasOwnProperty("y"),C=o,T=i,O=window;if(p){var k=K(r),L="clientHeight",D="clientWidth";k===x(r)&&"static"!==B(k=q(r)).position&&"absolute"===d&&(L="scrollHeight",D="scrollWidth"),(l===i||(l===o||l===s)&&h===c)&&(T=n,y-=(m&&k===O&&O.visualViewport?O.visualViewport.height:k[L])-a.height,y*=f?1:-1),l!==o&&(l!==i&&l!==n||h!==c)||(C=s,b-=(m&&k===O&&O.visualViewport?O.visualViewport.width:k[D])-a.width,b*=f?1:-1)}var $,S=Object.assign({position:d},p&&Z),I=!0===g?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:P(i*s)/s||0,y:P(n*s)/s||0}}({x:b,y},x(r)):{x:b,y};return b=I.x,y=I.y,f?Object.assign({},S,(($={})[T]=E?"0":"",$[C]=A?"0":"",$.transform=(O.devicePixelRatio||1)<=1?"translate("+b+"px, "+y+"px)":"translate3d("+b+"px, "+y+"px, 0)",$)):Object.assign({},S,((e={})[T]=E?y+"px":"",e[C]=A?b+"px":"",e.transform="",e))}const et={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:S(e.placement),variation:J(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,tt(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,tt(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var it={passive:!0};const nt={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=x(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,it)})),a&&l.addEventListener("resize",i.update,it),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,it)})),a&&l.removeEventListener("resize",i.update,it)}},data:{}};var st={left:"right",right:"left",bottom:"top",top:"bottom"};function ot(t){return t.replace(/left|right|bottom|top/g,(function(t){return st[t]}))}var rt={start:"end",end:"start"};function at(t){return t.replace(/start|end/g,(function(t){return rt[t]}))}function lt(t){var e=x(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function ct(t){return H(q(t)).left+lt(t).scrollLeft}function ht(t){var e=B(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function ut(t){return["html","body","#document"].indexOf(O(t))>=0?t.ownerDocument.body:L(t)&&ht(t)?t:ut(R(t))}function dt(t,e){var i;void 0===e&&(e=[]);var n=ut(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=x(n),r=s?[o].concat(o.visualViewport||[],ht(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(dt(R(r)))}function ft(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function pt(t,e,i){return e===u?ft(function(t,e){var i=x(t),n=q(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=M();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+ct(t),y:l}}(t,i)):k(e)?function(t,e){var i=H(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):ft(function(t){var e,i=q(t),n=lt(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=I(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=I(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+ct(t),l=-n.scrollTop;return"rtl"===B(s||i).direction&&(a+=I(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(q(t)))}function gt(t){var e,r=t.reference,a=t.element,h=t.placement,u=h?S(h):null,d=h?J(h):null,f=r.x+r.width/2-a.width/2,p=r.y+r.height/2-a.height/2;switch(u){case i:e={x:f,y:r.y-a.height};break;case n:e={x:f,y:r.y+r.height};break;case s:e={x:r.x+r.width,y:p};break;case o:e={x:r.x-a.width,y:p};break;default:e={x:r.x,y:r.y}}var g=u?Q(u):null;if(null!=g){var m="y"===g?"height":"width";switch(d){case l:e[g]=e[g]-(r[m]/2-a[m]/2);break;case c:e[g]=e[g]+(r[m]/2-a[m]/2)}}return e}function mt(t,e){void 0===e&&(e={});var o=e,r=o.placement,l=void 0===r?t.placement:r,c=o.strategy,p=void 0===c?t.strategy:c,g=o.boundary,m=void 0===g?h:g,_=o.rootBoundary,b=void 0===_?u:_,v=o.elementContext,y=void 0===v?d:v,w=o.altBoundary,A=void 0!==w&&w,E=o.padding,C=void 0===E?0:E,T=Y("number"!=typeof C?C:U(C,a)),x=y===d?f:d,D=t.rects.popper,$=t.elements[A?x:y],S=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=dt(R(t)),i=["absolute","fixed"].indexOf(B(t).position)>=0&&L(t)?K(t):t;return k(i)?e.filter((function(t){return k(t)&&F(t,i)&&"body"!==O(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=pt(t,i,n);return e.top=I(s.top,e.top),e.right=N(s.right,e.right),e.bottom=N(s.bottom,e.bottom),e.left=I(s.left,e.left),e}),pt(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(k($)?$:$.contextElement||q(t.elements.popper),m,b,p),P=H(t.elements.reference),j=gt({reference:P,element:D,strategy:"absolute",placement:l}),M=ft(Object.assign({},D,j)),W=y===d?M:P,z={top:S.top-W.top+T.top,bottom:W.bottom-S.bottom+T.bottom,left:S.left-W.left+T.left,right:W.right-S.right+T.right},V=t.modifiersData.offset;if(y===d&&V){var Q=V[l];Object.keys(z).forEach((function(t){var e=[s,n].indexOf(t)>=0?1:-1,o=[i,n].indexOf(t)>=0?"y":"x";z[t]+=Q[o]*e}))}return z}const _t={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,c=t.options,h=t.name;if(!e.modifiersData[h]._skip){for(var u=c.mainAxis,d=void 0===u||u,f=c.altAxis,m=void 0===f||f,_=c.fallbackPlacements,b=c.padding,v=c.boundary,y=c.rootBoundary,w=c.altBoundary,A=c.flipVariations,E=void 0===A||A,C=c.allowedAutoPlacements,T=e.options.placement,O=S(T),x=_||(O!==T&&E?function(t){if(S(t)===r)return[];var e=ot(t);return[at(t),e,at(e)]}(T):[ot(T)]),k=[T].concat(x).reduce((function(t,i){return t.concat(S(i)===r?function(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,l=i.flipVariations,c=i.allowedAutoPlacements,h=void 0===c?g:c,u=J(n),d=u?l?p:p.filter((function(t){return J(t)===u})):a,f=d.filter((function(t){return h.indexOf(t)>=0}));0===f.length&&(f=d);var m=f.reduce((function(e,i){return e[i]=mt(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[S(i)],e}),{});return Object.keys(m).sort((function(t,e){return m[t]-m[e]}))}(e,{placement:i,boundary:v,rootBoundary:y,padding:b,flipVariations:E,allowedAutoPlacements:C}):i)}),[]),L=e.rects.reference,D=e.rects.popper,$=new Map,I=!0,N=k[0],P=0;P=0,F=W?"width":"height",B=mt(e,{placement:j,boundary:v,rootBoundary:y,altBoundary:w,padding:b}),z=W?H?s:o:H?n:i;L[F]>D[F]&&(z=ot(z));var q=ot(z),R=[];if(d&&R.push(B[M]<=0),m&&R.push(B[z]<=0,B[q]<=0),R.every((function(t){return t}))){N=j,I=!1;break}$.set(j,R)}if(I)for(var V=function(t){var e=k.find((function(e){var i=$.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return N=e,"break"},K=E?3:1;K>0&&"break"!==V(K);K--);e.placement!==N&&(e.modifiersData[h]._skip=!0,e.placement=N,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function bt(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function vt(t){return[i,s,n,o].some((function(e){return t[e]>=0}))}const yt={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=mt(e,{elementContext:"reference"}),a=mt(e,{altBoundary:!0}),l=bt(r,n),c=bt(a,s,o),h=vt(l),u=vt(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:u},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":u})}},wt={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,n=t.options,r=t.name,a=n.offset,l=void 0===a?[0,0]:a,c=g.reduce((function(t,n){return t[n]=function(t,e,n){var r=S(t),a=[o,i].indexOf(r)>=0?-1:1,l="function"==typeof n?n(Object.assign({},e,{placement:t})):n,c=l[0],h=l[1];return c=c||0,h=(h||0)*a,[o,s].indexOf(r)>=0?{x:h,y:c}:{x:c,y:h}}(n,e.rects,l),t}),{}),h=c[e.placement],u=h.x,d=h.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=u,e.modifiersData.popperOffsets.y+=d),e.modifiersData[r]=c}},At={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=gt({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},Et={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,r=t.options,a=t.name,c=r.mainAxis,h=void 0===c||c,u=r.altAxis,d=void 0!==u&&u,f=r.boundary,p=r.rootBoundary,g=r.altBoundary,m=r.padding,_=r.tether,b=void 0===_||_,v=r.tetherOffset,y=void 0===v?0:v,w=mt(e,{boundary:f,rootBoundary:p,padding:m,altBoundary:g}),A=S(e.placement),E=J(e.placement),C=!E,T=Q(A),O="x"===T?"y":"x",x=e.modifiersData.popperOffsets,k=e.rects.reference,L=e.rects.popper,D="function"==typeof y?y(Object.assign({},e.rects,{placement:e.placement})):y,$="number"==typeof D?{mainAxis:D,altAxis:D}:Object.assign({mainAxis:0,altAxis:0},D),P=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,j={x:0,y:0};if(x){if(h){var M,H="y"===T?i:o,F="y"===T?n:s,B="y"===T?"height":"width",z=x[T],q=z+w[H],R=z-w[F],V=b?-L[B]/2:0,Y=E===l?k[B]:L[B],U=E===l?-L[B]:-k[B],G=e.elements.arrow,Z=b&&G?W(G):{width:0,height:0},tt=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},et=tt[H],it=tt[F],nt=X(0,k[B],Z[B]),st=C?k[B]/2-V-nt-et-$.mainAxis:Y-nt-et-$.mainAxis,ot=C?-k[B]/2+V+nt+it+$.mainAxis:U+nt+it+$.mainAxis,rt=e.elements.arrow&&K(e.elements.arrow),at=rt?"y"===T?rt.clientTop||0:rt.clientLeft||0:0,lt=null!=(M=null==P?void 0:P[T])?M:0,ct=z+ot-lt,ht=X(b?N(q,z+st-lt-at):q,z,b?I(R,ct):R);x[T]=ht,j[T]=ht-z}if(d){var ut,dt="x"===T?i:o,ft="x"===T?n:s,pt=x[O],gt="y"===O?"height":"width",_t=pt+w[dt],bt=pt-w[ft],vt=-1!==[i,o].indexOf(A),yt=null!=(ut=null==P?void 0:P[O])?ut:0,wt=vt?_t:pt-k[gt]-L[gt]-yt+$.altAxis,At=vt?pt+k[gt]+L[gt]-yt-$.altAxis:bt,Et=b&&vt?function(t,e,i){var n=X(t,e,i);return n>i?i:n}(wt,pt,At):X(b?wt:_t,pt,b?At:bt);x[O]=Et,j[O]=Et-pt}e.modifiersData[a]=j}},requiresIfExists:["offset"]};function Ct(t,e,i){void 0===i&&(i=!1);var n,s,o=L(e),r=L(e)&&function(t){var e=t.getBoundingClientRect(),i=P(e.width)/t.offsetWidth||1,n=P(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=q(e),l=H(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==O(e)||ht(a))&&(c=(n=e)!==x(n)&&L(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:lt(n)),L(e)?((h=H(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=ct(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function Tt(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var Ot={placement:"bottom",modifiers:[],strategy:"absolute"};function xt(){for(var t=arguments.length,e=new Array(t),i=0;i{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e},Nt=t=>{const e=It(t);return e&&document.querySelector(e)?e:null},Pt=t=>{const e=It(t);return e?document.querySelector(e):null},jt=t=>{t.dispatchEvent(new Event(St))},Mt=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),Ht=t=>Mt(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(t):null,Wt=t=>{if(!Mt(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},Ft=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),Bt=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?Bt(t.parentNode):null},zt=()=>{},qt=t=>{t.offsetHeight},Rt=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,Vt=[],Kt=()=>"rtl"===document.documentElement.dir,Qt=t=>{var e;e=()=>{const e=Rt();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(Vt.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of Vt)t()})),Vt.push(e)):e()},Xt=t=>{"function"==typeof t&&t()},Yt=(t,e,i=!0)=>{if(!i)return void Xt(t);const n=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let s=!1;const o=({target:i})=>{i===e&&(s=!0,e.removeEventListener(St,o),Xt(t))};e.addEventListener(St,o),setTimeout((()=>{s||jt(e)}),n)},Ut=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},Gt=/[^.]*(?=\..*)\.|.*/,Jt=/\..*/,Zt=/::\d+$/,te={};let ee=1;const ie={mouseenter:"mouseover",mouseleave:"mouseout"},ne=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function se(t,e){return e&&`${e}::${ee++}`||t.uidEvent||ee++}function oe(t){const e=se(t);return t.uidEvent=e,te[e]=te[e]||{},te[e]}function re(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function ae(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=ue(t);return ne.has(o)||(o=t),[n,s,o]}function le(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=ae(e,i,n);if(e in ie){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=oe(t),c=l[a]||(l[a]={}),h=re(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const u=se(r,e.replace(Gt,"")),d=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return fe(s,{delegateTarget:r}),n.oneOff&&de.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return fe(n,{delegateTarget:t}),i.oneOff&&de.off(t,n.type,e),e.apply(t,[n])}}(t,r);d.delegationSelector=o?i:null,d.callable=r,d.oneOff=s,d.uidEvent=u,c[u]=d,t.addEventListener(a,d,o)}function ce(t,e,i,n,s){const o=re(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function he(t,e,i,n){const s=e[i]||{};for(const o of Object.keys(s))if(o.includes(n)){const n=s[o];ce(t,e,i,n.callable,n.delegationSelector)}}function ue(t){return t=t.replace(Jt,""),ie[t]||t}const de={on(t,e,i,n){le(t,e,i,n,!1)},one(t,e,i,n){le(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=ae(e,i,n),a=r!==e,l=oe(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))he(t,l,i,e.slice(1));for(const i of Object.keys(c)){const n=i.replace(Zt,"");if(!a||e.includes(n)){const e=c[i];ce(t,l,r,e.callable,e.delegationSelector)}}}else{if(!Object.keys(c).length)return;ce(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=Rt();let s=null,o=!0,r=!0,a=!1;e!==ue(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());let l=new Event(e,{bubbles:o,cancelable:!0});return l=fe(l,i),a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function fe(t,e){for(const[i,n]of Object.entries(e||{}))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}const pe=new Map,ge={set(t,e,i){pe.has(t)||pe.set(t,new Map);const n=pe.get(t);n.has(e)||0===n.size?n.set(e,i):console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(n.keys())[0]}.`)},get:(t,e)=>pe.has(t)&&pe.get(t).get(e)||null,remove(t,e){if(!pe.has(t))return;const i=pe.get(t);i.delete(e),0===i.size&&pe.delete(t)}};function me(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function _e(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const be={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${_e(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${_e(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=me(t.dataset[n])}return e},getDataAttribute:(t,e)=>me(t.getAttribute(`data-bs-${_e(e)}`))};class ve{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=Mt(e)?be.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...Mt(e)?be.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const n of Object.keys(e)){const s=e[n],o=t[n],r=Mt(o)?"element":null==(i=o)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(r))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${r}" but expected type "${s}".`)}var i}}class ye extends ve{constructor(t,e){super(),(t=Ht(t))&&(this._element=t,this._config=this._getConfig(e),ge.set(this._element,this.constructor.DATA_KEY,this))}dispose(){ge.remove(this._element,this.constructor.DATA_KEY),de.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){Yt(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return ge.get(Ht(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.2.3"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const we=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;de.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),Ft(this))return;const s=Pt(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},Ae=".bs.alert",Ee=`close${Ae}`,Ce=`closed${Ae}`;class Te extends ye{static get NAME(){return"alert"}close(){if(de.trigger(this._element,Ee).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),de.trigger(this._element,Ce),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Te.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}we(Te,"close"),Qt(Te);const Oe='[data-bs-toggle="button"]';class xe extends ye{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=xe.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}de.on(document,"click.bs.button.data-api",Oe,(t=>{t.preventDefault();const e=t.target.closest(Oe);xe.getOrCreateInstance(e).toggle()})),Qt(xe);const ke={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!Ft(t)&&Wt(t)))}},Le=".bs.swipe",De=`touchstart${Le}`,$e=`touchmove${Le}`,Se=`touchend${Le}`,Ie=`pointerdown${Le}`,Ne=`pointerup${Le}`,Pe={endCallback:null,leftCallback:null,rightCallback:null},je={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class Me extends ve{constructor(t,e){super(),this._element=t,t&&Me.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return Pe}static get DefaultType(){return je}static get NAME(){return"swipe"}dispose(){de.off(this._element,Le)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),Xt(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&Xt(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(de.on(this._element,Ie,(t=>this._start(t))),de.on(this._element,Ne,(t=>this._end(t))),this._element.classList.add("pointer-event")):(de.on(this._element,De,(t=>this._start(t))),de.on(this._element,$e,(t=>this._move(t))),de.on(this._element,Se,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const He=".bs.carousel",We=".data-api",Fe="next",Be="prev",ze="left",qe="right",Re=`slide${He}`,Ve=`slid${He}`,Ke=`keydown${He}`,Qe=`mouseenter${He}`,Xe=`mouseleave${He}`,Ye=`dragstart${He}`,Ue=`load${He}${We}`,Ge=`click${He}${We}`,Je="carousel",Ze="active",ti=".active",ei=".carousel-item",ii=ti+ei,ni={ArrowLeft:qe,ArrowRight:ze},si={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},oi={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class ri extends ye{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=ke.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===Je&&this.cycle()}static get Default(){return si}static get DefaultType(){return oi}static get NAME(){return"carousel"}next(){this._slide(Fe)}nextWhenVisible(){!document.hidden&&Wt(this._element)&&this.next()}prev(){this._slide(Be)}pause(){this._isSliding&&jt(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?de.one(this._element,Ve,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void de.one(this._element,Ve,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?Fe:Be;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&de.on(this._element,Ke,(t=>this._keydown(t))),"hover"===this._config.pause&&(de.on(this._element,Qe,(()=>this.pause())),de.on(this._element,Xe,(()=>this._maybeEnableCycle()))),this._config.touch&&Me.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of ke.find(".carousel-item img",this._element))de.on(t,Ye,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(ze)),rightCallback:()=>this._slide(this._directionToOrder(qe)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new Me(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=ni[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=ke.findOne(ti,this._indicatorsElement);e.classList.remove(Ze),e.removeAttribute("aria-current");const i=ke.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(Ze),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===Fe,s=e||Ut(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>de.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(Re).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),qt(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(Ze),i.classList.remove(Ze,c,l),this._isSliding=!1,r(Ve)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return ke.findOne(ii,this._element)}_getItems(){return ke.find(ei,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return Kt()?t===ze?Be:Fe:t===ze?Fe:Be}_orderToDirection(t){return Kt()?t===Be?ze:qe:t===Be?qe:ze}static jQueryInterface(t){return this.each((function(){const e=ri.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}de.on(document,Ge,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=Pt(this);if(!e||!e.classList.contains(Je))return;t.preventDefault();const i=ri.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===be.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),de.on(window,Ue,(()=>{const t=ke.find('[data-bs-ride="carousel"]');for(const e of t)ri.getOrCreateInstance(e)})),Qt(ri);const ai=".bs.collapse",li=`show${ai}`,ci=`shown${ai}`,hi=`hide${ai}`,ui=`hidden${ai}`,di=`click${ai}.data-api`,fi="show",pi="collapse",gi="collapsing",mi=`:scope .${pi} .${pi}`,_i='[data-bs-toggle="collapse"]',bi={parent:null,toggle:!0},vi={parent:"(null|element)",toggle:"boolean"};class yi extends ye{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=ke.find(_i);for(const t of i){const e=Nt(t),i=ke.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return bi}static get DefaultType(){return vi}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>yi.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(de.trigger(this._element,li).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(pi),this._element.classList.add(gi),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(gi),this._element.classList.add(pi,fi),this._element.style[e]="",de.trigger(this._element,ci)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(de.trigger(this._element,hi).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,qt(this._element),this._element.classList.add(gi),this._element.classList.remove(pi,fi);for(const t of this._triggerArray){const e=Pt(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(gi),this._element.classList.add(pi),de.trigger(this._element,ui)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(fi)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=Ht(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(_i);for(const e of t){const t=Pt(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=ke.find(mi,this._config.parent);return ke.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=yi.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}de.on(document,di,_i,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();const e=Nt(this),i=ke.find(e);for(const t of i)yi.getOrCreateInstance(t,{toggle:!1}).toggle()})),Qt(yi);const wi="dropdown",Ai=".bs.dropdown",Ei=".data-api",Ci="ArrowUp",Ti="ArrowDown",Oi=`hide${Ai}`,xi=`hidden${Ai}`,ki=`show${Ai}`,Li=`shown${Ai}`,Di=`click${Ai}${Ei}`,$i=`keydown${Ai}${Ei}`,Si=`keyup${Ai}${Ei}`,Ii="show",Ni='[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)',Pi=`${Ni}.${Ii}`,ji=".dropdown-menu",Mi=Kt()?"top-end":"top-start",Hi=Kt()?"top-start":"top-end",Wi=Kt()?"bottom-end":"bottom-start",Fi=Kt()?"bottom-start":"bottom-end",Bi=Kt()?"left-start":"right-start",zi=Kt()?"right-start":"left-start",qi={autoClose:!0,boundary:"clippingParents",display:"dynamic",offset:[0,2],popperConfig:null,reference:"toggle"},Ri={autoClose:"(boolean|string)",boundary:"(string|element)",display:"string",offset:"(array|string|function)",popperConfig:"(null|object|function)",reference:"(string|element|object)"};class Vi extends ye{constructor(t,e){super(t,e),this._popper=null,this._parent=this._element.parentNode,this._menu=ke.next(this._element,ji)[0]||ke.prev(this._element,ji)[0]||ke.findOne(ji,this._parent),this._inNavbar=this._detectNavbar()}static get Default(){return qi}static get DefaultType(){return Ri}static get NAME(){return wi}toggle(){return this._isShown()?this.hide():this.show()}show(){if(Ft(this._element)||this._isShown())return;const t={relatedTarget:this._element};if(!de.trigger(this._element,ki,t).defaultPrevented){if(this._createPopper(),"ontouchstart"in document.documentElement&&!this._parent.closest(".navbar-nav"))for(const t of[].concat(...document.body.children))de.on(t,"mouseover",zt);this._element.focus(),this._element.setAttribute("aria-expanded",!0),this._menu.classList.add(Ii),this._element.classList.add(Ii),de.trigger(this._element,Li,t)}}hide(){if(Ft(this._element)||!this._isShown())return;const t={relatedTarget:this._element};this._completeHide(t)}dispose(){this._popper&&this._popper.destroy(),super.dispose()}update(){this._inNavbar=this._detectNavbar(),this._popper&&this._popper.update()}_completeHide(t){if(!de.trigger(this._element,Oi,t).defaultPrevented){if("ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))de.off(t,"mouseover",zt);this._popper&&this._popper.destroy(),this._menu.classList.remove(Ii),this._element.classList.remove(Ii),this._element.setAttribute("aria-expanded","false"),be.removeDataAttribute(this._menu,"popper"),de.trigger(this._element,xi,t)}}_getConfig(t){if("object"==typeof(t=super._getConfig(t)).reference&&!Mt(t.reference)&&"function"!=typeof t.reference.getBoundingClientRect)throw new TypeError(`${wi.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);return t}_createPopper(){if(void 0===e)throw new TypeError("Bootstrap's dropdowns require Popper (https://popper.js.org)");let t=this._element;"parent"===this._config.reference?t=this._parent:Mt(this._config.reference)?t=Ht(this._config.reference):"object"==typeof this._config.reference&&(t=this._config.reference);const i=this._getPopperConfig();this._popper=Dt(t,this._menu,i)}_isShown(){return this._menu.classList.contains(Ii)}_getPlacement(){const t=this._parent;if(t.classList.contains("dropend"))return Bi;if(t.classList.contains("dropstart"))return zi;if(t.classList.contains("dropup-center"))return"top";if(t.classList.contains("dropdown-center"))return"bottom";const e="end"===getComputedStyle(this._menu).getPropertyValue("--bs-position").trim();return t.classList.contains("dropup")?e?Hi:Mi:e?Fi:Wi}_detectNavbar(){return null!==this._element.closest(".navbar")}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(be.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,..."function"==typeof this._config.popperConfig?this._config.popperConfig(t):this._config.popperConfig}}_selectMenuItem({key:t,target:e}){const i=ke.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>Wt(t)));i.length&&Ut(i,e,t===Ti,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=Vi.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=ke.find(Pi);for(const i of e){const e=Vi.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Ci,Ti].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Ni)?this:ke.prev(this,Ni)[0]||ke.next(this,Ni)[0]||ke.findOne(Ni,t.delegateTarget.parentNode),o=Vi.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}de.on(document,$i,Ni,Vi.dataApiKeydownHandler),de.on(document,$i,ji,Vi.dataApiKeydownHandler),de.on(document,Di,Vi.clearMenus),de.on(document,Si,Vi.clearMenus),de.on(document,Di,Ni,(function(t){t.preventDefault(),Vi.getOrCreateInstance(this).toggle()})),Qt(Vi);const Ki=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",Qi=".sticky-top",Xi="padding-right",Yi="margin-right";class Ui{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,Xi,(e=>e+t)),this._setElementAttributes(Ki,Xi,(e=>e+t)),this._setElementAttributes(Qi,Yi,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,Xi),this._resetElementAttributes(Ki,Xi),this._resetElementAttributes(Qi,Yi)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&be.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=be.getDataAttribute(t,e);null!==i?(be.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(Mt(t))e(t);else for(const i of ke.find(t,this._element))e(i)}}const Gi="backdrop",Ji="show",Zi=`mousedown.bs.${Gi}`,tn={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},en={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class nn extends ve{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return tn}static get DefaultType(){return en}static get NAME(){return Gi}show(t){if(!this._config.isVisible)return void Xt(t);this._append();const e=this._getElement();this._config.isAnimated&&qt(e),e.classList.add(Ji),this._emulateAnimation((()=>{Xt(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Ji),this._emulateAnimation((()=>{this.dispose(),Xt(t)}))):Xt(t)}dispose(){this._isAppended&&(de.off(this._element,Zi),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=Ht(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),de.on(t,Zi,(()=>{Xt(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){Yt(t,this._getElement(),this._config.isAnimated)}}const sn=".bs.focustrap",on=`focusin${sn}`,rn=`keydown.tab${sn}`,an="backward",ln={autofocus:!0,trapElement:null},cn={autofocus:"boolean",trapElement:"element"};class hn extends ve{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return ln}static get DefaultType(){return cn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),de.off(document,sn),de.on(document,on,(t=>this._handleFocusin(t))),de.on(document,rn,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,de.off(document,sn))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=ke.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===an?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?an:"forward")}}const un=".bs.modal",dn=`hide${un}`,fn=`hidePrevented${un}`,pn=`hidden${un}`,gn=`show${un}`,mn=`shown${un}`,_n=`resize${un}`,bn=`click.dismiss${un}`,vn=`mousedown.dismiss${un}`,yn=`keydown.dismiss${un}`,wn=`click${un}.data-api`,An="modal-open",En="show",Cn="modal-static",Tn={backdrop:!0,focus:!0,keyboard:!0},On={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class xn extends ye{constructor(t,e){super(t,e),this._dialog=ke.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new Ui,this._addEventListeners()}static get Default(){return Tn}static get DefaultType(){return On}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||de.trigger(this._element,gn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(An),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(de.trigger(this._element,dn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(En),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){for(const t of[window,this._dialog])de.off(t,un);this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new nn({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new hn({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=ke.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),qt(this._element),this._element.classList.add(En),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,de.trigger(this._element,mn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){de.on(this._element,yn,(t=>{if("Escape"===t.key)return this._config.keyboard?(t.preventDefault(),void this.hide()):void this._triggerBackdropTransition()})),de.on(window,_n,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),de.on(this._element,vn,(t=>{de.one(this._element,bn,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(An),this._resetAdjustments(),this._scrollBar.reset(),de.trigger(this._element,pn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(de.trigger(this._element,fn).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(Cn)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(Cn),this._queueCallback((()=>{this._element.classList.remove(Cn),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=Kt()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=Kt()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=xn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}de.on(document,wn,'[data-bs-toggle="modal"]',(function(t){const e=Pt(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),de.one(e,gn,(t=>{t.defaultPrevented||de.one(e,pn,(()=>{Wt(this)&&this.focus()}))}));const i=ke.findOne(".modal.show");i&&xn.getInstance(i).hide(),xn.getOrCreateInstance(e).toggle(this)})),we(xn),Qt(xn);const kn=".bs.offcanvas",Ln=".data-api",Dn=`load${kn}${Ln}`,$n="show",Sn="showing",In="hiding",Nn=".offcanvas.show",Pn=`show${kn}`,jn=`shown${kn}`,Mn=`hide${kn}`,Hn=`hidePrevented${kn}`,Wn=`hidden${kn}`,Fn=`resize${kn}`,Bn=`click${kn}${Ln}`,zn=`keydown.dismiss${kn}`,qn={backdrop:!0,keyboard:!0,scroll:!1},Rn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class Vn extends ye{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return qn}static get DefaultType(){return Rn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||de.trigger(this._element,Pn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new Ui).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Sn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add($n),this._element.classList.remove(Sn),de.trigger(this._element,jn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(de.trigger(this._element,Mn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add(In),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove($n,In),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new Ui).reset(),de.trigger(this._element,Wn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new nn({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():de.trigger(this._element,Hn)}:null})}_initializeFocusTrap(){return new hn({trapElement:this._element})}_addEventListeners(){de.on(this._element,zn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():de.trigger(this._element,Hn))}))}static jQueryInterface(t){return this.each((function(){const e=Vn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}de.on(document,Bn,'[data-bs-toggle="offcanvas"]',(function(t){const e=Pt(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),Ft(this))return;de.one(e,Wn,(()=>{Wt(this)&&this.focus()}));const i=ke.findOne(Nn);i&&i!==e&&Vn.getInstance(i).hide(),Vn.getOrCreateInstance(e).toggle(this)})),de.on(window,Dn,(()=>{for(const t of ke.find(Nn))Vn.getOrCreateInstance(t).show()})),de.on(window,Fn,(()=>{for(const t of ke.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&Vn.getOrCreateInstance(t).hide()})),we(Vn),Qt(Vn);const Kn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Qn=/^(?:(?:https?|mailto|ftp|tel|file|sms):|[^#&/:?]*(?:[#/?]|$))/i,Xn=/^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[\d+/a-z]+=*$/i,Yn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Kn.has(i)||Boolean(Qn.test(t.nodeValue)||Xn.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Un={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],div:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Gn={allowList:Un,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Jn={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},Zn={entry:"(string|element|function|null)",selector:"(string|element)"};class ts extends ve{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Gn}static get DefaultType(){return Jn}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},Zn)}_setContent(t,e,i){const n=ke.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?Mt(e)?this._putElementInTemplate(Ht(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Yn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return"function"==typeof t?t(this):t}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const es=new Set(["sanitize","allowList","sanitizeFn"]),is="fade",ns="show",ss=".modal",os="hide.bs.modal",rs="hover",as="focus",ls={AUTO:"auto",TOP:"top",RIGHT:Kt()?"left":"right",BOTTOM:"bottom",LEFT:Kt()?"right":"left"},cs={allowList:Un,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,0],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},hs={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class us extends ye{constructor(t,i){if(void 0===e)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,i),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return cs}static get DefaultType(){return hs}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),de.off(this._element.closest(ss),os,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=de.trigger(this._element,this.constructor.eventName("show")),e=(Bt(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),de.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(ns),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))de.on(t,"mouseover",zt);this._queueCallback((()=>{de.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!de.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(ns),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))de.off(t,"mouseover",zt);this._activeTrigger.click=!1,this._activeTrigger[as]=!1,this._activeTrigger[rs]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),de.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(is,ns),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(is),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new ts({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{".tooltip-inner":this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(is)}_isShown(){return this.tip&&this.tip.classList.contains(ns)}_createPopper(t){const e="function"==typeof this._config.placement?this._config.placement.call(this,t,this._element):this._config.placement,i=ls[e.toUpperCase()];return Dt(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return"function"==typeof t?t.call(this._element):t}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,..."function"==typeof this._config.popperConfig?this._config.popperConfig(e):this._config.popperConfig}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)de.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===rs?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===rs?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");de.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?as:rs]=!0,e._enter()})),de.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?as:rs]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},de.on(this._element.closest(ss),os,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=be.getDataAttributes(this._element);for(const t of Object.keys(e))es.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:Ht(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const e in this._config)this.constructor.Default[e]!==this._config[e]&&(t[e]=this._config[e]);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=us.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(us);const ds={...us.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},fs={...us.DefaultType,content:"(null|string|element|function)"};class ps extends us{static get Default(){return ds}static get DefaultType(){return fs}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{".popover-header":this._getTitle(),".popover-body":this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=ps.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(ps);const gs=".bs.scrollspy",ms=`activate${gs}`,_s=`click${gs}`,bs=`load${gs}.data-api`,vs="active",ys="[href]",ws=".nav-link",As=`${ws}, .nav-item > ${ws}, .list-group-item`,Es={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},Cs={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Ts extends ye{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return Es}static get DefaultType(){return Cs}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=Ht(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(de.off(this._config.target,_s),de.on(this._config.target,_s,ys,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=ke.find(ys,this._config.target);for(const e of t){if(!e.hash||Ft(e))continue;const t=ke.findOne(e.hash,this._element);Wt(t)&&(this._targetLinks.set(e.hash,e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(vs),this._activateParents(t),de.trigger(this._element,ms,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))ke.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(vs);else for(const e of ke.parents(t,".nav, .list-group"))for(const t of ke.prev(e,As))t.classList.add(vs)}_clearActiveClass(t){t.classList.remove(vs);const e=ke.find(`${ys}.${vs}`,t);for(const t of e)t.classList.remove(vs)}static jQueryInterface(t){return this.each((function(){const e=Ts.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}de.on(window,bs,(()=>{for(const t of ke.find('[data-bs-spy="scroll"]'))Ts.getOrCreateInstance(t)})),Qt(Ts);const Os=".bs.tab",xs=`hide${Os}`,ks=`hidden${Os}`,Ls=`show${Os}`,Ds=`shown${Os}`,$s=`click${Os}`,Ss=`keydown${Os}`,Is=`load${Os}`,Ns="ArrowLeft",Ps="ArrowRight",js="ArrowUp",Ms="ArrowDown",Hs="active",Ws="fade",Fs="show",Bs=":not(.dropdown-toggle)",zs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',qs=`.nav-link${Bs}, .list-group-item${Bs}, [role="tab"]${Bs}, ${zs}`,Rs=`.${Hs}[data-bs-toggle="tab"], .${Hs}[data-bs-toggle="pill"], .${Hs}[data-bs-toggle="list"]`;class Vs extends ye{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),de.on(this._element,Ss,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?de.trigger(e,xs,{relatedTarget:t}):null;de.trigger(t,Ls,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(Hs),this._activate(Pt(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),de.trigger(t,Ds,{relatedTarget:e})):t.classList.add(Fs)}),t,t.classList.contains(Ws)))}_deactivate(t,e){t&&(t.classList.remove(Hs),t.blur(),this._deactivate(Pt(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),de.trigger(t,ks,{relatedTarget:e})):t.classList.remove(Fs)}),t,t.classList.contains(Ws)))}_keydown(t){if(![Ns,Ps,js,Ms].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=[Ps,Ms].includes(t.key),i=Ut(this._getChildren().filter((t=>!Ft(t))),t.target,e,!0);i&&(i.focus({preventScroll:!0}),Vs.getOrCreateInstance(i).show())}_getChildren(){return ke.find(qs,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=Pt(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`#${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=ke.findOne(t,i);s&&s.classList.toggle(n,e)};n(".dropdown-toggle",Hs),n(".dropdown-menu",Fs),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(Hs)}_getInnerElement(t){return t.matches(qs)?t:ke.findOne(qs,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Vs.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}de.on(document,$s,zs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),Ft(this)||Vs.getOrCreateInstance(this).show()})),de.on(window,Is,(()=>{for(const t of ke.find(Rs))Vs.getOrCreateInstance(t)})),Qt(Vs);const Ks=".bs.toast",Qs=`mouseover${Ks}`,Xs=`mouseout${Ks}`,Ys=`focusin${Ks}`,Us=`focusout${Ks}`,Gs=`hide${Ks}`,Js=`hidden${Ks}`,Zs=`show${Ks}`,to=`shown${Ks}`,eo="hide",io="show",no="showing",so={animation:"boolean",autohide:"boolean",delay:"number"},oo={animation:!0,autohide:!0,delay:5e3};class ro extends ye{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return oo}static get DefaultType(){return so}static get NAME(){return"toast"}show(){de.trigger(this._element,Zs).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(eo),qt(this._element),this._element.classList.add(io,no),this._queueCallback((()=>{this._element.classList.remove(no),de.trigger(this._element,to),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(de.trigger(this._element,Gs).defaultPrevented||(this._element.classList.add(no),this._queueCallback((()=>{this._element.classList.add(eo),this._element.classList.remove(no,io),de.trigger(this._element,Js)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(io),super.dispose()}isShown(){return this._element.classList.contains(io)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){de.on(this._element,Qs,(t=>this._onInteraction(t,!0))),de.on(this._element,Xs,(t=>this._onInteraction(t,!1))),de.on(this._element,Ys,(t=>this._onInteraction(t,!0))),de.on(this._element,Us,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=ro.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}var ao;we(ro),Qt(ro),ao=function(){[].slice.call(document.querySelectorAll('[data-bs-toggle="tooltip"]')).map((function(t){return new us(t,{delay:{show:500,hide:100}})}))},"loading"!=document.readyState?ao():document.addEventListener("DOMContentLoaded",ao)})(); +//# sourceMappingURL=bootstrap.js.map \ No newline at end of file diff --git a/_static/scripts/bootstrap.js.LICENSE.txt b/_static/scripts/bootstrap.js.LICENSE.txt new file mode 100644 index 0000000..91ad10a --- /dev/null +++ b/_static/scripts/bootstrap.js.LICENSE.txt @@ -0,0 +1,5 @@ +/*! + * Bootstrap v5.2.3 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ diff --git a/_static/scripts/bootstrap.js.map b/_static/scripts/bootstrap.js.map new file mode 100644 index 0000000..d83e2f7 --- /dev/null +++ b/_static/scripts/bootstrap.js.map @@ -0,0 +1 @@ +{"version":3,"file":"scripts/bootstrap.js","mappings":";mBACA,IAAIA,EAAsB,CCA1BA,EAAwB,CAACC,EAASC,KACjC,IAAI,IAAIC,KAAOD,EACXF,EAAoBI,EAAEF,EAAYC,KAASH,EAAoBI,EAAEH,EAASE,IAC5EE,OAAOC,eAAeL,EAASE,EAAK,CAAEI,YAAY,EAAMC,IAAKN,EAAWC,IAE1E,ECNDH,EAAwB,CAACS,EAAKC,IAAUL,OAAOM,UAAUC,eAAeC,KAAKJ,EAAKC,GCClFV,EAAyBC,IACH,oBAAXa,QAA0BA,OAAOC,aAC1CV,OAAOC,eAAeL,EAASa,OAAOC,YAAa,CAAEC,MAAO,WAE7DX,OAAOC,eAAeL,EAAS,aAAc,CAAEe,OAAO,GAAO,ipBCLvD,IAAI,EAAM,MACNC,EAAS,SACTC,EAAQ,QACRC,EAAO,OACPC,EAAO,OACPC,EAAiB,CAAC,EAAKJ,EAAQC,EAAOC,GACtCG,EAAQ,QACRC,EAAM,MACNC,EAAkB,kBAClBC,EAAW,WACXC,EAAS,SACTC,EAAY,YACZC,EAAmCP,EAAeQ,QAAO,SAAUC,EAAKC,GACjF,OAAOD,EAAIE,OAAO,CAACD,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAChE,GAAG,IACQ,EAA0B,GAAGS,OAAOX,EAAgB,CAACD,IAAOS,QAAO,SAAUC,EAAKC,GAC3F,OAAOD,EAAIE,OAAO,CAACD,EAAWA,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAC3E,GAAG,IAEQU,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAc,cACdC,EAAQ,QACRC,EAAa,aACbC,EAAiB,CAACT,EAAYC,EAAMC,EAAWC,EAAYC,EAAMC,EAAWC,EAAaC,EAAOC,GC9B5F,SAASE,EAAYC,GAClC,OAAOA,GAAWA,EAAQC,UAAY,IAAIC,cAAgB,IAC5D,CCFe,SAASC,EAAUC,GAChC,GAAY,MAARA,EACF,OAAOC,OAGT,GAAwB,oBAApBD,EAAKE,WAAkC,CACzC,IAAIC,EAAgBH,EAAKG,cACzB,OAAOA,GAAgBA,EAAcC,aAAwBH,MAC/D,CAEA,OAAOD,CACT,CCTA,SAASK,EAAUL,GAEjB,OAAOA,aADUD,EAAUC,GAAMM,SACIN,aAAgBM,OACvD,CAEA,SAASC,EAAcP,GAErB,OAAOA,aADUD,EAAUC,GAAMQ,aACIR,aAAgBQ,WACvD,CAEA,SAASC,EAAaT,GAEpB,MAA0B,oBAAfU,aAKJV,aADUD,EAAUC,GAAMU,YACIV,aAAgBU,WACvD,CCwDA,SACEC,KAAM,cACNC,SAAS,EACTC,MAAO,QACPC,GA5EF,SAAqBC,GACnB,IAAIC,EAAQD,EAAKC,MACjB3D,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIS,EAAQJ,EAAMK,OAAOV,IAAS,CAAC,EAC/BW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EACxCf,EAAUoB,EAAME,SAASP,GAExBJ,EAAcX,IAAaD,EAAYC,KAO5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUR,GACxC,IAAI3C,EAAQsD,EAAWX,IAET,IAAV3C,EACF4B,EAAQ4B,gBAAgBb,GAExBf,EAAQ6B,aAAad,GAAgB,IAAV3C,EAAiB,GAAKA,EAErD,IACF,GACF,EAoDE0D,OAlDF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MACdY,EAAgB,CAClBlD,OAAQ,CACNmD,SAAUb,EAAMc,QAAQC,SACxB5D,KAAM,IACN6D,IAAK,IACLC,OAAQ,KAEVC,MAAO,CACLL,SAAU,YAEZlD,UAAW,CAAC,GASd,OAPAtB,OAAOkE,OAAOP,EAAME,SAASxC,OAAO0C,MAAOQ,EAAclD,QACzDsC,EAAMK,OAASO,EAEXZ,EAAME,SAASgB,OACjB7E,OAAOkE,OAAOP,EAAME,SAASgB,MAAMd,MAAOQ,EAAcM,OAGnD,WACL7E,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIf,EAAUoB,EAAME,SAASP,GACzBW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EAGxCS,EAFkB/D,OAAO4D,KAAKD,EAAMK,OAAOzD,eAAe+C,GAAQK,EAAMK,OAAOV,GAAQiB,EAAcjB,IAE7E9B,QAAO,SAAUuC,EAAOe,GAElD,OADAf,EAAMe,GAAY,GACXf,CACT,GAAG,CAAC,GAECb,EAAcX,IAAaD,EAAYC,KAI5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUiB,GACxCxC,EAAQ4B,gBAAgBY,EAC1B,IACF,GACF,CACF,EASEC,SAAU,CAAC,kBCjFE,SAASC,EAAiBvD,GACvC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCHO,IAAI,EAAMC,KAAKC,IACX,EAAMD,KAAKE,IACXC,EAAQH,KAAKG,MCFT,SAASC,IACtB,IAAIC,EAASC,UAAUC,cAEvB,OAAc,MAAVF,GAAkBA,EAAOG,QAAUC,MAAMC,QAAQL,EAAOG,QACnDH,EAAOG,OAAOG,KAAI,SAAUC,GACjC,OAAOA,EAAKC,MAAQ,IAAMD,EAAKE,OACjC,IAAGC,KAAK,KAGHT,UAAUU,SACnB,CCTe,SAASC,IACtB,OAAQ,iCAAiCC,KAAKd,IAChD,CCCe,SAASe,EAAsB/D,EAASgE,EAAcC,QAC9C,IAAjBD,IACFA,GAAe,QAGO,IAApBC,IACFA,GAAkB,GAGpB,IAAIC,EAAalE,EAAQ+D,wBACrBI,EAAS,EACTC,EAAS,EAETJ,GAAgBrD,EAAcX,KAChCmE,EAASnE,EAAQqE,YAAc,GAAItB,EAAMmB,EAAWI,OAAStE,EAAQqE,aAAmB,EACxFD,EAASpE,EAAQuE,aAAe,GAAIxB,EAAMmB,EAAWM,QAAUxE,EAAQuE,cAAoB,GAG7F,IACIE,GADOhE,EAAUT,GAAWG,EAAUH,GAAWK,QAC3BoE,eAEtBC,GAAoBb,KAAsBI,EAC1CU,GAAKT,EAAW3F,MAAQmG,GAAoBD,EAAiBA,EAAeG,WAAa,IAAMT,EAC/FU,GAAKX,EAAW9B,KAAOsC,GAAoBD,EAAiBA,EAAeK,UAAY,IAAMV,EAC7FE,EAAQJ,EAAWI,MAAQH,EAC3BK,EAASN,EAAWM,OAASJ,EACjC,MAAO,CACLE,MAAOA,EACPE,OAAQA,EACRpC,IAAKyC,EACLvG,MAAOqG,EAAIL,EACXjG,OAAQwG,EAAIL,EACZjG,KAAMoG,EACNA,EAAGA,EACHE,EAAGA,EAEP,CCrCe,SAASE,EAAc/E,GACpC,IAAIkE,EAAaH,EAAsB/D,GAGnCsE,EAAQtE,EAAQqE,YAChBG,EAASxE,EAAQuE,aAUrB,OARI3B,KAAKoC,IAAId,EAAWI,MAAQA,IAAU,IACxCA,EAAQJ,EAAWI,OAGjB1B,KAAKoC,IAAId,EAAWM,OAASA,IAAW,IAC1CA,EAASN,EAAWM,QAGf,CACLG,EAAG3E,EAAQ4E,WACXC,EAAG7E,EAAQ8E,UACXR,MAAOA,EACPE,OAAQA,EAEZ,CCvBe,SAASS,EAASC,EAAQC,GACvC,IAAIC,EAAWD,EAAME,aAAeF,EAAME,cAE1C,GAAIH,EAAOD,SAASE,GAClB,OAAO,EAEJ,GAAIC,GAAYvE,EAAauE,GAAW,CACzC,IAAIE,EAAOH,EAEX,EAAG,CACD,GAAIG,GAAQJ,EAAOK,WAAWD,GAC5B,OAAO,EAITA,EAAOA,EAAKE,YAAcF,EAAKG,IACjC,OAASH,EACX,CAGF,OAAO,CACT,CCrBe,SAAS,EAAiBtF,GACvC,OAAOG,EAAUH,GAAS0F,iBAAiB1F,EAC7C,CCFe,SAAS2F,EAAe3F,GACrC,MAAO,CAAC,QAAS,KAAM,MAAM4F,QAAQ7F,EAAYC,KAAa,CAChE,CCFe,SAAS6F,EAAmB7F,GAEzC,QAASS,EAAUT,GAAWA,EAAQO,cACtCP,EAAQ8F,WAAazF,OAAOyF,UAAUC,eACxC,CCFe,SAASC,EAAchG,GACpC,MAA6B,SAAzBD,EAAYC,GACPA,EAMPA,EAAQiG,cACRjG,EAAQwF,aACR3E,EAAab,GAAWA,EAAQyF,KAAO,OAEvCI,EAAmB7F,EAGvB,CCVA,SAASkG,EAAoBlG,GAC3B,OAAKW,EAAcX,IACoB,UAAvC,EAAiBA,GAASiC,SAInBjC,EAAQmG,aAHN,IAIX,CAwCe,SAASC,EAAgBpG,GAItC,IAHA,IAAIK,EAASF,EAAUH,GACnBmG,EAAeD,EAAoBlG,GAEhCmG,GAAgBR,EAAeQ,IAA6D,WAA5C,EAAiBA,GAAclE,UACpFkE,EAAeD,EAAoBC,GAGrC,OAAIA,IAA+C,SAA9BpG,EAAYoG,IAA0D,SAA9BpG,EAAYoG,IAAwE,WAA5C,EAAiBA,GAAclE,UAC3H5B,EAGF8F,GAhDT,SAA4BnG,GAC1B,IAAIqG,EAAY,WAAWvC,KAAKd,KAGhC,GAFW,WAAWc,KAAKd,MAEfrC,EAAcX,IAII,UAFX,EAAiBA,GAEnBiC,SACb,OAAO,KAIX,IAAIqE,EAAcN,EAAchG,GAMhC,IAJIa,EAAayF,KACfA,EAAcA,EAAYb,MAGrB9E,EAAc2F,IAAgB,CAAC,OAAQ,QAAQV,QAAQ7F,EAAYuG,IAAgB,GAAG,CAC3F,IAAIC,EAAM,EAAiBD,GAI3B,GAAsB,SAAlBC,EAAIC,WAA4C,SAApBD,EAAIE,aAA0C,UAAhBF,EAAIG,UAAiF,IAA1D,CAAC,YAAa,eAAed,QAAQW,EAAII,aAAsBN,GAAgC,WAAnBE,EAAII,YAA2BN,GAAaE,EAAIK,QAAyB,SAAfL,EAAIK,OACjO,OAAON,EAEPA,EAAcA,EAAYd,UAE9B,CAEA,OAAO,IACT,CAgByBqB,CAAmB7G,IAAYK,CACxD,CCpEe,SAASyG,EAAyB3H,GAC/C,MAAO,CAAC,MAAO,UAAUyG,QAAQzG,IAAc,EAAI,IAAM,GAC3D,CCDO,SAAS4H,EAAOjE,EAAK1E,EAAOyE,GACjC,OAAO,EAAQC,EAAK,EAAQ1E,EAAOyE,GACrC,CCFe,SAASmE,EAAmBC,GACzC,OAAOxJ,OAAOkE,OAAO,CAAC,ECDf,CACLS,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GDHuC0I,EACjD,CEHe,SAASC,EAAgB9I,EAAOiD,GAC7C,OAAOA,EAAKpC,QAAO,SAAUkI,EAAS5J,GAEpC,OADA4J,EAAQ5J,GAAOa,EACR+I,CACT,GAAG,CAAC,EACN,CCuFA,SACEpG,KAAM,QACNC,SAAS,EACTC,MAAO,OACPC,GA9EF,SAAeC,GACb,IAAIiG,EAEAhG,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZmB,EAAUf,EAAKe,QACfmF,EAAejG,EAAME,SAASgB,MAC9BgF,EAAgBlG,EAAMmG,cAAcD,cACpCE,EAAgB9E,EAAiBtB,EAAMjC,WACvCsI,EAAOX,EAAyBU,GAEhCE,EADa,CAACnJ,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAClC,SAAW,QAElC,GAAKH,GAAiBC,EAAtB,CAIA,IAAIL,EAxBgB,SAAyBU,EAASvG,GAItD,OAAO4F,EAAsC,iBAH7CW,EAA6B,mBAAZA,EAAyBA,EAAQlK,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CAC/EzI,UAAWiC,EAAMjC,aACbwI,GACkDA,EAAUT,EAAgBS,EAASlJ,GAC7F,CAmBsBoJ,CAAgB3F,EAAQyF,QAASvG,GACjD0G,EAAY/C,EAAcsC,GAC1BU,EAAmB,MAATN,EAAe,EAAMlJ,EAC/ByJ,EAAmB,MAATP,EAAepJ,EAASC,EAClC2J,EAAU7G,EAAMwG,MAAM7I,UAAU2I,GAAOtG,EAAMwG,MAAM7I,UAAU0I,GAAQH,EAAcG,GAAQrG,EAAMwG,MAAM9I,OAAO4I,GAC9GQ,EAAYZ,EAAcG,GAAQrG,EAAMwG,MAAM7I,UAAU0I,GACxDU,EAAoB/B,EAAgBiB,GACpCe,EAAaD,EAA6B,MAATV,EAAeU,EAAkBE,cAAgB,EAAIF,EAAkBG,aAAe,EAAI,EAC3HC,EAAoBN,EAAU,EAAIC,EAAY,EAG9CpF,EAAMmE,EAAcc,GACpBlF,EAAMuF,EAAaN,EAAUJ,GAAOT,EAAce,GAClDQ,EAASJ,EAAa,EAAIN,EAAUJ,GAAO,EAAIa,EAC/CE,EAAS1B,EAAOjE,EAAK0F,EAAQ3F,GAE7B6F,EAAWjB,EACfrG,EAAMmG,cAAcxG,KAASqG,EAAwB,CAAC,GAAyBsB,GAAYD,EAAQrB,EAAsBuB,aAAeF,EAASD,EAAQpB,EAnBzJ,CAoBF,EA4CEtF,OA1CF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MAEdwH,EADU7G,EAAMG,QACWlC,QAC3BqH,OAAoC,IAArBuB,EAA8B,sBAAwBA,EAErD,MAAhBvB,IAKwB,iBAAjBA,IACTA,EAAejG,EAAME,SAASxC,OAAO+J,cAAcxB,MAahDpC,EAAS7D,EAAME,SAASxC,OAAQuI,KAQrCjG,EAAME,SAASgB,MAAQ+E,EACzB,EASE5E,SAAU,CAAC,iBACXqG,iBAAkB,CAAC,oBCnGN,SAASC,EAAa5J,GACnC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCOA,IAAIqG,EAAa,CACf5G,IAAK,OACL9D,MAAO,OACPD,OAAQ,OACRE,KAAM,QAeD,SAAS0K,GAAYlH,GAC1B,IAAImH,EAEApK,EAASiD,EAAMjD,OACfqK,EAAapH,EAAMoH,WACnBhK,EAAY4C,EAAM5C,UAClBiK,EAAYrH,EAAMqH,UAClBC,EAAUtH,EAAMsH,QAChBpH,EAAWF,EAAME,SACjBqH,EAAkBvH,EAAMuH,gBACxBC,EAAWxH,EAAMwH,SACjBC,EAAezH,EAAMyH,aACrBC,EAAU1H,EAAM0H,QAChBC,EAAaL,EAAQ1E,EACrBA,OAAmB,IAAf+E,EAAwB,EAAIA,EAChCC,EAAaN,EAAQxE,EACrBA,OAAmB,IAAf8E,EAAwB,EAAIA,EAEhCC,EAAgC,mBAAjBJ,EAA8BA,EAAa,CAC5D7E,EAAGA,EACHE,IACG,CACHF,EAAGA,EACHE,GAGFF,EAAIiF,EAAMjF,EACVE,EAAI+E,EAAM/E,EACV,IAAIgF,EAAOR,EAAQrL,eAAe,KAC9B8L,EAAOT,EAAQrL,eAAe,KAC9B+L,EAAQxL,EACRyL,EAAQ,EACRC,EAAM5J,OAEV,GAAIkJ,EAAU,CACZ,IAAIpD,EAAeC,EAAgBtH,GAC/BoL,EAAa,eACbC,EAAY,cAEZhE,IAAiBhG,EAAUrB,IAGmB,WAA5C,EAFJqH,EAAeN,EAAmB/G,IAECmD,UAAsC,aAAbA,IAC1DiI,EAAa,eACbC,EAAY,gBAOZhL,IAAc,IAAQA,IAAcZ,GAAQY,IAAcb,IAAU8K,IAAczK,KACpFqL,EAAQ3L,EAGRwG,IAFc4E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeD,OACzF2B,EAAa+D,IACEf,EAAW3E,OAC1BK,GAAKyE,EAAkB,GAAK,GAG1BnK,IAAcZ,IAASY,IAAc,GAAOA,IAAcd,GAAW+K,IAAczK,KACrFoL,EAAQzL,EAGRqG,IAFc8E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeH,MACzF6B,EAAagE,IACEhB,EAAW7E,MAC1BK,GAAK2E,EAAkB,GAAK,EAEhC,CAEA,IAgBMc,EAhBFC,EAAe5M,OAAOkE,OAAO,CAC/BM,SAAUA,GACTsH,GAAYP,GAEXsB,GAAyB,IAAjBd,EAlFd,SAA2BrI,EAAM8I,GAC/B,IAAItF,EAAIxD,EAAKwD,EACTE,EAAI1D,EAAK0D,EACT0F,EAAMN,EAAIO,kBAAoB,EAClC,MAAO,CACL7F,EAAG5B,EAAM4B,EAAI4F,GAAOA,GAAO,EAC3B1F,EAAG9B,EAAM8B,EAAI0F,GAAOA,GAAO,EAE/B,CA0EsCE,CAAkB,CACpD9F,EAAGA,EACHE,GACC1E,EAAUrB,IAAW,CACtB6F,EAAGA,EACHE,GAMF,OAHAF,EAAI2F,EAAM3F,EACVE,EAAIyF,EAAMzF,EAENyE,EAGK7L,OAAOkE,OAAO,CAAC,EAAG0I,IAAeD,EAAiB,CAAC,GAAkBJ,GAASF,EAAO,IAAM,GAAIM,EAAeL,GAASF,EAAO,IAAM,GAAIO,EAAe5D,WAAayD,EAAIO,kBAAoB,IAAM,EAAI,aAAe7F,EAAI,OAASE,EAAI,MAAQ,eAAiBF,EAAI,OAASE,EAAI,SAAUuF,IAG5R3M,OAAOkE,OAAO,CAAC,EAAG0I,IAAenB,EAAkB,CAAC,GAAmBc,GAASF,EAAOjF,EAAI,KAAO,GAAIqE,EAAgBa,GAASF,EAAOlF,EAAI,KAAO,GAAIuE,EAAgB1C,UAAY,GAAI0C,GAC9L,CAuDA,UACEnI,KAAM,gBACNC,SAAS,EACTC,MAAO,cACPC,GAzDF,SAAuBwJ,GACrB,IAAItJ,EAAQsJ,EAAMtJ,MACdc,EAAUwI,EAAMxI,QAChByI,EAAwBzI,EAAQoH,gBAChCA,OAA4C,IAA1BqB,GAA0CA,EAC5DC,EAAoB1I,EAAQqH,SAC5BA,OAAiC,IAAtBqB,GAAsCA,EACjDC,EAAwB3I,EAAQsH,aAChCA,OAAyC,IAA1BqB,GAA0CA,EAYzDR,EAAe,CACjBlL,UAAWuD,EAAiBtB,EAAMjC,WAClCiK,UAAWL,EAAa3H,EAAMjC,WAC9BL,OAAQsC,EAAME,SAASxC,OACvBqK,WAAY/H,EAAMwG,MAAM9I,OACxBwK,gBAAiBA,EACjBG,QAAoC,UAA3BrI,EAAMc,QAAQC,UAGgB,MAArCf,EAAMmG,cAAcD,gBACtBlG,EAAMK,OAAO3C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAO3C,OAAQmK,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACvGhB,QAASjI,EAAMmG,cAAcD,cAC7BrF,SAAUb,EAAMc,QAAQC,SACxBoH,SAAUA,EACVC,aAAcA,OAIe,MAA7BpI,EAAMmG,cAAcjF,QACtBlB,EAAMK,OAAOa,MAAQ7E,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAOa,MAAO2G,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACrGhB,QAASjI,EAAMmG,cAAcjF,MAC7BL,SAAU,WACVsH,UAAU,EACVC,aAAcA,OAIlBpI,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,wBAAyBsC,EAAMjC,WAEnC,EAQE2L,KAAM,CAAC,GChLT,IAAIC,GAAU,CACZA,SAAS,GAsCX,UACEhK,KAAM,iBACNC,SAAS,EACTC,MAAO,QACPC,GAAI,WAAe,EACnBY,OAxCF,SAAgBX,GACd,IAAIC,EAAQD,EAAKC,MACb4J,EAAW7J,EAAK6J,SAChB9I,EAAUf,EAAKe,QACf+I,EAAkB/I,EAAQgJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAkBjJ,EAAQkJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7C9K,EAASF,EAAUiB,EAAME,SAASxC,QAClCuM,EAAgB,GAAGjM,OAAOgC,EAAMiK,cAActM,UAAWqC,EAAMiK,cAAcvM,QAYjF,OAVIoM,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaC,iBAAiB,SAAUP,EAASQ,OAAQT,GAC3D,IAGEK,GACF/K,EAAOkL,iBAAiB,SAAUP,EAASQ,OAAQT,IAG9C,WACDG,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaG,oBAAoB,SAAUT,EAASQ,OAAQT,GAC9D,IAGEK,GACF/K,EAAOoL,oBAAoB,SAAUT,EAASQ,OAAQT,GAE1D,CACF,EASED,KAAM,CAAC,GC/CT,IAAIY,GAAO,CACTnN,KAAM,QACND,MAAO,OACPD,OAAQ,MACR+D,IAAK,UAEQ,SAASuJ,GAAqBxM,GAC3C,OAAOA,EAAUyM,QAAQ,0BAA0B,SAAUC,GAC3D,OAAOH,GAAKG,EACd,GACF,CCVA,IAAI,GAAO,CACTnN,MAAO,MACPC,IAAK,SAEQ,SAASmN,GAA8B3M,GACpD,OAAOA,EAAUyM,QAAQ,cAAc,SAAUC,GAC/C,OAAO,GAAKA,EACd,GACF,CCPe,SAASE,GAAgB3L,GACtC,IAAI6J,EAAM9J,EAAUC,GAGpB,MAAO,CACL4L,WAHe/B,EAAIgC,YAInBC,UAHcjC,EAAIkC,YAKtB,CCNe,SAASC,GAAoBpM,GAQ1C,OAAO+D,EAAsB8B,EAAmB7F,IAAUzB,KAAOwN,GAAgB/L,GAASgM,UAC5F,CCXe,SAASK,GAAerM,GAErC,IAAIsM,EAAoB,EAAiBtM,GACrCuM,EAAWD,EAAkBC,SAC7BC,EAAYF,EAAkBE,UAC9BC,EAAYH,EAAkBG,UAElC,MAAO,6BAA6B3I,KAAKyI,EAAWE,EAAYD,EAClE,CCLe,SAASE,GAAgBtM,GACtC,MAAI,CAAC,OAAQ,OAAQ,aAAawF,QAAQ7F,EAAYK,KAAU,EAEvDA,EAAKG,cAAcoM,KAGxBhM,EAAcP,IAASiM,GAAejM,GACjCA,EAGFsM,GAAgB1G,EAAc5F,GACvC,CCJe,SAASwM,GAAkB5M,EAAS6M,GACjD,IAAIC,OAES,IAATD,IACFA,EAAO,IAGT,IAAIvB,EAAeoB,GAAgB1M,GAC/B+M,EAASzB,KAAqE,OAAlDwB,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,MACpH1C,EAAM9J,EAAUmL,GAChB0B,EAASD,EAAS,CAAC9C,GAAK7K,OAAO6K,EAAIxF,gBAAkB,GAAI4H,GAAef,GAAgBA,EAAe,IAAMA,EAC7G2B,EAAcJ,EAAKzN,OAAO4N,GAC9B,OAAOD,EAASE,EAChBA,EAAY7N,OAAOwN,GAAkB5G,EAAcgH,IACrD,CCzBe,SAASE,GAAiBC,GACvC,OAAO1P,OAAOkE,OAAO,CAAC,EAAGwL,EAAM,CAC7B5O,KAAM4O,EAAKxI,EACXvC,IAAK+K,EAAKtI,EACVvG,MAAO6O,EAAKxI,EAAIwI,EAAK7I,MACrBjG,OAAQ8O,EAAKtI,EAAIsI,EAAK3I,QAE1B,CCqBA,SAAS4I,GAA2BpN,EAASqN,EAAgBlL,GAC3D,OAAOkL,IAAmBxO,EAAWqO,GCzBxB,SAAyBlN,EAASmC,GAC/C,IAAI8H,EAAM9J,EAAUH,GAChBsN,EAAOzH,EAAmB7F,GAC1ByE,EAAiBwF,EAAIxF,eACrBH,EAAQgJ,EAAKhF,YACb9D,EAAS8I,EAAKjF,aACd1D,EAAI,EACJE,EAAI,EAER,GAAIJ,EAAgB,CAClBH,EAAQG,EAAeH,MACvBE,EAASC,EAAeD,OACxB,IAAI+I,EAAiB1J,KAEjB0J,IAAmBA,GAA+B,UAAbpL,KACvCwC,EAAIF,EAAeG,WACnBC,EAAIJ,EAAeK,UAEvB,CAEA,MAAO,CACLR,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EAAIyH,GAAoBpM,GAC3B6E,EAAGA,EAEP,CDDwD2I,CAAgBxN,EAASmC,IAAa1B,EAAU4M,GAdxG,SAAoCrN,EAASmC,GAC3C,IAAIgL,EAAOpJ,EAAsB/D,GAAS,EAAoB,UAAbmC,GASjD,OARAgL,EAAK/K,IAAM+K,EAAK/K,IAAMpC,EAAQyN,UAC9BN,EAAK5O,KAAO4O,EAAK5O,KAAOyB,EAAQ0N,WAChCP,EAAK9O,OAAS8O,EAAK/K,IAAMpC,EAAQqI,aACjC8E,EAAK7O,MAAQ6O,EAAK5O,KAAOyB,EAAQsI,YACjC6E,EAAK7I,MAAQtE,EAAQsI,YACrB6E,EAAK3I,OAASxE,EAAQqI,aACtB8E,EAAKxI,EAAIwI,EAAK5O,KACd4O,EAAKtI,EAAIsI,EAAK/K,IACP+K,CACT,CAG0HQ,CAA2BN,EAAgBlL,GAAY+K,GEtBlK,SAAyBlN,GACtC,IAAI8M,EAEAQ,EAAOzH,EAAmB7F,GAC1B4N,EAAY7B,GAAgB/L,GAC5B2M,EAA0D,OAAlDG,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,KAChGrI,EAAQ,EAAIgJ,EAAKO,YAAaP,EAAKhF,YAAaqE,EAAOA,EAAKkB,YAAc,EAAGlB,EAAOA,EAAKrE,YAAc,GACvG9D,EAAS,EAAI8I,EAAKQ,aAAcR,EAAKjF,aAAcsE,EAAOA,EAAKmB,aAAe,EAAGnB,EAAOA,EAAKtE,aAAe,GAC5G1D,GAAKiJ,EAAU5B,WAAaI,GAAoBpM,GAChD6E,GAAK+I,EAAU1B,UAMnB,MAJiD,QAA7C,EAAiBS,GAAQW,GAAMS,YACjCpJ,GAAK,EAAI2I,EAAKhF,YAAaqE,EAAOA,EAAKrE,YAAc,GAAKhE,GAGrD,CACLA,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EACHE,EAAGA,EAEP,CFCkMmJ,CAAgBnI,EAAmB7F,IACrO,CG1Be,SAASiO,GAAe9M,GACrC,IAOIkI,EAPAtK,EAAYoC,EAAKpC,UACjBiB,EAAUmB,EAAKnB,QACfb,EAAYgC,EAAKhC,UACjBqI,EAAgBrI,EAAYuD,EAAiBvD,GAAa,KAC1DiK,EAAYjK,EAAY4J,EAAa5J,GAAa,KAClD+O,EAAUnP,EAAU4F,EAAI5F,EAAUuF,MAAQ,EAAItE,EAAQsE,MAAQ,EAC9D6J,EAAUpP,EAAU8F,EAAI9F,EAAUyF,OAAS,EAAIxE,EAAQwE,OAAS,EAGpE,OAAQgD,GACN,KAAK,EACH6B,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI7E,EAAQwE,QAE3B,MAEF,KAAKnG,EACHgL,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI9F,EAAUyF,QAE7B,MAEF,KAAKlG,EACH+K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI5F,EAAUuF,MAC3BO,EAAGsJ,GAEL,MAEF,KAAK5P,EACH8K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI3E,EAAQsE,MACzBO,EAAGsJ,GAEL,MAEF,QACE9E,EAAU,CACR1E,EAAG5F,EAAU4F,EACbE,EAAG9F,EAAU8F,GAInB,IAAIuJ,EAAW5G,EAAgBV,EAAyBU,GAAiB,KAEzE,GAAgB,MAAZ4G,EAAkB,CACpB,IAAI1G,EAAmB,MAAb0G,EAAmB,SAAW,QAExC,OAAQhF,GACN,KAAK1K,EACH2K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAC7E,MAEF,KAAK/I,EACH0K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAKnF,CAEA,OAAO2B,CACT,CC3De,SAASgF,GAAejN,EAAOc,QAC5B,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACXqM,EAAqBD,EAASnP,UAC9BA,OAAmC,IAAvBoP,EAAgCnN,EAAMjC,UAAYoP,EAC9DC,EAAoBF,EAASnM,SAC7BA,OAAiC,IAAtBqM,EAA+BpN,EAAMe,SAAWqM,EAC3DC,EAAoBH,EAASI,SAC7BA,OAAiC,IAAtBD,EAA+B7P,EAAkB6P,EAC5DE,EAAwBL,EAASM,aACjCA,OAAyC,IAA1BD,EAAmC9P,EAAW8P,EAC7DE,EAAwBP,EAASQ,eACjCA,OAA2C,IAA1BD,EAAmC/P,EAAS+P,EAC7DE,EAAuBT,EAASU,YAChCA,OAAuC,IAAzBD,GAA0CA,EACxDE,EAAmBX,EAAS3G,QAC5BA,OAA+B,IAArBsH,EAA8B,EAAIA,EAC5ChI,EAAgBD,EAAsC,iBAAZW,EAAuBA,EAAUT,EAAgBS,EAASlJ,IACpGyQ,EAAaJ,IAAmBhQ,EAASC,EAAYD,EACrDqK,EAAa/H,EAAMwG,MAAM9I,OACzBkB,EAAUoB,EAAME,SAAS0N,EAAcE,EAAaJ,GACpDK,EJkBS,SAAyBnP,EAAS0O,EAAUE,EAAczM,GACvE,IAAIiN,EAAmC,oBAAbV,EAlB5B,SAA4B1O,GAC1B,IAAIpB,EAAkBgO,GAAkB5G,EAAchG,IAElDqP,EADoB,CAAC,WAAY,SAASzJ,QAAQ,EAAiB5F,GAASiC,WAAa,GACnDtB,EAAcX,GAAWoG,EAAgBpG,GAAWA,EAE9F,OAAKS,EAAU4O,GAKRzQ,EAAgBgI,QAAO,SAAUyG,GACtC,OAAO5M,EAAU4M,IAAmBpI,EAASoI,EAAgBgC,IAAmD,SAAhCtP,EAAYsN,EAC9F,IANS,EAOX,CAK6DiC,CAAmBtP,GAAW,GAAGZ,OAAOsP,GAC/F9P,EAAkB,GAAGQ,OAAOgQ,EAAqB,CAACR,IAClDW,EAAsB3Q,EAAgB,GACtC4Q,EAAe5Q,EAAgBK,QAAO,SAAUwQ,EAASpC,GAC3D,IAAIF,EAAOC,GAA2BpN,EAASqN,EAAgBlL,GAK/D,OAJAsN,EAAQrN,IAAM,EAAI+K,EAAK/K,IAAKqN,EAAQrN,KACpCqN,EAAQnR,MAAQ,EAAI6O,EAAK7O,MAAOmR,EAAQnR,OACxCmR,EAAQpR,OAAS,EAAI8O,EAAK9O,OAAQoR,EAAQpR,QAC1CoR,EAAQlR,KAAO,EAAI4O,EAAK5O,KAAMkR,EAAQlR,MAC/BkR,CACT,GAAGrC,GAA2BpN,EAASuP,EAAqBpN,IAK5D,OAJAqN,EAAalL,MAAQkL,EAAalR,MAAQkR,EAAajR,KACvDiR,EAAahL,OAASgL,EAAanR,OAASmR,EAAapN,IACzDoN,EAAa7K,EAAI6K,EAAajR,KAC9BiR,EAAa3K,EAAI2K,EAAapN,IACvBoN,CACT,CInC2BE,CAAgBjP,EAAUT,GAAWA,EAAUA,EAAQ2P,gBAAkB9J,EAAmBzE,EAAME,SAASxC,QAAS4P,EAAUE,EAAczM,GACjKyN,EAAsB7L,EAAsB3C,EAAME,SAASvC,WAC3DuI,EAAgB2G,GAAe,CACjClP,UAAW6Q,EACX5P,QAASmJ,EACThH,SAAU,WACVhD,UAAWA,IAET0Q,EAAmB3C,GAAiBzP,OAAOkE,OAAO,CAAC,EAAGwH,EAAY7B,IAClEwI,EAAoBhB,IAAmBhQ,EAAS+Q,EAAmBD,EAGnEG,EAAkB,CACpB3N,IAAK+M,EAAmB/M,IAAM0N,EAAkB1N,IAAM6E,EAAc7E,IACpE/D,OAAQyR,EAAkBzR,OAAS8Q,EAAmB9Q,OAAS4I,EAAc5I,OAC7EE,KAAM4Q,EAAmB5Q,KAAOuR,EAAkBvR,KAAO0I,EAAc1I,KACvED,MAAOwR,EAAkBxR,MAAQ6Q,EAAmB7Q,MAAQ2I,EAAc3I,OAExE0R,EAAa5O,EAAMmG,cAAckB,OAErC,GAAIqG,IAAmBhQ,GAAUkR,EAAY,CAC3C,IAAIvH,EAASuH,EAAW7Q,GACxB1B,OAAO4D,KAAK0O,GAAiBxO,SAAQ,SAAUhE,GAC7C,IAAI0S,EAAW,CAAC3R,EAAOD,GAAQuH,QAAQrI,IAAQ,EAAI,GAAK,EACpDkK,EAAO,CAAC,EAAKpJ,GAAQuH,QAAQrI,IAAQ,EAAI,IAAM,IACnDwS,EAAgBxS,IAAQkL,EAAOhB,GAAQwI,CACzC,GACF,CAEA,OAAOF,CACT,CCyEA,UACEhP,KAAM,OACNC,SAAS,EACTC,MAAO,OACPC,GA5HF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KAEhB,IAAIK,EAAMmG,cAAcxG,GAAMmP,MAA9B,CAoCA,IAhCA,IAAIC,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAqCA,EACpDG,EAA8BtO,EAAQuO,mBACtC9I,EAAUzF,EAAQyF,QAClB+G,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtB0B,EAAwBxO,EAAQyO,eAChCA,OAA2C,IAA1BD,GAA0CA,EAC3DE,EAAwB1O,EAAQ0O,sBAChCC,EAAqBzP,EAAMc,QAAQ/C,UACnCqI,EAAgB9E,EAAiBmO,GAEjCJ,EAAqBD,IADHhJ,IAAkBqJ,GACqCF,EAjC/E,SAAuCxR,GACrC,GAAIuD,EAAiBvD,KAAeX,EAClC,MAAO,GAGT,IAAIsS,EAAoBnF,GAAqBxM,GAC7C,MAAO,CAAC2M,GAA8B3M,GAAY2R,EAAmBhF,GAA8BgF,GACrG,CA0B6IC,CAA8BF,GAA3E,CAAClF,GAAqBkF,KAChHG,EAAa,CAACH,GAAoBzR,OAAOqR,GAAoBxR,QAAO,SAAUC,EAAKC,GACrF,OAAOD,EAAIE,OAAOsD,EAAiBvD,KAAeX,ECvCvC,SAA8B4C,EAAOc,QAClC,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACX/C,EAAYmP,EAASnP,UACrBuP,EAAWJ,EAASI,SACpBE,EAAeN,EAASM,aACxBjH,EAAU2G,EAAS3G,QACnBgJ,EAAiBrC,EAASqC,eAC1BM,EAAwB3C,EAASsC,sBACjCA,OAAkD,IAA1BK,EAAmC,EAAgBA,EAC3E7H,EAAYL,EAAa5J,GACzB6R,EAAa5H,EAAYuH,EAAiB3R,EAAsBA,EAAoB4H,QAAO,SAAUzH,GACvG,OAAO4J,EAAa5J,KAAeiK,CACrC,IAAK3K,EACDyS,EAAoBF,EAAWpK,QAAO,SAAUzH,GAClD,OAAOyR,EAAsBhL,QAAQzG,IAAc,CACrD,IAEiC,IAA7B+R,EAAkBC,SACpBD,EAAoBF,GAQtB,IAAII,EAAYF,EAAkBjS,QAAO,SAAUC,EAAKC,GAOtD,OANAD,EAAIC,GAAakP,GAAejN,EAAO,CACrCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,IACRjF,EAAiBvD,IACbD,CACT,GAAG,CAAC,GACJ,OAAOzB,OAAO4D,KAAK+P,GAAWC,MAAK,SAAUC,EAAGC,GAC9C,OAAOH,EAAUE,GAAKF,EAAUG,EAClC,GACF,CDH6DC,CAAqBpQ,EAAO,CACnFjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTgJ,eAAgBA,EAChBC,sBAAuBA,IACpBzR,EACP,GAAG,IACCsS,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzB4S,EAAY,IAAIC,IAChBC,GAAqB,EACrBC,EAAwBb,EAAW,GAE9Bc,EAAI,EAAGA,EAAId,EAAWG,OAAQW,IAAK,CAC1C,IAAI3S,EAAY6R,EAAWc,GAEvBC,EAAiBrP,EAAiBvD,GAElC6S,EAAmBjJ,EAAa5J,KAAeT,EAC/CuT,EAAa,CAAC,EAAK5T,GAAQuH,QAAQmM,IAAmB,EACtDrK,EAAMuK,EAAa,QAAU,SAC7B1F,EAAW8B,GAAejN,EAAO,CACnCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdI,YAAaA,EACbrH,QAASA,IAEPuK,EAAoBD,EAAaD,EAAmB1T,EAAQC,EAAOyT,EAAmB3T,EAAS,EAE/FoT,EAAc/J,GAAOyB,EAAWzB,KAClCwK,EAAoBvG,GAAqBuG,IAG3C,IAAIC,EAAmBxG,GAAqBuG,GACxCE,EAAS,GAUb,GARIhC,GACFgC,EAAOC,KAAK9F,EAASwF,IAAmB,GAGtCxB,GACF6B,EAAOC,KAAK9F,EAAS2F,IAAsB,EAAG3F,EAAS4F,IAAqB,GAG1EC,EAAOE,OAAM,SAAUC,GACzB,OAAOA,CACT,IAAI,CACFV,EAAwB1S,EACxByS,GAAqB,EACrB,KACF,CAEAF,EAAUc,IAAIrT,EAAWiT,EAC3B,CAEA,GAAIR,EAqBF,IAnBA,IAEIa,EAAQ,SAAeC,GACzB,IAAIC,EAAmB3B,EAAW4B,MAAK,SAAUzT,GAC/C,IAAIiT,EAASV,EAAU9T,IAAIuB,GAE3B,GAAIiT,EACF,OAAOA,EAAOS,MAAM,EAAGH,GAAIJ,OAAM,SAAUC,GACzC,OAAOA,CACT,GAEJ,IAEA,GAAII,EAEF,OADAd,EAAwBc,EACjB,OAEX,EAESD,EAnBY/B,EAAiB,EAAI,EAmBZ+B,EAAK,GAGpB,UAFFD,EAAMC,GADmBA,KAOpCtR,EAAMjC,YAAc0S,IACtBzQ,EAAMmG,cAAcxG,GAAMmP,OAAQ,EAClC9O,EAAMjC,UAAY0S,EAClBzQ,EAAM0R,OAAQ,EA5GhB,CA8GF,EAQEhK,iBAAkB,CAAC,UACnBgC,KAAM,CACJoF,OAAO,IE7IX,SAAS6C,GAAexG,EAAUY,EAAM6F,GAQtC,YAPyB,IAArBA,IACFA,EAAmB,CACjBrO,EAAG,EACHE,EAAG,IAIA,CACLzC,IAAKmK,EAASnK,IAAM+K,EAAK3I,OAASwO,EAAiBnO,EACnDvG,MAAOiO,EAASjO,MAAQ6O,EAAK7I,MAAQ0O,EAAiBrO,EACtDtG,OAAQkO,EAASlO,OAAS8O,EAAK3I,OAASwO,EAAiBnO,EACzDtG,KAAMgO,EAAShO,KAAO4O,EAAK7I,MAAQ0O,EAAiBrO,EAExD,CAEA,SAASsO,GAAsB1G,GAC7B,MAAO,CAAC,EAAKjO,EAAOD,EAAQE,GAAM2U,MAAK,SAAUC,GAC/C,OAAO5G,EAAS4G,IAAS,CAC3B,GACF,CA+BA,UACEpS,KAAM,OACNC,SAAS,EACTC,MAAO,OACP6H,iBAAkB,CAAC,mBACnB5H,GAlCF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZ0Q,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBkU,EAAmB5R,EAAMmG,cAAc6L,gBACvCC,EAAoBhF,GAAejN,EAAO,CAC5C0N,eAAgB,cAEdwE,EAAoBjF,GAAejN,EAAO,CAC5C4N,aAAa,IAEXuE,EAA2BR,GAAeM,EAAmB5B,GAC7D+B,EAAsBT,GAAeO,EAAmBnK,EAAY6J,GACpES,EAAoBR,GAAsBM,GAC1CG,EAAmBT,GAAsBO,GAC7CpS,EAAMmG,cAAcxG,GAAQ,CAC1BwS,yBAA0BA,EAC1BC,oBAAqBA,EACrBC,kBAAmBA,EACnBC,iBAAkBA,GAEpBtS,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,+BAAgC2U,EAChC,sBAAuBC,GAE3B,GCJA,IACE3S,KAAM,SACNC,SAAS,EACTC,MAAO,OACPwB,SAAU,CAAC,iBACXvB,GA5BF,SAAgBa,GACd,IAAIX,EAAQW,EAAMX,MACdc,EAAUH,EAAMG,QAChBnB,EAAOgB,EAAMhB,KACb4S,EAAkBzR,EAAQuG,OAC1BA,OAA6B,IAApBkL,EAA6B,CAAC,EAAG,GAAKA,EAC/C7I,EAAO,UAAkB,SAAU5L,EAAKC,GAE1C,OADAD,EAAIC,GA5BD,SAAiCA,EAAWyI,EAAOa,GACxD,IAAIjB,EAAgB9E,EAAiBvD,GACjCyU,EAAiB,CAACrV,EAAM,GAAKqH,QAAQ4B,IAAkB,GAAK,EAAI,EAEhErG,EAAyB,mBAAXsH,EAAwBA,EAAOhL,OAAOkE,OAAO,CAAC,EAAGiG,EAAO,CACxEzI,UAAWA,KACPsJ,EACFoL,EAAW1S,EAAK,GAChB2S,EAAW3S,EAAK,GAIpB,OAFA0S,EAAWA,GAAY,EACvBC,GAAYA,GAAY,GAAKF,EACtB,CAACrV,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAAI,CACjD7C,EAAGmP,EACHjP,EAAGgP,GACD,CACFlP,EAAGkP,EACHhP,EAAGiP,EAEP,CASqBC,CAAwB5U,EAAWiC,EAAMwG,MAAOa,GAC1DvJ,CACT,GAAG,CAAC,GACA8U,EAAwBlJ,EAAK1J,EAAMjC,WACnCwF,EAAIqP,EAAsBrP,EAC1BE,EAAImP,EAAsBnP,EAEW,MAArCzD,EAAMmG,cAAcD,gBACtBlG,EAAMmG,cAAcD,cAAc3C,GAAKA,EACvCvD,EAAMmG,cAAcD,cAAczC,GAAKA,GAGzCzD,EAAMmG,cAAcxG,GAAQ+J,CAC9B,GC1BA,IACE/J,KAAM,gBACNC,SAAS,EACTC,MAAO,OACPC,GApBF,SAAuBC,GACrB,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KAKhBK,EAAMmG,cAAcxG,GAAQkN,GAAe,CACzClP,UAAWqC,EAAMwG,MAAM7I,UACvBiB,QAASoB,EAAMwG,MAAM9I,OACrBqD,SAAU,WACVhD,UAAWiC,EAAMjC,WAErB,EAQE2L,KAAM,CAAC,GCgHT,IACE/J,KAAM,kBACNC,SAAS,EACTC,MAAO,OACPC,GA/HF,SAAyBC,GACvB,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KACZoP,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAsCA,EACrD3B,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtBrH,EAAUzF,EAAQyF,QAClBsM,EAAkB/R,EAAQgS,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAwBjS,EAAQkS,aAChCA,OAAyC,IAA1BD,EAAmC,EAAIA,EACtD5H,EAAW8B,GAAejN,EAAO,CACnCsN,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTqH,YAAaA,IAEXxH,EAAgB9E,EAAiBtB,EAAMjC,WACvCiK,EAAYL,EAAa3H,EAAMjC,WAC/BkV,GAAmBjL,EACnBgF,EAAWtH,EAAyBU,GACpC8I,ECrCY,MDqCSlC,ECrCH,IAAM,IDsCxB9G,EAAgBlG,EAAMmG,cAAcD,cACpCmK,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBwV,EAA4C,mBAAjBF,EAA8BA,EAAa3W,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CACvGzI,UAAWiC,EAAMjC,aACbiV,EACFG,EAA2D,iBAAtBD,EAAiC,CACxElG,SAAUkG,EACVhE,QAASgE,GACP7W,OAAOkE,OAAO,CAChByM,SAAU,EACVkC,QAAS,GACRgE,GACCE,EAAsBpT,EAAMmG,cAAckB,OAASrH,EAAMmG,cAAckB,OAAOrH,EAAMjC,WAAa,KACjG2L,EAAO,CACTnG,EAAG,EACHE,EAAG,GAGL,GAAKyC,EAAL,CAIA,GAAI8I,EAAe,CACjB,IAAIqE,EAEAC,EAAwB,MAAbtG,EAAmB,EAAM7P,EACpCoW,EAAuB,MAAbvG,EAAmB/P,EAASC,EACtCoJ,EAAmB,MAAb0G,EAAmB,SAAW,QACpC3F,EAASnB,EAAc8G,GACvBtL,EAAM2F,EAAS8D,EAASmI,GACxB7R,EAAM4F,EAAS8D,EAASoI,GACxBC,EAAWV,GAAU/K,EAAWzB,GAAO,EAAI,EAC3CmN,EAASzL,IAAc1K,EAAQ+S,EAAc/J,GAAOyB,EAAWzB,GAC/DoN,EAAS1L,IAAc1K,GAASyK,EAAWzB,IAAQ+J,EAAc/J,GAGjEL,EAAejG,EAAME,SAASgB,MAC9BwF,EAAYoM,GAAU7M,EAAetC,EAAcsC,GAAgB,CACrE/C,MAAO,EACPE,OAAQ,GAENuQ,GAAqB3T,EAAMmG,cAAc,oBAAsBnG,EAAMmG,cAAc,oBAAoBI,QxBhFtG,CACLvF,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GwB6EFyW,GAAkBD,GAAmBL,GACrCO,GAAkBF,GAAmBJ,GAMrCO,GAAWnO,EAAO,EAAG0K,EAAc/J,GAAMI,EAAUJ,IACnDyN,GAAYd,EAAkB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWF,GAAkBT,EAA4BnG,SAAWyG,EAASK,GAAWF,GAAkBT,EAA4BnG,SACxMgH,GAAYf,GAAmB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWD,GAAkBV,EAA4BnG,SAAW0G,EAASI,GAAWD,GAAkBV,EAA4BnG,SACzMjG,GAAoB/G,EAAME,SAASgB,OAAS8D,EAAgBhF,EAAME,SAASgB,OAC3E+S,GAAelN,GAAiC,MAAbiG,EAAmBjG,GAAkBsF,WAAa,EAAItF,GAAkBuF,YAAc,EAAI,EAC7H4H,GAAwH,OAAjGb,EAA+C,MAAvBD,OAA8B,EAASA,EAAoBpG,IAAqBqG,EAAwB,EAEvJc,GAAY9M,EAAS2M,GAAYE,GACjCE,GAAkBzO,EAAOmN,EAAS,EAAQpR,EAF9B2F,EAAS0M,GAAYG,GAAsBD,IAEKvS,EAAK2F,EAAQyL,EAAS,EAAQrR,EAAK0S,IAAa1S,GAChHyE,EAAc8G,GAAYoH,GAC1B1K,EAAKsD,GAAYoH,GAAkB/M,CACrC,CAEA,GAAI8H,EAAc,CAChB,IAAIkF,GAEAC,GAAyB,MAAbtH,EAAmB,EAAM7P,EAErCoX,GAAwB,MAAbvH,EAAmB/P,EAASC,EAEvCsX,GAAUtO,EAAcgJ,GAExBuF,GAAmB,MAAZvF,EAAkB,SAAW,QAEpCwF,GAAOF,GAAUrJ,EAASmJ,IAE1BK,GAAOH,GAAUrJ,EAASoJ,IAE1BK,IAAuD,IAAxC,CAAC,EAAKzX,GAAMqH,QAAQ4B,GAEnCyO,GAAyH,OAAjGR,GAAgD,MAAvBjB,OAA8B,EAASA,EAAoBlE,IAAoBmF,GAAyB,EAEzJS,GAAaF,GAAeF,GAAOF,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAEzI6F,GAAaH,GAAeJ,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAAUyF,GAE5IK,GAAmBlC,GAAU8B,G1BzH9B,SAAwBlT,EAAK1E,EAAOyE,GACzC,IAAIwT,EAAItP,EAAOjE,EAAK1E,EAAOyE,GAC3B,OAAOwT,EAAIxT,EAAMA,EAAMwT,CACzB,C0BsHoDC,CAAeJ,GAAYN,GAASO,IAAcpP,EAAOmN,EAASgC,GAAaJ,GAAMF,GAAS1B,EAASiC,GAAaJ,IAEpKzO,EAAcgJ,GAAW8F,GACzBtL,EAAKwF,GAAW8F,GAAmBR,EACrC,CAEAxU,EAAMmG,cAAcxG,GAAQ+J,CAvE5B,CAwEF,EAQEhC,iBAAkB,CAAC,WE1HN,SAASyN,GAAiBC,EAAyBrQ,EAAcsD,QAC9D,IAAZA,IACFA,GAAU,GAGZ,ICnBoCrJ,ECJOJ,EFuBvCyW,EAA0B9V,EAAcwF,GACxCuQ,EAAuB/V,EAAcwF,IAf3C,SAAyBnG,GACvB,IAAImN,EAAOnN,EAAQ+D,wBACfI,EAASpB,EAAMoK,EAAK7I,OAAStE,EAAQqE,aAAe,EACpDD,EAASrB,EAAMoK,EAAK3I,QAAUxE,EAAQuE,cAAgB,EAC1D,OAAkB,IAAXJ,GAA2B,IAAXC,CACzB,CAU4DuS,CAAgBxQ,GACtEJ,EAAkBF,EAAmBM,GACrCgH,EAAOpJ,EAAsByS,EAAyBE,EAAsBjN,GAC5EyB,EAAS,CACXc,WAAY,EACZE,UAAW,GAET7C,EAAU,CACZ1E,EAAG,EACHE,EAAG,GAkBL,OAfI4R,IAA4BA,IAA4BhN,MACxB,SAA9B1J,EAAYoG,IAChBkG,GAAetG,MACbmF,GCnCgC9K,EDmCT+F,KClCdhG,EAAUC,IAAUO,EAAcP,GCJxC,CACL4L,YAFyChM,EDQbI,GCNR4L,WACpBE,UAAWlM,EAAQkM,WDGZH,GAAgB3L,IDoCnBO,EAAcwF,KAChBkD,EAAUtF,EAAsBoC,GAAc,IACtCxB,GAAKwB,EAAauH,WAC1BrE,EAAQxE,GAAKsB,EAAasH,WACjB1H,IACTsD,EAAQ1E,EAAIyH,GAAoBrG,KAI7B,CACLpB,EAAGwI,EAAK5O,KAAO2M,EAAOc,WAAa3C,EAAQ1E,EAC3CE,EAAGsI,EAAK/K,IAAM8I,EAAOgB,UAAY7C,EAAQxE,EACzCP,MAAO6I,EAAK7I,MACZE,OAAQ2I,EAAK3I,OAEjB,CGvDA,SAASoS,GAAMC,GACb,IAAItT,EAAM,IAAIoO,IACVmF,EAAU,IAAIC,IACdC,EAAS,GAKb,SAAS3F,EAAK4F,GACZH,EAAQI,IAAID,EAASlW,MACN,GAAG3B,OAAO6X,EAASxU,UAAY,GAAIwU,EAASnO,kBAAoB,IACtEvH,SAAQ,SAAU4V,GACzB,IAAKL,EAAQM,IAAID,GAAM,CACrB,IAAIE,EAAc9T,EAAI3F,IAAIuZ,GAEtBE,GACFhG,EAAKgG,EAET,CACF,IACAL,EAAO3E,KAAK4E,EACd,CAQA,OAzBAJ,EAAUtV,SAAQ,SAAU0V,GAC1B1T,EAAIiP,IAAIyE,EAASlW,KAAMkW,EACzB,IAiBAJ,EAAUtV,SAAQ,SAAU0V,GACrBH,EAAQM,IAAIH,EAASlW,OAExBsQ,EAAK4F,EAET,IACOD,CACT,CClBA,IAEIM,GAAkB,CACpBnY,UAAW,SACX0X,UAAW,GACX1U,SAAU,YAGZ,SAASoV,KACP,IAAK,IAAI1B,EAAO2B,UAAUrG,OAAQsG,EAAO,IAAIpU,MAAMwS,GAAO6B,EAAO,EAAGA,EAAO7B,EAAM6B,IAC/ED,EAAKC,GAAQF,UAAUE,GAGzB,OAAQD,EAAKvE,MAAK,SAAUlT,GAC1B,QAASA,GAAoD,mBAAlCA,EAAQ+D,sBACrC,GACF,CAEO,SAAS4T,GAAgBC,QACL,IAArBA,IACFA,EAAmB,CAAC,GAGtB,IAAIC,EAAoBD,EACpBE,EAAwBD,EAAkBE,iBAC1CA,OAA6C,IAA1BD,EAAmC,GAAKA,EAC3DE,EAAyBH,EAAkBI,eAC3CA,OAA4C,IAA3BD,EAAoCV,GAAkBU,EAC3E,OAAO,SAAsBjZ,EAAWD,EAAQoD,QAC9B,IAAZA,IACFA,EAAU+V,GAGZ,IC/C6B/W,EAC3BgX,ED8CE9W,EAAQ,CACVjC,UAAW,SACXgZ,iBAAkB,GAClBjW,QAASzE,OAAOkE,OAAO,CAAC,EAAG2V,GAAiBW,GAC5C1Q,cAAe,CAAC,EAChBjG,SAAU,CACRvC,UAAWA,EACXD,OAAQA,GAEV4C,WAAY,CAAC,EACbD,OAAQ,CAAC,GAEP2W,EAAmB,GACnBC,GAAc,EACdrN,EAAW,CACb5J,MAAOA,EACPkX,WAAY,SAAoBC,GAC9B,IAAIrW,EAAsC,mBAArBqW,EAAkCA,EAAiBnX,EAAMc,SAAWqW,EACzFC,IACApX,EAAMc,QAAUzE,OAAOkE,OAAO,CAAC,EAAGsW,EAAgB7W,EAAMc,QAASA,GACjEd,EAAMiK,cAAgB,CACpBtM,UAAW0B,EAAU1B,GAAa6N,GAAkB7N,GAAaA,EAAU4Q,eAAiB/C,GAAkB7N,EAAU4Q,gBAAkB,GAC1I7Q,OAAQ8N,GAAkB9N,IAI5B,IEzE4B+X,EAC9B4B,EFwEMN,EDvCG,SAAwBtB,GAErC,IAAIsB,EAAmBvB,GAAMC,GAE7B,OAAO/W,EAAeb,QAAO,SAAUC,EAAK+B,GAC1C,OAAO/B,EAAIE,OAAO+Y,EAAiBvR,QAAO,SAAUqQ,GAClD,OAAOA,EAAShW,QAAUA,CAC5B,IACF,GAAG,GACL,CC8B+ByX,EEzEK7B,EFyEsB,GAAGzX,OAAO2Y,EAAkB3W,EAAMc,QAAQ2U,WExE9F4B,EAAS5B,EAAU5X,QAAO,SAAUwZ,EAAQE,GAC9C,IAAIC,EAAWH,EAAOE,EAAQ5X,MAK9B,OAJA0X,EAAOE,EAAQ5X,MAAQ6X,EAAWnb,OAAOkE,OAAO,CAAC,EAAGiX,EAAUD,EAAS,CACrEzW,QAASzE,OAAOkE,OAAO,CAAC,EAAGiX,EAAS1W,QAASyW,EAAQzW,SACrD4I,KAAMrN,OAAOkE,OAAO,CAAC,EAAGiX,EAAS9N,KAAM6N,EAAQ7N,QAC5C6N,EACEF,CACT,GAAG,CAAC,GAEGhb,OAAO4D,KAAKoX,GAAQlV,KAAI,SAAUhG,GACvC,OAAOkb,EAAOlb,EAChB,MFsGM,OAvCA6D,EAAM+W,iBAAmBA,EAAiBvR,QAAO,SAAUiS,GACzD,OAAOA,EAAE7X,OACX,IAoJFI,EAAM+W,iBAAiB5W,SAAQ,SAAUqI,GACvC,IAAI7I,EAAO6I,EAAM7I,KACb+X,EAAgBlP,EAAM1H,QACtBA,OAA4B,IAAlB4W,EAA2B,CAAC,EAAIA,EAC1ChX,EAAS8H,EAAM9H,OAEnB,GAAsB,mBAAXA,EAAuB,CAChC,IAAIiX,EAAYjX,EAAO,CACrBV,MAAOA,EACPL,KAAMA,EACNiK,SAAUA,EACV9I,QAASA,IAKXkW,EAAiB/F,KAAK0G,GAFT,WAAmB,EAGlC,CACF,IAjIS/N,EAASQ,QAClB,EAMAwN,YAAa,WACX,IAAIX,EAAJ,CAIA,IAAIY,EAAkB7X,EAAME,SACxBvC,EAAYka,EAAgBla,UAC5BD,EAASma,EAAgBna,OAG7B,GAAKyY,GAAiBxY,EAAWD,GAAjC,CASAsC,EAAMwG,MAAQ,CACZ7I,UAAWwX,GAAiBxX,EAAWqH,EAAgBtH,GAAoC,UAA3BsC,EAAMc,QAAQC,UAC9ErD,OAAQiG,EAAcjG,IAOxBsC,EAAM0R,OAAQ,EACd1R,EAAMjC,UAAYiC,EAAMc,QAAQ/C,UAKhCiC,EAAM+W,iBAAiB5W,SAAQ,SAAU0V,GACvC,OAAO7V,EAAMmG,cAAc0P,EAASlW,MAAQtD,OAAOkE,OAAO,CAAC,EAAGsV,EAASnM,KACzE,IAGA,IAFA,IAESoO,EAAQ,EAAGA,EAAQ9X,EAAM+W,iBAAiBhH,OAAQ+H,IAUzD,IAAoB,IAAhB9X,EAAM0R,MAAV,CAMA,IAAIqG,EAAwB/X,EAAM+W,iBAAiBe,GAC/ChY,EAAKiY,EAAsBjY,GAC3BkY,EAAyBD,EAAsBjX,QAC/CoM,OAAsC,IAA3B8K,EAAoC,CAAC,EAAIA,EACpDrY,EAAOoY,EAAsBpY,KAEf,mBAAPG,IACTE,EAAQF,EAAG,CACTE,MAAOA,EACPc,QAASoM,EACTvN,KAAMA,EACNiK,SAAUA,KACN5J,EAdR,MAHEA,EAAM0R,OAAQ,EACdoG,GAAS,CAnCb,CAbA,CAmEF,EAGA1N,QClM2BtK,EDkMV,WACf,OAAO,IAAImY,SAAQ,SAAUC,GAC3BtO,EAASgO,cACTM,EAAQlY,EACV,GACF,ECrMG,WAUL,OATK8W,IACHA,EAAU,IAAImB,SAAQ,SAAUC,GAC9BD,QAAQC,UAAUC,MAAK,WACrBrB,OAAUsB,EACVF,EAAQpY,IACV,GACF,KAGKgX,CACT,GD2LIuB,QAAS,WACPjB,IACAH,GAAc,CAChB,GAGF,IAAKd,GAAiBxY,EAAWD,GAK/B,OAAOkM,EAmCT,SAASwN,IACPJ,EAAiB7W,SAAQ,SAAUL,GACjC,OAAOA,GACT,IACAkX,EAAmB,EACrB,CAEA,OAvCApN,EAASsN,WAAWpW,GAASqX,MAAK,SAAUnY,IACrCiX,GAAenW,EAAQwX,eAC1BxX,EAAQwX,cAActY,EAE1B,IAmCO4J,CACT,CACF,CACO,IAAI2O,GAA4BhC,KGrPnC,GAA4BA,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,EAAa,GAAQ,GAAM,GAAiB,EAAO,MCJrH,GAA4BjC,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,KCQtE,MAEMC,GAAiB,gBAsBjBC,GAAc9Z,IAClB,IAAI+Z,EAAW/Z,EAAQga,aAAa,kBAEpC,IAAKD,GAAyB,MAAbA,EAAkB,CACjC,IAAIE,EAAgBja,EAAQga,aAAa,QAKzC,IAAKC,IAAkBA,EAAcC,SAAS,OAASD,EAAcE,WAAW,KAC9E,OAAO,KAILF,EAAcC,SAAS,OAASD,EAAcE,WAAW,OAC3DF,EAAgB,IAAIA,EAActX,MAAM,KAAK,MAG/CoX,EAAWE,GAAmC,MAAlBA,EAAwBA,EAAcG,OAAS,IAC7E,CAEA,OAAOL,CAAQ,EAGXM,GAAyBra,IAC7B,MAAM+Z,EAAWD,GAAY9Z,GAE7B,OAAI+Z,GACKjU,SAAS+C,cAAckR,GAAYA,EAGrC,IAAI,EAGPO,GAAyBta,IAC7B,MAAM+Z,EAAWD,GAAY9Z,GAC7B,OAAO+Z,EAAWjU,SAAS+C,cAAckR,GAAY,IAAI,EA0BrDQ,GAAuBva,IAC3BA,EAAQwa,cAAc,IAAIC,MAAMZ,IAAgB,EAG5C,GAAYa,MACXA,GAA4B,iBAAXA,UAIO,IAAlBA,EAAOC,SAChBD,EAASA,EAAO,SAGgB,IAApBA,EAAOE,UAGjBC,GAAaH,GAEb,GAAUA,GACLA,EAAOC,OAASD,EAAO,GAAKA,EAGf,iBAAXA,GAAuBA,EAAOvJ,OAAS,EACzCrL,SAAS+C,cAAc6R,GAGzB,KAGHI,GAAY9a,IAChB,IAAK,GAAUA,IAAgD,IAApCA,EAAQ+a,iBAAiB5J,OAClD,OAAO,EAGT,MAAM6J,EAAgF,YAA7DtV,iBAAiB1F,GAASib,iBAAiB,cAE9DC,EAAgBlb,EAAQmb,QAAQ,uBAEtC,IAAKD,EACH,OAAOF,EAGT,GAAIE,IAAkBlb,EAAS,CAC7B,MAAMob,EAAUpb,EAAQmb,QAAQ,WAEhC,GAAIC,GAAWA,EAAQ5V,aAAe0V,EACpC,OAAO,EAGT,GAAgB,OAAZE,EACF,OAAO,CAEX,CAEA,OAAOJ,CAAgB,EAGnBK,GAAarb,IACZA,GAAWA,EAAQ4a,WAAaU,KAAKC,gBAItCvb,EAAQwb,UAAUvW,SAAS,mBAIC,IAArBjF,EAAQyb,SACVzb,EAAQyb,SAGVzb,EAAQ0b,aAAa,aAAoD,UAArC1b,EAAQga,aAAa,aAG5D2B,GAAiB3b,IACrB,IAAK8F,SAASC,gBAAgB6V,aAC5B,OAAO,KAIT,GAAmC,mBAAxB5b,EAAQqF,YAA4B,CAC7C,MAAMwW,EAAO7b,EAAQqF,cACrB,OAAOwW,aAAgB/a,WAAa+a,EAAO,IAC7C,CAEA,OAAI7b,aAAmBc,WACdd,EAIJA,EAAQwF,WAINmW,GAAe3b,EAAQwF,YAHrB,IAGgC,EAGrCsW,GAAO,OAWPC,GAAS/b,IACbA,EAAQuE,YAAY,EAGhByX,GAAY,IACZ3b,OAAO4b,SAAWnW,SAAS6G,KAAK+O,aAAa,qBACxCrb,OAAO4b,OAGT,KAGHC,GAA4B,GAmB5BC,GAAQ,IAAuC,QAAjCrW,SAASC,gBAAgBqW,IAEvCC,GAAqBC,IAnBAC,QAoBN,KACjB,MAAMC,EAAIR,KAGV,GAAIQ,EAAG,CACL,MAAMzb,EAAOub,EAAOG,KACdC,EAAqBF,EAAEtb,GAAGH,GAChCyb,EAAEtb,GAAGH,GAAQub,EAAOK,gBACpBH,EAAEtb,GAAGH,GAAM6b,YAAcN,EAEzBE,EAAEtb,GAAGH,GAAM8b,WAAa,KACtBL,EAAEtb,GAAGH,GAAQ2b,EACNJ,EAAOK,gBAElB,GAjC0B,YAAxB7W,SAASgX,YAENZ,GAA0B/K,QAC7BrL,SAASyF,iBAAiB,oBAAoB,KAC5C,IAAK,MAAMgR,KAAYL,GACrBK,GACF,IAIJL,GAA0B7J,KAAKkK,IAE/BA,GAsBA,EAGEQ,GAAUR,IACU,mBAAbA,GACTA,GACF,EAGIS,GAAyB,CAACT,EAAUU,EAAmBC,GAAoB,KAC/E,IAAKA,EAEH,YADAH,GAAQR,GAIV,MACMY,EAnMiCnd,KACvC,IAAKA,EACH,OAAO,EAIT,IAAI,mBACFod,EAAkB,gBAClBC,GACEhd,OAAOqF,iBAAiB1F,GAC5B,MAAMsd,EAA0BC,OAAOC,WAAWJ,GAC5CK,EAAuBF,OAAOC,WAAWH,GAE/C,OAAKC,GAA4BG,GAKjCL,EAAqBA,EAAmBza,MAAM,KAAK,GACnD0a,EAAkBA,EAAgB1a,MAAM,KAAK,GAjFf,KAkFtB4a,OAAOC,WAAWJ,GAAsBG,OAAOC,WAAWH,KANzD,CAMoG,EA+KpFK,CAAiCT,GADlC,EAExB,IAAIU,GAAS,EAEb,MAAMC,EAAU,EACd5Q,aAEIA,IAAWiQ,IAIfU,GAAS,EACTV,EAAkBxR,oBAAoBoO,GAAgB+D,GACtDb,GAAQR,GAAS,EAGnBU,EAAkB1R,iBAAiBsO,GAAgB+D,GACnDC,YAAW,KACJF,GACHpD,GAAqB0C,EACvB,GACCE,EAAiB,EAahBW,GAAuB,CAACjR,EAAMkR,EAAeC,EAAeC,KAChE,MAAMC,EAAarR,EAAKsE,OACxB,IAAI+H,EAAQrM,EAAKjH,QAAQmY,GAGzB,OAAe,IAAX7E,GACM8E,GAAiBC,EAAiBpR,EAAKqR,EAAa,GAAKrR,EAAK,IAGxEqM,GAAS8E,EAAgB,GAAK,EAE1BC,IACF/E,GAASA,EAAQgF,GAAcA,GAG1BrR,EAAKjK,KAAKC,IAAI,EAAGD,KAAKE,IAAIoW,EAAOgF,EAAa,KAAI,EAarDC,GAAiB,qBACjBC,GAAiB,OACjBC,GAAgB,SAChBC,GAAgB,CAAC,EAEvB,IAAIC,GAAW,EACf,MAAMC,GAAe,CACnBC,WAAY,YACZC,WAAY,YAERC,GAAe,IAAI5H,IAAI,CAAC,QAAS,WAAY,UAAW,YAAa,cAAe,aAAc,iBAAkB,YAAa,WAAY,YAAa,cAAe,YAAa,UAAW,WAAY,QAAS,oBAAqB,aAAc,YAAa,WAAY,cAAe,cAAe,cAAe,YAAa,eAAgB,gBAAiB,eAAgB,gBAAiB,aAAc,QAAS,OAAQ,SAAU,QAAS,SAAU,SAAU,UAAW,WAAY,OAAQ,SAAU,eAAgB,SAAU,OAAQ,mBAAoB,mBAAoB,QAAS,QAAS,WAK/lB,SAAS6H,GAAa5e,EAAS6e,GAC7B,OAAOA,GAAO,GAAGA,MAAQN,QAAgBve,EAAQue,UAAYA,IAC/D,CAEA,SAASO,GAAiB9e,GACxB,MAAM6e,EAAMD,GAAa5e,GAGzB,OAFAA,EAAQue,SAAWM,EACnBP,GAAcO,GAAOP,GAAcO,IAAQ,CAAC,EACrCP,GAAcO,EACvB,CA0CA,SAASE,GAAYC,EAAQC,EAAUC,EAAqB,MAC1D,OAAOzhB,OAAO0hB,OAAOH,GAAQpM,MAAKwM,GAASA,EAAMH,WAAaA,GAAYG,EAAMF,qBAAuBA,GACzG,CAEA,SAASG,GAAoBC,EAAmB1B,EAAS2B,GACvD,MAAMC,EAAiC,iBAAZ5B,EAErBqB,EAAWO,EAAcD,EAAqB3B,GAAW2B,EAC/D,IAAIE,EAAYC,GAAaJ,GAM7B,OAJKX,GAAavH,IAAIqI,KACpBA,EAAYH,GAGP,CAACE,EAAaP,EAAUQ,EACjC,CAEA,SAASE,GAAW3f,EAASsf,EAAmB1B,EAAS2B,EAAoBK,GAC3E,GAAiC,iBAAtBN,IAAmCtf,EAC5C,OAGF,IAAKwf,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GAGzF,GAAID,KAAqBd,GAAc,CACrC,MAAMqB,EAAe3e,GACZ,SAAUke,GACf,IAAKA,EAAMU,eAAiBV,EAAMU,gBAAkBV,EAAMW,iBAAmBX,EAAMW,eAAe9a,SAASma,EAAMU,eAC/G,OAAO5e,EAAGjD,KAAK+hB,KAAMZ,EAEzB,EAGFH,EAAWY,EAAaZ,EAC1B,CAEA,MAAMD,EAASF,GAAiB9e,GAC1BigB,EAAWjB,EAAOS,KAAeT,EAAOS,GAAa,CAAC,GACtDS,EAAmBnB,GAAYkB,EAAUhB,EAAUO,EAAc5B,EAAU,MAEjF,GAAIsC,EAEF,YADAA,EAAiBN,OAASM,EAAiBN,QAAUA,GAIvD,MAAMf,EAAMD,GAAaK,EAAUK,EAAkB1T,QAAQuS,GAAgB,KACvEjd,EAAKse,EAzEb,SAAoCxf,EAAS+Z,EAAU7Y,GACrD,OAAO,SAAS0c,EAAQwB,GACtB,MAAMe,EAAcngB,EAAQogB,iBAAiBrG,GAE7C,IAAK,IAAI,OACP/M,GACEoS,EAAOpS,GAAUA,IAAWgT,KAAMhT,EAASA,EAAOxH,WACpD,IAAK,MAAM6a,KAAcF,EACvB,GAAIE,IAAerT,EAYnB,OARAsT,GAAWlB,EAAO,CAChBW,eAAgB/S,IAGd4Q,EAAQgC,QACVW,GAAaC,IAAIxgB,EAASof,EAAMqB,KAAM1G,EAAU7Y,GAG3CA,EAAGwf,MAAM1T,EAAQ,CAACoS,GAG/B,CACF,CAiD2BuB,CAA2B3gB,EAAS4d,EAASqB,GAvFxE,SAA0Bjf,EAASkB,GACjC,OAAO,SAAS0c,EAAQwB,GAStB,OARAkB,GAAWlB,EAAO,CAChBW,eAAgB/f,IAGd4d,EAAQgC,QACVW,GAAaC,IAAIxgB,EAASof,EAAMqB,KAAMvf,GAGjCA,EAAGwf,MAAM1gB,EAAS,CAACof,GAC5B,CACF,CA2EoFwB,CAAiB5gB,EAASif,GAC5G/d,EAAGge,mBAAqBM,EAAc5B,EAAU,KAChD1c,EAAG+d,SAAWA,EACd/d,EAAG0e,OAASA,EACZ1e,EAAGqd,SAAWM,EACdoB,EAASpB,GAAO3d,EAChBlB,EAAQuL,iBAAiBkU,EAAWve,EAAIse,EAC1C,CAEA,SAASqB,GAAc7gB,EAASgf,EAAQS,EAAW7B,EAASsB,GAC1D,MAAMhe,EAAK6d,GAAYC,EAAOS,GAAY7B,EAASsB,GAE9Che,IAILlB,EAAQyL,oBAAoBgU,EAAWve,EAAI4f,QAAQ5B,WAC5CF,EAAOS,GAAWve,EAAGqd,UAC9B,CAEA,SAASwC,GAAyB/gB,EAASgf,EAAQS,EAAWuB,GAC5D,MAAMC,EAAoBjC,EAAOS,IAAc,CAAC,EAEhD,IAAK,MAAMyB,KAAczjB,OAAO4D,KAAK4f,GACnC,GAAIC,EAAWhH,SAAS8G,GAAY,CAClC,MAAM5B,EAAQ6B,EAAkBC,GAChCL,GAAc7gB,EAASgf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAClE,CAEJ,CAEA,SAASQ,GAAaN,GAGpB,OADAA,EAAQA,EAAMxT,QAAQwS,GAAgB,IAC/BI,GAAaY,IAAUA,CAChC,CAEA,MAAMmB,GAAe,CACnBY,GAAGnhB,EAASof,EAAOxB,EAAS2B,GAC1BI,GAAW3f,EAASof,EAAOxB,EAAS2B,GAAoB,EAC1D,EAEA6B,IAAIphB,EAASof,EAAOxB,EAAS2B,GAC3BI,GAAW3f,EAASof,EAAOxB,EAAS2B,GAAoB,EAC1D,EAEAiB,IAAIxgB,EAASsf,EAAmB1B,EAAS2B,GACvC,GAAiC,iBAAtBD,IAAmCtf,EAC5C,OAGF,MAAOwf,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GACrF8B,EAAc5B,IAAcH,EAC5BN,EAASF,GAAiB9e,GAC1BihB,EAAoBjC,EAAOS,IAAc,CAAC,EAC1C6B,EAAchC,EAAkBnF,WAAW,KAEjD,QAAwB,IAAb8E,EAAX,CAUA,GAAIqC,EACF,IAAK,MAAMC,KAAgB9jB,OAAO4D,KAAK2d,GACrC+B,GAAyB/gB,EAASgf,EAAQuC,EAAcjC,EAAkBzM,MAAM,IAIpF,IAAK,MAAM2O,KAAe/jB,OAAO4D,KAAK4f,GAAoB,CACxD,MAAMC,EAAaM,EAAY5V,QAAQyS,GAAe,IAEtD,IAAKgD,GAAe/B,EAAkBpF,SAASgH,GAAa,CAC1D,MAAM9B,EAAQ6B,EAAkBO,GAChCX,GAAc7gB,EAASgf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAClE,CACF,CAfA,KARA,CAEE,IAAKzhB,OAAO4D,KAAK4f,GAAmB9P,OAClC,OAGF0P,GAAc7gB,EAASgf,EAAQS,EAAWR,EAAUO,EAAc5B,EAAU,KAE9E,CAgBF,EAEA6D,QAAQzhB,EAASof,EAAO3H,GACtB,GAAqB,iBAAV2H,IAAuBpf,EAChC,OAAO,KAGT,MAAMwc,EAAIR,KAGV,IAAI0F,EAAc,KACdC,GAAU,EACVC,GAAiB,EACjBC,GAAmB,EAJHzC,IADFM,GAAaN,IAOZ5C,IACjBkF,EAAclF,EAAE/B,MAAM2E,EAAO3H,GAC7B+E,EAAExc,GAASyhB,QAAQC,GACnBC,GAAWD,EAAYI,uBACvBF,GAAkBF,EAAYK,gCAC9BF,EAAmBH,EAAYM,sBAGjC,IAAIC,EAAM,IAAIxH,MAAM2E,EAAO,CACzBuC,UACAO,YAAY,IAgBd,OAdAD,EAAM3B,GAAW2B,EAAKxK,GAElBoK,GACFI,EAAIE,iBAGFP,GACF5hB,EAAQwa,cAAcyH,GAGpBA,EAAIJ,kBAAoBH,GAC1BA,EAAYS,iBAGPF,CACT,GAIF,SAAS3B,GAAWziB,EAAKukB,GACvB,IAAK,MAAO7kB,EAAKa,KAAUX,OAAO4kB,QAAQD,GAAQ,CAAC,GACjD,IACEvkB,EAAIN,GAAOa,CACb,CAAE,MAAOkkB,GACP7kB,OAAOC,eAAeG,EAAKN,EAAK,CAC9BglB,cAAc,EAEd3kB,IAAG,IACMQ,GAIb,CAGF,OAAOP,CACT,CAYA,MAAM2kB,GAAa,IAAI7Q,IACjB8Q,GAAO,CACXjQ,IAAIxS,EAASzC,EAAKyN,GACXwX,GAAWpL,IAAIpX,IAClBwiB,GAAWhQ,IAAIxS,EAAS,IAAI2R,KAG9B,MAAM+Q,EAAcF,GAAW5kB,IAAIoC,GAG9B0iB,EAAYtL,IAAI7Z,IAA6B,IAArBmlB,EAAYC,KAMzCD,EAAYlQ,IAAIjV,EAAKyN,GAJnB4X,QAAQC,MAAM,+EAA+Exf,MAAMyf,KAAKJ,EAAYrhB,QAAQ,MAKhI,EAEAzD,IAAG,CAACoC,EAASzC,IACPilB,GAAWpL,IAAIpX,IACVwiB,GAAW5kB,IAAIoC,GAASpC,IAAIL,IAG9B,KAGTwlB,OAAO/iB,EAASzC,GACd,IAAKilB,GAAWpL,IAAIpX,GAClB,OAGF,MAAM0iB,EAAcF,GAAW5kB,IAAIoC,GACnC0iB,EAAYM,OAAOzlB,GAEM,IAArBmlB,EAAYC,MACdH,GAAWQ,OAAOhjB,EAEtB,GAUF,SAASijB,GAAc7kB,GACrB,GAAc,SAAVA,EACF,OAAO,EAGT,GAAc,UAAVA,EACF,OAAO,EAGT,GAAIA,IAAUmf,OAAOnf,GAAOkC,WAC1B,OAAOid,OAAOnf,GAGhB,GAAc,KAAVA,GAA0B,SAAVA,EAClB,OAAO,KAGT,GAAqB,iBAAVA,EACT,OAAOA,EAGT,IACE,OAAO8kB,KAAKC,MAAMC,mBAAmBhlB,GACvC,CAAE,MAAOkkB,GACP,OAAOlkB,CACT,CACF,CAEA,SAASilB,GAAiB9lB,GACxB,OAAOA,EAAIqO,QAAQ,UAAU0X,GAAO,IAAIA,EAAIpjB,iBAC9C,CAEA,MAAMqjB,GAAc,CAClBC,iBAAiBxjB,EAASzC,EAAKa,GAC7B4B,EAAQ6B,aAAa,WAAWwhB,GAAiB9lB,KAAQa,EAC3D,EAEAqlB,oBAAoBzjB,EAASzC,GAC3ByC,EAAQ4B,gBAAgB,WAAWyhB,GAAiB9lB,KACtD,EAEAmmB,kBAAkB1jB,GAChB,IAAKA,EACH,MAAO,CAAC,EAGV,MAAM0B,EAAa,CAAC,EACdiiB,EAASlmB,OAAO4D,KAAKrB,EAAQ4jB,SAAShd,QAAOrJ,GAAOA,EAAI4c,WAAW,QAAU5c,EAAI4c,WAAW,cAElG,IAAK,MAAM5c,KAAOomB,EAAQ,CACxB,IAAIE,EAAUtmB,EAAIqO,QAAQ,MAAO,IACjCiY,EAAUA,EAAQC,OAAO,GAAG5jB,cAAgB2jB,EAAQhR,MAAM,EAAGgR,EAAQ1S,QACrEzP,EAAWmiB,GAAWZ,GAAcjjB,EAAQ4jB,QAAQrmB,GACtD,CAEA,OAAOmE,CACT,EAEAqiB,iBAAgB,CAAC/jB,EAASzC,IACjB0lB,GAAcjjB,EAAQga,aAAa,WAAWqJ,GAAiB9lB,QAe1E,MAAMymB,GAEOC,qBACT,MAAO,CAAC,CACV,CAEWC,yBACT,MAAO,CAAC,CACV,CAEWzH,kBACT,MAAM,IAAI0H,MAAM,sEAClB,CAEAC,WAAWC,GAMT,OALAA,EAASrE,KAAKsE,gBAAgBD,GAC9BA,EAASrE,KAAKuE,kBAAkBF,GAEhCrE,KAAKwE,iBAAiBH,GAEfA,CACT,CAEAE,kBAAkBF,GAChB,OAAOA,CACT,CAEAC,gBAAgBD,EAAQrkB,GACtB,MAAMykB,EAAa,GAAUzkB,GAAWujB,GAAYQ,iBAAiB/jB,EAAS,UAAY,CAAC,EAE3F,MAAO,IAAKggB,KAAK0E,YAAYT,WACD,iBAAfQ,EAA0BA,EAAa,CAAC,KAC/C,GAAUzkB,GAAWujB,GAAYG,kBAAkB1jB,GAAW,CAAC,KAC7C,iBAAXqkB,EAAsBA,EAAS,CAAC,EAE/C,CAEAG,iBAAiBH,EAAQM,EAAc3E,KAAK0E,YAAYR,aACtD,IAAK,MAAM3hB,KAAY9E,OAAO4D,KAAKsjB,GAAc,CAC/C,MAAMC,EAAgBD,EAAYpiB,GAC5BnE,EAAQimB,EAAO9hB,GACfsiB,EAAY,GAAUzmB,GAAS,UA1uBrCsc,OADSA,EA2uB+Ctc,GAzuBnD,GAAGsc,IAGLjd,OAAOM,UAAUuC,SAASrC,KAAKyc,GAAQoK,MAAM,eAAe,GAAG5kB,cAwuBlE,IAAK,IAAI6kB,OAAOH,GAAe9gB,KAAK+gB,GAClC,MAAM,IAAIG,UAAU,GAAGhF,KAAK0E,YAAYjI,KAAKwI,0BAA0B1iB,qBAA4BsiB,yBAAiCD,MAExI,CAhvBWlK,KAivBb,EAmBF,MAAMwK,WAAsBlB,GAC1BU,YAAY1kB,EAASqkB,GACnBc,SACAnlB,EAAU6a,GAAW7a,MAMrBggB,KAAKoF,SAAWplB,EAChBggB,KAAKqF,QAAUrF,KAAKoE,WAAWC,GAC/B5B,GAAKjQ,IAAIwN,KAAKoF,SAAUpF,KAAK0E,YAAYY,SAAUtF,MACrD,CAGAuF,UACE9C,GAAKM,OAAO/C,KAAKoF,SAAUpF,KAAK0E,YAAYY,UAC5C/E,GAAaC,IAAIR,KAAKoF,SAAUpF,KAAK0E,YAAYc,WAEjD,IAAK,MAAMC,KAAgBhoB,OAAOioB,oBAAoB1F,MACpDA,KAAKyF,GAAgB,IAEzB,CAEAE,eAAepJ,EAAUvc,EAAS4lB,GAAa,GAC7C5I,GAAuBT,EAAUvc,EAAS4lB,EAC5C,CAEAxB,WAAWC,GAMT,OALAA,EAASrE,KAAKsE,gBAAgBD,EAAQrE,KAAKoF,UAC3Cf,EAASrE,KAAKuE,kBAAkBF,GAEhCrE,KAAKwE,iBAAiBH,GAEfA,CACT,CAGAwB,mBAAmB7lB,GACjB,OAAOyiB,GAAK7kB,IAAIid,GAAW7a,GAAUggB,KAAKsF,SAC5C,CAEAO,2BAA2B7lB,EAASqkB,EAAS,CAAC,GAC5C,OAAOrE,KAAK8F,YAAY9lB,IAAY,IAAIggB,KAAKhgB,EAA2B,iBAAXqkB,EAAsBA,EAAS,KAC9F,CAEW0B,qBACT,MApDY,OAqDd,CAEWT,sBACT,MAAO,MAAMtF,KAAKvD,MACpB,CAEW+I,uBACT,MAAO,IAAIxF,KAAKsF,UAClB,CAEAO,iBAAiB9kB,GACf,MAAO,GAAGA,IAAOif,KAAKwF,WACxB,EAWF,MAAMQ,GAAuB,CAACC,EAAWC,EAAS,UAChD,MAAMC,EAAa,gBAAgBF,EAAUT,YACvCzkB,EAAOklB,EAAUxJ,KACvB8D,GAAaY,GAAGrb,SAAUqgB,EAAY,qBAAqBplB,OAAU,SAAUqe,GAK7E,GAJI,CAAC,IAAK,QAAQlF,SAAS8F,KAAKoG,UAC9BhH,EAAM+C,iBAGJ9G,GAAW2E,MACb,OAGF,MAAMhT,EAASsN,GAAuB0F,OAASA,KAAK7E,QAAQ,IAAIpa,KAC/CklB,EAAUI,oBAAoBrZ,GAEtCkZ,IACX,GAAE,EAeEI,GAAc,YACdC,GAAc,QAAQD,KACtBE,GAAe,SAASF,KAO9B,MAAMG,WAAcvB,GAEPzI,kBACT,MAdW,OAeb,CAGAiK,QAGE,GAFmBnG,GAAakB,QAAQzB,KAAKoF,SAAUmB,IAExC1E,iBACb,OAGF7B,KAAKoF,SAAS5J,UAAUuH,OAnBF,QAqBtB,MAAM6C,EAAa5F,KAAKoF,SAAS5J,UAAUvW,SAtBrB,QAwBtB+a,KAAK2F,gBAAe,IAAM3F,KAAK2G,mBAAmB3G,KAAKoF,SAAUQ,EACnE,CAGAe,kBACE3G,KAAKoF,SAASrC,SAEdxC,GAAakB,QAAQzB,KAAKoF,SAAUoB,IACpCxG,KAAKuF,SACP,CAGAM,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAO2b,GAAMJ,oBAAoBrG,MAEvC,GAAsB,iBAAXqE,EAAX,CAIA,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,GAAQrE,KANb,CAOF,GACF,EAQFgG,GAAqBS,GAAO,SAK5BpK,GAAmBoK,IAYnB,MAKMI,GAAyB,4BAM/B,MAAMC,WAAe5B,GAERzI,kBACT,MAdW,QAeb,CAGAsK,SAEE/G,KAAKoF,SAASvjB,aAAa,eAAgBme,KAAKoF,SAAS5J,UAAUuL,OAhB3C,UAiB1B,CAGAlB,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOgc,GAAOT,oBAAoBrG,MAEzB,WAAXqE,GACFvZ,EAAKuZ,IAET,GACF,EAQF9D,GAAaY,GAAGrb,SAlCe,2BAkCmB+gB,IAAwBzH,IACxEA,EAAM+C,iBACN,MAAM6E,EAAS5H,EAAMpS,OAAOmO,QAAQ0L,IACvBC,GAAOT,oBAAoBW,GACnCD,QAAQ,IAMf1K,GAAmByK,IAYnB,MAAMG,GAAiB,CACrBrU,KAAI,CAACmH,EAAU/Z,EAAU8F,SAASC,kBACzB,GAAG3G,UAAUsB,QAAQ3C,UAAUqiB,iBAAiBniB,KAAK+B,EAAS+Z,IAGvEmN,QAAO,CAACnN,EAAU/Z,EAAU8F,SAASC,kBAC5BrF,QAAQ3C,UAAU8K,cAAc5K,KAAK+B,EAAS+Z,GAGvDoN,SAAQ,CAACnnB,EAAS+Z,IACT,GAAG3a,UAAUY,EAAQmnB,UAAUvgB,QAAOzB,GAASA,EAAMiiB,QAAQrN,KAGtEsN,QAAQrnB,EAAS+Z,GACf,MAAMsN,EAAU,GAChB,IAAIC,EAAWtnB,EAAQwF,WAAW2V,QAAQpB,GAE1C,KAAOuN,GACLD,EAAQhV,KAAKiV,GACbA,EAAWA,EAAS9hB,WAAW2V,QAAQpB,GAGzC,OAAOsN,CACT,EAEAE,KAAKvnB,EAAS+Z,GACZ,IAAIyN,EAAWxnB,EAAQynB,uBAEvB,KAAOD,GAAU,CACf,GAAIA,EAASJ,QAAQrN,GACnB,MAAO,CAACyN,GAGVA,EAAWA,EAASC,sBACtB,CAEA,MAAO,EACT,EAGAniB,KAAKtF,EAAS+Z,GACZ,IAAIzU,EAAOtF,EAAQ0nB,mBAEnB,KAAOpiB,GAAM,CACX,GAAIA,EAAK8hB,QAAQrN,GACf,MAAO,CAACzU,GAGVA,EAAOA,EAAKoiB,kBACd,CAEA,MAAO,EACT,EAEAC,kBAAkB3nB,GAChB,MAAM4nB,EAAa,CAAC,IAAK,SAAU,QAAS,WAAY,SAAU,UAAW,aAAc,4BAA4BrkB,KAAIwW,GAAY,GAAGA,2BAAiCpW,KAAK,KAChL,OAAOqc,KAAKpN,KAAKgV,EAAY5nB,GAAS4G,QAAOihB,IAAOxM,GAAWwM,IAAO/M,GAAU+M,IAClF,GAeIC,GAAc,YACdC,GAAmB,aAAaD,KAChCE,GAAkB,YAAYF,KAC9BG,GAAiB,WAAWH,KAC5BI,GAAoB,cAAcJ,KAClCK,GAAkB,YAAYL,KAK9BM,GAAY,CAChBC,YAAa,KACbC,aAAc,KACdC,cAAe,MAEXC,GAAgB,CACpBH,YAAa,kBACbC,aAAc,kBACdC,cAAe,mBAMjB,MAAME,WAAczE,GAClBU,YAAY1kB,EAASqkB,GACnBc,QACAnF,KAAKoF,SAAWplB,EAEXA,GAAYyoB,GAAMC,gBAIvB1I,KAAKqF,QAAUrF,KAAKoE,WAAWC,GAC/BrE,KAAK2I,QAAU,EACf3I,KAAK4I,sBAAwB9H,QAAQzgB,OAAOwoB,cAE5C7I,KAAK8I,cACP,CAGW7E,qBACT,OAAOmE,EACT,CAEWlE,yBACT,OAAOsE,EACT,CAEW/L,kBACT,MAnDW,OAoDb,CAGA8I,UACEhF,GAAaC,IAAIR,KAAKoF,SAAU0C,GAClC,CAGAiB,OAAO3J,GACAY,KAAK4I,sBAKN5I,KAAKgJ,wBAAwB5J,KAC/BY,KAAK2I,QAAUvJ,EAAM6J,SALrBjJ,KAAK2I,QAAUvJ,EAAM8J,QAAQ,GAAGD,OAOpC,CAEAE,KAAK/J,GACCY,KAAKgJ,wBAAwB5J,KAC/BY,KAAK2I,QAAUvJ,EAAM6J,QAAUjJ,KAAK2I,SAGtC3I,KAAKoJ,eAELrM,GAAQiD,KAAKqF,QAAQgD,YACvB,CAEAgB,MAAMjK,GACJY,KAAK2I,QAAUvJ,EAAM8J,SAAW9J,EAAM8J,QAAQ/X,OAAS,EAAI,EAAIiO,EAAM8J,QAAQ,GAAGD,QAAUjJ,KAAK2I,OACjG,CAEAS,eACE,MAAME,EAAY1mB,KAAKoC,IAAIgb,KAAK2I,SAEhC,GAAIW,GA9EgB,GA+ElB,OAGF,MAAMvb,EAAYub,EAAYtJ,KAAK2I,QACnC3I,KAAK2I,QAAU,EAEV5a,GAILgP,GAAQhP,EAAY,EAAIiS,KAAKqF,QAAQkD,cAAgBvI,KAAKqF,QAAQiD,aACpE,CAEAQ,cACM9I,KAAK4I,uBACPrI,GAAaY,GAAGnB,KAAKoF,SAAU8C,IAAmB9I,GAASY,KAAK+I,OAAO3J,KACvEmB,GAAaY,GAAGnB,KAAKoF,SAAU+C,IAAiB/I,GAASY,KAAKmJ,KAAK/J,KAEnEY,KAAKoF,SAAS5J,UAAUtE,IAlGG,mBAoG3BqJ,GAAaY,GAAGnB,KAAKoF,SAAU2C,IAAkB3I,GAASY,KAAK+I,OAAO3J,KACtEmB,GAAaY,GAAGnB,KAAKoF,SAAU4C,IAAiB5I,GAASY,KAAKqJ,MAAMjK,KACpEmB,GAAaY,GAAGnB,KAAKoF,SAAU6C,IAAgB7I,GAASY,KAAKmJ,KAAK/J,KAEtE,CAEA4J,wBAAwB5J,GACtB,OAAOY,KAAK4I,wBA5GS,QA4GiBxJ,EAAMmK,aA7GrB,UA6GyDnK,EAAMmK,YACxF,CAGA1D,qBACE,MAAO,iBAAkB/f,SAASC,iBAAmB7C,UAAUsmB,eAAiB,CAClF,EAcF,MAEMC,GAAc,eACdC,GAAiB,YAKjBC,GAAa,OACbC,GAAa,OACbC,GAAiB,OACjBC,GAAkB,QAClBC,GAAc,QAAQN,KACtBO,GAAa,OAAOP,KACpBQ,GAAkB,UAAUR,KAC5BS,GAAqB,aAAaT,KAClCU,GAAqB,aAAaV,KAClCW,GAAmB,YAAYX,KAC/BY,GAAwB,OAAOZ,KAAcC,KAC7CY,GAAyB,QAAQb,KAAcC,KAC/Ca,GAAsB,WACtBC,GAAsB,SAMtBC,GAAkB,UAClBC,GAAgB,iBAChBC,GAAuBF,GAAkBC,GAKzCE,GAAmB,CACvB,UAAoBd,GACpB,WAAqBD,IAEjBgB,GAAY,CAChBC,SAAU,IACVC,UAAU,EACVC,MAAO,QACPC,MAAM,EACNC,OAAO,EACPC,MAAM,GAEFC,GAAgB,CACpBN,SAAU,mBAEVC,SAAU,UACVC,MAAO,mBACPC,KAAM,mBACNC,MAAO,UACPC,KAAM,WAMR,MAAME,WAAiBnG,GACrBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAKsL,UAAY,KACjBtL,KAAKuL,eAAiB,KACtBvL,KAAKwL,YAAa,EAClBxL,KAAKyL,aAAe,KACpBzL,KAAK0L,aAAe,KACpB1L,KAAK2L,mBAAqB1E,GAAeC,QApCjB,uBAoC8ClH,KAAKoF,UAE3EpF,KAAK4L,qBAED5L,KAAKqF,QAAQ4F,OAASV,IACxBvK,KAAK6L,OAET,CAGW5H,qBACT,OAAO4G,EACT,CAEW3G,yBACT,OAAOkH,EACT,CAEW3O,kBACT,MAtFW,UAuFb,CAGAnX,OACE0a,KAAK8L,OAAOnC,GACd,CAEAoC,mBAIOjmB,SAASkmB,QAAUlR,GAAUkF,KAAKoF,WACrCpF,KAAK1a,MAET,CAEAiiB,OACEvH,KAAK8L,OAAOlC,GACd,CAEAoB,QACMhL,KAAKwL,YACPjR,GAAqByF,KAAKoF,UAG5BpF,KAAKiM,gBACP,CAEAJ,QACE7L,KAAKiM,iBAELjM,KAAKkM,kBAELlM,KAAKsL,UAAYa,aAAY,IAAMnM,KAAK+L,mBAAmB/L,KAAKqF,QAAQyF,SAC1E,CAEAsB,oBACOpM,KAAKqF,QAAQ4F,OAIdjL,KAAKwL,WACPjL,GAAaa,IAAIpB,KAAKoF,SAAU4E,IAAY,IAAMhK,KAAK6L,UAIzD7L,KAAK6L,QACP,CAEAQ,GAAGnT,GACD,MAAMoT,EAAQtM,KAAKuM,YAEnB,GAAIrT,EAAQoT,EAAMnb,OAAS,GAAK+H,EAAQ,EACtC,OAGF,GAAI8G,KAAKwL,WAEP,YADAjL,GAAaa,IAAIpB,KAAKoF,SAAU4E,IAAY,IAAMhK,KAAKqM,GAAGnT,KAI5D,MAAMsT,EAAcxM,KAAKyM,cAAczM,KAAK0M,cAE5C,GAAIF,IAAgBtT,EAClB,OAGF,MAAMtC,EAAQsC,EAAQsT,EAAc7C,GAAaC,GAEjD5J,KAAK8L,OAAOlV,EAAO0V,EAAMpT,GAC3B,CAEAqM,UACMvF,KAAK0L,cACP1L,KAAK0L,aAAanG,UAGpBJ,MAAMI,SACR,CAGAhB,kBAAkBF,GAEhB,OADAA,EAAOsI,gBAAkBtI,EAAOyG,SACzBzG,CACT,CAEAuH,qBACM5L,KAAKqF,QAAQ0F,UACfxK,GAAaY,GAAGnB,KAAKoF,SAAU6E,IAAiB7K,GAASY,KAAK4M,SAASxN,KAG9C,UAAvBY,KAAKqF,QAAQ2F,QACfzK,GAAaY,GAAGnB,KAAKoF,SAAU8E,IAAoB,IAAMlK,KAAKgL,UAC9DzK,GAAaY,GAAGnB,KAAKoF,SAAU+E,IAAoB,IAAMnK,KAAKoM,uBAG5DpM,KAAKqF,QAAQ6F,OAASzC,GAAMC,eAC9B1I,KAAK6M,yBAET,CAEAA,0BACE,IAAK,MAAMC,KAAO7F,GAAerU,KA/JX,qBA+JmCoN,KAAKoF,UAC5D7E,GAAaY,GAAG2L,EAAK1C,IAAkBhL,GAASA,EAAM+C,mBAGxD,MAqBM4K,EAAc,CAClBzE,aAAc,IAAMtI,KAAK8L,OAAO9L,KAAKgN,kBAAkBnD,KACvDtB,cAAe,IAAMvI,KAAK8L,OAAO9L,KAAKgN,kBAAkBlD,KACxDzB,YAxBkB,KACS,UAAvBrI,KAAKqF,QAAQ2F,QAWjBhL,KAAKgL,QAEDhL,KAAKyL,cACPwB,aAAajN,KAAKyL,cAGpBzL,KAAKyL,aAAe5N,YAAW,IAAMmC,KAAKoM,qBA7MjB,IA6M+DpM,KAAKqF,QAAQyF,UAAS,GAQhH9K,KAAK0L,aAAe,IAAIjD,GAAMzI,KAAKoF,SAAU2H,EAC/C,CAEAH,SAASxN,GACP,GAAI,kBAAkBtb,KAAKsb,EAAMpS,OAAOoZ,SACtC,OAGF,MAAMrY,EAAY6c,GAAiBxL,EAAM7hB,KAErCwQ,IACFqR,EAAM+C,iBAENnC,KAAK8L,OAAO9L,KAAKgN,kBAAkBjf,IAEvC,CAEA0e,cAAczsB,GACZ,OAAOggB,KAAKuM,YAAY3mB,QAAQ5F,EAClC,CAEAktB,2BAA2BhU,GACzB,IAAK8G,KAAK2L,mBACR,OAGF,MAAMwB,EAAkBlG,GAAeC,QAAQuD,GAAiBzK,KAAK2L,oBACrEwB,EAAgB3R,UAAUuH,OAAOyH,IACjC2C,EAAgBvrB,gBAAgB,gBAChC,MAAMwrB,EAAqBnG,GAAeC,QAAQ,sBAAsBhO,MAAW8G,KAAK2L,oBAEpFyB,IACFA,EAAmB5R,UAAUtE,IAAIsT,IACjC4C,EAAmBvrB,aAAa,eAAgB,QAEpD,CAEAqqB,kBACE,MAAMlsB,EAAUggB,KAAKuL,gBAAkBvL,KAAK0M,aAE5C,IAAK1sB,EACH,OAGF,MAAMqtB,EAAkB9P,OAAO+P,SAASttB,EAAQga,aAAa,oBAAqB,IAClFgG,KAAKqF,QAAQyF,SAAWuC,GAAmBrN,KAAKqF,QAAQsH,eAC1D,CAEAb,OAAOlV,EAAO5W,EAAU,MACtB,GAAIggB,KAAKwL,WACP,OAGF,MAAMzN,EAAgBiC,KAAK0M,aAErBa,EAAS3W,IAAU+S,GACnB6D,EAAcxtB,GAAW8d,GAAqBkC,KAAKuM,YAAaxO,EAAewP,EAAQvN,KAAKqF,QAAQ8F,MAE1G,GAAIqC,IAAgBzP,EAClB,OAGF,MAAM0P,EAAmBzN,KAAKyM,cAAce,GAEtCE,EAAeC,GACZpN,GAAakB,QAAQzB,KAAKoF,SAAUuI,EAAW,CACpD7N,cAAe0N,EACfzf,UAAWiS,KAAK4N,kBAAkBhX,GAClCkM,KAAM9C,KAAKyM,cAAc1O,GACzBsO,GAAIoB,IAMR,GAFmBC,EAAa3D,IAEjBlI,iBACb,OAGF,IAAK9D,IAAkByP,EAGrB,OAGF,MAAMK,EAAY/M,QAAQd,KAAKsL,WAC/BtL,KAAKgL,QACLhL,KAAKwL,YAAa,EAElBxL,KAAKkN,2BAA2BO,GAEhCzN,KAAKuL,eAAiBiC,EACtB,MAAMM,EAAuBP,EA/RR,sBADF,oBAiSbQ,EAAiBR,EA/RH,qBACA,qBA+RpBC,EAAYhS,UAAUtE,IAAI6W,GAC1BhS,GAAOyR,GACPzP,EAAcvC,UAAUtE,IAAI4W,GAC5BN,EAAYhS,UAAUtE,IAAI4W,GAU1B9N,KAAK2F,gBARoB,KACvB6H,EAAYhS,UAAUuH,OAAO+K,EAAsBC,GACnDP,EAAYhS,UAAUtE,IAAIsT,IAC1BzM,EAAcvC,UAAUuH,OAAOyH,GAAqBuD,EAAgBD,GACpE9N,KAAKwL,YAAa,EAClBkC,EAAa1D,GAAW,GAGYjM,EAAeiC,KAAKgO,eAEtDH,GACF7N,KAAK6L,OAET,CAEAmC,cACE,OAAOhO,KAAKoF,SAAS5J,UAAUvW,SAxTV,QAyTvB,CAEAynB,aACE,OAAOzF,GAAeC,QAAQyD,GAAsB3K,KAAKoF,SAC3D,CAEAmH,YACE,OAAOtF,GAAerU,KAAK8X,GAAe1K,KAAKoF,SACjD,CAEA6G,iBACMjM,KAAKsL,YACP2C,cAAcjO,KAAKsL,WACnBtL,KAAKsL,UAAY,KAErB,CAEA0B,kBAAkBjf,GAChB,OAAIoO,KACKpO,IAAc8b,GAAiBD,GAAaD,GAG9C5b,IAAc8b,GAAiBF,GAAaC,EACrD,CAEAgE,kBAAkBhX,GAChB,OAAIuF,KACKvF,IAAUgT,GAAaC,GAAiBC,GAG1ClT,IAAUgT,GAAaE,GAAkBD,EAClD,CAGAhE,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOugB,GAAShF,oBAAoBrG,KAAMqE,GAEhD,GAAsB,iBAAXA,GAKX,GAAsB,iBAAXA,EAAqB,CAC9B,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IACP,OAVEvZ,EAAKuhB,GAAGhI,EAWZ,GACF,EAQF9D,GAAaY,GAAGrb,SAAUwkB,GA1WE,uCA0W2C,SAAUlL,GAC/E,MAAMpS,EAASsN,GAAuB0F,MAEtC,IAAKhT,IAAWA,EAAOwO,UAAUvW,SAASslB,IACxC,OAGFnL,EAAM+C,iBACN,MAAM+L,EAAW7C,GAAShF,oBAAoBrZ,GACxCmhB,EAAanO,KAAKhG,aAAa,oBAErC,OAAImU,GACFD,EAAS7B,GAAG8B,QAEZD,EAAS9B,qBAKyC,SAAhD7I,GAAYQ,iBAAiB/D,KAAM,UACrCkO,EAAS5oB,YAET4oB,EAAS9B,sBAKX8B,EAAS3G,YAET2G,EAAS9B,oBACX,IACA7L,GAAaY,GAAG9gB,OAAQgqB,IAAuB,KAC7C,MAAM+D,EAAYnH,GAAerU,KAzYR,6BA2YzB,IAAK,MAAMsb,KAAYE,EACrB/C,GAAShF,oBAAoB6H,EAC/B,IAMF7R,GAAmBgP,IAYnB,MAEMgD,GAAc,eAEdC,GAAe,OAAOD,KACtBE,GAAgB,QAAQF,KACxBG,GAAe,OAAOH,KACtBI,GAAiB,SAASJ,KAC1BK,GAAyB,QAAQL,cACjCM,GAAoB,OACpBC,GAAsB,WACtBC,GAAwB,aAExBC,GAA6B,WAAWF,OAAwBA,KAKhEG,GAAyB,8BACzBC,GAAY,CAChB9pB,OAAQ,KACR6hB,QAAQ,GAEJkI,GAAgB,CACpB/pB,OAAQ,iBACR6hB,OAAQ,WAMV,MAAMmI,WAAiBhK,GACrBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAKmP,kBAAmB,EACxBnP,KAAKoP,cAAgB,GACrB,MAAMC,EAAapI,GAAerU,KAAKmc,IAEvC,IAAK,MAAMO,KAAQD,EAAY,CAC7B,MAAMtV,EAAWM,GAAuBiV,GAClCC,EAAgBtI,GAAerU,KAAKmH,GAAUnT,QAAO4oB,GAAgBA,IAAiBxP,KAAKoF,WAEhF,OAAbrL,GAAqBwV,EAAcpe,QACrC6O,KAAKoP,cAAc/c,KAAKid,EAE5B,CAEAtP,KAAKyP,sBAEAzP,KAAKqF,QAAQngB,QAChB8a,KAAK0P,0BAA0B1P,KAAKoP,cAAepP,KAAK2P,YAGtD3P,KAAKqF,QAAQ0B,QACf/G,KAAK+G,QAET,CAGW9C,qBACT,OAAO+K,EACT,CAEW9K,yBACT,OAAO+K,EACT,CAEWxS,kBACT,MApEW,UAqEb,CAGAsK,SACM/G,KAAK2P,WACP3P,KAAK4P,OAEL5P,KAAK6P,MAET,CAEAA,OACE,GAAI7P,KAAKmP,kBAAoBnP,KAAK2P,WAChC,OAGF,IAAIG,EAAiB,GAQrB,GANI9P,KAAKqF,QAAQngB,SACf4qB,EAAiB9P,KAAK+P,uBAvEH,wCAuE4CnpB,QAAO5G,GAAWA,IAAYggB,KAAKoF,WAAU7hB,KAAIvD,GAAWkvB,GAAS7I,oBAAoBrmB,EAAS,CAC/J+mB,QAAQ,OAIR+I,EAAe3e,QAAU2e,EAAe,GAAGX,iBAC7C,OAKF,GAFmB5O,GAAakB,QAAQzB,KAAKoF,SAAUkJ,IAExCzM,iBACb,OAGF,IAAK,MAAMmO,KAAkBF,EAC3BE,EAAeJ,OAGjB,MAAMK,EAAYjQ,KAAKkQ,gBAEvBlQ,KAAKoF,SAAS5J,UAAUuH,OAAO6L,IAE/B5O,KAAKoF,SAAS5J,UAAUtE,IAAI2X,IAE5B7O,KAAKoF,SAAS5jB,MAAMyuB,GAAa,EAEjCjQ,KAAK0P,0BAA0B1P,KAAKoP,eAAe,GAEnDpP,KAAKmP,kBAAmB,EAExB,MAYMgB,EAAa,SADUF,EAAU,GAAGhL,cAAgBgL,EAAUpd,MAAM,KAG1EmN,KAAK2F,gBAdY,KACf3F,KAAKmP,kBAAmB,EAExBnP,KAAKoF,SAAS5J,UAAUuH,OAAO8L,IAE/B7O,KAAKoF,SAAS5J,UAAUtE,IAAI0X,GAAqBD,IAEjD3O,KAAKoF,SAAS5jB,MAAMyuB,GAAa,GACjC1P,GAAakB,QAAQzB,KAAKoF,SAAUmJ,GAAc,GAMtBvO,KAAKoF,UAAU,GAE7CpF,KAAKoF,SAAS5jB,MAAMyuB,GAAa,GAAGjQ,KAAKoF,SAAS+K,MACpD,CAEAP,OACE,GAAI5P,KAAKmP,mBAAqBnP,KAAK2P,WACjC,OAKF,GAFmBpP,GAAakB,QAAQzB,KAAKoF,SAAUoJ,IAExC3M,iBACb,OAGF,MAAMoO,EAAYjQ,KAAKkQ,gBAEvBlQ,KAAKoF,SAAS5jB,MAAMyuB,GAAa,GAAGjQ,KAAKoF,SAASrhB,wBAAwBksB,OAC1ElU,GAAOiE,KAAKoF,UAEZpF,KAAKoF,SAAS5J,UAAUtE,IAAI2X,IAE5B7O,KAAKoF,SAAS5J,UAAUuH,OAAO6L,GAAqBD,IAEpD,IAAK,MAAMlN,KAAWzB,KAAKoP,cAAe,CACxC,MAAMpvB,EAAUsa,GAAuBmH,GAEnCzhB,IAAYggB,KAAK2P,SAAS3vB,IAC5BggB,KAAK0P,0BAA0B,CAACjO,IAAU,EAE9C,CAEAzB,KAAKmP,kBAAmB,EAYxBnP,KAAKoF,SAAS5jB,MAAMyuB,GAAa,GAEjCjQ,KAAK2F,gBAZY,KACf3F,KAAKmP,kBAAmB,EAExBnP,KAAKoF,SAAS5J,UAAUuH,OAAO8L,IAE/B7O,KAAKoF,SAAS5J,UAAUtE,IAAI0X,IAE5BrO,GAAakB,QAAQzB,KAAKoF,SAAUqJ,GAAe,GAKvBzO,KAAKoF,UAAU,EAC/C,CAEAuK,SAAS3vB,EAAUggB,KAAKoF,UACtB,OAAOplB,EAAQwb,UAAUvW,SAAS0pB,GACpC,CAGApK,kBAAkBF,GAIhB,OAHAA,EAAO0C,OAASjG,QAAQuD,EAAO0C,QAE/B1C,EAAOnf,OAAS2V,GAAWwJ,EAAOnf,QAC3Bmf,CACT,CAEA6L,gBACE,OAAOlQ,KAAKoF,SAAS5J,UAAUvW,SAtLL,uBAChB,QACC,QAqLb,CAEAwqB,sBACE,IAAKzP,KAAKqF,QAAQngB,OAChB,OAGF,MAAMiiB,EAAWnH,KAAK+P,uBAAuBhB,IAE7C,IAAK,MAAM/uB,KAAWmnB,EAAU,CAC9B,MAAMiJ,EAAW9V,GAAuBta,GAEpCowB,GACFpQ,KAAK0P,0BAA0B,CAAC1vB,GAAUggB,KAAK2P,SAASS,GAE5D,CACF,CAEAL,uBAAuBhW,GACrB,MAAMoN,EAAWF,GAAerU,KAAKkc,GAA4B9O,KAAKqF,QAAQngB,QAE9E,OAAO+hB,GAAerU,KAAKmH,EAAUiG,KAAKqF,QAAQngB,QAAQ0B,QAAO5G,IAAYmnB,EAASjN,SAASla,IACjG,CAEA0vB,0BAA0BW,EAAcC,GACtC,GAAKD,EAAalf,OAIlB,IAAK,MAAMnR,KAAWqwB,EACpBrwB,EAAQwb,UAAUuL,OAvNK,aAuNyBuJ,GAChDtwB,EAAQ6B,aAAa,gBAAiByuB,EAE1C,CAGAzK,uBAAuBxB,GACrB,MAAMgB,EAAU,CAAC,EAMjB,MAJsB,iBAAXhB,GAAuB,YAAYvgB,KAAKugB,KACjDgB,EAAQ0B,QAAS,GAGZ/G,KAAK4G,MAAK,WACf,MAAM9b,EAAOokB,GAAS7I,oBAAoBrG,KAAMqF,GAEhD,GAAsB,iBAAXhB,EAAqB,CAC9B,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IACP,CACF,GACF,EAQF9D,GAAaY,GAAGrb,SAAU4oB,GAAwBK,IAAwB,SAAU3P,IAErD,MAAzBA,EAAMpS,OAAOoZ,SAAmBhH,EAAMW,gBAAmD,MAAjCX,EAAMW,eAAeqG,UAC/EhH,EAAM+C,iBAGR,MAAMpI,EAAWM,GAAuB2F,MAClCuQ,EAAmBtJ,GAAerU,KAAKmH,GAE7C,IAAK,MAAM/Z,KAAWuwB,EACpBrB,GAAS7I,oBAAoBrmB,EAAS,CACpC+mB,QAAQ,IACPA,QAEP,IAKA1K,GAAmB6S,IAYnB,MAAMsB,GAAS,WAETC,GAAc,eACdC,GAAiB,YAGjBC,GAAiB,UACjBC,GAAmB,YAGnBC,GAAe,OAAOJ,KACtBK,GAAiB,SAASL,KAC1BM,GAAe,OAAON,KACtBO,GAAgB,QAAQP,KACxBQ,GAAyB,QAAQR,KAAcC,KAC/CQ,GAAyB,UAAUT,KAAcC,KACjDS,GAAuB,QAAQV,KAAcC,KAC7CU,GAAoB,OAMpBC,GAAyB,4DACzBC,GAA6B,GAAGD,MAA0BD,KAC1DG,GAAgB,iBAIhBC,GAAgBrV,KAAU,UAAY,YACtCsV,GAAmBtV,KAAU,YAAc,UAC3CuV,GAAmBvV,KAAU,aAAe,eAC5CwV,GAAsBxV,KAAU,eAAiB,aACjDyV,GAAkBzV,KAAU,aAAe,cAC3C0V,GAAiB1V,KAAU,cAAgB,aAG3C2V,GAAY,CAChBC,WAAW,EACXrjB,SAAU,kBACVsjB,QAAS,UACTvpB,OAAQ,CAAC,EAAG,GACZwpB,aAAc,KACdlzB,UAAW,UAEPmzB,GAAgB,CACpBH,UAAW,mBACXrjB,SAAU,mBACVsjB,QAAS,SACTvpB,OAAQ,0BACRwpB,aAAc,yBACdlzB,UAAW,2BAMb,MAAMozB,WAAiBjN,GACrBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAKoS,QAAU,KACfpS,KAAKqS,QAAUrS,KAAKoF,SAAS5f,WAG7Bwa,KAAKsS,MAAQrL,GAAe3hB,KAAK0a,KAAKoF,SAAUmM,IAAe,IAAMtK,GAAeM,KAAKvH,KAAKoF,SAAUmM,IAAe,IAAMtK,GAAeC,QAAQqK,GAAevR,KAAKqS,SACxKrS,KAAKuS,UAAYvS,KAAKwS,eACxB,CAGWvO,qBACT,OAAO6N,EACT,CAEW5N,yBACT,OAAOgO,EACT,CAEWzV,kBACT,OAAO+T,EACT,CAGAzJ,SACE,OAAO/G,KAAK2P,WAAa3P,KAAK4P,OAAS5P,KAAK6P,MAC9C,CAEAA,OACE,GAAIxU,GAAW2E,KAAKoF,WAAapF,KAAK2P,WACpC,OAGF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAKoF,UAItB,IAFkB7E,GAAakB,QAAQzB,KAAKoF,SAAU2L,GAAcjR,GAEtD+B,iBAAd,CAUA,GANA7B,KAAKyS,gBAMD,iBAAkB3sB,SAASC,kBAAoBia,KAAKqS,QAAQlX,QA/ExC,eAgFtB,IAAK,MAAMnb,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAKwa,UAC/C5G,GAAaY,GAAGnhB,EAAS,YAAa8b,IAI1CkE,KAAKoF,SAASsN,QAEd1S,KAAKoF,SAASvjB,aAAa,iBAAiB,GAE5Cme,KAAKsS,MAAM9W,UAAUtE,IAAIka,IAEzBpR,KAAKoF,SAAS5J,UAAUtE,IAAIka,IAE5B7Q,GAAakB,QAAQzB,KAAKoF,SAAU4L,GAAelR,EAtBnD,CAuBF,CAEA8P,OACE,GAAIvU,GAAW2E,KAAKoF,YAAcpF,KAAK2P,WACrC,OAGF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAKoF,UAGtBpF,KAAK2S,cAAc7S,EACrB,CAEAyF,UACMvF,KAAKoS,SACPpS,KAAKoS,QAAQ3Y,UAGf0L,MAAMI,SACR,CAEA/Z,SACEwU,KAAKuS,UAAYvS,KAAKwS,gBAElBxS,KAAKoS,SACPpS,KAAKoS,QAAQ5mB,QAEjB,CAGAmnB,cAAc7S,GAGZ,IAFkBS,GAAakB,QAAQzB,KAAKoF,SAAUyL,GAAc/Q,GAEtD+B,iBAAd,CAMA,GAAI,iBAAkB/b,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAKwa,UAC/C5G,GAAaC,IAAIxgB,EAAS,YAAa8b,IAIvCkE,KAAKoS,SACPpS,KAAKoS,QAAQ3Y,UAGfuG,KAAKsS,MAAM9W,UAAUuH,OAAOqO,IAE5BpR,KAAKoF,SAAS5J,UAAUuH,OAAOqO,IAE/BpR,KAAKoF,SAASvjB,aAAa,gBAAiB,SAE5C0hB,GAAYE,oBAAoBzD,KAAKsS,MAAO,UAC5C/R,GAAakB,QAAQzB,KAAKoF,SAAU0L,GAAgBhR,EArBpD,CAsBF,CAEAsE,WAAWC,GAGT,GAAgC,iBAFhCA,EAASc,MAAMf,WAAWC,IAERtlB,YAA2B,GAAUslB,EAAOtlB,YAAgE,mBAA3CslB,EAAOtlB,UAAUgF,sBAElG,MAAM,IAAIihB,UAAU,GAAGwL,GAAOvL,+GAGhC,OAAOZ,CACT,CAEAoO,gBACE,QAAsB,IAAX,EACT,MAAM,IAAIzN,UAAU,gEAGtB,IAAI4N,EAAmB5S,KAAKoF,SAEG,WAA3BpF,KAAKqF,QAAQtmB,UACf6zB,EAAmB5S,KAAKqS,QACf,GAAUrS,KAAKqF,QAAQtmB,WAChC6zB,EAAmB/X,GAAWmF,KAAKqF,QAAQtmB,WACA,iBAA3BihB,KAAKqF,QAAQtmB,YAC7B6zB,EAAmB5S,KAAKqF,QAAQtmB,WAGlC,MAAMkzB,EAAejS,KAAK6S,mBAE1B7S,KAAKoS,QAAU,GAAoBQ,EAAkB5S,KAAKsS,MAAOL,EACnE,CAEAtC,WACE,OAAO3P,KAAKsS,MAAM9W,UAAUvW,SAASmsB,GACvC,CAEA0B,gBACE,MAAMC,EAAiB/S,KAAKqS,QAE5B,GAAIU,EAAevX,UAAUvW,SAxMN,WAyMrB,OAAO2sB,GAGT,GAAImB,EAAevX,UAAUvW,SA3MJ,aA4MvB,OAAO4sB,GAGT,GAAIkB,EAAevX,UAAUvW,SA9MA,iBA+M3B,MAjMsB,MAoMxB,GAAI8tB,EAAevX,UAAUvW,SAjNE,mBAkN7B,MApMyB,SAwM3B,MAAM+tB,EAAkF,QAA1EttB,iBAAiBsa,KAAKsS,OAAOrX,iBAAiB,iBAAiBb,OAE7E,OAAI2Y,EAAevX,UAAUvW,SA5NP,UA6Nb+tB,EAAQvB,GAAmBD,GAG7BwB,EAAQrB,GAAsBD,EACvC,CAEAc,gBACE,OAAkD,OAA3CxS,KAAKoF,SAASjK,QA5ND,UA6NtB,CAEA8X,aACE,MAAM,OACJxqB,GACEuX,KAAKqF,QAET,MAAsB,iBAAX5c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAASmf,OAAO+P,SAASlvB,EAAO,MAGzC,mBAAXqK,EACFyqB,GAAczqB,EAAOyqB,EAAYlT,KAAKoF,UAGxC3c,CACT,CAEAoqB,mBACE,MAAMM,EAAwB,CAC5Bh0B,UAAW6gB,KAAK8S,gBAChBjc,UAAW,CAAC,CACV9V,KAAM,kBACNmB,QAAS,CACPwM,SAAUsR,KAAKqF,QAAQ3W,WAExB,CACD3N,KAAM,SACNmB,QAAS,CACPuG,OAAQuX,KAAKiT,iBAcnB,OATIjT,KAAKuS,WAAsC,WAAzBvS,KAAKqF,QAAQ2M,WACjCzO,GAAYC,iBAAiBxD,KAAKsS,MAAO,SAAU,UAEnDa,EAAsBtc,UAAY,CAAC,CACjC9V,KAAM,cACNC,SAAS,KAIN,IAAKmyB,KAC+B,mBAA9BnT,KAAKqF,QAAQ4M,aAA8BjS,KAAKqF,QAAQ4M,aAAakB,GAAyBnT,KAAKqF,QAAQ4M,aAE1H,CAEAmB,iBAAgB,IACd71B,EAAG,OACHyP,IAEA,MAAMsf,EAAQrF,GAAerU,KA/QF,8DA+Q+BoN,KAAKsS,OAAO1rB,QAAO5G,GAAW8a,GAAU9a,KAE7FssB,EAAMnb,QAMX2M,GAAqBwO,EAAOtf,EAAQzP,IAAQqzB,IAAmBtE,EAAMpS,SAASlN,IAAS0lB,OACzF,CAGA7M,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOqnB,GAAS9L,oBAAoBrG,KAAMqE,GAEhD,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,CAEAwB,kBAAkBzG,GAChB,GAhUuB,IAgUnBA,EAAM4H,QAAgD,UAAf5H,EAAMqB,MAnUnC,QAmUuDrB,EAAM7hB,IACzE,OAGF,MAAM81B,EAAcpM,GAAerU,KAAK0e,IAExC,IAAK,MAAMvK,KAAUsM,EAAa,CAChC,MAAMC,EAAUnB,GAASrM,YAAYiB,GAErC,IAAKuM,IAAyC,IAA9BA,EAAQjO,QAAQ0M,UAC9B,SAGF,MAAMwB,EAAenU,EAAMmU,eACrBC,EAAeD,EAAarZ,SAASoZ,EAAQhB,OAEnD,GAAIiB,EAAarZ,SAASoZ,EAAQlO,WAA2C,WAA9BkO,EAAQjO,QAAQ0M,YAA2ByB,GAA8C,YAA9BF,EAAQjO,QAAQ0M,WAA2ByB,EACnJ,SAIF,GAAIF,EAAQhB,MAAMrtB,SAASma,EAAMpS,UAA2B,UAAfoS,EAAMqB,MAxVvC,QAwV2DrB,EAAM7hB,KAAqB,qCAAqCuG,KAAKsb,EAAMpS,OAAOoZ,UACvJ,SAGF,MAAMtG,EAAgB,CACpBA,cAAewT,EAAQlO,UAGN,UAAfhG,EAAMqB,OACRX,EAAcqG,WAAa/G,GAG7BkU,EAAQX,cAAc7S,EACxB,CACF,CAEA+F,6BAA6BzG,GAG3B,MAAMqU,EAAU,kBAAkB3vB,KAAKsb,EAAMpS,OAAOoZ,SAC9CsN,EA7WW,WA6WKtU,EAAM7hB,IACtBo2B,EAAkB,CAAChD,GAAgBC,IAAkB1W,SAASkF,EAAM7hB,KAE1E,IAAKo2B,IAAoBD,EACvB,OAGF,GAAID,IAAYC,EACd,OAGFtU,EAAM+C,iBAEN,MAAMyR,EAAkB5T,KAAKoH,QAAQiK,IAA0BrR,KAAOiH,GAAeM,KAAKvH,KAAMqR,IAAwB,IAAMpK,GAAe3hB,KAAK0a,KAAMqR,IAAwB,IAAMpK,GAAeC,QAAQmK,GAAwBjS,EAAMW,eAAeva,YACpPwF,EAAWmnB,GAAS9L,oBAAoBuN,GAE9C,GAAID,EAMF,OALAvU,EAAMyU,kBACN7oB,EAAS6kB,YAET7kB,EAASooB,gBAAgBhU,GAKvBpU,EAAS2kB,aAEXvQ,EAAMyU,kBACN7oB,EAAS4kB,OACTgE,EAAgBlB,QAEpB,EAQFnS,GAAaY,GAAGrb,SAAUorB,GAAwBG,GAAwBc,GAAS2B,uBACnFvT,GAAaY,GAAGrb,SAAUorB,GAAwBK,GAAeY,GAAS2B,uBAC1EvT,GAAaY,GAAGrb,SAAUmrB,GAAwBkB,GAAS4B,YAC3DxT,GAAaY,GAAGrb,SAAUqrB,GAAsBgB,GAAS4B,YACzDxT,GAAaY,GAAGrb,SAAUmrB,GAAwBI,IAAwB,SAAUjS,GAClFA,EAAM+C,iBACNgQ,GAAS9L,oBAAoBrG,MAAM+G,QACrC,IAKA1K,GAAmB8V,IAYnB,MAAM6B,GAAyB,oDACzBC,GAA0B,cAC1BC,GAAmB,gBACnBC,GAAkB,eAKxB,MAAMC,GACJ1P,cACE1E,KAAKoF,SAAWtf,SAAS6G,IAC3B,CAGA0nB,WAEE,MAAMC,EAAgBxuB,SAASC,gBAAgBuC,YAC/C,OAAO1F,KAAKoC,IAAI3E,OAAOk0B,WAAaD,EACtC,CAEA1E,OACE,MAAMtrB,EAAQ0b,KAAKqU,WAEnBrU,KAAKwU,mBAGLxU,KAAKyU,sBAAsBzU,KAAKoF,SAAU8O,IAAkBQ,GAAmBA,EAAkBpwB,IAGjG0b,KAAKyU,sBAAsBT,GAAwBE,IAAkBQ,GAAmBA,EAAkBpwB,IAE1G0b,KAAKyU,sBAAsBR,GAAyBE,IAAiBO,GAAmBA,EAAkBpwB,GAC5G,CAEAwO,QACEkN,KAAK2U,wBAAwB3U,KAAKoF,SAAU,YAE5CpF,KAAK2U,wBAAwB3U,KAAKoF,SAAU8O,IAE5ClU,KAAK2U,wBAAwBX,GAAwBE,IAErDlU,KAAK2U,wBAAwBV,GAAyBE,GACxD,CAEAS,gBACE,OAAO5U,KAAKqU,WAAa,CAC3B,CAGAG,mBACExU,KAAK6U,sBAAsB7U,KAAKoF,SAAU,YAE1CpF,KAAKoF,SAAS5jB,MAAM+K,SAAW,QACjC,CAEAkoB,sBAAsB1a,EAAU+a,EAAevY,GAC7C,MAAMwY,EAAiB/U,KAAKqU,WAa5BrU,KAAKgV,2BAA2Bjb,GAXH/Z,IAC3B,GAAIA,IAAYggB,KAAKoF,UAAY/kB,OAAOk0B,WAAav0B,EAAQsI,YAAcysB,EACzE,OAGF/U,KAAK6U,sBAAsB70B,EAAS80B,GAEpC,MAAMJ,EAAkBr0B,OAAOqF,iBAAiB1F,GAASib,iBAAiB6Z,GAC1E90B,EAAQwB,MAAMyzB,YAAYH,EAAe,GAAGvY,EAASgB,OAAOC,WAAWkX,QAAsB,GAIjG,CAEAG,sBAAsB70B,EAAS80B,GAC7B,MAAMI,EAAcl1B,EAAQwB,MAAMyZ,iBAAiB6Z,GAE/CI,GACF3R,GAAYC,iBAAiBxjB,EAAS80B,EAAeI,EAEzD,CAEAP,wBAAwB5a,EAAU+a,GAahC9U,KAAKgV,2BAA2Bjb,GAZH/Z,IAC3B,MAAM5B,EAAQmlB,GAAYQ,iBAAiB/jB,EAAS80B,GAEtC,OAAV12B,GAKJmlB,GAAYE,oBAAoBzjB,EAAS80B,GACzC90B,EAAQwB,MAAMyzB,YAAYH,EAAe12B,IALvC4B,EAAQwB,MAAM2zB,eAAeL,EAKgB,GAInD,CAEAE,2BAA2Bjb,EAAUqb,GACnC,GAAI,GAAUrb,GACZqb,EAASrb,QAIX,IAAK,MAAMsb,KAAOpO,GAAerU,KAAKmH,EAAUiG,KAAKoF,UACnDgQ,EAASC,EAEb,EAcF,MAAMC,GAAS,WAETC,GAAoB,OACpBC,GAAkB,gBAAgBF,KAClCG,GAAY,CAChBC,UAAW,iBACXC,cAAe,KACf/P,YAAY,EACZ9K,WAAW,EAEX8a,YAAa,QAGTC,GAAgB,CACpBH,UAAW,SACXC,cAAe,kBACf/P,WAAY,UACZ9K,UAAW,UACX8a,YAAa,oBAMf,MAAME,WAAiB9R,GACrBU,YAAYL,GACVc,QACAnF,KAAKqF,QAAUrF,KAAKoE,WAAWC,GAC/BrE,KAAK+V,aAAc,EACnB/V,KAAKoF,SAAW,IAClB,CAGWnB,qBACT,OAAOwR,EACT,CAEWvR,yBACT,OAAO2R,EACT,CAEWpZ,kBACT,OAAO6Y,EACT,CAGAzF,KAAKtT,GACH,IAAKyD,KAAKqF,QAAQvK,UAEhB,YADAiC,GAAQR,GAIVyD,KAAKgW,UAEL,MAAMh2B,EAAUggB,KAAKiW,cAEjBjW,KAAKqF,QAAQO,YACf7J,GAAO/b,GAGTA,EAAQwb,UAAUtE,IAAIqe,IAEtBvV,KAAKkW,mBAAkB,KACrBnZ,GAAQR,EAAS,GAErB,CAEAqT,KAAKrT,GACEyD,KAAKqF,QAAQvK,WAKlBkF,KAAKiW,cAAcza,UAAUuH,OAAOwS,IAEpCvV,KAAKkW,mBAAkB,KACrBlW,KAAKuF,UACLxI,GAAQR,EAAS,KARjBQ,GAAQR,EAUZ,CAEAgJ,UACOvF,KAAK+V,cAIVxV,GAAaC,IAAIR,KAAKoF,SAAUoQ,IAEhCxV,KAAKoF,SAASrC,SAEd/C,KAAK+V,aAAc,EACrB,CAGAE,cACE,IAAKjW,KAAKoF,SAAU,CAClB,MAAM+Q,EAAWrwB,SAASswB,cAAc,OACxCD,EAAST,UAAY1V,KAAKqF,QAAQqQ,UAE9B1V,KAAKqF,QAAQO,YACfuQ,EAAS3a,UAAUtE,IAnGD,QAsGpB8I,KAAKoF,SAAW+Q,CAClB,CAEA,OAAOnW,KAAKoF,QACd,CAEAb,kBAAkBF,GAGhB,OADAA,EAAOuR,YAAc/a,GAAWwJ,EAAOuR,aAChCvR,CACT,CAEA2R,UACE,GAAIhW,KAAK+V,YACP,OAGF,MAAM/1B,EAAUggB,KAAKiW,cAErBjW,KAAKqF,QAAQuQ,YAAYS,OAAOr2B,GAEhCugB,GAAaY,GAAGnhB,EAASw1B,IAAiB,KACxCzY,GAAQiD,KAAKqF,QAAQsQ,cAAc,IAErC3V,KAAK+V,aAAc,CACrB,CAEAG,kBAAkB3Z,GAChBS,GAAuBT,EAAUyD,KAAKiW,cAAejW,KAAKqF,QAAQO,WACpE,EAcF,MAEM0Q,GAAc,gBACdC,GAAkB,UAAUD,KAC5BE,GAAoB,cAAcF,KAGlCG,GAAmB,WACnBC,GAAY,CAChBC,WAAW,EACXC,YAAa,MAGTC,GAAgB,CACpBF,UAAW,UACXC,YAAa,WAMf,MAAME,WAAkB9S,GACtBU,YAAYL,GACVc,QACAnF,KAAKqF,QAAUrF,KAAKoE,WAAWC,GAC/BrE,KAAK+W,WAAY,EACjB/W,KAAKgX,qBAAuB,IAC9B,CAGW/S,qBACT,OAAOyS,EACT,CAEWxS,yBACT,OAAO2S,EACT,CAEWpa,kBACT,MAvCW,WAwCb,CAGAwa,WACMjX,KAAK+W,YAIL/W,KAAKqF,QAAQsR,WACf3W,KAAKqF,QAAQuR,YAAYlE,QAG3BnS,GAAaC,IAAI1a,SAAUwwB,IAE3B/V,GAAaY,GAAGrb,SAAUywB,IAAiBnX,GAASY,KAAKkX,eAAe9X,KACxEmB,GAAaY,GAAGrb,SAAU0wB,IAAmBpX,GAASY,KAAKmX,eAAe/X,KAC1EY,KAAK+W,WAAY,EACnB,CAEAK,aACOpX,KAAK+W,YAIV/W,KAAK+W,WAAY,EACjBxW,GAAaC,IAAI1a,SAAUwwB,IAC7B,CAGAY,eAAe9X,GACb,MAAM,YACJwX,GACE5W,KAAKqF,QAET,GAAIjG,EAAMpS,SAAWlH,UAAYsZ,EAAMpS,SAAW4pB,GAAeA,EAAY3xB,SAASma,EAAMpS,QAC1F,OAGF,MAAM1L,EAAW2lB,GAAeU,kBAAkBiP,GAE1B,IAApBt1B,EAAS6P,OACXylB,EAAYlE,QACH1S,KAAKgX,uBAAyBP,GACvCn1B,EAASA,EAAS6P,OAAS,GAAGuhB,QAE9BpxB,EAAS,GAAGoxB,OAEhB,CAEAyE,eAAe/X,GApFD,QAqFRA,EAAM7hB,MAIVyiB,KAAKgX,qBAAuB5X,EAAMiY,SAAWZ,GAxFzB,UAyFtB,EAcF,MAEMa,GAAc,YAGdC,GAAe,OAAOD,KACtBE,GAAyB,gBAAgBF,KACzCG,GAAiB,SAASH,KAC1BI,GAAe,OAAOJ,KACtBK,GAAgB,QAAQL,KACxBM,GAAiB,SAASN,KAC1BO,GAAsB,gBAAgBP,KACtCQ,GAA0B,oBAAoBR,KAC9CS,GAA0B,kBAAkBT,KAC5CU,GAAyB,QAAQV,cACjCW,GAAkB,aAElBC,GAAoB,OACpBC,GAAoB,eAKpBC,GAAY,CAChBjC,UAAU,EACVzD,OAAO,EACP3H,UAAU,GAENsN,GAAgB,CACpBlC,SAAU,mBACVzD,MAAO,UACP3H,SAAU,WAMZ,MAAMuN,WAAcpT,GAClBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAKuY,QAAUtR,GAAeC,QApBV,gBAoBmClH,KAAKoF,UAC5DpF,KAAKwY,UAAYxY,KAAKyY,sBACtBzY,KAAK0Y,WAAa1Y,KAAK2Y,uBACvB3Y,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK4Y,WAAa,IAAIxE,GAEtBpU,KAAK4L,oBACP,CAGW3H,qBACT,OAAOmU,EACT,CAEWlU,yBACT,OAAOmU,EACT,CAEW5b,kBACT,MA5DW,OA6Db,CAGAsK,OAAOjH,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CAEA+P,KAAK/P,GACCE,KAAK2P,UAAY3P,KAAKmP,kBAIR5O,GAAakB,QAAQzB,KAAKoF,SAAUsS,GAAc,CAClE5X,kBAGY+B,mBAId7B,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EAExBnP,KAAK4Y,WAAWhJ,OAEhB9pB,SAAS6G,KAAK6O,UAAUtE,IAAI+gB,IAE5BjY,KAAK6Y,gBAEL7Y,KAAKwY,UAAU3I,MAAK,IAAM7P,KAAK8Y,aAAahZ,KAC9C,CAEA8P,OACO5P,KAAK2P,WAAY3P,KAAKmP,mBAIT5O,GAAakB,QAAQzB,KAAKoF,SAAUmS,IAExC1V,mBAId7B,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EAExBnP,KAAK0Y,WAAWtB,aAEhBpX,KAAKoF,SAAS5J,UAAUuH,OAAOmV,IAE/BlY,KAAK2F,gBAAe,IAAM3F,KAAK+Y,cAAc/Y,KAAKoF,SAAUpF,KAAKgO,gBACnE,CAEAzI,UACE,IAAK,MAAMyT,IAAe,CAAC34B,OAAQ2f,KAAKuY,SACtChY,GAAaC,IAAIwY,EAAa1B,IAGhCtX,KAAKwY,UAAUjT,UAEfvF,KAAK0Y,WAAWtB,aAEhBjS,MAAMI,SACR,CAEA0T,eACEjZ,KAAK6Y,eACP,CAGAJ,sBACE,OAAO,IAAI3C,GAAS,CAClBhb,UAAWgG,QAAQd,KAAKqF,QAAQ8Q,UAEhCvQ,WAAY5F,KAAKgO,eAErB,CAEA2K,uBACE,OAAO,IAAI7B,GAAU,CACnBF,YAAa5W,KAAKoF,UAEtB,CAEA0T,aAAahZ,GAENha,SAAS6G,KAAK1H,SAAS+a,KAAKoF,WAC/Btf,SAAS6G,KAAK0pB,OAAOrW,KAAKoF,UAG5BpF,KAAKoF,SAAS5jB,MAAMwwB,QAAU,QAE9BhS,KAAKoF,SAASxjB,gBAAgB,eAE9Boe,KAAKoF,SAASvjB,aAAa,cAAc,GAEzCme,KAAKoF,SAASvjB,aAAa,OAAQ,UAEnCme,KAAKoF,SAASlZ,UAAY,EAC1B,MAAMgtB,EAAYjS,GAAeC,QA3IT,cA2IsClH,KAAKuY,SAE/DW,IACFA,EAAUhtB,UAAY,GAGxB6P,GAAOiE,KAAKoF,UAEZpF,KAAKoF,SAAS5J,UAAUtE,IAAIghB,IAa5BlY,KAAK2F,gBAXsB,KACrB3F,KAAKqF,QAAQqN,OACf1S,KAAK0Y,WAAWzB,WAGlBjX,KAAKmP,kBAAmB,EACxB5O,GAAakB,QAAQzB,KAAKoF,SAAUuS,GAAe,CACjD7X,iBACA,GAGoCE,KAAKuY,QAASvY,KAAKgO,cAC7D,CAEApC,qBACErL,GAAaY,GAAGnB,KAAKoF,SAAU2S,IAAyB3Y,IACtD,GAtLe,WAsLXA,EAAM7hB,IAIV,OAAIyiB,KAAKqF,QAAQ0F,UACf3L,EAAM+C,sBACNnC,KAAK4P,aAIP5P,KAAKmZ,4BAA4B,IAEnC5Y,GAAaY,GAAG9gB,OAAQu3B,IAAgB,KAClC5X,KAAK2P,WAAa3P,KAAKmP,kBACzBnP,KAAK6Y,eACP,IAEFtY,GAAaY,GAAGnB,KAAKoF,SAAU0S,IAAyB1Y,IAEtDmB,GAAaa,IAAIpB,KAAKoF,SAAUyS,IAAqBuB,IAC/CpZ,KAAKoF,WAAahG,EAAMpS,QAAUgT,KAAKoF,WAAagU,EAAOpsB,SAIjC,WAA1BgT,KAAKqF,QAAQ8Q,SAMbnW,KAAKqF,QAAQ8Q,UACfnW,KAAK4P,OANL5P,KAAKmZ,6BAOP,GACA,GAEN,CAEAJ,aACE/Y,KAAKoF,SAAS5jB,MAAMwwB,QAAU,OAE9BhS,KAAKoF,SAASvjB,aAAa,eAAe,GAE1Cme,KAAKoF,SAASxjB,gBAAgB,cAE9Boe,KAAKoF,SAASxjB,gBAAgB,QAE9Boe,KAAKmP,kBAAmB,EAExBnP,KAAKwY,UAAU5I,MAAK,KAClB9pB,SAAS6G,KAAK6O,UAAUuH,OAAOkV,IAE/BjY,KAAKqZ,oBAELrZ,KAAK4Y,WAAW9lB,QAEhByN,GAAakB,QAAQzB,KAAKoF,SAAUqS,GAAe,GAEvD,CAEAzJ,cACE,OAAOhO,KAAKoF,SAAS5J,UAAUvW,SAtOT,OAuOxB,CAEAk0B,6BAGE,GAFkB5Y,GAAakB,QAAQzB,KAAKoF,SAAUoS,IAExC3V,iBACZ,OAGF,MAAMyX,EAAqBtZ,KAAKoF,SAAStX,aAAehI,SAASC,gBAAgBsC,aAC3EkxB,EAAmBvZ,KAAKoF,SAAS5jB,MAAMiL,UAEpB,WAArB8sB,GAAiCvZ,KAAKoF,SAAS5J,UAAUvW,SAASkzB,MAIjEmB,IACHtZ,KAAKoF,SAAS5jB,MAAMiL,UAAY,UAGlCuT,KAAKoF,SAAS5J,UAAUtE,IAAIihB,IAE5BnY,KAAK2F,gBAAe,KAClB3F,KAAKoF,SAAS5J,UAAUuH,OAAOoV,IAE/BnY,KAAK2F,gBAAe,KAClB3F,KAAKoF,SAAS5jB,MAAMiL,UAAY8sB,CAAgB,GAC/CvZ,KAAKuY,QAAQ,GACfvY,KAAKuY,SAERvY,KAAKoF,SAASsN,QAChB,CAMAmG,gBACE,MAAMS,EAAqBtZ,KAAKoF,SAAStX,aAAehI,SAASC,gBAAgBsC,aAE3E0sB,EAAiB/U,KAAK4Y,WAAWvE,WAEjCmF,EAAoBzE,EAAiB,EAE3C,GAAIyE,IAAsBF,EAAoB,CAC5C,MAAM/2B,EAAW4Z,KAAU,cAAgB,eAC3C6D,KAAKoF,SAAS5jB,MAAMe,GAAY,GAAGwyB,KACrC,CAEA,IAAKyE,GAAqBF,EAAoB,CAC5C,MAAM/2B,EAAW4Z,KAAU,eAAiB,cAC5C6D,KAAKoF,SAAS5jB,MAAMe,GAAY,GAAGwyB,KACrC,CACF,CAEAsE,oBACErZ,KAAKoF,SAAS5jB,MAAMi4B,YAAc,GAClCzZ,KAAKoF,SAAS5jB,MAAMk4B,aAAe,EACrC,CAGA7T,uBAAuBxB,EAAQvE,GAC7B,OAAOE,KAAK4G,MAAK,WACf,MAAM9b,EAAOwtB,GAAMjS,oBAAoBrG,KAAMqE,GAE7C,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,GAAQvE,EANb,CAOF,GACF,EAQFS,GAAaY,GAAGrb,SAAUkyB,GApTK,4BAoT2C,SAAU5Y,GAClF,MAAMpS,EAASsN,GAAuB0F,MAElC,CAAC,IAAK,QAAQ9F,SAAS8F,KAAKoG,UAC9BhH,EAAM+C,iBAGR5B,GAAaa,IAAIpU,EAAQ0qB,IAAciC,IACjCA,EAAU9X,kBAKdtB,GAAaa,IAAIpU,EAAQyqB,IAAgB,KACnC3c,GAAUkF,OACZA,KAAK0S,OACP,GACA,IAGJ,MAAMkH,EAAc3S,GAAeC,QA3Ub,eA6UlB0S,GACFtB,GAAMxS,YAAY8T,GAAahK,OAGpB0I,GAAMjS,oBAAoBrZ,GAClC+Z,OAAO/G,KACd,IACAgG,GAAqBsS,IAKrBjc,GAAmBic,IAYnB,MAEMuB,GAAc,gBACdC,GAAiB,YACjBC,GAAwB,OAAOF,KAAcC,KAE7CE,GAAoB,OACpBC,GAAuB,UACvBC,GAAoB,SAEpBC,GAAgB,kBAChBC,GAAe,OAAOP,KACtBQ,GAAgB,QAAQR,KACxBS,GAAe,OAAOT,KACtBU,GAAuB,gBAAgBV,KACvCW,GAAiB,SAASX,KAC1BY,GAAe,SAASZ,KACxBa,GAAyB,QAAQb,KAAcC,KAC/Ca,GAAwB,kBAAkBd,KAE1Ce,GAAY,CAChBzE,UAAU,EACVpL,UAAU,EACV7f,QAAQ,GAEJ2vB,GAAgB,CACpB1E,SAAU,mBACVpL,SAAU,UACV7f,OAAQ,WAMV,MAAM4vB,WAAkB5V,GACtBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAK2P,UAAW,EAChB3P,KAAKwY,UAAYxY,KAAKyY,sBACtBzY,KAAK0Y,WAAa1Y,KAAK2Y,uBAEvB3Y,KAAK4L,oBACP,CAGW3H,qBACT,OAAO2W,EACT,CAEW1W,yBACT,OAAO2W,EACT,CAEWpe,kBACT,MAtDW,WAuDb,CAGAsK,OAAOjH,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CAEA+P,KAAK/P,GACCE,KAAK2P,UAISpP,GAAakB,QAAQzB,KAAKoF,SAAUgV,GAAc,CAClEta,kBAGY+B,mBAId7B,KAAK2P,UAAW,EAEhB3P,KAAKwY,UAAU3I,OAEV7P,KAAKqF,QAAQna,SAChB,IAAIkpB,IAAkBxE,OAGxB5P,KAAKoF,SAASvjB,aAAa,cAAc,GAEzCme,KAAKoF,SAASvjB,aAAa,OAAQ,UAEnCme,KAAKoF,SAAS5J,UAAUtE,IAAI+iB,IAgB5Bja,KAAK2F,gBAdoB,KAClB3F,KAAKqF,QAAQna,SAAU8U,KAAKqF,QAAQ8Q,UACvCnW,KAAK0Y,WAAWzB,WAGlBjX,KAAKoF,SAAS5J,UAAUtE,IAAI8iB,IAE5Bha,KAAKoF,SAAS5J,UAAUuH,OAAOkX,IAE/B1Z,GAAakB,QAAQzB,KAAKoF,SAAUiV,GAAe,CACjDva,iBACA,GAGkCE,KAAKoF,UAAU,GACvD,CAEAwK,OACO5P,KAAK2P,WAIQpP,GAAakB,QAAQzB,KAAKoF,SAAUkV,IAExCzY,mBAId7B,KAAK0Y,WAAWtB,aAEhBpX,KAAKoF,SAAS2V,OAEd/a,KAAK2P,UAAW,EAEhB3P,KAAKoF,SAAS5J,UAAUtE,IAAIgjB,IAE5Bla,KAAKwY,UAAU5I,OAgBf5P,KAAK2F,gBAdoB,KACvB3F,KAAKoF,SAAS5J,UAAUuH,OAAOiX,GAAmBE,IAElDla,KAAKoF,SAASxjB,gBAAgB,cAE9Boe,KAAKoF,SAASxjB,gBAAgB,QAEzBoe,KAAKqF,QAAQna,SAChB,IAAIkpB,IAAkBthB,QAGxByN,GAAakB,QAAQzB,KAAKoF,SAAUoV,GAAe,GAGfxa,KAAKoF,UAAU,IACvD,CAEAG,UACEvF,KAAKwY,UAAUjT,UAEfvF,KAAK0Y,WAAWtB,aAEhBjS,MAAMI,SACR,CAGAkT,sBACE,MAUM3d,EAAYgG,QAAQd,KAAKqF,QAAQ8Q,UACvC,OAAO,IAAIL,GAAS,CAClBJ,UA7JsB,qBA8JtB5a,YACA8K,YAAY,EACZgQ,YAAa5V,KAAKoF,SAAS5f,WAC3BmwB,cAAe7a,EAhBK,KACU,WAA1BkF,KAAKqF,QAAQ8Q,SAKjBnW,KAAK4P,OAJHrP,GAAakB,QAAQzB,KAAKoF,SAAUmV,GAI3B,EAUgC,MAE/C,CAEA5B,uBACE,OAAO,IAAI7B,GAAU,CACnBF,YAAa5W,KAAKoF,UAEtB,CAEAwG,qBACErL,GAAaY,GAAGnB,KAAKoF,SAAUuV,IAAuBvb,IAhLvC,WAiLTA,EAAM7hB,MAILyiB,KAAKqF,QAAQ0F,SAKlB/K,KAAK4P,OAJHrP,GAAakB,QAAQzB,KAAKoF,SAAUmV,IAI3B,GAEf,CAGA1U,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOgwB,GAAUzU,oBAAoBrG,KAAMqE,GAEjD,GAAsB,iBAAXA,EAAX,CAIA,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,GAAQrE,KANb,CAOF,GACF,EAQFO,GAAaY,GAAGrb,SAAU40B,GAvMK,gCAuM2C,SAAUtb,GAClF,MAAMpS,EAASsN,GAAuB0F,MAMtC,GAJI,CAAC,IAAK,QAAQ9F,SAAS8F,KAAKoG,UAC9BhH,EAAM+C,iBAGJ9G,GAAW2E,MACb,OAGFO,GAAaa,IAAIpU,EAAQwtB,IAAgB,KAEnC1f,GAAUkF,OACZA,KAAK0S,OACP,IAGF,MAAMkH,EAAc3S,GAAeC,QAAQiT,IAEvCP,GAAeA,IAAgB5sB,GACjC8tB,GAAUhV,YAAY8T,GAAahK,OAGxBkL,GAAUzU,oBAAoBrZ,GACtC+Z,OAAO/G,KACd,IACAO,GAAaY,GAAG9gB,OAAQ05B,IAAuB,KAC7C,IAAK,MAAMhgB,KAAYkN,GAAerU,KAAKunB,IACzCW,GAAUzU,oBAAoBtM,GAAU8V,MAC1C,IAEFtP,GAAaY,GAAG9gB,OAAQo6B,IAAc,KACpC,IAAK,MAAMz6B,KAAWinB,GAAerU,KAAK,gDACG,UAAvClN,iBAAiB1F,GAASiC,UAC5B64B,GAAUzU,oBAAoBrmB,GAAS4vB,MAE3C,IAEF5J,GAAqB8U,IAKrBze,GAAmBye,IAQnB,MAAME,GAAgB,IAAIjkB,IAAI,CAAC,aAAc,OAAQ,OAAQ,WAAY,WAAY,SAAU,MAAO,eAQhGkkB,GAAmB,iEAOnBC,GAAmB,qIAEnBC,GAAmB,CAAC34B,EAAW44B,KACnC,MAAMC,EAAgB74B,EAAUvC,SAASC,cAEzC,OAAIk7B,EAAqBlhB,SAASmhB,IAC5BL,GAAc5jB,IAAIikB,IACbva,QAAQma,GAAiBn3B,KAAKtB,EAAU84B,YAAcJ,GAAiBp3B,KAAKtB,EAAU84B,YAO1FF,EAAqBx0B,QAAO20B,GAAkBA,aAA0BxW,SAAQ7R,MAAKsoB,GAASA,EAAM13B,KAAKu3B,IAAe,EAG3HI,GAAmB,CAEvB,IAAK,CAAC,QAAS,MAAO,KAAM,OAAQ,OAjCP,kBAkC7BnqB,EAAG,CAAC,SAAU,OAAQ,QAAS,OAC/BoqB,KAAM,GACNnqB,EAAG,GACHoqB,GAAI,GACJC,IAAK,GACLC,KAAM,GACNC,IAAK,GACLC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJxqB,EAAG,GACHgb,IAAK,CAAC,MAAO,SAAU,MAAO,QAAS,QAAS,UAChDyP,GAAI,GACJC,GAAI,GACJC,EAAG,GACHC,IAAK,GACLC,EAAG,GACHC,MAAO,GACPC,KAAM,GACNC,IAAK,GACLC,IAAK,GACLC,OAAQ,GACRC,EAAG,GACHC,GAAI,IA+CAC,GAAY,CAChBC,UAAW3B,GACX4B,QAAS,CAAC,EAEVC,WAAY,GACZhwB,MAAM,EACNiwB,UAAU,EACVC,WAAY,KACZC,SAAU,eAENC,GAAgB,CACpBN,UAAW,SACXC,QAAS,SACTC,WAAY,oBACZhwB,KAAM,UACNiwB,SAAU,UACVC,WAAY,kBACZC,SAAU,UAENE,GAAqB,CACzBC,MAAO,iCACP7jB,SAAU,oBAMZ,MAAM8jB,WAAwB7Z,GAC5BU,YAAYL,GACVc,QACAnF,KAAKqF,QAAUrF,KAAKoE,WAAWC,EACjC,CAGWJ,qBACT,OAAOkZ,EACT,CAEWjZ,yBACT,OAAOwZ,EACT,CAEWjhB,kBACT,MA5CW,iBA6Cb,CAGAqhB,aACE,OAAOrgC,OAAO0hB,OAAOa,KAAKqF,QAAQgY,SAAS95B,KAAI8gB,GAAUrE,KAAK+d,yBAAyB1Z,KAASzd,OAAOka,QACzG,CAEAkd,aACE,OAAOhe,KAAK8d,aAAa3sB,OAAS,CACpC,CAEA8sB,cAAcZ,GAMZ,OALArd,KAAKke,cAAcb,GAEnBrd,KAAKqF,QAAQgY,QAAU,IAAKrd,KAAKqF,QAAQgY,WACpCA,GAEErd,IACT,CAEAme,SACE,MAAMC,EAAkBt4B,SAASswB,cAAc,OAC/CgI,EAAgBC,UAAYre,KAAKse,eAAete,KAAKqF,QAAQoY,UAE7D,IAAK,MAAO1jB,EAAUwkB,KAAS9gC,OAAO4kB,QAAQrC,KAAKqF,QAAQgY,SACzDrd,KAAKwe,YAAYJ,EAAiBG,EAAMxkB,GAG1C,MAAM0jB,EAAWW,EAAgBjX,SAAS,GAEpCmW,EAAatd,KAAK+d,yBAAyB/d,KAAKqF,QAAQiY,YAM9D,OAJIA,GACFG,EAASjiB,UAAUtE,OAAOomB,EAAW36B,MAAM,MAGtC86B,CACT,CAGAjZ,iBAAiBH,GACfc,MAAMX,iBAAiBH,GAEvBrE,KAAKke,cAAc7Z,EAAOgZ,QAC5B,CAEAa,cAAcO,GACZ,IAAK,MAAO1kB,EAAUsjB,KAAY5/B,OAAO4kB,QAAQoc,GAC/CtZ,MAAMX,iBAAiB,CACrBzK,WACA6jB,MAAOP,GACNM,GAEP,CAEAa,YAAYf,EAAUJ,EAAStjB,GAC7B,MAAM2kB,EAAkBzX,GAAeC,QAAQnN,EAAU0jB,GAEpDiB,KAILrB,EAAUrd,KAAK+d,yBAAyBV,IAOpC,GAAUA,GACZrd,KAAK2e,sBAAsB9jB,GAAWwiB,GAAUqB,GAK9C1e,KAAKqF,QAAQ/X,KACfoxB,EAAgBL,UAAYre,KAAKse,eAAejB,GAIlDqB,EAAgBE,YAAcvB,EAf5BqB,EAAgB3b,SAgBpB,CAEAub,eAAeG,GACb,OAAOze,KAAKqF,QAAQkY,SA7KxB,SAAsBsB,EAAYzB,EAAW0B,GAC3C,IAAKD,EAAW1tB,OACd,OAAO0tB,EAGT,GAAIC,GAAgD,mBAArBA,EAC7B,OAAOA,EAAiBD,GAG1B,MACME,GADY,IAAI1+B,OAAO2+B,WACKC,gBAAgBJ,EAAY,aACxDv9B,EAAW,GAAGlC,UAAU2/B,EAAgBpyB,KAAKyT,iBAAiB,MAEpE,IAAK,MAAMpgB,KAAWsB,EAAU,CAC9B,MAAM49B,EAAcl/B,EAAQC,SAASC,cAErC,IAAKzC,OAAO4D,KAAK+7B,GAAWljB,SAASglB,GAAc,CACjDl/B,EAAQ+iB,SACR,QACF,CAEA,MAAMoc,EAAgB,GAAG//B,UAAUY,EAAQ0B,YACrC09B,EAAoB,GAAGhgC,OAAOg+B,EAAU,MAAQ,GAAIA,EAAU8B,IAAgB,IAEpF,IAAK,MAAM18B,KAAa28B,EACjBhE,GAAiB34B,EAAW48B,IAC/Bp/B,EAAQ4B,gBAAgBY,EAAUvC,SAGxC,CAEA,OAAO8+B,EAAgBpyB,KAAK0xB,SAC9B,CA6ImCgB,CAAaZ,EAAKze,KAAKqF,QAAQ+X,UAAWpd,KAAKqF,QAAQmY,YAAciB,CACtG,CAEAV,yBAAyBU,GACvB,MAAsB,mBAARA,EAAqBA,EAAIze,MAAQye,CACjD,CAEAE,sBAAsB3+B,EAAS0+B,GAC7B,GAAI1e,KAAKqF,QAAQ/X,KAGf,OAFAoxB,EAAgBL,UAAY,QAC5BK,EAAgBrI,OAAOr2B,GAIzB0+B,EAAgBE,YAAc5+B,EAAQ4+B,WACxC,EAcF,MACMU,GAAwB,IAAIvoB,IAAI,CAAC,WAAY,YAAa,eAC1DwoB,GAAoB,OAEpBC,GAAoB,OAEpBC,GAAiB,SACjBC,GAAmB,gBACnBC,GAAgB,QAChBC,GAAgB,QAahBC,GAAgB,CACpBC,KAAM,OACNC,IAAK,MACLC,MAAO7jB,KAAU,OAAS,QAC1B8jB,OAAQ,SACRC,KAAM/jB,KAAU,QAAU,QAEtBgkB,GAAY,CAChB/C,UAAW3B,GACX2E,WAAW,EACX1xB,SAAU,kBACV2xB,WAAW,EACXC,YAAa,GACbC,MAAO,EACP9vB,mBAAoB,CAAC,MAAO,QAAS,SAAU,QAC/CnD,MAAM,EACN7E,OAAQ,CAAC,EAAG,GACZtJ,UAAW,MACX8yB,aAAc,KACdsL,UAAU,EACVC,WAAY,KACZzjB,UAAU,EACV0jB,SAAU,+GACV+C,MAAO,GACP/e,QAAS,eAELgf,GAAgB,CACpBrD,UAAW,SACXgD,UAAW,UACX1xB,SAAU,mBACV2xB,UAAW,2BACXC,YAAa,oBACbC,MAAO,kBACP9vB,mBAAoB,QACpBnD,KAAM,UACN7E,OAAQ,0BACRtJ,UAAW,oBACX8yB,aAAc,yBACdsL,SAAU,UACVC,WAAY,kBACZzjB,SAAU,mBACV0jB,SAAU,SACV+C,MAAO,4BACP/e,QAAS,UAMX,MAAMif,WAAgBxb,GACpBR,YAAY1kB,EAASqkB,GACnB,QAAsB,IAAX,EACT,MAAM,IAAIW,UAAU,+DAGtBG,MAAMnlB,EAASqkB,GAEfrE,KAAK2gB,YAAa,EAClB3gB,KAAK4gB,SAAW,EAChB5gB,KAAK6gB,WAAa,KAClB7gB,KAAK8gB,eAAiB,CAAC,EACvB9gB,KAAKoS,QAAU,KACfpS,KAAK+gB,iBAAmB,KACxB/gB,KAAKghB,YAAc,KAEnBhhB,KAAKihB,IAAM,KAEXjhB,KAAKkhB,gBAEAlhB,KAAKqF,QAAQtL,UAChBiG,KAAKmhB,WAET,CAGWld,qBACT,OAAOkc,EACT,CAEWjc,yBACT,OAAOuc,EACT,CAEWhkB,kBACT,MA1GW,SA2Gb,CAGA2kB,SACEphB,KAAK2gB,YAAa,CACpB,CAEAU,UACErhB,KAAK2gB,YAAa,CACpB,CAEAW,gBACEthB,KAAK2gB,YAAc3gB,KAAK2gB,UAC1B,CAEA5Z,SACO/G,KAAK2gB,aAIV3gB,KAAK8gB,eAAeS,OAASvhB,KAAK8gB,eAAeS,MAE7CvhB,KAAK2P,WACP3P,KAAKwhB,SAKPxhB,KAAKyhB,SACP,CAEAlc,UACE0H,aAAajN,KAAK4gB,UAClBrgB,GAAaC,IAAIR,KAAKoF,SAASjK,QAAQskB,IAAiBC,GAAkB1f,KAAK0hB,mBAE3E1hB,KAAKoF,SAASpL,aAAa,2BAC7BgG,KAAKoF,SAASvjB,aAAa,QAASme,KAAKoF,SAASpL,aAAa,2BAGjEgG,KAAK2hB,iBAELxc,MAAMI,SACR,CAEAsK,OACE,GAAoC,SAAhC7P,KAAKoF,SAAS5jB,MAAMwwB,QACtB,MAAM,IAAI7N,MAAM,uCAGlB,IAAMnE,KAAK4hB,mBAAoB5hB,KAAK2gB,WAClC,OAGF,MAAMhH,EAAYpZ,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UAlJtD,SAqJXkU,GAFalmB,GAAeqE,KAAKoF,WAELpF,KAAKoF,SAAS7kB,cAAcwF,iBAAiBd,SAAS+a,KAAKoF,UAE7F,GAAIuU,EAAU9X,mBAAqBggB,EACjC,OAIF7hB,KAAK2hB,iBAEL,MAAMV,EAAMjhB,KAAK8hB,iBAEjB9hB,KAAKoF,SAASvjB,aAAa,mBAAoBo/B,EAAIjnB,aAAa,OAEhE,MAAM,UACJqmB,GACErgB,KAAKqF,QAaT,GAXKrF,KAAKoF,SAAS7kB,cAAcwF,gBAAgBd,SAAS+a,KAAKihB,OAC7DZ,EAAUhK,OAAO4K,GACjB1gB,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UAtKpC,cAyKnB3N,KAAKoS,QAAUpS,KAAKyS,cAAcwO,GAClCA,EAAIzlB,UAAUtE,IAAIsoB,IAKd,iBAAkB15B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAKwa,UAC/C5G,GAAaY,GAAGnhB,EAAS,YAAa8b,IAc1CkE,KAAK2F,gBAVY,KACfpF,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UAvLrC,WAyLQ,IAApB3N,KAAK6gB,YACP7gB,KAAKwhB,SAGPxhB,KAAK6gB,YAAa,CAAK,GAGK7gB,KAAKihB,IAAKjhB,KAAKgO,cAC/C,CAEA4B,OACE,GAAK5P,KAAK2P,aAIQpP,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UA3MtD,SA6MH9L,iBAAd,CASA,GALY7B,KAAK8hB,iBAEbtmB,UAAUuH,OAAOyc,IAGjB,iBAAkB15B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAKwa,UAC/C5G,GAAaC,IAAIxgB,EAAS,YAAa8b,IAI3CkE,KAAK8gB,eAA4B,OAAI,EACrC9gB,KAAK8gB,eAAelB,KAAiB,EACrC5f,KAAK8gB,eAAenB,KAAiB,EACrC3f,KAAK6gB,WAAa,KAgBlB7gB,KAAK2F,gBAdY,KACX3F,KAAK+hB,yBAIJ/hB,KAAK6gB,YACR7gB,KAAK2hB,iBAGP3hB,KAAKoF,SAASxjB,gBAAgB,oBAE9B2e,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UA3OpC,WA2O8D,GAGnD3N,KAAKihB,IAAKjhB,KAAKgO,cAhC7C,CAiCF,CAEAxiB,SACMwU,KAAKoS,SACPpS,KAAKoS,QAAQ5mB,QAEjB,CAGAo2B,iBACE,OAAO9gB,QAAQd,KAAKgiB,YACtB,CAEAF,iBAKE,OAJK9hB,KAAKihB,MACRjhB,KAAKihB,IAAMjhB,KAAKiiB,kBAAkBjiB,KAAKghB,aAAehhB,KAAKkiB,2BAGtDliB,KAAKihB,GACd,CAEAgB,kBAAkB5E,GAChB,MAAM4D,EAAMjhB,KAAKmiB,oBAAoB9E,GAASc,SAG9C,IAAK8C,EACH,OAAO,KAGTA,EAAIzlB,UAAUuH,OAAOwc,GAAmBC,IAExCyB,EAAIzlB,UAAUtE,IAAI,MAAM8I,KAAK0E,YAAYjI,aACzC,MAAM2lB,EA92HKC,KACb,GACEA,GAAUz/B,KAAK0/B,MAlBH,IAkBS1/B,KAAK2/B,gBACnBz8B,SAAS08B,eAAeH,IAEjC,OAAOA,CAAM,EAy2HGI,CAAOziB,KAAK0E,YAAYjI,MAAMnc,WAO5C,OANA2gC,EAAIp/B,aAAa,KAAMugC,GAEnBpiB,KAAKgO,eACPiT,EAAIzlB,UAAUtE,IAAIqoB,IAGb0B,CACT,CAEAyB,WAAWrF,GACTrd,KAAKghB,YAAc3D,EAEfrd,KAAK2P,aACP3P,KAAK2hB,iBAEL3hB,KAAK6P,OAET,CAEAsS,oBAAoB9E,GAYlB,OAXIrd,KAAK+gB,iBACP/gB,KAAK+gB,iBAAiB9C,cAAcZ,GAEpCrd,KAAK+gB,iBAAmB,IAAIlD,GAAgB,IAAK7d,KAAKqF,QAGpDgY,UACAC,WAAYtd,KAAK+d,yBAAyB/d,KAAKqF,QAAQib,eAIpDtgB,KAAK+gB,gBACd,CAEAmB,yBACE,MAAO,CACL,iBAA0BliB,KAAKgiB,YAEnC,CAEAA,YACE,OAAOhiB,KAAK+d,yBAAyB/d,KAAKqF,QAAQmb,QAAUxgB,KAAKoF,SAASpL,aAAa,yBACzF,CAGA2oB,6BAA6BvjB,GAC3B,OAAOY,KAAK0E,YAAY2B,oBAAoBjH,EAAMW,eAAgBC,KAAK4iB,qBACzE,CAEA5U,cACE,OAAOhO,KAAKqF,QAAQ+a,WAAapgB,KAAKihB,KAAOjhB,KAAKihB,IAAIzlB,UAAUvW,SAASs6B,GAC3E,CAEA5P,WACE,OAAO3P,KAAKihB,KAAOjhB,KAAKihB,IAAIzlB,UAAUvW,SAASu6B,GACjD,CAEA/M,cAAcwO,GACZ,MAAM9hC,EAA8C,mBAA3B6gB,KAAKqF,QAAQlmB,UAA2B6gB,KAAKqF,QAAQlmB,UAAUlB,KAAK+hB,KAAMihB,EAAKjhB,KAAKoF,UAAYpF,KAAKqF,QAAQlmB,UAChI0jC,EAAahD,GAAc1gC,EAAU8lB,eAC3C,OAAO,GAAoBjF,KAAKoF,SAAU6b,EAAKjhB,KAAK6S,iBAAiBgQ,GACvE,CAEA5P,aACE,MAAM,OACJxqB,GACEuX,KAAKqF,QAET,MAAsB,iBAAX5c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAASmf,OAAO+P,SAASlvB,EAAO,MAGzC,mBAAXqK,EACFyqB,GAAczqB,EAAOyqB,EAAYlT,KAAKoF,UAGxC3c,CACT,CAEAs1B,yBAAyBU,GACvB,MAAsB,mBAARA,EAAqBA,EAAIxgC,KAAK+hB,KAAKoF,UAAYqZ,CAC/D,CAEA5L,iBAAiBgQ,GACf,MAAM1P,EAAwB,CAC5Bh0B,UAAW0jC,EACXhsB,UAAW,CAAC,CACV9V,KAAM,OACNmB,QAAS,CACPuO,mBAAoBuP,KAAKqF,QAAQ5U,qBAElC,CACD1P,KAAM,SACNmB,QAAS,CACPuG,OAAQuX,KAAKiT,eAEd,CACDlyB,KAAM,kBACNmB,QAAS,CACPwM,SAAUsR,KAAKqF,QAAQ3W,WAExB,CACD3N,KAAM,QACNmB,QAAS,CACPlC,QAAS,IAAIggB,KAAK0E,YAAYjI,eAE/B,CACD1b,KAAM,kBACNC,SAAS,EACTC,MAAO,aACPC,GAAI4J,IAGFkV,KAAK8hB,iBAAiBjgC,aAAa,wBAAyBiJ,EAAK1J,MAAMjC,UAAU,KAIvF,MAAO,IAAKg0B,KAC+B,mBAA9BnT,KAAKqF,QAAQ4M,aAA8BjS,KAAKqF,QAAQ4M,aAAakB,GAAyBnT,KAAKqF,QAAQ4M,aAE1H,CAEAiP,gBACE,MAAM4B,EAAW9iB,KAAKqF,QAAQ5D,QAAQ9e,MAAM,KAE5C,IAAK,MAAM8e,KAAWqhB,EACpB,GAAgB,UAAZrhB,EACFlB,GAAaY,GAAGnB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UA3YlC,SA2Y4D3N,KAAKqF,QAAQtL,UAAUqF,IAC/EY,KAAK2iB,6BAA6BvjB,GAE1C2H,QAAQ,SAEb,GAtZU,WAsZNtF,EAA4B,CACrC,MAAMshB,EAAUthB,IAAYke,GAAgB3f,KAAK0E,YAAYiJ,UA9Y5C,cA8Y0E3N,KAAK0E,YAAYiJ,UAhZ5F,WAiZVqV,EAAWvhB,IAAYke,GAAgB3f,KAAK0E,YAAYiJ,UA9Y7C,cA8Y2E3N,KAAK0E,YAAYiJ,UAhZ5F,YAiZjBpN,GAAaY,GAAGnB,KAAKoF,SAAU2d,EAAS/iB,KAAKqF,QAAQtL,UAAUqF,IAC7D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAElDkU,EAAQwN,eAA8B,YAAf1hB,EAAMqB,KAAqBmf,GAAgBD,KAAiB,EAEnFrM,EAAQmO,QAAQ,IAElBlhB,GAAaY,GAAGnB,KAAKoF,SAAU4d,EAAUhjB,KAAKqF,QAAQtL,UAAUqF,IAC9D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAElDkU,EAAQwN,eAA8B,aAAf1hB,EAAMqB,KAAsBmf,GAAgBD,IAAiBrM,EAAQlO,SAASngB,SAASma,EAAMU,eAEpHwT,EAAQkO,QAAQ,GAEpB,CAGFxhB,KAAK0hB,kBAAoB,KACnB1hB,KAAKoF,UACPpF,KAAK4P,MACP,EAGFrP,GAAaY,GAAGnB,KAAKoF,SAASjK,QAAQskB,IAAiBC,GAAkB1f,KAAK0hB,kBAChF,CAEAP,YACE,MAAMX,EAAQxgB,KAAKoF,SAASpL,aAAa,SAEpCwmB,IAIAxgB,KAAKoF,SAASpL,aAAa,eAAkBgG,KAAKoF,SAASwZ,YAAYxkB,QAC1E4F,KAAKoF,SAASvjB,aAAa,aAAc2+B,GAG3CxgB,KAAKoF,SAASvjB,aAAa,yBAA0B2+B,GAGrDxgB,KAAKoF,SAASxjB,gBAAgB,SAChC,CAEA6/B,SACMzhB,KAAK2P,YAAc3P,KAAK6gB,WAC1B7gB,KAAK6gB,YAAa,GAIpB7gB,KAAK6gB,YAAa,EAElB7gB,KAAKijB,aAAY,KACXjjB,KAAK6gB,YACP7gB,KAAK6P,MACP,GACC7P,KAAKqF,QAAQkb,MAAM1Q,MACxB,CAEA2R,SACMxhB,KAAK+hB,yBAIT/hB,KAAK6gB,YAAa,EAElB7gB,KAAKijB,aAAY,KACVjjB,KAAK6gB,YACR7gB,KAAK4P,MACP,GACC5P,KAAKqF,QAAQkb,MAAM3Q,MACxB,CAEAqT,YAAYrlB,EAASslB,GACnBjW,aAAajN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW/iB,WAAWD,EAASslB,EACtC,CAEAnB,uBACE,OAAOtkC,OAAO0hB,OAAOa,KAAK8gB,gBAAgB5mB,UAAS,EACrD,CAEAkK,WAAWC,GACT,MAAM8e,EAAiB5f,GAAYG,kBAAkB1D,KAAKoF,UAE1D,IAAK,MAAMge,KAAiB3lC,OAAO4D,KAAK8hC,GAClC7D,GAAsBloB,IAAIgsB,WACrBD,EAAeC,GAY1B,OARA/e,EAAS,IAAK8e,KACU,iBAAX9e,GAAuBA,EAASA,EAAS,CAAC,GAEvDA,EAASrE,KAAKsE,gBAAgBD,GAC9BA,EAASrE,KAAKuE,kBAAkBF,GAEhCrE,KAAKwE,iBAAiBH,GAEfA,CACT,CAEAE,kBAAkBF,GAkBhB,OAjBAA,EAAOgc,WAAiC,IAArBhc,EAAOgc,UAAsBv6B,SAAS6G,KAAOkO,GAAWwJ,EAAOgc,WAEtD,iBAAjBhc,EAAOkc,QAChBlc,EAAOkc,MAAQ,CACb1Q,KAAMxL,EAAOkc,MACb3Q,KAAMvL,EAAOkc,QAIW,iBAAjBlc,EAAOmc,QAChBnc,EAAOmc,MAAQnc,EAAOmc,MAAMlgC,YAGA,iBAAnB+jB,EAAOgZ,UAChBhZ,EAAOgZ,QAAUhZ,EAAOgZ,QAAQ/8B,YAG3B+jB,CACT,CAEAue,qBACE,MAAMve,EAAS,CAAC,EAEhB,IAAK,MAAM9mB,KAAOyiB,KAAKqF,QACjBrF,KAAK0E,YAAYT,QAAQ1mB,KAASyiB,KAAKqF,QAAQ9nB,KACjD8mB,EAAO9mB,GAAOyiB,KAAKqF,QAAQ9nB,IAS/B,OALA8mB,EAAOtK,UAAW,EAClBsK,EAAO5C,QAAU,SAIV4C,CACT,CAEAsd,iBACM3hB,KAAKoS,UACPpS,KAAKoS,QAAQ3Y,UAEbuG,KAAKoS,QAAU,MAGbpS,KAAKihB,MACPjhB,KAAKihB,IAAIle,SACT/C,KAAKihB,IAAM,KAEf,CAGApb,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAO41B,GAAQra,oBAAoBrG,KAAMqE,GAE/C,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,EAQFhI,GAAmBqkB,IAYnB,MAGM2C,GAAY,IAAK3C,GAAQzc,QAC7BoZ,QAAS,GACT50B,OAAQ,CAAC,EAAG,GACZtJ,UAAW,QACXs+B,SAAU,8IACVhc,QAAS,SAEL6hB,GAAgB,IAAK5C,GAAQxc,YACjCmZ,QAAS,kCAMX,MAAMkG,WAAgB7C,GAETzc,qBACT,OAAOof,EACT,CAEWnf,yBACT,OAAOof,EACT,CAEW7mB,kBACT,MA5BW,SA6Bb,CAGAmlB,iBACE,OAAO5hB,KAAKgiB,aAAehiB,KAAKwjB,aAClC,CAGAtB,yBACE,MAAO,CACL,kBAAkBliB,KAAKgiB,YACvB,gBAAoBhiB,KAAKwjB,cAE7B,CAEAA,cACE,OAAOxjB,KAAK+d,yBAAyB/d,KAAKqF,QAAQgY,QACpD,CAGAxX,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOy4B,GAAQld,oBAAoBrG,KAAMqE,GAE/C,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,EAQFhI,GAAmBknB,IAYnB,MAEME,GAAc,gBAEdC,GAAiB,WAAWD,KAC5BE,GAAc,QAAQF,KACtBG,GAAwB,OAAOH,cAE/BI,GAAsB,SAEtBC,GAAwB,SAExBC,GAAqB,YAGrBC,GAAsB,GAAGD,mBAA+CA,uBAGxEE,GAAY,CAChBx7B,OAAQ,KAERy7B,WAAY,eACZC,cAAc,EACdn3B,OAAQ,KACRo3B,UAAW,CAAC,GAAK,GAAK,IAElBC,GAAgB,CACpB57B,OAAQ,gBAERy7B,WAAY,SACZC,aAAc,UACdn3B,OAAQ,UACRo3B,UAAW,SAMb,MAAME,WAAkBpf,GACtBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GAEfrE,KAAKukB,aAAe,IAAI5yB,IACxBqO,KAAKwkB,oBAAsB,IAAI7yB,IAC/BqO,KAAKykB,aAA6D,YAA9C/+B,iBAAiBsa,KAAKoF,UAAU3Y,UAA0B,KAAOuT,KAAKoF,SAC1FpF,KAAK0kB,cAAgB,KACrB1kB,KAAK2kB,UAAY,KACjB3kB,KAAK4kB,oBAAsB,CACzBC,gBAAiB,EACjBC,gBAAiB,GAEnB9kB,KAAK+kB,SACP,CAGW9gB,qBACT,OAAOggB,EACT,CAEW/f,yBACT,OAAOmgB,EACT,CAEW5nB,kBACT,MAhEW,WAiEb,CAGAsoB,UACE/kB,KAAKglB,mCAELhlB,KAAKilB,2BAEDjlB,KAAK2kB,UACP3kB,KAAK2kB,UAAUO,aAEfllB,KAAK2kB,UAAY3kB,KAAKmlB,kBAGxB,IAAK,MAAMC,KAAWplB,KAAKwkB,oBAAoBrlB,SAC7Ca,KAAK2kB,UAAUU,QAAQD,EAE3B,CAEA7f,UACEvF,KAAK2kB,UAAUO,aAEf/f,MAAMI,SACR,CAGAhB,kBAAkBF,GAUhB,OARAA,EAAOrX,OAAS6N,GAAWwJ,EAAOrX,SAAWlH,SAAS6G,KAEtD0X,EAAO6f,WAAa7f,EAAO5b,OAAS,GAAG4b,EAAO5b,oBAAsB4b,EAAO6f,WAE3C,iBAArB7f,EAAO+f,YAChB/f,EAAO+f,UAAY/f,EAAO+f,UAAUzhC,MAAM,KAAKY,KAAInF,GAASmf,OAAOC,WAAWpf,MAGzEimB,CACT,CAEA4gB,2BACOjlB,KAAKqF,QAAQ8e,eAKlB5jB,GAAaC,IAAIR,KAAKqF,QAAQrY,OAAQ22B,IACtCpjB,GAAaY,GAAGnB,KAAKqF,QAAQrY,OAAQ22B,GAAaG,IAAuB1kB,IACvE,MAAMkmB,EAAoBtlB,KAAKwkB,oBAAoB5mC,IAAIwhB,EAAMpS,OAAOtB,MAEpE,GAAI45B,EAAmB,CACrBlmB,EAAM+C,iBACN,MAAMtG,EAAOmE,KAAKykB,cAAgBpkC,OAC5BmE,EAAS8gC,EAAkBxgC,UAAYkb,KAAKoF,SAAStgB,UAE3D,GAAI+W,EAAK0pB,SAKP,YAJA1pB,EAAK0pB,SAAS,CACZnjC,IAAKoC,EACLghC,SAAU,WAMd3pB,EAAK3P,UAAY1H,CACnB,KAEJ,CAEA2gC,kBACE,MAAMjjC,EAAU,CACd2Z,KAAMmE,KAAKykB,aACXL,UAAWpkB,KAAKqF,QAAQ+e,UACxBF,WAAYlkB,KAAKqF,QAAQ6e,YAE3B,OAAO,IAAIuB,sBAAqBpjB,GAAWrC,KAAK0lB,kBAAkBrjB,IAAUngB,EAC9E,CAGAwjC,kBAAkBrjB,GAChB,MAAMsjB,EAAgB/H,GAAS5d,KAAKukB,aAAa3mC,IAAI,IAAIggC,EAAM5wB,OAAO44B,MAEhE3O,EAAW2G,IACf5d,KAAK4kB,oBAAoBC,gBAAkBjH,EAAM5wB,OAAOlI,UAExDkb,KAAK6lB,SAASF,EAAc/H,GAAO,EAG/BkH,GAAmB9kB,KAAKykB,cAAgB3+B,SAASC,iBAAiBmG,UAClE45B,EAAkBhB,GAAmB9kB,KAAK4kB,oBAAoBE,gBACpE9kB,KAAK4kB,oBAAoBE,gBAAkBA,EAE3C,IAAK,MAAMlH,KAASvb,EAAS,CAC3B,IAAKub,EAAMmI,eAAgB,CACzB/lB,KAAK0kB,cAAgB,KAErB1kB,KAAKgmB,kBAAkBL,EAAc/H,IAErC,QACF,CAEA,MAAMqI,EAA2BrI,EAAM5wB,OAAOlI,WAAakb,KAAK4kB,oBAAoBC,gBAEpF,GAAIiB,GAAmBG,GAGrB,GAFAhP,EAAS2G,IAEJkH,EACH,YAOCgB,GAAoBG,GACvBhP,EAAS2G,EAEb,CACF,CAEAoH,mCACEhlB,KAAKukB,aAAe,IAAI5yB,IACxBqO,KAAKwkB,oBAAsB,IAAI7yB,IAC/B,MAAMu0B,EAAcjf,GAAerU,KAAKkxB,GAAuB9jB,KAAKqF,QAAQrY,QAE5E,IAAK,MAAMm5B,KAAUD,EAAa,CAEhC,IAAKC,EAAOz6B,MAAQ2P,GAAW8qB,GAC7B,SAGF,MAAMb,EAAoBre,GAAeC,QAAQif,EAAOz6B,KAAMsU,KAAKoF,UAE/DtK,GAAUwqB,KACZtlB,KAAKukB,aAAa/xB,IAAI2zB,EAAOz6B,KAAMy6B,GAEnCnmB,KAAKwkB,oBAAoBhyB,IAAI2zB,EAAOz6B,KAAM45B,GAE9C,CACF,CAEAO,SAAS74B,GACHgT,KAAK0kB,gBAAkB13B,IAI3BgT,KAAKgmB,kBAAkBhmB,KAAKqF,QAAQrY,QAEpCgT,KAAK0kB,cAAgB13B,EACrBA,EAAOwO,UAAUtE,IAAI2sB,IAErB7jB,KAAKomB,iBAAiBp5B,GAEtBuT,GAAakB,QAAQzB,KAAKoF,SAAUse,GAAgB,CAClD5jB,cAAe9S,IAEnB,CAEAo5B,iBAAiBp5B,GAEf,GAAIA,EAAOwO,UAAUvW,SAzNQ,iBA0N3BgiB,GAAeC,QAhNc,mBAgNsBla,EAAOmO,QAjNtC,cAiNkEK,UAAUtE,IAAI2sB,SAItG,IAAK,MAAMwC,KAAapf,GAAeI,QAAQra,EA1NnB,qBA6N1B,IAAK,MAAMxJ,KAAQyjB,GAAeM,KAAK8e,EAAWrC,IAChDxgC,EAAKgY,UAAUtE,IAAI2sB,GAGzB,CAEAmC,kBAAkB9gC,GAChBA,EAAOsW,UAAUuH,OAAO8gB,IACxB,MAAMyC,EAAcrf,GAAerU,KAAK,GAAGkxB,MAAyBD,KAAuB3+B,GAE3F,IAAK,MAAM9E,KAAQkmC,EACjBlmC,EAAKob,UAAUuH,OAAO8gB,GAE1B,CAGAhe,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOw5B,GAAUje,oBAAoBrG,KAAMqE,GAEjD,GAAsB,iBAAXA,EAAX,CAIA,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,EAQF9D,GAAaY,GAAG9gB,OAAQujC,IAAuB,KAC7C,IAAK,MAAM2C,KAAOtf,GAAerU,KAtQT,0BAuQtB0xB,GAAUje,oBAAoBkgB,EAChC,IAMFlqB,GAAmBioB,IAYnB,MAEMkC,GAAc,UACdC,GAAe,OAAOD,KACtBE,GAAiB,SAASF,KAC1BG,GAAe,OAAOH,KACtBI,GAAgB,QAAQJ,KACxBK,GAAuB,QAAQL,KAC/BM,GAAgB,UAAUN,KAC1BO,GAAsB,OAAOP,KAC7BQ,GAAiB,YACjBC,GAAkB,aAClBC,GAAe,UACfC,GAAiB,YACjBC,GAAoB,SACpBC,GAAoB,OACpBC,GAAoB,OAIpBC,GAA+B,yBAI/BC,GAAuB,2EAEvBC,GAAsB,YAHOF,uBAAiDA,mBAA6CA,OAG/EC,KAC5CE,GAA8B,IAAIN,8BAA6CA,+BAA8CA,4BAKnI,MAAMO,WAAYziB,GAChBR,YAAY1kB,GACVmlB,MAAMnlB,GACNggB,KAAKqS,QAAUrS,KAAKoF,SAASjK,QAdN,uCAgBlB6E,KAAKqS,UAMVrS,KAAK4nB,sBAAsB5nB,KAAKqS,QAASrS,KAAK6nB,gBAE9CtnB,GAAaY,GAAGnB,KAAKoF,SAAU0hB,IAAe1nB,GAASY,KAAK4M,SAASxN,KACvE,CAGW3C,kBACT,MAlDW,KAmDb,CAGAoT,OAEE,MAAMiY,EAAY9nB,KAAKoF,SAEvB,GAAIpF,KAAK+nB,cAAcD,GACrB,OAIF,MAAME,EAAShoB,KAAKioB,iBAEdC,EAAYF,EAASznB,GAAakB,QAAQumB,EAAQvB,GAAc,CACpE3mB,cAAegoB,IACZ,KACavnB,GAAakB,QAAQqmB,EAAWnB,GAAc,CAC9D7mB,cAAekoB,IAGHnmB,kBAAoBqmB,GAAaA,EAAUrmB,mBAIzD7B,KAAKmoB,YAAYH,EAAQF,GAEzB9nB,KAAKooB,UAAUN,EAAWE,GAC5B,CAGAI,UAAUpoC,EAASqoC,GACZroC,IAILA,EAAQwb,UAAUtE,IAAIkwB,IAEtBpnB,KAAKooB,UAAU9tB,GAAuBta,IAmBtCggB,KAAK2F,gBAhBY,KACsB,QAAjC3lB,EAAQga,aAAa,SAKzBha,EAAQ4B,gBAAgB,YACxB5B,EAAQ6B,aAAa,iBAAiB,GAEtCme,KAAKsoB,gBAAgBtoC,GAAS,GAE9BugB,GAAakB,QAAQzhB,EAAS4mC,GAAe,CAC3C9mB,cAAeuoB,KAVfroC,EAAQwb,UAAUtE,IAAIowB,GAWtB,GAG0BtnC,EAASA,EAAQwb,UAAUvW,SAASoiC,KACpE,CAEAc,YAAYnoC,EAASqoC,GACdroC,IAILA,EAAQwb,UAAUuH,OAAOqkB,IACzBpnC,EAAQ+6B,OAER/a,KAAKmoB,YAAY7tB,GAAuBta,IAmBxCggB,KAAK2F,gBAhBY,KACsB,QAAjC3lB,EAAQga,aAAa,SAKzBha,EAAQ6B,aAAa,iBAAiB,GACtC7B,EAAQ6B,aAAa,WAAY,MAEjCme,KAAKsoB,gBAAgBtoC,GAAS,GAE9BugB,GAAakB,QAAQzhB,EAAS0mC,GAAgB,CAC5C5mB,cAAeuoB,KAVfroC,EAAQwb,UAAUuH,OAAOukB,GAWzB,GAG0BtnC,EAASA,EAAQwb,UAAUvW,SAASoiC,KACpE,CAEAza,SAASxN,GACP,IAAK,CAAC4nB,GAAgBC,GAAiBC,GAAcC,IAAgBjtB,SAASkF,EAAM7hB,KAClF,OAGF6hB,EAAMyU,kBAENzU,EAAM+C,iBACN,MAAMoL,EAAS,CAAC0Z,GAAiBE,IAAgBjtB,SAASkF,EAAM7hB,KAC1DgrC,EAAoBzqB,GAAqBkC,KAAK6nB,eAAejhC,QAAO5G,IAAYqb,GAAWrb,KAAWof,EAAMpS,OAAQugB,GAAQ,GAE9Hgb,IACFA,EAAkB7V,MAAM,CACtB8V,eAAe,IAEjBb,GAAIthB,oBAAoBkiB,GAAmB1Y,OAE/C,CAEAgY,eAEE,OAAO5gB,GAAerU,KAAK60B,GAAqBznB,KAAKqS,QACvD,CAEA4V,iBACE,OAAOjoB,KAAK6nB,eAAej1B,MAAKzN,GAAS6a,KAAK+nB,cAAc5iC,MAAW,IACzE,CAEAyiC,sBAAsB1iC,EAAQiiB,GAC5BnH,KAAKyoB,yBAAyBvjC,EAAQ,OAAQ,WAE9C,IAAK,MAAMC,KAASgiB,EAClBnH,KAAK0oB,6BAA6BvjC,EAEtC,CAEAujC,6BAA6BvjC,GAC3BA,EAAQ6a,KAAK2oB,iBAAiBxjC,GAE9B,MAAMyjC,EAAW5oB,KAAK+nB,cAAc5iC,GAE9B0jC,EAAY7oB,KAAK8oB,iBAAiB3jC,GAExCA,EAAMtD,aAAa,gBAAiB+mC,GAEhCC,IAAc1jC,GAChB6a,KAAKyoB,yBAAyBI,EAAW,OAAQ,gBAG9CD,GACHzjC,EAAMtD,aAAa,WAAY,MAGjCme,KAAKyoB,yBAAyBtjC,EAAO,OAAQ,OAG7C6a,KAAK+oB,mCAAmC5jC,EAC1C,CAEA4jC,mCAAmC5jC,GACjC,MAAM6H,EAASsN,GAAuBnV,GAEjC6H,IAILgT,KAAKyoB,yBAAyBz7B,EAAQ,OAAQ,YAE1C7H,EAAMygC,IACR5lB,KAAKyoB,yBAAyBz7B,EAAQ,kBAAmB,IAAI7H,EAAMygC,MAEvE,CAEA0C,gBAAgBtoC,EAASgpC,GACvB,MAAMH,EAAY7oB,KAAK8oB,iBAAiB9oC,GAExC,IAAK6oC,EAAUrtB,UAAUvW,SAxMN,YAyMjB,OAGF,MAAM8hB,EAAS,CAAChN,EAAU2b,KACxB,MAAM11B,EAAUinB,GAAeC,QAAQnN,EAAU8uB,GAE7C7oC,GACFA,EAAQwb,UAAUuL,OAAO2O,EAAWsT,EACtC,EAGFjiB,EAnN6B,mBAmNIqgB,IACjCrgB,EAnN2B,iBAmNIugB,IAC/BuB,EAAUhnC,aAAa,gBAAiBmnC,EAC1C,CAEAP,yBAAyBzoC,EAASwC,EAAWpE,GACtC4B,EAAQ0b,aAAalZ,IACxBxC,EAAQ6B,aAAaW,EAAWpE,EAEpC,CAEA2pC,cAAczY,GACZ,OAAOA,EAAK9T,UAAUvW,SAASmiC,GACjC,CAGAuB,iBAAiBrZ,GACf,OAAOA,EAAKlI,QAAQqgB,IAAuBnY,EAAOrI,GAAeC,QAAQugB,GAAqBnY,EAChG,CAGAwZ,iBAAiBxZ,GACf,OAAOA,EAAKnU,QArOO,gCAqOoBmU,CACzC,CAGAzJ,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAO68B,GAAIthB,oBAAoBrG,MAErC,GAAsB,iBAAXqE,EAAX,CAIA,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,EAQF9D,GAAaY,GAAGrb,SAAU+gC,GAAsBW,IAAsB,SAAUpoB,GAC1E,CAAC,IAAK,QAAQlF,SAAS8F,KAAKoG,UAC9BhH,EAAM+C,iBAGJ9G,GAAW2E,OAIf2nB,GAAIthB,oBAAoBrG,MAAM6P,MAChC,IAKAtP,GAAaY,GAAG9gB,OAAQ0mC,IAAqB,KAC3C,IAAK,MAAM/mC,KAAWinB,GAAerU,KAAK80B,IACxCC,GAAIthB,oBAAoBrmB,EAC1B,IAMFqc,GAAmBsrB,IAYnB,MAEMniB,GAAY,YACZyjB,GAAkB,YAAYzjB,KAC9B0jB,GAAiB,WAAW1jB,KAC5B2jB,GAAgB,UAAU3jB,KAC1B4jB,GAAiB,WAAW5jB,KAC5B6jB,GAAa,OAAO7jB,KACpB8jB,GAAe,SAAS9jB,KACxB+jB,GAAa,OAAO/jB,KACpBgkB,GAAc,QAAQhkB,KAEtBikB,GAAkB,OAElBC,GAAkB,OAClBC,GAAqB,UACrBzlB,GAAc,CAClBkc,UAAW,UACXwJ,SAAU,UACVrJ,MAAO,UAEHtc,GAAU,CACdmc,WAAW,EACXwJ,UAAU,EACVrJ,MAAO,KAMT,MAAMsJ,WAAc3kB,GAClBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAK4gB,SAAW,KAChB5gB,KAAK8pB,sBAAuB,EAC5B9pB,KAAK+pB,yBAA0B,EAE/B/pB,KAAKkhB,eACP,CAGWjd,qBACT,OAAOA,EACT,CAEWC,yBACT,OAAOA,EACT,CAEWzH,kBACT,MAlDS,OAmDX,CAGAoT,OACoBtP,GAAakB,QAAQzB,KAAKoF,SAAUmkB,IAExC1nB,mBAId7B,KAAKgqB,gBAEDhqB,KAAKqF,QAAQ+a,WACfpgB,KAAKoF,SAAS5J,UAAUtE,IArDN,QAgEpB8I,KAAKoF,SAAS5J,UAAUuH,OAAO0mB,IAG/B1tB,GAAOiE,KAAKoF,UAEZpF,KAAKoF,SAAS5J,UAAUtE,IAAIwyB,GAAiBC,IAE7C3pB,KAAK2F,gBAfY,KACf3F,KAAKoF,SAAS5J,UAAUuH,OAAO4mB,IAE/BppB,GAAakB,QAAQzB,KAAKoF,SAAUokB,IAEpCxpB,KAAKiqB,oBAAoB,GAUGjqB,KAAKoF,SAAUpF,KAAKqF,QAAQ+a,WAC5D,CAEAxQ,OACO5P,KAAKkqB,YAIQ3pB,GAAakB,QAAQzB,KAAKoF,SAAUikB,IAExCxnB,mBAad7B,KAAKoF,SAAS5J,UAAUtE,IAAIyyB,IAE5B3pB,KAAK2F,gBAXY,KACf3F,KAAKoF,SAAS5J,UAAUtE,IAAIuyB,IAG5BzpB,KAAKoF,SAAS5J,UAAUuH,OAAO4mB,GAAoBD,IAEnDnpB,GAAakB,QAAQzB,KAAKoF,SAAUkkB,GAAa,GAKrBtpB,KAAKoF,SAAUpF,KAAKqF,QAAQ+a,YAC5D,CAEA7a,UACEvF,KAAKgqB,gBAEDhqB,KAAKkqB,WACPlqB,KAAKoF,SAAS5J,UAAUuH,OAAO2mB,IAGjCvkB,MAAMI,SACR,CAEA2kB,UACE,OAAOlqB,KAAKoF,SAAS5J,UAAUvW,SAASykC,GAC1C,CAGAO,qBACOjqB,KAAKqF,QAAQukB,WAId5pB,KAAK8pB,sBAAwB9pB,KAAK+pB,0BAItC/pB,KAAK4gB,SAAW/iB,YAAW,KACzBmC,KAAK4P,MAAM,GACV5P,KAAKqF,QAAQkb,QAClB,CAEA4J,eAAe/qB,EAAOgrB,GACpB,OAAQhrB,EAAMqB,MACZ,IAAK,YACL,IAAK,WAEDT,KAAK8pB,qBAAuBM,EAC5B,MAGJ,IAAK,UACL,IAAK,WAEDpqB,KAAK+pB,wBAA0BK,EAKrC,GAAIA,EAGF,YAFApqB,KAAKgqB,gBAKP,MAAMxc,EAAcpO,EAAMU,cAEtBE,KAAKoF,WAAaoI,GAAexN,KAAKoF,SAASngB,SAASuoB,IAI5DxN,KAAKiqB,oBACP,CAEA/I,gBACE3gB,GAAaY,GAAGnB,KAAKoF,SAAU6jB,IAAiB7pB,GAASY,KAAKmqB,eAAe/qB,GAAO,KACpFmB,GAAaY,GAAGnB,KAAKoF,SAAU8jB,IAAgB9pB,GAASY,KAAKmqB,eAAe/qB,GAAO,KACnFmB,GAAaY,GAAGnB,KAAKoF,SAAU+jB,IAAe/pB,GAASY,KAAKmqB,eAAe/qB,GAAO,KAClFmB,GAAaY,GAAGnB,KAAKoF,SAAUgkB,IAAgBhqB,GAASY,KAAKmqB,eAAe/qB,GAAO,IACrF,CAEA4qB,gBACE/c,aAAajN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW,IAClB,CAGA/a,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAO++B,GAAMxjB,oBAAoBrG,KAAMqE,GAE7C,GAAsB,iBAAXA,EAAqB,CAC9B,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,GAAQrE,KACf,CACF,GACF,ECxjKK,IAAuBzD,GDgkK9ByJ,GAAqB6jB,IAKrBxtB,GAAmBwtB,ICrkKWttB,GCK9B,WAC2B,GAAG1J,MAAM5U,KAChC6H,SAASsa,iBAAiB,+BAET7c,KAAI,SAAU8mC,GAC/B,OAAO,IAAI3J,GAAQ2J,EAAkB,CAAE9J,MAAO,CAAE1Q,KAAM,IAAKD,KAAM,MACnE,GACF,EDX6B,WAAvB9pB,SAASgX,WAAyBP,KACjCzW,SAASyF,iBAAiB,mBAAoBgR","sources":["webpack://pydata_sphinx_theme/webpack/bootstrap","webpack://pydata_sphinx_theme/webpack/runtime/define property getters","webpack://pydata_sphinx_theme/webpack/runtime/hasOwnProperty shorthand","webpack://pydata_sphinx_theme/webpack/runtime/make namespace object","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/enums.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/instanceOf.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/applyStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getBasePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/math.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/userAgent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isLayoutViewport.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getBoundingClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getLayoutRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/contains.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getComputedStyle.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isTableElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getParentNode.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getOffsetParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getMainAxisFromPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/within.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergePaddingObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getFreshSideObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/expandToHashMap.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/arrow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getVariation.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/computeStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/eventListeners.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositeVariationPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScrollBarX.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/listScrollParents.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/rectToClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getClippingRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getViewportRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/detectOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/flip.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeAutoPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/hide.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/offset.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/popperOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/preventOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getAltAxis.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getCompositeRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getHTMLElementScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/orderModifiers.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/createPopper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/debounce.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergeByName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper-lite.js","webpack://pydata_sphinx_theme/./node_modules/bootstrap/dist/js/bootstrap.esm.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/mixin.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/bootstrap.js"],"sourcesContent":["// The require scope\nvar __webpack_require__ = {};\n\n","// define getter functions for harmony exports\n__webpack_require__.d = (exports, definition) => {\n\tfor(var key in definition) {\n\t\tif(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {\n\t\t\tObject.defineProperty(exports, key, { enumerable: true, get: definition[key] });\n\t\t}\n\t}\n};","__webpack_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop))","// define __esModule on exports\n__webpack_require__.r = (exports) => {\n\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n\t}\n\tObject.defineProperty(exports, '__esModule', { value: true });\n};","export var top = 'top';\nexport var bottom = 'bottom';\nexport var right = 'right';\nexport var left = 'left';\nexport var auto = 'auto';\nexport var basePlacements = [top, bottom, right, left];\nexport var start = 'start';\nexport var end = 'end';\nexport var clippingParents = 'clippingParents';\nexport var viewport = 'viewport';\nexport var popper = 'popper';\nexport var reference = 'reference';\nexport var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {\n return acc.concat([placement + \"-\" + start, placement + \"-\" + end]);\n}, []);\nexport var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {\n return acc.concat([placement, placement + \"-\" + start, placement + \"-\" + end]);\n}, []); // modifiers that need to read the DOM\n\nexport var beforeRead = 'beforeRead';\nexport var read = 'read';\nexport var afterRead = 'afterRead'; // pure-logic modifiers\n\nexport var beforeMain = 'beforeMain';\nexport var main = 'main';\nexport var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)\n\nexport var beforeWrite = 'beforeWrite';\nexport var write = 'write';\nexport var afterWrite = 'afterWrite';\nexport var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];","export default function getNodeName(element) {\n return element ? (element.nodeName || '').toLowerCase() : null;\n}","export default function getWindow(node) {\n if (node == null) {\n return window;\n }\n\n if (node.toString() !== '[object Window]') {\n var ownerDocument = node.ownerDocument;\n return ownerDocument ? ownerDocument.defaultView || window : window;\n }\n\n return node;\n}","import getWindow from \"./getWindow.js\";\n\nfunction isElement(node) {\n var OwnElement = getWindow(node).Element;\n return node instanceof OwnElement || node instanceof Element;\n}\n\nfunction isHTMLElement(node) {\n var OwnElement = getWindow(node).HTMLElement;\n return node instanceof OwnElement || node instanceof HTMLElement;\n}\n\nfunction isShadowRoot(node) {\n // IE 11 has no ShadowRoot\n if (typeof ShadowRoot === 'undefined') {\n return false;\n }\n\n var OwnElement = getWindow(node).ShadowRoot;\n return node instanceof OwnElement || node instanceof ShadowRoot;\n}\n\nexport { isElement, isHTMLElement, isShadowRoot };","import getNodeName from \"../dom-utils/getNodeName.js\";\nimport { isHTMLElement } from \"../dom-utils/instanceOf.js\"; // This modifier takes the styles prepared by the `computeStyles` modifier\n// and applies them to the HTMLElements such as popper and arrow\n\nfunction applyStyles(_ref) {\n var state = _ref.state;\n Object.keys(state.elements).forEach(function (name) {\n var style = state.styles[name] || {};\n var attributes = state.attributes[name] || {};\n var element = state.elements[name]; // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n } // Flow doesn't support to extend this property, but it's the most\n // effective way to apply styles to an HTMLElement\n // $FlowFixMe[cannot-write]\n\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (name) {\n var value = attributes[name];\n\n if (value === false) {\n element.removeAttribute(name);\n } else {\n element.setAttribute(name, value === true ? '' : value);\n }\n });\n });\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state;\n var initialStyles = {\n popper: {\n position: state.options.strategy,\n left: '0',\n top: '0',\n margin: '0'\n },\n arrow: {\n position: 'absolute'\n },\n reference: {}\n };\n Object.assign(state.elements.popper.style, initialStyles.popper);\n state.styles = initialStyles;\n\n if (state.elements.arrow) {\n Object.assign(state.elements.arrow.style, initialStyles.arrow);\n }\n\n return function () {\n Object.keys(state.elements).forEach(function (name) {\n var element = state.elements[name];\n var attributes = state.attributes[name] || {};\n var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them\n\n var style = styleProperties.reduce(function (style, property) {\n style[property] = '';\n return style;\n }, {}); // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n }\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (attribute) {\n element.removeAttribute(attribute);\n });\n });\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'applyStyles',\n enabled: true,\n phase: 'write',\n fn: applyStyles,\n effect: effect,\n requires: ['computeStyles']\n};","import { auto } from \"../enums.js\";\nexport default function getBasePlacement(placement) {\n return placement.split('-')[0];\n}","export var max = Math.max;\nexport var min = Math.min;\nexport var round = Math.round;","export default function getUAString() {\n var uaData = navigator.userAgentData;\n\n if (uaData != null && uaData.brands && Array.isArray(uaData.brands)) {\n return uaData.brands.map(function (item) {\n return item.brand + \"/\" + item.version;\n }).join(' ');\n }\n\n return navigator.userAgent;\n}","import getUAString from \"../utils/userAgent.js\";\nexport default function isLayoutViewport() {\n return !/^((?!chrome|android).)*safari/i.test(getUAString());\n}","import { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport { round } from \"../utils/math.js\";\nimport getWindow from \"./getWindow.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getBoundingClientRect(element, includeScale, isFixedStrategy) {\n if (includeScale === void 0) {\n includeScale = false;\n }\n\n if (isFixedStrategy === void 0) {\n isFixedStrategy = false;\n }\n\n var clientRect = element.getBoundingClientRect();\n var scaleX = 1;\n var scaleY = 1;\n\n if (includeScale && isHTMLElement(element)) {\n scaleX = element.offsetWidth > 0 ? round(clientRect.width) / element.offsetWidth || 1 : 1;\n scaleY = element.offsetHeight > 0 ? round(clientRect.height) / element.offsetHeight || 1 : 1;\n }\n\n var _ref = isElement(element) ? getWindow(element) : window,\n visualViewport = _ref.visualViewport;\n\n var addVisualOffsets = !isLayoutViewport() && isFixedStrategy;\n var x = (clientRect.left + (addVisualOffsets && visualViewport ? visualViewport.offsetLeft : 0)) / scaleX;\n var y = (clientRect.top + (addVisualOffsets && visualViewport ? visualViewport.offsetTop : 0)) / scaleY;\n var width = clientRect.width / scaleX;\n var height = clientRect.height / scaleY;\n return {\n width: width,\n height: height,\n top: y,\n right: x + width,\n bottom: y + height,\n left: x,\n x: x,\n y: y\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\"; // Returns the layout rect of an element relative to its offsetParent. Layout\n// means it doesn't take into account transforms.\n\nexport default function getLayoutRect(element) {\n var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed.\n // Fixes https://github.com/popperjs/popper-core/issues/1223\n\n var width = element.offsetWidth;\n var height = element.offsetHeight;\n\n if (Math.abs(clientRect.width - width) <= 1) {\n width = clientRect.width;\n }\n\n if (Math.abs(clientRect.height - height) <= 1) {\n height = clientRect.height;\n }\n\n return {\n x: element.offsetLeft,\n y: element.offsetTop,\n width: width,\n height: height\n };\n}","import { isShadowRoot } from \"./instanceOf.js\";\nexport default function contains(parent, child) {\n var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method\n\n if (parent.contains(child)) {\n return true;\n } // then fallback to custom implementation with Shadow DOM support\n else if (rootNode && isShadowRoot(rootNode)) {\n var next = child;\n\n do {\n if (next && parent.isSameNode(next)) {\n return true;\n } // $FlowFixMe[prop-missing]: need a better way to handle this...\n\n\n next = next.parentNode || next.host;\n } while (next);\n } // Give up, the result is false\n\n\n return false;\n}","import getWindow from \"./getWindow.js\";\nexport default function getComputedStyle(element) {\n return getWindow(element).getComputedStyle(element);\n}","import getNodeName from \"./getNodeName.js\";\nexport default function isTableElement(element) {\n return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;\n}","import { isElement } from \"./instanceOf.js\";\nexport default function getDocumentElement(element) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing]\n element.document) || window.document).documentElement;\n}","import getNodeName from \"./getNodeName.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport { isShadowRoot } from \"./instanceOf.js\";\nexport default function getParentNode(element) {\n if (getNodeName(element) === 'html') {\n return element;\n }\n\n return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle\n // $FlowFixMe[incompatible-return]\n // $FlowFixMe[prop-missing]\n element.assignedSlot || // step into the shadow DOM of the parent of a slotted node\n element.parentNode || ( // DOM Element detected\n isShadowRoot(element) ? element.host : null) || // ShadowRoot detected\n // $FlowFixMe[incompatible-call]: HTMLElement is a Node\n getDocumentElement(element) // fallback\n\n );\n}","import getWindow from \"./getWindow.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isHTMLElement, isShadowRoot } from \"./instanceOf.js\";\nimport isTableElement from \"./isTableElement.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getUAString from \"../utils/userAgent.js\";\n\nfunction getTrueOffsetParent(element) {\n if (!isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837\n getComputedStyle(element).position === 'fixed') {\n return null;\n }\n\n return element.offsetParent;\n} // `.offsetParent` reports `null` for fixed elements, while absolute elements\n// return the containing block\n\n\nfunction getContainingBlock(element) {\n var isFirefox = /firefox/i.test(getUAString());\n var isIE = /Trident/i.test(getUAString());\n\n if (isIE && isHTMLElement(element)) {\n // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport\n var elementCss = getComputedStyle(element);\n\n if (elementCss.position === 'fixed') {\n return null;\n }\n }\n\n var currentNode = getParentNode(element);\n\n if (isShadowRoot(currentNode)) {\n currentNode = currentNode.host;\n }\n\n while (isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {\n var css = getComputedStyle(currentNode); // This is non-exhaustive but covers the most common CSS properties that\n // create a containing block.\n // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n\n if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') {\n return currentNode;\n } else {\n currentNode = currentNode.parentNode;\n }\n }\n\n return null;\n} // Gets the closest ancestor positioned element. Handles some edge cases,\n// such as table ancestors and cross browser bugs.\n\n\nexport default function getOffsetParent(element) {\n var window = getWindow(element);\n var offsetParent = getTrueOffsetParent(element);\n\n while (offsetParent && isTableElement(offsetParent) && getComputedStyle(offsetParent).position === 'static') {\n offsetParent = getTrueOffsetParent(offsetParent);\n }\n\n if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle(offsetParent).position === 'static')) {\n return window;\n }\n\n return offsetParent || getContainingBlock(element) || window;\n}","export default function getMainAxisFromPlacement(placement) {\n return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';\n}","import { max as mathMax, min as mathMin } from \"./math.js\";\nexport function within(min, value, max) {\n return mathMax(min, mathMin(value, max));\n}\nexport function withinMaxClamp(min, value, max) {\n var v = within(min, value, max);\n return v > max ? max : v;\n}","import getFreshSideObject from \"./getFreshSideObject.js\";\nexport default function mergePaddingObject(paddingObject) {\n return Object.assign({}, getFreshSideObject(), paddingObject);\n}","export default function getFreshSideObject() {\n return {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n };\n}","export default function expandToHashMap(value, keys) {\n return keys.reduce(function (hashMap, key) {\n hashMap[key] = value;\n return hashMap;\n }, {});\n}","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport contains from \"../dom-utils/contains.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport { within } from \"../utils/within.js\";\nimport mergePaddingObject from \"../utils/mergePaddingObject.js\";\nimport expandToHashMap from \"../utils/expandToHashMap.js\";\nimport { left, right, basePlacements, top, bottom } from \"../enums.js\";\nimport { isHTMLElement } from \"../dom-utils/instanceOf.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar toPaddingObject = function toPaddingObject(padding, state) {\n padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, {\n placement: state.placement\n })) : padding;\n return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n};\n\nfunction arrow(_ref) {\n var _state$modifiersData$;\n\n var state = _ref.state,\n name = _ref.name,\n options = _ref.options;\n var arrowElement = state.elements.arrow;\n var popperOffsets = state.modifiersData.popperOffsets;\n var basePlacement = getBasePlacement(state.placement);\n var axis = getMainAxisFromPlacement(basePlacement);\n var isVertical = [left, right].indexOf(basePlacement) >= 0;\n var len = isVertical ? 'height' : 'width';\n\n if (!arrowElement || !popperOffsets) {\n return;\n }\n\n var paddingObject = toPaddingObject(options.padding, state);\n var arrowRect = getLayoutRect(arrowElement);\n var minProp = axis === 'y' ? top : left;\n var maxProp = axis === 'y' ? bottom : right;\n var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];\n var startDiff = popperOffsets[axis] - state.rects.reference[axis];\n var arrowOffsetParent = getOffsetParent(arrowElement);\n var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;\n var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is\n // outside of the popper bounds\n\n var min = paddingObject[minProp];\n var max = clientSize - arrowRect[len] - paddingObject[maxProp];\n var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;\n var offset = within(min, center, max); // Prevents breaking syntax highlighting...\n\n var axisProp = axis;\n state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state,\n options = _ref2.options;\n var _options$element = options.element,\n arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element;\n\n if (arrowElement == null) {\n return;\n } // CSS selector\n\n\n if (typeof arrowElement === 'string') {\n arrowElement = state.elements.popper.querySelector(arrowElement);\n\n if (!arrowElement) {\n return;\n }\n }\n\n if (process.env.NODE_ENV !== \"production\") {\n if (!isHTMLElement(arrowElement)) {\n console.error(['Popper: \"arrow\" element must be an HTMLElement (not an SVGElement).', 'To use an SVG arrow, wrap it in an HTMLElement that will be used as', 'the arrow.'].join(' '));\n }\n }\n\n if (!contains(state.elements.popper, arrowElement)) {\n if (process.env.NODE_ENV !== \"production\") {\n console.error(['Popper: \"arrow\" modifier\\'s `element` must be a child of the popper', 'element.'].join(' '));\n }\n\n return;\n }\n\n state.elements.arrow = arrowElement;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'arrow',\n enabled: true,\n phase: 'main',\n fn: arrow,\n effect: effect,\n requires: ['popperOffsets'],\n requiresIfExists: ['preventOverflow']\n};","export default function getVariation(placement) {\n return placement.split('-')[1];\n}","import { top, left, right, bottom, end } from \"../enums.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getWindow from \"../dom-utils/getWindow.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getComputedStyle from \"../dom-utils/getComputedStyle.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport { round } from \"../utils/math.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar unsetSides = {\n top: 'auto',\n right: 'auto',\n bottom: 'auto',\n left: 'auto'\n}; // Round the offsets to the nearest suitable subpixel based on the DPR.\n// Zooming can change the DPR, but it seems to report a value that will\n// cleanly divide the values into the appropriate subpixels.\n\nfunction roundOffsetsByDPR(_ref, win) {\n var x = _ref.x,\n y = _ref.y;\n var dpr = win.devicePixelRatio || 1;\n return {\n x: round(x * dpr) / dpr || 0,\n y: round(y * dpr) / dpr || 0\n };\n}\n\nexport function mapToStyles(_ref2) {\n var _Object$assign2;\n\n var popper = _ref2.popper,\n popperRect = _ref2.popperRect,\n placement = _ref2.placement,\n variation = _ref2.variation,\n offsets = _ref2.offsets,\n position = _ref2.position,\n gpuAcceleration = _ref2.gpuAcceleration,\n adaptive = _ref2.adaptive,\n roundOffsets = _ref2.roundOffsets,\n isFixed = _ref2.isFixed;\n var _offsets$x = offsets.x,\n x = _offsets$x === void 0 ? 0 : _offsets$x,\n _offsets$y = offsets.y,\n y = _offsets$y === void 0 ? 0 : _offsets$y;\n\n var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({\n x: x,\n y: y\n }) : {\n x: x,\n y: y\n };\n\n x = _ref3.x;\n y = _ref3.y;\n var hasX = offsets.hasOwnProperty('x');\n var hasY = offsets.hasOwnProperty('y');\n var sideX = left;\n var sideY = top;\n var win = window;\n\n if (adaptive) {\n var offsetParent = getOffsetParent(popper);\n var heightProp = 'clientHeight';\n var widthProp = 'clientWidth';\n\n if (offsetParent === getWindow(popper)) {\n offsetParent = getDocumentElement(popper);\n\n if (getComputedStyle(offsetParent).position !== 'static' && position === 'absolute') {\n heightProp = 'scrollHeight';\n widthProp = 'scrollWidth';\n }\n } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it\n\n\n offsetParent = offsetParent;\n\n if (placement === top || (placement === left || placement === right) && variation === end) {\n sideY = bottom;\n var offsetY = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing]\n offsetParent[heightProp];\n y -= offsetY - popperRect.height;\n y *= gpuAcceleration ? 1 : -1;\n }\n\n if (placement === left || (placement === top || placement === bottom) && variation === end) {\n sideX = right;\n var offsetX = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing]\n offsetParent[widthProp];\n x -= offsetX - popperRect.width;\n x *= gpuAcceleration ? 1 : -1;\n }\n }\n\n var commonStyles = Object.assign({\n position: position\n }, adaptive && unsetSides);\n\n var _ref4 = roundOffsets === true ? roundOffsetsByDPR({\n x: x,\n y: y\n }, getWindow(popper)) : {\n x: x,\n y: y\n };\n\n x = _ref4.x;\n y = _ref4.y;\n\n if (gpuAcceleration) {\n var _Object$assign;\n\n return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? \"translate(\" + x + \"px, \" + y + \"px)\" : \"translate3d(\" + x + \"px, \" + y + \"px, 0)\", _Object$assign));\n }\n\n return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + \"px\" : '', _Object$assign2[sideX] = hasX ? x + \"px\" : '', _Object$assign2.transform = '', _Object$assign2));\n}\n\nfunction computeStyles(_ref5) {\n var state = _ref5.state,\n options = _ref5.options;\n var _options$gpuAccelerat = options.gpuAcceleration,\n gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,\n _options$adaptive = options.adaptive,\n adaptive = _options$adaptive === void 0 ? true : _options$adaptive,\n _options$roundOffsets = options.roundOffsets,\n roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets;\n\n if (process.env.NODE_ENV !== \"production\") {\n var transitionProperty = getComputedStyle(state.elements.popper).transitionProperty || '';\n\n if (adaptive && ['transform', 'top', 'right', 'bottom', 'left'].some(function (property) {\n return transitionProperty.indexOf(property) >= 0;\n })) {\n console.warn(['Popper: Detected CSS transitions on at least one of the following', 'CSS properties: \"transform\", \"top\", \"right\", \"bottom\", \"left\".', '\\n\\n', 'Disable the \"computeStyles\" modifier\\'s `adaptive` option to allow', 'for smooth transitions, or remove these properties from the CSS', 'transition declaration on the popper element if only transitioning', 'opacity or background-color for example.', '\\n\\n', 'We recommend using the popper element as a wrapper around an inner', 'element that can have any CSS property transitioned for animations.'].join(' '));\n }\n }\n\n var commonStyles = {\n placement: getBasePlacement(state.placement),\n variation: getVariation(state.placement),\n popper: state.elements.popper,\n popperRect: state.rects.popper,\n gpuAcceleration: gpuAcceleration,\n isFixed: state.options.strategy === 'fixed'\n };\n\n if (state.modifiersData.popperOffsets != null) {\n state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.popperOffsets,\n position: state.options.strategy,\n adaptive: adaptive,\n roundOffsets: roundOffsets\n })));\n }\n\n if (state.modifiersData.arrow != null) {\n state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.arrow,\n position: 'absolute',\n adaptive: false,\n roundOffsets: roundOffsets\n })));\n }\n\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-placement': state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'computeStyles',\n enabled: true,\n phase: 'beforeWrite',\n fn: computeStyles,\n data: {}\n};","import getWindow from \"../dom-utils/getWindow.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar passive = {\n passive: true\n};\n\nfunction effect(_ref) {\n var state = _ref.state,\n instance = _ref.instance,\n options = _ref.options;\n var _options$scroll = options.scroll,\n scroll = _options$scroll === void 0 ? true : _options$scroll,\n _options$resize = options.resize,\n resize = _options$resize === void 0 ? true : _options$resize;\n var window = getWindow(state.elements.popper);\n var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);\n\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.addEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.addEventListener('resize', instance.update, passive);\n }\n\n return function () {\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.removeEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.removeEventListener('resize', instance.update, passive);\n }\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'eventListeners',\n enabled: true,\n phase: 'write',\n fn: function fn() {},\n effect: effect,\n data: {}\n};","var hash = {\n left: 'right',\n right: 'left',\n bottom: 'top',\n top: 'bottom'\n};\nexport default function getOppositePlacement(placement) {\n return placement.replace(/left|right|bottom|top/g, function (matched) {\n return hash[matched];\n });\n}","var hash = {\n start: 'end',\n end: 'start'\n};\nexport default function getOppositeVariationPlacement(placement) {\n return placement.replace(/start|end/g, function (matched) {\n return hash[matched];\n });\n}","import getWindow from \"./getWindow.js\";\nexport default function getWindowScroll(node) {\n var win = getWindow(node);\n var scrollLeft = win.pageXOffset;\n var scrollTop = win.pageYOffset;\n return {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nexport default function getWindowScrollBarX(element) {\n // If has a CSS width greater than the viewport, then this will be\n // incorrect for RTL.\n // Popper 1 is broken in this case and never had a bug report so let's assume\n // it's not an issue. I don't think anyone ever specifies width on \n // anyway.\n // Browsers where the left scrollbar doesn't cause an issue report `0` for\n // this (e.g. Edge 2019, IE11, Safari)\n return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;\n}","import getComputedStyle from \"./getComputedStyle.js\";\nexport default function isScrollParent(element) {\n // Firefox wants us to check `-x` and `-y` variations as well\n var _getComputedStyle = getComputedStyle(element),\n overflow = _getComputedStyle.overflow,\n overflowX = _getComputedStyle.overflowX,\n overflowY = _getComputedStyle.overflowY;\n\n return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);\n}","import getParentNode from \"./getParentNode.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nexport default function getScrollParent(node) {\n if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return node.ownerDocument.body;\n }\n\n if (isHTMLElement(node) && isScrollParent(node)) {\n return node;\n }\n\n return getScrollParent(getParentNode(node));\n}","import getScrollParent from \"./getScrollParent.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getWindow from \"./getWindow.js\";\nimport isScrollParent from \"./isScrollParent.js\";\n/*\ngiven a DOM element, return the list of all scroll parents, up the list of ancesors\nuntil we get to the top window object. This list is what we attach scroll listeners\nto, because if any of these parent elements scroll, we'll need to re-calculate the\nreference element's position.\n*/\n\nexport default function listScrollParents(element, list) {\n var _element$ownerDocumen;\n\n if (list === void 0) {\n list = [];\n }\n\n var scrollParent = getScrollParent(element);\n var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body);\n var win = getWindow(scrollParent);\n var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;\n var updatedList = list.concat(target);\n return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here\n updatedList.concat(listScrollParents(getParentNode(target)));\n}","export default function rectToClientRect(rect) {\n return Object.assign({}, rect, {\n left: rect.x,\n top: rect.y,\n right: rect.x + rect.width,\n bottom: rect.y + rect.height\n });\n}","import { viewport } from \"../enums.js\";\nimport getViewportRect from \"./getViewportRect.js\";\nimport getDocumentRect from \"./getDocumentRect.js\";\nimport listScrollParents from \"./listScrollParents.js\";\nimport getOffsetParent from \"./getOffsetParent.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport contains from \"./contains.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport rectToClientRect from \"../utils/rectToClientRect.js\";\nimport { max, min } from \"../utils/math.js\";\n\nfunction getInnerBoundingClientRect(element, strategy) {\n var rect = getBoundingClientRect(element, false, strategy === 'fixed');\n rect.top = rect.top + element.clientTop;\n rect.left = rect.left + element.clientLeft;\n rect.bottom = rect.top + element.clientHeight;\n rect.right = rect.left + element.clientWidth;\n rect.width = element.clientWidth;\n rect.height = element.clientHeight;\n rect.x = rect.left;\n rect.y = rect.top;\n return rect;\n}\n\nfunction getClientRectFromMixedType(element, clippingParent, strategy) {\n return clippingParent === viewport ? rectToClientRect(getViewportRect(element, strategy)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent, strategy) : rectToClientRect(getDocumentRect(getDocumentElement(element)));\n} // A \"clipping parent\" is an overflowable container with the characteristic of\n// clipping (or hiding) overflowing elements with a position different from\n// `initial`\n\n\nfunction getClippingParents(element) {\n var clippingParents = listScrollParents(getParentNode(element));\n var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle(element).position) >= 0;\n var clipperElement = canEscapeClipping && isHTMLElement(element) ? getOffsetParent(element) : element;\n\n if (!isElement(clipperElement)) {\n return [];\n } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414\n\n\n return clippingParents.filter(function (clippingParent) {\n return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';\n });\n} // Gets the maximum area that the element is visible in due to any number of\n// clipping parents\n\n\nexport default function getClippingRect(element, boundary, rootBoundary, strategy) {\n var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);\n var clippingParents = [].concat(mainClippingParents, [rootBoundary]);\n var firstClippingParent = clippingParents[0];\n var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {\n var rect = getClientRectFromMixedType(element, clippingParent, strategy);\n accRect.top = max(rect.top, accRect.top);\n accRect.right = min(rect.right, accRect.right);\n accRect.bottom = min(rect.bottom, accRect.bottom);\n accRect.left = max(rect.left, accRect.left);\n return accRect;\n }, getClientRectFromMixedType(element, firstClippingParent, strategy));\n clippingRect.width = clippingRect.right - clippingRect.left;\n clippingRect.height = clippingRect.bottom - clippingRect.top;\n clippingRect.x = clippingRect.left;\n clippingRect.y = clippingRect.top;\n return clippingRect;\n}","import getWindow from \"./getWindow.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getViewportRect(element, strategy) {\n var win = getWindow(element);\n var html = getDocumentElement(element);\n var visualViewport = win.visualViewport;\n var width = html.clientWidth;\n var height = html.clientHeight;\n var x = 0;\n var y = 0;\n\n if (visualViewport) {\n width = visualViewport.width;\n height = visualViewport.height;\n var layoutViewport = isLayoutViewport();\n\n if (layoutViewport || !layoutViewport && strategy === 'fixed') {\n x = visualViewport.offsetLeft;\n y = visualViewport.offsetTop;\n }\n }\n\n return {\n width: width,\n height: height,\n x: x + getWindowScrollBarX(element),\n y: y\n };\n}","import getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nimport { max } from \"../utils/math.js\"; // Gets the entire size of the scrollable document area, even extending outside\n// of the `` and `` rect bounds if horizontally scrollable\n\nexport default function getDocumentRect(element) {\n var _element$ownerDocumen;\n\n var html = getDocumentElement(element);\n var winScroll = getWindowScroll(element);\n var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body;\n var width = max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);\n var height = max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);\n var x = -winScroll.scrollLeft + getWindowScrollBarX(element);\n var y = -winScroll.scrollTop;\n\n if (getComputedStyle(body || html).direction === 'rtl') {\n x += max(html.clientWidth, body ? body.clientWidth : 0) - width;\n }\n\n return {\n width: width,\n height: height,\n x: x,\n y: y\n };\n}","import getBasePlacement from \"./getBasePlacement.js\";\nimport getVariation from \"./getVariation.js\";\nimport getMainAxisFromPlacement from \"./getMainAxisFromPlacement.js\";\nimport { top, right, bottom, left, start, end } from \"../enums.js\";\nexport default function computeOffsets(_ref) {\n var reference = _ref.reference,\n element = _ref.element,\n placement = _ref.placement;\n var basePlacement = placement ? getBasePlacement(placement) : null;\n var variation = placement ? getVariation(placement) : null;\n var commonX = reference.x + reference.width / 2 - element.width / 2;\n var commonY = reference.y + reference.height / 2 - element.height / 2;\n var offsets;\n\n switch (basePlacement) {\n case top:\n offsets = {\n x: commonX,\n y: reference.y - element.height\n };\n break;\n\n case bottom:\n offsets = {\n x: commonX,\n y: reference.y + reference.height\n };\n break;\n\n case right:\n offsets = {\n x: reference.x + reference.width,\n y: commonY\n };\n break;\n\n case left:\n offsets = {\n x: reference.x - element.width,\n y: commonY\n };\n break;\n\n default:\n offsets = {\n x: reference.x,\n y: reference.y\n };\n }\n\n var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;\n\n if (mainAxis != null) {\n var len = mainAxis === 'y' ? 'height' : 'width';\n\n switch (variation) {\n case start:\n offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2);\n break;\n\n case end:\n offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2);\n break;\n\n default:\n }\n }\n\n return offsets;\n}","import getClippingRect from \"../dom-utils/getClippingRect.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getBoundingClientRect from \"../dom-utils/getBoundingClientRect.js\";\nimport computeOffsets from \"./computeOffsets.js\";\nimport rectToClientRect from \"./rectToClientRect.js\";\nimport { clippingParents, reference, popper, bottom, top, right, basePlacements, viewport } from \"../enums.js\";\nimport { isElement } from \"../dom-utils/instanceOf.js\";\nimport mergePaddingObject from \"./mergePaddingObject.js\";\nimport expandToHashMap from \"./expandToHashMap.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport default function detectOverflow(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n _options$placement = _options.placement,\n placement = _options$placement === void 0 ? state.placement : _options$placement,\n _options$strategy = _options.strategy,\n strategy = _options$strategy === void 0 ? state.strategy : _options$strategy,\n _options$boundary = _options.boundary,\n boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,\n _options$rootBoundary = _options.rootBoundary,\n rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,\n _options$elementConte = _options.elementContext,\n elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,\n _options$altBoundary = _options.altBoundary,\n altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,\n _options$padding = _options.padding,\n padding = _options$padding === void 0 ? 0 : _options$padding;\n var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n var altContext = elementContext === popper ? reference : popper;\n var popperRect = state.rects.popper;\n var element = state.elements[altBoundary ? altContext : elementContext];\n var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary, strategy);\n var referenceClientRect = getBoundingClientRect(state.elements.reference);\n var popperOffsets = computeOffsets({\n reference: referenceClientRect,\n element: popperRect,\n strategy: 'absolute',\n placement: placement\n });\n var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets));\n var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect\n // 0 or negative = within the clipping rect\n\n var overflowOffsets = {\n top: clippingClientRect.top - elementClientRect.top + paddingObject.top,\n bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,\n left: clippingClientRect.left - elementClientRect.left + paddingObject.left,\n right: elementClientRect.right - clippingClientRect.right + paddingObject.right\n };\n var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element\n\n if (elementContext === popper && offsetData) {\n var offset = offsetData[placement];\n Object.keys(overflowOffsets).forEach(function (key) {\n var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;\n var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x';\n overflowOffsets[key] += offset[axis] * multiply;\n });\n }\n\n return overflowOffsets;\n}","import getOppositePlacement from \"../utils/getOppositePlacement.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getOppositeVariationPlacement from \"../utils/getOppositeVariationPlacement.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport computeAutoPlacement from \"../utils/computeAutoPlacement.js\";\nimport { bottom, top, start, right, left, auto } from \"../enums.js\";\nimport getVariation from \"../utils/getVariation.js\"; // eslint-disable-next-line import/no-unused-modules\n\nfunction getExpandedFallbackPlacements(placement) {\n if (getBasePlacement(placement) === auto) {\n return [];\n }\n\n var oppositePlacement = getOppositePlacement(placement);\n return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];\n}\n\nfunction flip(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n\n if (state.modifiersData[name]._skip) {\n return;\n }\n\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,\n specifiedFallbackPlacements = options.fallbackPlacements,\n padding = options.padding,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n _options$flipVariatio = options.flipVariations,\n flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,\n allowedAutoPlacements = options.allowedAutoPlacements;\n var preferredPlacement = state.options.placement;\n var basePlacement = getBasePlacement(preferredPlacement);\n var isBasePlacement = basePlacement === preferredPlacement;\n var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));\n var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {\n return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n flipVariations: flipVariations,\n allowedAutoPlacements: allowedAutoPlacements\n }) : placement);\n }, []);\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var checksMap = new Map();\n var makeFallbackChecks = true;\n var firstFittingPlacement = placements[0];\n\n for (var i = 0; i < placements.length; i++) {\n var placement = placements[i];\n\n var _basePlacement = getBasePlacement(placement);\n\n var isStartVariation = getVariation(placement) === start;\n var isVertical = [top, bottom].indexOf(_basePlacement) >= 0;\n var len = isVertical ? 'width' : 'height';\n var overflow = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n altBoundary: altBoundary,\n padding: padding\n });\n var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top;\n\n if (referenceRect[len] > popperRect[len]) {\n mainVariationSide = getOppositePlacement(mainVariationSide);\n }\n\n var altVariationSide = getOppositePlacement(mainVariationSide);\n var checks = [];\n\n if (checkMainAxis) {\n checks.push(overflow[_basePlacement] <= 0);\n }\n\n if (checkAltAxis) {\n checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);\n }\n\n if (checks.every(function (check) {\n return check;\n })) {\n firstFittingPlacement = placement;\n makeFallbackChecks = false;\n break;\n }\n\n checksMap.set(placement, checks);\n }\n\n if (makeFallbackChecks) {\n // `2` may be desired in some cases – research later\n var numberOfChecks = flipVariations ? 3 : 1;\n\n var _loop = function _loop(_i) {\n var fittingPlacement = placements.find(function (placement) {\n var checks = checksMap.get(placement);\n\n if (checks) {\n return checks.slice(0, _i).every(function (check) {\n return check;\n });\n }\n });\n\n if (fittingPlacement) {\n firstFittingPlacement = fittingPlacement;\n return \"break\";\n }\n };\n\n for (var _i = numberOfChecks; _i > 0; _i--) {\n var _ret = _loop(_i);\n\n if (_ret === \"break\") break;\n }\n }\n\n if (state.placement !== firstFittingPlacement) {\n state.modifiersData[name]._skip = true;\n state.placement = firstFittingPlacement;\n state.reset = true;\n }\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'flip',\n enabled: true,\n phase: 'main',\n fn: flip,\n requiresIfExists: ['offset'],\n data: {\n _skip: false\n }\n};","import getVariation from \"./getVariation.js\";\nimport { variationPlacements, basePlacements, placements as allPlacements } from \"../enums.js\";\nimport detectOverflow from \"./detectOverflow.js\";\nimport getBasePlacement from \"./getBasePlacement.js\";\nexport default function computeAutoPlacement(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n placement = _options.placement,\n boundary = _options.boundary,\n rootBoundary = _options.rootBoundary,\n padding = _options.padding,\n flipVariations = _options.flipVariations,\n _options$allowedAutoP = _options.allowedAutoPlacements,\n allowedAutoPlacements = _options$allowedAutoP === void 0 ? allPlacements : _options$allowedAutoP;\n var variation = getVariation(placement);\n var placements = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {\n return getVariation(placement) === variation;\n }) : basePlacements;\n var allowedPlacements = placements.filter(function (placement) {\n return allowedAutoPlacements.indexOf(placement) >= 0;\n });\n\n if (allowedPlacements.length === 0) {\n allowedPlacements = placements;\n\n if (process.env.NODE_ENV !== \"production\") {\n console.error(['Popper: The `allowedAutoPlacements` option did not allow any', 'placements. Ensure the `placement` option matches the variation', 'of the allowed placements.', 'For example, \"auto\" cannot be used to allow \"bottom-start\".', 'Use \"auto-start\" instead.'].join(' '));\n }\n } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions...\n\n\n var overflows = allowedPlacements.reduce(function (acc, placement) {\n acc[placement] = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding\n })[getBasePlacement(placement)];\n return acc;\n }, {});\n return Object.keys(overflows).sort(function (a, b) {\n return overflows[a] - overflows[b];\n });\n}","import { top, bottom, left, right } from \"../enums.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\n\nfunction getSideOffsets(overflow, rect, preventedOffsets) {\n if (preventedOffsets === void 0) {\n preventedOffsets = {\n x: 0,\n y: 0\n };\n }\n\n return {\n top: overflow.top - rect.height - preventedOffsets.y,\n right: overflow.right - rect.width + preventedOffsets.x,\n bottom: overflow.bottom - rect.height + preventedOffsets.y,\n left: overflow.left - rect.width - preventedOffsets.x\n };\n}\n\nfunction isAnySideFullyClipped(overflow) {\n return [top, right, bottom, left].some(function (side) {\n return overflow[side] >= 0;\n });\n}\n\nfunction hide(_ref) {\n var state = _ref.state,\n name = _ref.name;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var preventedOffsets = state.modifiersData.preventOverflow;\n var referenceOverflow = detectOverflow(state, {\n elementContext: 'reference'\n });\n var popperAltOverflow = detectOverflow(state, {\n altBoundary: true\n });\n var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);\n var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);\n var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);\n var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);\n state.modifiersData[name] = {\n referenceClippingOffsets: referenceClippingOffsets,\n popperEscapeOffsets: popperEscapeOffsets,\n isReferenceHidden: isReferenceHidden,\n hasPopperEscaped: hasPopperEscaped\n };\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-reference-hidden': isReferenceHidden,\n 'data-popper-escaped': hasPopperEscaped\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'hide',\n enabled: true,\n phase: 'main',\n requiresIfExists: ['preventOverflow'],\n fn: hide\n};","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport { top, left, right, placements } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport function distanceAndSkiddingToXY(placement, rects, offset) {\n var basePlacement = getBasePlacement(placement);\n var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1;\n\n var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, {\n placement: placement\n })) : offset,\n skidding = _ref[0],\n distance = _ref[1];\n\n skidding = skidding || 0;\n distance = (distance || 0) * invertDistance;\n return [left, right].indexOf(basePlacement) >= 0 ? {\n x: distance,\n y: skidding\n } : {\n x: skidding,\n y: distance\n };\n}\n\nfunction offset(_ref2) {\n var state = _ref2.state,\n options = _ref2.options,\n name = _ref2.name;\n var _options$offset = options.offset,\n offset = _options$offset === void 0 ? [0, 0] : _options$offset;\n var data = placements.reduce(function (acc, placement) {\n acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);\n return acc;\n }, {});\n var _data$state$placement = data[state.placement],\n x = _data$state$placement.x,\n y = _data$state$placement.y;\n\n if (state.modifiersData.popperOffsets != null) {\n state.modifiersData.popperOffsets.x += x;\n state.modifiersData.popperOffsets.y += y;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'offset',\n enabled: true,\n phase: 'main',\n requires: ['popperOffsets'],\n fn: offset\n};","import computeOffsets from \"../utils/computeOffsets.js\";\n\nfunction popperOffsets(_ref) {\n var state = _ref.state,\n name = _ref.name;\n // Offsets are the actual position the popper needs to have to be\n // properly positioned near its reference element\n // This is the most basic placement, and will be adjusted by\n // the modifiers in the next step\n state.modifiersData[name] = computeOffsets({\n reference: state.rects.reference,\n element: state.rects.popper,\n strategy: 'absolute',\n placement: state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'popperOffsets',\n enabled: true,\n phase: 'read',\n fn: popperOffsets,\n data: {}\n};","import { top, left, right, bottom, start } from \"../enums.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport getAltAxis from \"../utils/getAltAxis.js\";\nimport { within, withinMaxClamp } from \"../utils/within.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport getFreshSideObject from \"../utils/getFreshSideObject.js\";\nimport { min as mathMin, max as mathMax } from \"../utils/math.js\";\n\nfunction preventOverflow(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n padding = options.padding,\n _options$tether = options.tether,\n tether = _options$tether === void 0 ? true : _options$tether,\n _options$tetherOffset = options.tetherOffset,\n tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;\n var overflow = detectOverflow(state, {\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n altBoundary: altBoundary\n });\n var basePlacement = getBasePlacement(state.placement);\n var variation = getVariation(state.placement);\n var isBasePlacement = !variation;\n var mainAxis = getMainAxisFromPlacement(basePlacement);\n var altAxis = getAltAxis(mainAxis);\n var popperOffsets = state.modifiersData.popperOffsets;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, {\n placement: state.placement\n })) : tetherOffset;\n var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? {\n mainAxis: tetherOffsetValue,\n altAxis: tetherOffsetValue\n } : Object.assign({\n mainAxis: 0,\n altAxis: 0\n }, tetherOffsetValue);\n var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null;\n var data = {\n x: 0,\n y: 0\n };\n\n if (!popperOffsets) {\n return;\n }\n\n if (checkMainAxis) {\n var _offsetModifierState$;\n\n var mainSide = mainAxis === 'y' ? top : left;\n var altSide = mainAxis === 'y' ? bottom : right;\n var len = mainAxis === 'y' ? 'height' : 'width';\n var offset = popperOffsets[mainAxis];\n var min = offset + overflow[mainSide];\n var max = offset - overflow[altSide];\n var additive = tether ? -popperRect[len] / 2 : 0;\n var minLen = variation === start ? referenceRect[len] : popperRect[len];\n var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go\n // outside the reference bounds\n\n var arrowElement = state.elements.arrow;\n var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {\n width: 0,\n height: 0\n };\n var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();\n var arrowPaddingMin = arrowPaddingObject[mainSide];\n var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want\n // to include its full size in the calculation. If the reference is small\n // and near the edge of a boundary, the popper can overflow even if the\n // reference is not overflowing as well (e.g. virtual elements with no\n // width or height)\n\n var arrowLen = within(0, referenceRect[len], arrowRect[len]);\n var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis;\n var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis;\n var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);\n var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;\n var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0;\n var tetherMin = offset + minOffset - offsetModifierValue - clientOffset;\n var tetherMax = offset + maxOffset - offsetModifierValue;\n var preventedOffset = within(tether ? mathMin(min, tetherMin) : min, offset, tether ? mathMax(max, tetherMax) : max);\n popperOffsets[mainAxis] = preventedOffset;\n data[mainAxis] = preventedOffset - offset;\n }\n\n if (checkAltAxis) {\n var _offsetModifierState$2;\n\n var _mainSide = mainAxis === 'x' ? top : left;\n\n var _altSide = mainAxis === 'x' ? bottom : right;\n\n var _offset = popperOffsets[altAxis];\n\n var _len = altAxis === 'y' ? 'height' : 'width';\n\n var _min = _offset + overflow[_mainSide];\n\n var _max = _offset - overflow[_altSide];\n\n var isOriginSide = [top, left].indexOf(basePlacement) !== -1;\n\n var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0;\n\n var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis;\n\n var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max;\n\n var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max);\n\n popperOffsets[altAxis] = _preventedOffset;\n data[altAxis] = _preventedOffset - _offset;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'preventOverflow',\n enabled: true,\n phase: 'main',\n fn: preventOverflow,\n requiresIfExists: ['offset']\n};","export default function getAltAxis(axis) {\n return axis === 'x' ? 'y' : 'x';\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getNodeScroll from \"./getNodeScroll.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport { round } from \"../utils/math.js\";\n\nfunction isElementScaled(element) {\n var rect = element.getBoundingClientRect();\n var scaleX = round(rect.width) / element.offsetWidth || 1;\n var scaleY = round(rect.height) / element.offsetHeight || 1;\n return scaleX !== 1 || scaleY !== 1;\n} // Returns the composite rect of an element relative to its offsetParent.\n// Composite means it takes into account transforms as well as layout.\n\n\nexport default function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {\n if (isFixed === void 0) {\n isFixed = false;\n }\n\n var isOffsetParentAnElement = isHTMLElement(offsetParent);\n var offsetParentIsScaled = isHTMLElement(offsetParent) && isElementScaled(offsetParent);\n var documentElement = getDocumentElement(offsetParent);\n var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled, isFixed);\n var scroll = {\n scrollLeft: 0,\n scrollTop: 0\n };\n var offsets = {\n x: 0,\n y: 0\n };\n\n if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078\n isScrollParent(documentElement)) {\n scroll = getNodeScroll(offsetParent);\n }\n\n if (isHTMLElement(offsetParent)) {\n offsets = getBoundingClientRect(offsetParent, true);\n offsets.x += offsetParent.clientLeft;\n offsets.y += offsetParent.clientTop;\n } else if (documentElement) {\n offsets.x = getWindowScrollBarX(documentElement);\n }\n }\n\n return {\n x: rect.left + scroll.scrollLeft - offsets.x,\n y: rect.top + scroll.scrollTop - offsets.y,\n width: rect.width,\n height: rect.height\n };\n}","import getWindowScroll from \"./getWindowScroll.js\";\nimport getWindow from \"./getWindow.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getHTMLElementScroll from \"./getHTMLElementScroll.js\";\nexport default function getNodeScroll(node) {\n if (node === getWindow(node) || !isHTMLElement(node)) {\n return getWindowScroll(node);\n } else {\n return getHTMLElementScroll(node);\n }\n}","export default function getHTMLElementScroll(element) {\n return {\n scrollLeft: element.scrollLeft,\n scrollTop: element.scrollTop\n };\n}","import { modifierPhases } from \"../enums.js\"; // source: https://stackoverflow.com/questions/49875255\n\nfunction order(modifiers) {\n var map = new Map();\n var visited = new Set();\n var result = [];\n modifiers.forEach(function (modifier) {\n map.set(modifier.name, modifier);\n }); // On visiting object, check for its dependencies and visit them recursively\n\n function sort(modifier) {\n visited.add(modifier.name);\n var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);\n requires.forEach(function (dep) {\n if (!visited.has(dep)) {\n var depModifier = map.get(dep);\n\n if (depModifier) {\n sort(depModifier);\n }\n }\n });\n result.push(modifier);\n }\n\n modifiers.forEach(function (modifier) {\n if (!visited.has(modifier.name)) {\n // check for visited object\n sort(modifier);\n }\n });\n return result;\n}\n\nexport default function orderModifiers(modifiers) {\n // order based on dependencies\n var orderedModifiers = order(modifiers); // order based on phase\n\n return modifierPhases.reduce(function (acc, phase) {\n return acc.concat(orderedModifiers.filter(function (modifier) {\n return modifier.phase === phase;\n }));\n }, []);\n}","import getCompositeRect from \"./dom-utils/getCompositeRect.js\";\nimport getLayoutRect from \"./dom-utils/getLayoutRect.js\";\nimport listScrollParents from \"./dom-utils/listScrollParents.js\";\nimport getOffsetParent from \"./dom-utils/getOffsetParent.js\";\nimport getComputedStyle from \"./dom-utils/getComputedStyle.js\";\nimport orderModifiers from \"./utils/orderModifiers.js\";\nimport debounce from \"./utils/debounce.js\";\nimport validateModifiers from \"./utils/validateModifiers.js\";\nimport uniqueBy from \"./utils/uniqueBy.js\";\nimport getBasePlacement from \"./utils/getBasePlacement.js\";\nimport mergeByName from \"./utils/mergeByName.js\";\nimport detectOverflow from \"./utils/detectOverflow.js\";\nimport { isElement } from \"./dom-utils/instanceOf.js\";\nimport { auto } from \"./enums.js\";\nvar INVALID_ELEMENT_ERROR = 'Popper: Invalid reference or popper argument provided. They must be either a DOM element or virtual element.';\nvar INFINITE_LOOP_ERROR = 'Popper: An infinite loop in the modifiers cycle has been detected! The cycle has been interrupted to prevent a browser crash.';\nvar DEFAULT_OPTIONS = {\n placement: 'bottom',\n modifiers: [],\n strategy: 'absolute'\n};\n\nfunction areValidElements() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n return !args.some(function (element) {\n return !(element && typeof element.getBoundingClientRect === 'function');\n });\n}\n\nexport function popperGenerator(generatorOptions) {\n if (generatorOptions === void 0) {\n generatorOptions = {};\n }\n\n var _generatorOptions = generatorOptions,\n _generatorOptions$def = _generatorOptions.defaultModifiers,\n defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,\n _generatorOptions$def2 = _generatorOptions.defaultOptions,\n defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;\n return function createPopper(reference, popper, options) {\n if (options === void 0) {\n options = defaultOptions;\n }\n\n var state = {\n placement: 'bottom',\n orderedModifiers: [],\n options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions),\n modifiersData: {},\n elements: {\n reference: reference,\n popper: popper\n },\n attributes: {},\n styles: {}\n };\n var effectCleanupFns = [];\n var isDestroyed = false;\n var instance = {\n state: state,\n setOptions: function setOptions(setOptionsAction) {\n var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction;\n cleanupModifierEffects();\n state.options = Object.assign({}, defaultOptions, state.options, options);\n state.scrollParents = {\n reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],\n popper: listScrollParents(popper)\n }; // Orders the modifiers based on their dependencies and `phase`\n // properties\n\n var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers\n\n state.orderedModifiers = orderedModifiers.filter(function (m) {\n return m.enabled;\n }); // Validate the provided modifiers so that the consumer will get warned\n // if one of the modifiers is invalid for any reason\n\n if (process.env.NODE_ENV !== \"production\") {\n var modifiers = uniqueBy([].concat(orderedModifiers, state.options.modifiers), function (_ref) {\n var name = _ref.name;\n return name;\n });\n validateModifiers(modifiers);\n\n if (getBasePlacement(state.options.placement) === auto) {\n var flipModifier = state.orderedModifiers.find(function (_ref2) {\n var name = _ref2.name;\n return name === 'flip';\n });\n\n if (!flipModifier) {\n console.error(['Popper: \"auto\" placements require the \"flip\" modifier be', 'present and enabled to work.'].join(' '));\n }\n }\n\n var _getComputedStyle = getComputedStyle(popper),\n marginTop = _getComputedStyle.marginTop,\n marginRight = _getComputedStyle.marginRight,\n marginBottom = _getComputedStyle.marginBottom,\n marginLeft = _getComputedStyle.marginLeft; // We no longer take into account `margins` on the popper, and it can\n // cause bugs with positioning, so we'll warn the consumer\n\n\n if ([marginTop, marginRight, marginBottom, marginLeft].some(function (margin) {\n return parseFloat(margin);\n })) {\n console.warn(['Popper: CSS \"margin\" styles cannot be used to apply padding', 'between the popper and its reference element or boundary.', 'To replicate margin, use the `offset` modifier, as well as', 'the `padding` option in the `preventOverflow` and `flip`', 'modifiers.'].join(' '));\n }\n }\n\n runModifierEffects();\n return instance.update();\n },\n // Sync update – it will always be executed, even if not necessary. This\n // is useful for low frequency updates where sync behavior simplifies the\n // logic.\n // For high frequency updates (e.g. `resize` and `scroll` events), always\n // prefer the async Popper#update method\n forceUpdate: function forceUpdate() {\n if (isDestroyed) {\n return;\n }\n\n var _state$elements = state.elements,\n reference = _state$elements.reference,\n popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements\n // anymore\n\n if (!areValidElements(reference, popper)) {\n if (process.env.NODE_ENV !== \"production\") {\n console.error(INVALID_ELEMENT_ERROR);\n }\n\n return;\n } // Store the reference and popper rects to be read by modifiers\n\n\n state.rects = {\n reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),\n popper: getLayoutRect(popper)\n }; // Modifiers have the ability to reset the current update cycle. The\n // most common use case for this is the `flip` modifier changing the\n // placement, which then needs to re-run all the modifiers, because the\n // logic was previously ran for the previous placement and is therefore\n // stale/incorrect\n\n state.reset = false;\n state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier\n // is filled with the initial data specified by the modifier. This means\n // it doesn't persist and is fresh on each update.\n // To ensure persistent data, use `${name}#persistent`\n\n state.orderedModifiers.forEach(function (modifier) {\n return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);\n });\n var __debug_loops__ = 0;\n\n for (var index = 0; index < state.orderedModifiers.length; index++) {\n if (process.env.NODE_ENV !== \"production\") {\n __debug_loops__ += 1;\n\n if (__debug_loops__ > 100) {\n console.error(INFINITE_LOOP_ERROR);\n break;\n }\n }\n\n if (state.reset === true) {\n state.reset = false;\n index = -1;\n continue;\n }\n\n var _state$orderedModifie = state.orderedModifiers[index],\n fn = _state$orderedModifie.fn,\n _state$orderedModifie2 = _state$orderedModifie.options,\n _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,\n name = _state$orderedModifie.name;\n\n if (typeof fn === 'function') {\n state = fn({\n state: state,\n options: _options,\n name: name,\n instance: instance\n }) || state;\n }\n }\n },\n // Async and optimistically optimized update – it will not be executed if\n // not necessary (debounced to run at most once-per-tick)\n update: debounce(function () {\n return new Promise(function (resolve) {\n instance.forceUpdate();\n resolve(state);\n });\n }),\n destroy: function destroy() {\n cleanupModifierEffects();\n isDestroyed = true;\n }\n };\n\n if (!areValidElements(reference, popper)) {\n if (process.env.NODE_ENV !== \"production\") {\n console.error(INVALID_ELEMENT_ERROR);\n }\n\n return instance;\n }\n\n instance.setOptions(options).then(function (state) {\n if (!isDestroyed && options.onFirstUpdate) {\n options.onFirstUpdate(state);\n }\n }); // Modifiers have the ability to execute arbitrary code before the first\n // update cycle runs. They will be executed in the same order as the update\n // cycle. This is useful when a modifier adds some persistent data that\n // other modifiers need to use, but the modifier is run after the dependent\n // one.\n\n function runModifierEffects() {\n state.orderedModifiers.forEach(function (_ref3) {\n var name = _ref3.name,\n _ref3$options = _ref3.options,\n options = _ref3$options === void 0 ? {} : _ref3$options,\n effect = _ref3.effect;\n\n if (typeof effect === 'function') {\n var cleanupFn = effect({\n state: state,\n name: name,\n instance: instance,\n options: options\n });\n\n var noopFn = function noopFn() {};\n\n effectCleanupFns.push(cleanupFn || noopFn);\n }\n });\n }\n\n function cleanupModifierEffects() {\n effectCleanupFns.forEach(function (fn) {\n return fn();\n });\n effectCleanupFns = [];\n }\n\n return instance;\n };\n}\nexport var createPopper = /*#__PURE__*/popperGenerator(); // eslint-disable-next-line import/no-unused-modules\n\nexport { detectOverflow };","export default function debounce(fn) {\n var pending;\n return function () {\n if (!pending) {\n pending = new Promise(function (resolve) {\n Promise.resolve().then(function () {\n pending = undefined;\n resolve(fn());\n });\n });\n }\n\n return pending;\n };\n}","export default function mergeByName(modifiers) {\n var merged = modifiers.reduce(function (merged, current) {\n var existing = merged[current.name];\n merged[current.name] = existing ? Object.assign({}, existing, current, {\n options: Object.assign({}, existing.options, current.options),\n data: Object.assign({}, existing.data, current.data)\n }) : current;\n return merged;\n }, {}); // IE11 does not support Object.values\n\n return Object.keys(merged).map(function (key) {\n return merged[key];\n });\n}","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nimport offset from \"./modifiers/offset.js\";\nimport flip from \"./modifiers/flip.js\";\nimport preventOverflow from \"./modifiers/preventOverflow.js\";\nimport arrow from \"./modifiers/arrow.js\";\nimport hide from \"./modifiers/hide.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles, offset, flip, preventOverflow, arrow, hide];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow }; // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper as createPopperLite } from \"./popper-lite.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport * from \"./modifiers/index.js\";","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow };","/*!\n * Bootstrap v5.2.3 (https://getbootstrap.com/)\n * Copyright 2011-2022 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n */\nimport * as Popper from '@popperjs/core';\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/index.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\nconst MAX_UID = 1000000;\nconst MILLISECONDS_MULTIPLIER = 1000;\nconst TRANSITION_END = 'transitionend'; // Shout-out Angus Croll (https://goo.gl/pxwQGp)\n\nconst toType = object => {\n if (object === null || object === undefined) {\n return `${object}`;\n }\n\n return Object.prototype.toString.call(object).match(/\\s([a-z]+)/i)[1].toLowerCase();\n};\n/**\n * Public Util API\n */\n\n\nconst getUID = prefix => {\n do {\n prefix += Math.floor(Math.random() * MAX_UID);\n } while (document.getElementById(prefix));\n\n return prefix;\n};\n\nconst getSelector = element => {\n let selector = element.getAttribute('data-bs-target');\n\n if (!selector || selector === '#') {\n let hrefAttribute = element.getAttribute('href'); // The only valid content that could double as a selector are IDs or classes,\n // so everything starting with `#` or `.`. If a \"real\" URL is used as the selector,\n // `document.querySelector` will rightfully complain it is invalid.\n // See https://github.com/twbs/bootstrap/issues/32273\n\n if (!hrefAttribute || !hrefAttribute.includes('#') && !hrefAttribute.startsWith('.')) {\n return null;\n } // Just in case some CMS puts out a full URL with the anchor appended\n\n\n if (hrefAttribute.includes('#') && !hrefAttribute.startsWith('#')) {\n hrefAttribute = `#${hrefAttribute.split('#')[1]}`;\n }\n\n selector = hrefAttribute && hrefAttribute !== '#' ? hrefAttribute.trim() : null;\n }\n\n return selector;\n};\n\nconst getSelectorFromElement = element => {\n const selector = getSelector(element);\n\n if (selector) {\n return document.querySelector(selector) ? selector : null;\n }\n\n return null;\n};\n\nconst getElementFromSelector = element => {\n const selector = getSelector(element);\n return selector ? document.querySelector(selector) : null;\n};\n\nconst getTransitionDurationFromElement = element => {\n if (!element) {\n return 0;\n } // Get transition-duration of the element\n\n\n let {\n transitionDuration,\n transitionDelay\n } = window.getComputedStyle(element);\n const floatTransitionDuration = Number.parseFloat(transitionDuration);\n const floatTransitionDelay = Number.parseFloat(transitionDelay); // Return 0 if element or transition duration is not found\n\n if (!floatTransitionDuration && !floatTransitionDelay) {\n return 0;\n } // If multiple durations are defined, take the first\n\n\n transitionDuration = transitionDuration.split(',')[0];\n transitionDelay = transitionDelay.split(',')[0];\n return (Number.parseFloat(transitionDuration) + Number.parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;\n};\n\nconst triggerTransitionEnd = element => {\n element.dispatchEvent(new Event(TRANSITION_END));\n};\n\nconst isElement = object => {\n if (!object || typeof object !== 'object') {\n return false;\n }\n\n if (typeof object.jquery !== 'undefined') {\n object = object[0];\n }\n\n return typeof object.nodeType !== 'undefined';\n};\n\nconst getElement = object => {\n // it's a jQuery object or a node element\n if (isElement(object)) {\n return object.jquery ? object[0] : object;\n }\n\n if (typeof object === 'string' && object.length > 0) {\n return document.querySelector(object);\n }\n\n return null;\n};\n\nconst isVisible = element => {\n if (!isElement(element) || element.getClientRects().length === 0) {\n return false;\n }\n\n const elementIsVisible = getComputedStyle(element).getPropertyValue('visibility') === 'visible'; // Handle `details` element as its content may falsie appear visible when it is closed\n\n const closedDetails = element.closest('details:not([open])');\n\n if (!closedDetails) {\n return elementIsVisible;\n }\n\n if (closedDetails !== element) {\n const summary = element.closest('summary');\n\n if (summary && summary.parentNode !== closedDetails) {\n return false;\n }\n\n if (summary === null) {\n return false;\n }\n }\n\n return elementIsVisible;\n};\n\nconst isDisabled = element => {\n if (!element || element.nodeType !== Node.ELEMENT_NODE) {\n return true;\n }\n\n if (element.classList.contains('disabled')) {\n return true;\n }\n\n if (typeof element.disabled !== 'undefined') {\n return element.disabled;\n }\n\n return element.hasAttribute('disabled') && element.getAttribute('disabled') !== 'false';\n};\n\nconst findShadowRoot = element => {\n if (!document.documentElement.attachShadow) {\n return null;\n } // Can find the shadow root otherwise it'll return the document\n\n\n if (typeof element.getRootNode === 'function') {\n const root = element.getRootNode();\n return root instanceof ShadowRoot ? root : null;\n }\n\n if (element instanceof ShadowRoot) {\n return element;\n } // when we don't find a shadow root\n\n\n if (!element.parentNode) {\n return null;\n }\n\n return findShadowRoot(element.parentNode);\n};\n\nconst noop = () => {};\n/**\n * Trick to restart an element's animation\n *\n * @param {HTMLElement} element\n * @return void\n *\n * @see https://www.charistheo.io/blog/2021/02/restart-a-css-animation-with-javascript/#restarting-a-css-animation\n */\n\n\nconst reflow = element => {\n element.offsetHeight; // eslint-disable-line no-unused-expressions\n};\n\nconst getjQuery = () => {\n if (window.jQuery && !document.body.hasAttribute('data-bs-no-jquery')) {\n return window.jQuery;\n }\n\n return null;\n};\n\nconst DOMContentLoadedCallbacks = [];\n\nconst onDOMContentLoaded = callback => {\n if (document.readyState === 'loading') {\n // add listener on the first call when the document is in loading state\n if (!DOMContentLoadedCallbacks.length) {\n document.addEventListener('DOMContentLoaded', () => {\n for (const callback of DOMContentLoadedCallbacks) {\n callback();\n }\n });\n }\n\n DOMContentLoadedCallbacks.push(callback);\n } else {\n callback();\n }\n};\n\nconst isRTL = () => document.documentElement.dir === 'rtl';\n\nconst defineJQueryPlugin = plugin => {\n onDOMContentLoaded(() => {\n const $ = getjQuery();\n /* istanbul ignore if */\n\n if ($) {\n const name = plugin.NAME;\n const JQUERY_NO_CONFLICT = $.fn[name];\n $.fn[name] = plugin.jQueryInterface;\n $.fn[name].Constructor = plugin;\n\n $.fn[name].noConflict = () => {\n $.fn[name] = JQUERY_NO_CONFLICT;\n return plugin.jQueryInterface;\n };\n }\n });\n};\n\nconst execute = callback => {\n if (typeof callback === 'function') {\n callback();\n }\n};\n\nconst executeAfterTransition = (callback, transitionElement, waitForTransition = true) => {\n if (!waitForTransition) {\n execute(callback);\n return;\n }\n\n const durationPadding = 5;\n const emulatedDuration = getTransitionDurationFromElement(transitionElement) + durationPadding;\n let called = false;\n\n const handler = ({\n target\n }) => {\n if (target !== transitionElement) {\n return;\n }\n\n called = true;\n transitionElement.removeEventListener(TRANSITION_END, handler);\n execute(callback);\n };\n\n transitionElement.addEventListener(TRANSITION_END, handler);\n setTimeout(() => {\n if (!called) {\n triggerTransitionEnd(transitionElement);\n }\n }, emulatedDuration);\n};\n/**\n * Return the previous/next element of a list.\n *\n * @param {array} list The list of elements\n * @param activeElement The active element\n * @param shouldGetNext Choose to get next or previous element\n * @param isCycleAllowed\n * @return {Element|elem} The proper element\n */\n\n\nconst getNextActiveElement = (list, activeElement, shouldGetNext, isCycleAllowed) => {\n const listLength = list.length;\n let index = list.indexOf(activeElement); // if the element does not exist in the list return an element\n // depending on the direction and if cycle is allowed\n\n if (index === -1) {\n return !shouldGetNext && isCycleAllowed ? list[listLength - 1] : list[0];\n }\n\n index += shouldGetNext ? 1 : -1;\n\n if (isCycleAllowed) {\n index = (index + listLength) % listLength;\n }\n\n return list[Math.max(0, Math.min(index, listLength - 1))];\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dom/event-handler.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst namespaceRegex = /[^.]*(?=\\..*)\\.|.*/;\nconst stripNameRegex = /\\..*/;\nconst stripUidRegex = /::\\d+$/;\nconst eventRegistry = {}; // Events storage\n\nlet uidEvent = 1;\nconst customEvents = {\n mouseenter: 'mouseover',\n mouseleave: 'mouseout'\n};\nconst nativeEvents = new Set(['click', 'dblclick', 'mouseup', 'mousedown', 'contextmenu', 'mousewheel', 'DOMMouseScroll', 'mouseover', 'mouseout', 'mousemove', 'selectstart', 'selectend', 'keydown', 'keypress', 'keyup', 'orientationchange', 'touchstart', 'touchmove', 'touchend', 'touchcancel', 'pointerdown', 'pointermove', 'pointerup', 'pointerleave', 'pointercancel', 'gesturestart', 'gesturechange', 'gestureend', 'focus', 'blur', 'change', 'reset', 'select', 'submit', 'focusin', 'focusout', 'load', 'unload', 'beforeunload', 'resize', 'move', 'DOMContentLoaded', 'readystatechange', 'error', 'abort', 'scroll']);\n/**\n * Private methods\n */\n\nfunction makeEventUid(element, uid) {\n return uid && `${uid}::${uidEvent++}` || element.uidEvent || uidEvent++;\n}\n\nfunction getElementEvents(element) {\n const uid = makeEventUid(element);\n element.uidEvent = uid;\n eventRegistry[uid] = eventRegistry[uid] || {};\n return eventRegistry[uid];\n}\n\nfunction bootstrapHandler(element, fn) {\n return function handler(event) {\n hydrateObj(event, {\n delegateTarget: element\n });\n\n if (handler.oneOff) {\n EventHandler.off(element, event.type, fn);\n }\n\n return fn.apply(element, [event]);\n };\n}\n\nfunction bootstrapDelegationHandler(element, selector, fn) {\n return function handler(event) {\n const domElements = element.querySelectorAll(selector);\n\n for (let {\n target\n } = event; target && target !== this; target = target.parentNode) {\n for (const domElement of domElements) {\n if (domElement !== target) {\n continue;\n }\n\n hydrateObj(event, {\n delegateTarget: target\n });\n\n if (handler.oneOff) {\n EventHandler.off(element, event.type, selector, fn);\n }\n\n return fn.apply(target, [event]);\n }\n }\n };\n}\n\nfunction findHandler(events, callable, delegationSelector = null) {\n return Object.values(events).find(event => event.callable === callable && event.delegationSelector === delegationSelector);\n}\n\nfunction normalizeParameters(originalTypeEvent, handler, delegationFunction) {\n const isDelegated = typeof handler === 'string'; // todo: tooltip passes `false` instead of selector, so we need to check\n\n const callable = isDelegated ? delegationFunction : handler || delegationFunction;\n let typeEvent = getTypeEvent(originalTypeEvent);\n\n if (!nativeEvents.has(typeEvent)) {\n typeEvent = originalTypeEvent;\n }\n\n return [isDelegated, callable, typeEvent];\n}\n\nfunction addHandler(element, originalTypeEvent, handler, delegationFunction, oneOff) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n\n let [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction); // in case of mouseenter or mouseleave wrap the handler within a function that checks for its DOM position\n // this prevents the handler from being dispatched the same way as mouseover or mouseout does\n\n if (originalTypeEvent in customEvents) {\n const wrapFunction = fn => {\n return function (event) {\n if (!event.relatedTarget || event.relatedTarget !== event.delegateTarget && !event.delegateTarget.contains(event.relatedTarget)) {\n return fn.call(this, event);\n }\n };\n };\n\n callable = wrapFunction(callable);\n }\n\n const events = getElementEvents(element);\n const handlers = events[typeEvent] || (events[typeEvent] = {});\n const previousFunction = findHandler(handlers, callable, isDelegated ? handler : null);\n\n if (previousFunction) {\n previousFunction.oneOff = previousFunction.oneOff && oneOff;\n return;\n }\n\n const uid = makeEventUid(callable, originalTypeEvent.replace(namespaceRegex, ''));\n const fn = isDelegated ? bootstrapDelegationHandler(element, handler, callable) : bootstrapHandler(element, callable);\n fn.delegationSelector = isDelegated ? handler : null;\n fn.callable = callable;\n fn.oneOff = oneOff;\n fn.uidEvent = uid;\n handlers[uid] = fn;\n element.addEventListener(typeEvent, fn, isDelegated);\n}\n\nfunction removeHandler(element, events, typeEvent, handler, delegationSelector) {\n const fn = findHandler(events[typeEvent], handler, delegationSelector);\n\n if (!fn) {\n return;\n }\n\n element.removeEventListener(typeEvent, fn, Boolean(delegationSelector));\n delete events[typeEvent][fn.uidEvent];\n}\n\nfunction removeNamespacedHandlers(element, events, typeEvent, namespace) {\n const storeElementEvent = events[typeEvent] || {};\n\n for (const handlerKey of Object.keys(storeElementEvent)) {\n if (handlerKey.includes(namespace)) {\n const event = storeElementEvent[handlerKey];\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n}\n\nfunction getTypeEvent(event) {\n // allow to get the native events from namespaced events ('click.bs.button' --> 'click')\n event = event.replace(stripNameRegex, '');\n return customEvents[event] || event;\n}\n\nconst EventHandler = {\n on(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, false);\n },\n\n one(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, true);\n },\n\n off(element, originalTypeEvent, handler, delegationFunction) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n\n const [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n const inNamespace = typeEvent !== originalTypeEvent;\n const events = getElementEvents(element);\n const storeElementEvent = events[typeEvent] || {};\n const isNamespace = originalTypeEvent.startsWith('.');\n\n if (typeof callable !== 'undefined') {\n // Simplest case: handler is passed, remove that listener ONLY.\n if (!Object.keys(storeElementEvent).length) {\n return;\n }\n\n removeHandler(element, events, typeEvent, callable, isDelegated ? handler : null);\n return;\n }\n\n if (isNamespace) {\n for (const elementEvent of Object.keys(events)) {\n removeNamespacedHandlers(element, events, elementEvent, originalTypeEvent.slice(1));\n }\n }\n\n for (const keyHandlers of Object.keys(storeElementEvent)) {\n const handlerKey = keyHandlers.replace(stripUidRegex, '');\n\n if (!inNamespace || originalTypeEvent.includes(handlerKey)) {\n const event = storeElementEvent[keyHandlers];\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n },\n\n trigger(element, event, args) {\n if (typeof event !== 'string' || !element) {\n return null;\n }\n\n const $ = getjQuery();\n const typeEvent = getTypeEvent(event);\n const inNamespace = event !== typeEvent;\n let jQueryEvent = null;\n let bubbles = true;\n let nativeDispatch = true;\n let defaultPrevented = false;\n\n if (inNamespace && $) {\n jQueryEvent = $.Event(event, args);\n $(element).trigger(jQueryEvent);\n bubbles = !jQueryEvent.isPropagationStopped();\n nativeDispatch = !jQueryEvent.isImmediatePropagationStopped();\n defaultPrevented = jQueryEvent.isDefaultPrevented();\n }\n\n let evt = new Event(event, {\n bubbles,\n cancelable: true\n });\n evt = hydrateObj(evt, args);\n\n if (defaultPrevented) {\n evt.preventDefault();\n }\n\n if (nativeDispatch) {\n element.dispatchEvent(evt);\n }\n\n if (evt.defaultPrevented && jQueryEvent) {\n jQueryEvent.preventDefault();\n }\n\n return evt;\n }\n\n};\n\nfunction hydrateObj(obj, meta) {\n for (const [key, value] of Object.entries(meta || {})) {\n try {\n obj[key] = value;\n } catch (_unused) {\n Object.defineProperty(obj, key, {\n configurable: true,\n\n get() {\n return value;\n }\n\n });\n }\n }\n\n return obj;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dom/data.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n/**\n * Constants\n */\nconst elementMap = new Map();\nconst Data = {\n set(element, key, instance) {\n if (!elementMap.has(element)) {\n elementMap.set(element, new Map());\n }\n\n const instanceMap = elementMap.get(element); // make it clear we only want one instance per element\n // can be removed later when multiple key/instances are fine to be used\n\n if (!instanceMap.has(key) && instanceMap.size !== 0) {\n // eslint-disable-next-line no-console\n console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(instanceMap.keys())[0]}.`);\n return;\n }\n\n instanceMap.set(key, instance);\n },\n\n get(element, key) {\n if (elementMap.has(element)) {\n return elementMap.get(element).get(key) || null;\n }\n\n return null;\n },\n\n remove(element, key) {\n if (!elementMap.has(element)) {\n return;\n }\n\n const instanceMap = elementMap.get(element);\n instanceMap.delete(key); // free up element references if there are no instances left for an element\n\n if (instanceMap.size === 0) {\n elementMap.delete(element);\n }\n }\n\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dom/manipulator.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\nfunction normalizeData(value) {\n if (value === 'true') {\n return true;\n }\n\n if (value === 'false') {\n return false;\n }\n\n if (value === Number(value).toString()) {\n return Number(value);\n }\n\n if (value === '' || value === 'null') {\n return null;\n }\n\n if (typeof value !== 'string') {\n return value;\n }\n\n try {\n return JSON.parse(decodeURIComponent(value));\n } catch (_unused) {\n return value;\n }\n}\n\nfunction normalizeDataKey(key) {\n return key.replace(/[A-Z]/g, chr => `-${chr.toLowerCase()}`);\n}\n\nconst Manipulator = {\n setDataAttribute(element, key, value) {\n element.setAttribute(`data-bs-${normalizeDataKey(key)}`, value);\n },\n\n removeDataAttribute(element, key) {\n element.removeAttribute(`data-bs-${normalizeDataKey(key)}`);\n },\n\n getDataAttributes(element) {\n if (!element) {\n return {};\n }\n\n const attributes = {};\n const bsKeys = Object.keys(element.dataset).filter(key => key.startsWith('bs') && !key.startsWith('bsConfig'));\n\n for (const key of bsKeys) {\n let pureKey = key.replace(/^bs/, '');\n pureKey = pureKey.charAt(0).toLowerCase() + pureKey.slice(1, pureKey.length);\n attributes[pureKey] = normalizeData(element.dataset[key]);\n }\n\n return attributes;\n },\n\n getDataAttribute(element, key) {\n return normalizeData(element.getAttribute(`data-bs-${normalizeDataKey(key)}`));\n }\n\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/config.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Class definition\n */\n\nclass Config {\n // Getters\n static get Default() {\n return {};\n }\n\n static get DefaultType() {\n return {};\n }\n\n static get NAME() {\n throw new Error('You have to implement the static method \"NAME\", for each component!');\n }\n\n _getConfig(config) {\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n\n this._typeCheckConfig(config);\n\n return config;\n }\n\n _configAfterMerge(config) {\n return config;\n }\n\n _mergeConfigObj(config, element) {\n const jsonConfig = isElement(element) ? Manipulator.getDataAttribute(element, 'config') : {}; // try to parse\n\n return { ...this.constructor.Default,\n ...(typeof jsonConfig === 'object' ? jsonConfig : {}),\n ...(isElement(element) ? Manipulator.getDataAttributes(element) : {}),\n ...(typeof config === 'object' ? config : {})\n };\n }\n\n _typeCheckConfig(config, configTypes = this.constructor.DefaultType) {\n for (const property of Object.keys(configTypes)) {\n const expectedTypes = configTypes[property];\n const value = config[property];\n const valueType = isElement(value) ? 'element' : toType(value);\n\n if (!new RegExp(expectedTypes).test(valueType)) {\n throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option \"${property}\" provided type \"${valueType}\" but expected type \"${expectedTypes}\".`);\n }\n }\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): base-component.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst VERSION = '5.2.3';\n/**\n * Class definition\n */\n\nclass BaseComponent extends Config {\n constructor(element, config) {\n super();\n element = getElement(element);\n\n if (!element) {\n return;\n }\n\n this._element = element;\n this._config = this._getConfig(config);\n Data.set(this._element, this.constructor.DATA_KEY, this);\n } // Public\n\n\n dispose() {\n Data.remove(this._element, this.constructor.DATA_KEY);\n EventHandler.off(this._element, this.constructor.EVENT_KEY);\n\n for (const propertyName of Object.getOwnPropertyNames(this)) {\n this[propertyName] = null;\n }\n }\n\n _queueCallback(callback, element, isAnimated = true) {\n executeAfterTransition(callback, element, isAnimated);\n }\n\n _getConfig(config) {\n config = this._mergeConfigObj(config, this._element);\n config = this._configAfterMerge(config);\n\n this._typeCheckConfig(config);\n\n return config;\n } // Static\n\n\n static getInstance(element) {\n return Data.get(getElement(element), this.DATA_KEY);\n }\n\n static getOrCreateInstance(element, config = {}) {\n return this.getInstance(element) || new this(element, typeof config === 'object' ? config : null);\n }\n\n static get VERSION() {\n return VERSION;\n }\n\n static get DATA_KEY() {\n return `bs.${this.NAME}`;\n }\n\n static get EVENT_KEY() {\n return `.${this.DATA_KEY}`;\n }\n\n static eventName(name) {\n return `${name}${this.EVENT_KEY}`;\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/component-functions.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst enableDismissTrigger = (component, method = 'hide') => {\n const clickEvent = `click.dismiss${component.EVENT_KEY}`;\n const name = component.NAME;\n EventHandler.on(document, clickEvent, `[data-bs-dismiss=\"${name}\"]`, function (event) {\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n\n if (isDisabled(this)) {\n return;\n }\n\n const target = getElementFromSelector(this) || this.closest(`.${name}`);\n const instance = component.getOrCreateInstance(target); // Method argument is left, for Alert and only, as it doesn't implement the 'hide' method\n\n instance[method]();\n });\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): alert.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$f = 'alert';\nconst DATA_KEY$a = 'bs.alert';\nconst EVENT_KEY$b = `.${DATA_KEY$a}`;\nconst EVENT_CLOSE = `close${EVENT_KEY$b}`;\nconst EVENT_CLOSED = `closed${EVENT_KEY$b}`;\nconst CLASS_NAME_FADE$5 = 'fade';\nconst CLASS_NAME_SHOW$8 = 'show';\n/**\n * Class definition\n */\n\nclass Alert extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$f;\n } // Public\n\n\n close() {\n const closeEvent = EventHandler.trigger(this._element, EVENT_CLOSE);\n\n if (closeEvent.defaultPrevented) {\n return;\n }\n\n this._element.classList.remove(CLASS_NAME_SHOW$8);\n\n const isAnimated = this._element.classList.contains(CLASS_NAME_FADE$5);\n\n this._queueCallback(() => this._destroyElement(), this._element, isAnimated);\n } // Private\n\n\n _destroyElement() {\n this._element.remove();\n\n EventHandler.trigger(this._element, EVENT_CLOSED);\n this.dispose();\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Alert.getOrCreateInstance(this);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config](this);\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nenableDismissTrigger(Alert, 'close');\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Alert);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): button.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$e = 'button';\nconst DATA_KEY$9 = 'bs.button';\nconst EVENT_KEY$a = `.${DATA_KEY$9}`;\nconst DATA_API_KEY$6 = '.data-api';\nconst CLASS_NAME_ACTIVE$3 = 'active';\nconst SELECTOR_DATA_TOGGLE$5 = '[data-bs-toggle=\"button\"]';\nconst EVENT_CLICK_DATA_API$6 = `click${EVENT_KEY$a}${DATA_API_KEY$6}`;\n/**\n * Class definition\n */\n\nclass Button extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$e;\n } // Public\n\n\n toggle() {\n // Toggle class and sync the `aria-pressed` attribute with the return value of the `.toggle()` method\n this._element.setAttribute('aria-pressed', this._element.classList.toggle(CLASS_NAME_ACTIVE$3));\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Button.getOrCreateInstance(this);\n\n if (config === 'toggle') {\n data[config]();\n }\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$6, SELECTOR_DATA_TOGGLE$5, event => {\n event.preventDefault();\n const button = event.target.closest(SELECTOR_DATA_TOGGLE$5);\n const data = Button.getOrCreateInstance(button);\n data.toggle();\n});\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Button);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dom/selector-engine.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst SelectorEngine = {\n find(selector, element = document.documentElement) {\n return [].concat(...Element.prototype.querySelectorAll.call(element, selector));\n },\n\n findOne(selector, element = document.documentElement) {\n return Element.prototype.querySelector.call(element, selector);\n },\n\n children(element, selector) {\n return [].concat(...element.children).filter(child => child.matches(selector));\n },\n\n parents(element, selector) {\n const parents = [];\n let ancestor = element.parentNode.closest(selector);\n\n while (ancestor) {\n parents.push(ancestor);\n ancestor = ancestor.parentNode.closest(selector);\n }\n\n return parents;\n },\n\n prev(element, selector) {\n let previous = element.previousElementSibling;\n\n while (previous) {\n if (previous.matches(selector)) {\n return [previous];\n }\n\n previous = previous.previousElementSibling;\n }\n\n return [];\n },\n\n // TODO: this is now unused; remove later along with prev()\n next(element, selector) {\n let next = element.nextElementSibling;\n\n while (next) {\n if (next.matches(selector)) {\n return [next];\n }\n\n next = next.nextElementSibling;\n }\n\n return [];\n },\n\n focusableChildren(element) {\n const focusables = ['a', 'button', 'input', 'textarea', 'select', 'details', '[tabindex]', '[contenteditable=\"true\"]'].map(selector => `${selector}:not([tabindex^=\"-\"])`).join(',');\n return this.find(focusables, element).filter(el => !isDisabled(el) && isVisible(el));\n }\n\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/swipe.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$d = 'swipe';\nconst EVENT_KEY$9 = '.bs.swipe';\nconst EVENT_TOUCHSTART = `touchstart${EVENT_KEY$9}`;\nconst EVENT_TOUCHMOVE = `touchmove${EVENT_KEY$9}`;\nconst EVENT_TOUCHEND = `touchend${EVENT_KEY$9}`;\nconst EVENT_POINTERDOWN = `pointerdown${EVENT_KEY$9}`;\nconst EVENT_POINTERUP = `pointerup${EVENT_KEY$9}`;\nconst POINTER_TYPE_TOUCH = 'touch';\nconst POINTER_TYPE_PEN = 'pen';\nconst CLASS_NAME_POINTER_EVENT = 'pointer-event';\nconst SWIPE_THRESHOLD = 40;\nconst Default$c = {\n endCallback: null,\n leftCallback: null,\n rightCallback: null\n};\nconst DefaultType$c = {\n endCallback: '(function|null)',\n leftCallback: '(function|null)',\n rightCallback: '(function|null)'\n};\n/**\n * Class definition\n */\n\nclass Swipe extends Config {\n constructor(element, config) {\n super();\n this._element = element;\n\n if (!element || !Swipe.isSupported()) {\n return;\n }\n\n this._config = this._getConfig(config);\n this._deltaX = 0;\n this._supportPointerEvents = Boolean(window.PointerEvent);\n\n this._initEvents();\n } // Getters\n\n\n static get Default() {\n return Default$c;\n }\n\n static get DefaultType() {\n return DefaultType$c;\n }\n\n static get NAME() {\n return NAME$d;\n } // Public\n\n\n dispose() {\n EventHandler.off(this._element, EVENT_KEY$9);\n } // Private\n\n\n _start(event) {\n if (!this._supportPointerEvents) {\n this._deltaX = event.touches[0].clientX;\n return;\n }\n\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX;\n }\n }\n\n _end(event) {\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX - this._deltaX;\n }\n\n this._handleSwipe();\n\n execute(this._config.endCallback);\n }\n\n _move(event) {\n this._deltaX = event.touches && event.touches.length > 1 ? 0 : event.touches[0].clientX - this._deltaX;\n }\n\n _handleSwipe() {\n const absDeltaX = Math.abs(this._deltaX);\n\n if (absDeltaX <= SWIPE_THRESHOLD) {\n return;\n }\n\n const direction = absDeltaX / this._deltaX;\n this._deltaX = 0;\n\n if (!direction) {\n return;\n }\n\n execute(direction > 0 ? this._config.rightCallback : this._config.leftCallback);\n }\n\n _initEvents() {\n if (this._supportPointerEvents) {\n EventHandler.on(this._element, EVENT_POINTERDOWN, event => this._start(event));\n EventHandler.on(this._element, EVENT_POINTERUP, event => this._end(event));\n\n this._element.classList.add(CLASS_NAME_POINTER_EVENT);\n } else {\n EventHandler.on(this._element, EVENT_TOUCHSTART, event => this._start(event));\n EventHandler.on(this._element, EVENT_TOUCHMOVE, event => this._move(event));\n EventHandler.on(this._element, EVENT_TOUCHEND, event => this._end(event));\n }\n }\n\n _eventIsPointerPenTouch(event) {\n return this._supportPointerEvents && (event.pointerType === POINTER_TYPE_PEN || event.pointerType === POINTER_TYPE_TOUCH);\n } // Static\n\n\n static isSupported() {\n return 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0;\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): carousel.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$c = 'carousel';\nconst DATA_KEY$8 = 'bs.carousel';\nconst EVENT_KEY$8 = `.${DATA_KEY$8}`;\nconst DATA_API_KEY$5 = '.data-api';\nconst ARROW_LEFT_KEY$1 = 'ArrowLeft';\nconst ARROW_RIGHT_KEY$1 = 'ArrowRight';\nconst TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch\n\nconst ORDER_NEXT = 'next';\nconst ORDER_PREV = 'prev';\nconst DIRECTION_LEFT = 'left';\nconst DIRECTION_RIGHT = 'right';\nconst EVENT_SLIDE = `slide${EVENT_KEY$8}`;\nconst EVENT_SLID = `slid${EVENT_KEY$8}`;\nconst EVENT_KEYDOWN$1 = `keydown${EVENT_KEY$8}`;\nconst EVENT_MOUSEENTER$1 = `mouseenter${EVENT_KEY$8}`;\nconst EVENT_MOUSELEAVE$1 = `mouseleave${EVENT_KEY$8}`;\nconst EVENT_DRAG_START = `dragstart${EVENT_KEY$8}`;\nconst EVENT_LOAD_DATA_API$3 = `load${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst EVENT_CLICK_DATA_API$5 = `click${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst CLASS_NAME_CAROUSEL = 'carousel';\nconst CLASS_NAME_ACTIVE$2 = 'active';\nconst CLASS_NAME_SLIDE = 'slide';\nconst CLASS_NAME_END = 'carousel-item-end';\nconst CLASS_NAME_START = 'carousel-item-start';\nconst CLASS_NAME_NEXT = 'carousel-item-next';\nconst CLASS_NAME_PREV = 'carousel-item-prev';\nconst SELECTOR_ACTIVE = '.active';\nconst SELECTOR_ITEM = '.carousel-item';\nconst SELECTOR_ACTIVE_ITEM = SELECTOR_ACTIVE + SELECTOR_ITEM;\nconst SELECTOR_ITEM_IMG = '.carousel-item img';\nconst SELECTOR_INDICATORS = '.carousel-indicators';\nconst SELECTOR_DATA_SLIDE = '[data-bs-slide], [data-bs-slide-to]';\nconst SELECTOR_DATA_RIDE = '[data-bs-ride=\"carousel\"]';\nconst KEY_TO_DIRECTION = {\n [ARROW_LEFT_KEY$1]: DIRECTION_RIGHT,\n [ARROW_RIGHT_KEY$1]: DIRECTION_LEFT\n};\nconst Default$b = {\n interval: 5000,\n keyboard: true,\n pause: 'hover',\n ride: false,\n touch: true,\n wrap: true\n};\nconst DefaultType$b = {\n interval: '(number|boolean)',\n // TODO:v6 remove boolean support\n keyboard: 'boolean',\n pause: '(string|boolean)',\n ride: '(boolean|string)',\n touch: 'boolean',\n wrap: 'boolean'\n};\n/**\n * Class definition\n */\n\nclass Carousel extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._interval = null;\n this._activeElement = null;\n this._isSliding = false;\n this.touchTimeout = null;\n this._swipeHelper = null;\n this._indicatorsElement = SelectorEngine.findOne(SELECTOR_INDICATORS, this._element);\n\n this._addEventListeners();\n\n if (this._config.ride === CLASS_NAME_CAROUSEL) {\n this.cycle();\n }\n } // Getters\n\n\n static get Default() {\n return Default$b;\n }\n\n static get DefaultType() {\n return DefaultType$b;\n }\n\n static get NAME() {\n return NAME$c;\n } // Public\n\n\n next() {\n this._slide(ORDER_NEXT);\n }\n\n nextWhenVisible() {\n // FIXME TODO use `document.visibilityState`\n // Don't call next when the page isn't visible\n // or the carousel or its parent isn't visible\n if (!document.hidden && isVisible(this._element)) {\n this.next();\n }\n }\n\n prev() {\n this._slide(ORDER_PREV);\n }\n\n pause() {\n if (this._isSliding) {\n triggerTransitionEnd(this._element);\n }\n\n this._clearInterval();\n }\n\n cycle() {\n this._clearInterval();\n\n this._updateInterval();\n\n this._interval = setInterval(() => this.nextWhenVisible(), this._config.interval);\n }\n\n _maybeEnableCycle() {\n if (!this._config.ride) {\n return;\n }\n\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.cycle());\n return;\n }\n\n this.cycle();\n }\n\n to(index) {\n const items = this._getItems();\n\n if (index > items.length - 1 || index < 0) {\n return;\n }\n\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.to(index));\n return;\n }\n\n const activeIndex = this._getItemIndex(this._getActive());\n\n if (activeIndex === index) {\n return;\n }\n\n const order = index > activeIndex ? ORDER_NEXT : ORDER_PREV;\n\n this._slide(order, items[index]);\n }\n\n dispose() {\n if (this._swipeHelper) {\n this._swipeHelper.dispose();\n }\n\n super.dispose();\n } // Private\n\n\n _configAfterMerge(config) {\n config.defaultInterval = config.interval;\n return config;\n }\n\n _addEventListeners() {\n if (this._config.keyboard) {\n EventHandler.on(this._element, EVENT_KEYDOWN$1, event => this._keydown(event));\n }\n\n if (this._config.pause === 'hover') {\n EventHandler.on(this._element, EVENT_MOUSEENTER$1, () => this.pause());\n EventHandler.on(this._element, EVENT_MOUSELEAVE$1, () => this._maybeEnableCycle());\n }\n\n if (this._config.touch && Swipe.isSupported()) {\n this._addTouchEventListeners();\n }\n }\n\n _addTouchEventListeners() {\n for (const img of SelectorEngine.find(SELECTOR_ITEM_IMG, this._element)) {\n EventHandler.on(img, EVENT_DRAG_START, event => event.preventDefault());\n }\n\n const endCallBack = () => {\n if (this._config.pause !== 'hover') {\n return;\n } // If it's a touch-enabled device, mouseenter/leave are fired as\n // part of the mouse compatibility events on first tap - the carousel\n // would stop cycling until user tapped out of it;\n // here, we listen for touchend, explicitly pause the carousel\n // (as if it's the second time we tap on it, mouseenter compat event\n // is NOT fired) and after a timeout (to allow for mouse compatibility\n // events to fire) we explicitly restart cycling\n\n\n this.pause();\n\n if (this.touchTimeout) {\n clearTimeout(this.touchTimeout);\n }\n\n this.touchTimeout = setTimeout(() => this._maybeEnableCycle(), TOUCHEVENT_COMPAT_WAIT + this._config.interval);\n };\n\n const swipeConfig = {\n leftCallback: () => this._slide(this._directionToOrder(DIRECTION_LEFT)),\n rightCallback: () => this._slide(this._directionToOrder(DIRECTION_RIGHT)),\n endCallback: endCallBack\n };\n this._swipeHelper = new Swipe(this._element, swipeConfig);\n }\n\n _keydown(event) {\n if (/input|textarea/i.test(event.target.tagName)) {\n return;\n }\n\n const direction = KEY_TO_DIRECTION[event.key];\n\n if (direction) {\n event.preventDefault();\n\n this._slide(this._directionToOrder(direction));\n }\n }\n\n _getItemIndex(element) {\n return this._getItems().indexOf(element);\n }\n\n _setActiveIndicatorElement(index) {\n if (!this._indicatorsElement) {\n return;\n }\n\n const activeIndicator = SelectorEngine.findOne(SELECTOR_ACTIVE, this._indicatorsElement);\n activeIndicator.classList.remove(CLASS_NAME_ACTIVE$2);\n activeIndicator.removeAttribute('aria-current');\n const newActiveIndicator = SelectorEngine.findOne(`[data-bs-slide-to=\"${index}\"]`, this._indicatorsElement);\n\n if (newActiveIndicator) {\n newActiveIndicator.classList.add(CLASS_NAME_ACTIVE$2);\n newActiveIndicator.setAttribute('aria-current', 'true');\n }\n }\n\n _updateInterval() {\n const element = this._activeElement || this._getActive();\n\n if (!element) {\n return;\n }\n\n const elementInterval = Number.parseInt(element.getAttribute('data-bs-interval'), 10);\n this._config.interval = elementInterval || this._config.defaultInterval;\n }\n\n _slide(order, element = null) {\n if (this._isSliding) {\n return;\n }\n\n const activeElement = this._getActive();\n\n const isNext = order === ORDER_NEXT;\n const nextElement = element || getNextActiveElement(this._getItems(), activeElement, isNext, this._config.wrap);\n\n if (nextElement === activeElement) {\n return;\n }\n\n const nextElementIndex = this._getItemIndex(nextElement);\n\n const triggerEvent = eventName => {\n return EventHandler.trigger(this._element, eventName, {\n relatedTarget: nextElement,\n direction: this._orderToDirection(order),\n from: this._getItemIndex(activeElement),\n to: nextElementIndex\n });\n };\n\n const slideEvent = triggerEvent(EVENT_SLIDE);\n\n if (slideEvent.defaultPrevented) {\n return;\n }\n\n if (!activeElement || !nextElement) {\n // Some weirdness is happening, so we bail\n // todo: change tests that use empty divs to avoid this check\n return;\n }\n\n const isCycling = Boolean(this._interval);\n this.pause();\n this._isSliding = true;\n\n this._setActiveIndicatorElement(nextElementIndex);\n\n this._activeElement = nextElement;\n const directionalClassName = isNext ? CLASS_NAME_START : CLASS_NAME_END;\n const orderClassName = isNext ? CLASS_NAME_NEXT : CLASS_NAME_PREV;\n nextElement.classList.add(orderClassName);\n reflow(nextElement);\n activeElement.classList.add(directionalClassName);\n nextElement.classList.add(directionalClassName);\n\n const completeCallBack = () => {\n nextElement.classList.remove(directionalClassName, orderClassName);\n nextElement.classList.add(CLASS_NAME_ACTIVE$2);\n activeElement.classList.remove(CLASS_NAME_ACTIVE$2, orderClassName, directionalClassName);\n this._isSliding = false;\n triggerEvent(EVENT_SLID);\n };\n\n this._queueCallback(completeCallBack, activeElement, this._isAnimated());\n\n if (isCycling) {\n this.cycle();\n }\n }\n\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_SLIDE);\n }\n\n _getActive() {\n return SelectorEngine.findOne(SELECTOR_ACTIVE_ITEM, this._element);\n }\n\n _getItems() {\n return SelectorEngine.find(SELECTOR_ITEM, this._element);\n }\n\n _clearInterval() {\n if (this._interval) {\n clearInterval(this._interval);\n this._interval = null;\n }\n }\n\n _directionToOrder(direction) {\n if (isRTL()) {\n return direction === DIRECTION_LEFT ? ORDER_PREV : ORDER_NEXT;\n }\n\n return direction === DIRECTION_LEFT ? ORDER_NEXT : ORDER_PREV;\n }\n\n _orderToDirection(order) {\n if (isRTL()) {\n return order === ORDER_PREV ? DIRECTION_LEFT : DIRECTION_RIGHT;\n }\n\n return order === ORDER_PREV ? DIRECTION_RIGHT : DIRECTION_LEFT;\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Carousel.getOrCreateInstance(this, config);\n\n if (typeof config === 'number') {\n data.to(config);\n return;\n }\n\n if (typeof config === 'string') {\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n }\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$5, SELECTOR_DATA_SLIDE, function (event) {\n const target = getElementFromSelector(this);\n\n if (!target || !target.classList.contains(CLASS_NAME_CAROUSEL)) {\n return;\n }\n\n event.preventDefault();\n const carousel = Carousel.getOrCreateInstance(target);\n const slideIndex = this.getAttribute('data-bs-slide-to');\n\n if (slideIndex) {\n carousel.to(slideIndex);\n\n carousel._maybeEnableCycle();\n\n return;\n }\n\n if (Manipulator.getDataAttribute(this, 'slide') === 'next') {\n carousel.next();\n\n carousel._maybeEnableCycle();\n\n return;\n }\n\n carousel.prev();\n\n carousel._maybeEnableCycle();\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$3, () => {\n const carousels = SelectorEngine.find(SELECTOR_DATA_RIDE);\n\n for (const carousel of carousels) {\n Carousel.getOrCreateInstance(carousel);\n }\n});\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Carousel);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): collapse.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$b = 'collapse';\nconst DATA_KEY$7 = 'bs.collapse';\nconst EVENT_KEY$7 = `.${DATA_KEY$7}`;\nconst DATA_API_KEY$4 = '.data-api';\nconst EVENT_SHOW$6 = `show${EVENT_KEY$7}`;\nconst EVENT_SHOWN$6 = `shown${EVENT_KEY$7}`;\nconst EVENT_HIDE$6 = `hide${EVENT_KEY$7}`;\nconst EVENT_HIDDEN$6 = `hidden${EVENT_KEY$7}`;\nconst EVENT_CLICK_DATA_API$4 = `click${EVENT_KEY$7}${DATA_API_KEY$4}`;\nconst CLASS_NAME_SHOW$7 = 'show';\nconst CLASS_NAME_COLLAPSE = 'collapse';\nconst CLASS_NAME_COLLAPSING = 'collapsing';\nconst CLASS_NAME_COLLAPSED = 'collapsed';\nconst CLASS_NAME_DEEPER_CHILDREN = `:scope .${CLASS_NAME_COLLAPSE} .${CLASS_NAME_COLLAPSE}`;\nconst CLASS_NAME_HORIZONTAL = 'collapse-horizontal';\nconst WIDTH = 'width';\nconst HEIGHT = 'height';\nconst SELECTOR_ACTIVES = '.collapse.show, .collapse.collapsing';\nconst SELECTOR_DATA_TOGGLE$4 = '[data-bs-toggle=\"collapse\"]';\nconst Default$a = {\n parent: null,\n toggle: true\n};\nconst DefaultType$a = {\n parent: '(null|element)',\n toggle: 'boolean'\n};\n/**\n * Class definition\n */\n\nclass Collapse extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isTransitioning = false;\n this._triggerArray = [];\n const toggleList = SelectorEngine.find(SELECTOR_DATA_TOGGLE$4);\n\n for (const elem of toggleList) {\n const selector = getSelectorFromElement(elem);\n const filterElement = SelectorEngine.find(selector).filter(foundElement => foundElement === this._element);\n\n if (selector !== null && filterElement.length) {\n this._triggerArray.push(elem);\n }\n }\n\n this._initializeChildren();\n\n if (!this._config.parent) {\n this._addAriaAndCollapsedClass(this._triggerArray, this._isShown());\n }\n\n if (this._config.toggle) {\n this.toggle();\n }\n } // Getters\n\n\n static get Default() {\n return Default$a;\n }\n\n static get DefaultType() {\n return DefaultType$a;\n }\n\n static get NAME() {\n return NAME$b;\n } // Public\n\n\n toggle() {\n if (this._isShown()) {\n this.hide();\n } else {\n this.show();\n }\n }\n\n show() {\n if (this._isTransitioning || this._isShown()) {\n return;\n }\n\n let activeChildren = []; // find active children\n\n if (this._config.parent) {\n activeChildren = this._getFirstLevelChildren(SELECTOR_ACTIVES).filter(element => element !== this._element).map(element => Collapse.getOrCreateInstance(element, {\n toggle: false\n }));\n }\n\n if (activeChildren.length && activeChildren[0]._isTransitioning) {\n return;\n }\n\n const startEvent = EventHandler.trigger(this._element, EVENT_SHOW$6);\n\n if (startEvent.defaultPrevented) {\n return;\n }\n\n for (const activeInstance of activeChildren) {\n activeInstance.hide();\n }\n\n const dimension = this._getDimension();\n\n this._element.classList.remove(CLASS_NAME_COLLAPSE);\n\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n\n this._element.style[dimension] = 0;\n\n this._addAriaAndCollapsedClass(this._triggerArray, true);\n\n this._isTransitioning = true;\n\n const complete = () => {\n this._isTransitioning = false;\n\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n\n this._element.classList.add(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n\n this._element.style[dimension] = '';\n EventHandler.trigger(this._element, EVENT_SHOWN$6);\n };\n\n const capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);\n const scrollSize = `scroll${capitalizedDimension}`;\n\n this._queueCallback(complete, this._element, true);\n\n this._element.style[dimension] = `${this._element[scrollSize]}px`;\n }\n\n hide() {\n if (this._isTransitioning || !this._isShown()) {\n return;\n }\n\n const startEvent = EventHandler.trigger(this._element, EVENT_HIDE$6);\n\n if (startEvent.defaultPrevented) {\n return;\n }\n\n const dimension = this._getDimension();\n\n this._element.style[dimension] = `${this._element.getBoundingClientRect()[dimension]}px`;\n reflow(this._element);\n\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n\n this._element.classList.remove(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n\n for (const trigger of this._triggerArray) {\n const element = getElementFromSelector(trigger);\n\n if (element && !this._isShown(element)) {\n this._addAriaAndCollapsedClass([trigger], false);\n }\n }\n\n this._isTransitioning = true;\n\n const complete = () => {\n this._isTransitioning = false;\n\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n\n this._element.classList.add(CLASS_NAME_COLLAPSE);\n\n EventHandler.trigger(this._element, EVENT_HIDDEN$6);\n };\n\n this._element.style[dimension] = '';\n\n this._queueCallback(complete, this._element, true);\n }\n\n _isShown(element = this._element) {\n return element.classList.contains(CLASS_NAME_SHOW$7);\n } // Private\n\n\n _configAfterMerge(config) {\n config.toggle = Boolean(config.toggle); // Coerce string values\n\n config.parent = getElement(config.parent);\n return config;\n }\n\n _getDimension() {\n return this._element.classList.contains(CLASS_NAME_HORIZONTAL) ? WIDTH : HEIGHT;\n }\n\n _initializeChildren() {\n if (!this._config.parent) {\n return;\n }\n\n const children = this._getFirstLevelChildren(SELECTOR_DATA_TOGGLE$4);\n\n for (const element of children) {\n const selected = getElementFromSelector(element);\n\n if (selected) {\n this._addAriaAndCollapsedClass([element], this._isShown(selected));\n }\n }\n }\n\n _getFirstLevelChildren(selector) {\n const children = SelectorEngine.find(CLASS_NAME_DEEPER_CHILDREN, this._config.parent); // remove children if greater depth\n\n return SelectorEngine.find(selector, this._config.parent).filter(element => !children.includes(element));\n }\n\n _addAriaAndCollapsedClass(triggerArray, isOpen) {\n if (!triggerArray.length) {\n return;\n }\n\n for (const element of triggerArray) {\n element.classList.toggle(CLASS_NAME_COLLAPSED, !isOpen);\n element.setAttribute('aria-expanded', isOpen);\n }\n } // Static\n\n\n static jQueryInterface(config) {\n const _config = {};\n\n if (typeof config === 'string' && /show|hide/.test(config)) {\n _config.toggle = false;\n }\n\n return this.each(function () {\n const data = Collapse.getOrCreateInstance(this, _config);\n\n if (typeof config === 'string') {\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n }\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$4, SELECTOR_DATA_TOGGLE$4, function (event) {\n // preventDefault only for elements (which change the URL) not inside the collapsible element\n if (event.target.tagName === 'A' || event.delegateTarget && event.delegateTarget.tagName === 'A') {\n event.preventDefault();\n }\n\n const selector = getSelectorFromElement(this);\n const selectorElements = SelectorEngine.find(selector);\n\n for (const element of selectorElements) {\n Collapse.getOrCreateInstance(element, {\n toggle: false\n }).toggle();\n }\n});\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Collapse);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dropdown.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$a = 'dropdown';\nconst DATA_KEY$6 = 'bs.dropdown';\nconst EVENT_KEY$6 = `.${DATA_KEY$6}`;\nconst DATA_API_KEY$3 = '.data-api';\nconst ESCAPE_KEY$2 = 'Escape';\nconst TAB_KEY$1 = 'Tab';\nconst ARROW_UP_KEY$1 = 'ArrowUp';\nconst ARROW_DOWN_KEY$1 = 'ArrowDown';\nconst RIGHT_MOUSE_BUTTON = 2; // MouseEvent.button value for the secondary button, usually the right button\n\nconst EVENT_HIDE$5 = `hide${EVENT_KEY$6}`;\nconst EVENT_HIDDEN$5 = `hidden${EVENT_KEY$6}`;\nconst EVENT_SHOW$5 = `show${EVENT_KEY$6}`;\nconst EVENT_SHOWN$5 = `shown${EVENT_KEY$6}`;\nconst EVENT_CLICK_DATA_API$3 = `click${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYDOWN_DATA_API = `keydown${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYUP_DATA_API = `keyup${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst CLASS_NAME_SHOW$6 = 'show';\nconst CLASS_NAME_DROPUP = 'dropup';\nconst CLASS_NAME_DROPEND = 'dropend';\nconst CLASS_NAME_DROPSTART = 'dropstart';\nconst CLASS_NAME_DROPUP_CENTER = 'dropup-center';\nconst CLASS_NAME_DROPDOWN_CENTER = 'dropdown-center';\nconst SELECTOR_DATA_TOGGLE$3 = '[data-bs-toggle=\"dropdown\"]:not(.disabled):not(:disabled)';\nconst SELECTOR_DATA_TOGGLE_SHOWN = `${SELECTOR_DATA_TOGGLE$3}.${CLASS_NAME_SHOW$6}`;\nconst SELECTOR_MENU = '.dropdown-menu';\nconst SELECTOR_NAVBAR = '.navbar';\nconst SELECTOR_NAVBAR_NAV = '.navbar-nav';\nconst SELECTOR_VISIBLE_ITEMS = '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)';\nconst PLACEMENT_TOP = isRTL() ? 'top-end' : 'top-start';\nconst PLACEMENT_TOPEND = isRTL() ? 'top-start' : 'top-end';\nconst PLACEMENT_BOTTOM = isRTL() ? 'bottom-end' : 'bottom-start';\nconst PLACEMENT_BOTTOMEND = isRTL() ? 'bottom-start' : 'bottom-end';\nconst PLACEMENT_RIGHT = isRTL() ? 'left-start' : 'right-start';\nconst PLACEMENT_LEFT = isRTL() ? 'right-start' : 'left-start';\nconst PLACEMENT_TOPCENTER = 'top';\nconst PLACEMENT_BOTTOMCENTER = 'bottom';\nconst Default$9 = {\n autoClose: true,\n boundary: 'clippingParents',\n display: 'dynamic',\n offset: [0, 2],\n popperConfig: null,\n reference: 'toggle'\n};\nconst DefaultType$9 = {\n autoClose: '(boolean|string)',\n boundary: '(string|element)',\n display: 'string',\n offset: '(array|string|function)',\n popperConfig: '(null|object|function)',\n reference: '(string|element|object)'\n};\n/**\n * Class definition\n */\n\nclass Dropdown extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._popper = null;\n this._parent = this._element.parentNode; // dropdown wrapper\n // todo: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.2/forms/input-group/\n\n this._menu = SelectorEngine.next(this._element, SELECTOR_MENU)[0] || SelectorEngine.prev(this._element, SELECTOR_MENU)[0] || SelectorEngine.findOne(SELECTOR_MENU, this._parent);\n this._inNavbar = this._detectNavbar();\n } // Getters\n\n\n static get Default() {\n return Default$9;\n }\n\n static get DefaultType() {\n return DefaultType$9;\n }\n\n static get NAME() {\n return NAME$a;\n } // Public\n\n\n toggle() {\n return this._isShown() ? this.hide() : this.show();\n }\n\n show() {\n if (isDisabled(this._element) || this._isShown()) {\n return;\n }\n\n const relatedTarget = {\n relatedTarget: this._element\n };\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$5, relatedTarget);\n\n if (showEvent.defaultPrevented) {\n return;\n }\n\n this._createPopper(); // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n\n\n if ('ontouchstart' in document.documentElement && !this._parent.closest(SELECTOR_NAVBAR_NAV)) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n\n this._element.focus();\n\n this._element.setAttribute('aria-expanded', true);\n\n this._menu.classList.add(CLASS_NAME_SHOW$6);\n\n this._element.classList.add(CLASS_NAME_SHOW$6);\n\n EventHandler.trigger(this._element, EVENT_SHOWN$5, relatedTarget);\n }\n\n hide() {\n if (isDisabled(this._element) || !this._isShown()) {\n return;\n }\n\n const relatedTarget = {\n relatedTarget: this._element\n };\n\n this._completeHide(relatedTarget);\n }\n\n dispose() {\n if (this._popper) {\n this._popper.destroy();\n }\n\n super.dispose();\n }\n\n update() {\n this._inNavbar = this._detectNavbar();\n\n if (this._popper) {\n this._popper.update();\n }\n } // Private\n\n\n _completeHide(relatedTarget) {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$5, relatedTarget);\n\n if (hideEvent.defaultPrevented) {\n return;\n } // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n\n\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n\n if (this._popper) {\n this._popper.destroy();\n }\n\n this._menu.classList.remove(CLASS_NAME_SHOW$6);\n\n this._element.classList.remove(CLASS_NAME_SHOW$6);\n\n this._element.setAttribute('aria-expanded', 'false');\n\n Manipulator.removeDataAttribute(this._menu, 'popper');\n EventHandler.trigger(this._element, EVENT_HIDDEN$5, relatedTarget);\n }\n\n _getConfig(config) {\n config = super._getConfig(config);\n\n if (typeof config.reference === 'object' && !isElement(config.reference) && typeof config.reference.getBoundingClientRect !== 'function') {\n // Popper virtual elements require a getBoundingClientRect method\n throw new TypeError(`${NAME$a.toUpperCase()}: Option \"reference\" provided type \"object\" without a required \"getBoundingClientRect\" method.`);\n }\n\n return config;\n }\n\n _createPopper() {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s dropdowns require Popper (https://popper.js.org)');\n }\n\n let referenceElement = this._element;\n\n if (this._config.reference === 'parent') {\n referenceElement = this._parent;\n } else if (isElement(this._config.reference)) {\n referenceElement = getElement(this._config.reference);\n } else if (typeof this._config.reference === 'object') {\n referenceElement = this._config.reference;\n }\n\n const popperConfig = this._getPopperConfig();\n\n this._popper = Popper.createPopper(referenceElement, this._menu, popperConfig);\n }\n\n _isShown() {\n return this._menu.classList.contains(CLASS_NAME_SHOW$6);\n }\n\n _getPlacement() {\n const parentDropdown = this._parent;\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPEND)) {\n return PLACEMENT_RIGHT;\n }\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPSTART)) {\n return PLACEMENT_LEFT;\n }\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP_CENTER)) {\n return PLACEMENT_TOPCENTER;\n }\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPDOWN_CENTER)) {\n return PLACEMENT_BOTTOMCENTER;\n } // We need to trim the value because custom properties can also include spaces\n\n\n const isEnd = getComputedStyle(this._menu).getPropertyValue('--bs-position').trim() === 'end';\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP)) {\n return isEnd ? PLACEMENT_TOPEND : PLACEMENT_TOP;\n }\n\n return isEnd ? PLACEMENT_BOTTOMEND : PLACEMENT_BOTTOM;\n }\n\n _detectNavbar() {\n return this._element.closest(SELECTOR_NAVBAR) !== null;\n }\n\n _getOffset() {\n const {\n offset\n } = this._config;\n\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n\n return offset;\n }\n\n _getPopperConfig() {\n const defaultBsPopperConfig = {\n placement: this._getPlacement(),\n modifiers: [{\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }]\n }; // Disable Popper if we have a static display or Dropdown is in Navbar\n\n if (this._inNavbar || this._config.display === 'static') {\n Manipulator.setDataAttribute(this._menu, 'popper', 'static'); // todo:v6 remove\n\n defaultBsPopperConfig.modifiers = [{\n name: 'applyStyles',\n enabled: false\n }];\n }\n\n return { ...defaultBsPopperConfig,\n ...(typeof this._config.popperConfig === 'function' ? this._config.popperConfig(defaultBsPopperConfig) : this._config.popperConfig)\n };\n }\n\n _selectMenuItem({\n key,\n target\n }) {\n const items = SelectorEngine.find(SELECTOR_VISIBLE_ITEMS, this._menu).filter(element => isVisible(element));\n\n if (!items.length) {\n return;\n } // if target isn't included in items (e.g. when expanding the dropdown)\n // allow cycling to get the last item in case key equals ARROW_UP_KEY\n\n\n getNextActiveElement(items, target, key === ARROW_DOWN_KEY$1, !items.includes(target)).focus();\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Dropdown.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n });\n }\n\n static clearMenus(event) {\n if (event.button === RIGHT_MOUSE_BUTTON || event.type === 'keyup' && event.key !== TAB_KEY$1) {\n return;\n }\n\n const openToggles = SelectorEngine.find(SELECTOR_DATA_TOGGLE_SHOWN);\n\n for (const toggle of openToggles) {\n const context = Dropdown.getInstance(toggle);\n\n if (!context || context._config.autoClose === false) {\n continue;\n }\n\n const composedPath = event.composedPath();\n const isMenuTarget = composedPath.includes(context._menu);\n\n if (composedPath.includes(context._element) || context._config.autoClose === 'inside' && !isMenuTarget || context._config.autoClose === 'outside' && isMenuTarget) {\n continue;\n } // Tab navigation through the dropdown menu or events from contained inputs shouldn't close the menu\n\n\n if (context._menu.contains(event.target) && (event.type === 'keyup' && event.key === TAB_KEY$1 || /input|select|option|textarea|form/i.test(event.target.tagName))) {\n continue;\n }\n\n const relatedTarget = {\n relatedTarget: context._element\n };\n\n if (event.type === 'click') {\n relatedTarget.clickEvent = event;\n }\n\n context._completeHide(relatedTarget);\n }\n }\n\n static dataApiKeydownHandler(event) {\n // If not an UP | DOWN | ESCAPE key => not a dropdown command\n // If input/textarea && if key is other than ESCAPE => not a dropdown command\n const isInput = /input|textarea/i.test(event.target.tagName);\n const isEscapeEvent = event.key === ESCAPE_KEY$2;\n const isUpOrDownEvent = [ARROW_UP_KEY$1, ARROW_DOWN_KEY$1].includes(event.key);\n\n if (!isUpOrDownEvent && !isEscapeEvent) {\n return;\n }\n\n if (isInput && !isEscapeEvent) {\n return;\n }\n\n event.preventDefault(); // todo: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.2/forms/input-group/\n\n const getToggleButton = this.matches(SELECTOR_DATA_TOGGLE$3) ? this : SelectorEngine.prev(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.next(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.findOne(SELECTOR_DATA_TOGGLE$3, event.delegateTarget.parentNode);\n const instance = Dropdown.getOrCreateInstance(getToggleButton);\n\n if (isUpOrDownEvent) {\n event.stopPropagation();\n instance.show();\n\n instance._selectMenuItem(event);\n\n return;\n }\n\n if (instance._isShown()) {\n // else is escape and we check if it is shown\n event.stopPropagation();\n instance.hide();\n getToggleButton.focus();\n }\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_DATA_TOGGLE$3, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_MENU, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_KEYUP_DATA_API, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, SELECTOR_DATA_TOGGLE$3, function (event) {\n event.preventDefault();\n Dropdown.getOrCreateInstance(this).toggle();\n});\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Dropdown);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/scrollBar.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst SELECTOR_FIXED_CONTENT = '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top';\nconst SELECTOR_STICKY_CONTENT = '.sticky-top';\nconst PROPERTY_PADDING = 'padding-right';\nconst PROPERTY_MARGIN = 'margin-right';\n/**\n * Class definition\n */\n\nclass ScrollBarHelper {\n constructor() {\n this._element = document.body;\n } // Public\n\n\n getWidth() {\n // https://developer.mozilla.org/en-US/docs/Web/API/Window/innerWidth#usage_notes\n const documentWidth = document.documentElement.clientWidth;\n return Math.abs(window.innerWidth - documentWidth);\n }\n\n hide() {\n const width = this.getWidth();\n\n this._disableOverFlow(); // give padding to element to balance the hidden scrollbar width\n\n\n this._setElementAttributes(this._element, PROPERTY_PADDING, calculatedValue => calculatedValue + width); // trick: We adjust positive paddingRight and negative marginRight to sticky-top elements to keep showing fullwidth\n\n\n this._setElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n\n this._setElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN, calculatedValue => calculatedValue - width);\n }\n\n reset() {\n this._resetElementAttributes(this._element, 'overflow');\n\n this._resetElementAttributes(this._element, PROPERTY_PADDING);\n\n this._resetElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING);\n\n this._resetElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN);\n }\n\n isOverflowing() {\n return this.getWidth() > 0;\n } // Private\n\n\n _disableOverFlow() {\n this._saveInitialAttribute(this._element, 'overflow');\n\n this._element.style.overflow = 'hidden';\n }\n\n _setElementAttributes(selector, styleProperty, callback) {\n const scrollbarWidth = this.getWidth();\n\n const manipulationCallBack = element => {\n if (element !== this._element && window.innerWidth > element.clientWidth + scrollbarWidth) {\n return;\n }\n\n this._saveInitialAttribute(element, styleProperty);\n\n const calculatedValue = window.getComputedStyle(element).getPropertyValue(styleProperty);\n element.style.setProperty(styleProperty, `${callback(Number.parseFloat(calculatedValue))}px`);\n };\n\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n\n _saveInitialAttribute(element, styleProperty) {\n const actualValue = element.style.getPropertyValue(styleProperty);\n\n if (actualValue) {\n Manipulator.setDataAttribute(element, styleProperty, actualValue);\n }\n }\n\n _resetElementAttributes(selector, styleProperty) {\n const manipulationCallBack = element => {\n const value = Manipulator.getDataAttribute(element, styleProperty); // We only want to remove the property if the value is `null`; the value can also be zero\n\n if (value === null) {\n element.style.removeProperty(styleProperty);\n return;\n }\n\n Manipulator.removeDataAttribute(element, styleProperty);\n element.style.setProperty(styleProperty, value);\n };\n\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n\n _applyManipulationCallback(selector, callBack) {\n if (isElement(selector)) {\n callBack(selector);\n return;\n }\n\n for (const sel of SelectorEngine.find(selector, this._element)) {\n callBack(sel);\n }\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/backdrop.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$9 = 'backdrop';\nconst CLASS_NAME_FADE$4 = 'fade';\nconst CLASS_NAME_SHOW$5 = 'show';\nconst EVENT_MOUSEDOWN = `mousedown.bs.${NAME$9}`;\nconst Default$8 = {\n className: 'modal-backdrop',\n clickCallback: null,\n isAnimated: false,\n isVisible: true,\n // if false, we use the backdrop helper without adding any element to the dom\n rootElement: 'body' // give the choice to place backdrop under different elements\n\n};\nconst DefaultType$8 = {\n className: 'string',\n clickCallback: '(function|null)',\n isAnimated: 'boolean',\n isVisible: 'boolean',\n rootElement: '(element|string)'\n};\n/**\n * Class definition\n */\n\nclass Backdrop extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isAppended = false;\n this._element = null;\n } // Getters\n\n\n static get Default() {\n return Default$8;\n }\n\n static get DefaultType() {\n return DefaultType$8;\n }\n\n static get NAME() {\n return NAME$9;\n } // Public\n\n\n show(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n\n this._append();\n\n const element = this._getElement();\n\n if (this._config.isAnimated) {\n reflow(element);\n }\n\n element.classList.add(CLASS_NAME_SHOW$5);\n\n this._emulateAnimation(() => {\n execute(callback);\n });\n }\n\n hide(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n\n this._getElement().classList.remove(CLASS_NAME_SHOW$5);\n\n this._emulateAnimation(() => {\n this.dispose();\n execute(callback);\n });\n }\n\n dispose() {\n if (!this._isAppended) {\n return;\n }\n\n EventHandler.off(this._element, EVENT_MOUSEDOWN);\n\n this._element.remove();\n\n this._isAppended = false;\n } // Private\n\n\n _getElement() {\n if (!this._element) {\n const backdrop = document.createElement('div');\n backdrop.className = this._config.className;\n\n if (this._config.isAnimated) {\n backdrop.classList.add(CLASS_NAME_FADE$4);\n }\n\n this._element = backdrop;\n }\n\n return this._element;\n }\n\n _configAfterMerge(config) {\n // use getElement() with the default \"body\" to get a fresh Element on each instantiation\n config.rootElement = getElement(config.rootElement);\n return config;\n }\n\n _append() {\n if (this._isAppended) {\n return;\n }\n\n const element = this._getElement();\n\n this._config.rootElement.append(element);\n\n EventHandler.on(element, EVENT_MOUSEDOWN, () => {\n execute(this._config.clickCallback);\n });\n this._isAppended = true;\n }\n\n _emulateAnimation(callback) {\n executeAfterTransition(callback, this._getElement(), this._config.isAnimated);\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/focustrap.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$8 = 'focustrap';\nconst DATA_KEY$5 = 'bs.focustrap';\nconst EVENT_KEY$5 = `.${DATA_KEY$5}`;\nconst EVENT_FOCUSIN$2 = `focusin${EVENT_KEY$5}`;\nconst EVENT_KEYDOWN_TAB = `keydown.tab${EVENT_KEY$5}`;\nconst TAB_KEY = 'Tab';\nconst TAB_NAV_FORWARD = 'forward';\nconst TAB_NAV_BACKWARD = 'backward';\nconst Default$7 = {\n autofocus: true,\n trapElement: null // The element to trap focus inside of\n\n};\nconst DefaultType$7 = {\n autofocus: 'boolean',\n trapElement: 'element'\n};\n/**\n * Class definition\n */\n\nclass FocusTrap extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isActive = false;\n this._lastTabNavDirection = null;\n } // Getters\n\n\n static get Default() {\n return Default$7;\n }\n\n static get DefaultType() {\n return DefaultType$7;\n }\n\n static get NAME() {\n return NAME$8;\n } // Public\n\n\n activate() {\n if (this._isActive) {\n return;\n }\n\n if (this._config.autofocus) {\n this._config.trapElement.focus();\n }\n\n EventHandler.off(document, EVENT_KEY$5); // guard against infinite focus loop\n\n EventHandler.on(document, EVENT_FOCUSIN$2, event => this._handleFocusin(event));\n EventHandler.on(document, EVENT_KEYDOWN_TAB, event => this._handleKeydown(event));\n this._isActive = true;\n }\n\n deactivate() {\n if (!this._isActive) {\n return;\n }\n\n this._isActive = false;\n EventHandler.off(document, EVENT_KEY$5);\n } // Private\n\n\n _handleFocusin(event) {\n const {\n trapElement\n } = this._config;\n\n if (event.target === document || event.target === trapElement || trapElement.contains(event.target)) {\n return;\n }\n\n const elements = SelectorEngine.focusableChildren(trapElement);\n\n if (elements.length === 0) {\n trapElement.focus();\n } else if (this._lastTabNavDirection === TAB_NAV_BACKWARD) {\n elements[elements.length - 1].focus();\n } else {\n elements[0].focus();\n }\n }\n\n _handleKeydown(event) {\n if (event.key !== TAB_KEY) {\n return;\n }\n\n this._lastTabNavDirection = event.shiftKey ? TAB_NAV_BACKWARD : TAB_NAV_FORWARD;\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): modal.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$7 = 'modal';\nconst DATA_KEY$4 = 'bs.modal';\nconst EVENT_KEY$4 = `.${DATA_KEY$4}`;\nconst DATA_API_KEY$2 = '.data-api';\nconst ESCAPE_KEY$1 = 'Escape';\nconst EVENT_HIDE$4 = `hide${EVENT_KEY$4}`;\nconst EVENT_HIDE_PREVENTED$1 = `hidePrevented${EVENT_KEY$4}`;\nconst EVENT_HIDDEN$4 = `hidden${EVENT_KEY$4}`;\nconst EVENT_SHOW$4 = `show${EVENT_KEY$4}`;\nconst EVENT_SHOWN$4 = `shown${EVENT_KEY$4}`;\nconst EVENT_RESIZE$1 = `resize${EVENT_KEY$4}`;\nconst EVENT_CLICK_DISMISS = `click.dismiss${EVENT_KEY$4}`;\nconst EVENT_MOUSEDOWN_DISMISS = `mousedown.dismiss${EVENT_KEY$4}`;\nconst EVENT_KEYDOWN_DISMISS$1 = `keydown.dismiss${EVENT_KEY$4}`;\nconst EVENT_CLICK_DATA_API$2 = `click${EVENT_KEY$4}${DATA_API_KEY$2}`;\nconst CLASS_NAME_OPEN = 'modal-open';\nconst CLASS_NAME_FADE$3 = 'fade';\nconst CLASS_NAME_SHOW$4 = 'show';\nconst CLASS_NAME_STATIC = 'modal-static';\nconst OPEN_SELECTOR$1 = '.modal.show';\nconst SELECTOR_DIALOG = '.modal-dialog';\nconst SELECTOR_MODAL_BODY = '.modal-body';\nconst SELECTOR_DATA_TOGGLE$2 = '[data-bs-toggle=\"modal\"]';\nconst Default$6 = {\n backdrop: true,\n focus: true,\n keyboard: true\n};\nconst DefaultType$6 = {\n backdrop: '(boolean|string)',\n focus: 'boolean',\n keyboard: 'boolean'\n};\n/**\n * Class definition\n */\n\nclass Modal extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._dialog = SelectorEngine.findOne(SELECTOR_DIALOG, this._element);\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._isShown = false;\n this._isTransitioning = false;\n this._scrollBar = new ScrollBarHelper();\n\n this._addEventListeners();\n } // Getters\n\n\n static get Default() {\n return Default$6;\n }\n\n static get DefaultType() {\n return DefaultType$6;\n }\n\n static get NAME() {\n return NAME$7;\n } // Public\n\n\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n\n show(relatedTarget) {\n if (this._isShown || this._isTransitioning) {\n return;\n }\n\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$4, {\n relatedTarget\n });\n\n if (showEvent.defaultPrevented) {\n return;\n }\n\n this._isShown = true;\n this._isTransitioning = true;\n\n this._scrollBar.hide();\n\n document.body.classList.add(CLASS_NAME_OPEN);\n\n this._adjustDialog();\n\n this._backdrop.show(() => this._showElement(relatedTarget));\n }\n\n hide() {\n if (!this._isShown || this._isTransitioning) {\n return;\n }\n\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$4);\n\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n this._isShown = false;\n this._isTransitioning = true;\n\n this._focustrap.deactivate();\n\n this._element.classList.remove(CLASS_NAME_SHOW$4);\n\n this._queueCallback(() => this._hideModal(), this._element, this._isAnimated());\n }\n\n dispose() {\n for (const htmlElement of [window, this._dialog]) {\n EventHandler.off(htmlElement, EVENT_KEY$4);\n }\n\n this._backdrop.dispose();\n\n this._focustrap.deactivate();\n\n super.dispose();\n }\n\n handleUpdate() {\n this._adjustDialog();\n } // Private\n\n\n _initializeBackDrop() {\n return new Backdrop({\n isVisible: Boolean(this._config.backdrop),\n // 'static' option will be translated to true, and booleans will keep their value,\n isAnimated: this._isAnimated()\n });\n }\n\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n\n _showElement(relatedTarget) {\n // try to append dynamic modal\n if (!document.body.contains(this._element)) {\n document.body.append(this._element);\n }\n\n this._element.style.display = 'block';\n\n this._element.removeAttribute('aria-hidden');\n\n this._element.setAttribute('aria-modal', true);\n\n this._element.setAttribute('role', 'dialog');\n\n this._element.scrollTop = 0;\n const modalBody = SelectorEngine.findOne(SELECTOR_MODAL_BODY, this._dialog);\n\n if (modalBody) {\n modalBody.scrollTop = 0;\n }\n\n reflow(this._element);\n\n this._element.classList.add(CLASS_NAME_SHOW$4);\n\n const transitionComplete = () => {\n if (this._config.focus) {\n this._focustrap.activate();\n }\n\n this._isTransitioning = false;\n EventHandler.trigger(this._element, EVENT_SHOWN$4, {\n relatedTarget\n });\n };\n\n this._queueCallback(transitionComplete, this._dialog, this._isAnimated());\n }\n\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS$1, event => {\n if (event.key !== ESCAPE_KEY$1) {\n return;\n }\n\n if (this._config.keyboard) {\n event.preventDefault();\n this.hide();\n return;\n }\n\n this._triggerBackdropTransition();\n });\n EventHandler.on(window, EVENT_RESIZE$1, () => {\n if (this._isShown && !this._isTransitioning) {\n this._adjustDialog();\n }\n });\n EventHandler.on(this._element, EVENT_MOUSEDOWN_DISMISS, event => {\n // a bad trick to segregate clicks that may start inside dialog but end outside, and avoid listen to scrollbar clicks\n EventHandler.one(this._element, EVENT_CLICK_DISMISS, event2 => {\n if (this._element !== event.target || this._element !== event2.target) {\n return;\n }\n\n if (this._config.backdrop === 'static') {\n this._triggerBackdropTransition();\n\n return;\n }\n\n if (this._config.backdrop) {\n this.hide();\n }\n });\n });\n }\n\n _hideModal() {\n this._element.style.display = 'none';\n\n this._element.setAttribute('aria-hidden', true);\n\n this._element.removeAttribute('aria-modal');\n\n this._element.removeAttribute('role');\n\n this._isTransitioning = false;\n\n this._backdrop.hide(() => {\n document.body.classList.remove(CLASS_NAME_OPEN);\n\n this._resetAdjustments();\n\n this._scrollBar.reset();\n\n EventHandler.trigger(this._element, EVENT_HIDDEN$4);\n });\n }\n\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_FADE$3);\n }\n\n _triggerBackdropTransition() {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED$1);\n\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const initialOverflowY = this._element.style.overflowY; // return if the following background transition hasn't yet completed\n\n if (initialOverflowY === 'hidden' || this._element.classList.contains(CLASS_NAME_STATIC)) {\n return;\n }\n\n if (!isModalOverflowing) {\n this._element.style.overflowY = 'hidden';\n }\n\n this._element.classList.add(CLASS_NAME_STATIC);\n\n this._queueCallback(() => {\n this._element.classList.remove(CLASS_NAME_STATIC);\n\n this._queueCallback(() => {\n this._element.style.overflowY = initialOverflowY;\n }, this._dialog);\n }, this._dialog);\n\n this._element.focus();\n }\n /**\n * The following methods are used to handle overflowing modals\n */\n\n\n _adjustDialog() {\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n\n const scrollbarWidth = this._scrollBar.getWidth();\n\n const isBodyOverflowing = scrollbarWidth > 0;\n\n if (isBodyOverflowing && !isModalOverflowing) {\n const property = isRTL() ? 'paddingLeft' : 'paddingRight';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n\n if (!isBodyOverflowing && isModalOverflowing) {\n const property = isRTL() ? 'paddingRight' : 'paddingLeft';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n }\n\n _resetAdjustments() {\n this._element.style.paddingLeft = '';\n this._element.style.paddingRight = '';\n } // Static\n\n\n static jQueryInterface(config, relatedTarget) {\n return this.each(function () {\n const data = Modal.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config](relatedTarget);\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$2, SELECTOR_DATA_TOGGLE$2, function (event) {\n const target = getElementFromSelector(this);\n\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n\n EventHandler.one(target, EVENT_SHOW$4, showEvent => {\n if (showEvent.defaultPrevented) {\n // only register focus restorer if modal will actually get shown\n return;\n }\n\n EventHandler.one(target, EVENT_HIDDEN$4, () => {\n if (isVisible(this)) {\n this.focus();\n }\n });\n }); // avoid conflict when clicking modal toggler while another one is open\n\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR$1);\n\n if (alreadyOpen) {\n Modal.getInstance(alreadyOpen).hide();\n }\n\n const data = Modal.getOrCreateInstance(target);\n data.toggle(this);\n});\nenableDismissTrigger(Modal);\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Modal);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): offcanvas.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$6 = 'offcanvas';\nconst DATA_KEY$3 = 'bs.offcanvas';\nconst EVENT_KEY$3 = `.${DATA_KEY$3}`;\nconst DATA_API_KEY$1 = '.data-api';\nconst EVENT_LOAD_DATA_API$2 = `load${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst ESCAPE_KEY = 'Escape';\nconst CLASS_NAME_SHOW$3 = 'show';\nconst CLASS_NAME_SHOWING$1 = 'showing';\nconst CLASS_NAME_HIDING = 'hiding';\nconst CLASS_NAME_BACKDROP = 'offcanvas-backdrop';\nconst OPEN_SELECTOR = '.offcanvas.show';\nconst EVENT_SHOW$3 = `show${EVENT_KEY$3}`;\nconst EVENT_SHOWN$3 = `shown${EVENT_KEY$3}`;\nconst EVENT_HIDE$3 = `hide${EVENT_KEY$3}`;\nconst EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY$3}`;\nconst EVENT_HIDDEN$3 = `hidden${EVENT_KEY$3}`;\nconst EVENT_RESIZE = `resize${EVENT_KEY$3}`;\nconst EVENT_CLICK_DATA_API$1 = `click${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY$3}`;\nconst SELECTOR_DATA_TOGGLE$1 = '[data-bs-toggle=\"offcanvas\"]';\nconst Default$5 = {\n backdrop: true,\n keyboard: true,\n scroll: false\n};\nconst DefaultType$5 = {\n backdrop: '(boolean|string)',\n keyboard: 'boolean',\n scroll: 'boolean'\n};\n/**\n * Class definition\n */\n\nclass Offcanvas extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isShown = false;\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n\n this._addEventListeners();\n } // Getters\n\n\n static get Default() {\n return Default$5;\n }\n\n static get DefaultType() {\n return DefaultType$5;\n }\n\n static get NAME() {\n return NAME$6;\n } // Public\n\n\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n\n show(relatedTarget) {\n if (this._isShown) {\n return;\n }\n\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$3, {\n relatedTarget\n });\n\n if (showEvent.defaultPrevented) {\n return;\n }\n\n this._isShown = true;\n\n this._backdrop.show();\n\n if (!this._config.scroll) {\n new ScrollBarHelper().hide();\n }\n\n this._element.setAttribute('aria-modal', true);\n\n this._element.setAttribute('role', 'dialog');\n\n this._element.classList.add(CLASS_NAME_SHOWING$1);\n\n const completeCallBack = () => {\n if (!this._config.scroll || this._config.backdrop) {\n this._focustrap.activate();\n }\n\n this._element.classList.add(CLASS_NAME_SHOW$3);\n\n this._element.classList.remove(CLASS_NAME_SHOWING$1);\n\n EventHandler.trigger(this._element, EVENT_SHOWN$3, {\n relatedTarget\n });\n };\n\n this._queueCallback(completeCallBack, this._element, true);\n }\n\n hide() {\n if (!this._isShown) {\n return;\n }\n\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$3);\n\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n this._focustrap.deactivate();\n\n this._element.blur();\n\n this._isShown = false;\n\n this._element.classList.add(CLASS_NAME_HIDING);\n\n this._backdrop.hide();\n\n const completeCallback = () => {\n this._element.classList.remove(CLASS_NAME_SHOW$3, CLASS_NAME_HIDING);\n\n this._element.removeAttribute('aria-modal');\n\n this._element.removeAttribute('role');\n\n if (!this._config.scroll) {\n new ScrollBarHelper().reset();\n }\n\n EventHandler.trigger(this._element, EVENT_HIDDEN$3);\n };\n\n this._queueCallback(completeCallback, this._element, true);\n }\n\n dispose() {\n this._backdrop.dispose();\n\n this._focustrap.deactivate();\n\n super.dispose();\n } // Private\n\n\n _initializeBackDrop() {\n const clickCallback = () => {\n if (this._config.backdrop === 'static') {\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n return;\n }\n\n this.hide();\n }; // 'static' option will be translated to true, and booleans will keep their value\n\n\n const isVisible = Boolean(this._config.backdrop);\n return new Backdrop({\n className: CLASS_NAME_BACKDROP,\n isVisible,\n isAnimated: true,\n rootElement: this._element.parentNode,\n clickCallback: isVisible ? clickCallback : null\n });\n }\n\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => {\n if (event.key !== ESCAPE_KEY) {\n return;\n }\n\n if (!this._config.keyboard) {\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n return;\n }\n\n this.hide();\n });\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Offcanvas.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config](this);\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$1, SELECTOR_DATA_TOGGLE$1, function (event) {\n const target = getElementFromSelector(this);\n\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n\n if (isDisabled(this)) {\n return;\n }\n\n EventHandler.one(target, EVENT_HIDDEN$3, () => {\n // focus on trigger when it is closed\n if (isVisible(this)) {\n this.focus();\n }\n }); // avoid conflict when clicking a toggler of an offcanvas, while another is open\n\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR);\n\n if (alreadyOpen && alreadyOpen !== target) {\n Offcanvas.getInstance(alreadyOpen).hide();\n }\n\n const data = Offcanvas.getOrCreateInstance(target);\n data.toggle(this);\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$2, () => {\n for (const selector of SelectorEngine.find(OPEN_SELECTOR)) {\n Offcanvas.getOrCreateInstance(selector).show();\n }\n});\nEventHandler.on(window, EVENT_RESIZE, () => {\n for (const element of SelectorEngine.find('[aria-modal][class*=show][class*=offcanvas-]')) {\n if (getComputedStyle(element).position !== 'fixed') {\n Offcanvas.getOrCreateInstance(element).hide();\n }\n }\n});\nenableDismissTrigger(Offcanvas);\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Offcanvas);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/sanitizer.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\nconst uriAttributes = new Set(['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href']);\nconst ARIA_ATTRIBUTE_PATTERN = /^aria-[\\w-]*$/i;\n/**\n * A pattern that recognizes a commonly useful subset of URLs that are safe.\n *\n * Shout-out to Angular https://github.com/angular/angular/blob/12.2.x/packages/core/src/sanitization/url_sanitizer.ts\n */\n\nconst SAFE_URL_PATTERN = /^(?:(?:https?|mailto|ftp|tel|file|sms):|[^#&/:?]*(?:[#/?]|$))/i;\n/**\n * A pattern that matches safe data URLs. Only matches image, video and audio types.\n *\n * Shout-out to Angular https://github.com/angular/angular/blob/12.2.x/packages/core/src/sanitization/url_sanitizer.ts\n */\n\nconst DATA_URL_PATTERN = /^data:(?:image\\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\\/(?:mpeg|mp4|ogg|webm)|audio\\/(?:mp3|oga|ogg|opus));base64,[\\d+/a-z]+=*$/i;\n\nconst allowedAttribute = (attribute, allowedAttributeList) => {\n const attributeName = attribute.nodeName.toLowerCase();\n\n if (allowedAttributeList.includes(attributeName)) {\n if (uriAttributes.has(attributeName)) {\n return Boolean(SAFE_URL_PATTERN.test(attribute.nodeValue) || DATA_URL_PATTERN.test(attribute.nodeValue));\n }\n\n return true;\n } // Check if a regular expression validates the attribute.\n\n\n return allowedAttributeList.filter(attributeRegex => attributeRegex instanceof RegExp).some(regex => regex.test(attributeName));\n};\n\nconst DefaultAllowlist = {\n // Global attributes allowed on any supplied element below.\n '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],\n a: ['target', 'href', 'title', 'rel'],\n area: [],\n b: [],\n br: [],\n col: [],\n code: [],\n div: [],\n em: [],\n hr: [],\n h1: [],\n h2: [],\n h3: [],\n h4: [],\n h5: [],\n h6: [],\n i: [],\n img: ['src', 'srcset', 'alt', 'title', 'width', 'height'],\n li: [],\n ol: [],\n p: [],\n pre: [],\n s: [],\n small: [],\n span: [],\n sub: [],\n sup: [],\n strong: [],\n u: [],\n ul: []\n};\nfunction sanitizeHtml(unsafeHtml, allowList, sanitizeFunction) {\n if (!unsafeHtml.length) {\n return unsafeHtml;\n }\n\n if (sanitizeFunction && typeof sanitizeFunction === 'function') {\n return sanitizeFunction(unsafeHtml);\n }\n\n const domParser = new window.DOMParser();\n const createdDocument = domParser.parseFromString(unsafeHtml, 'text/html');\n const elements = [].concat(...createdDocument.body.querySelectorAll('*'));\n\n for (const element of elements) {\n const elementName = element.nodeName.toLowerCase();\n\n if (!Object.keys(allowList).includes(elementName)) {\n element.remove();\n continue;\n }\n\n const attributeList = [].concat(...element.attributes);\n const allowedAttributes = [].concat(allowList['*'] || [], allowList[elementName] || []);\n\n for (const attribute of attributeList) {\n if (!allowedAttribute(attribute, allowedAttributes)) {\n element.removeAttribute(attribute.nodeName);\n }\n }\n }\n\n return createdDocument.body.innerHTML;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/template-factory.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$5 = 'TemplateFactory';\nconst Default$4 = {\n allowList: DefaultAllowlist,\n content: {},\n // { selector : text , selector2 : text2 , }\n extraClass: '',\n html: false,\n sanitize: true,\n sanitizeFn: null,\n template: '
'\n};\nconst DefaultType$4 = {\n allowList: 'object',\n content: 'object',\n extraClass: '(string|function)',\n html: 'boolean',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n template: 'string'\n};\nconst DefaultContentType = {\n entry: '(string|element|function|null)',\n selector: '(string|element)'\n};\n/**\n * Class definition\n */\n\nclass TemplateFactory extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n } // Getters\n\n\n static get Default() {\n return Default$4;\n }\n\n static get DefaultType() {\n return DefaultType$4;\n }\n\n static get NAME() {\n return NAME$5;\n } // Public\n\n\n getContent() {\n return Object.values(this._config.content).map(config => this._resolvePossibleFunction(config)).filter(Boolean);\n }\n\n hasContent() {\n return this.getContent().length > 0;\n }\n\n changeContent(content) {\n this._checkContent(content);\n\n this._config.content = { ...this._config.content,\n ...content\n };\n return this;\n }\n\n toHtml() {\n const templateWrapper = document.createElement('div');\n templateWrapper.innerHTML = this._maybeSanitize(this._config.template);\n\n for (const [selector, text] of Object.entries(this._config.content)) {\n this._setContent(templateWrapper, text, selector);\n }\n\n const template = templateWrapper.children[0];\n\n const extraClass = this._resolvePossibleFunction(this._config.extraClass);\n\n if (extraClass) {\n template.classList.add(...extraClass.split(' '));\n }\n\n return template;\n } // Private\n\n\n _typeCheckConfig(config) {\n super._typeCheckConfig(config);\n\n this._checkContent(config.content);\n }\n\n _checkContent(arg) {\n for (const [selector, content] of Object.entries(arg)) {\n super._typeCheckConfig({\n selector,\n entry: content\n }, DefaultContentType);\n }\n }\n\n _setContent(template, content, selector) {\n const templateElement = SelectorEngine.findOne(selector, template);\n\n if (!templateElement) {\n return;\n }\n\n content = this._resolvePossibleFunction(content);\n\n if (!content) {\n templateElement.remove();\n return;\n }\n\n if (isElement(content)) {\n this._putElementInTemplate(getElement(content), templateElement);\n\n return;\n }\n\n if (this._config.html) {\n templateElement.innerHTML = this._maybeSanitize(content);\n return;\n }\n\n templateElement.textContent = content;\n }\n\n _maybeSanitize(arg) {\n return this._config.sanitize ? sanitizeHtml(arg, this._config.allowList, this._config.sanitizeFn) : arg;\n }\n\n _resolvePossibleFunction(arg) {\n return typeof arg === 'function' ? arg(this) : arg;\n }\n\n _putElementInTemplate(element, templateElement) {\n if (this._config.html) {\n templateElement.innerHTML = '';\n templateElement.append(element);\n return;\n }\n\n templateElement.textContent = element.textContent;\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): tooltip.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$4 = 'tooltip';\nconst DISALLOWED_ATTRIBUTES = new Set(['sanitize', 'allowList', 'sanitizeFn']);\nconst CLASS_NAME_FADE$2 = 'fade';\nconst CLASS_NAME_MODAL = 'modal';\nconst CLASS_NAME_SHOW$2 = 'show';\nconst SELECTOR_TOOLTIP_INNER = '.tooltip-inner';\nconst SELECTOR_MODAL = `.${CLASS_NAME_MODAL}`;\nconst EVENT_MODAL_HIDE = 'hide.bs.modal';\nconst TRIGGER_HOVER = 'hover';\nconst TRIGGER_FOCUS = 'focus';\nconst TRIGGER_CLICK = 'click';\nconst TRIGGER_MANUAL = 'manual';\nconst EVENT_HIDE$2 = 'hide';\nconst EVENT_HIDDEN$2 = 'hidden';\nconst EVENT_SHOW$2 = 'show';\nconst EVENT_SHOWN$2 = 'shown';\nconst EVENT_INSERTED = 'inserted';\nconst EVENT_CLICK$1 = 'click';\nconst EVENT_FOCUSIN$1 = 'focusin';\nconst EVENT_FOCUSOUT$1 = 'focusout';\nconst EVENT_MOUSEENTER = 'mouseenter';\nconst EVENT_MOUSELEAVE = 'mouseleave';\nconst AttachmentMap = {\n AUTO: 'auto',\n TOP: 'top',\n RIGHT: isRTL() ? 'left' : 'right',\n BOTTOM: 'bottom',\n LEFT: isRTL() ? 'right' : 'left'\n};\nconst Default$3 = {\n allowList: DefaultAllowlist,\n animation: true,\n boundary: 'clippingParents',\n container: false,\n customClass: '',\n delay: 0,\n fallbackPlacements: ['top', 'right', 'bottom', 'left'],\n html: false,\n offset: [0, 0],\n placement: 'top',\n popperConfig: null,\n sanitize: true,\n sanitizeFn: null,\n selector: false,\n template: '
' + '
' + '
' + '
',\n title: '',\n trigger: 'hover focus'\n};\nconst DefaultType$3 = {\n allowList: 'object',\n animation: 'boolean',\n boundary: '(string|element)',\n container: '(string|element|boolean)',\n customClass: '(string|function)',\n delay: '(number|object)',\n fallbackPlacements: 'array',\n html: 'boolean',\n offset: '(array|string|function)',\n placement: '(string|function)',\n popperConfig: '(null|object|function)',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n selector: '(string|boolean)',\n template: 'string',\n title: '(string|element|function)',\n trigger: 'string'\n};\n/**\n * Class definition\n */\n\nclass Tooltip extends BaseComponent {\n constructor(element, config) {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s tooltips require Popper (https://popper.js.org)');\n }\n\n super(element, config); // Private\n\n this._isEnabled = true;\n this._timeout = 0;\n this._isHovered = null;\n this._activeTrigger = {};\n this._popper = null;\n this._templateFactory = null;\n this._newContent = null; // Protected\n\n this.tip = null;\n\n this._setListeners();\n\n if (!this._config.selector) {\n this._fixTitle();\n }\n } // Getters\n\n\n static get Default() {\n return Default$3;\n }\n\n static get DefaultType() {\n return DefaultType$3;\n }\n\n static get NAME() {\n return NAME$4;\n } // Public\n\n\n enable() {\n this._isEnabled = true;\n }\n\n disable() {\n this._isEnabled = false;\n }\n\n toggleEnabled() {\n this._isEnabled = !this._isEnabled;\n }\n\n toggle() {\n if (!this._isEnabled) {\n return;\n }\n\n this._activeTrigger.click = !this._activeTrigger.click;\n\n if (this._isShown()) {\n this._leave();\n\n return;\n }\n\n this._enter();\n }\n\n dispose() {\n clearTimeout(this._timeout);\n EventHandler.off(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n\n if (this._element.getAttribute('data-bs-original-title')) {\n this._element.setAttribute('title', this._element.getAttribute('data-bs-original-title'));\n }\n\n this._disposePopper();\n\n super.dispose();\n }\n\n show() {\n if (this._element.style.display === 'none') {\n throw new Error('Please use show on visible elements');\n }\n\n if (!(this._isWithContent() && this._isEnabled)) {\n return;\n }\n\n const showEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOW$2));\n const shadowRoot = findShadowRoot(this._element);\n\n const isInTheDom = (shadowRoot || this._element.ownerDocument.documentElement).contains(this._element);\n\n if (showEvent.defaultPrevented || !isInTheDom) {\n return;\n } // todo v6 remove this OR make it optional\n\n\n this._disposePopper();\n\n const tip = this._getTipElement();\n\n this._element.setAttribute('aria-describedby', tip.getAttribute('id'));\n\n const {\n container\n } = this._config;\n\n if (!this._element.ownerDocument.documentElement.contains(this.tip)) {\n container.append(tip);\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_INSERTED));\n }\n\n this._popper = this._createPopper(tip);\n tip.classList.add(CLASS_NAME_SHOW$2); // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n\n const complete = () => {\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOWN$2));\n\n if (this._isHovered === false) {\n this._leave();\n }\n\n this._isHovered = false;\n };\n\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n\n hide() {\n if (!this._isShown()) {\n return;\n }\n\n const hideEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDE$2));\n\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n const tip = this._getTipElement();\n\n tip.classList.remove(CLASS_NAME_SHOW$2); // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n\n this._activeTrigger[TRIGGER_CLICK] = false;\n this._activeTrigger[TRIGGER_FOCUS] = false;\n this._activeTrigger[TRIGGER_HOVER] = false;\n this._isHovered = null; // it is a trick to support manual triggering\n\n const complete = () => {\n if (this._isWithActiveTrigger()) {\n return;\n }\n\n if (!this._isHovered) {\n this._disposePopper();\n }\n\n this._element.removeAttribute('aria-describedby');\n\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDDEN$2));\n };\n\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n\n update() {\n if (this._popper) {\n this._popper.update();\n }\n } // Protected\n\n\n _isWithContent() {\n return Boolean(this._getTitle());\n }\n\n _getTipElement() {\n if (!this.tip) {\n this.tip = this._createTipElement(this._newContent || this._getContentForTemplate());\n }\n\n return this.tip;\n }\n\n _createTipElement(content) {\n const tip = this._getTemplateFactory(content).toHtml(); // todo: remove this check on v6\n\n\n if (!tip) {\n return null;\n }\n\n tip.classList.remove(CLASS_NAME_FADE$2, CLASS_NAME_SHOW$2); // todo: on v6 the following can be achieved with CSS only\n\n tip.classList.add(`bs-${this.constructor.NAME}-auto`);\n const tipId = getUID(this.constructor.NAME).toString();\n tip.setAttribute('id', tipId);\n\n if (this._isAnimated()) {\n tip.classList.add(CLASS_NAME_FADE$2);\n }\n\n return tip;\n }\n\n setContent(content) {\n this._newContent = content;\n\n if (this._isShown()) {\n this._disposePopper();\n\n this.show();\n }\n }\n\n _getTemplateFactory(content) {\n if (this._templateFactory) {\n this._templateFactory.changeContent(content);\n } else {\n this._templateFactory = new TemplateFactory({ ...this._config,\n // the `content` var has to be after `this._config`\n // to override config.content in case of popover\n content,\n extraClass: this._resolvePossibleFunction(this._config.customClass)\n });\n }\n\n return this._templateFactory;\n }\n\n _getContentForTemplate() {\n return {\n [SELECTOR_TOOLTIP_INNER]: this._getTitle()\n };\n }\n\n _getTitle() {\n return this._resolvePossibleFunction(this._config.title) || this._element.getAttribute('data-bs-original-title');\n } // Private\n\n\n _initializeOnDelegatedTarget(event) {\n return this.constructor.getOrCreateInstance(event.delegateTarget, this._getDelegateConfig());\n }\n\n _isAnimated() {\n return this._config.animation || this.tip && this.tip.classList.contains(CLASS_NAME_FADE$2);\n }\n\n _isShown() {\n return this.tip && this.tip.classList.contains(CLASS_NAME_SHOW$2);\n }\n\n _createPopper(tip) {\n const placement = typeof this._config.placement === 'function' ? this._config.placement.call(this, tip, this._element) : this._config.placement;\n const attachment = AttachmentMap[placement.toUpperCase()];\n return Popper.createPopper(this._element, tip, this._getPopperConfig(attachment));\n }\n\n _getOffset() {\n const {\n offset\n } = this._config;\n\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n\n return offset;\n }\n\n _resolvePossibleFunction(arg) {\n return typeof arg === 'function' ? arg.call(this._element) : arg;\n }\n\n _getPopperConfig(attachment) {\n const defaultBsPopperConfig = {\n placement: attachment,\n modifiers: [{\n name: 'flip',\n options: {\n fallbackPlacements: this._config.fallbackPlacements\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }, {\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'arrow',\n options: {\n element: `.${this.constructor.NAME}-arrow`\n }\n }, {\n name: 'preSetPlacement',\n enabled: true,\n phase: 'beforeMain',\n fn: data => {\n // Pre-set Popper's placement attribute in order to read the arrow sizes properly.\n // Otherwise, Popper mixes up the width and height dimensions since the initial arrow style is for top placement\n this._getTipElement().setAttribute('data-popper-placement', data.state.placement);\n }\n }]\n };\n return { ...defaultBsPopperConfig,\n ...(typeof this._config.popperConfig === 'function' ? this._config.popperConfig(defaultBsPopperConfig) : this._config.popperConfig)\n };\n }\n\n _setListeners() {\n const triggers = this._config.trigger.split(' ');\n\n for (const trigger of triggers) {\n if (trigger === 'click') {\n EventHandler.on(this._element, this.constructor.eventName(EVENT_CLICK$1), this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n\n context.toggle();\n });\n } else if (trigger !== TRIGGER_MANUAL) {\n const eventIn = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSEENTER) : this.constructor.eventName(EVENT_FOCUSIN$1);\n const eventOut = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSELEAVE) : this.constructor.eventName(EVENT_FOCUSOUT$1);\n EventHandler.on(this._element, eventIn, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n\n context._activeTrigger[event.type === 'focusin' ? TRIGGER_FOCUS : TRIGGER_HOVER] = true;\n\n context._enter();\n });\n EventHandler.on(this._element, eventOut, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n\n context._activeTrigger[event.type === 'focusout' ? TRIGGER_FOCUS : TRIGGER_HOVER] = context._element.contains(event.relatedTarget);\n\n context._leave();\n });\n }\n }\n\n this._hideModalHandler = () => {\n if (this._element) {\n this.hide();\n }\n };\n\n EventHandler.on(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n }\n\n _fixTitle() {\n const title = this._element.getAttribute('title');\n\n if (!title) {\n return;\n }\n\n if (!this._element.getAttribute('aria-label') && !this._element.textContent.trim()) {\n this._element.setAttribute('aria-label', title);\n }\n\n this._element.setAttribute('data-bs-original-title', title); // DO NOT USE IT. Is only for backwards compatibility\n\n\n this._element.removeAttribute('title');\n }\n\n _enter() {\n if (this._isShown() || this._isHovered) {\n this._isHovered = true;\n return;\n }\n\n this._isHovered = true;\n\n this._setTimeout(() => {\n if (this._isHovered) {\n this.show();\n }\n }, this._config.delay.show);\n }\n\n _leave() {\n if (this._isWithActiveTrigger()) {\n return;\n }\n\n this._isHovered = false;\n\n this._setTimeout(() => {\n if (!this._isHovered) {\n this.hide();\n }\n }, this._config.delay.hide);\n }\n\n _setTimeout(handler, timeout) {\n clearTimeout(this._timeout);\n this._timeout = setTimeout(handler, timeout);\n }\n\n _isWithActiveTrigger() {\n return Object.values(this._activeTrigger).includes(true);\n }\n\n _getConfig(config) {\n const dataAttributes = Manipulator.getDataAttributes(this._element);\n\n for (const dataAttribute of Object.keys(dataAttributes)) {\n if (DISALLOWED_ATTRIBUTES.has(dataAttribute)) {\n delete dataAttributes[dataAttribute];\n }\n }\n\n config = { ...dataAttributes,\n ...(typeof config === 'object' && config ? config : {})\n };\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n\n this._typeCheckConfig(config);\n\n return config;\n }\n\n _configAfterMerge(config) {\n config.container = config.container === false ? document.body : getElement(config.container);\n\n if (typeof config.delay === 'number') {\n config.delay = {\n show: config.delay,\n hide: config.delay\n };\n }\n\n if (typeof config.title === 'number') {\n config.title = config.title.toString();\n }\n\n if (typeof config.content === 'number') {\n config.content = config.content.toString();\n }\n\n return config;\n }\n\n _getDelegateConfig() {\n const config = {};\n\n for (const key in this._config) {\n if (this.constructor.Default[key] !== this._config[key]) {\n config[key] = this._config[key];\n }\n }\n\n config.selector = false;\n config.trigger = 'manual'; // In the future can be replaced with:\n // const keysWithDifferentValues = Object.entries(this._config).filter(entry => this.constructor.Default[entry[0]] !== this._config[entry[0]])\n // `Object.fromEntries(keysWithDifferentValues)`\n\n return config;\n }\n\n _disposePopper() {\n if (this._popper) {\n this._popper.destroy();\n\n this._popper = null;\n }\n\n if (this.tip) {\n this.tip.remove();\n this.tip = null;\n }\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Tooltip.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n });\n }\n\n}\n/**\n * jQuery\n */\n\n\ndefineJQueryPlugin(Tooltip);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): popover.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$3 = 'popover';\nconst SELECTOR_TITLE = '.popover-header';\nconst SELECTOR_CONTENT = '.popover-body';\nconst Default$2 = { ...Tooltip.Default,\n content: '',\n offset: [0, 8],\n placement: 'right',\n template: '
' + '
' + '

' + '
' + '
',\n trigger: 'click'\n};\nconst DefaultType$2 = { ...Tooltip.DefaultType,\n content: '(null|string|element|function)'\n};\n/**\n * Class definition\n */\n\nclass Popover extends Tooltip {\n // Getters\n static get Default() {\n return Default$2;\n }\n\n static get DefaultType() {\n return DefaultType$2;\n }\n\n static get NAME() {\n return NAME$3;\n } // Overrides\n\n\n _isWithContent() {\n return this._getTitle() || this._getContent();\n } // Private\n\n\n _getContentForTemplate() {\n return {\n [SELECTOR_TITLE]: this._getTitle(),\n [SELECTOR_CONTENT]: this._getContent()\n };\n }\n\n _getContent() {\n return this._resolvePossibleFunction(this._config.content);\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Popover.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n });\n }\n\n}\n/**\n * jQuery\n */\n\n\ndefineJQueryPlugin(Popover);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): scrollspy.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$2 = 'scrollspy';\nconst DATA_KEY$2 = 'bs.scrollspy';\nconst EVENT_KEY$2 = `.${DATA_KEY$2}`;\nconst DATA_API_KEY = '.data-api';\nconst EVENT_ACTIVATE = `activate${EVENT_KEY$2}`;\nconst EVENT_CLICK = `click${EVENT_KEY$2}`;\nconst EVENT_LOAD_DATA_API$1 = `load${EVENT_KEY$2}${DATA_API_KEY}`;\nconst CLASS_NAME_DROPDOWN_ITEM = 'dropdown-item';\nconst CLASS_NAME_ACTIVE$1 = 'active';\nconst SELECTOR_DATA_SPY = '[data-bs-spy=\"scroll\"]';\nconst SELECTOR_TARGET_LINKS = '[href]';\nconst SELECTOR_NAV_LIST_GROUP = '.nav, .list-group';\nconst SELECTOR_NAV_LINKS = '.nav-link';\nconst SELECTOR_NAV_ITEMS = '.nav-item';\nconst SELECTOR_LIST_ITEMS = '.list-group-item';\nconst SELECTOR_LINK_ITEMS = `${SELECTOR_NAV_LINKS}, ${SELECTOR_NAV_ITEMS} > ${SELECTOR_NAV_LINKS}, ${SELECTOR_LIST_ITEMS}`;\nconst SELECTOR_DROPDOWN = '.dropdown';\nconst SELECTOR_DROPDOWN_TOGGLE$1 = '.dropdown-toggle';\nconst Default$1 = {\n offset: null,\n // TODO: v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: '0px 0px -25%',\n smoothScroll: false,\n target: null,\n threshold: [0.1, 0.5, 1]\n};\nconst DefaultType$1 = {\n offset: '(number|null)',\n // TODO v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: 'string',\n smoothScroll: 'boolean',\n target: 'element',\n threshold: 'array'\n};\n/**\n * Class definition\n */\n\nclass ScrollSpy extends BaseComponent {\n constructor(element, config) {\n super(element, config); // this._element is the observablesContainer and config.target the menu links wrapper\n\n this._targetLinks = new Map();\n this._observableSections = new Map();\n this._rootElement = getComputedStyle(this._element).overflowY === 'visible' ? null : this._element;\n this._activeTarget = null;\n this._observer = null;\n this._previousScrollData = {\n visibleEntryTop: 0,\n parentScrollTop: 0\n };\n this.refresh(); // initialize\n } // Getters\n\n\n static get Default() {\n return Default$1;\n }\n\n static get DefaultType() {\n return DefaultType$1;\n }\n\n static get NAME() {\n return NAME$2;\n } // Public\n\n\n refresh() {\n this._initializeTargetsAndObservables();\n\n this._maybeEnableSmoothScroll();\n\n if (this._observer) {\n this._observer.disconnect();\n } else {\n this._observer = this._getNewObserver();\n }\n\n for (const section of this._observableSections.values()) {\n this._observer.observe(section);\n }\n }\n\n dispose() {\n this._observer.disconnect();\n\n super.dispose();\n } // Private\n\n\n _configAfterMerge(config) {\n // TODO: on v6 target should be given explicitly & remove the {target: 'ss-target'} case\n config.target = getElement(config.target) || document.body; // TODO: v6 Only for backwards compatibility reasons. Use rootMargin only\n\n config.rootMargin = config.offset ? `${config.offset}px 0px -30%` : config.rootMargin;\n\n if (typeof config.threshold === 'string') {\n config.threshold = config.threshold.split(',').map(value => Number.parseFloat(value));\n }\n\n return config;\n }\n\n _maybeEnableSmoothScroll() {\n if (!this._config.smoothScroll) {\n return;\n } // unregister any previous listeners\n\n\n EventHandler.off(this._config.target, EVENT_CLICK);\n EventHandler.on(this._config.target, EVENT_CLICK, SELECTOR_TARGET_LINKS, event => {\n const observableSection = this._observableSections.get(event.target.hash);\n\n if (observableSection) {\n event.preventDefault();\n const root = this._rootElement || window;\n const height = observableSection.offsetTop - this._element.offsetTop;\n\n if (root.scrollTo) {\n root.scrollTo({\n top: height,\n behavior: 'smooth'\n });\n return;\n } // Chrome 60 doesn't support `scrollTo`\n\n\n root.scrollTop = height;\n }\n });\n }\n\n _getNewObserver() {\n const options = {\n root: this._rootElement,\n threshold: this._config.threshold,\n rootMargin: this._config.rootMargin\n };\n return new IntersectionObserver(entries => this._observerCallback(entries), options);\n } // The logic of selection\n\n\n _observerCallback(entries) {\n const targetElement = entry => this._targetLinks.get(`#${entry.target.id}`);\n\n const activate = entry => {\n this._previousScrollData.visibleEntryTop = entry.target.offsetTop;\n\n this._process(targetElement(entry));\n };\n\n const parentScrollTop = (this._rootElement || document.documentElement).scrollTop;\n const userScrollsDown = parentScrollTop >= this._previousScrollData.parentScrollTop;\n this._previousScrollData.parentScrollTop = parentScrollTop;\n\n for (const entry of entries) {\n if (!entry.isIntersecting) {\n this._activeTarget = null;\n\n this._clearActiveClass(targetElement(entry));\n\n continue;\n }\n\n const entryIsLowerThanPrevious = entry.target.offsetTop >= this._previousScrollData.visibleEntryTop; // if we are scrolling down, pick the bigger offsetTop\n\n if (userScrollsDown && entryIsLowerThanPrevious) {\n activate(entry); // if parent isn't scrolled, let's keep the first visible item, breaking the iteration\n\n if (!parentScrollTop) {\n return;\n }\n\n continue;\n } // if we are scrolling up, pick the smallest offsetTop\n\n\n if (!userScrollsDown && !entryIsLowerThanPrevious) {\n activate(entry);\n }\n }\n }\n\n _initializeTargetsAndObservables() {\n this._targetLinks = new Map();\n this._observableSections = new Map();\n const targetLinks = SelectorEngine.find(SELECTOR_TARGET_LINKS, this._config.target);\n\n for (const anchor of targetLinks) {\n // ensure that the anchor has an id and is not disabled\n if (!anchor.hash || isDisabled(anchor)) {\n continue;\n }\n\n const observableSection = SelectorEngine.findOne(anchor.hash, this._element); // ensure that the observableSection exists & is visible\n\n if (isVisible(observableSection)) {\n this._targetLinks.set(anchor.hash, anchor);\n\n this._observableSections.set(anchor.hash, observableSection);\n }\n }\n }\n\n _process(target) {\n if (this._activeTarget === target) {\n return;\n }\n\n this._clearActiveClass(this._config.target);\n\n this._activeTarget = target;\n target.classList.add(CLASS_NAME_ACTIVE$1);\n\n this._activateParents(target);\n\n EventHandler.trigger(this._element, EVENT_ACTIVATE, {\n relatedTarget: target\n });\n }\n\n _activateParents(target) {\n // Activate dropdown parents\n if (target.classList.contains(CLASS_NAME_DROPDOWN_ITEM)) {\n SelectorEngine.findOne(SELECTOR_DROPDOWN_TOGGLE$1, target.closest(SELECTOR_DROPDOWN)).classList.add(CLASS_NAME_ACTIVE$1);\n return;\n }\n\n for (const listGroup of SelectorEngine.parents(target, SELECTOR_NAV_LIST_GROUP)) {\n // Set triggered links parents as active\n // With both